diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__init__.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__init__.py
new file mode 100644
index 0000000000000000000000000000000000000000..50f3815761176cc8af5eccf964e2dccc78c3ad72
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__init__.py
@@ -0,0 +1,172 @@
+"""Rich text and beautiful formatting in the terminal."""
+
+import os
+from typing import Callable, IO, TYPE_CHECKING, Any, Optional
+
+from ._extension import load_ipython_extension
+
+__all__ = ["get_console", "reconfigure", "print", "inspect"]
+
+if TYPE_CHECKING:
+    from .console import Console
+
+# Global console used by alternative print
+_console: Optional["Console"] = None
+
+_IMPORT_CWD = os.path.abspath(os.getcwd())
+
+
+def get_console() -> "Console":
+    """Get a global :class:`~rich.console.Console` instance. This function is used when Rich requires a Console,
+    and hasn't been explicitly given one.
+
+    Returns:
+        Console: A console instance.
+    """
+    global _console
+    if _console is None:
+        from .console import Console
+
+        _console = Console()
+
+    return _console
+
+
+def reconfigure(*args: Any, **kwargs: Any) -> None:
+    """Reconfigures the global console by replacing it with another.
+
+    Args:
+        console (Console): Replacement console instance.
+    """
+    from pip._vendor.rich.console import Console
+
+    new_console = Console(*args, **kwargs)
+    _console = get_console()
+    _console.__dict__ = new_console.__dict__
+
+
+def print(
+    *objects: Any,
+    sep: str = " ",
+    end: str = "\n",
+    file: Optional[IO[str]] = None,
+    flush: bool = False,
+) -> None:
+    r"""Print object(s) supplied via positional arguments.
+    This function has an identical signature to the built-in print.
+    For more advanced features, see the :class:`~rich.console.Console` class.
+
+    Args:
+        sep (str, optional): Separator between printed objects. Defaults to " ".
+        end (str, optional): Character to write at end of output. Defaults to "\\n".
+        file (IO[str], optional): File to write to, or None for stdout. Defaults to None.
+        flush (bool, optional): Has no effect as Rich always flushes output. Defaults to False.
+
+    """
+    from .console import Console
+
+    write_console = get_console() if file is None else Console(file=file)
+    return write_console.print(*objects, sep=sep, end=end)
+
+
+def print_json(
+    json: Optional[str] = None,
+    *,
+    data: Any = None,
+    indent: int = 2,
+    highlight: bool = True,
+    skip_keys: bool = False,
+    ensure_ascii: bool = True,
+    check_circular: bool = True,
+    allow_nan: bool = True,
+    default: Optional[Callable[[Any], Any]] = None,
+    sort_keys: bool = False,
+) -> None:
+    """Pretty prints JSON. Output will be valid JSON.
+
+    Args:
+        json (str): A string containing JSON.
+        data (Any): If json is not supplied, then encode this data.
+        indent (int, optional): Number of spaces to indent. Defaults to 2.
+        highlight (bool, optional): Enable highlighting of output: Defaults to True.
+        skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+        ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+        check_circular (bool, optional): Check for circular references. Defaults to True.
+        allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+        default (Callable, optional): A callable that converts values that can not be encoded
+            in to something that can be JSON encoded. Defaults to None.
+        sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+    """
+
+    get_console().print_json(
+        json,
+        data=data,
+        indent=indent,
+        highlight=highlight,
+        skip_keys=skip_keys,
+        ensure_ascii=ensure_ascii,
+        check_circular=check_circular,
+        allow_nan=allow_nan,
+        default=default,
+        sort_keys=sort_keys,
+    )
+
+
+def inspect(
+    obj: Any,
+    *,
+    console: Optional["Console"] = None,
+    title: Optional[str] = None,
+    help: bool = False,
+    methods: bool = False,
+    docs: bool = True,
+    private: bool = False,
+    dunder: bool = False,
+    sort: bool = True,
+    all: bool = False,
+    value: bool = True,
+) -> None:
+    """Inspect any Python object.
+
+    * inspect(<OBJECT>) to see summarized info.
+    * inspect(<OBJECT>, methods=True) to see methods.
+    * inspect(<OBJECT>, help=True) to see full (non-abbreviated) help.
+    * inspect(<OBJECT>, private=True) to see private attributes (single underscore).
+    * inspect(<OBJECT>, dunder=True) to see attributes beginning with double underscore.
+    * inspect(<OBJECT>, all=True) to see all attributes.
+
+    Args:
+        obj (Any): An object to inspect.
+        title (str, optional): Title to display over inspect result, or None use type. Defaults to None.
+        help (bool, optional): Show full help text rather than just first paragraph. Defaults to False.
+        methods (bool, optional): Enable inspection of callables. Defaults to False.
+        docs (bool, optional): Also render doc strings. Defaults to True.
+        private (bool, optional): Show private attributes (beginning with underscore). Defaults to False.
+        dunder (bool, optional): Show attributes starting with double underscore. Defaults to False.
+        sort (bool, optional): Sort attributes alphabetically. Defaults to True.
+        all (bool, optional): Show all attributes. Defaults to False.
+        value (bool, optional): Pretty print value. Defaults to True.
+    """
+    _console = console or get_console()
+    from pip._vendor.rich._inspect import Inspect
+
+    # Special case for inspect(inspect)
+    is_inspect = obj is inspect
+
+    _inspect = Inspect(
+        obj,
+        title=title,
+        help=is_inspect or help,
+        methods=is_inspect or methods,
+        docs=is_inspect or docs,
+        private=private,
+        dunder=dunder,
+        sort=sort,
+        all=all,
+        value=value,
+    )
+    _console.print(_inspect)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    print("Hello, **World**")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__main__.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__main__.py
new file mode 100644
index 0000000000000000000000000000000000000000..8692d37e00b32771a40a85d206642f550e1f9eeb
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__main__.py
@@ -0,0 +1,280 @@
+import colorsys
+import io
+from time import process_time
+
+from pip._vendor.rich import box
+from pip._vendor.rich.color import Color
+from pip._vendor.rich.console import Console, ConsoleOptions, Group, RenderableType, RenderResult
+from pip._vendor.rich.markdown import Markdown
+from pip._vendor.rich.measure import Measurement
+from pip._vendor.rich.pretty import Pretty
+from pip._vendor.rich.segment import Segment
+from pip._vendor.rich.style import Style
+from pip._vendor.rich.syntax import Syntax
+from pip._vendor.rich.table import Table
+from pip._vendor.rich.text import Text
+
+
+class ColorBox:
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        for y in range(0, 5):
+            for x in range(options.max_width):
+                h = x / options.max_width
+                l = 0.1 + ((y / 5) * 0.7)
+                r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0)
+                r2, g2, b2 = colorsys.hls_to_rgb(h, l + 0.7 / 10, 1.0)
+                bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255)
+                color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255)
+                yield Segment("▄", Style(color=color, bgcolor=bgcolor))
+            yield Segment.line()
+
+    def __rich_measure__(
+        self, console: "Console", options: ConsoleOptions
+    ) -> Measurement:
+        return Measurement(1, options.max_width)
+
+
+def make_test_card() -> Table:
+    """Get a renderable that demonstrates a number of features."""
+    table = Table.grid(padding=1, pad_edge=True)
+    table.title = "Rich features"
+    table.add_column("Feature", no_wrap=True, justify="center", style="bold red")
+    table.add_column("Demonstration")
+
+    color_table = Table(
+        box=None,
+        expand=False,
+        show_header=False,
+        show_edge=False,
+        pad_edge=False,
+    )
+    color_table.add_row(
+        # "[bold yellow]256[/] colors or [bold green]16.7 million[/] colors [blue](if supported by your terminal)[/].",
+        (
+            "✓ [bold green]4-bit color[/]\n"
+            "✓ [bold blue]8-bit color[/]\n"
+            "✓ [bold magenta]Truecolor (16.7 million)[/]\n"
+            "✓ [bold yellow]Dumb terminals[/]\n"
+            "✓ [bold cyan]Automatic color conversion"
+        ),
+        ColorBox(),
+    )
+
+    table.add_row("Colors", color_table)
+
+    table.add_row(
+        "Styles",
+        "All ansi styles: [bold]bold[/], [dim]dim[/], [italic]italic[/italic], [underline]underline[/], [strike]strikethrough[/], [reverse]reverse[/], and even [blink]blink[/].",
+    )
+
+    lorem = "Lorem ipsum dolor sit amet, consectetur adipiscing elit. Quisque in metus sed sapien ultricies pretium a at justo. Maecenas luctus velit et auctor maximus."
+    lorem_table = Table.grid(padding=1, collapse_padding=True)
+    lorem_table.pad_edge = False
+    lorem_table.add_row(
+        Text(lorem, justify="left", style="green"),
+        Text(lorem, justify="center", style="yellow"),
+        Text(lorem, justify="right", style="blue"),
+        Text(lorem, justify="full", style="red"),
+    )
+    table.add_row(
+        "Text",
+        Group(
+            Text.from_markup(
+                """Word wrap text. Justify [green]left[/], [yellow]center[/], [blue]right[/] or [red]full[/].\n"""
+            ),
+            lorem_table,
+        ),
+    )
+
+    def comparison(renderable1: RenderableType, renderable2: RenderableType) -> Table:
+        table = Table(show_header=False, pad_edge=False, box=None, expand=True)
+        table.add_column("1", ratio=1)
+        table.add_column("2", ratio=1)
+        table.add_row(renderable1, renderable2)
+        return table
+
+    table.add_row(
+        "Asian\nlanguage\nsupport",
+        ":flag_for_china:  该库支持中文，日文和韩文文本！\n:flag_for_japan:  ライブラリは中国語、日本語、韓国語のテキストをサポートしています\n:flag_for_south_korea:  이 라이브러리는 중국어, 일본어 및 한국어 텍스트를 지원합니다",
+    )
+
+    markup_example = (
+        "[bold magenta]Rich[/] supports a simple [i]bbcode[/i]-like [b]markup[/b] for [yellow]color[/], [underline]style[/], and emoji! "
+        ":+1: :apple: :ant: :bear: :baguette_bread: :bus: "
+    )
+    table.add_row("Markup", markup_example)
+
+    example_table = Table(
+        show_edge=False,
+        show_header=True,
+        expand=False,
+        row_styles=["none", "dim"],
+        box=box.SIMPLE,
+    )
+    example_table.add_column("[green]Date", style="green", no_wrap=True)
+    example_table.add_column("[blue]Title", style="blue")
+    example_table.add_column(
+        "[cyan]Production Budget",
+        style="cyan",
+        justify="right",
+        no_wrap=True,
+    )
+    example_table.add_column(
+        "[magenta]Box Office",
+        style="magenta",
+        justify="right",
+        no_wrap=True,
+    )
+    example_table.add_row(
+        "Dec 20, 2019",
+        "Star Wars: The Rise of Skywalker",
+        "$275,000,000",
+        "$375,126,118",
+    )
+    example_table.add_row(
+        "May 25, 2018",
+        "[b]Solo[/]: A Star Wars Story",
+        "$275,000,000",
+        "$393,151,347",
+    )
+    example_table.add_row(
+        "Dec 15, 2017",
+        "Star Wars Ep. VIII: The Last Jedi",
+        "$262,000,000",
+        "[bold]$1,332,539,889[/bold]",
+    )
+    example_table.add_row(
+        "May 19, 1999",
+        "Star Wars Ep. [b]I[/b]: [i]The phantom Menace",
+        "$115,000,000",
+        "$1,027,044,677",
+    )
+
+    table.add_row("Tables", example_table)
+
+    code = '''\
+def iter_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:
+    """Iterate and generate a tuple with a flag for last value."""
+    iter_values = iter(values)
+    try:
+        previous_value = next(iter_values)
+    except StopIteration:
+        return
+    for value in iter_values:
+        yield False, previous_value
+        previous_value = value
+    yield True, previous_value'''
+
+    pretty_data = {
+        "foo": [
+            3.1427,
+            (
+                "Paul Atreides",
+                "Vladimir Harkonnen",
+                "Thufir Hawat",
+            ),
+        ],
+        "atomic": (False, True, None),
+    }
+    table.add_row(
+        "Syntax\nhighlighting\n&\npretty\nprinting",
+        comparison(
+            Syntax(code, "python3", line_numbers=True, indent_guides=True),
+            Pretty(pretty_data, indent_guides=True),
+        ),
+    )
+
+    markdown_example = """\
+# Markdown
+
+Supports much of the *markdown* __syntax__!
+
+- Headers
+- Basic formatting: **bold**, *italic*, `code`
+- Block quotes
+- Lists, and more...
+    """
+    table.add_row(
+        "Markdown", comparison("[cyan]" + markdown_example, Markdown(markdown_example))
+    )
+
+    table.add_row(
+        "+more!",
+        """Progress bars, columns, styled logging handler, tracebacks, etc...""",
+    )
+    return table
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    console = Console(
+        file=io.StringIO(),
+        force_terminal=True,
+    )
+    test_card = make_test_card()
+
+    # Print once to warm cache
+    start = process_time()
+    console.print(test_card)
+    pre_cache_taken = round((process_time() - start) * 1000.0, 1)
+
+    console.file = io.StringIO()
+
+    start = process_time()
+    console.print(test_card)
+    taken = round((process_time() - start) * 1000.0, 1)
+
+    text = console.file.getvalue()
+    # https://bugs.python.org/issue37871
+    for line in text.splitlines(True):
+        print(line, end="")
+
+    print(f"rendered in {pre_cache_taken}ms (cold cache)")
+    print(f"rendered in {taken}ms (warm cache)")
+
+    from pip._vendor.rich.panel import Panel
+
+    console = Console()
+
+    sponsor_message = Table.grid(padding=1)
+    sponsor_message.add_column(style="green", justify="right")
+    sponsor_message.add_column(no_wrap=True)
+
+    sponsor_message.add_row(
+        "Buy devs a :coffee:",
+        "[u blue link=https://ko-fi.com/textualize]https://ko-fi.com/textualize",
+    )
+    sponsor_message.add_row(
+        "Twitter",
+        "[u blue link=https://twitter.com/willmcgugan]https://twitter.com/willmcgugan",
+    )
+    sponsor_message.add_row(
+        "Blog", "[u blue link=https://www.willmcgugan.com]https://www.willmcgugan.com"
+    )
+
+    intro_message = Text.from_markup(
+        """\
+We hope you enjoy using Rich!
+
+Rich is maintained with :heart: by [link=https://www.textualize.io]Textualize.io[/]
+
+- Will McGugan"""
+    )
+
+    message = Table.grid(padding=2)
+    message.add_column()
+    message.add_column(no_wrap=True)
+    message.add_row(intro_message, sponsor_message)
+
+    console.print(
+        Panel.fit(
+            message,
+            box=box.ROUNDED,
+            padding=(1, 2),
+            title="[b red]Thanks for trying out Rich!",
+            border_style="bright_blue",
+        ),
+        justify="center",
+    )
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/__init__.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/__init__.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..b840f45bbf8b1d25dcdf41cef53ebad654f0b455
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/__init__.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/_cell_widths.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/_cell_widths.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..e6a22c1cc029b6ce40bcaa5f385f4281bc4f8b6b
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/_cell_widths.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/bar.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/bar.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..080c4bba1c298fcd542cbe0848ff6ff5d6e7134e
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/bar.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/constrain.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/constrain.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..98d5c714a0273664542aeaa1f382aca846625bad
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/constrain.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/file_proxy.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/file_proxy.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..e15dfc09336537319e10ae87ecd3567e6be9ccce
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/file_proxy.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/layout.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/layout.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..5edd7cbba41c71eecf7edb0a77ebe72f98afd4f5
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/layout.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/pager.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/pager.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..258164f6489f5440dfb0398034421ca54cc8d7a7
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/pager.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/palette.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/palette.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..703ec2943413bbfc7caf1c03657c06f171cec565
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/palette.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/panel.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/panel.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..c771abb2a98690b95b333b036850fb17513970b9
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/panel.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/pretty.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/pretty.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..01b08fcc98f1752c0e6ba016fcd65fe969b5227e
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/pretty.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/protocol.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/protocol.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..a89a1f830f0eea97a75d1cc6dada74ac6e825ee8
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/protocol.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/repr.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/repr.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..f2e169bfc6591ad87dda4f7487cab488ab31c622
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/repr.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/scope.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/scope.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..94cb0145661229abb1d4e023c62b1b7ad8747381
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/scope.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/style.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/style.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..b4da2036fd89a3b91292ebaf1c8b88e77c1342fa
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/style.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/tabulate.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/tabulate.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..b6124e62759a21c21ea5db303d176701204c560a
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/tabulate.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/theme.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/theme.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..a1366f87ba877250851d2c8b507462826f69dc65
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/theme.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/themes.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/themes.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..4a24e9b05c40cff6c370be8289b917562705d241
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/themes.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/traceback.cpython-310.pyc b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/traceback.cpython-310.pyc
new file mode 100644
index 0000000000000000000000000000000000000000..5524310a8c131009c80c76840f4a6035175b3efd
Binary files /dev/null and b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/__pycache__/traceback.cpython-310.pyc differ
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_cell_widths.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_cell_widths.py
new file mode 100644
index 0000000000000000000000000000000000000000..36286df379e28ea997bea3ee1fd62cadebebbba9
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_cell_widths.py
@@ -0,0 +1,451 @@
+# Auto generated by make_terminal_widths.py
+
+CELL_WIDTHS = [
+    (0, 0, 0),
+    (1, 31, -1),
+    (127, 159, -1),
+    (768, 879, 0),
+    (1155, 1161, 0),
+    (1425, 1469, 0),
+    (1471, 1471, 0),
+    (1473, 1474, 0),
+    (1476, 1477, 0),
+    (1479, 1479, 0),
+    (1552, 1562, 0),
+    (1611, 1631, 0),
+    (1648, 1648, 0),
+    (1750, 1756, 0),
+    (1759, 1764, 0),
+    (1767, 1768, 0),
+    (1770, 1773, 0),
+    (1809, 1809, 0),
+    (1840, 1866, 0),
+    (1958, 1968, 0),
+    (2027, 2035, 0),
+    (2045, 2045, 0),
+    (2070, 2073, 0),
+    (2075, 2083, 0),
+    (2085, 2087, 0),
+    (2089, 2093, 0),
+    (2137, 2139, 0),
+    (2259, 2273, 0),
+    (2275, 2306, 0),
+    (2362, 2362, 0),
+    (2364, 2364, 0),
+    (2369, 2376, 0),
+    (2381, 2381, 0),
+    (2385, 2391, 0),
+    (2402, 2403, 0),
+    (2433, 2433, 0),
+    (2492, 2492, 0),
+    (2497, 2500, 0),
+    (2509, 2509, 0),
+    (2530, 2531, 0),
+    (2558, 2558, 0),
+    (2561, 2562, 0),
+    (2620, 2620, 0),
+    (2625, 2626, 0),
+    (2631, 2632, 0),
+    (2635, 2637, 0),
+    (2641, 2641, 0),
+    (2672, 2673, 0),
+    (2677, 2677, 0),
+    (2689, 2690, 0),
+    (2748, 2748, 0),
+    (2753, 2757, 0),
+    (2759, 2760, 0),
+    (2765, 2765, 0),
+    (2786, 2787, 0),
+    (2810, 2815, 0),
+    (2817, 2817, 0),
+    (2876, 2876, 0),
+    (2879, 2879, 0),
+    (2881, 2884, 0),
+    (2893, 2893, 0),
+    (2901, 2902, 0),
+    (2914, 2915, 0),
+    (2946, 2946, 0),
+    (3008, 3008, 0),
+    (3021, 3021, 0),
+    (3072, 3072, 0),
+    (3076, 3076, 0),
+    (3134, 3136, 0),
+    (3142, 3144, 0),
+    (3146, 3149, 0),
+    (3157, 3158, 0),
+    (3170, 3171, 0),
+    (3201, 3201, 0),
+    (3260, 3260, 0),
+    (3263, 3263, 0),
+    (3270, 3270, 0),
+    (3276, 3277, 0),
+    (3298, 3299, 0),
+    (3328, 3329, 0),
+    (3387, 3388, 0),
+    (3393, 3396, 0),
+    (3405, 3405, 0),
+    (3426, 3427, 0),
+    (3457, 3457, 0),
+    (3530, 3530, 0),
+    (3538, 3540, 0),
+    (3542, 3542, 0),
+    (3633, 3633, 0),
+    (3636, 3642, 0),
+    (3655, 3662, 0),
+    (3761, 3761, 0),
+    (3764, 3772, 0),
+    (3784, 3789, 0),
+    (3864, 3865, 0),
+    (3893, 3893, 0),
+    (3895, 3895, 0),
+    (3897, 3897, 0),
+    (3953, 3966, 0),
+    (3968, 3972, 0),
+    (3974, 3975, 0),
+    (3981, 3991, 0),
+    (3993, 4028, 0),
+    (4038, 4038, 0),
+    (4141, 4144, 0),
+    (4146, 4151, 0),
+    (4153, 4154, 0),
+    (4157, 4158, 0),
+    (4184, 4185, 0),
+    (4190, 4192, 0),
+    (4209, 4212, 0),
+    (4226, 4226, 0),
+    (4229, 4230, 0),
+    (4237, 4237, 0),
+    (4253, 4253, 0),
+    (4352, 4447, 2),
+    (4957, 4959, 0),
+    (5906, 5908, 0),
+    (5938, 5940, 0),
+    (5970, 5971, 0),
+    (6002, 6003, 0),
+    (6068, 6069, 0),
+    (6071, 6077, 0),
+    (6086, 6086, 0),
+    (6089, 6099, 0),
+    (6109, 6109, 0),
+    (6155, 6157, 0),
+    (6277, 6278, 0),
+    (6313, 6313, 0),
+    (6432, 6434, 0),
+    (6439, 6440, 0),
+    (6450, 6450, 0),
+    (6457, 6459, 0),
+    (6679, 6680, 0),
+    (6683, 6683, 0),
+    (6742, 6742, 0),
+    (6744, 6750, 0),
+    (6752, 6752, 0),
+    (6754, 6754, 0),
+    (6757, 6764, 0),
+    (6771, 6780, 0),
+    (6783, 6783, 0),
+    (6832, 6848, 0),
+    (6912, 6915, 0),
+    (6964, 6964, 0),
+    (6966, 6970, 0),
+    (6972, 6972, 0),
+    (6978, 6978, 0),
+    (7019, 7027, 0),
+    (7040, 7041, 0),
+    (7074, 7077, 0),
+    (7080, 7081, 0),
+    (7083, 7085, 0),
+    (7142, 7142, 0),
+    (7144, 7145, 0),
+    (7149, 7149, 0),
+    (7151, 7153, 0),
+    (7212, 7219, 0),
+    (7222, 7223, 0),
+    (7376, 7378, 0),
+    (7380, 7392, 0),
+    (7394, 7400, 0),
+    (7405, 7405, 0),
+    (7412, 7412, 0),
+    (7416, 7417, 0),
+    (7616, 7673, 0),
+    (7675, 7679, 0),
+    (8203, 8207, 0),
+    (8232, 8238, 0),
+    (8288, 8291, 0),
+    (8400, 8432, 0),
+    (8986, 8987, 2),
+    (9001, 9002, 2),
+    (9193, 9196, 2),
+    (9200, 9200, 2),
+    (9203, 9203, 2),
+    (9725, 9726, 2),
+    (9748, 9749, 2),
+    (9800, 9811, 2),
+    (9855, 9855, 2),
+    (9875, 9875, 2),
+    (9889, 9889, 2),
+    (9898, 9899, 2),
+    (9917, 9918, 2),
+    (9924, 9925, 2),
+    (9934, 9934, 2),
+    (9940, 9940, 2),
+    (9962, 9962, 2),
+    (9970, 9971, 2),
+    (9973, 9973, 2),
+    (9978, 9978, 2),
+    (9981, 9981, 2),
+    (9989, 9989, 2),
+    (9994, 9995, 2),
+    (10024, 10024, 2),
+    (10060, 10060, 2),
+    (10062, 10062, 2),
+    (10067, 10069, 2),
+    (10071, 10071, 2),
+    (10133, 10135, 2),
+    (10160, 10160, 2),
+    (10175, 10175, 2),
+    (11035, 11036, 2),
+    (11088, 11088, 2),
+    (11093, 11093, 2),
+    (11503, 11505, 0),
+    (11647, 11647, 0),
+    (11744, 11775, 0),
+    (11904, 11929, 2),
+    (11931, 12019, 2),
+    (12032, 12245, 2),
+    (12272, 12283, 2),
+    (12288, 12329, 2),
+    (12330, 12333, 0),
+    (12334, 12350, 2),
+    (12353, 12438, 2),
+    (12441, 12442, 0),
+    (12443, 12543, 2),
+    (12549, 12591, 2),
+    (12593, 12686, 2),
+    (12688, 12771, 2),
+    (12784, 12830, 2),
+    (12832, 12871, 2),
+    (12880, 19903, 2),
+    (19968, 42124, 2),
+    (42128, 42182, 2),
+    (42607, 42610, 0),
+    (42612, 42621, 0),
+    (42654, 42655, 0),
+    (42736, 42737, 0),
+    (43010, 43010, 0),
+    (43014, 43014, 0),
+    (43019, 43019, 0),
+    (43045, 43046, 0),
+    (43052, 43052, 0),
+    (43204, 43205, 0),
+    (43232, 43249, 0),
+    (43263, 43263, 0),
+    (43302, 43309, 0),
+    (43335, 43345, 0),
+    (43360, 43388, 2),
+    (43392, 43394, 0),
+    (43443, 43443, 0),
+    (43446, 43449, 0),
+    (43452, 43453, 0),
+    (43493, 43493, 0),
+    (43561, 43566, 0),
+    (43569, 43570, 0),
+    (43573, 43574, 0),
+    (43587, 43587, 0),
+    (43596, 43596, 0),
+    (43644, 43644, 0),
+    (43696, 43696, 0),
+    (43698, 43700, 0),
+    (43703, 43704, 0),
+    (43710, 43711, 0),
+    (43713, 43713, 0),
+    (43756, 43757, 0),
+    (43766, 43766, 0),
+    (44005, 44005, 0),
+    (44008, 44008, 0),
+    (44013, 44013, 0),
+    (44032, 55203, 2),
+    (63744, 64255, 2),
+    (64286, 64286, 0),
+    (65024, 65039, 0),
+    (65040, 65049, 2),
+    (65056, 65071, 0),
+    (65072, 65106, 2),
+    (65108, 65126, 2),
+    (65128, 65131, 2),
+    (65281, 65376, 2),
+    (65504, 65510, 2),
+    (66045, 66045, 0),
+    (66272, 66272, 0),
+    (66422, 66426, 0),
+    (68097, 68099, 0),
+    (68101, 68102, 0),
+    (68108, 68111, 0),
+    (68152, 68154, 0),
+    (68159, 68159, 0),
+    (68325, 68326, 0),
+    (68900, 68903, 0),
+    (69291, 69292, 0),
+    (69446, 69456, 0),
+    (69633, 69633, 0),
+    (69688, 69702, 0),
+    (69759, 69761, 0),
+    (69811, 69814, 0),
+    (69817, 69818, 0),
+    (69888, 69890, 0),
+    (69927, 69931, 0),
+    (69933, 69940, 0),
+    (70003, 70003, 0),
+    (70016, 70017, 0),
+    (70070, 70078, 0),
+    (70089, 70092, 0),
+    (70095, 70095, 0),
+    (70191, 70193, 0),
+    (70196, 70196, 0),
+    (70198, 70199, 0),
+    (70206, 70206, 0),
+    (70367, 70367, 0),
+    (70371, 70378, 0),
+    (70400, 70401, 0),
+    (70459, 70460, 0),
+    (70464, 70464, 0),
+    (70502, 70508, 0),
+    (70512, 70516, 0),
+    (70712, 70719, 0),
+    (70722, 70724, 0),
+    (70726, 70726, 0),
+    (70750, 70750, 0),
+    (70835, 70840, 0),
+    (70842, 70842, 0),
+    (70847, 70848, 0),
+    (70850, 70851, 0),
+    (71090, 71093, 0),
+    (71100, 71101, 0),
+    (71103, 71104, 0),
+    (71132, 71133, 0),
+    (71219, 71226, 0),
+    (71229, 71229, 0),
+    (71231, 71232, 0),
+    (71339, 71339, 0),
+    (71341, 71341, 0),
+    (71344, 71349, 0),
+    (71351, 71351, 0),
+    (71453, 71455, 0),
+    (71458, 71461, 0),
+    (71463, 71467, 0),
+    (71727, 71735, 0),
+    (71737, 71738, 0),
+    (71995, 71996, 0),
+    (71998, 71998, 0),
+    (72003, 72003, 0),
+    (72148, 72151, 0),
+    (72154, 72155, 0),
+    (72160, 72160, 0),
+    (72193, 72202, 0),
+    (72243, 72248, 0),
+    (72251, 72254, 0),
+    (72263, 72263, 0),
+    (72273, 72278, 0),
+    (72281, 72283, 0),
+    (72330, 72342, 0),
+    (72344, 72345, 0),
+    (72752, 72758, 0),
+    (72760, 72765, 0),
+    (72767, 72767, 0),
+    (72850, 72871, 0),
+    (72874, 72880, 0),
+    (72882, 72883, 0),
+    (72885, 72886, 0),
+    (73009, 73014, 0),
+    (73018, 73018, 0),
+    (73020, 73021, 0),
+    (73023, 73029, 0),
+    (73031, 73031, 0),
+    (73104, 73105, 0),
+    (73109, 73109, 0),
+    (73111, 73111, 0),
+    (73459, 73460, 0),
+    (92912, 92916, 0),
+    (92976, 92982, 0),
+    (94031, 94031, 0),
+    (94095, 94098, 0),
+    (94176, 94179, 2),
+    (94180, 94180, 0),
+    (94192, 94193, 2),
+    (94208, 100343, 2),
+    (100352, 101589, 2),
+    (101632, 101640, 2),
+    (110592, 110878, 2),
+    (110928, 110930, 2),
+    (110948, 110951, 2),
+    (110960, 111355, 2),
+    (113821, 113822, 0),
+    (119143, 119145, 0),
+    (119163, 119170, 0),
+    (119173, 119179, 0),
+    (119210, 119213, 0),
+    (119362, 119364, 0),
+    (121344, 121398, 0),
+    (121403, 121452, 0),
+    (121461, 121461, 0),
+    (121476, 121476, 0),
+    (121499, 121503, 0),
+    (121505, 121519, 0),
+    (122880, 122886, 0),
+    (122888, 122904, 0),
+    (122907, 122913, 0),
+    (122915, 122916, 0),
+    (122918, 122922, 0),
+    (123184, 123190, 0),
+    (123628, 123631, 0),
+    (125136, 125142, 0),
+    (125252, 125258, 0),
+    (126980, 126980, 2),
+    (127183, 127183, 2),
+    (127374, 127374, 2),
+    (127377, 127386, 2),
+    (127488, 127490, 2),
+    (127504, 127547, 2),
+    (127552, 127560, 2),
+    (127568, 127569, 2),
+    (127584, 127589, 2),
+    (127744, 127776, 2),
+    (127789, 127797, 2),
+    (127799, 127868, 2),
+    (127870, 127891, 2),
+    (127904, 127946, 2),
+    (127951, 127955, 2),
+    (127968, 127984, 2),
+    (127988, 127988, 2),
+    (127992, 128062, 2),
+    (128064, 128064, 2),
+    (128066, 128252, 2),
+    (128255, 128317, 2),
+    (128331, 128334, 2),
+    (128336, 128359, 2),
+    (128378, 128378, 2),
+    (128405, 128406, 2),
+    (128420, 128420, 2),
+    (128507, 128591, 2),
+    (128640, 128709, 2),
+    (128716, 128716, 2),
+    (128720, 128722, 2),
+    (128725, 128727, 2),
+    (128747, 128748, 2),
+    (128756, 128764, 2),
+    (128992, 129003, 2),
+    (129292, 129338, 2),
+    (129340, 129349, 2),
+    (129351, 129400, 2),
+    (129402, 129483, 2),
+    (129485, 129535, 2),
+    (129648, 129652, 2),
+    (129656, 129658, 2),
+    (129664, 129670, 2),
+    (129680, 129704, 2),
+    (129712, 129718, 2),
+    (129728, 129730, 2),
+    (129744, 129750, 2),
+    (131072, 196605, 2),
+    (196608, 262141, 2),
+    (917760, 917999, 0),
+]
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_emoji_replace.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_emoji_replace.py
new file mode 100644
index 0000000000000000000000000000000000000000..bb2cafa18011e7115773055338291c366f173d6f
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_emoji_replace.py
@@ -0,0 +1,32 @@
+from typing import Callable, Match, Optional
+import re
+
+from ._emoji_codes import EMOJI
+
+
+_ReStringMatch = Match[str]  # regex match object
+_ReSubCallable = Callable[[_ReStringMatch], str]  # Callable invoked by re.sub
+_EmojiSubMethod = Callable[[_ReSubCallable, str], str]  # Sub method of a compiled re
+
+
+def _emoji_replace(
+    text: str,
+    default_variant: Optional[str] = None,
+    _emoji_sub: _EmojiSubMethod = re.compile(r"(:(\S*?)(?:(?:\-)(emoji|text))?:)").sub,
+) -> str:
+    """Replace emoji code in text."""
+    get_emoji = EMOJI.__getitem__
+    variants = {"text": "\uFE0E", "emoji": "\uFE0F"}
+    get_variant = variants.get
+    default_variant_code = variants.get(default_variant, "") if default_variant else ""
+
+    def do_replace(match: Match[str]) -> str:
+        emoji_code, emoji_name, variant = match.groups()
+        try:
+            return get_emoji(emoji_name.lower()) + get_variant(
+                variant, default_variant_code
+            )
+        except KeyError:
+            return emoji_code
+
+    return _emoji_sub(do_replace, text)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_extension.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_extension.py
new file mode 100644
index 0000000000000000000000000000000000000000..cbd6da9be4956ce8558304ed72ffbe88ccd22ba5
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_extension.py
@@ -0,0 +1,10 @@
+from typing import Any
+
+
+def load_ipython_extension(ip: Any) -> None:  # pragma: no cover
+    # prevent circular import
+    from pip._vendor.rich.pretty import install
+    from pip._vendor.rich.traceback import install as tr_install
+
+    install()
+    tr_install()
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_inspect.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_inspect.py
new file mode 100644
index 0000000000000000000000000000000000000000..262695b1c4723bfb57569f3badd6f81f1cccd3df
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_inspect.py
@@ -0,0 +1,210 @@
+from __future__ import absolute_import
+
+from inspect import cleandoc, getdoc, getfile, isclass, ismodule, signature
+from typing import Any, Iterable, Optional, Tuple
+
+from .console import RenderableType, Group
+from .highlighter import ReprHighlighter
+from .jupyter import JupyterMixin
+from .panel import Panel
+from .pretty import Pretty
+from .table import Table
+from .text import Text, TextType
+
+
+def _first_paragraph(doc: str) -> str:
+    """Get the first paragraph from a docstring."""
+    paragraph, _, _ = doc.partition("\n\n")
+    return paragraph
+
+
+def _reformat_doc(doc: str) -> str:
+    """Reformat docstring."""
+    doc = cleandoc(doc).strip()
+    return doc
+
+
+class Inspect(JupyterMixin):
+    """A renderable to inspect any Python Object.
+
+    Args:
+        obj (Any): An object to inspect.
+        title (str, optional): Title to display over inspect result, or None use type. Defaults to None.
+        help (bool, optional): Show full help text rather than just first paragraph. Defaults to False.
+        methods (bool, optional): Enable inspection of callables. Defaults to False.
+        docs (bool, optional): Also render doc strings. Defaults to True.
+        private (bool, optional): Show private attributes (beginning with underscore). Defaults to False.
+        dunder (bool, optional): Show attributes starting with double underscore. Defaults to False.
+        sort (bool, optional): Sort attributes alphabetically. Defaults to True.
+        all (bool, optional): Show all attributes. Defaults to False.
+        value (bool, optional): Pretty print value of object. Defaults to True.
+    """
+
+    def __init__(
+        self,
+        obj: Any,
+        *,
+        title: Optional[TextType] = None,
+        help: bool = False,
+        methods: bool = False,
+        docs: bool = True,
+        private: bool = False,
+        dunder: bool = False,
+        sort: bool = True,
+        all: bool = True,
+        value: bool = True,
+    ) -> None:
+        self.highlighter = ReprHighlighter()
+        self.obj = obj
+        self.title = title or self._make_title(obj)
+        if all:
+            methods = private = dunder = True
+        self.help = help
+        self.methods = methods
+        self.docs = docs or help
+        self.private = private or dunder
+        self.dunder = dunder
+        self.sort = sort
+        self.value = value
+
+    def _make_title(self, obj: Any) -> Text:
+        """Make a default title."""
+        title_str = (
+            str(obj)
+            if (isclass(obj) or callable(obj) or ismodule(obj))
+            else str(type(obj))
+        )
+        title_text = self.highlighter(title_str)
+        return title_text
+
+    def __rich__(self) -> Panel:
+        return Panel.fit(
+            Group(*self._render()),
+            title=self.title,
+            border_style="scope.border",
+            padding=(0, 1),
+        )
+
+    def _get_signature(self, name: str, obj: Any) -> Optional[Text]:
+        """Get a signature for a callable."""
+        try:
+            _signature = str(signature(obj)) + ":"
+        except ValueError:
+            _signature = "(...)"
+        except TypeError:
+            return None
+
+        source_filename: Optional[str] = None
+        try:
+            source_filename = getfile(obj)
+        except TypeError:
+            pass
+
+        callable_name = Text(name, style="inspect.callable")
+        if source_filename:
+            callable_name.stylize(f"link file://{source_filename}")
+        signature_text = self.highlighter(_signature)
+
+        qualname = name or getattr(obj, "__qualname__", name)
+        qual_signature = Text.assemble(
+            ("def ", "inspect.def"), (qualname, "inspect.callable"), signature_text
+        )
+
+        return qual_signature
+
+    def _render(self) -> Iterable[RenderableType]:
+        """Render object."""
+
+        def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]:
+            key, (_error, value) = item
+            return (callable(value), key.strip("_").lower())
+
+        def safe_getattr(attr_name: str) -> Tuple[Any, Any]:
+            """Get attribute or any exception."""
+            try:
+                return (None, getattr(obj, attr_name))
+            except Exception as error:
+                return (error, None)
+
+        obj = self.obj
+        keys = dir(obj)
+        total_items = len(keys)
+        if not self.dunder:
+            keys = [key for key in keys if not key.startswith("__")]
+        if not self.private:
+            keys = [key for key in keys if not key.startswith("_")]
+        not_shown_count = total_items - len(keys)
+        items = [(key, safe_getattr(key)) for key in keys]
+        if self.sort:
+            items.sort(key=sort_items)
+
+        items_table = Table.grid(padding=(0, 1), expand=False)
+        items_table.add_column(justify="right")
+        add_row = items_table.add_row
+        highlighter = self.highlighter
+
+        if callable(obj):
+            signature = self._get_signature("", obj)
+            if signature is not None:
+                yield signature
+                yield ""
+
+        if self.docs:
+            _doc = getdoc(obj)
+            if _doc is not None:
+                if not self.help:
+                    _doc = _first_paragraph(_doc)
+                doc_text = Text(_reformat_doc(_doc), style="inspect.help")
+                doc_text = highlighter(doc_text)
+                yield doc_text
+                yield ""
+
+        if self.value and not (isclass(obj) or callable(obj) or ismodule(obj)):
+            yield Panel(
+                Pretty(obj, indent_guides=True, max_length=10, max_string=60),
+                border_style="inspect.value.border",
+            )
+            yield ""
+
+        for key, (error, value) in items:
+            key_text = Text.assemble(
+                (
+                    key,
+                    "inspect.attr.dunder" if key.startswith("__") else "inspect.attr",
+                ),
+                (" =", "inspect.equals"),
+            )
+            if error is not None:
+                warning = key_text.copy()
+                warning.stylize("inspect.error")
+                add_row(warning, highlighter(repr(error)))
+                continue
+
+            if callable(value):
+                if not self.methods:
+                    continue
+
+                _signature_text = self._get_signature(key, value)
+                if _signature_text is None:
+                    add_row(key_text, Pretty(value, highlighter=highlighter))
+                else:
+                    if self.docs:
+                        docs = getdoc(value)
+                        if docs is not None:
+                            _doc = _reformat_doc(str(docs))
+                            if not self.help:
+                                _doc = _first_paragraph(_doc)
+                            _signature_text.append("\n" if "\n" in _doc else " ")
+                            doc = highlighter(_doc)
+                            doc.stylize("inspect.doc")
+                            _signature_text.append(doc)
+
+                    add_row(key_text, _signature_text)
+            else:
+                add_row(key_text, Pretty(value, highlighter=highlighter))
+        if items_table.row_count:
+            yield items_table
+        else:
+            yield Text.from_markup(
+                f"[b cyan]{not_shown_count}[/][i] attribute(s) not shown.[/i] Run [b][magenta]inspect[/]([not b]inspect[/])[/b] for options."
+            )
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_log_render.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_log_render.py
new file mode 100644
index 0000000000000000000000000000000000000000..fc16c84437a8a34231c44d3f0a331459ddcb0f34
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_log_render.py
@@ -0,0 +1,94 @@
+from datetime import datetime
+from typing import Iterable, List, Optional, TYPE_CHECKING, Union, Callable
+
+
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleRenderable, RenderableType
+    from .table import Table
+
+FormatTimeCallable = Callable[[datetime], Text]
+
+
+class LogRender:
+    def __init__(
+        self,
+        show_time: bool = True,
+        show_level: bool = False,
+        show_path: bool = True,
+        time_format: Union[str, FormatTimeCallable] = "[%x %X]",
+        omit_repeated_times: bool = True,
+        level_width: Optional[int] = 8,
+    ) -> None:
+        self.show_time = show_time
+        self.show_level = show_level
+        self.show_path = show_path
+        self.time_format = time_format
+        self.omit_repeated_times = omit_repeated_times
+        self.level_width = level_width
+        self._last_time: Optional[Text] = None
+
+    def __call__(
+        self,
+        console: "Console",
+        renderables: Iterable["ConsoleRenderable"],
+        log_time: Optional[datetime] = None,
+        time_format: Optional[Union[str, FormatTimeCallable]] = None,
+        level: TextType = "",
+        path: Optional[str] = None,
+        line_no: Optional[int] = None,
+        link_path: Optional[str] = None,
+    ) -> "Table":
+        from .containers import Renderables
+        from .table import Table
+
+        output = Table.grid(padding=(0, 1))
+        output.expand = True
+        if self.show_time:
+            output.add_column(style="log.time")
+        if self.show_level:
+            output.add_column(style="log.level", width=self.level_width)
+        output.add_column(ratio=1, style="log.message", overflow="fold")
+        if self.show_path and path:
+            output.add_column(style="log.path")
+        row: List["RenderableType"] = []
+        if self.show_time:
+            log_time = log_time or console.get_datetime()
+            time_format = time_format or self.time_format
+            if callable(time_format):
+                log_time_display = time_format(log_time)
+            else:
+                log_time_display = Text(log_time.strftime(time_format))
+            if log_time_display == self._last_time and self.omit_repeated_times:
+                row.append(Text(" " * len(log_time_display)))
+            else:
+                row.append(log_time_display)
+                self._last_time = log_time_display
+        if self.show_level:
+            row.append(level)
+
+        row.append(Renderables(renderables))
+        if self.show_path and path:
+            path_text = Text()
+            path_text.append(
+                path, style=f"link file://{link_path}" if link_path else ""
+            )
+            if line_no:
+                path_text.append(":")
+                path_text.append(
+                    f"{line_no}",
+                    style=f"link file://{link_path}#{line_no}" if link_path else "",
+                )
+            row.append(path_text)
+
+        output.add_row(*row)
+        return output
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+
+    c = Console()
+    c.print("[on blue]Hello", justify="right")
+    c.log("[on blue]hello", justify="right")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_lru_cache.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_lru_cache.py
new file mode 100644
index 0000000000000000000000000000000000000000..b7bf2ce1ad72703b1dc8442d7445b778dc6030c1
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_lru_cache.py
@@ -0,0 +1,34 @@
+from collections import OrderedDict
+from typing import Dict, Generic, TypeVar
+
+
+CacheKey = TypeVar("CacheKey")
+CacheValue = TypeVar("CacheValue")
+
+
+class LRUCache(Generic[CacheKey, CacheValue], OrderedDict):  # type: ignore # https://github.com/python/mypy/issues/6904
+    """
+    A dictionary-like container that stores a given maximum items.
+
+    If an additional item is added when the LRUCache is full, the least
+    recently used key is discarded to make room for the new item.
+
+    """
+
+    def __init__(self, cache_size: int) -> None:
+        self.cache_size = cache_size
+        super(LRUCache, self).__init__()
+
+    def __setitem__(self, key: CacheKey, value: CacheValue) -> None:
+        """Store a new views, potentially discarding an old value."""
+        if key not in self:
+            if len(self) >= self.cache_size:
+                self.popitem(last=False)
+        OrderedDict.__setitem__(self, key, value)
+
+    def __getitem__(self: Dict[CacheKey, CacheValue], key: CacheKey) -> CacheValue:
+        """Gets the item, but also makes it most recent."""
+        value: CacheValue = OrderedDict.__getitem__(self, key)
+        OrderedDict.__delitem__(self, key)
+        OrderedDict.__setitem__(self, key, value)
+        return value
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_palettes.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_palettes.py
new file mode 100644
index 0000000000000000000000000000000000000000..3c748d33e45bfcdc690ceee490cbb50b516cd2b3
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_palettes.py
@@ -0,0 +1,309 @@
+from .palette import Palette
+
+
+# Taken from https://en.wikipedia.org/wiki/ANSI_escape_code (Windows 10 column)
+WINDOWS_PALETTE = Palette(
+    [
+        (12, 12, 12),
+        (197, 15, 31),
+        (19, 161, 14),
+        (193, 156, 0),
+        (0, 55, 218),
+        (136, 23, 152),
+        (58, 150, 221),
+        (204, 204, 204),
+        (118, 118, 118),
+        (231, 72, 86),
+        (22, 198, 12),
+        (249, 241, 165),
+        (59, 120, 255),
+        (180, 0, 158),
+        (97, 214, 214),
+        (242, 242, 242),
+    ]
+)
+
+# # The standard ansi colors (including bright variants)
+STANDARD_PALETTE = Palette(
+    [
+        (0, 0, 0),
+        (170, 0, 0),
+        (0, 170, 0),
+        (170, 85, 0),
+        (0, 0, 170),
+        (170, 0, 170),
+        (0, 170, 170),
+        (170, 170, 170),
+        (85, 85, 85),
+        (255, 85, 85),
+        (85, 255, 85),
+        (255, 255, 85),
+        (85, 85, 255),
+        (255, 85, 255),
+        (85, 255, 255),
+        (255, 255, 255),
+    ]
+)
+
+
+# The 256 color palette
+EIGHT_BIT_PALETTE = Palette(
+    [
+        (0, 0, 0),
+        (128, 0, 0),
+        (0, 128, 0),
+        (128, 128, 0),
+        (0, 0, 128),
+        (128, 0, 128),
+        (0, 128, 128),
+        (192, 192, 192),
+        (128, 128, 128),
+        (255, 0, 0),
+        (0, 255, 0),
+        (255, 255, 0),
+        (0, 0, 255),
+        (255, 0, 255),
+        (0, 255, 255),
+        (255, 255, 255),
+        (0, 0, 0),
+        (0, 0, 95),
+        (0, 0, 135),
+        (0, 0, 175),
+        (0, 0, 215),
+        (0, 0, 255),
+        (0, 95, 0),
+        (0, 95, 95),
+        (0, 95, 135),
+        (0, 95, 175),
+        (0, 95, 215),
+        (0, 95, 255),
+        (0, 135, 0),
+        (0, 135, 95),
+        (0, 135, 135),
+        (0, 135, 175),
+        (0, 135, 215),
+        (0, 135, 255),
+        (0, 175, 0),
+        (0, 175, 95),
+        (0, 175, 135),
+        (0, 175, 175),
+        (0, 175, 215),
+        (0, 175, 255),
+        (0, 215, 0),
+        (0, 215, 95),
+        (0, 215, 135),
+        (0, 215, 175),
+        (0, 215, 215),
+        (0, 215, 255),
+        (0, 255, 0),
+        (0, 255, 95),
+        (0, 255, 135),
+        (0, 255, 175),
+        (0, 255, 215),
+        (0, 255, 255),
+        (95, 0, 0),
+        (95, 0, 95),
+        (95, 0, 135),
+        (95, 0, 175),
+        (95, 0, 215),
+        (95, 0, 255),
+        (95, 95, 0),
+        (95, 95, 95),
+        (95, 95, 135),
+        (95, 95, 175),
+        (95, 95, 215),
+        (95, 95, 255),
+        (95, 135, 0),
+        (95, 135, 95),
+        (95, 135, 135),
+        (95, 135, 175),
+        (95, 135, 215),
+        (95, 135, 255),
+        (95, 175, 0),
+        (95, 175, 95),
+        (95, 175, 135),
+        (95, 175, 175),
+        (95, 175, 215),
+        (95, 175, 255),
+        (95, 215, 0),
+        (95, 215, 95),
+        (95, 215, 135),
+        (95, 215, 175),
+        (95, 215, 215),
+        (95, 215, 255),
+        (95, 255, 0),
+        (95, 255, 95),
+        (95, 255, 135),
+        (95, 255, 175),
+        (95, 255, 215),
+        (95, 255, 255),
+        (135, 0, 0),
+        (135, 0, 95),
+        (135, 0, 135),
+        (135, 0, 175),
+        (135, 0, 215),
+        (135, 0, 255),
+        (135, 95, 0),
+        (135, 95, 95),
+        (135, 95, 135),
+        (135, 95, 175),
+        (135, 95, 215),
+        (135, 95, 255),
+        (135, 135, 0),
+        (135, 135, 95),
+        (135, 135, 135),
+        (135, 135, 175),
+        (135, 135, 215),
+        (135, 135, 255),
+        (135, 175, 0),
+        (135, 175, 95),
+        (135, 175, 135),
+        (135, 175, 175),
+        (135, 175, 215),
+        (135, 175, 255),
+        (135, 215, 0),
+        (135, 215, 95),
+        (135, 215, 135),
+        (135, 215, 175),
+        (135, 215, 215),
+        (135, 215, 255),
+        (135, 255, 0),
+        (135, 255, 95),
+        (135, 255, 135),
+        (135, 255, 175),
+        (135, 255, 215),
+        (135, 255, 255),
+        (175, 0, 0),
+        (175, 0, 95),
+        (175, 0, 135),
+        (175, 0, 175),
+        (175, 0, 215),
+        (175, 0, 255),
+        (175, 95, 0),
+        (175, 95, 95),
+        (175, 95, 135),
+        (175, 95, 175),
+        (175, 95, 215),
+        (175, 95, 255),
+        (175, 135, 0),
+        (175, 135, 95),
+        (175, 135, 135),
+        (175, 135, 175),
+        (175, 135, 215),
+        (175, 135, 255),
+        (175, 175, 0),
+        (175, 175, 95),
+        (175, 175, 135),
+        (175, 175, 175),
+        (175, 175, 215),
+        (175, 175, 255),
+        (175, 215, 0),
+        (175, 215, 95),
+        (175, 215, 135),
+        (175, 215, 175),
+        (175, 215, 215),
+        (175, 215, 255),
+        (175, 255, 0),
+        (175, 255, 95),
+        (175, 255, 135),
+        (175, 255, 175),
+        (175, 255, 215),
+        (175, 255, 255),
+        (215, 0, 0),
+        (215, 0, 95),
+        (215, 0, 135),
+        (215, 0, 175),
+        (215, 0, 215),
+        (215, 0, 255),
+        (215, 95, 0),
+        (215, 95, 95),
+        (215, 95, 135),
+        (215, 95, 175),
+        (215, 95, 215),
+        (215, 95, 255),
+        (215, 135, 0),
+        (215, 135, 95),
+        (215, 135, 135),
+        (215, 135, 175),
+        (215, 135, 215),
+        (215, 135, 255),
+        (215, 175, 0),
+        (215, 175, 95),
+        (215, 175, 135),
+        (215, 175, 175),
+        (215, 175, 215),
+        (215, 175, 255),
+        (215, 215, 0),
+        (215, 215, 95),
+        (215, 215, 135),
+        (215, 215, 175),
+        (215, 215, 215),
+        (215, 215, 255),
+        (215, 255, 0),
+        (215, 255, 95),
+        (215, 255, 135),
+        (215, 255, 175),
+        (215, 255, 215),
+        (215, 255, 255),
+        (255, 0, 0),
+        (255, 0, 95),
+        (255, 0, 135),
+        (255, 0, 175),
+        (255, 0, 215),
+        (255, 0, 255),
+        (255, 95, 0),
+        (255, 95, 95),
+        (255, 95, 135),
+        (255, 95, 175),
+        (255, 95, 215),
+        (255, 95, 255),
+        (255, 135, 0),
+        (255, 135, 95),
+        (255, 135, 135),
+        (255, 135, 175),
+        (255, 135, 215),
+        (255, 135, 255),
+        (255, 175, 0),
+        (255, 175, 95),
+        (255, 175, 135),
+        (255, 175, 175),
+        (255, 175, 215),
+        (255, 175, 255),
+        (255, 215, 0),
+        (255, 215, 95),
+        (255, 215, 135),
+        (255, 215, 175),
+        (255, 215, 215),
+        (255, 215, 255),
+        (255, 255, 0),
+        (255, 255, 95),
+        (255, 255, 135),
+        (255, 255, 175),
+        (255, 255, 215),
+        (255, 255, 255),
+        (8, 8, 8),
+        (18, 18, 18),
+        (28, 28, 28),
+        (38, 38, 38),
+        (48, 48, 48),
+        (58, 58, 58),
+        (68, 68, 68),
+        (78, 78, 78),
+        (88, 88, 88),
+        (98, 98, 98),
+        (108, 108, 108),
+        (118, 118, 118),
+        (128, 128, 128),
+        (138, 138, 138),
+        (148, 148, 148),
+        (158, 158, 158),
+        (168, 168, 168),
+        (178, 178, 178),
+        (188, 188, 188),
+        (198, 198, 198),
+        (208, 208, 208),
+        (218, 218, 218),
+        (228, 228, 228),
+        (238, 238, 238),
+    ]
+)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_pick.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_pick.py
new file mode 100644
index 0000000000000000000000000000000000000000..4f6d8b2d79406012c5f8bae9c289ed5bf4d179cc
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_pick.py
@@ -0,0 +1,17 @@
+from typing import Optional
+
+
+def pick_bool(*values: Optional[bool]) -> bool:
+    """Pick the first non-none bool or return the last value.
+
+    Args:
+        *values (bool): Any number of boolean or None values.
+
+    Returns:
+        bool: First non-none boolean.
+    """
+    assert values, "1 or more values required"
+    for value in values:
+        if value is not None:
+            return value
+    return bool(value)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_ratio.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_ratio.py
new file mode 100644
index 0000000000000000000000000000000000000000..e8a3a674e0070159b956c29c5092b0f72abc969d
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_ratio.py
@@ -0,0 +1,160 @@
+import sys
+from fractions import Fraction
+from math import ceil
+from typing import cast, List, Optional, Sequence
+
+if sys.version_info >= (3, 8):
+    from typing import Protocol
+else:
+    from pip._vendor.typing_extensions import Protocol  # pragma: no cover
+
+
+class Edge(Protocol):
+    """Any object that defines an edge (such as Layout)."""
+
+    size: Optional[int] = None
+    ratio: int = 1
+    minimum_size: int = 1
+
+
+def ratio_resolve(total: int, edges: Sequence[Edge]) -> List[int]:
+    """Divide total space to satisfy size, ratio, and minimum_size, constraints.
+
+    The returned list of integers should add up to total in most cases, unless it is
+    impossible to satisfy all the constraints. For instance, if there are two edges
+    with a minimum size of 20 each and `total` is 30 then the returned list will be
+    greater than total. In practice, this would mean that a Layout object would
+    clip the rows that would overflow the screen height.
+
+    Args:
+        total (int): Total number of characters.
+        edges (List[Edge]): Edges within total space.
+
+    Returns:
+        List[int]: Number of characters for each edge.
+    """
+    # Size of edge or None for yet to be determined
+    sizes = [(edge.size or None) for edge in edges]
+
+    _Fraction = Fraction
+
+    # While any edges haven't been calculated
+    while None in sizes:
+        # Get flexible edges and index to map these back on to sizes list
+        flexible_edges = [
+            (index, edge)
+            for index, (size, edge) in enumerate(zip(sizes, edges))
+            if size is None
+        ]
+        # Remaining space in total
+        remaining = total - sum(size or 0 for size in sizes)
+        if remaining <= 0:
+            # No room for flexible edges
+            return [
+                ((edge.minimum_size or 1) if size is None else size)
+                for size, edge in zip(sizes, edges)
+            ]
+        # Calculate number of characters in a ratio portion
+        portion = _Fraction(
+            remaining, sum((edge.ratio or 1) for _, edge in flexible_edges)
+        )
+
+        # If any edges will be less than their minimum, replace size with the minimum
+        for index, edge in flexible_edges:
+            if portion * edge.ratio <= edge.minimum_size:
+                sizes[index] = edge.minimum_size
+                # New fixed size will invalidate calculations, so we need to repeat the process
+                break
+        else:
+            # Distribute flexible space and compensate for rounding error
+            # Since edge sizes can only be integers we need to add the remainder
+            # to the following line
+            remainder = _Fraction(0)
+            for index, edge in flexible_edges:
+                size, remainder = divmod(portion * edge.ratio + remainder, 1)
+                sizes[index] = size
+            break
+    # Sizes now contains integers only
+    return cast(List[int], sizes)
+
+
+def ratio_reduce(
+    total: int, ratios: List[int], maximums: List[int], values: List[int]
+) -> List[int]:
+    """Divide an integer total in to parts based on ratios.
+
+    Args:
+        total (int): The total to divide.
+        ratios (List[int]): A list of integer ratios.
+        maximums (List[int]): List of maximums values for each slot.
+        values (List[int]): List of values
+
+    Returns:
+        List[int]: A list of integers guaranteed to sum to total.
+    """
+    ratios = [ratio if _max else 0 for ratio, _max in zip(ratios, maximums)]
+    total_ratio = sum(ratios)
+    if not total_ratio:
+        return values[:]
+    total_remaining = total
+    result: List[int] = []
+    append = result.append
+    for ratio, maximum, value in zip(ratios, maximums, values):
+        if ratio and total_ratio > 0:
+            distributed = min(maximum, round(ratio * total_remaining / total_ratio))
+            append(value - distributed)
+            total_remaining -= distributed
+            total_ratio -= ratio
+        else:
+            append(value)
+    return result
+
+
+def ratio_distribute(
+    total: int, ratios: List[int], minimums: Optional[List[int]] = None
+) -> List[int]:
+    """Distribute an integer total in to parts based on ratios.
+
+    Args:
+        total (int): The total to divide.
+        ratios (List[int]): A list of integer ratios.
+        minimums (List[int]): List of minimum values for each slot.
+
+    Returns:
+        List[int]: A list of integers guaranteed to sum to total.
+    """
+    if minimums:
+        ratios = [ratio if _min else 0 for ratio, _min in zip(ratios, minimums)]
+    total_ratio = sum(ratios)
+    assert total_ratio > 0, "Sum of ratios must be > 0"
+
+    total_remaining = total
+    distributed_total: List[int] = []
+    append = distributed_total.append
+    if minimums is None:
+        _minimums = [0] * len(ratios)
+    else:
+        _minimums = minimums
+    for ratio, minimum in zip(ratios, _minimums):
+        if total_ratio > 0:
+            distributed = max(minimum, ceil(ratio * total_remaining / total_ratio))
+        else:
+            distributed = total_remaining
+        append(distributed)
+        total_ratio -= ratio
+        total_remaining -= distributed
+    return distributed_total
+
+
+if __name__ == "__main__":
+    from dataclasses import dataclass
+
+    @dataclass
+    class E:
+
+        size: Optional[int] = None
+        ratio: int = 1
+        minimum_size: int = 1
+
+    resolved = ratio_resolve(110, [E(None, 1, 1), E(None, 1, 1), E(None, 1, 1)])
+    print(sum(resolved))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_stack.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_stack.py
new file mode 100644
index 0000000000000000000000000000000000000000..194564e761ddae165b39ef6598877e2e3820af0a
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_stack.py
@@ -0,0 +1,16 @@
+from typing import List, TypeVar
+
+T = TypeVar("T")
+
+
+class Stack(List[T]):
+    """A small shim over builtin list."""
+
+    @property
+    def top(self) -> T:
+        """Get top of stack."""
+        return self[-1]
+
+    def push(self, item: T) -> None:
+        """Push an item on to the stack (append in stack nomenclature)."""
+        self.append(item)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_timer.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_timer.py
new file mode 100644
index 0000000000000000000000000000000000000000..a2ca6be03c43054caaa3660998273ebf704345dd
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_timer.py
@@ -0,0 +1,19 @@
+"""
+Timer context manager, only used in debug.
+
+"""
+
+from time import time
+
+import contextlib
+from typing import Generator
+
+
+@contextlib.contextmanager
+def timer(subject: str = "time") -> Generator[None, None, None]:
+    """print the elapsed time. (only used in debugging)"""
+    start = time()
+    yield
+    elapsed = time() - start
+    elapsed_ms = elapsed * 1000
+    print(f"{subject} elapsed {elapsed_ms:.1f}ms")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_windows.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_windows.py
new file mode 100644
index 0000000000000000000000000000000000000000..ca3a680d354eac46af4ccbb529229e11d072e9ef
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_windows.py
@@ -0,0 +1,72 @@
+import sys
+from dataclasses import dataclass
+
+
+@dataclass
+class WindowsConsoleFeatures:
+    """Windows features available."""
+
+    vt: bool = False
+    """The console supports VT codes."""
+    truecolor: bool = False
+    """The console supports truecolor."""
+
+
+try:
+    import ctypes
+    from ctypes import LibraryLoader, wintypes
+
+    if sys.platform == "win32":
+        windll = LibraryLoader(ctypes.WinDLL)
+    else:
+        windll = None
+        raise ImportError("Not windows")
+except (AttributeError, ImportError, ValueError):
+
+    # Fallback if we can't load the Windows DLL
+    def get_windows_console_features() -> WindowsConsoleFeatures:
+        features = WindowsConsoleFeatures()
+        return features
+
+else:
+
+    STDOUT = -11
+    ENABLE_VIRTUAL_TERMINAL_PROCESSING = 4
+    _GetConsoleMode = windll.kernel32.GetConsoleMode
+    _GetConsoleMode.argtypes = [wintypes.HANDLE, wintypes.LPDWORD]
+    _GetConsoleMode.restype = wintypes.BOOL
+
+    _GetStdHandle = windll.kernel32.GetStdHandle
+    _GetStdHandle.argtypes = [
+        wintypes.DWORD,
+    ]
+    _GetStdHandle.restype = wintypes.HANDLE
+
+    def get_windows_console_features() -> WindowsConsoleFeatures:
+        """Get windows console features.
+
+        Returns:
+            WindowsConsoleFeatures: An instance of WindowsConsoleFeatures.
+        """
+        handle = _GetStdHandle(STDOUT)
+        console_mode = wintypes.DWORD()
+        result = _GetConsoleMode(handle, console_mode)
+        vt = bool(result and console_mode.value & ENABLE_VIRTUAL_TERMINAL_PROCESSING)
+        truecolor = False
+        if vt:
+            win_version = sys.getwindowsversion()
+            truecolor = win_version.major > 10 or (
+                win_version.major == 10 and win_version.build >= 15063
+            )
+        features = WindowsConsoleFeatures(vt=vt, truecolor=truecolor)
+        return features
+
+
+if __name__ == "__main__":
+    import platform
+
+    features = get_windows_console_features()
+    from pip._vendor.rich import print
+
+    print(f'platform="{platform.system()}"')
+    print(repr(features))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_wrap.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_wrap.py
new file mode 100644
index 0000000000000000000000000000000000000000..b537757a573be8777c45b0b265a13a15d90bdf29
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/_wrap.py
@@ -0,0 +1,55 @@
+import re
+from typing import Iterable, List, Tuple
+
+from .cells import cell_len, chop_cells
+from ._loop import loop_last
+
+re_word = re.compile(r"\s*\S+\s*")
+
+
+def words(text: str) -> Iterable[Tuple[int, int, str]]:
+    position = 0
+    word_match = re_word.match(text, position)
+    while word_match is not None:
+        start, end = word_match.span()
+        word = word_match.group(0)
+        yield start, end, word
+        word_match = re_word.match(text, end)
+
+
+def divide_line(text: str, width: int, fold: bool = True) -> List[int]:
+    divides: List[int] = []
+    append = divides.append
+    line_position = 0
+    _cell_len = cell_len
+    for start, _end, word in words(text):
+        word_length = _cell_len(word.rstrip())
+        if line_position + word_length > width:
+            if word_length > width:
+                if fold:
+                    for last, line in loop_last(
+                        chop_cells(word, width, position=line_position)
+                    ):
+                        if last:
+                            line_position = _cell_len(line)
+                        else:
+                            start += len(line)
+                            append(start)
+                else:
+                    if start:
+                        append(start)
+                    line_position = _cell_len(word)
+            elif line_position and start:
+                append(start)
+                line_position = _cell_len(word)
+        else:
+            line_position += _cell_len(word)
+    return divides
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    console = Console(width=10)
+    console.print("12345 abcdefghijklmnopqrstuvwyxzABCDEFGHIJKLMNOPQRSTUVWXYZ 12345")
+    print(chop_cells("abcdefghijklmnopqrstuvwxyz", 10, position=2))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/ansi.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/ansi.py
new file mode 100644
index 0000000000000000000000000000000000000000..92e4772eddfb5320dadadaf233bb5a89c53dc5e8
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/ansi.py
@@ -0,0 +1,228 @@
+from contextlib import suppress
+import re
+from typing import Iterable, NamedTuple
+
+from .color import Color
+from .style import Style
+from .text import Text
+
+re_ansi = re.compile(r"(?:\x1b\[(.*?)m)|(?:\x1b\](.*?)\x1b\\)")
+re_csi = re.compile(r"\x1B(?:[@-Z\\-_]|\[[0-?]*[ -/]*[@-~])")
+
+
+class _AnsiToken(NamedTuple):
+    """Result of ansi tokenized string."""
+
+    plain: str = ""
+    sgr: str = ""
+    osc: str = ""
+
+
+def _ansi_tokenize(ansi_text: str) -> Iterable[_AnsiToken]:
+    """Tokenize a string in to plain text and ANSI codes.
+
+    Args:
+        ansi_text (str): A String containing ANSI codes.
+
+    Yields:
+        AnsiToken: A named tuple of (plain, sgr, osc)
+    """
+
+    def remove_csi(ansi_text: str) -> str:
+        """Remove unknown CSI sequences."""
+        return re_csi.sub("", ansi_text)
+
+    position = 0
+    for match in re_ansi.finditer(ansi_text):
+        start, end = match.span(0)
+        sgr, osc = match.groups()
+        if start > position:
+            yield _AnsiToken(remove_csi(ansi_text[position:start]))
+        yield _AnsiToken("", sgr, osc)
+        position = end
+    if position < len(ansi_text):
+        yield _AnsiToken(remove_csi(ansi_text[position:]))
+
+
+SGR_STYLE_MAP = {
+    1: "bold",
+    2: "dim",
+    3: "italic",
+    4: "underline",
+    5: "blink",
+    6: "blink2",
+    7: "reverse",
+    8: "conceal",
+    9: "strike",
+    21: "underline2",
+    22: "not dim not bold",
+    23: "not italic",
+    24: "not underline",
+    25: "not blink",
+    26: "not blink2",
+    27: "not reverse",
+    28: "not conceal",
+    29: "not strike",
+    30: "color(0)",
+    31: "color(1)",
+    32: "color(2)",
+    33: "color(3)",
+    34: "color(4)",
+    35: "color(5)",
+    36: "color(6)",
+    37: "color(7)",
+    39: "default",
+    40: "on color(0)",
+    41: "on color(1)",
+    42: "on color(2)",
+    43: "on color(3)",
+    44: "on color(4)",
+    45: "on color(5)",
+    46: "on color(6)",
+    47: "on color(7)",
+    49: "on default",
+    51: "frame",
+    52: "encircle",
+    53: "overline",
+    54: "not frame not encircle",
+    55: "not overline",
+    90: "color(8)",
+    91: "color(9)",
+    92: "color(10)",
+    93: "color(11)",
+    94: "color(12)",
+    95: "color(13)",
+    96: "color(14)",
+    97: "color(15)",
+    100: "on color(8)",
+    101: "on color(9)",
+    102: "on color(10)",
+    103: "on color(11)",
+    104: "on color(12)",
+    105: "on color(13)",
+    106: "on color(14)",
+    107: "on color(15)",
+}
+
+
+class AnsiDecoder:
+    """Translate ANSI code in to styled Text."""
+
+    def __init__(self) -> None:
+        self.style = Style.null()
+
+    def decode(self, terminal_text: str) -> Iterable[Text]:
+        """Decode ANSI codes in an interable of lines.
+
+        Args:
+            lines (Iterable[str]): An iterable of lines of terminal output.
+
+        Yields:
+            Text: Marked up Text.
+        """
+        for line in terminal_text.splitlines():
+            yield self.decode_line(line)
+
+    def decode_line(self, line: str) -> Text:
+        """Decode a line containing ansi codes.
+
+        Args:
+            line (str): A line of terminal output.
+
+        Returns:
+            Text: A Text instance marked up according to ansi codes.
+        """
+        from_ansi = Color.from_ansi
+        from_rgb = Color.from_rgb
+        _Style = Style
+        text = Text()
+        append = text.append
+        line = line.rsplit("\r", 1)[-1]
+        for token in _ansi_tokenize(line):
+            plain_text, sgr, osc = token
+            if plain_text:
+                append(plain_text, self.style or None)
+            elif osc:
+                if osc.startswith("8;"):
+                    _params, semicolon, link = osc[2:].partition(";")
+                    if semicolon:
+                        self.style = self.style.update_link(link or None)
+            elif sgr:
+                # Translate in to semi-colon separated codes
+                # Ignore invalid codes, because we want to be lenient
+                codes = [
+                    min(255, int(_code)) for _code in sgr.split(";") if _code.isdigit()
+                ]
+                iter_codes = iter(codes)
+                for code in iter_codes:
+                    if code == 0:
+                        # reset
+                        self.style = _Style.null()
+                    elif code in SGR_STYLE_MAP:
+                        # styles
+                        self.style += _Style.parse(SGR_STYLE_MAP[code])
+                    elif code == 38:
+                        #  Foreground
+                        with suppress(StopIteration):
+                            color_type = next(iter_codes)
+                            if color_type == 5:
+                                self.style += _Style.from_color(
+                                    from_ansi(next(iter_codes))
+                                )
+                            elif color_type == 2:
+                                self.style += _Style.from_color(
+                                    from_rgb(
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                    )
+                                )
+                    elif code == 48:
+                        # Background
+                        with suppress(StopIteration):
+                            color_type = next(iter_codes)
+                            if color_type == 5:
+                                self.style += _Style.from_color(
+                                    None, from_ansi(next(iter_codes))
+                                )
+                            elif color_type == 2:
+                                self.style += _Style.from_color(
+                                    None,
+                                    from_rgb(
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                    ),
+                                )
+
+        return text
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import pty
+    import io
+    import os
+    import sys
+
+    decoder = AnsiDecoder()
+
+    stdout = io.BytesIO()
+
+    def read(fd: int) -> bytes:
+        data = os.read(fd, 1024)
+        stdout.write(data)
+        return data
+
+    pty.spawn(sys.argv[1:], read)
+
+    from .console import Console
+
+    console = Console(record=True)
+
+    stdout_result = stdout.getvalue().decode("utf-8")
+    print(stdout_result)
+
+    for line in decoder.decode(stdout_result):
+        console.print(line)
+
+    console.save_html("stdout.html")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/bar.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/bar.py
new file mode 100644
index 0000000000000000000000000000000000000000..ed86a552d1ca6baa0cfd48ec73a7a5c952d047c9
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/bar.py
@@ -0,0 +1,94 @@
+from typing import Optional, Union
+
+from .color import Color
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style
+
+# There are left-aligned characters for 1/8 to 7/8, but
+# the right-aligned characters exist only for 1/8 and 4/8.
+BEGIN_BLOCK_ELEMENTS = ["█", "█", "█", "▐", "▐", "▐", "▕", "▕"]
+END_BLOCK_ELEMENTS = [" ", "▏", "▎", "▍", "▌", "▋", "▊", "▉"]
+FULL_BLOCK = "█"
+
+
+class Bar(JupyterMixin):
+    """Renders a solid block bar.
+
+    Args:
+        size (float): Value for the end of the bar.
+        begin (float): Begin point (between 0 and size, inclusive).
+        end (float): End point (between 0 and size, inclusive).
+        width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None.
+        color (Union[Color, str], optional): Color of the bar. Defaults to "default".
+        bgcolor (Union[Color, str], optional): Color of bar background. Defaults to "default".
+    """
+
+    def __init__(
+        self,
+        size: float,
+        begin: float,
+        end: float,
+        *,
+        width: Optional[int] = None,
+        color: Union[Color, str] = "default",
+        bgcolor: Union[Color, str] = "default",
+    ):
+        self.size = size
+        self.begin = max(begin, 0)
+        self.end = min(end, size)
+        self.width = width
+        self.style = Style(color=color, bgcolor=bgcolor)
+
+    def __repr__(self) -> str:
+        return f"Bar({self.size}, {self.begin}, {self.end})"
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        width = min(
+            self.width if self.width is not None else options.max_width,
+            options.max_width,
+        )
+
+        if self.begin >= self.end:
+            yield Segment(" " * width, self.style)
+            yield Segment.line()
+            return
+
+        prefix_complete_eights = int(width * 8 * self.begin / self.size)
+        prefix_bar_count = prefix_complete_eights // 8
+        prefix_eights_count = prefix_complete_eights % 8
+
+        body_complete_eights = int(width * 8 * self.end / self.size)
+        body_bar_count = body_complete_eights // 8
+        body_eights_count = body_complete_eights % 8
+
+        # When start and end fall into the same cell, we ideally should render
+        # a symbol that's "center-aligned", but there is no good symbol in Unicode.
+        # In this case, we fall back to right-aligned block symbol for simplicity.
+
+        prefix = " " * prefix_bar_count
+        if prefix_eights_count:
+            prefix += BEGIN_BLOCK_ELEMENTS[prefix_eights_count]
+
+        body = FULL_BLOCK * body_bar_count
+        if body_eights_count:
+            body += END_BLOCK_ELEMENTS[body_eights_count]
+
+        suffix = " " * (width - len(body))
+
+        yield Segment(prefix + body[len(prefix) :] + suffix, self.style)
+        yield Segment.line()
+
+    def __rich_measure__(
+        self, console: Console, options: ConsoleOptions
+    ) -> Measurement:
+        return (
+            Measurement(self.width, self.width)
+            if self.width is not None
+            else Measurement(4, options.max_width)
+        )
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/box.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/box.py
new file mode 100644
index 0000000000000000000000000000000000000000..aec2926bea28c5914f8d26731f831260a2b6057b
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/box.py
@@ -0,0 +1,483 @@
+import sys
+from typing import TYPE_CHECKING, Iterable, List
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+
+from ._loop import loop_last
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.console import ConsoleOptions
+
+
+class Box:
+    """Defines characters to render boxes.
+
+    ┌─┬┐ top
+    │ ││ head
+    ├─┼┤ head_row
+    │ ││ mid
+    ├─┼┤ row
+    ├─┼┤ foot_row
+    │ ││ foot
+    └─┴┘ bottom
+
+    Args:
+        box (str): Characters making up box.
+        ascii (bool, optional): True if this box uses ascii characters only. Default is False.
+    """
+
+    def __init__(self, box: str, *, ascii: bool = False) -> None:
+        self._box = box
+        self.ascii = ascii
+        line1, line2, line3, line4, line5, line6, line7, line8 = box.splitlines()
+        # top
+        self.top_left, self.top, self.top_divider, self.top_right = iter(line1)
+        # head
+        self.head_left, _, self.head_vertical, self.head_right = iter(line2)
+        # head_row
+        (
+            self.head_row_left,
+            self.head_row_horizontal,
+            self.head_row_cross,
+            self.head_row_right,
+        ) = iter(line3)
+
+        # mid
+        self.mid_left, _, self.mid_vertical, self.mid_right = iter(line4)
+        # row
+        self.row_left, self.row_horizontal, self.row_cross, self.row_right = iter(line5)
+        # foot_row
+        (
+            self.foot_row_left,
+            self.foot_row_horizontal,
+            self.foot_row_cross,
+            self.foot_row_right,
+        ) = iter(line6)
+        # foot
+        self.foot_left, _, self.foot_vertical, self.foot_right = iter(line7)
+        # bottom
+        self.bottom_left, self.bottom, self.bottom_divider, self.bottom_right = iter(
+            line8
+        )
+
+    def __repr__(self) -> str:
+        return "Box(...)"
+
+    def __str__(self) -> str:
+        return self._box
+
+    def substitute(self, options: "ConsoleOptions", safe: bool = True) -> "Box":
+        """Substitute this box for another if it won't render due to platform issues.
+
+        Args:
+            options (ConsoleOptions): Console options used in rendering.
+            safe (bool, optional): Substitute this for another Box if there are known problems
+                displaying on the platform (currently only relevant on Windows). Default is True.
+
+        Returns:
+            Box: A different Box or the same Box.
+        """
+        box = self
+        if options.legacy_windows and safe:
+            box = LEGACY_WINDOWS_SUBSTITUTIONS.get(box, box)
+        if options.ascii_only and not box.ascii:
+            box = ASCII
+        return box
+
+    def get_top(self, widths: Iterable[int]) -> str:
+        """Get the top of a simple box.
+
+        Args:
+            widths (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+
+        parts: List[str] = []
+        append = parts.append
+        append(self.top_left)
+        for last, width in loop_last(widths):
+            append(self.top * width)
+            if not last:
+                append(self.top_divider)
+        append(self.top_right)
+        return "".join(parts)
+
+    def get_row(
+        self,
+        widths: Iterable[int],
+        level: Literal["head", "row", "foot", "mid"] = "row",
+        edge: bool = True,
+    ) -> str:
+        """Get the top of a simple box.
+
+        Args:
+            width (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+        if level == "head":
+            left = self.head_row_left
+            horizontal = self.head_row_horizontal
+            cross = self.head_row_cross
+            right = self.head_row_right
+        elif level == "row":
+            left = self.row_left
+            horizontal = self.row_horizontal
+            cross = self.row_cross
+            right = self.row_right
+        elif level == "mid":
+            left = self.mid_left
+            horizontal = " "
+            cross = self.mid_vertical
+            right = self.mid_right
+        elif level == "foot":
+            left = self.foot_row_left
+            horizontal = self.foot_row_horizontal
+            cross = self.foot_row_cross
+            right = self.foot_row_right
+        else:
+            raise ValueError("level must be 'head', 'row' or 'foot'")
+
+        parts: List[str] = []
+        append = parts.append
+        if edge:
+            append(left)
+        for last, width in loop_last(widths):
+            append(horizontal * width)
+            if not last:
+                append(cross)
+        if edge:
+            append(right)
+        return "".join(parts)
+
+    def get_bottom(self, widths: Iterable[int]) -> str:
+        """Get the bottom of a simple box.
+
+        Args:
+            widths (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+
+        parts: List[str] = []
+        append = parts.append
+        append(self.bottom_left)
+        for last, width in loop_last(widths):
+            append(self.bottom * width)
+            if not last:
+                append(self.bottom_divider)
+        append(self.bottom_right)
+        return "".join(parts)
+
+
+ASCII: Box = Box(
+    """\
++--+
+| ||
+|-+|
+| ||
+|-+|
+|-+|
+| ||
++--+
+""",
+    ascii=True,
+)
+
+ASCII2: Box = Box(
+    """\
++-++
+| ||
++-++
+| ||
++-++
++-++
+| ||
++-++
+""",
+    ascii=True,
+)
+
+ASCII_DOUBLE_HEAD: Box = Box(
+    """\
++-++
+| ||
++=++
+| ||
++-++
++-++
+| ||
++-++
+""",
+    ascii=True,
+)
+
+SQUARE: Box = Box(
+    """\
+┌─┬┐
+│ ││
+├─┼┤
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+└─┴┘
+"""
+)
+
+SQUARE_DOUBLE_HEAD: Box = Box(
+    """\
+┌─┬┐
+│ ││
+╞═╪╡
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+└─┴┘
+"""
+)
+
+MINIMAL: Box = Box(
+    """\
+  ╷ 
+  │ 
+╶─┼╴
+  │ 
+╶─┼╴
+╶─┼╴
+  │ 
+  ╵ 
+"""
+)
+
+
+MINIMAL_HEAVY_HEAD: Box = Box(
+    """\
+  ╷ 
+  │ 
+╺━┿╸
+  │ 
+╶─┼╴
+╶─┼╴
+  │ 
+  ╵ 
+"""
+)
+
+MINIMAL_DOUBLE_HEAD: Box = Box(
+    """\
+  ╷ 
+  │ 
+ ═╪ 
+  │ 
+ ─┼ 
+ ─┼ 
+  │ 
+  ╵ 
+"""
+)
+
+
+SIMPLE: Box = Box(
+    """\
+    
+    
+ ── 
+    
+    
+ ── 
+    
+    
+"""
+)
+
+SIMPLE_HEAD: Box = Box(
+    """\
+    
+    
+ ── 
+    
+    
+    
+    
+    
+"""
+)
+
+
+SIMPLE_HEAVY: Box = Box(
+    """\
+    
+    
+ ━━ 
+    
+    
+ ━━ 
+    
+    
+"""
+)
+
+
+HORIZONTALS: Box = Box(
+    """\
+ ── 
+    
+ ── 
+    
+ ── 
+ ── 
+    
+ ── 
+"""
+)
+
+ROUNDED: Box = Box(
+    """\
+╭─┬╮
+│ ││
+├─┼┤
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+╰─┴╯
+"""
+)
+
+HEAVY: Box = Box(
+    """\
+┏━┳┓
+┃ ┃┃
+┣━╋┫
+┃ ┃┃
+┣━╋┫
+┣━╋┫
+┃ ┃┃
+┗━┻┛
+"""
+)
+
+HEAVY_EDGE: Box = Box(
+    """\
+┏━┯┓
+┃ │┃
+┠─┼┨
+┃ │┃
+┠─┼┨
+┠─┼┨
+┃ │┃
+┗━┷┛
+"""
+)
+
+HEAVY_HEAD: Box = Box(
+    """\
+┏━┳┓
+┃ ┃┃
+┡━╇┩
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+└─┴┘
+"""
+)
+
+DOUBLE: Box = Box(
+    """\
+╔═╦╗
+║ ║║
+╠═╬╣
+║ ║║
+╠═╬╣
+╠═╬╣
+║ ║║
+╚═╩╝
+"""
+)
+
+DOUBLE_EDGE: Box = Box(
+    """\
+╔═╤╗
+║ │║
+╟─┼╢
+║ │║
+╟─┼╢
+╟─┼╢
+║ │║
+╚═╧╝
+"""
+)
+
+# Map Boxes that don't render with raster fonts on to equivalent that do
+LEGACY_WINDOWS_SUBSTITUTIONS = {
+    ROUNDED: SQUARE,
+    MINIMAL_HEAVY_HEAD: MINIMAL,
+    SIMPLE_HEAVY: SIMPLE,
+    HEAVY: SQUARE,
+    HEAVY_EDGE: SQUARE,
+    HEAVY_HEAD: SQUARE,
+}
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from pip._vendor.rich.columns import Columns
+    from pip._vendor.rich.panel import Panel
+
+    from . import box as box
+    from .console import Console
+    from .table import Table
+    from .text import Text
+
+    console = Console(record=True)
+
+    BOXES = [
+        "ASCII",
+        "ASCII2",
+        "ASCII_DOUBLE_HEAD",
+        "SQUARE",
+        "SQUARE_DOUBLE_HEAD",
+        "MINIMAL",
+        "MINIMAL_HEAVY_HEAD",
+        "MINIMAL_DOUBLE_HEAD",
+        "SIMPLE",
+        "SIMPLE_HEAD",
+        "SIMPLE_HEAVY",
+        "HORIZONTALS",
+        "ROUNDED",
+        "HEAVY",
+        "HEAVY_EDGE",
+        "HEAVY_HEAD",
+        "DOUBLE",
+        "DOUBLE_EDGE",
+    ]
+
+    console.print(Panel("[bold green]Box Constants", style="green"), justify="center")
+    console.print()
+
+    columns = Columns(expand=True, padding=2)
+    for box_name in sorted(BOXES):
+        table = Table(
+            show_footer=True, style="dim", border_style="not dim", expand=True
+        )
+        table.add_column("Header 1", "Footer 1")
+        table.add_column("Header 2", "Footer 2")
+        table.add_row("Cell", "Cell")
+        table.add_row("Cell", "Cell")
+        table.box = getattr(box, box_name)
+        table.title = Text(f"box.{box_name}", style="magenta")
+        columns.add_renderable(table)
+    console.print(columns)
+
+    # console.save_html("box.html", inline_styles=True)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/cells.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/cells.py
new file mode 100644
index 0000000000000000000000000000000000000000..e824ea2a6df91e2a6af08e5d5cc2f6703f8853d8
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/cells.py
@@ -0,0 +1,147 @@
+from functools import lru_cache
+import re
+from typing import Dict, List
+
+from ._cell_widths import CELL_WIDTHS
+from ._lru_cache import LRUCache
+
+# Regex to match sequence of the most common character ranges
+_is_single_cell_widths = re.compile("^[\u0020-\u006f\u00a0\u02ff\u0370-\u0482]*$").match
+
+
+def cell_len(text: str, _cache: Dict[str, int] = LRUCache(1024 * 4)) -> int:
+    """Get the number of cells required to display text.
+
+    Args:
+        text (str): Text to display.
+
+    Returns:
+        int: Get the number of cells required to display text.
+    """
+
+    if _is_single_cell_widths(text):
+        return len(text)
+    else:
+        cached_result = _cache.get(text, None)
+        if cached_result is not None:
+            return cached_result
+        _get_size = get_character_cell_size
+        total_size = sum(_get_size(character) for character in text)
+        if len(text) <= 64:
+            _cache[text] = total_size
+    return total_size
+
+
+@lru_cache(maxsize=4096)
+def get_character_cell_size(character: str) -> int:
+    """Get the cell size of a character.
+
+    Args:
+        character (str): A single character.
+
+    Returns:
+        int: Number of cells (0, 1 or 2) occupied by that character.
+    """
+    if _is_single_cell_widths(character):
+        return 1
+
+    return _get_codepoint_cell_size(ord(character))
+
+
+@lru_cache(maxsize=4096)
+def _get_codepoint_cell_size(codepoint: int) -> int:
+    """Get the cell size of a character.
+
+    Args:
+        character (str): A single character.
+
+    Returns:
+        int: Number of cells (0, 1 or 2) occupied by that character.
+    """
+
+    _table = CELL_WIDTHS
+    lower_bound = 0
+    upper_bound = len(_table) - 1
+    index = (lower_bound + upper_bound) // 2
+    while True:
+        start, end, width = _table[index]
+        if codepoint < start:
+            upper_bound = index - 1
+        elif codepoint > end:
+            lower_bound = index + 1
+        else:
+            return 0 if width == -1 else width
+        if upper_bound < lower_bound:
+            break
+        index = (lower_bound + upper_bound) // 2
+    return 1
+
+
+def set_cell_size(text: str, total: int) -> str:
+    """Set the length of a string to fit within given number of cells."""
+
+    if _is_single_cell_widths(text):
+        size = len(text)
+        if size < total:
+            return text + " " * (total - size)
+        return text[:total]
+
+    if not total:
+        return ""
+    cell_size = cell_len(text)
+    if cell_size == total:
+        return text
+    if cell_size < total:
+        return text + " " * (total - cell_size)
+
+    start = 0
+    end = len(text)
+
+    # Binary search until we find the right size
+    while True:
+        pos = (start + end) // 2
+        before = text[: pos + 1]
+        before_len = cell_len(before)
+        if before_len == total + 1 and cell_len(before[-1]) == 2:
+            return before[:-1] + " "
+        if before_len == total:
+            return before
+        if before_len > total:
+            end = pos
+        else:
+            start = pos
+
+
+# TODO: This is inefficient
+# TODO: This might not work with CWJ type characters
+def chop_cells(text: str, max_size: int, position: int = 0) -> List[str]:
+    """Break text in to equal (cell) length strings."""
+    _get_character_cell_size = get_character_cell_size
+    characters = [
+        (character, _get_character_cell_size(character)) for character in text
+    ][::-1]
+    total_size = position
+    lines: List[List[str]] = [[]]
+    append = lines[-1].append
+
+    pop = characters.pop
+    while characters:
+        character, size = pop()
+        if total_size + size > max_size:
+            lines.append([character])
+            append = lines[-1].append
+            total_size = size
+        else:
+            total_size += size
+            append(character)
+    return ["".join(line) for line in lines]
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    print(get_character_cell_size("😽"))
+    for line in chop_cells("""这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑。""", 8):
+        print(line)
+    for n in range(80, 1, -1):
+        print(set_cell_size("""这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑。""", n) + "|")
+        print("x" * n)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/color.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/color.py
new file mode 100644
index 0000000000000000000000000000000000000000..f0fa026d64687dea1ddfa061ca5875578eb45db2
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/color.py
@@ -0,0 +1,581 @@
+import platform
+import re
+from colorsys import rgb_to_hls
+from enum import IntEnum
+from functools import lru_cache
+from typing import TYPE_CHECKING, NamedTuple, Optional, Tuple
+
+from ._palettes import EIGHT_BIT_PALETTE, STANDARD_PALETTE, WINDOWS_PALETTE
+from .color_triplet import ColorTriplet
+from .repr import rich_repr, Result
+from .terminal_theme import DEFAULT_TERMINAL_THEME
+
+if TYPE_CHECKING:  # pragma: no cover
+    from .terminal_theme import TerminalTheme
+    from .text import Text
+
+
+WINDOWS = platform.system() == "Windows"
+
+
+class ColorSystem(IntEnum):
+    """One of the 3 color system supported by terminals."""
+
+    STANDARD = 1
+    EIGHT_BIT = 2
+    TRUECOLOR = 3
+    WINDOWS = 4
+
+    def __repr__(self) -> str:
+        return f"ColorSystem.{self.name}"
+
+
+class ColorType(IntEnum):
+    """Type of color stored in Color class."""
+
+    DEFAULT = 0
+    STANDARD = 1
+    EIGHT_BIT = 2
+    TRUECOLOR = 3
+    WINDOWS = 4
+
+    def __repr__(self) -> str:
+        return f"ColorType.{self.name}"
+
+
+ANSI_COLOR_NAMES = {
+    "black": 0,
+    "red": 1,
+    "green": 2,
+    "yellow": 3,
+    "blue": 4,
+    "magenta": 5,
+    "cyan": 6,
+    "white": 7,
+    "bright_black": 8,
+    "bright_red": 9,
+    "bright_green": 10,
+    "bright_yellow": 11,
+    "bright_blue": 12,
+    "bright_magenta": 13,
+    "bright_cyan": 14,
+    "bright_white": 15,
+    "grey0": 16,
+    "navy_blue": 17,
+    "dark_blue": 18,
+    "blue3": 20,
+    "blue1": 21,
+    "dark_green": 22,
+    "deep_sky_blue4": 25,
+    "dodger_blue3": 26,
+    "dodger_blue2": 27,
+    "green4": 28,
+    "spring_green4": 29,
+    "turquoise4": 30,
+    "deep_sky_blue3": 32,
+    "dodger_blue1": 33,
+    "green3": 40,
+    "spring_green3": 41,
+    "dark_cyan": 36,
+    "light_sea_green": 37,
+    "deep_sky_blue2": 38,
+    "deep_sky_blue1": 39,
+    "spring_green2": 47,
+    "cyan3": 43,
+    "dark_turquoise": 44,
+    "turquoise2": 45,
+    "green1": 46,
+    "spring_green1": 48,
+    "medium_spring_green": 49,
+    "cyan2": 50,
+    "cyan1": 51,
+    "dark_red": 88,
+    "deep_pink4": 125,
+    "purple4": 55,
+    "purple3": 56,
+    "blue_violet": 57,
+    "orange4": 94,
+    "grey37": 59,
+    "medium_purple4": 60,
+    "slate_blue3": 62,
+    "royal_blue1": 63,
+    "chartreuse4": 64,
+    "dark_sea_green4": 71,
+    "pale_turquoise4": 66,
+    "steel_blue": 67,
+    "steel_blue3": 68,
+    "cornflower_blue": 69,
+    "chartreuse3": 76,
+    "cadet_blue": 73,
+    "sky_blue3": 74,
+    "steel_blue1": 81,
+    "pale_green3": 114,
+    "sea_green3": 78,
+    "aquamarine3": 79,
+    "medium_turquoise": 80,
+    "chartreuse2": 112,
+    "sea_green2": 83,
+    "sea_green1": 85,
+    "aquamarine1": 122,
+    "dark_slate_gray2": 87,
+    "dark_magenta": 91,
+    "dark_violet": 128,
+    "purple": 129,
+    "light_pink4": 95,
+    "plum4": 96,
+    "medium_purple3": 98,
+    "slate_blue1": 99,
+    "yellow4": 106,
+    "wheat4": 101,
+    "grey53": 102,
+    "light_slate_grey": 103,
+    "medium_purple": 104,
+    "light_slate_blue": 105,
+    "dark_olive_green3": 149,
+    "dark_sea_green": 108,
+    "light_sky_blue3": 110,
+    "sky_blue2": 111,
+    "dark_sea_green3": 150,
+    "dark_slate_gray3": 116,
+    "sky_blue1": 117,
+    "chartreuse1": 118,
+    "light_green": 120,
+    "pale_green1": 156,
+    "dark_slate_gray1": 123,
+    "red3": 160,
+    "medium_violet_red": 126,
+    "magenta3": 164,
+    "dark_orange3": 166,
+    "indian_red": 167,
+    "hot_pink3": 168,
+    "medium_orchid3": 133,
+    "medium_orchid": 134,
+    "medium_purple2": 140,
+    "dark_goldenrod": 136,
+    "light_salmon3": 173,
+    "rosy_brown": 138,
+    "grey63": 139,
+    "medium_purple1": 141,
+    "gold3": 178,
+    "dark_khaki": 143,
+    "navajo_white3": 144,
+    "grey69": 145,
+    "light_steel_blue3": 146,
+    "light_steel_blue": 147,
+    "yellow3": 184,
+    "dark_sea_green2": 157,
+    "light_cyan3": 152,
+    "light_sky_blue1": 153,
+    "green_yellow": 154,
+    "dark_olive_green2": 155,
+    "dark_sea_green1": 193,
+    "pale_turquoise1": 159,
+    "deep_pink3": 162,
+    "magenta2": 200,
+    "hot_pink2": 169,
+    "orchid": 170,
+    "medium_orchid1": 207,
+    "orange3": 172,
+    "light_pink3": 174,
+    "pink3": 175,
+    "plum3": 176,
+    "violet": 177,
+    "light_goldenrod3": 179,
+    "tan": 180,
+    "misty_rose3": 181,
+    "thistle3": 182,
+    "plum2": 183,
+    "khaki3": 185,
+    "light_goldenrod2": 222,
+    "light_yellow3": 187,
+    "grey84": 188,
+    "light_steel_blue1": 189,
+    "yellow2": 190,
+    "dark_olive_green1": 192,
+    "honeydew2": 194,
+    "light_cyan1": 195,
+    "red1": 196,
+    "deep_pink2": 197,
+    "deep_pink1": 199,
+    "magenta1": 201,
+    "orange_red1": 202,
+    "indian_red1": 204,
+    "hot_pink": 206,
+    "dark_orange": 208,
+    "salmon1": 209,
+    "light_coral": 210,
+    "pale_violet_red1": 211,
+    "orchid2": 212,
+    "orchid1": 213,
+    "orange1": 214,
+    "sandy_brown": 215,
+    "light_salmon1": 216,
+    "light_pink1": 217,
+    "pink1": 218,
+    "plum1": 219,
+    "gold1": 220,
+    "navajo_white1": 223,
+    "misty_rose1": 224,
+    "thistle1": 225,
+    "yellow1": 226,
+    "light_goldenrod1": 227,
+    "khaki1": 228,
+    "wheat1": 229,
+    "cornsilk1": 230,
+    "grey100": 231,
+    "grey3": 232,
+    "grey7": 233,
+    "grey11": 234,
+    "grey15": 235,
+    "grey19": 236,
+    "grey23": 237,
+    "grey27": 238,
+    "grey30": 239,
+    "grey35": 240,
+    "grey39": 241,
+    "grey42": 242,
+    "grey46": 243,
+    "grey50": 244,
+    "grey54": 245,
+    "grey58": 246,
+    "grey62": 247,
+    "grey66": 248,
+    "grey70": 249,
+    "grey74": 250,
+    "grey78": 251,
+    "grey82": 252,
+    "grey85": 253,
+    "grey89": 254,
+    "grey93": 255,
+}
+
+
+class ColorParseError(Exception):
+    """The color could not be parsed."""
+
+
+RE_COLOR = re.compile(
+    r"""^
+\#([0-9a-f]{6})$|
+color\(([0-9]{1,3})\)$|
+rgb\(([\d\s,]+)\)$
+""",
+    re.VERBOSE,
+)
+
+
+@rich_repr
+class Color(NamedTuple):
+    """Terminal color definition."""
+
+    name: str
+    """The name of the color (typically the input to Color.parse)."""
+    type: ColorType
+    """The type of the color."""
+    number: Optional[int] = None
+    """The color number, if a standard color, or None."""
+    triplet: Optional[ColorTriplet] = None
+    """A triplet of color components, if an RGB color."""
+
+    def __rich__(self) -> "Text":
+        """Dispays the actual color if Rich printed."""
+        from .text import Text
+        from .style import Style
+
+        return Text.assemble(
+            f"<color {self.name!r} ({self.type.name.lower()})",
+            ("⬤", Style(color=self)),
+            " >",
+        )
+
+    def __rich_repr__(self) -> Result:
+        yield self.name
+        yield self.type
+        yield "number", self.number, None
+        yield "triplet", self.triplet, None
+
+    @property
+    def system(self) -> ColorSystem:
+        """Get the native color system for this color."""
+        if self.type == ColorType.DEFAULT:
+            return ColorSystem.STANDARD
+        return ColorSystem(int(self.type))
+
+    @property
+    def is_system_defined(self) -> bool:
+        """Check if the color is ultimately defined by the system."""
+        return self.system not in (ColorSystem.EIGHT_BIT, ColorSystem.TRUECOLOR)
+
+    @property
+    def is_default(self) -> bool:
+        """Check if the color is a default color."""
+        return self.type == ColorType.DEFAULT
+
+    def get_truecolor(
+        self, theme: Optional["TerminalTheme"] = None, foreground: bool = True
+    ) -> ColorTriplet:
+        """Get an equivalent color triplet for this color.
+
+        Args:
+            theme (TerminalTheme, optional): Optional terminal theme, or None to use default. Defaults to None.
+            foreground (bool, optional): True for a foreground color, or False for background. Defaults to True.
+
+        Returns:
+            ColorTriplet: A color triplet containing RGB components.
+        """
+
+        if theme is None:
+            theme = DEFAULT_TERMINAL_THEME
+        if self.type == ColorType.TRUECOLOR:
+            assert self.triplet is not None
+            return self.triplet
+        elif self.type == ColorType.EIGHT_BIT:
+            assert self.number is not None
+            return EIGHT_BIT_PALETTE[self.number]
+        elif self.type == ColorType.STANDARD:
+            assert self.number is not None
+            return theme.ansi_colors[self.number]
+        elif self.type == ColorType.WINDOWS:
+            assert self.number is not None
+            return WINDOWS_PALETTE[self.number]
+        else:  # self.type == ColorType.DEFAULT:
+            assert self.number is None
+            return theme.foreground_color if foreground else theme.background_color
+
+    @classmethod
+    def from_ansi(cls, number: int) -> "Color":
+        """Create a Color number from it's 8-bit ansi number.
+
+        Args:
+            number (int): A number between 0-255 inclusive.
+
+        Returns:
+            Color: A new Color instance.
+        """
+        return cls(
+            name=f"color({number})",
+            type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),
+            number=number,
+        )
+
+    @classmethod
+    def from_triplet(cls, triplet: "ColorTriplet") -> "Color":
+        """Create a truecolor RGB color from a triplet of values.
+
+        Args:
+            triplet (ColorTriplet): A color triplet containing red, green and blue components.
+
+        Returns:
+            Color: A new color object.
+        """
+        return cls(name=triplet.hex, type=ColorType.TRUECOLOR, triplet=triplet)
+
+    @classmethod
+    def from_rgb(cls, red: float, green: float, blue: float) -> "Color":
+        """Create a truecolor from three color components in the range(0->255).
+
+        Args:
+            red (float): Red component in range 0-255.
+            green (float): Green component in range 0-255.
+            blue (float): Blue component in range 0-255.
+
+        Returns:
+            Color: A new color object.
+        """
+        return cls.from_triplet(ColorTriplet(int(red), int(green), int(blue)))
+
+    @classmethod
+    def default(cls) -> "Color":
+        """Get a Color instance representing the default color.
+
+        Returns:
+            Color: Default color.
+        """
+        return cls(name="default", type=ColorType.DEFAULT)
+
+    @classmethod
+    @lru_cache(maxsize=1024)
+    def parse(cls, color: str) -> "Color":
+        """Parse a color definition."""
+        original_color = color
+        color = color.lower().strip()
+
+        if color == "default":
+            return cls(color, type=ColorType.DEFAULT)
+
+        color_number = ANSI_COLOR_NAMES.get(color)
+        if color_number is not None:
+            return cls(
+                color,
+                type=(ColorType.STANDARD if color_number < 16 else ColorType.EIGHT_BIT),
+                number=color_number,
+            )
+
+        color_match = RE_COLOR.match(color)
+        if color_match is None:
+            raise ColorParseError(f"{original_color!r} is not a valid color")
+
+        color_24, color_8, color_rgb = color_match.groups()
+        if color_24:
+            triplet = ColorTriplet(
+                int(color_24[0:2], 16), int(color_24[2:4], 16), int(color_24[4:6], 16)
+            )
+            return cls(color, ColorType.TRUECOLOR, triplet=triplet)
+
+        elif color_8:
+            number = int(color_8)
+            if number > 255:
+                raise ColorParseError(f"color number must be <= 255 in {color!r}")
+            return cls(
+                color,
+                type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),
+                number=number,
+            )
+
+        else:  #  color_rgb:
+            components = color_rgb.split(",")
+            if len(components) != 3:
+                raise ColorParseError(
+                    f"expected three components in {original_color!r}"
+                )
+            red, green, blue = components
+            triplet = ColorTriplet(int(red), int(green), int(blue))
+            if not all(component <= 255 for component in triplet):
+                raise ColorParseError(
+                    f"color components must be <= 255 in {original_color!r}"
+                )
+            return cls(color, ColorType.TRUECOLOR, triplet=triplet)
+
+    @lru_cache(maxsize=1024)
+    def get_ansi_codes(self, foreground: bool = True) -> Tuple[str, ...]:
+        """Get the ANSI escape codes for this color."""
+        _type = self.type
+        if _type == ColorType.DEFAULT:
+            return ("39" if foreground else "49",)
+
+        elif _type == ColorType.WINDOWS:
+            number = self.number
+            assert number is not None
+            fore, back = (30, 40) if number < 8 else (82, 92)
+            return (str(fore + number if foreground else back + number),)
+
+        elif _type == ColorType.STANDARD:
+            number = self.number
+            assert number is not None
+            fore, back = (30, 40) if number < 8 else (82, 92)
+            return (str(fore + number if foreground else back + number),)
+
+        elif _type == ColorType.EIGHT_BIT:
+            assert self.number is not None
+            return ("38" if foreground else "48", "5", str(self.number))
+
+        else:  # self.standard == ColorStandard.TRUECOLOR:
+            assert self.triplet is not None
+            red, green, blue = self.triplet
+            return ("38" if foreground else "48", "2", str(red), str(green), str(blue))
+
+    @lru_cache(maxsize=1024)
+    def downgrade(self, system: ColorSystem) -> "Color":
+        """Downgrade a color system to a system with fewer colors."""
+
+        if self.type in [ColorType.DEFAULT, system]:
+            return self
+        # Convert to 8-bit color from truecolor color
+        if system == ColorSystem.EIGHT_BIT and self.system == ColorSystem.TRUECOLOR:
+            assert self.triplet is not None
+            red, green, blue = self.triplet.normalized
+            _h, l, s = rgb_to_hls(red, green, blue)
+            # If saturation is under 10% assume it is grayscale
+            if s < 0.1:
+                gray = round(l * 25.0)
+                if gray == 0:
+                    color_number = 16
+                elif gray == 25:
+                    color_number = 231
+                else:
+                    color_number = 231 + gray
+                return Color(self.name, ColorType.EIGHT_BIT, number=color_number)
+
+            color_number = (
+                16 + 36 * round(red * 5.0) + 6 * round(green * 5.0) + round(blue * 5.0)
+            )
+            return Color(self.name, ColorType.EIGHT_BIT, number=color_number)
+
+        # Convert to standard from truecolor or 8-bit
+        elif system == ColorSystem.STANDARD:
+            if self.system == ColorSystem.TRUECOLOR:
+                assert self.triplet is not None
+                triplet = self.triplet
+            else:  # self.system == ColorSystem.EIGHT_BIT
+                assert self.number is not None
+                triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])
+
+            color_number = STANDARD_PALETTE.match(triplet)
+            return Color(self.name, ColorType.STANDARD, number=color_number)
+
+        elif system == ColorSystem.WINDOWS:
+            if self.system == ColorSystem.TRUECOLOR:
+                assert self.triplet is not None
+                triplet = self.triplet
+            else:  # self.system == ColorSystem.EIGHT_BIT
+                assert self.number is not None
+                if self.number < 16:
+                    return Color(self.name, ColorType.WINDOWS, number=self.number)
+                triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])
+
+            color_number = WINDOWS_PALETTE.match(triplet)
+            return Color(self.name, ColorType.WINDOWS, number=color_number)
+
+        return self
+
+
+def parse_rgb_hex(hex_color: str) -> ColorTriplet:
+    """Parse six hex characters in to RGB triplet."""
+    assert len(hex_color) == 6, "must be 6 characters"
+    color = ColorTriplet(
+        int(hex_color[0:2], 16), int(hex_color[2:4], 16), int(hex_color[4:6], 16)
+    )
+    return color
+
+
+def blend_rgb(
+    color1: ColorTriplet, color2: ColorTriplet, cross_fade: float = 0.5
+) -> ColorTriplet:
+    """Blend one RGB color in to another."""
+    r1, g1, b1 = color1
+    r2, g2, b2 = color2
+    new_color = ColorTriplet(
+        int(r1 + (r2 - r1) * cross_fade),
+        int(g1 + (g2 - g1) * cross_fade),
+        int(b1 + (b2 - b1) * cross_fade),
+    )
+    return new_color
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from .console import Console
+    from .table import Table
+    from .text import Text
+
+    console = Console()
+
+    table = Table(show_footer=False, show_edge=True)
+    table.add_column("Color", width=10, overflow="ellipsis")
+    table.add_column("Number", justify="right", style="yellow")
+    table.add_column("Name", style="green")
+    table.add_column("Hex", style="blue")
+    table.add_column("RGB", style="magenta")
+
+    colors = sorted((v, k) for k, v in ANSI_COLOR_NAMES.items())
+    for color_number, name in colors:
+        color_cell = Text(" " * 10, style=f"on {name}")
+        if color_number < 16:
+            table.add_row(color_cell, f"{color_number}", Text(f'"{name}"'))
+        else:
+            color = EIGHT_BIT_PALETTE[color_number]  # type: ignore
+            table.add_row(
+                color_cell, str(color_number), Text(f'"{name}"'), color.hex, color.rgb
+            )
+
+    console.print(table)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/color_triplet.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/color_triplet.py
new file mode 100644
index 0000000000000000000000000000000000000000..02cab328251af9bfa809981aaa44933c407e2cd7
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/color_triplet.py
@@ -0,0 +1,38 @@
+from typing import NamedTuple, Tuple
+
+
+class ColorTriplet(NamedTuple):
+    """The red, green, and blue components of a color."""
+
+    red: int
+    """Red component in 0 to 255 range."""
+    green: int
+    """Green component in 0 to 255 range."""
+    blue: int
+    """Blue component in 0 to 255 range."""
+
+    @property
+    def hex(self) -> str:
+        """get the color triplet in CSS style."""
+        red, green, blue = self
+        return f"#{red:02x}{green:02x}{blue:02x}"
+
+    @property
+    def rgb(self) -> str:
+        """The color in RGB format.
+
+        Returns:
+            str: An rgb color, e.g. ``"rgb(100,23,255)"``.
+        """
+        red, green, blue = self
+        return f"rgb({red},{green},{blue})"
+
+    @property
+    def normalized(self) -> Tuple[float, float, float]:
+        """Convert components into floats between 0 and 1.
+
+        Returns:
+            Tuple[float, float, float]: A tuple of three normalized colour components.
+        """
+        red, green, blue = self
+        return red / 255.0, green / 255.0, blue / 255.0
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/columns.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/columns.py
new file mode 100644
index 0000000000000000000000000000000000000000..669a3a7074f9a9e1af29cb4bc78b05851df67959
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/columns.py
@@ -0,0 +1,187 @@
+from collections import defaultdict
+from itertools import chain
+from operator import itemgetter
+from typing import Dict, Iterable, List, Optional, Tuple
+
+from .align import Align, AlignMethod
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .constrain import Constrain
+from .measure import Measurement
+from .padding import Padding, PaddingDimensions
+from .table import Table
+from .text import TextType
+from .jupyter import JupyterMixin
+
+
+class Columns(JupyterMixin):
+    """Display renderables in neat columns.
+
+    Args:
+        renderables (Iterable[RenderableType]): Any number of Rich renderables (including str).
+        width (int, optional): The desired width of the columns, or None to auto detect. Defaults to None.
+        padding (PaddingDimensions, optional): Optional padding around cells. Defaults to (0, 1).
+        expand (bool, optional): Expand columns to full width. Defaults to False.
+        equal (bool, optional): Arrange in to equal sized columns. Defaults to False.
+        column_first (bool, optional): Align items from top to bottom (rather than left to right). Defaults to False.
+        right_to_left (bool, optional): Start column from right hand side. Defaults to False.
+        align (str, optional): Align value ("left", "right", or "center") or None for default. Defaults to None.
+        title (TextType, optional): Optional title for Columns.
+    """
+
+    def __init__(
+        self,
+        renderables: Optional[Iterable[RenderableType]] = None,
+        padding: PaddingDimensions = (0, 1),
+        *,
+        width: Optional[int] = None,
+        expand: bool = False,
+        equal: bool = False,
+        column_first: bool = False,
+        right_to_left: bool = False,
+        align: Optional[AlignMethod] = None,
+        title: Optional[TextType] = None,
+    ) -> None:
+        self.renderables = list(renderables or [])
+        self.width = width
+        self.padding = padding
+        self.expand = expand
+        self.equal = equal
+        self.column_first = column_first
+        self.right_to_left = right_to_left
+        self.align: Optional[AlignMethod] = align
+        self.title = title
+
+    def add_renderable(self, renderable: RenderableType) -> None:
+        """Add a renderable to the columns.
+
+        Args:
+            renderable (RenderableType): Any renderable object.
+        """
+        self.renderables.append(renderable)
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        render_str = console.render_str
+        renderables = [
+            render_str(renderable) if isinstance(renderable, str) else renderable
+            for renderable in self.renderables
+        ]
+        if not renderables:
+            return
+        _top, right, _bottom, left = Padding.unpack(self.padding)
+        width_padding = max(left, right)
+        max_width = options.max_width
+        widths: Dict[int, int] = defaultdict(int)
+        column_count = len(renderables)
+
+        get_measurement = Measurement.get
+        renderable_widths = [
+            get_measurement(console, options, renderable).maximum
+            for renderable in renderables
+        ]
+        if self.equal:
+            renderable_widths = [max(renderable_widths)] * len(renderable_widths)
+
+        def iter_renderables(
+            column_count: int,
+        ) -> Iterable[Tuple[int, Optional[RenderableType]]]:
+            item_count = len(renderables)
+            if self.column_first:
+                width_renderables = list(zip(renderable_widths, renderables))
+
+                column_lengths: List[int] = [item_count // column_count] * column_count
+                for col_no in range(item_count % column_count):
+                    column_lengths[col_no] += 1
+
+                row_count = (item_count + column_count - 1) // column_count
+                cells = [[-1] * column_count for _ in range(row_count)]
+                row = col = 0
+                for index in range(item_count):
+                    cells[row][col] = index
+                    column_lengths[col] -= 1
+                    if column_lengths[col]:
+                        row += 1
+                    else:
+                        col += 1
+                        row = 0
+                for index in chain.from_iterable(cells):
+                    if index == -1:
+                        break
+                    yield width_renderables[index]
+            else:
+                yield from zip(renderable_widths, renderables)
+            # Pad odd elements with spaces
+            if item_count % column_count:
+                for _ in range(column_count - (item_count % column_count)):
+                    yield 0, None
+
+        table = Table.grid(padding=self.padding, collapse_padding=True, pad_edge=False)
+        table.expand = self.expand
+        table.title = self.title
+
+        if self.width is not None:
+            column_count = (max_width) // (self.width + width_padding)
+            for _ in range(column_count):
+                table.add_column(width=self.width)
+        else:
+            while column_count > 1:
+                widths.clear()
+                column_no = 0
+                for renderable_width, _ in iter_renderables(column_count):
+                    widths[column_no] = max(widths[column_no], renderable_width)
+                    total_width = sum(widths.values()) + width_padding * (
+                        len(widths) - 1
+                    )
+                    if total_width > max_width:
+                        column_count = len(widths) - 1
+                        break
+                    else:
+                        column_no = (column_no + 1) % column_count
+                else:
+                    break
+
+        get_renderable = itemgetter(1)
+        _renderables = [
+            get_renderable(_renderable)
+            for _renderable in iter_renderables(column_count)
+        ]
+        if self.equal:
+            _renderables = [
+                None
+                if renderable is None
+                else Constrain(renderable, renderable_widths[0])
+                for renderable in _renderables
+            ]
+        if self.align:
+            align = self.align
+            _Align = Align
+            _renderables = [
+                None if renderable is None else _Align(renderable, align)
+                for renderable in _renderables
+            ]
+
+        right_to_left = self.right_to_left
+        add_row = table.add_row
+        for start in range(0, len(_renderables), column_count):
+            row = _renderables[start : start + column_count]
+            if right_to_left:
+                row = row[::-1]
+            add_row(*row)
+        yield table
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import os
+
+    console = Console()
+
+    files = [f"{i} {s}" for i, s in enumerate(sorted(os.listdir()))]
+    columns = Columns(files, padding=(0, 1), expand=False, equal=False)
+    console.print(columns)
+    console.rule()
+    columns.column_first = True
+    console.print(columns)
+    columns.right_to_left = True
+    console.rule()
+    console.print(columns)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/console.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/console.py
new file mode 100644
index 0000000000000000000000000000000000000000..27e722760ffa94f03f21fa1b0a715dc2ca5ccbe3
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/console.py
@@ -0,0 +1,2211 @@
+import inspect
+import os
+import platform
+import sys
+import threading
+from abc import ABC, abstractmethod
+from dataclasses import dataclass, field
+from datetime import datetime
+from functools import wraps
+from getpass import getpass
+from html import escape
+from inspect import isclass
+from itertools import islice
+from threading import RLock
+from time import monotonic
+from types import FrameType, ModuleType, TracebackType
+from typing import (
+    IO,
+    TYPE_CHECKING,
+    Any,
+    Callable,
+    Dict,
+    Iterable,
+    List,
+    Mapping,
+    NamedTuple,
+    Optional,
+    TextIO,
+    Tuple,
+    Type,
+    Union,
+    cast,
+)
+
+if sys.version_info >= (3, 8):
+    from typing import Literal, Protocol, runtime_checkable
+else:
+    from pip._vendor.typing_extensions import (
+        Literal,
+        Protocol,
+        runtime_checkable,
+    )  # pragma: no cover
+
+from . import errors, themes
+from ._emoji_replace import _emoji_replace
+from ._log_render import FormatTimeCallable, LogRender
+from .align import Align, AlignMethod
+from .color import ColorSystem
+from .control import Control
+from .emoji import EmojiVariant
+from .highlighter import NullHighlighter, ReprHighlighter
+from .markup import render as render_markup
+from .measure import Measurement, measure_renderables
+from .pager import Pager, SystemPager
+from .pretty import Pretty, is_expandable
+from .protocol import rich_cast
+from .region import Region
+from .scope import render_scope
+from .screen import Screen
+from .segment import Segment
+from .style import Style, StyleType
+from .styled import Styled
+from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme
+from .text import Text, TextType
+from .theme import Theme, ThemeStack
+
+if TYPE_CHECKING:
+    from ._windows import WindowsConsoleFeatures
+    from .live import Live
+    from .status import Status
+
+WINDOWS = platform.system() == "Windows"
+
+HighlighterType = Callable[[Union[str, "Text"]], "Text"]
+JustifyMethod = Literal["default", "left", "center", "right", "full"]
+OverflowMethod = Literal["fold", "crop", "ellipsis", "ignore"]
+
+
+class NoChange:
+    pass
+
+
+NO_CHANGE = NoChange()
+
+
+CONSOLE_HTML_FORMAT = """\
+<!DOCTYPE html>
+<head>
+<meta charset="UTF-8">
+<style>
+{stylesheet}
+body {{
+    color: {foreground};
+    background-color: {background};
+}}
+</style>
+</head>
+<html>
+<body>
+    <code>
+        <pre style="font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre>
+    </code>
+</body>
+</html>
+"""
+
+_TERM_COLORS = {"256color": ColorSystem.EIGHT_BIT, "16color": ColorSystem.STANDARD}
+
+
+class ConsoleDimensions(NamedTuple):
+    """Size of the terminal."""
+
+    width: int
+    """The width of the console in 'cells'."""
+    height: int
+    """The height of the console in lines."""
+
+
+@dataclass
+class ConsoleOptions:
+    """Options for __rich_console__ method."""
+
+    size: ConsoleDimensions
+    """Size of console."""
+    legacy_windows: bool
+    """legacy_windows: flag for legacy windows."""
+    min_width: int
+    """Minimum width of renderable."""
+    max_width: int
+    """Maximum width of renderable."""
+    is_terminal: bool
+    """True if the target is a terminal, otherwise False."""
+    encoding: str
+    """Encoding of terminal."""
+    max_height: int
+    """Height of container (starts as terminal)"""
+    justify: Optional[JustifyMethod] = None
+    """Justify value override for renderable."""
+    overflow: Optional[OverflowMethod] = None
+    """Overflow value override for renderable."""
+    no_wrap: Optional[bool] = False
+    """Disable wrapping for text."""
+    highlight: Optional[bool] = None
+    """Highlight override for render_str."""
+    markup: Optional[bool] = None
+    """Enable markup when rendering strings."""
+    height: Optional[int] = None
+
+    @property
+    def ascii_only(self) -> bool:
+        """Check if renderables should use ascii only."""
+        return not self.encoding.startswith("utf")
+
+    def copy(self) -> "ConsoleOptions":
+        """Return a copy of the options.
+
+        Returns:
+            ConsoleOptions: a copy of self.
+        """
+        options: ConsoleOptions = ConsoleOptions.__new__(ConsoleOptions)
+        options.__dict__ = self.__dict__.copy()
+        return options
+
+    def update(
+        self,
+        *,
+        width: Union[int, NoChange] = NO_CHANGE,
+        min_width: Union[int, NoChange] = NO_CHANGE,
+        max_width: Union[int, NoChange] = NO_CHANGE,
+        justify: Union[Optional[JustifyMethod], NoChange] = NO_CHANGE,
+        overflow: Union[Optional[OverflowMethod], NoChange] = NO_CHANGE,
+        no_wrap: Union[Optional[bool], NoChange] = NO_CHANGE,
+        highlight: Union[Optional[bool], NoChange] = NO_CHANGE,
+        markup: Union[Optional[bool], NoChange] = NO_CHANGE,
+        height: Union[Optional[int], NoChange] = NO_CHANGE,
+    ) -> "ConsoleOptions":
+        """Update values, return a copy."""
+        options = self.copy()
+        if not isinstance(width, NoChange):
+            options.min_width = options.max_width = max(0, width)
+        if not isinstance(min_width, NoChange):
+            options.min_width = min_width
+        if not isinstance(max_width, NoChange):
+            options.max_width = max_width
+        if not isinstance(justify, NoChange):
+            options.justify = justify
+        if not isinstance(overflow, NoChange):
+            options.overflow = overflow
+        if not isinstance(no_wrap, NoChange):
+            options.no_wrap = no_wrap
+        if not isinstance(highlight, NoChange):
+            options.highlight = highlight
+        if not isinstance(markup, NoChange):
+            options.markup = markup
+        if not isinstance(height, NoChange):
+            if height is not None:
+                options.max_height = height
+            options.height = None if height is None else max(0, height)
+        return options
+
+    def update_width(self, width: int) -> "ConsoleOptions":
+        """Update just the width, return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width)
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        return options
+
+    def update_height(self, height: int) -> "ConsoleOptions":
+        """Update the height, and return a copy.
+
+        Args:
+            height (int): New height
+
+        Returns:
+            ~ConsoleOptions: New Console options instance.
+        """
+        options = self.copy()
+        options.max_height = options.height = height
+        return options
+
+    def update_dimensions(self, width: int, height: int) -> "ConsoleOptions":
+        """Update the width and height, and return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width).
+            height (int): New height.
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        options.height = options.max_height = height
+        return options
+
+
+@runtime_checkable
+class RichCast(Protocol):
+    """An object that may be 'cast' to a console renderable."""
+
+    def __rich__(self) -> Union["ConsoleRenderable", str]:  # pragma: no cover
+        ...
+
+
+@runtime_checkable
+class ConsoleRenderable(Protocol):
+    """An object that supports the console protocol."""
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":  # pragma: no cover
+        ...
+
+
+# A type that may be rendered by Console.
+RenderableType = Union[ConsoleRenderable, RichCast, str]
+
+
+# The result of calling a __rich_console__ method.
+RenderResult = Iterable[Union[RenderableType, Segment]]
+
+
+_null_highlighter = NullHighlighter()
+
+
+class CaptureError(Exception):
+    """An error in the Capture context manager."""
+
+
+class NewLine:
+    """A renderable to generate new line(s)"""
+
+    def __init__(self, count: int = 1) -> None:
+        self.count = count
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Iterable[Segment]:
+        yield Segment("\n" * self.count)
+
+
+class ScreenUpdate:
+    """Render a list of lines at a given offset."""
+
+    def __init__(self, lines: List[List[Segment]], x: int, y: int) -> None:
+        self._lines = lines
+        self.x = x
+        self.y = y
+
+    def __rich_console__(
+        self, console: "Console", options: ConsoleOptions
+    ) -> RenderResult:
+        x = self.x
+        move_to = Control.move_to
+        for offset, line in enumerate(self._lines, self.y):
+            yield move_to(x, offset)
+            yield from line
+
+
+class Capture:
+    """Context manager to capture the result of printing to the console.
+    See :meth:`~rich.console.Console.capture` for how to use.
+
+    Args:
+        console (Console): A console instance to capture output.
+    """
+
+    def __init__(self, console: "Console") -> None:
+        self._console = console
+        self._result: Optional[str] = None
+
+    def __enter__(self) -> "Capture":
+        self._console.begin_capture()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self._result = self._console.end_capture()
+
+    def get(self) -> str:
+        """Get the result of the capture."""
+        if self._result is None:
+            raise CaptureError(
+                "Capture result is not available until context manager exits."
+            )
+        return self._result
+
+
+class ThemeContext:
+    """A context manager to use a temporary theme. See :meth:`~rich.console.Console.use_theme` for usage."""
+
+    def __init__(self, console: "Console", theme: Theme, inherit: bool = True) -> None:
+        self.console = console
+        self.theme = theme
+        self.inherit = inherit
+
+    def __enter__(self) -> "ThemeContext":
+        self.console.push_theme(self.theme)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.console.pop_theme()
+
+
+class PagerContext:
+    """A context manager that 'pages' content. See :meth:`~rich.console.Console.pager` for usage."""
+
+    def __init__(
+        self,
+        console: "Console",
+        pager: Optional[Pager] = None,
+        styles: bool = False,
+        links: bool = False,
+    ) -> None:
+        self._console = console
+        self.pager = SystemPager() if pager is None else pager
+        self.styles = styles
+        self.links = links
+
+    def __enter__(self) -> "PagerContext":
+        self._console._enter_buffer()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if exc_type is None:
+            with self._console._lock:
+                buffer: List[Segment] = self._console._buffer[:]
+                del self._console._buffer[:]
+                segments: Iterable[Segment] = buffer
+                if not self.styles:
+                    segments = Segment.strip_styles(segments)
+                elif not self.links:
+                    segments = Segment.strip_links(segments)
+                content = self._console._render_buffer(segments)
+            self.pager.show(content)
+        self._console._exit_buffer()
+
+
+class ScreenContext:
+    """A context manager that enables an alternative screen. See :meth:`~rich.console.Console.screen` for usage."""
+
+    def __init__(
+        self, console: "Console", hide_cursor: bool, style: StyleType = ""
+    ) -> None:
+        self.console = console
+        self.hide_cursor = hide_cursor
+        self.screen = Screen(style=style)
+        self._changed = False
+
+    def update(
+        self, *renderables: RenderableType, style: Optional[StyleType] = None
+    ) -> None:
+        """Update the screen.
+
+        Args:
+            renderable (RenderableType, optional): Optional renderable to replace current renderable,
+                or None for no change. Defaults to None.
+            style: (Style, optional): Replacement style, or None for no change. Defaults to None.
+        """
+        if renderables:
+            self.screen.renderable = (
+                Group(*renderables) if len(renderables) > 1 else renderables[0]
+            )
+        if style is not None:
+            self.screen.style = style
+        self.console.print(self.screen, end="")
+
+    def __enter__(self) -> "ScreenContext":
+        self._changed = self.console.set_alt_screen(True)
+        if self._changed and self.hide_cursor:
+            self.console.show_cursor(False)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if self._changed:
+            self.console.set_alt_screen(False)
+            if self.hide_cursor:
+                self.console.show_cursor(True)
+
+
+class Group:
+    """Takes a group of renderables and returns a renderable object that renders the group.
+
+    Args:
+        renderables (Iterable[RenderableType]): An iterable of renderable objects.
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def __init__(self, *renderables: "RenderableType", fit: bool = True) -> None:
+        self._renderables = renderables
+        self.fit = fit
+        self._render: Optional[List[RenderableType]] = None
+
+    @property
+    def renderables(self) -> List["RenderableType"]:
+        if self._render is None:
+            self._render = list(self._renderables)
+        return self._render
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.fit:
+            return measure_renderables(console, options, self.renderables)
+        else:
+            return Measurement(options.max_width, options.max_width)
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> RenderResult:
+        yield from self.renderables
+
+
+def group(fit: bool = True) -> Callable[..., Callable[..., Group]]:
+    """A decorator that turns an iterable of renderables in to a group.
+
+    Args:
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def decorator(
+        method: Callable[..., Iterable[RenderableType]]
+    ) -> Callable[..., Group]:
+        """Convert a method that returns an iterable of renderables in to a Group."""
+
+        @wraps(method)
+        def _replace(*args: Any, **kwargs: Any) -> Group:
+            renderables = method(*args, **kwargs)
+            return Group(*renderables, fit=fit)
+
+        return _replace
+
+    return decorator
+
+
+def _is_jupyter() -> bool:  # pragma: no cover
+    """Check if we're running in a Jupyter notebook."""
+    try:
+        get_ipython  # type: ignore
+    except NameError:
+        return False
+    ipython = get_ipython()  # type: ignore
+    shell = ipython.__class__.__name__
+    if "google.colab" in str(ipython.__class__) or shell == "ZMQInteractiveShell":
+        return True  # Jupyter notebook or qtconsole
+    elif shell == "TerminalInteractiveShell":
+        return False  # Terminal running IPython
+    else:
+        return False  # Other type (?)
+
+
+COLOR_SYSTEMS = {
+    "standard": ColorSystem.STANDARD,
+    "256": ColorSystem.EIGHT_BIT,
+    "truecolor": ColorSystem.TRUECOLOR,
+    "windows": ColorSystem.WINDOWS,
+}
+
+
+_COLOR_SYSTEMS_NAMES = {system: name for name, system in COLOR_SYSTEMS.items()}
+
+
+@dataclass
+class ConsoleThreadLocals(threading.local):
+    """Thread local values for Console context."""
+
+    theme_stack: ThemeStack
+    buffer: List[Segment] = field(default_factory=list)
+    buffer_index: int = 0
+
+
+class RenderHook(ABC):
+    """Provides hooks in to the render process."""
+
+    @abstractmethod
+    def process_renderables(
+        self, renderables: List[ConsoleRenderable]
+    ) -> List[ConsoleRenderable]:
+        """Called with a list of objects to render.
+
+        This method can return a new list of renderables, or modify and return the same list.
+
+        Args:
+            renderables (List[ConsoleRenderable]): A number of renderable objects.
+
+        Returns:
+            List[ConsoleRenderable]: A replacement list of renderables.
+        """
+
+
+_windows_console_features: Optional["WindowsConsoleFeatures"] = None
+
+
+def get_windows_console_features() -> "WindowsConsoleFeatures":  # pragma: no cover
+    global _windows_console_features
+    if _windows_console_features is not None:
+        return _windows_console_features
+    from ._windows import get_windows_console_features
+
+    _windows_console_features = get_windows_console_features()
+    return _windows_console_features
+
+
+def detect_legacy_windows() -> bool:
+    """Detect legacy Windows."""
+    return WINDOWS and not get_windows_console_features().vt
+
+
+if detect_legacy_windows():  # pragma: no cover
+    from pip._vendor.colorama import init
+
+    init(strip=False)
+
+
+class Console:
+    """A high level console interface.
+
+    Args:
+        color_system (str, optional): The color system supported by your terminal,
+            either ``"standard"``, ``"256"`` or ``"truecolor"``. Leave as ``"auto"`` to autodetect.
+        force_terminal (Optional[bool], optional): Enable/disable terminal control codes, or None to auto-detect terminal. Defaults to None.
+        force_jupyter (Optional[bool], optional): Enable/disable Jupyter rendering, or None to auto-detect Jupyter. Defaults to None.
+        force_interactive (Optional[bool], optional): Enable/disable interactive mode, or None to auto detect. Defaults to None.
+        soft_wrap (Optional[bool], optional): Set soft wrap default on print method. Defaults to False.
+        theme (Theme, optional): An optional style theme object, or ``None`` for default theme.
+        stderr (bool, optional): Use stderr rather than stdout if ``file`` is not specified. Defaults to False.
+        file (IO, optional): A file object where the console should write to. Defaults to stdout.
+        quiet (bool, Optional): Boolean to suppress all output. Defaults to False.
+        width (int, optional): The width of the terminal. Leave as default to auto-detect width.
+        height (int, optional): The height of the terminal. Leave as default to auto-detect height.
+        style (StyleType, optional): Style to apply to all output, or None for no style. Defaults to None.
+        no_color (Optional[bool], optional): Enabled no color mode, or None to auto detect. Defaults to None.
+        tab_size (int, optional): Number of spaces used to replace a tab character. Defaults to 8.
+        record (bool, optional): Boolean to enable recording of terminal output,
+            required to call :meth:`export_html` and :meth:`export_text`. Defaults to False.
+        markup (bool, optional): Boolean to enable :ref:`console_markup`. Defaults to True.
+        emoji (bool, optional): Enable emoji code. Defaults to True.
+        emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None.
+        highlight (bool, optional): Enable automatic highlighting. Defaults to True.
+        log_time (bool, optional): Boolean to enable logging of time by :meth:`log` methods. Defaults to True.
+        log_path (bool, optional): Boolean to enable the logging of the caller by :meth:`log`. Defaults to True.
+        log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%X] ".
+        highlighter (HighlighterType, optional): Default highlighter.
+        legacy_windows (bool, optional): Enable legacy Windows mode, or ``None`` to auto detect. Defaults to ``None``.
+        safe_box (bool, optional): Restrict box options that don't render on legacy Windows.
+        get_datetime (Callable[[], datetime], optional): Callable that gets the current time as a datetime.datetime object (used by Console.log),
+            or None for datetime.now.
+        get_time (Callable[[], time], optional): Callable that gets the current time in seconds, default uses time.monotonic.
+    """
+
+    _environ: Mapping[str, str] = os.environ
+
+    def __init__(
+        self,
+        *,
+        color_system: Optional[
+            Literal["auto", "standard", "256", "truecolor", "windows"]
+        ] = "auto",
+        force_terminal: Optional[bool] = None,
+        force_jupyter: Optional[bool] = None,
+        force_interactive: Optional[bool] = None,
+        soft_wrap: bool = False,
+        theme: Optional[Theme] = None,
+        stderr: bool = False,
+        file: Optional[IO[str]] = None,
+        quiet: bool = False,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        style: Optional[StyleType] = None,
+        no_color: Optional[bool] = None,
+        tab_size: int = 8,
+        record: bool = False,
+        markup: bool = True,
+        emoji: bool = True,
+        emoji_variant: Optional[EmojiVariant] = None,
+        highlight: bool = True,
+        log_time: bool = True,
+        log_path: bool = True,
+        log_time_format: Union[str, FormatTimeCallable] = "[%X]",
+        highlighter: Optional["HighlighterType"] = ReprHighlighter(),
+        legacy_windows: Optional[bool] = None,
+        safe_box: bool = True,
+        get_datetime: Optional[Callable[[], datetime]] = None,
+        get_time: Optional[Callable[[], float]] = None,
+        _environ: Optional[Mapping[str, str]] = None,
+    ):
+        # Copy of os.environ allows us to replace it for testing
+        if _environ is not None:
+            self._environ = _environ
+
+        self.is_jupyter = _is_jupyter() if force_jupyter is None else force_jupyter
+        if self.is_jupyter:
+            width = width or 93
+            height = height or 100
+
+        self.soft_wrap = soft_wrap
+        self._width = width
+        self._height = height
+        self.tab_size = tab_size
+        self.record = record
+        self._markup = markup
+        self._emoji = emoji
+        self._emoji_variant: Optional[EmojiVariant] = emoji_variant
+        self._highlight = highlight
+        self.legacy_windows: bool = (
+            (detect_legacy_windows() and not self.is_jupyter)
+            if legacy_windows is None
+            else legacy_windows
+        )
+        if width is None:
+            columns = self._environ.get("COLUMNS")
+            if columns is not None and columns.isdigit():
+                width = int(columns) - self.legacy_windows
+        if height is None:
+            lines = self._environ.get("LINES")
+            if lines is not None and lines.isdigit():
+                height = int(lines)
+
+        self.soft_wrap = soft_wrap
+        self._width = width
+        self._height = height
+
+        self._color_system: Optional[ColorSystem]
+        self._force_terminal = force_terminal
+        self._file = file
+        self.quiet = quiet
+        self.stderr = stderr
+
+        if color_system is None:
+            self._color_system = None
+        elif color_system == "auto":
+            self._color_system = self._detect_color_system()
+        else:
+            self._color_system = COLOR_SYSTEMS[color_system]
+
+        self._lock = threading.RLock()
+        self._log_render = LogRender(
+            show_time=log_time,
+            show_path=log_path,
+            time_format=log_time_format,
+        )
+        self.highlighter: HighlighterType = highlighter or _null_highlighter
+        self.safe_box = safe_box
+        self.get_datetime = get_datetime or datetime.now
+        self.get_time = get_time or monotonic
+        self.style = style
+        self.no_color = (
+            no_color if no_color is not None else "NO_COLOR" in self._environ
+        )
+        self.is_interactive = (
+            (self.is_terminal and not self.is_dumb_terminal)
+            if force_interactive is None
+            else force_interactive
+        )
+
+        self._record_buffer_lock = threading.RLock()
+        self._thread_locals = ConsoleThreadLocals(
+            theme_stack=ThemeStack(themes.DEFAULT if theme is None else theme)
+        )
+        self._record_buffer: List[Segment] = []
+        self._render_hooks: List[RenderHook] = []
+        self._live: Optional["Live"] = None
+        self._is_alt_screen = False
+
+    def __repr__(self) -> str:
+        return f"<console width={self.width} {str(self._color_system)}>"
+
+    @property
+    def file(self) -> IO[str]:
+        """Get the file object to write to."""
+        file = self._file or (sys.stderr if self.stderr else sys.stdout)
+        file = getattr(file, "rich_proxied_file", file)
+        return file
+
+    @file.setter
+    def file(self, new_file: IO[str]) -> None:
+        """Set a new file object."""
+        self._file = new_file
+
+    @property
+    def _buffer(self) -> List[Segment]:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer
+
+    @property
+    def _buffer_index(self) -> int:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer_index
+
+    @_buffer_index.setter
+    def _buffer_index(self, value: int) -> None:
+        self._thread_locals.buffer_index = value
+
+    @property
+    def _theme_stack(self) -> ThemeStack:
+        """Get the thread local theme stack."""
+        return self._thread_locals.theme_stack
+
+    def _detect_color_system(self) -> Optional[ColorSystem]:
+        """Detect color system from env vars."""
+        if self.is_jupyter:
+            return ColorSystem.TRUECOLOR
+        if not self.is_terminal or self.is_dumb_terminal:
+            return None
+        if WINDOWS:  # pragma: no cover
+            if self.legacy_windows:  # pragma: no cover
+                return ColorSystem.WINDOWS
+            windows_console_features = get_windows_console_features()
+            return (
+                ColorSystem.TRUECOLOR
+                if windows_console_features.truecolor
+                else ColorSystem.EIGHT_BIT
+            )
+        else:
+            color_term = self._environ.get("COLORTERM", "").strip().lower()
+            if color_term in ("truecolor", "24bit"):
+                return ColorSystem.TRUECOLOR
+            term = self._environ.get("TERM", "").strip().lower()
+            _term_name, _hyphen, colors = term.rpartition("-")
+            color_system = _TERM_COLORS.get(colors, ColorSystem.STANDARD)
+            return color_system
+
+    def _enter_buffer(self) -> None:
+        """Enter in to a buffer context, and buffer all output."""
+        self._buffer_index += 1
+
+    def _exit_buffer(self) -> None:
+        """Leave buffer context, and render content if required."""
+        self._buffer_index -= 1
+        self._check_buffer()
+
+    def set_live(self, live: "Live") -> None:
+        """Set Live instance. Used by Live context manager.
+
+        Args:
+            live (Live): Live instance using this Console.
+
+        Raises:
+            errors.LiveError: If this Console has a Live context currently active.
+        """
+        with self._lock:
+            if self._live is not None:
+                raise errors.LiveError("Only one live display may be active at once")
+            self._live = live
+
+    def clear_live(self) -> None:
+        """Clear the Live instance."""
+        with self._lock:
+            self._live = None
+
+    def push_render_hook(self, hook: RenderHook) -> None:
+        """Add a new render hook to the stack.
+
+        Args:
+            hook (RenderHook): Render hook instance.
+        """
+        with self._lock:
+            self._render_hooks.append(hook)
+
+    def pop_render_hook(self) -> None:
+        """Pop the last renderhook from the stack."""
+        with self._lock:
+            self._render_hooks.pop()
+
+    def __enter__(self) -> "Console":
+        """Own context manager to enter buffer context."""
+        self._enter_buffer()
+        return self
+
+    def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None:
+        """Exit buffer context."""
+        self._exit_buffer()
+
+    def begin_capture(self) -> None:
+        """Begin capturing console output. Call :meth:`end_capture` to exit capture mode and return output."""
+        self._enter_buffer()
+
+    def end_capture(self) -> str:
+        """End capture mode and return captured string.
+
+        Returns:
+            str: Console output.
+        """
+        render_result = self._render_buffer(self._buffer)
+        del self._buffer[:]
+        self._exit_buffer()
+        return render_result
+
+    def push_theme(self, theme: Theme, *, inherit: bool = True) -> None:
+        """Push a new theme on to the top of the stack, replacing the styles from the previous theme.
+        Generally speaking, you should call :meth:`~rich.console.Console.use_theme` to get a context manager, rather
+        than calling this method directly.
+
+        Args:
+            theme (Theme): A theme instance.
+            inherit (bool, optional): Inherit existing styles. Defaults to True.
+        """
+        self._theme_stack.push_theme(theme, inherit=inherit)
+
+    def pop_theme(self) -> None:
+        """Remove theme from top of stack, restoring previous theme."""
+        self._theme_stack.pop_theme()
+
+    def use_theme(self, theme: Theme, *, inherit: bool = True) -> ThemeContext:
+        """Use a different theme for the duration of the context manager.
+
+        Args:
+            theme (Theme): Theme instance to user.
+            inherit (bool, optional): Inherit existing console styles. Defaults to True.
+
+        Returns:
+            ThemeContext: [description]
+        """
+        return ThemeContext(self, theme, inherit)
+
+    @property
+    def color_system(self) -> Optional[str]:
+        """Get color system string.
+
+        Returns:
+            Optional[str]: "standard", "256" or "truecolor".
+        """
+
+        if self._color_system is not None:
+            return _COLOR_SYSTEMS_NAMES[self._color_system]
+        else:
+            return None
+
+    @property
+    def encoding(self) -> str:
+        """Get the encoding of the console file, e.g. ``"utf-8"``.
+
+        Returns:
+            str: A standard encoding string.
+        """
+        return (getattr(self.file, "encoding", "utf-8") or "utf-8").lower()
+
+    @property
+    def is_terminal(self) -> bool:
+        """Check if the console is writing to a terminal.
+
+        Returns:
+            bool: True if the console writing to a device capable of
+            understanding terminal codes, otherwise False.
+        """
+        if self._force_terminal is not None:
+            return self._force_terminal
+        isatty: Optional[Callable[[], bool]] = getattr(self.file, "isatty", None)
+        try:
+            return False if isatty is None else isatty()
+        except ValueError:
+            # in some situation (at the end of a pytest run for example) isatty() can raise
+            # ValueError: I/O operation on closed file
+            # return False because we aren't in a terminal anymore
+            return False
+
+    @property
+    def is_dumb_terminal(self) -> bool:
+        """Detect dumb terminal.
+
+        Returns:
+            bool: True if writing to a dumb terminal, otherwise False.
+
+        """
+        _term = self._environ.get("TERM", "")
+        is_dumb = _term.lower() in ("dumb", "unknown")
+        return self.is_terminal and is_dumb
+
+    @property
+    def options(self) -> ConsoleOptions:
+        """Get default console options."""
+        return ConsoleOptions(
+            max_height=self.size.height,
+            size=self.size,
+            legacy_windows=self.legacy_windows,
+            min_width=1,
+            max_width=self.width,
+            encoding=self.encoding,
+            is_terminal=self.is_terminal,
+        )
+
+    @property
+    def size(self) -> ConsoleDimensions:
+        """Get the size of the console.
+
+        Returns:
+            ConsoleDimensions: A named tuple containing the dimensions.
+        """
+
+        if self._width is not None and self._height is not None:
+            return ConsoleDimensions(self._width - self.legacy_windows, self._height)
+
+        if self.is_dumb_terminal:
+            return ConsoleDimensions(80, 25)
+
+        width: Optional[int] = None
+        height: Optional[int] = None
+
+        if WINDOWS:  # pragma: no cover
+            try:
+                width, height = os.get_terminal_size()
+            except OSError:  # Probably not a terminal
+                pass
+        else:
+            try:
+                width, height = os.get_terminal_size(sys.__stdin__.fileno())
+            except (AttributeError, ValueError, OSError):
+                try:
+                    width, height = os.get_terminal_size(sys.__stdout__.fileno())
+                except (AttributeError, ValueError, OSError):
+                    pass
+
+        columns = self._environ.get("COLUMNS")
+        if columns is not None and columns.isdigit():
+            width = int(columns)
+        lines = self._environ.get("LINES")
+        if lines is not None and lines.isdigit():
+            height = int(lines)
+
+        # get_terminal_size can report 0, 0 if run from pseudo-terminal
+        width = width or 80
+        height = height or 25
+        return ConsoleDimensions(
+            width - self.legacy_windows if self._width is None else self._width,
+            height if self._height is None else self._height,
+        )
+
+    @size.setter
+    def size(self, new_size: Tuple[int, int]) -> None:
+        """Set a new size for the terminal.
+
+        Args:
+            new_size (Tuple[int, int]): New width and height.
+        """
+        width, height = new_size
+        self._width = width
+        self._height = height
+
+    @property
+    def width(self) -> int:
+        """Get the width of the console.
+
+        Returns:
+            int: The width (in characters) of the console.
+        """
+        return self.size.width
+
+    @width.setter
+    def width(self, width: int) -> None:
+        """Set width.
+
+        Args:
+            width (int): New width.
+        """
+        self._width = width
+
+    @property
+    def height(self) -> int:
+        """Get the height of the console.
+
+        Returns:
+            int: The height (in lines) of the console.
+        """
+        return self.size.height
+
+    @height.setter
+    def height(self, height: int) -> None:
+        """Set height.
+
+        Args:
+            height (int): new height.
+        """
+        self._height = height
+
+    def bell(self) -> None:
+        """Play a 'bell' sound (if supported by the terminal)."""
+        self.control(Control.bell())
+
+    def capture(self) -> Capture:
+        """A context manager to *capture* the result of print() or log() in a string,
+        rather than writing it to the console.
+
+        Example:
+            >>> from rich.console import Console
+            >>> console = Console()
+            >>> with console.capture() as capture:
+            ...     console.print("[bold magenta]Hello World[/]")
+            >>> print(capture.get())
+
+        Returns:
+            Capture: Context manager with disables writing to the terminal.
+        """
+        capture = Capture(self)
+        return capture
+
+    def pager(
+        self, pager: Optional[Pager] = None, styles: bool = False, links: bool = False
+    ) -> PagerContext:
+        """A context manager to display anything printed within a "pager". The pager application
+        is defined by the system and will typically support at least pressing a key to scroll.
+
+        Args:
+            pager (Pager, optional): A pager object, or None to use :class:`~rich.pager.SystemPager`. Defaults to None.
+            styles (bool, optional): Show styles in pager. Defaults to False.
+            links (bool, optional): Show links in pager. Defaults to False.
+
+        Example:
+            >>> from rich.console import Console
+            >>> from rich.__main__ import make_test_card
+            >>> console = Console()
+            >>> with console.pager():
+                    console.print(make_test_card())
+
+        Returns:
+            PagerContext: A context manager.
+        """
+        return PagerContext(self, pager=pager, styles=styles, links=links)
+
+    def line(self, count: int = 1) -> None:
+        """Write new line(s).
+
+        Args:
+            count (int, optional): Number of new lines. Defaults to 1.
+        """
+
+        assert count >= 0, "count must be >= 0"
+        self.print(NewLine(count))
+
+    def clear(self, home: bool = True) -> None:
+        """Clear the screen.
+
+        Args:
+            home (bool, optional): Also move the cursor to 'home' position. Defaults to True.
+        """
+        if home:
+            self.control(Control.clear(), Control.home())
+        else:
+            self.control(Control.clear())
+
+    def status(
+        self,
+        status: RenderableType,
+        *,
+        spinner: str = "dots",
+        spinner_style: str = "status.spinner",
+        speed: float = 1.0,
+        refresh_per_second: float = 12.5,
+    ) -> "Status":
+        """Display a status and spinner.
+
+        Args:
+            status (RenderableType): A status renderable (str or Text typically).
+            spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots".
+            spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner".
+            speed (float, optional): Speed factor for spinner animation. Defaults to 1.0.
+            refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5.
+
+        Returns:
+            Status: A Status object that may be used as a context manager.
+        """
+        from .status import Status
+
+        status_renderable = Status(
+            status,
+            console=self,
+            spinner=spinner,
+            spinner_style=spinner_style,
+            speed=speed,
+            refresh_per_second=refresh_per_second,
+        )
+        return status_renderable
+
+    def show_cursor(self, show: bool = True) -> bool:
+        """Show or hide the cursor.
+
+        Args:
+            show (bool, optional): Set visibility of the cursor.
+        """
+        if self.is_terminal and not self.legacy_windows:
+            self.control(Control.show_cursor(show))
+            return True
+        return False
+
+    def set_alt_screen(self, enable: bool = True) -> bool:
+        """Enables alternative screen mode.
+
+        Note, if you enable this mode, you should ensure that is disabled before
+        the application exits. See :meth:`~rich.Console.screen` for a context manager
+        that handles this for you.
+
+        Args:
+            enable (bool, optional): Enable (True) or disable (False) alternate screen. Defaults to True.
+
+        Returns:
+            bool: True if the control codes were written.
+
+        """
+        changed = False
+        if self.is_terminal and not self.legacy_windows:
+            self.control(Control.alt_screen(enable))
+            changed = True
+            self._is_alt_screen = enable
+        return changed
+
+    @property
+    def is_alt_screen(self) -> bool:
+        """Check if the alt screen was enabled.
+
+        Returns:
+            bool: True if the alt screen was enabled, otherwise False.
+        """
+        return self._is_alt_screen
+
+    def screen(
+        self, hide_cursor: bool = True, style: Optional[StyleType] = None
+    ) -> "ScreenContext":
+        """Context manager to enable and disable 'alternative screen' mode.
+
+        Args:
+            hide_cursor (bool, optional): Also hide the cursor. Defaults to False.
+            style (Style, optional): Optional style for screen. Defaults to None.
+
+        Returns:
+            ~ScreenContext: Context which enables alternate screen on enter, and disables it on exit.
+        """
+        return ScreenContext(self, hide_cursor=hide_cursor, style=style or "")
+
+    def measure(
+        self, renderable: RenderableType, *, options: Optional[ConsoleOptions] = None
+    ) -> Measurement:
+        """Measure a renderable. Returns a :class:`~rich.measure.Measurement` object which contains
+        information regarding the number of characters required to print the renderable.
+
+        Args:
+            renderable (RenderableType): Any renderable or string.
+            options (Optional[ConsoleOptions], optional): Options to use when measuring, or None
+                to use default options. Defaults to None.
+
+        Returns:
+            Measurement: A measurement of the renderable.
+        """
+        measurement = Measurement.get(self, options or self.options, renderable)
+        return measurement
+
+    def render(
+        self, renderable: RenderableType, options: Optional[ConsoleOptions] = None
+    ) -> Iterable[Segment]:
+        """Render an object in to an iterable of `Segment` instances.
+
+        This method contains the logic for rendering objects with the console protocol.
+        You are unlikely to need to use it directly, unless you are extending the library.
+
+        Args:
+            renderable (RenderableType): An object supporting the console protocol, or
+                an object that may be converted to a string.
+            options (ConsoleOptions, optional): An options object, or None to use self.options. Defaults to None.
+
+        Returns:
+            Iterable[Segment]: An iterable of segments that may be rendered.
+        """
+
+        _options = options or self.options
+        if _options.max_width < 1:
+            # No space to render anything. This prevents potential recursion errors.
+            return
+        render_iterable: RenderResult
+
+        renderable = rich_cast(renderable)
+        if hasattr(renderable, "__rich_console__") and not isclass(renderable):
+            render_iterable = renderable.__rich_console__(self, _options)  # type: ignore
+        elif isinstance(renderable, str):
+            text_renderable = self.render_str(
+                renderable, highlight=_options.highlight, markup=_options.markup
+            )
+            render_iterable = text_renderable.__rich_console__(self, _options)
+        else:
+            raise errors.NotRenderableError(
+                f"Unable to render {renderable!r}; "
+                "A str, Segment or object with __rich_console__ method is required"
+            )
+
+        try:
+            iter_render = iter(render_iterable)
+        except TypeError:
+            raise errors.NotRenderableError(
+                f"object {render_iterable!r} is not renderable"
+            )
+        _Segment = Segment
+        for render_output in iter_render:
+            if isinstance(render_output, _Segment):
+                yield render_output
+            else:
+                yield from self.render(render_output, _options)
+
+    def render_lines(
+        self,
+        renderable: RenderableType,
+        options: Optional[ConsoleOptions] = None,
+        *,
+        style: Optional[Style] = None,
+        pad: bool = True,
+        new_lines: bool = False,
+    ) -> List[List[Segment]]:
+        """Render objects in to a list of lines.
+
+        The output of render_lines is useful when further formatting of rendered console text
+        is required, such as the Panel class which draws a border around any renderable object.
+
+        Args:
+            renderable (RenderableType): Any object renderable in the console.
+            options (Optional[ConsoleOptions], optional): Console options, or None to use self.options. Default to ``None``.
+            style (Style, optional): Optional style to apply to renderables. Defaults to ``None``.
+            pad (bool, optional): Pad lines shorter than render width. Defaults to ``True``.
+            new_lines (bool, optional): Include "\n" characters at end of lines.
+
+        Returns:
+            List[List[Segment]]: A list of lines, where a line is a list of Segment objects.
+        """
+        with self._lock:
+            render_options = options or self.options
+            _rendered = self.render(renderable, render_options)
+            if style:
+                _rendered = Segment.apply_style(_rendered, style)
+            lines = list(
+                islice(
+                    Segment.split_and_crop_lines(
+                        _rendered,
+                        render_options.max_width,
+                        include_new_lines=new_lines,
+                        pad=pad,
+                    ),
+                    None,
+                    render_options.height,
+                )
+            )
+            if render_options.height is not None:
+                extra_lines = render_options.height - len(lines)
+                if extra_lines > 0:
+                    pad_line = [
+                        [Segment(" " * render_options.max_width, style), Segment("\n")]
+                        if new_lines
+                        else [Segment(" " * render_options.max_width, style)]
+                    ]
+                    lines.extend(pad_line * extra_lines)
+
+            return lines
+
+    def render_str(
+        self,
+        text: str,
+        *,
+        style: Union[str, Style] = "",
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        highlighter: Optional[HighlighterType] = None,
+    ) -> "Text":
+        """Convert a string to a Text instance. This is is called automatically if
+        you print or log a string.
+
+        Args:
+            text (str): Text to render.
+            style (Union[str, Style], optional): Style to apply to rendered text.
+            justify (str, optional): Justify method: "default", "left", "center", "full", or "right". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji, or ``None`` to use Console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use Console default.
+            highlight (Optional[bool], optional): Enable highlighting, or ``None`` to use Console default.
+            highlighter (HighlighterType, optional): Optional highlighter to apply.
+        Returns:
+            ConsoleRenderable: Renderable object.
+
+        """
+        emoji_enabled = emoji or (emoji is None and self._emoji)
+        markup_enabled = markup or (markup is None and self._markup)
+        highlight_enabled = highlight or (highlight is None and self._highlight)
+
+        if markup_enabled:
+            rich_text = render_markup(
+                text,
+                style=style,
+                emoji=emoji_enabled,
+                emoji_variant=self._emoji_variant,
+            )
+            rich_text.justify = justify
+            rich_text.overflow = overflow
+        else:
+            rich_text = Text(
+                _emoji_replace(text, default_variant=self._emoji_variant)
+                if emoji_enabled
+                else text,
+                justify=justify,
+                overflow=overflow,
+                style=style,
+            )
+
+        _highlighter = (highlighter or self.highlighter) if highlight_enabled else None
+        if _highlighter is not None:
+            highlight_text = _highlighter(str(rich_text))
+            highlight_text.copy_styles(rich_text)
+            return highlight_text
+
+        return rich_text
+
+    def get_style(
+        self, name: Union[str, Style], *, default: Optional[Union[Style, str]] = None
+    ) -> Style:
+        """Get a Style instance by it's theme name or parse a definition.
+
+        Args:
+            name (str): The name of a style or a style definition.
+
+        Returns:
+            Style: A Style object.
+
+        Raises:
+            MissingStyle: If no style could be parsed from name.
+
+        """
+        if isinstance(name, Style):
+            return name
+
+        try:
+            style = self._theme_stack.get(name)
+            if style is None:
+                style = Style.parse(name)
+            return style.copy() if style.link else style
+        except errors.StyleSyntaxError as error:
+            if default is not None:
+                return self.get_style(default)
+            raise errors.MissingStyle(
+                f"Failed to get style {name!r}; {error}"
+            ) from None
+
+    def _collect_renderables(
+        self,
+        objects: Iterable[Any],
+        sep: str,
+        end: str,
+        *,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+    ) -> List[ConsoleRenderable]:
+        """Combine a number of renderables and text into one renderable.
+
+        Args:
+            objects (Iterable[Any]): Anything that Rich can render.
+            sep (str): String to write between print data.
+            end (str): String to write at end of print data.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default.
+
+        Returns:
+            List[ConsoleRenderable]: A list of things to render.
+        """
+        renderables: List[ConsoleRenderable] = []
+        _append = renderables.append
+        text: List[Text] = []
+        append_text = text.append
+
+        append = _append
+        if justify in ("left", "center", "right"):
+
+            def align_append(renderable: RenderableType) -> None:
+                _append(Align(renderable, cast(AlignMethod, justify)))
+
+            append = align_append
+
+        _highlighter: HighlighterType = _null_highlighter
+        if highlight or (highlight is None and self._highlight):
+            _highlighter = self.highlighter
+
+        def check_text() -> None:
+            if text:
+                sep_text = Text(sep, justify=justify, end=end)
+                append(sep_text.join(text))
+                del text[:]
+
+        for renderable in objects:
+            renderable = rich_cast(renderable)
+            if isinstance(renderable, str):
+                append_text(
+                    self.render_str(
+                        renderable, emoji=emoji, markup=markup, highlighter=_highlighter
+                    )
+                )
+            elif isinstance(renderable, Text):
+                append_text(renderable)
+            elif isinstance(renderable, ConsoleRenderable):
+                check_text()
+                append(renderable)
+            elif is_expandable(renderable):
+                check_text()
+                append(Pretty(renderable, highlighter=_highlighter))
+            else:
+                append_text(_highlighter(str(renderable)))
+
+        check_text()
+
+        if self.style is not None:
+            style = self.get_style(self.style)
+            renderables = [Styled(renderable, style) for renderable in renderables]
+
+        return renderables
+
+    def rule(
+        self,
+        title: TextType = "",
+        *,
+        characters: str = "─",
+        style: Union[str, Style] = "rule.line",
+        align: AlignMethod = "center",
+    ) -> None:
+        """Draw a line with optional centered title.
+
+        Args:
+            title (str, optional): Text to render over the rule. Defaults to "".
+            characters (str, optional): Character(s) to form the line. Defaults to "─".
+            style (str, optional): Style of line. Defaults to "rule.line".
+            align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center".
+        """
+        from .rule import Rule
+
+        rule = Rule(title=title, characters=characters, style=style, align=align)
+        self.print(rule)
+
+    def control(self, *control: Control) -> None:
+        """Insert non-printing control codes.
+
+        Args:
+            control_codes (str): Control codes, such as those that may move the cursor.
+        """
+        if not self.is_dumb_terminal:
+            with self:
+                self._buffer.extend(_control.segment for _control in control)
+
+    def out(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        highlight: Optional[bool] = None,
+    ) -> None:
+        """Output to the terminal. This is a low-level way of writing to the terminal which unlike
+        :meth:`~rich.console.Console.print` won't pretty print, wrap text, or apply markup, but will
+        optionally apply highlighting and a basic style.
+
+        Args:
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use
+                console default. Defaults to ``None``.
+        """
+        raw_output: str = sep.join(str(_object) for _object in objects)
+        self.print(
+            raw_output,
+            style=style,
+            highlight=highlight,
+            emoji=False,
+            markup=False,
+            no_wrap=True,
+            overflow="ignore",
+            crop=False,
+            end=end,
+        )
+
+    def print(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        no_wrap: Optional[bool] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        crop: bool = True,
+        soft_wrap: Optional[bool] = None,
+        new_line_start: bool = False,
+    ) -> None:
+        """Print to the console.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): Justify method: "default", "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "ignore", "crop", "fold", or "ellipsis". Defaults to None.
+            no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to ``None``.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to ``None``.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``.
+            width (Optional[int], optional): Width of output, or ``None`` to auto-detect. Defaults to ``None``.
+            crop (Optional[bool], optional): Crop output to width of terminal. Defaults to True.
+            soft_wrap (bool, optional): Enable soft wrap mode which disables word wrapping and cropping of text or ``None`` for
+                Console default. Defaults to ``None``.
+            new_line_start (bool, False): Insert a new line at the start if the output contains more than one line. Defaults to ``False``.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        if soft_wrap is None:
+            soft_wrap = self.soft_wrap
+        if soft_wrap:
+            if no_wrap is None:
+                no_wrap = True
+            if overflow is None:
+                overflow = "ignore"
+            crop = False
+        render_hooks = self._render_hooks[:]
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            render_options = self.options.update(
+                justify=justify,
+                overflow=overflow,
+                width=min(width, self.width) if width is not None else NO_CHANGE,
+                height=height,
+                no_wrap=no_wrap,
+                markup=markup,
+                highlight=highlight,
+            )
+
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            if style is None:
+                for renderable in renderables:
+                    extend(render(renderable, render_options))
+            else:
+                for renderable in renderables:
+                    extend(
+                        Segment.apply_style(
+                            render(renderable, render_options), self.get_style(style)
+                        )
+                    )
+            if new_line_start:
+                if (
+                    len("".join(segment.text for segment in new_segments).splitlines())
+                    > 1
+                ):
+                    new_segments.insert(0, Segment.line())
+            if crop:
+                buffer_extend = self._buffer.extend
+                for line in Segment.split_and_crop_lines(
+                    new_segments, self.width, pad=False
+                ):
+                    buffer_extend(line)
+            else:
+                self._buffer.extend(new_segments)
+
+    def print_json(
+        self,
+        json: Optional[str] = None,
+        *,
+        data: Any = None,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = True,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> None:
+        """Pretty prints JSON. Output will be valid JSON.
+
+        Args:
+            json (Optional[str]): A string containing JSON.
+            data (Any): If json is not supplied, then encode this data.
+            indent (Union[None, int, str], optional): Number of spaces to indent. Defaults to 2.
+            highlight (bool, optional): Enable highlighting of output: Defaults to True.
+            skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+            ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+            check_circular (bool, optional): Check for circular references. Defaults to True.
+            allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+            default (Callable, optional): A callable that converts values that can not be encoded
+                in to something that can be JSON encoded. Defaults to None.
+            sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+        """
+        from pip._vendor.rich.json import JSON
+
+        if json is None:
+            json_renderable = JSON.from_data(
+                data,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        else:
+            if not isinstance(json, str):
+                raise TypeError(
+                    f"json must be str. Did you mean print_json(data={json!r}) ?"
+                )
+            json_renderable = JSON(
+                json,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        self.print(json_renderable, soft_wrap=True)
+
+    def update_screen(
+        self,
+        renderable: RenderableType,
+        *,
+        region: Optional[Region] = None,
+        options: Optional[ConsoleOptions] = None,
+    ) -> None:
+        """Update the screen at a given offset.
+
+        Args:
+            renderable (RenderableType): A Rich renderable.
+            region (Region, optional): Region of screen to update, or None for entire screen. Defaults to None.
+            x (int, optional): x offset. Defaults to 0.
+            y (int, optional): y offset. Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        render_options = options or self.options
+        if region is None:
+            x = y = 0
+            render_options = render_options.update_dimensions(
+                render_options.max_width, render_options.height or self.height
+            )
+        else:
+            x, y, width, height = region
+            render_options = render_options.update_dimensions(width, height)
+
+        lines = self.render_lines(renderable, options=render_options)
+        self.update_screen_lines(lines, x, y)
+
+    def update_screen_lines(
+        self, lines: List[List[Segment]], x: int = 0, y: int = 0
+    ) -> None:
+        """Update lines of the screen at a given offset.
+
+        Args:
+            lines (List[List[Segment]]): Rendered lines (as produced by :meth:`~rich.Console.render_lines`).
+            x (int, optional): x offset (column no). Defaults to 0.
+            y (int, optional): y offset (column no). Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        screen_update = ScreenUpdate(lines, x, y)
+        segments = self.render(screen_update)
+        self._buffer.extend(segments)
+        self._check_buffer()
+
+    def print_exception(
+        self,
+        *,
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ) -> None:
+        """Prints a rich render of the last exception and traceback.
+
+        Args:
+            width (Optional[int], optional): Number of characters used to render code. Defaults to 88.
+            extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+            theme (str, optional): Override pygments theme used in traceback
+            word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+            max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+        """
+        from .traceback import Traceback
+
+        traceback = Traceback(
+            width=width,
+            extra_lines=extra_lines,
+            theme=theme,
+            word_wrap=word_wrap,
+            show_locals=show_locals,
+            suppress=suppress,
+            max_frames=max_frames,
+        )
+        self.print(traceback)
+
+    @staticmethod
+    def _caller_frame_info(
+        offset: int,
+        currentframe: Callable[[], Optional[FrameType]] = inspect.currentframe,
+    ) -> Tuple[str, int, Dict[str, Any]]:
+        """Get caller frame information.
+
+        Args:
+            offset (int): the caller offset within the current frame stack.
+            currentframe (Callable[[], Optional[FrameType]], optional): the callable to use to
+                retrieve the current frame. Defaults to ``inspect.currentframe``.
+
+        Returns:
+            Tuple[str, int, Dict[str, Any]]: A tuple containing the filename, the line number and
+                the dictionary of local variables associated with the caller frame.
+
+        Raises:
+            RuntimeError: If the stack offset is invalid.
+        """
+        # Ignore the frame of this local helper
+        offset += 1
+
+        frame = currentframe()
+        if frame is not None:
+            # Use the faster currentframe where implemented
+            while offset and frame:
+                frame = frame.f_back
+                offset -= 1
+            assert frame is not None
+            return frame.f_code.co_filename, frame.f_lineno, frame.f_locals
+        else:
+            # Fallback to the slower stack
+            frame_info = inspect.stack()[offset]
+            return frame_info.filename, frame_info.lineno, frame_info.frame.f_locals
+
+    def log(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        log_locals: bool = False,
+        _stack_offset: int = 1,
+    ) -> None:
+        """Log rich content to the terminal.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to None.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to None.
+            log_locals (bool, optional): Boolean to enable logging of locals where ``log()``
+                was called. Defaults to False.
+            _stack_offset (int, optional): Offset of caller from end of call stack. Defaults to 1.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        render_hooks = self._render_hooks[:]
+
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            if style is not None:
+                renderables = [Styled(renderable, style) for renderable in renderables]
+
+            filename, line_no, locals = self._caller_frame_info(_stack_offset)
+            link_path = None if filename.startswith("<") else os.path.abspath(filename)
+            path = filename.rpartition(os.sep)[-1]
+            if log_locals:
+                locals_map = {
+                    key: value
+                    for key, value in locals.items()
+                    if not key.startswith("__")
+                }
+                renderables.append(render_scope(locals_map, title="[i]locals"))
+
+            renderables = [
+                self._log_render(
+                    self,
+                    renderables,
+                    log_time=self.get_datetime(),
+                    path=path,
+                    line_no=line_no,
+                    link_path=link_path,
+                )
+            ]
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            render_options = self.options
+            for renderable in renderables:
+                extend(render(renderable, render_options))
+            buffer_extend = self._buffer.extend
+            for line in Segment.split_and_crop_lines(
+                new_segments, self.width, pad=False
+            ):
+                buffer_extend(line)
+
+    def _check_buffer(self) -> None:
+        """Check if the buffer may be rendered."""
+        if self.quiet:
+            del self._buffer[:]
+            return
+        with self._lock:
+            if self._buffer_index == 0:
+                if self.is_jupyter:  # pragma: no cover
+                    from .jupyter import display
+
+                    display(self._buffer, self._render_buffer(self._buffer[:]))
+                    del self._buffer[:]
+                else:
+                    text = self._render_buffer(self._buffer[:])
+                    del self._buffer[:]
+                    if text:
+                        try:
+                            if WINDOWS:  # pragma: no cover
+                                # https://bugs.python.org/issue37871
+                                write = self.file.write
+                                for line in text.splitlines(True):
+                                    write(line)
+                            else:
+                                self.file.write(text)
+                            self.file.flush()
+                        except UnicodeEncodeError as error:
+                            error.reason = f"{error.reason}\n*** You may need to add PYTHONIOENCODING=utf-8 to your environment ***"
+                            raise
+
+    def _render_buffer(self, buffer: Iterable[Segment]) -> str:
+        """Render buffered output, and clear buffer."""
+        output: List[str] = []
+        append = output.append
+        color_system = self._color_system
+        legacy_windows = self.legacy_windows
+        if self.record:
+            with self._record_buffer_lock:
+                self._record_buffer.extend(buffer)
+        not_terminal = not self.is_terminal
+        if self.no_color and color_system:
+            buffer = Segment.remove_color(buffer)
+        for text, style, control in buffer:
+            if style:
+                append(
+                    style.render(
+                        text,
+                        color_system=color_system,
+                        legacy_windows=legacy_windows,
+                    )
+                )
+            elif not (not_terminal and control):
+                append(text)
+
+        rendered = "".join(output)
+        return rendered
+
+    def input(
+        self,
+        prompt: TextType = "",
+        *,
+        markup: bool = True,
+        emoji: bool = True,
+        password: bool = False,
+        stream: Optional[TextIO] = None,
+    ) -> str:
+        """Displays a prompt and waits for input from the user. The prompt may contain color / style.
+
+        It works in the same way as Python's builtin :func:`input` function and provides elaborate line editing and history features if Python's builtin :mod:`readline` module is previously loaded.
+
+        Args:
+            prompt (Union[str, Text]): Text to render in the prompt.
+            markup (bool, optional): Enable console markup (requires a str prompt). Defaults to True.
+            emoji (bool, optional): Enable emoji (requires a str prompt). Defaults to True.
+            password: (bool, optional): Hide typed text. Defaults to False.
+            stream: (TextIO, optional): Optional file to read input from (rather than stdin). Defaults to None.
+
+        Returns:
+            str: Text read from stdin.
+        """
+        prompt_str = ""
+        if prompt:
+            with self.capture() as capture:
+                self.print(prompt, markup=markup, emoji=emoji, end="")
+            prompt_str = capture.get()
+        if self.legacy_windows:
+            # Legacy windows doesn't like ANSI codes in getpass or input (colorama bug)?
+            self.file.write(prompt_str)
+            prompt_str = ""
+        if password:
+            result = getpass(prompt_str, stream=stream)
+        else:
+            if stream:
+                self.file.write(prompt_str)
+                result = stream.readline()
+            else:
+                result = input(prompt_str)
+        return result
+
+    def export_text(self, *, clear: bool = True, styles: bool = False) -> str:
+        """Generate text from console contents (requires record=True argument in constructor).
+
+        Args:
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi escape codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        Returns:
+            str: String containing console contents.
+
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+
+        with self._record_buffer_lock:
+            if styles:
+                text = "".join(
+                    (style.render(text) if style else text)
+                    for text, style, _ in self._record_buffer
+                )
+            else:
+                text = "".join(
+                    segment.text
+                    for segment in self._record_buffer
+                    if not segment.control
+                )
+            if clear:
+                del self._record_buffer[:]
+        return text
+
+    def save_text(self, path: str, *, clear: bool = True, styles: bool = False) -> None:
+        """Generate text from console and save to a given location (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write text files.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi style codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        """
+        text = self.export_text(clear=clear, styles=styles)
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(text)
+
+    def export_html(
+        self,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: Optional[str] = None,
+        inline_styles: bool = False,
+    ) -> str:
+        """Generate HTML from console contents (requires record=True argument in constructor).
+
+        Args:
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML, should contain {foreground}
+                {background} and {code}.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        Returns:
+            str: String containing console contents as HTML.
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+        fragments: List[str] = []
+        append = fragments.append
+        _theme = theme or DEFAULT_TERMINAL_THEME
+        stylesheet = ""
+
+        render_code_format = CONSOLE_HTML_FORMAT if code_format is None else code_format
+
+        with self._record_buffer_lock:
+            if inline_styles:
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        if style.link:
+                            text = f'<a href="{style.link}">{text}</a>'
+                        text = f'<span style="{rule}">{text}</span>' if rule else text
+                    append(text)
+            else:
+                styles: Dict[str, int] = {}
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        style_number = styles.setdefault(rule, len(styles) + 1)
+                        if style.link:
+                            text = f'<a class="r{style_number}" href="{style.link}">{text}</a>'
+                        else:
+                            text = f'<span class="r{style_number}">{text}</span>'
+                    append(text)
+                stylesheet_rules: List[str] = []
+                stylesheet_append = stylesheet_rules.append
+                for style_rule, style_number in styles.items():
+                    if style_rule:
+                        stylesheet_append(f".r{style_number} {{{style_rule}}}")
+                stylesheet = "\n".join(stylesheet_rules)
+
+            rendered_code = render_code_format.format(
+                code="".join(fragments),
+                stylesheet=stylesheet,
+                foreground=_theme.foreground_color.hex,
+                background=_theme.background_color.hex,
+            )
+            if clear:
+                del self._record_buffer[:]
+        return rendered_code
+
+    def save_html(
+        self,
+        path: str,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: str = CONSOLE_HTML_FORMAT,
+        inline_styles: bool = False,
+    ) -> None:
+        """Generate HTML from console contents and write to a file (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write html file.
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML, should contain {foreground}
+                {background} and {code}.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        """
+        html = self.export_html(
+            theme=theme,
+            clear=clear,
+            code_format=code_format,
+            inline_styles=inline_styles,
+        )
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(html)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console()
+
+    console.log(
+        "JSONRPC [i]request[/i]",
+        5,
+        1.3,
+        True,
+        False,
+        None,
+        {
+            "jsonrpc": "2.0",
+            "method": "subtract",
+            "params": {"minuend": 42, "subtrahend": 23},
+            "id": 3,
+        },
+    )
+
+    console.log("Hello, World!", "{'a': 1}", repr(console))
+
+    console.print(
+        {
+            "name": None,
+            "empty": [],
+            "quiz": {
+                "sport": {
+                    "answered": True,
+                    "q1": {
+                        "question": "Which one is correct team name in NBA?",
+                        "options": [
+                            "New York Bulls",
+                            "Los Angeles Kings",
+                            "Golden State Warriors",
+                            "Huston Rocket",
+                        ],
+                        "answer": "Huston Rocket",
+                    },
+                },
+                "maths": {
+                    "answered": False,
+                    "q1": {
+                        "question": "5 + 7 = ?",
+                        "options": [10, 11, 12, 13],
+                        "answer": 12,
+                    },
+                    "q2": {
+                        "question": "12 - 8 = ?",
+                        "options": [1, 2, 3, 4],
+                        "answer": 4,
+                    },
+                },
+            },
+        }
+    )
+    console.log("foo")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/constrain.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/constrain.py
new file mode 100644
index 0000000000000000000000000000000000000000..65fdf56342e8b5b8e181914881025231684e1871
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/constrain.py
@@ -0,0 +1,37 @@
+from typing import Optional, TYPE_CHECKING
+
+from .jupyter import JupyterMixin
+from .measure import Measurement
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+
+class Constrain(JupyterMixin):
+    """Constrain the width of a renderable to a given number of characters.
+
+    Args:
+        renderable (RenderableType): A renderable object.
+        width (int, optional): The maximum width (in characters) to render. Defaults to 80.
+    """
+
+    def __init__(self, renderable: "RenderableType", width: Optional[int] = 80) -> None:
+        self.renderable = renderable
+        self.width = width
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.width is None:
+            yield self.renderable
+        else:
+            child_options = options.update_width(min(self.width, options.max_width))
+            yield from console.render(self.renderable, child_options)
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.width is not None:
+            options = options.update_width(self.width)
+        measurement = Measurement.get(console, options, self.renderable)
+        return measurement
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/containers.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/containers.py
new file mode 100644
index 0000000000000000000000000000000000000000..e29cf368991ccb083b67cda8133e4635defbfe53
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/containers.py
@@ -0,0 +1,167 @@
+from itertools import zip_longest
+from typing import (
+    Iterator,
+    Iterable,
+    List,
+    Optional,
+    Union,
+    overload,
+    TypeVar,
+    TYPE_CHECKING,
+)
+
+if TYPE_CHECKING:
+    from .console import (
+        Console,
+        ConsoleOptions,
+        JustifyMethod,
+        OverflowMethod,
+        RenderResult,
+        RenderableType,
+    )
+    from .text import Text
+
+from .cells import cell_len
+from .measure import Measurement
+
+T = TypeVar("T")
+
+
+class Renderables:
+    """A list subclass which renders its contents to the console."""
+
+    def __init__(
+        self, renderables: Optional[Iterable["RenderableType"]] = None
+    ) -> None:
+        self._renderables: List["RenderableType"] = (
+            list(renderables) if renderables is not None else []
+        )
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        """Console render method to insert line-breaks."""
+        yield from self._renderables
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        dimensions = [
+            Measurement.get(console, options, renderable)
+            for renderable in self._renderables
+        ]
+        if not dimensions:
+            return Measurement(1, 1)
+        _min = max(dimension.minimum for dimension in dimensions)
+        _max = max(dimension.maximum for dimension in dimensions)
+        return Measurement(_min, _max)
+
+    def append(self, renderable: "RenderableType") -> None:
+        self._renderables.append(renderable)
+
+    def __iter__(self) -> Iterable["RenderableType"]:
+        return iter(self._renderables)
+
+
+class Lines:
+    """A list subclass which can render to the console."""
+
+    def __init__(self, lines: Iterable["Text"] = ()) -> None:
+        self._lines: List["Text"] = list(lines)
+
+    def __repr__(self) -> str:
+        return f"Lines({self._lines!r})"
+
+    def __iter__(self) -> Iterator["Text"]:
+        return iter(self._lines)
+
+    @overload
+    def __getitem__(self, index: int) -> "Text":
+        ...
+
+    @overload
+    def __getitem__(self, index: slice) -> List["Text"]:
+        ...
+
+    def __getitem__(self, index: Union[slice, int]) -> Union["Text", List["Text"]]:
+        return self._lines[index]
+
+    def __setitem__(self, index: int, value: "Text") -> "Lines":
+        self._lines[index] = value
+        return self
+
+    def __len__(self) -> int:
+        return self._lines.__len__()
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        """Console render method to insert line-breaks."""
+        yield from self._lines
+
+    def append(self, line: "Text") -> None:
+        self._lines.append(line)
+
+    def extend(self, lines: Iterable["Text"]) -> None:
+        self._lines.extend(lines)
+
+    def pop(self, index: int = -1) -> "Text":
+        return self._lines.pop(index)
+
+    def justify(
+        self,
+        console: "Console",
+        width: int,
+        justify: "JustifyMethod" = "left",
+        overflow: "OverflowMethod" = "fold",
+    ) -> None:
+        """Justify and overflow text to a given width.
+
+        Args:
+            console (Console): Console instance.
+            width (int): Number of characters per line.
+            justify (str, optional): Default justify method for text: "left", "center", "full" or "right". Defaults to "left".
+            overflow (str, optional): Default overflow for text: "crop", "fold", or "ellipsis". Defaults to "fold".
+
+        """
+        from .text import Text
+
+        if justify == "left":
+            for line in self._lines:
+                line.truncate(width, overflow=overflow, pad=True)
+        elif justify == "center":
+            for line in self._lines:
+                line.rstrip()
+                line.truncate(width, overflow=overflow)
+                line.pad_left((width - cell_len(line.plain)) // 2)
+                line.pad_right(width - cell_len(line.plain))
+        elif justify == "right":
+            for line in self._lines:
+                line.rstrip()
+                line.truncate(width, overflow=overflow)
+                line.pad_left(width - cell_len(line.plain))
+        elif justify == "full":
+            for line_index, line in enumerate(self._lines):
+                if line_index == len(self._lines) - 1:
+                    break
+                words = line.split(" ")
+                words_size = sum(cell_len(word.plain) for word in words)
+                num_spaces = len(words) - 1
+                spaces = [1 for _ in range(num_spaces)]
+                index = 0
+                if spaces:
+                    while words_size + num_spaces < width:
+                        spaces[len(spaces) - index - 1] += 1
+                        num_spaces += 1
+                        index = (index + 1) % len(spaces)
+                tokens: List[Text] = []
+                for index, (word, next_word) in enumerate(
+                    zip_longest(words, words[1:])
+                ):
+                    tokens.append(word)
+                    if index < len(spaces):
+                        style = word.get_style_at_offset(console, -1)
+                        next_style = next_word.get_style_at_offset(console, 0)
+                        space_style = style if style == next_style else line.style
+                        tokens.append(Text(" " * spaces[index], style=space_style))
+                self[line_index] = Text("").join(tokens)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/control.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/control.py
new file mode 100644
index 0000000000000000000000000000000000000000..c98d0d7d98bd6de3b6b14b89ccffabbbefc5aefb
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/control.py
@@ -0,0 +1,175 @@
+from typing import Any, Callable, Dict, Iterable, List, TYPE_CHECKING, Union
+
+from .segment import ControlCode, ControlType, Segment
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult
+
+STRIP_CONTROL_CODES = [
+    8,  # Backspace
+    11,  # Vertical tab
+    12,  # Form feed
+    13,  # Carriage return
+]
+_CONTROL_TRANSLATE = {_codepoint: None for _codepoint in STRIP_CONTROL_CODES}
+
+
+CONTROL_CODES_FORMAT: Dict[int, Callable[..., str]] = {
+    ControlType.BELL: lambda: "\x07",
+    ControlType.CARRIAGE_RETURN: lambda: "\r",
+    ControlType.HOME: lambda: "\x1b[H",
+    ControlType.CLEAR: lambda: "\x1b[2J",
+    ControlType.ENABLE_ALT_SCREEN: lambda: "\x1b[?1049h",
+    ControlType.DISABLE_ALT_SCREEN: lambda: "\x1b[?1049l",
+    ControlType.SHOW_CURSOR: lambda: "\x1b[?25h",
+    ControlType.HIDE_CURSOR: lambda: "\x1b[?25l",
+    ControlType.CURSOR_UP: lambda param: f"\x1b[{param}A",
+    ControlType.CURSOR_DOWN: lambda param: f"\x1b[{param}B",
+    ControlType.CURSOR_FORWARD: lambda param: f"\x1b[{param}C",
+    ControlType.CURSOR_BACKWARD: lambda param: f"\x1b[{param}D",
+    ControlType.CURSOR_MOVE_TO_COLUMN: lambda param: f"\x1b[{param+1}G",
+    ControlType.ERASE_IN_LINE: lambda param: f"\x1b[{param}K",
+    ControlType.CURSOR_MOVE_TO: lambda x, y: f"\x1b[{y+1};{x+1}H",
+}
+
+
+class Control:
+    """A renderable that inserts a control code (non printable but may move cursor).
+
+    Args:
+        *codes (str): Positional arguments are either a :class:`~rich.segment.ControlType` enum or a
+            tuple of ControlType and an integer parameter
+    """
+
+    __slots__ = ["segment"]
+
+    def __init__(self, *codes: Union[ControlType, ControlCode]) -> None:
+        control_codes: List[ControlCode] = [
+            (code,) if isinstance(code, ControlType) else code for code in codes
+        ]
+        _format_map = CONTROL_CODES_FORMAT
+        rendered_codes = "".join(
+            _format_map[code](*parameters) for code, *parameters in control_codes
+        )
+        self.segment = Segment(rendered_codes, None, control_codes)
+
+    @classmethod
+    def bell(cls) -> "Control":
+        """Ring the 'bell'."""
+        return cls(ControlType.BELL)
+
+    @classmethod
+    def home(cls) -> "Control":
+        """Move cursor to 'home' position."""
+        return cls(ControlType.HOME)
+
+    @classmethod
+    def move(cls, x: int = 0, y: int = 0) -> "Control":
+        """Move cursor relative to current position.
+
+        Args:
+            x (int): X offset.
+            y (int): Y offset.
+
+        Returns:
+            ~Control: Control object.
+
+        """
+
+        def get_codes() -> Iterable[ControlCode]:
+            control = ControlType
+            if x:
+                yield (
+                    control.CURSOR_FORWARD if x > 0 else control.CURSOR_BACKWARD,
+                    abs(x),
+                )
+            if y:
+                yield (
+                    control.CURSOR_DOWN if y > 0 else control.CURSOR_UP,
+                    abs(y),
+                )
+
+        control = cls(*get_codes())
+        return control
+
+    @classmethod
+    def move_to_column(cls, x: int, y: int = 0) -> "Control":
+        """Move to the given column, optionally add offset to row.
+
+        Returns:
+            x (int): absolute x (column)
+            y (int): optional y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+
+        return (
+            cls(
+                (ControlType.CURSOR_MOVE_TO_COLUMN, x),
+                (
+                    ControlType.CURSOR_DOWN if y > 0 else ControlType.CURSOR_UP,
+                    abs(y),
+                ),
+            )
+            if y
+            else cls((ControlType.CURSOR_MOVE_TO_COLUMN, x))
+        )
+
+    @classmethod
+    def move_to(cls, x: int, y: int) -> "Control":
+        """Move cursor to absolute position.
+
+        Args:
+            x (int): x offset (column)
+            y (int): y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+        return cls((ControlType.CURSOR_MOVE_TO, x, y))
+
+    @classmethod
+    def clear(cls) -> "Control":
+        """Clear the screen."""
+        return cls(ControlType.CLEAR)
+
+    @classmethod
+    def show_cursor(cls, show: bool) -> "Control":
+        """Show or hide the cursor."""
+        return cls(ControlType.SHOW_CURSOR if show else ControlType.HIDE_CURSOR)
+
+    @classmethod
+    def alt_screen(cls, enable: bool) -> "Control":
+        """Enable or disable alt screen."""
+        if enable:
+            return cls(ControlType.ENABLE_ALT_SCREEN, ControlType.HOME)
+        else:
+            return cls(ControlType.DISABLE_ALT_SCREEN)
+
+    def __str__(self) -> str:
+        return self.segment.text
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.segment.text:
+            yield self.segment
+
+
+def strip_control_codes(
+    text: str, _translate_table: Dict[int, None] = _CONTROL_TRANSLATE
+) -> str:
+    """Remove control codes from text.
+
+    Args:
+        text (str): A string possibly contain control codes.
+
+    Returns:
+        str: String with control codes removed.
+    """
+    return text.translate(_translate_table)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    print(strip_control_codes("hello\rWorld"))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/default_styles.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/default_styles.py
new file mode 100644
index 0000000000000000000000000000000000000000..91ab232d31d561d7f2fcb92e83af1bbd4a4e89f7
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/default_styles.py
@@ -0,0 +1,183 @@
+from typing import Dict
+
+from .style import Style
+
+
+DEFAULT_STYLES: Dict[str, Style] = {
+    "none": Style.null(),
+    "reset": Style(
+        color="default",
+        bgcolor="default",
+        dim=False,
+        bold=False,
+        italic=False,
+        underline=False,
+        blink=False,
+        blink2=False,
+        reverse=False,
+        conceal=False,
+        strike=False,
+    ),
+    "dim": Style(dim=True),
+    "bright": Style(dim=False),
+    "bold": Style(bold=True),
+    "strong": Style(bold=True),
+    "code": Style(reverse=True, bold=True),
+    "italic": Style(italic=True),
+    "emphasize": Style(italic=True),
+    "underline": Style(underline=True),
+    "blink": Style(blink=True),
+    "blink2": Style(blink2=True),
+    "reverse": Style(reverse=True),
+    "strike": Style(strike=True),
+    "black": Style(color="black"),
+    "red": Style(color="red"),
+    "green": Style(color="green"),
+    "yellow": Style(color="yellow"),
+    "magenta": Style(color="magenta"),
+    "cyan": Style(color="cyan"),
+    "white": Style(color="white"),
+    "inspect.attr": Style(color="yellow", italic=True),
+    "inspect.attr.dunder": Style(color="yellow", italic=True, dim=True),
+    "inspect.callable": Style(bold=True, color="red"),
+    "inspect.def": Style(italic=True, color="bright_cyan"),
+    "inspect.error": Style(bold=True, color="red"),
+    "inspect.equals": Style(),
+    "inspect.help": Style(color="cyan"),
+    "inspect.doc": Style(dim=True),
+    "inspect.value.border": Style(color="green"),
+    "live.ellipsis": Style(bold=True, color="red"),
+    "layout.tree.row": Style(dim=False, color="red"),
+    "layout.tree.column": Style(dim=False, color="blue"),
+    "logging.keyword": Style(bold=True, color="yellow"),
+    "logging.level.notset": Style(dim=True),
+    "logging.level.debug": Style(color="green"),
+    "logging.level.info": Style(color="blue"),
+    "logging.level.warning": Style(color="red"),
+    "logging.level.error": Style(color="red", bold=True),
+    "logging.level.critical": Style(color="red", bold=True, reverse=True),
+    "log.level": Style.null(),
+    "log.time": Style(color="cyan", dim=True),
+    "log.message": Style.null(),
+    "log.path": Style(dim=True),
+    "repr.ellipsis": Style(color="yellow"),
+    "repr.indent": Style(color="green", dim=True),
+    "repr.error": Style(color="red", bold=True),
+    "repr.str": Style(color="green", italic=False, bold=False),
+    "repr.brace": Style(bold=True),
+    "repr.comma": Style(bold=True),
+    "repr.ipv4": Style(bold=True, color="bright_green"),
+    "repr.ipv6": Style(bold=True, color="bright_green"),
+    "repr.eui48": Style(bold=True, color="bright_green"),
+    "repr.eui64": Style(bold=True, color="bright_green"),
+    "repr.tag_start": Style(bold=True),
+    "repr.tag_name": Style(color="bright_magenta", bold=True),
+    "repr.tag_contents": Style(color="default"),
+    "repr.tag_end": Style(bold=True),
+    "repr.attrib_name": Style(color="yellow", italic=False),
+    "repr.attrib_equal": Style(bold=True),
+    "repr.attrib_value": Style(color="magenta", italic=False),
+    "repr.number": Style(color="cyan", bold=True, italic=False),
+    "repr.bool_true": Style(color="bright_green", italic=True),
+    "repr.bool_false": Style(color="bright_red", italic=True),
+    "repr.none": Style(color="magenta", italic=True),
+    "repr.url": Style(underline=True, color="bright_blue", italic=False, bold=False),
+    "repr.uuid": Style(color="bright_yellow", bold=False),
+    "repr.call": Style(color="magenta", bold=True),
+    "repr.path": Style(color="magenta"),
+    "repr.filename": Style(color="bright_magenta"),
+    "rule.line": Style(color="bright_green"),
+    "rule.text": Style.null(),
+    "json.brace": Style(bold=True),
+    "json.bool_true": Style(color="bright_green", italic=True),
+    "json.bool_false": Style(color="bright_red", italic=True),
+    "json.null": Style(color="magenta", italic=True),
+    "json.number": Style(color="cyan", bold=True, italic=False),
+    "json.str": Style(color="green", italic=False, bold=False),
+    "json.key": Style(color="blue", bold=True),
+    "prompt": Style.null(),
+    "prompt.choices": Style(color="magenta", bold=True),
+    "prompt.default": Style(color="cyan", bold=True),
+    "prompt.invalid": Style(color="red"),
+    "prompt.invalid.choice": Style(color="red"),
+    "pretty": Style.null(),
+    "scope.border": Style(color="blue"),
+    "scope.key": Style(color="yellow", italic=True),
+    "scope.key.special": Style(color="yellow", italic=True, dim=True),
+    "scope.equals": Style(color="red"),
+    "table.header": Style(bold=True),
+    "table.footer": Style(bold=True),
+    "table.cell": Style.null(),
+    "table.title": Style(italic=True),
+    "table.caption": Style(italic=True, dim=True),
+    "traceback.error": Style(color="red", italic=True),
+    "traceback.border.syntax_error": Style(color="bright_red"),
+    "traceback.border": Style(color="red"),
+    "traceback.text": Style.null(),
+    "traceback.title": Style(color="red", bold=True),
+    "traceback.exc_type": Style(color="bright_red", bold=True),
+    "traceback.exc_value": Style.null(),
+    "traceback.offset": Style(color="bright_red", bold=True),
+    "bar.back": Style(color="grey23"),
+    "bar.complete": Style(color="rgb(249,38,114)"),
+    "bar.finished": Style(color="rgb(114,156,31)"),
+    "bar.pulse": Style(color="rgb(249,38,114)"),
+    "progress.description": Style.null(),
+    "progress.filesize": Style(color="green"),
+    "progress.filesize.total": Style(color="green"),
+    "progress.download": Style(color="green"),
+    "progress.elapsed": Style(color="yellow"),
+    "progress.percentage": Style(color="magenta"),
+    "progress.remaining": Style(color="cyan"),
+    "progress.data.speed": Style(color="red"),
+    "progress.spinner": Style(color="green"),
+    "status.spinner": Style(color="green"),
+    "tree": Style(),
+    "tree.line": Style(),
+    "markdown.paragraph": Style(),
+    "markdown.text": Style(),
+    "markdown.emph": Style(italic=True),
+    "markdown.strong": Style(bold=True),
+    "markdown.code": Style(bgcolor="black", color="bright_white"),
+    "markdown.code_block": Style(dim=True, color="cyan", bgcolor="black"),
+    "markdown.block_quote": Style(color="magenta"),
+    "markdown.list": Style(color="cyan"),
+    "markdown.item": Style(),
+    "markdown.item.bullet": Style(color="yellow", bold=True),
+    "markdown.item.number": Style(color="yellow", bold=True),
+    "markdown.hr": Style(color="yellow"),
+    "markdown.h1.border": Style(),
+    "markdown.h1": Style(bold=True),
+    "markdown.h2": Style(bold=True, underline=True),
+    "markdown.h3": Style(bold=True),
+    "markdown.h4": Style(bold=True, dim=True),
+    "markdown.h5": Style(underline=True),
+    "markdown.h6": Style(italic=True),
+    "markdown.h7": Style(italic=True, dim=True),
+    "markdown.link": Style(color="bright_blue"),
+    "markdown.link_url": Style(color="blue"),
+}
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import argparse
+    import io
+
+    from pip._vendor.rich.console import Console
+    from pip._vendor.rich.table import Table
+    from pip._vendor.rich.text import Text
+
+    parser = argparse.ArgumentParser()
+    parser.add_argument("--html", action="store_true", help="Export as HTML table")
+    args = parser.parse_args()
+    html: bool = args.html
+    console = Console(record=True, width=70, file=io.StringIO()) if html else Console()
+
+    table = Table("Name", "Styling")
+
+    for style_name, style in DEFAULT_STYLES.items():
+        table.add_row(Text(style_name, style=style), str(style))
+
+    console.print(table)
+    if html:
+        print(console.export_html(inline_styles=True))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/diagnose.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/diagnose.py
new file mode 100644
index 0000000000000000000000000000000000000000..38728da2ae2b557aa5c1b96a116c5901462fe298
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/diagnose.py
@@ -0,0 +1,6 @@
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+    from pip._vendor.rich import inspect
+
+    console = Console()
+    inspect(console)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/errors.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/errors.py
new file mode 100644
index 0000000000000000000000000000000000000000..0bcbe53ef59373c608e62ea285536f8b22b47ecb
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/errors.py
@@ -0,0 +1,34 @@
+class ConsoleError(Exception):
+    """An error in console operation."""
+
+
+class StyleError(Exception):
+    """An error in styles."""
+
+
+class StyleSyntaxError(ConsoleError):
+    """Style was badly formatted."""
+
+
+class MissingStyle(StyleError):
+    """No such style."""
+
+
+class StyleStackError(ConsoleError):
+    """Style stack is invalid."""
+
+
+class NotRenderableError(ConsoleError):
+    """Object is not renderable."""
+
+
+class MarkupError(ConsoleError):
+    """Markup was badly formatted."""
+
+
+class LiveError(ConsoleError):
+    """Error related to Live display."""
+
+
+class NoAltScreen(ConsoleError):
+    """Alt screen mode was required."""
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/file_proxy.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/file_proxy.py
new file mode 100644
index 0000000000000000000000000000000000000000..3ec593a5a480b101f8d67a6bc4b2ceabc4685d8e
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/file_proxy.py
@@ -0,0 +1,54 @@
+import io
+from typing import List, Any, IO, TYPE_CHECKING
+
+from .ansi import AnsiDecoder
+from .text import Text
+
+if TYPE_CHECKING:
+    from .console import Console
+
+
+class FileProxy(io.TextIOBase):
+    """Wraps a file (e.g. sys.stdout) and redirects writes to a console."""
+
+    def __init__(self, console: "Console", file: IO[str]) -> None:
+        self.__console = console
+        self.__file = file
+        self.__buffer: List[str] = []
+        self.__ansi_decoder = AnsiDecoder()
+
+    @property
+    def rich_proxied_file(self) -> IO[str]:
+        """Get proxied file."""
+        return self.__file
+
+    def __getattr__(self, name: str) -> Any:
+        return getattr(self.__file, name)
+
+    def write(self, text: str) -> int:
+        if not isinstance(text, str):
+            raise TypeError(f"write() argument must be str, not {type(text).__name__}")
+        buffer = self.__buffer
+        lines: List[str] = []
+        while text:
+            line, new_line, text = text.partition("\n")
+            if new_line:
+                lines.append("".join(buffer) + line)
+                del buffer[:]
+            else:
+                buffer.append(line)
+                break
+        if lines:
+            console = self.__console
+            with console:
+                output = Text("\n").join(
+                    self.__ansi_decoder.decode_line(line) for line in lines
+                )
+                console.print(output)
+        return len(text)
+
+    def flush(self) -> None:
+        buffer = self.__buffer
+        if buffer:
+            self.__console.print("".join(buffer))
+            del buffer[:]
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/filesize.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/filesize.py
new file mode 100644
index 0000000000000000000000000000000000000000..b3a0996b05ef985e64ce69225e1347c1603dc023
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/filesize.py
@@ -0,0 +1,89 @@
+# coding: utf-8
+"""Functions for reporting filesizes. Borrowed from https://github.com/PyFilesystem/pyfilesystem2
+
+The functions declared in this module should cover the different
+usecases needed to generate a string representation of a file size
+using several different units. Since there are many standards regarding
+file size units, three different functions have been implemented.
+
+See Also:
+    * `Wikipedia: Binary prefix <https://en.wikipedia.org/wiki/Binary_prefix>`_
+
+"""
+
+__all__ = ["decimal"]
+
+from typing import Iterable, List, Tuple, Optional
+
+
+def _to_str(
+    size: int,
+    suffixes: Iterable[str],
+    base: int,
+    *,
+    precision: Optional[int] = 1,
+    separator: Optional[str] = " ",
+) -> str:
+    if size == 1:
+        return "1 byte"
+    elif size < base:
+        return "{:,} bytes".format(size)
+
+    for i, suffix in enumerate(suffixes, 2):  # noqa: B007
+        unit = base ** i
+        if size < unit:
+            break
+    return "{:,.{precision}f}{separator}{}".format(
+        (base * size / unit),
+        suffix,
+        precision=precision,
+        separator=separator,
+    )
+
+
+def pick_unit_and_suffix(size: int, suffixes: List[str], base: int) -> Tuple[int, str]:
+    """Pick a suffix and base for the given size."""
+    for i, suffix in enumerate(suffixes):
+        unit = base ** i
+        if size < unit * base:
+            break
+    return unit, suffix
+
+
+def decimal(
+    size: int,
+    *,
+    precision: Optional[int] = 1,
+    separator: Optional[str] = " ",
+) -> str:
+    """Convert a filesize in to a string (powers of 1000, SI prefixes).
+
+    In this convention, ``1000 B = 1 kB``.
+
+    This is typically the format used to advertise the storage
+    capacity of USB flash drives and the like (*256 MB* meaning
+    actually a storage capacity of more than *256 000 000 B*),
+    or used by **Mac OS X** since v10.6 to report file sizes.
+
+    Arguments:
+        int (size): A file size.
+        int (precision): The number of decimal places to include (default = 1).
+        str (separator): The string to separate the value from the units (default = " ").
+
+    Returns:
+        `str`: A string containing a abbreviated file size and units.
+
+    Example:
+        >>> filesize.decimal(30000)
+        '30.0 kB'
+        >>> filesize.decimal(30000, precision=2, separator="")
+        '30.00kB'
+
+    """
+    return _to_str(
+        size,
+        ("kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"),
+        1000,
+        precision=precision,
+        separator=separator,
+    )
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py
new file mode 100644
index 0000000000000000000000000000000000000000..8afdd017b6e5c11458b3dd61af3bbe9c20ba8ea6
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py
@@ -0,0 +1,147 @@
+from abc import ABC, abstractmethod
+from typing import List, Union
+
+from .text import Text
+
+
+def _combine_regex(*regexes: str) -> str:
+    """Combine a number of regexes in to a single regex.
+
+    Returns:
+        str: New regex with all regexes ORed together.
+    """
+    return "|".join(regexes)
+
+
+class Highlighter(ABC):
+    """Abstract base class for highlighters."""
+
+    def __call__(self, text: Union[str, Text]) -> Text:
+        """Highlight a str or Text instance.
+
+        Args:
+            text (Union[str, ~Text]): Text to highlight.
+
+        Raises:
+            TypeError: If not called with text or str.
+
+        Returns:
+            Text: A test instance with highlighting applied.
+        """
+        if isinstance(text, str):
+            highlight_text = Text(text)
+        elif isinstance(text, Text):
+            highlight_text = text.copy()
+        else:
+            raise TypeError(f"str or Text instance required, not {text!r}")
+        self.highlight(highlight_text)
+        return highlight_text
+
+    @abstractmethod
+    def highlight(self, text: Text) -> None:
+        """Apply highlighting in place to text.
+
+        Args:
+            text (~Text): A text object highlight.
+        """
+
+
+class NullHighlighter(Highlighter):
+    """A highlighter object that doesn't highlight.
+
+    May be used to disable highlighting entirely.
+
+    """
+
+    def highlight(self, text: Text) -> None:
+        """Nothing to do"""
+
+
+class RegexHighlighter(Highlighter):
+    """Applies highlighting from a list of regular expressions."""
+
+    highlights: List[str] = []
+    base_style: str = ""
+
+    def highlight(self, text: Text) -> None:
+        """Highlight :class:`rich.text.Text` using regular expressions.
+
+        Args:
+            text (~Text): Text to highlighted.
+
+        """
+
+        highlight_regex = text.highlight_regex
+        for re_highlight in self.highlights:
+            highlight_regex(re_highlight, style_prefix=self.base_style)
+
+
+class ReprHighlighter(RegexHighlighter):
+    """Highlights the text typically produced from ``__repr__`` methods."""
+
+    base_style = "repr."
+    highlights = [
+        r"(?P<tag_start>\<)(?P<tag_name>[\w\-\.\:]*)(?P<tag_contents>[\w\W]*?)(?P<tag_end>\>)",
+        r"(?P<attrib_name>[\w_]{1,50})=(?P<attrib_value>\"?[\w_]+\"?)?",
+        r"(?P<brace>[\{\[\(\)\]\}])",
+        _combine_regex(
+            r"(?P<ipv4>[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})",
+            r"(?P<ipv6>([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})",
+            r"(?P<eui64>(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})",
+            r"(?P<eui48>(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})",
+            r"(?P<call>[\w\.]*?)\(",
+            r"\b(?P<bool_true>True)\b|\b(?P<bool_false>False)\b|\b(?P<none>None)\b",
+            r"(?P<ellipsis>\.\.\.)",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            r"(?P<path>\B(\/[\w\.\-\_\+]+)*\/)(?P<filename>[\w\.\-\_\+]*)?",
+            r"(?<![\\\w])(?P<str>b?\'\'\'.*?(?<!\\)\'\'\'|b?\'.*?(?<!\\)\'|b?\"\"\".*?(?<!\\)\"\"\"|b?\".*?(?<!\\)\")",
+            r"(?P<uuid>[a-fA-F0-9]{8}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{12})",
+            r"(?P<url>(file|https|http|ws|wss):\/\/[0-9a-zA-Z\$\-\_\+\!`\(\)\,\.\?\/\;\:\&\=\%\#]*)",
+        ),
+    ]
+
+
+class JSONHighlighter(RegexHighlighter):
+    """Highlights JSON"""
+
+    base_style = "json."
+    highlights = [
+        _combine_regex(
+            r"(?P<brace>[\{\[\(\)\]\}])",
+            r"\b(?P<bool_true>true)\b|\b(?P<bool_false>false)\b|\b(?P<null>null)\b",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            r"(?<![\\\w])(?P<str>b?\".*?(?<!\\)\")",
+        ),
+        r"(?<![\\\w])(?P<key>b?\".*?(?<!\\)\")\:",
+    ]
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    console = Console()
+    console.print("[bold green]hello world![/bold green]")
+    console.print("'[bold green]hello world![/bold green]'")
+
+    console.print(" /foo")
+    console.print("/foo/")
+    console.print("/foo/bar")
+    console.print("foo/bar/baz")
+
+    console.print("/foo/bar/baz?foo=bar+egg&egg=baz")
+    console.print("/foo/bar/baz/")
+    console.print("/foo/bar/baz/egg")
+    console.print("/foo/bar/baz/egg.py")
+    console.print("/foo/bar/baz/egg.py word")
+    console.print(" /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/ba._++z/egg+.py word")
+    console.print("https://example.org?foo=bar#header")
+
+    console.print(1234567.34)
+    console.print(1 / 2)
+    console.print(-1 / 123123123123)
+
+    console.print(
+        "127.0.1.1 bar 192.168.1.4 2001:0db8:85a3:0000:0000:8a2e:0370:7334 foo"
+    )
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/jupyter.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/jupyter.py
new file mode 100644
index 0000000000000000000000000000000000000000..bedf5cb19a385c8b57c5d0e71a32da52f34a5e78
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/jupyter.py
@@ -0,0 +1,92 @@
+from typing import Any, Dict, Iterable, List
+
+from . import get_console
+from .segment import Segment
+from .terminal_theme import DEFAULT_TERMINAL_THEME
+
+JUPYTER_HTML_FORMAT = """\
+<pre style="white-space:pre;overflow-x:auto;line-height:normal;font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre>
+"""
+
+
+class JupyterRenderable:
+    """A shim to write html to Jupyter notebook."""
+
+    def __init__(self, html: str, text: str) -> None:
+        self.html = html
+        self.text = text
+
+    def _repr_mimebundle_(
+        self, include: Iterable[str], exclude: Iterable[str], **kwargs: Any
+    ) -> Dict[str, str]:
+        data = {"text/plain": self.text, "text/html": self.html}
+        if include:
+            data = {k: v for (k, v) in data.items() if k in include}
+        if exclude:
+            data = {k: v for (k, v) in data.items() if k not in exclude}
+        return data
+
+
+class JupyterMixin:
+    """Add to an Rich renderable to make it render in Jupyter notebook."""
+
+    __slots__ = ()
+
+    def _repr_mimebundle_(
+        self, include: Iterable[str], exclude: Iterable[str], **kwargs: Any
+    ) -> Dict[str, str]:
+        console = get_console()
+        segments = list(console.render(self, console.options))  # type: ignore
+        html = _render_segments(segments)
+        text = console._render_buffer(segments)
+        data = {"text/plain": text, "text/html": html}
+        if include:
+            data = {k: v for (k, v) in data.items() if k in include}
+        if exclude:
+            data = {k: v for (k, v) in data.items() if k not in exclude}
+        return data
+
+
+def _render_segments(segments: Iterable[Segment]) -> str:
+    def escape(text: str) -> str:
+        """Escape html."""
+        return text.replace("&", "&amp;").replace("<", "&lt;").replace(">", "&gt;")
+
+    fragments: List[str] = []
+    append_fragment = fragments.append
+    theme = DEFAULT_TERMINAL_THEME
+    for text, style, control in Segment.simplify(segments):
+        if control:
+            continue
+        text = escape(text)
+        if style:
+            rule = style.get_html_style(theme)
+            text = f'<span style="{rule}">{text}</span>' if rule else text
+            if style.link:
+                text = f'<a href="{style.link}">{text}</a>'
+        append_fragment(text)
+
+    code = "".join(fragments)
+    html = JUPYTER_HTML_FORMAT.format(code=code)
+
+    return html
+
+
+def display(segments: Iterable[Segment], text: str) -> None:
+    """Render segments to Jupyter."""
+    html = _render_segments(segments)
+    jupyter_renderable = JupyterRenderable(html, text)
+    try:
+        from IPython.display import display as ipython_display
+
+        ipython_display(jupyter_renderable)
+    except ModuleNotFoundError:
+        # Handle the case where the Console has force_jupyter=True,
+        # but IPython is not installed.
+        pass
+
+
+def print(*args: Any, **kwargs: Any) -> None:
+    """Proxy for Console print."""
+    console = get_console()
+    return console.print(*args, **kwargs)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/live.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/live.py
new file mode 100644
index 0000000000000000000000000000000000000000..6db5b605f907bd02911cd0f961dd5cab34a3e6fb
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/live.py
@@ -0,0 +1,365 @@
+import sys
+from threading import Event, RLock, Thread
+from types import TracebackType
+from typing import IO, Any, Callable, List, Optional, TextIO, Type, cast
+
+from . import get_console
+from .console import Console, ConsoleRenderable, RenderableType, RenderHook
+from .control import Control
+from .file_proxy import FileProxy
+from .jupyter import JupyterMixin
+from .live_render import LiveRender, VerticalOverflowMethod
+from .screen import Screen
+from .text import Text
+
+
+class _RefreshThread(Thread):
+    """A thread that calls refresh() at regular intervals."""
+
+    def __init__(self, live: "Live", refresh_per_second: float) -> None:
+        self.live = live
+        self.refresh_per_second = refresh_per_second
+        self.done = Event()
+        super().__init__(daemon=True)
+
+    def stop(self) -> None:
+        self.done.set()
+
+    def run(self) -> None:
+        while not self.done.wait(1 / self.refresh_per_second):
+            with self.live._lock:
+                if not self.done.is_set():
+                    self.live.refresh()
+
+
+class Live(JupyterMixin, RenderHook):
+    """Renders an auto-updating live display of any given renderable.
+
+    Args:
+        renderable (RenderableType, optional): The renderable to live display. Defaults to displaying nothing.
+        console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout.
+        screen (bool, optional): Enable alternate screen mode. Defaults to False.
+        auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()` or `update()` with refresh flag. Defaults to True
+        refresh_per_second (float, optional): Number of times per second to refresh the live display. Defaults to 4.
+        transient (bool, optional): Clear the renderable on exit (has no effect when screen=True). Defaults to False.
+        redirect_stdout (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True.
+        redirect_stderr (bool, optional): Enable redirection of stderr. Defaults to True.
+        vertical_overflow (VerticalOverflowMethod, optional): How to handle renderable when it is too tall for the console. Defaults to "ellipsis".
+        get_renderable (Callable[[], RenderableType], optional): Optional callable to get renderable. Defaults to None.
+    """
+
+    def __init__(
+        self,
+        renderable: Optional[RenderableType] = None,
+        *,
+        console: Optional[Console] = None,
+        screen: bool = False,
+        auto_refresh: bool = True,
+        refresh_per_second: float = 4,
+        transient: bool = False,
+        redirect_stdout: bool = True,
+        redirect_stderr: bool = True,
+        vertical_overflow: VerticalOverflowMethod = "ellipsis",
+        get_renderable: Optional[Callable[[], RenderableType]] = None,
+    ) -> None:
+        assert refresh_per_second > 0, "refresh_per_second must be > 0"
+        self._renderable = renderable
+        self.console = console if console is not None else get_console()
+        self._screen = screen
+        self._alt_screen = False
+
+        self._redirect_stdout = redirect_stdout
+        self._redirect_stderr = redirect_stderr
+        self._restore_stdout: Optional[IO[str]] = None
+        self._restore_stderr: Optional[IO[str]] = None
+
+        self._lock = RLock()
+        self.ipy_widget: Optional[Any] = None
+        self.auto_refresh = auto_refresh
+        self._started: bool = False
+        self.transient = True if screen else transient
+
+        self._refresh_thread: Optional[_RefreshThread] = None
+        self.refresh_per_second = refresh_per_second
+
+        self.vertical_overflow = vertical_overflow
+        self._get_renderable = get_renderable
+        self._live_render = LiveRender(
+            self.get_renderable(), vertical_overflow=vertical_overflow
+        )
+
+    @property
+    def is_started(self) -> bool:
+        """Check if live display has been started."""
+        return self._started
+
+    def get_renderable(self) -> RenderableType:
+        renderable = (
+            self._get_renderable()
+            if self._get_renderable is not None
+            else self._renderable
+        )
+        return renderable or ""
+
+    def start(self, refresh: bool = False) -> None:
+        """Start live rendering display.
+
+        Args:
+            refresh (bool, optional): Also refresh. Defaults to False.
+        """
+        with self._lock:
+            if self._started:
+                return
+            self.console.set_live(self)
+            self._started = True
+            if self._screen:
+                self._alt_screen = self.console.set_alt_screen(True)
+            self.console.show_cursor(False)
+            self._enable_redirect_io()
+            self.console.push_render_hook(self)
+            if refresh:
+                self.refresh()
+            if self.auto_refresh:
+                self._refresh_thread = _RefreshThread(self, self.refresh_per_second)
+                self._refresh_thread.start()
+
+    def stop(self) -> None:
+        """Stop live rendering display."""
+        with self._lock:
+            if not self._started:
+                return
+            self.console.clear_live()
+            self._started = False
+
+            if self.auto_refresh and self._refresh_thread is not None:
+                self._refresh_thread.stop()
+                self._refresh_thread = None
+            # allow it to fully render on the last even if overflow
+            self.vertical_overflow = "visible"
+            with self.console:
+                try:
+                    if not self._alt_screen and not self.console.is_jupyter:
+                        self.refresh()
+                finally:
+                    self._disable_redirect_io()
+                    self.console.pop_render_hook()
+                    if not self._alt_screen and self.console.is_terminal:
+                        self.console.line()
+                    self.console.show_cursor(True)
+                    if self._alt_screen:
+                        self.console.set_alt_screen(False)
+
+                    if self.transient and not self._alt_screen:
+                        self.console.control(self._live_render.restore_cursor())
+                    if self.ipy_widget is not None and self.transient:
+                        self.ipy_widget.close()  # pragma: no cover
+
+    def __enter__(self) -> "Live":
+        self.start(refresh=self._renderable is not None)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.stop()
+
+    def _enable_redirect_io(self) -> None:
+        """Enable redirecting of stdout / stderr."""
+        if self.console.is_terminal or self.console.is_jupyter:
+            if self._redirect_stdout and not isinstance(sys.stdout, FileProxy):
+                self._restore_stdout = sys.stdout
+                sys.stdout = cast("TextIO", FileProxy(self.console, sys.stdout))
+            if self._redirect_stderr and not isinstance(sys.stderr, FileProxy):
+                self._restore_stderr = sys.stderr
+                sys.stderr = cast("TextIO", FileProxy(self.console, sys.stderr))
+
+    def _disable_redirect_io(self) -> None:
+        """Disable redirecting of stdout / stderr."""
+        if self._restore_stdout:
+            sys.stdout = cast("TextIO", self._restore_stdout)
+            self._restore_stdout = None
+        if self._restore_stderr:
+            sys.stderr = cast("TextIO", self._restore_stderr)
+            self._restore_stderr = None
+
+    @property
+    def renderable(self) -> RenderableType:
+        """Get the renderable that is being displayed
+
+        Returns:
+            RenderableType: Displayed renderable.
+        """
+        renderable = self.get_renderable()
+        return Screen(renderable) if self._alt_screen else renderable
+
+    def update(self, renderable: RenderableType, *, refresh: bool = False) -> None:
+        """Update the renderable that is being displayed
+
+        Args:
+            renderable (RenderableType): New renderable to use.
+            refresh (bool, optional): Refresh the display. Defaults to False.
+        """
+        with self._lock:
+            self._renderable = renderable
+            if refresh:
+                self.refresh()
+
+    def refresh(self) -> None:
+        """Update the display of the Live Render."""
+        with self._lock:
+            self._live_render.set_renderable(self.renderable)
+            if self.console.is_jupyter:  # pragma: no cover
+                try:
+                    from IPython.display import display
+                    from ipywidgets import Output
+                except ImportError:
+                    import warnings
+
+                    warnings.warn('install "ipywidgets" for Jupyter support')
+                else:
+                    if self.ipy_widget is None:
+                        self.ipy_widget = Output()
+                        display(self.ipy_widget)
+
+                    with self.ipy_widget:
+                        self.ipy_widget.clear_output(wait=True)
+                        self.console.print(self._live_render.renderable)
+            elif self.console.is_terminal and not self.console.is_dumb_terminal:
+                with self.console:
+                    self.console.print(Control())
+            elif (
+                not self._started and not self.transient
+            ):  # if it is finished allow files or dumb-terminals to see final result
+                with self.console:
+                    self.console.print(Control())
+
+    def process_renderables(
+        self, renderables: List[ConsoleRenderable]
+    ) -> List[ConsoleRenderable]:
+        """Process renderables to restore cursor and display progress."""
+        self._live_render.vertical_overflow = self.vertical_overflow
+        if self.console.is_interactive:
+            # lock needs acquiring as user can modify live_render renderable at any time unlike in Progress.
+            with self._lock:
+                reset = (
+                    Control.home()
+                    if self._alt_screen
+                    else self._live_render.position_cursor()
+                )
+                renderables = [reset, *renderables, self._live_render]
+        elif (
+            not self._started and not self.transient
+        ):  # if it is finished render the final output for files or dumb_terminals
+            renderables = [*renderables, self._live_render]
+
+        return renderables
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import random
+    import time
+    from itertools import cycle
+    from typing import Dict, List, Tuple
+
+    from .align import Align
+    from .console import Console
+    from .live import Live as Live
+    from .panel import Panel
+    from .rule import Rule
+    from .syntax import Syntax
+    from .table import Table
+
+    console = Console()
+
+    syntax = Syntax(
+        '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:
+    """Iterate and generate a tuple with a flag for last value."""
+    iter_values = iter(values)
+    try:
+        previous_value = next(iter_values)
+    except StopIteration:
+        return
+    for value in iter_values:
+        yield False, previous_value
+        previous_value = value
+    yield True, previous_value''',
+        "python",
+        line_numbers=True,
+    )
+
+    table = Table("foo", "bar", "baz")
+    table.add_row("1", "2", "3")
+
+    progress_renderables = [
+        "You can make the terminal shorter and taller to see the live table hide"
+        "Text may be printed while the progress bars are rendering.",
+        Panel("In fact, [i]any[/i] renderable will work"),
+        "Such as [magenta]tables[/]...",
+        table,
+        "Pretty printed structures...",
+        {"type": "example", "text": "Pretty printed"},
+        "Syntax...",
+        syntax,
+        Rule("Give it a try!"),
+    ]
+
+    examples = cycle(progress_renderables)
+
+    exchanges = [
+        "SGD",
+        "MYR",
+        "EUR",
+        "USD",
+        "AUD",
+        "JPY",
+        "CNH",
+        "HKD",
+        "CAD",
+        "INR",
+        "DKK",
+        "GBP",
+        "RUB",
+        "NZD",
+        "MXN",
+        "IDR",
+        "TWD",
+        "THB",
+        "VND",
+    ]
+    with Live(console=console) as live_table:
+        exchange_rate_dict: Dict[Tuple[str, str], float] = {}
+
+        for index in range(100):
+            select_exchange = exchanges[index % len(exchanges)]
+
+            for exchange in exchanges:
+                if exchange == select_exchange:
+                    continue
+                time.sleep(0.4)
+                if random.randint(0, 10) < 1:
+                    console.log(next(examples))
+                exchange_rate_dict[(select_exchange, exchange)] = 200 / (
+                    (random.random() * 320) + 1
+                )
+                if len(exchange_rate_dict) > len(exchanges) - 1:
+                    exchange_rate_dict.pop(list(exchange_rate_dict.keys())[0])
+                table = Table(title="Exchange Rates")
+
+                table.add_column("Source Currency")
+                table.add_column("Destination Currency")
+                table.add_column("Exchange Rate")
+
+                for ((source, dest), exchange_rate) in exchange_rate_dict.items():
+                    table.add_row(
+                        source,
+                        dest,
+                        Text(
+                            f"{exchange_rate:.4f}",
+                            style="red" if exchange_rate < 1.0 else "green",
+                        ),
+                    )
+
+                live_table.update(Align.center(table))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/live_render.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/live_render.py
new file mode 100644
index 0000000000000000000000000000000000000000..b90fbf7f35097694f727e201b0b378942d70a443
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/live_render.py
@@ -0,0 +1,113 @@
+import sys
+from typing import Optional, Tuple
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+
+from ._loop import loop_last
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .control import Control
+from .segment import ControlType, Segment
+from .style import StyleType
+from .text import Text
+
+VerticalOverflowMethod = Literal["crop", "ellipsis", "visible"]
+
+
+class LiveRender:
+    """Creates a renderable that may be updated.
+
+    Args:
+        renderable (RenderableType): Any renderable object.
+        style (StyleType, optional): An optional style to apply to the renderable. Defaults to "".
+    """
+
+    def __init__(
+        self,
+        renderable: RenderableType,
+        style: StyleType = "",
+        vertical_overflow: VerticalOverflowMethod = "ellipsis",
+    ) -> None:
+        self.renderable = renderable
+        self.style = style
+        self.vertical_overflow = vertical_overflow
+        self._shape: Optional[Tuple[int, int]] = None
+
+    def set_renderable(self, renderable: RenderableType) -> None:
+        """Set a new renderable.
+
+        Args:
+            renderable (RenderableType): Any renderable object, including str.
+        """
+        self.renderable = renderable
+
+    def position_cursor(self) -> Control:
+        """Get control codes to move cursor to beginning of live render.
+
+        Returns:
+            Control: A control instance that may be printed.
+        """
+        if self._shape is not None:
+            _, height = self._shape
+            return Control(
+                ControlType.CARRIAGE_RETURN,
+                (ControlType.ERASE_IN_LINE, 2),
+                *(
+                    (
+                        (ControlType.CURSOR_UP, 1),
+                        (ControlType.ERASE_IN_LINE, 2),
+                    )
+                    * (height - 1)
+                )
+            )
+        return Control()
+
+    def restore_cursor(self) -> Control:
+        """Get control codes to clear the render and restore the cursor to its previous position.
+
+        Returns:
+            Control: A Control instance that may be printed.
+        """
+        if self._shape is not None:
+            _, height = self._shape
+            return Control(
+                ControlType.CARRIAGE_RETURN,
+                *((ControlType.CURSOR_UP, 1), (ControlType.ERASE_IN_LINE, 2)) * height
+            )
+        return Control()
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        renderable = self.renderable
+        style = console.get_style(self.style)
+        lines = console.render_lines(renderable, options, style=style, pad=False)
+        shape = Segment.get_shape(lines)
+
+        _, height = shape
+        if height > options.size.height:
+            if self.vertical_overflow == "crop":
+                lines = lines[: options.size.height]
+                shape = Segment.get_shape(lines)
+            elif self.vertical_overflow == "ellipsis":
+                lines = lines[: (options.size.height - 1)]
+                overflow_text = Text(
+                    "...",
+                    overflow="crop",
+                    justify="center",
+                    end="",
+                    style="live.ellipsis",
+                )
+                lines.append(list(console.render(overflow_text)))
+                shape = Segment.get_shape(lines)
+        self._shape = shape
+
+        new_line = Segment.line()
+        for last, line in loop_last(lines):
+            yield from line
+            if not last:
+                yield new_line
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/logging.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/logging.py
new file mode 100644
index 0000000000000000000000000000000000000000..002f1f7bf1c6857bdcce388f78ac1e415ef8d3f5
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/logging.py
@@ -0,0 +1,268 @@
+import logging
+from datetime import datetime
+from logging import Handler, LogRecord
+from pathlib import Path
+from typing import ClassVar, List, Optional, Type, Union
+
+from . import get_console
+from ._log_render import LogRender, FormatTimeCallable
+from .console import Console, ConsoleRenderable
+from .highlighter import Highlighter, ReprHighlighter
+from .text import Text
+from .traceback import Traceback
+
+
+class RichHandler(Handler):
+    """A logging handler that renders output with Rich. The time / level / message and file are displayed in columns.
+    The level is color coded, and the message is syntax highlighted.
+
+    Note:
+        Be careful when enabling console markup in log messages if you have configured logging for libraries not
+        under your control. If a dependency writes messages containing square brackets, it may not produce the intended output.
+
+    Args:
+        level (Union[int, str], optional): Log level. Defaults to logging.NOTSET.
+        console (:class:`~rich.console.Console`, optional): Optional console instance to write logs.
+            Default will use a global console instance writing to stdout.
+        show_time (bool, optional): Show a column for the time. Defaults to True.
+        omit_repeated_times (bool, optional): Omit repetition of the same time. Defaults to True.
+        show_level (bool, optional): Show a column for the level. Defaults to True.
+        show_path (bool, optional): Show the path to the original log call. Defaults to True.
+        enable_link_path (bool, optional): Enable terminal link of path column to file. Defaults to True.
+        highlighter (Highlighter, optional): Highlighter to style log messages, or None to use ReprHighlighter. Defaults to None.
+        markup (bool, optional): Enable console markup in log messages. Defaults to False.
+        rich_tracebacks (bool, optional): Enable rich tracebacks with syntax highlighting and formatting. Defaults to False.
+        tracebacks_width (Optional[int], optional): Number of characters used to render tracebacks, or None for full width. Defaults to None.
+        tracebacks_extra_lines (int, optional): Additional lines of code to render tracebacks, or None for full width. Defaults to None.
+        tracebacks_theme (str, optional): Override pygments theme used in traceback.
+        tracebacks_word_wrap (bool, optional): Enable word wrapping of long tracebacks lines. Defaults to True.
+        tracebacks_show_locals (bool, optional): Enable display of locals in tracebacks. Defaults to False.
+        locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to 10.
+        locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+        log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%x %X] ".
+    """
+
+    KEYWORDS: ClassVar[Optional[List[str]]] = [
+        "GET",
+        "POST",
+        "HEAD",
+        "PUT",
+        "DELETE",
+        "OPTIONS",
+        "TRACE",
+        "PATCH",
+    ]
+    HIGHLIGHTER_CLASS: ClassVar[Type[Highlighter]] = ReprHighlighter
+
+    def __init__(
+        self,
+        level: Union[int, str] = logging.NOTSET,
+        console: Optional[Console] = None,
+        *,
+        show_time: bool = True,
+        omit_repeated_times: bool = True,
+        show_level: bool = True,
+        show_path: bool = True,
+        enable_link_path: bool = True,
+        highlighter: Optional[Highlighter] = None,
+        markup: bool = False,
+        rich_tracebacks: bool = False,
+        tracebacks_width: Optional[int] = None,
+        tracebacks_extra_lines: int = 3,
+        tracebacks_theme: Optional[str] = None,
+        tracebacks_word_wrap: bool = True,
+        tracebacks_show_locals: bool = False,
+        locals_max_length: int = 10,
+        locals_max_string: int = 80,
+        log_time_format: Union[str, FormatTimeCallable] = "[%x %X]",
+    ) -> None:
+        super().__init__(level=level)
+        self.console = console or get_console()
+        self.highlighter = highlighter or self.HIGHLIGHTER_CLASS()
+        self._log_render = LogRender(
+            show_time=show_time,
+            show_level=show_level,
+            show_path=show_path,
+            time_format=log_time_format,
+            omit_repeated_times=omit_repeated_times,
+            level_width=None,
+        )
+        self.enable_link_path = enable_link_path
+        self.markup = markup
+        self.rich_tracebacks = rich_tracebacks
+        self.tracebacks_width = tracebacks_width
+        self.tracebacks_extra_lines = tracebacks_extra_lines
+        self.tracebacks_theme = tracebacks_theme
+        self.tracebacks_word_wrap = tracebacks_word_wrap
+        self.tracebacks_show_locals = tracebacks_show_locals
+        self.locals_max_length = locals_max_length
+        self.locals_max_string = locals_max_string
+
+    def get_level_text(self, record: LogRecord) -> Text:
+        """Get the level name from the record.
+
+        Args:
+            record (LogRecord): LogRecord instance.
+
+        Returns:
+            Text: A tuple of the style and level name.
+        """
+        level_name = record.levelname
+        level_text = Text.styled(
+            level_name.ljust(8), f"logging.level.{level_name.lower()}"
+        )
+        return level_text
+
+    def emit(self, record: LogRecord) -> None:
+        """Invoked by logging."""
+        message = self.format(record)
+        traceback = None
+        if (
+            self.rich_tracebacks
+            and record.exc_info
+            and record.exc_info != (None, None, None)
+        ):
+            exc_type, exc_value, exc_traceback = record.exc_info
+            assert exc_type is not None
+            assert exc_value is not None
+            traceback = Traceback.from_exception(
+                exc_type,
+                exc_value,
+                exc_traceback,
+                width=self.tracebacks_width,
+                extra_lines=self.tracebacks_extra_lines,
+                theme=self.tracebacks_theme,
+                word_wrap=self.tracebacks_word_wrap,
+                show_locals=self.tracebacks_show_locals,
+                locals_max_length=self.locals_max_length,
+                locals_max_string=self.locals_max_string,
+            )
+            message = record.getMessage()
+            if self.formatter:
+                record.message = record.getMessage()
+                formatter = self.formatter
+                if hasattr(formatter, "usesTime") and formatter.usesTime():
+                    record.asctime = formatter.formatTime(record, formatter.datefmt)
+                message = formatter.formatMessage(record)
+
+        message_renderable = self.render_message(record, message)
+        log_renderable = self.render(
+            record=record, traceback=traceback, message_renderable=message_renderable
+        )
+        try:
+            self.console.print(log_renderable)
+        except Exception:
+            self.handleError(record)
+
+    def render_message(self, record: LogRecord, message: str) -> "ConsoleRenderable":
+        """Render message text in to Text.
+
+        record (LogRecord): logging Record.
+        message (str): String containing log message.
+
+        Returns:
+            ConsoleRenderable: Renderable to display log message.
+        """
+        use_markup = getattr(record, "markup", self.markup)
+        message_text = Text.from_markup(message) if use_markup else Text(message)
+
+        highlighter = getattr(record, "highlighter", self.highlighter)
+        if highlighter:
+            message_text = highlighter(message_text)
+
+        if self.KEYWORDS:
+            message_text.highlight_words(self.KEYWORDS, "logging.keyword")
+        return message_text
+
+    def render(
+        self,
+        *,
+        record: LogRecord,
+        traceback: Optional[Traceback],
+        message_renderable: "ConsoleRenderable",
+    ) -> "ConsoleRenderable":
+        """Render log for display.
+
+        Args:
+            record (LogRecord): logging Record.
+            traceback (Optional[Traceback]): Traceback instance or None for no Traceback.
+            message_renderable (ConsoleRenderable): Renderable (typically Text) containing log message contents.
+
+        Returns:
+            ConsoleRenderable: Renderable to display log.
+        """
+        path = Path(record.pathname).name
+        level = self.get_level_text(record)
+        time_format = None if self.formatter is None else self.formatter.datefmt
+        log_time = datetime.fromtimestamp(record.created)
+
+        log_renderable = self._log_render(
+            self.console,
+            [message_renderable] if not traceback else [message_renderable, traceback],
+            log_time=log_time,
+            time_format=time_format,
+            level=level,
+            path=path,
+            line_no=record.lineno,
+            link_path=record.pathname if self.enable_link_path else None,
+        )
+        return log_renderable
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from time import sleep
+
+    FORMAT = "%(message)s"
+    # FORMAT = "%(asctime)-15s - %(levelname)s - %(message)s"
+    logging.basicConfig(
+        level="NOTSET",
+        format=FORMAT,
+        datefmt="[%X]",
+        handlers=[RichHandler(rich_tracebacks=True, tracebacks_show_locals=True)],
+    )
+    log = logging.getLogger("rich")
+
+    log.info("Server starting...")
+    log.info("Listening on http://127.0.0.1:8080")
+    sleep(1)
+
+    log.info("GET /index.html 200 1298")
+    log.info("GET /imgs/backgrounds/back1.jpg 200 54386")
+    log.info("GET /css/styles.css 200 54386")
+    log.warning("GET /favicon.ico 404 242")
+    sleep(1)
+
+    log.debug(
+        "JSONRPC request\n--> %r\n<-- %r",
+        {
+            "version": "1.1",
+            "method": "confirmFruitPurchase",
+            "params": [["apple", "orange", "mangoes", "pomelo"], 1.123],
+            "id": "194521489",
+        },
+        {"version": "1.1", "result": True, "error": None, "id": "194521489"},
+    )
+    log.debug(
+        "Loading configuration file /adasd/asdasd/qeqwe/qwrqwrqwr/sdgsdgsdg/werwerwer/dfgerert/ertertert/ertetert/werwerwer"
+    )
+    log.error("Unable to find 'pomelo' in database!")
+    log.info("POST /jsonrpc/ 200 65532")
+    log.info("POST /admin/ 401 42234")
+    log.warning("password was rejected for admin site.")
+
+    def divide() -> None:
+        number = 1
+        divisor = 0
+        foos = ["foo"] * 100
+        log.debug("in divide")
+        try:
+            number / divisor
+        except:
+            log.exception("An error of some kind occurred!")
+
+    divide()
+    sleep(1)
+    log.critical("Out of memory!")
+    log.info("Server exited with code=-1")
+    log.info("[bold]EXITING...[/bold]", extra=dict(markup=True))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/markup.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/markup.py
new file mode 100644
index 0000000000000000000000000000000000000000..619540202cb554f93112b7779c235cf5309d499f
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/markup.py
@@ -0,0 +1,244 @@
+from ast import literal_eval
+from operator import attrgetter
+import re
+from typing import Callable, Iterable, List, Match, NamedTuple, Optional, Tuple, Union
+
+from .errors import MarkupError
+from .style import Style
+from .text import Span, Text
+from .emoji import EmojiVariant
+from ._emoji_replace import _emoji_replace
+
+
+RE_TAGS = re.compile(
+    r"""((\\*)\[([a-z#\/@].*?)\])""",
+    re.VERBOSE,
+)
+
+RE_HANDLER = re.compile(r"^([\w\.]*?)(\(.*?\))?$")
+
+
+class Tag(NamedTuple):
+    """A tag in console markup."""
+
+    name: str
+    """The tag name. e.g. 'bold'."""
+    parameters: Optional[str]
+    """Any additional parameters after the name."""
+
+    def __str__(self) -> str:
+        return (
+            self.name if self.parameters is None else f"{self.name} {self.parameters}"
+        )
+
+    @property
+    def markup(self) -> str:
+        """Get the string representation of this tag."""
+        return (
+            f"[{self.name}]"
+            if self.parameters is None
+            else f"[{self.name}={self.parameters}]"
+        )
+
+
+_ReStringMatch = Match[str]  # regex match object
+_ReSubCallable = Callable[[_ReStringMatch], str]  # Callable invoked by re.sub
+_EscapeSubMethod = Callable[[_ReSubCallable, str], str]  # Sub method of a compiled re
+
+
+def escape(
+    markup: str, _escape: _EscapeSubMethod = re.compile(r"(\\*)(\[[a-z#\/@].*?\])").sub
+) -> str:
+    """Escapes text so that it won't be interpreted as markup.
+
+    Args:
+        markup (str): Content to be inserted in to markup.
+
+    Returns:
+        str: Markup with square brackets escaped.
+    """
+
+    def escape_backslashes(match: Match[str]) -> str:
+        """Called by re.sub replace matches."""
+        backslashes, text = match.groups()
+        return f"{backslashes}{backslashes}\\{text}"
+
+    markup = _escape(escape_backslashes, markup)
+    return markup
+
+
+def _parse(markup: str) -> Iterable[Tuple[int, Optional[str], Optional[Tag]]]:
+    """Parse markup in to an iterable of tuples of (position, text, tag).
+
+    Args:
+        markup (str): A string containing console markup
+
+    """
+    position = 0
+    _divmod = divmod
+    _Tag = Tag
+    for match in RE_TAGS.finditer(markup):
+        full_text, escapes, tag_text = match.groups()
+        start, end = match.span()
+        if start > position:
+            yield start, markup[position:start], None
+        if escapes:
+            backslashes, escaped = _divmod(len(escapes), 2)
+            if backslashes:
+                # Literal backslashes
+                yield start, "\\" * backslashes, None
+                start += backslashes * 2
+            if escaped:
+                # Escape of tag
+                yield start, full_text[len(escapes) :], None
+                position = end
+                continue
+        text, equals, parameters = tag_text.partition("=")
+        yield start, None, _Tag(text, parameters if equals else None)
+        position = end
+    if position < len(markup):
+        yield position, markup[position:], None
+
+
+def render(
+    markup: str,
+    style: Union[str, Style] = "",
+    emoji: bool = True,
+    emoji_variant: Optional[EmojiVariant] = None,
+) -> Text:
+    """Render console markup in to a Text instance.
+
+    Args:
+        markup (str): A string containing console markup.
+        emoji (bool, optional): Also render emoji code. Defaults to True.
+
+    Raises:
+        MarkupError: If there is a syntax error in the markup.
+
+    Returns:
+        Text: A test instance.
+    """
+    emoji_replace = _emoji_replace
+    if "[" not in markup:
+        return Text(
+            emoji_replace(markup, default_variant=emoji_variant) if emoji else markup,
+            style=style,
+        )
+    text = Text(style=style)
+    append = text.append
+    normalize = Style.normalize
+
+    style_stack: List[Tuple[int, Tag]] = []
+    pop = style_stack.pop
+
+    spans: List[Span] = []
+    append_span = spans.append
+
+    _Span = Span
+    _Tag = Tag
+
+    def pop_style(style_name: str) -> Tuple[int, Tag]:
+        """Pop tag matching given style name."""
+        for index, (_, tag) in enumerate(reversed(style_stack), 1):
+            if tag.name == style_name:
+                return pop(-index)
+        raise KeyError(style_name)
+
+    for position, plain_text, tag in _parse(markup):
+        if plain_text is not None:
+            append(emoji_replace(plain_text) if emoji else plain_text)
+        elif tag is not None:
+            if tag.name.startswith("/"):  # Closing tag
+                style_name = tag.name[1:].strip()
+
+                if style_name:  # explicit close
+                    style_name = normalize(style_name)
+                    try:
+                        start, open_tag = pop_style(style_name)
+                    except KeyError:
+                        raise MarkupError(
+                            f"closing tag '{tag.markup}' at position {position} doesn't match any open tag"
+                        ) from None
+                else:  # implicit close
+                    try:
+                        start, open_tag = pop()
+                    except IndexError:
+                        raise MarkupError(
+                            f"closing tag '[/]' at position {position} has nothing to close"
+                        ) from None
+
+                if open_tag.name.startswith("@"):
+                    if open_tag.parameters:
+                        handler_name = ""
+                        parameters = open_tag.parameters.strip()
+                        handler_match = RE_HANDLER.match(parameters)
+                        if handler_match is not None:
+                            handler_name, match_parameters = handler_match.groups()
+                            parameters = (
+                                "()" if match_parameters is None else match_parameters
+                            )
+
+                        try:
+                            meta_params = literal_eval(parameters)
+                        except SyntaxError as error:
+                            raise MarkupError(
+                                f"error parsing {parameters!r} in {open_tag.parameters!r}; {error.msg}"
+                            )
+                        except Exception as error:
+                            raise MarkupError(
+                                f"error parsing {open_tag.parameters!r}; {error}"
+                            ) from None
+
+                        if handler_name:
+                            meta_params = (
+                                handler_name,
+                                meta_params
+                                if isinstance(meta_params, tuple)
+                                else (meta_params,),
+                            )
+
+                    else:
+                        meta_params = ()
+
+                    append_span(
+                        _Span(
+                            start, len(text), Style(meta={open_tag.name: meta_params})
+                        )
+                    )
+                else:
+                    append_span(_Span(start, len(text), str(open_tag)))
+
+            else:  # Opening tag
+                normalized_tag = _Tag(normalize(tag.name), tag.parameters)
+                style_stack.append((len(text), normalized_tag))
+
+    text_length = len(text)
+    while style_stack:
+        start, tag = style_stack.pop()
+        style = str(tag)
+        if style:
+            append_span(_Span(start, text_length, style))
+
+    text.spans = sorted(spans[::-1], key=attrgetter("start"))
+    return text
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    MARKUP = [
+        "[red]Hello World[/red]",
+        "[magenta]Hello [b]World[/b]",
+        "[bold]Bold[italic] bold and italic [/bold]italic[/italic]",
+        "Click [link=https://www.willmcgugan.com]here[/link] to visit my Blog",
+        ":warning-emoji: [bold red blink] DANGER![/]",
+    ]
+
+    from pip._vendor.rich.table import Table
+    from pip._vendor.rich import print
+
+    grid = Table("Markup", "Result", padding=(0, 1))
+
+    for markup in MARKUP:
+        grid.add_row(Text(markup), markup)
+
+    print(grid)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/padding.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/padding.py
new file mode 100644
index 0000000000000000000000000000000000000000..1b2204f59f2ce4d9c8f2cca85326e4d81f8805bb
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/padding.py
@@ -0,0 +1,141 @@
+from typing import cast, List, Optional, Tuple, TYPE_CHECKING, Union
+
+if TYPE_CHECKING:
+    from .console import (
+        Console,
+        ConsoleOptions,
+        RenderableType,
+        RenderResult,
+    )
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .style import Style
+from .segment import Segment
+
+
+PaddingDimensions = Union[int, Tuple[int], Tuple[int, int], Tuple[int, int, int, int]]
+
+
+class Padding(JupyterMixin):
+    """Draw space around content.
+
+    Example:
+        >>> print(Padding("Hello", (2, 4), style="on blue"))
+
+    Args:
+        renderable (RenderableType): String or other renderable.
+        pad (Union[int, Tuple[int]]): Padding for top, right, bottom, and left borders.
+            May be specified with 1, 2, or 4 integers (CSS style).
+        style (Union[str, Style], optional): Style for padding characters. Defaults to "none".
+        expand (bool, optional): Expand padding to fit available width. Defaults to True.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        pad: "PaddingDimensions" = (0, 0, 0, 0),
+        *,
+        style: Union[str, Style] = "none",
+        expand: bool = True,
+    ):
+        self.renderable = renderable
+        self.top, self.right, self.bottom, self.left = self.unpack(pad)
+        self.style = style
+        self.expand = expand
+
+    @classmethod
+    def indent(cls, renderable: "RenderableType", level: int) -> "Padding":
+        """Make padding instance to render an indent.
+
+        Args:
+            renderable (RenderableType): String or other renderable.
+            level (int): Number of characters to indent.
+
+        Returns:
+            Padding: A Padding instance.
+        """
+
+        return Padding(renderable, pad=(0, 0, 0, level), expand=False)
+
+    @staticmethod
+    def unpack(pad: "PaddingDimensions") -> Tuple[int, int, int, int]:
+        """Unpack padding specified in CSS style."""
+        if isinstance(pad, int):
+            return (pad, pad, pad, pad)
+        if len(pad) == 1:
+            _pad = pad[0]
+            return (_pad, _pad, _pad, _pad)
+        if len(pad) == 2:
+            pad_top, pad_right = cast(Tuple[int, int], pad)
+            return (pad_top, pad_right, pad_top, pad_right)
+        if len(pad) == 4:
+            top, right, bottom, left = cast(Tuple[int, int, int, int], pad)
+            return (top, right, bottom, left)
+        raise ValueError(f"1, 2 or 4 integers required for padding; {len(pad)} given")
+
+    def __repr__(self) -> str:
+        return f"Padding({self.renderable!r}, ({self.top},{self.right},{self.bottom},{self.left}))"
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        style = console.get_style(self.style)
+        if self.expand:
+            width = options.max_width
+        else:
+            width = min(
+                Measurement.get(console, options, self.renderable).maximum
+                + self.left
+                + self.right,
+                options.max_width,
+            )
+        render_options = options.update_width(width - self.left - self.right)
+        if render_options.height is not None:
+            render_options = render_options.update_height(
+                height=render_options.height - self.top - self.bottom
+            )
+        lines = console.render_lines(
+            self.renderable, render_options, style=style, pad=True
+        )
+        _Segment = Segment
+
+        left = _Segment(" " * self.left, style) if self.left else None
+        right = (
+            [_Segment(f'{" " * self.right}', style), _Segment.line()]
+            if self.right
+            else [_Segment.line()]
+        )
+        blank_line: Optional[List[Segment]] = None
+        if self.top:
+            blank_line = [_Segment(f'{" " * width}\n', style)]
+            yield from blank_line * self.top
+        if left:
+            for line in lines:
+                yield left
+                yield from line
+                yield from right
+        else:
+            for line in lines:
+                yield from line
+                yield from right
+        if self.bottom:
+            blank_line = blank_line or [_Segment(f'{" " * width}\n', style)]
+            yield from blank_line * self.bottom
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        max_width = options.max_width
+        extra_width = self.left + self.right
+        if max_width - extra_width < 1:
+            return Measurement(max_width, max_width)
+        measure_min, measure_max = Measurement.get(console, options, self.renderable)
+        measurement = Measurement(measure_min + extra_width, measure_max + extra_width)
+        measurement = measurement.with_maximum(max_width)
+        return measurement
+
+
+if __name__ == "__main__":  #  pragma: no cover
+    from pip._vendor.rich import print
+
+    print(Padding("Hello, World", (2, 4), style="on blue"))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/pager.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/pager.py
new file mode 100644
index 0000000000000000000000000000000000000000..dbfb973e368c56013386d8a75585b99297d48b4b
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/pager.py
@@ -0,0 +1,34 @@
+from abc import ABC, abstractmethod
+from typing import Any, Callable
+
+
+class Pager(ABC):
+    """Base class for a pager."""
+
+    @abstractmethod
+    def show(self, content: str) -> None:
+        """Show content in pager.
+
+        Args:
+            content (str): Content to be displayed.
+        """
+
+
+class SystemPager(Pager):
+    """Uses the pager installed on the system."""
+
+    def _pager(self, content: str) -> Any:  #  pragma: no cover
+        return __import__("pydoc").pager(content)
+
+    def show(self, content: str) -> None:
+        """Use the same pager used by pydoc."""
+        self._pager(content)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .__main__ import make_test_card
+    from .console import Console
+
+    console = Console()
+    with console.pager(styles=True):
+        console.print(make_test_card())
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/palette.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/palette.py
new file mode 100644
index 0000000000000000000000000000000000000000..fa0c4dd40381addf5b42fae4228b6d8fef03abd9
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/palette.py
@@ -0,0 +1,100 @@
+from math import sqrt
+from functools import lru_cache
+from typing import Sequence, Tuple, TYPE_CHECKING
+
+from .color_triplet import ColorTriplet
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.table import Table
+
+
+class Palette:
+    """A palette of available colors."""
+
+    def __init__(self, colors: Sequence[Tuple[int, int, int]]):
+        self._colors = colors
+
+    def __getitem__(self, number: int) -> ColorTriplet:
+        return ColorTriplet(*self._colors[number])
+
+    def __rich__(self) -> "Table":
+        from pip._vendor.rich.color import Color
+        from pip._vendor.rich.style import Style
+        from pip._vendor.rich.text import Text
+        from pip._vendor.rich.table import Table
+
+        table = Table(
+            "index",
+            "RGB",
+            "Color",
+            title="Palette",
+            caption=f"{len(self._colors)} colors",
+            highlight=True,
+            caption_justify="right",
+        )
+        for index, color in enumerate(self._colors):
+            table.add_row(
+                str(index),
+                repr(color),
+                Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))),
+            )
+        return table
+
+    # This is somewhat inefficient and needs caching
+    @lru_cache(maxsize=1024)
+    def match(self, color: Tuple[int, int, int]) -> int:
+        """Find a color from a palette that most closely matches a given color.
+
+        Args:
+            color (Tuple[int, int, int]): RGB components in range 0 > 255.
+
+        Returns:
+            int: Index of closes matching color.
+        """
+        red1, green1, blue1 = color
+        _sqrt = sqrt
+        get_color = self._colors.__getitem__
+
+        def get_color_distance(index: int) -> float:
+            """Get the distance to a color."""
+            red2, green2, blue2 = get_color(index)
+            red_mean = (red1 + red2) // 2
+            red = red1 - red2
+            green = green1 - green2
+            blue = blue1 - blue2
+            return _sqrt(
+                (((512 + red_mean) * red * red) >> 8)
+                + 4 * green * green
+                + (((767 - red_mean) * blue * blue) >> 8)
+            )
+
+        min_index = min(range(len(self._colors)), key=get_color_distance)
+        return min_index
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import colorsys
+    from typing import Iterable
+    from pip._vendor.rich.color import Color
+    from pip._vendor.rich.console import Console, ConsoleOptions
+    from pip._vendor.rich.segment import Segment
+    from pip._vendor.rich.style import Style
+
+    class ColorBox:
+        def __rich_console__(
+            self, console: Console, options: ConsoleOptions
+        ) -> Iterable[Segment]:
+            height = console.size.height - 3
+            for y in range(0, height):
+                for x in range(options.max_width):
+                    h = x / options.max_width
+                    l = y / (height + 1)
+                    r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0)
+                    r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0)
+                    bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255)
+                    color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255)
+                    yield Segment("▄", Style(color=color, bgcolor=bgcolor))
+                yield Segment.line()
+
+    console = Console()
+    console.print(ColorBox())
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/panel.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/panel.py
new file mode 100644
index 0000000000000000000000000000000000000000..151fe5f017f855f7df0150508ec0fb53f15abb60
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/panel.py
@@ -0,0 +1,250 @@
+from typing import Optional, TYPE_CHECKING
+
+from .box import Box, ROUNDED
+
+from .align import AlignMethod
+from .jupyter import JupyterMixin
+from .measure import Measurement, measure_renderables
+from .padding import Padding, PaddingDimensions
+from .style import StyleType
+from .text import Text, TextType
+from .segment import Segment
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+
+class Panel(JupyterMixin):
+    """A console renderable that draws a border around its contents.
+
+    Example:
+        >>> console.print(Panel("Hello, World!"))
+
+    Args:
+        renderable (RenderableType): A console renderable object.
+        box (Box, optional): A Box instance that defines the look of the border (see :ref:`appendix_box`.
+            Defaults to box.ROUNDED.
+        safe_box (bool, optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True.
+        expand (bool, optional): If True the panel will stretch to fill the console
+            width, otherwise it will be sized to fit the contents. Defaults to True.
+        style (str, optional): The style of the panel (border and contents). Defaults to "none".
+        border_style (str, optional): The style of the border. Defaults to "none".
+        width (Optional[int], optional): Optional width of panel. Defaults to None to auto-detect.
+        height (Optional[int], optional): Optional height of panel. Defaults to None to auto-detect.
+        padding (Optional[PaddingDimensions]): Optional padding around renderable. Defaults to 0.
+        highlight (bool, optional): Enable automatic highlighting of panel title (if str). Defaults to False.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        box: Box = ROUNDED,
+        *,
+        title: Optional[TextType] = None,
+        title_align: AlignMethod = "center",
+        subtitle: Optional[TextType] = None,
+        subtitle_align: AlignMethod = "center",
+        safe_box: Optional[bool] = None,
+        expand: bool = True,
+        style: StyleType = "none",
+        border_style: StyleType = "none",
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        padding: PaddingDimensions = (0, 1),
+        highlight: bool = False,
+    ) -> None:
+        self.renderable = renderable
+        self.box = box
+        self.title = title
+        self.title_align: AlignMethod = title_align
+        self.subtitle = subtitle
+        self.subtitle_align = subtitle_align
+        self.safe_box = safe_box
+        self.expand = expand
+        self.style = style
+        self.border_style = border_style
+        self.width = width
+        self.height = height
+        self.padding = padding
+        self.highlight = highlight
+
+    @classmethod
+    def fit(
+        cls,
+        renderable: "RenderableType",
+        box: Box = ROUNDED,
+        *,
+        title: Optional[TextType] = None,
+        title_align: AlignMethod = "center",
+        subtitle: Optional[TextType] = None,
+        subtitle_align: AlignMethod = "center",
+        safe_box: Optional[bool] = None,
+        style: StyleType = "none",
+        border_style: StyleType = "none",
+        width: Optional[int] = None,
+        padding: PaddingDimensions = (0, 1),
+    ) -> "Panel":
+        """An alternative constructor that sets expand=False."""
+        return cls(
+            renderable,
+            box,
+            title=title,
+            title_align=title_align,
+            subtitle=subtitle,
+            subtitle_align=subtitle_align,
+            safe_box=safe_box,
+            style=style,
+            border_style=border_style,
+            width=width,
+            padding=padding,
+            expand=False,
+        )
+
+    @property
+    def _title(self) -> Optional[Text]:
+        if self.title:
+            title_text = (
+                Text.from_markup(self.title)
+                if isinstance(self.title, str)
+                else self.title.copy()
+            )
+            title_text.end = ""
+            title_text.plain = title_text.plain.replace("\n", " ")
+            title_text.no_wrap = True
+            title_text.expand_tabs()
+            title_text.pad(1)
+            return title_text
+        return None
+
+    @property
+    def _subtitle(self) -> Optional[Text]:
+        if self.subtitle:
+            subtitle_text = (
+                Text.from_markup(self.subtitle)
+                if isinstance(self.subtitle, str)
+                else self.subtitle.copy()
+            )
+            subtitle_text.end = ""
+            subtitle_text.plain = subtitle_text.plain.replace("\n", " ")
+            subtitle_text.no_wrap = True
+            subtitle_text.expand_tabs()
+            subtitle_text.pad(1)
+            return subtitle_text
+        return None
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        _padding = Padding.unpack(self.padding)
+        renderable = (
+            Padding(self.renderable, _padding) if any(_padding) else self.renderable
+        )
+        style = console.get_style(self.style)
+        border_style = style + console.get_style(self.border_style)
+        width = (
+            options.max_width
+            if self.width is None
+            else min(options.max_width, self.width)
+        )
+
+        safe_box: bool = console.safe_box if self.safe_box is None else self.safe_box
+        box = self.box.substitute(options, safe=safe_box)
+
+        title_text = self._title
+        if title_text is not None:
+            title_text.style = border_style
+
+        child_width = (
+            width - 2
+            if self.expand
+            else console.measure(
+                renderable, options=options.update_width(width - 2)
+            ).maximum
+        )
+        child_height = self.height or options.height or None
+        if child_height:
+            child_height -= 2
+        if title_text is not None:
+            child_width = min(
+                options.max_width - 2, max(child_width, title_text.cell_len + 2)
+            )
+
+        width = child_width + 2
+        child_options = options.update(
+            width=child_width, height=child_height, highlight=self.highlight
+        )
+        lines = console.render_lines(renderable, child_options, style=style)
+
+        line_start = Segment(box.mid_left, border_style)
+        line_end = Segment(f"{box.mid_right}", border_style)
+        new_line = Segment.line()
+        if title_text is None or width <= 4:
+            yield Segment(box.get_top([width - 2]), border_style)
+        else:
+            title_text.align(self.title_align, width - 4, character=box.top)
+            yield Segment(box.top_left + box.top, border_style)
+            yield from console.render(title_text)
+            yield Segment(box.top + box.top_right, border_style)
+
+        yield new_line
+        for line in lines:
+            yield line_start
+            yield from line
+            yield line_end
+            yield new_line
+
+        subtitle_text = self._subtitle
+        if subtitle_text is not None:
+            subtitle_text.style = border_style
+
+        if subtitle_text is None or width <= 4:
+            yield Segment(box.get_bottom([width - 2]), border_style)
+        else:
+            subtitle_text.align(self.subtitle_align, width - 4, character=box.bottom)
+            yield Segment(box.bottom_left + box.bottom, border_style)
+            yield from console.render(subtitle_text)
+            yield Segment(box.bottom + box.bottom_right, border_style)
+
+        yield new_line
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        _title = self._title
+        _, right, _, left = Padding.unpack(self.padding)
+        padding = left + right
+        renderables = [self.renderable, _title] if _title else [self.renderable]
+
+        if self.width is None:
+            width = (
+                measure_renderables(
+                    console,
+                    options.update_width(options.max_width - padding - 2),
+                    renderables,
+                ).maximum
+                + padding
+                + 2
+            )
+        else:
+            width = self.width
+        return Measurement(width, width)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    c = Console()
+
+    from .padding import Padding
+    from .box import ROUNDED, DOUBLE
+
+    p = Panel(
+        "Hello, World!",
+        title="rich.Panel",
+        style="white on blue",
+        box=DOUBLE,
+        padding=1,
+    )
+
+    c.print()
+    c.print(p)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/progress.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/progress.py
new file mode 100644
index 0000000000000000000000000000000000000000..1f670db43852bd52f78fcbeb98f5b9c1a24a3930
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/progress.py
@@ -0,0 +1,1036 @@
+from abc import ABC, abstractmethod
+from collections import deque
+from collections.abc import Sized
+from dataclasses import dataclass, field
+from datetime import timedelta
+from math import ceil
+from threading import Event, RLock, Thread
+from types import TracebackType
+from typing import (
+    Any,
+    Callable,
+    Deque,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    NewType,
+    Optional,
+    Sequence,
+    Tuple,
+    Type,
+    TypeVar,
+    Union,
+)
+
+from . import filesize, get_console
+from .console import Console, JustifyMethod, RenderableType, Group
+from .highlighter import Highlighter
+from .jupyter import JupyterMixin
+from .live import Live
+from .progress_bar import ProgressBar
+from .spinner import Spinner
+from .style import StyleType
+from .table import Column, Table
+from .text import Text, TextType
+
+TaskID = NewType("TaskID", int)
+
+ProgressType = TypeVar("ProgressType")
+
+GetTimeCallable = Callable[[], float]
+
+
+class _TrackThread(Thread):
+    """A thread to periodically update progress."""
+
+    def __init__(self, progress: "Progress", task_id: "TaskID", update_period: float):
+        self.progress = progress
+        self.task_id = task_id
+        self.update_period = update_period
+        self.done = Event()
+
+        self.completed = 0
+        super().__init__()
+
+    def run(self) -> None:
+        task_id = self.task_id
+        advance = self.progress.advance
+        update_period = self.update_period
+        last_completed = 0
+        wait = self.done.wait
+        while not wait(update_period):
+            completed = self.completed
+            if last_completed != completed:
+                advance(task_id, completed - last_completed)
+                last_completed = completed
+
+        self.progress.update(self.task_id, completed=self.completed, refresh=True)
+
+    def __enter__(self) -> "_TrackThread":
+        self.start()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.done.set()
+        self.join()
+
+
+def track(
+    sequence: Union[Sequence[ProgressType], Iterable[ProgressType]],
+    description: str = "Working...",
+    total: Optional[float] = None,
+    auto_refresh: bool = True,
+    console: Optional[Console] = None,
+    transient: bool = False,
+    get_time: Optional[Callable[[], float]] = None,
+    refresh_per_second: float = 10,
+    style: StyleType = "bar.back",
+    complete_style: StyleType = "bar.complete",
+    finished_style: StyleType = "bar.finished",
+    pulse_style: StyleType = "bar.pulse",
+    update_period: float = 0.1,
+    disable: bool = False,
+) -> Iterable[ProgressType]:
+    """Track progress by iterating over a sequence.
+
+    Args:
+        sequence (Iterable[ProgressType]): A sequence (must support "len") you wish to iterate over.
+        description (str, optional): Description of task show next to progress bar. Defaults to "Working".
+        total: (float, optional): Total number of steps. Default is len(sequence).
+        auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True.
+        transient: (bool, optional): Clear the progress on exit. Defaults to False.
+        console (Console, optional): Console to write to. Default creates internal Console instance.
+        refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1.
+        disable (bool, optional): Disable display of progress.
+    Returns:
+        Iterable[ProgressType]: An iterable of the values in the sequence.
+
+    """
+
+    columns: List["ProgressColumn"] = (
+        [TextColumn("[progress.description]{task.description}")] if description else []
+    )
+    columns.extend(
+        (
+            BarColumn(
+                style=style,
+                complete_style=complete_style,
+                finished_style=finished_style,
+                pulse_style=pulse_style,
+            ),
+            TextColumn("[progress.percentage]{task.percentage:>3.0f}%"),
+            TimeRemainingColumn(),
+        )
+    )
+    progress = Progress(
+        *columns,
+        auto_refresh=auto_refresh,
+        console=console,
+        transient=transient,
+        get_time=get_time,
+        refresh_per_second=refresh_per_second or 10,
+        disable=disable,
+    )
+
+    with progress:
+        yield from progress.track(
+            sequence, total=total, description=description, update_period=update_period
+        )
+
+
+class ProgressColumn(ABC):
+    """Base class for a widget to use in progress display."""
+
+    max_refresh: Optional[float] = None
+
+    def __init__(self, table_column: Optional[Column] = None) -> None:
+        self._table_column = table_column
+        self._renderable_cache: Dict[TaskID, Tuple[float, RenderableType]] = {}
+        self._update_time: Optional[float] = None
+
+    def get_table_column(self) -> Column:
+        """Get a table column, used to build tasks table."""
+        return self._table_column or Column()
+
+    def __call__(self, task: "Task") -> RenderableType:
+        """Called by the Progress object to return a renderable for the given task.
+
+        Args:
+            task (Task): An object containing information regarding the task.
+
+        Returns:
+            RenderableType: Anything renderable (including str).
+        """
+        current_time = task.get_time()
+        if self.max_refresh is not None and not task.completed:
+            try:
+                timestamp, renderable = self._renderable_cache[task.id]
+            except KeyError:
+                pass
+            else:
+                if timestamp + self.max_refresh > current_time:
+                    return renderable
+
+        renderable = self.render(task)
+        self._renderable_cache[task.id] = (current_time, renderable)
+        return renderable
+
+    @abstractmethod
+    def render(self, task: "Task") -> RenderableType:
+        """Should return a renderable object."""
+
+
+class RenderableColumn(ProgressColumn):
+    """A column to insert an arbitrary column.
+
+    Args:
+        renderable (RenderableType, optional): Any renderable. Defaults to empty string.
+    """
+
+    def __init__(
+        self, renderable: RenderableType = "", *, table_column: Optional[Column] = None
+    ):
+        self.renderable = renderable
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> RenderableType:
+        return self.renderable
+
+
+class SpinnerColumn(ProgressColumn):
+    """A column with a 'spinner' animation.
+
+    Args:
+        spinner_name (str, optional): Name of spinner animation. Defaults to "dots".
+        style (StyleType, optional): Style of spinner. Defaults to "progress.spinner".
+        speed (float, optional): Speed factor of spinner. Defaults to 1.0.
+        finished_text (TextType, optional): Text used when task is finished. Defaults to " ".
+    """
+
+    def __init__(
+        self,
+        spinner_name: str = "dots",
+        style: Optional[StyleType] = "progress.spinner",
+        speed: float = 1.0,
+        finished_text: TextType = " ",
+        table_column: Optional[Column] = None,
+    ):
+        self.spinner = Spinner(spinner_name, style=style, speed=speed)
+        self.finished_text = (
+            Text.from_markup(finished_text)
+            if isinstance(finished_text, str)
+            else finished_text
+        )
+        super().__init__(table_column=table_column)
+
+    def set_spinner(
+        self,
+        spinner_name: str,
+        spinner_style: Optional[StyleType] = "progress.spinner",
+        speed: float = 1.0,
+    ) -> None:
+        """Set a new spinner.
+
+        Args:
+            spinner_name (str): Spinner name, see python -m rich.spinner.
+            spinner_style (Optional[StyleType], optional): Spinner style. Defaults to "progress.spinner".
+            speed (float, optional): Speed factor of spinner. Defaults to 1.0.
+        """
+        self.spinner = Spinner(spinner_name, style=spinner_style, speed=speed)
+
+    def render(self, task: "Task") -> RenderableType:
+        text = (
+            self.finished_text
+            if task.finished
+            else self.spinner.render(task.get_time())
+        )
+        return text
+
+
+class TextColumn(ProgressColumn):
+    """A column containing text."""
+
+    def __init__(
+        self,
+        text_format: str,
+        style: StyleType = "none",
+        justify: JustifyMethod = "left",
+        markup: bool = True,
+        highlighter: Optional[Highlighter] = None,
+        table_column: Optional[Column] = None,
+    ) -> None:
+        self.text_format = text_format
+        self.justify: JustifyMethod = justify
+        self.style = style
+        self.markup = markup
+        self.highlighter = highlighter
+        super().__init__(table_column=table_column or Column(no_wrap=True))
+
+    def render(self, task: "Task") -> Text:
+        _text = self.text_format.format(task=task)
+        if self.markup:
+            text = Text.from_markup(_text, style=self.style, justify=self.justify)
+        else:
+            text = Text(_text, style=self.style, justify=self.justify)
+        if self.highlighter:
+            self.highlighter.highlight(text)
+        return text
+
+
+class BarColumn(ProgressColumn):
+    """Renders a visual progress bar.
+
+    Args:
+        bar_width (Optional[int], optional): Width of bar or None for full width. Defaults to 40.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+    """
+
+    def __init__(
+        self,
+        bar_width: Optional[int] = 40,
+        style: StyleType = "bar.back",
+        complete_style: StyleType = "bar.complete",
+        finished_style: StyleType = "bar.finished",
+        pulse_style: StyleType = "bar.pulse",
+        table_column: Optional[Column] = None,
+    ) -> None:
+        self.bar_width = bar_width
+        self.style = style
+        self.complete_style = complete_style
+        self.finished_style = finished_style
+        self.pulse_style = pulse_style
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> ProgressBar:
+        """Gets a progress bar widget for a task."""
+        return ProgressBar(
+            total=max(0, task.total),
+            completed=max(0, task.completed),
+            width=None if self.bar_width is None else max(1, self.bar_width),
+            pulse=not task.started,
+            animation_time=task.get_time(),
+            style=self.style,
+            complete_style=self.complete_style,
+            finished_style=self.finished_style,
+            pulse_style=self.pulse_style,
+        )
+
+
+class TimeElapsedColumn(ProgressColumn):
+    """Renders time elapsed."""
+
+    def render(self, task: "Task") -> Text:
+        """Show time remaining."""
+        elapsed = task.finished_time if task.finished else task.elapsed
+        if elapsed is None:
+            return Text("-:--:--", style="progress.elapsed")
+        delta = timedelta(seconds=int(elapsed))
+        return Text(str(delta), style="progress.elapsed")
+
+
+class TimeRemainingColumn(ProgressColumn):
+    """Renders estimated time remaining."""
+
+    # Only refresh twice a second to prevent jitter
+    max_refresh = 0.5
+
+    def render(self, task: "Task") -> Text:
+        """Show time remaining."""
+        remaining = task.time_remaining
+        if remaining is None:
+            return Text("-:--:--", style="progress.remaining")
+        remaining_delta = timedelta(seconds=int(remaining))
+        return Text(str(remaining_delta), style="progress.remaining")
+
+
+class FileSizeColumn(ProgressColumn):
+    """Renders completed filesize."""
+
+    def render(self, task: "Task") -> Text:
+        """Show data completed."""
+        data_size = filesize.decimal(int(task.completed))
+        return Text(data_size, style="progress.filesize")
+
+
+class TotalFileSizeColumn(ProgressColumn):
+    """Renders total filesize."""
+
+    def render(self, task: "Task") -> Text:
+        """Show data completed."""
+        data_size = filesize.decimal(int(task.total))
+        return Text(data_size, style="progress.filesize.total")
+
+
+class DownloadColumn(ProgressColumn):
+    """Renders file size downloaded and total, e.g. '0.5/2.3 GB'.
+
+    Args:
+        binary_units (bool, optional): Use binary units, KiB, MiB etc. Defaults to False.
+    """
+
+    def __init__(
+        self, binary_units: bool = False, table_column: Optional[Column] = None
+    ) -> None:
+        self.binary_units = binary_units
+        super().__init__(table_column=table_column)
+
+    def render(self, task: "Task") -> Text:
+        """Calculate common unit for completed and total."""
+        completed = int(task.completed)
+        total = int(task.total)
+        if self.binary_units:
+            unit, suffix = filesize.pick_unit_and_suffix(
+                total,
+                ["bytes", "KiB", "MiB", "GiB", "TiB", "PiB", "EiB", "ZiB", "YiB"],
+                1024,
+            )
+        else:
+            unit, suffix = filesize.pick_unit_and_suffix(
+                total, ["bytes", "KB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"], 1000
+            )
+        completed_ratio = completed / unit
+        total_ratio = total / unit
+        precision = 0 if unit == 1 else 1
+        completed_str = f"{completed_ratio:,.{precision}f}"
+        total_str = f"{total_ratio:,.{precision}f}"
+        download_status = f"{completed_str}/{total_str} {suffix}"
+        download_text = Text(download_status, style="progress.download")
+        return download_text
+
+
+class TransferSpeedColumn(ProgressColumn):
+    """Renders human readable transfer speed."""
+
+    def render(self, task: "Task") -> Text:
+        """Show data transfer speed."""
+        speed = task.finished_speed or task.speed
+        if speed is None:
+            return Text("?", style="progress.data.speed")
+        data_speed = filesize.decimal(int(speed))
+        return Text(f"{data_speed}/s", style="progress.data.speed")
+
+
+class ProgressSample(NamedTuple):
+    """Sample of progress for a given time."""
+
+    timestamp: float
+    """Timestamp of sample."""
+    completed: float
+    """Number of steps completed."""
+
+
+@dataclass
+class Task:
+    """Information regarding a progress task.
+
+    This object should be considered read-only outside of the :class:`~Progress` class.
+
+    """
+
+    id: TaskID
+    """Task ID associated with this task (used in Progress methods)."""
+
+    description: str
+    """str: Description of the task."""
+
+    total: float
+    """str: Total number of steps in this task."""
+
+    completed: float
+    """float: Number of steps completed"""
+
+    _get_time: GetTimeCallable
+    """Callable to get the current time."""
+
+    finished_time: Optional[float] = None
+    """float: Time task was finished."""
+
+    visible: bool = True
+    """bool: Indicates if this task is visible in the progress display."""
+
+    fields: Dict[str, Any] = field(default_factory=dict)
+    """dict: Arbitrary fields passed in via Progress.update."""
+
+    start_time: Optional[float] = field(default=None, init=False, repr=False)
+    """Optional[float]: Time this task was started, or None if not started."""
+
+    stop_time: Optional[float] = field(default=None, init=False, repr=False)
+    """Optional[float]: Time this task was stopped, or None if not stopped."""
+
+    finished_speed: Optional[float] = None
+    """Optional[float]: The last speed for a finished task."""
+
+    _progress: Deque[ProgressSample] = field(
+        default_factory=deque, init=False, repr=False
+    )
+
+    _lock: RLock = field(repr=False, default_factory=RLock)
+    """Thread lock."""
+
+    def get_time(self) -> float:
+        """float: Get the current time, in seconds."""
+        return self._get_time()
+
+    @property
+    def started(self) -> bool:
+        """bool: Check if the task as started."""
+        return self.start_time is not None
+
+    @property
+    def remaining(self) -> float:
+        """float: Get the number of steps remaining."""
+        return self.total - self.completed
+
+    @property
+    def elapsed(self) -> Optional[float]:
+        """Optional[float]: Time elapsed since task was started, or ``None`` if the task hasn't started."""
+        if self.start_time is None:
+            return None
+        if self.stop_time is not None:
+            return self.stop_time - self.start_time
+        return self.get_time() - self.start_time
+
+    @property
+    def finished(self) -> bool:
+        """Check if the task has finished."""
+        return self.finished_time is not None
+
+    @property
+    def percentage(self) -> float:
+        """float: Get progress of task as a percentage."""
+        if not self.total:
+            return 0.0
+        completed = (self.completed / self.total) * 100.0
+        completed = min(100.0, max(0.0, completed))
+        return completed
+
+    @property
+    def speed(self) -> Optional[float]:
+        """Optional[float]: Get the estimated speed in steps per second."""
+        if self.start_time is None:
+            return None
+        with self._lock:
+            progress = self._progress
+            if not progress:
+                return None
+            total_time = progress[-1].timestamp - progress[0].timestamp
+            if total_time == 0:
+                return None
+            iter_progress = iter(progress)
+            next(iter_progress)
+            total_completed = sum(sample.completed for sample in iter_progress)
+            speed = total_completed / total_time
+            return speed
+
+    @property
+    def time_remaining(self) -> Optional[float]:
+        """Optional[float]: Get estimated time to completion, or ``None`` if no data."""
+        if self.finished:
+            return 0.0
+        speed = self.speed
+        if not speed:
+            return None
+        estimate = ceil(self.remaining / speed)
+        return estimate
+
+    def _reset(self) -> None:
+        """Reset progress."""
+        self._progress.clear()
+        self.finished_time = None
+        self.finished_speed = None
+
+
+class Progress(JupyterMixin):
+    """Renders an auto-updating progress bar(s).
+
+    Args:
+        console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout.
+        auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()`.
+        refresh_per_second (Optional[float], optional): Number of times per second to refresh the progress information or None to use default (10). Defaults to None.
+        speed_estimate_period: (float, optional): Period (in seconds) used to calculate the speed estimate. Defaults to 30.
+        transient: (bool, optional): Clear the progress on exit. Defaults to False.
+        redirect_stdout: (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True.
+        redirect_stderr: (bool, optional): Enable redirection of stderr. Defaults to True.
+        get_time: (Callable, optional): A callable that gets the current time, or None to use Console.get_time. Defaults to None.
+        disable (bool, optional): Disable progress display. Defaults to False
+        expand (bool, optional): Expand tasks table to fit width. Defaults to False.
+    """
+
+    def __init__(
+        self,
+        *columns: Union[str, ProgressColumn],
+        console: Optional[Console] = None,
+        auto_refresh: bool = True,
+        refresh_per_second: float = 10,
+        speed_estimate_period: float = 30.0,
+        transient: bool = False,
+        redirect_stdout: bool = True,
+        redirect_stderr: bool = True,
+        get_time: Optional[GetTimeCallable] = None,
+        disable: bool = False,
+        expand: bool = False,
+    ) -> None:
+        assert (
+            refresh_per_second is None or refresh_per_second > 0
+        ), "refresh_per_second must be > 0"
+        self._lock = RLock()
+        self.columns = columns or (
+            TextColumn("[progress.description]{task.description}"),
+            BarColumn(),
+            TextColumn("[progress.percentage]{task.percentage:>3.0f}%"),
+            TimeRemainingColumn(),
+        )
+        self.speed_estimate_period = speed_estimate_period
+
+        self.disable = disable
+        self.expand = expand
+        self._tasks: Dict[TaskID, Task] = {}
+        self._task_index: TaskID = TaskID(0)
+        self.live = Live(
+            console=console or get_console(),
+            auto_refresh=auto_refresh,
+            refresh_per_second=refresh_per_second,
+            transient=transient,
+            redirect_stdout=redirect_stdout,
+            redirect_stderr=redirect_stderr,
+            get_renderable=self.get_renderable,
+        )
+        self.get_time = get_time or self.console.get_time
+        self.print = self.console.print
+        self.log = self.console.log
+
+    @property
+    def console(self) -> Console:
+        return self.live.console
+
+    @property
+    def tasks(self) -> List[Task]:
+        """Get a list of Task instances."""
+        with self._lock:
+            return list(self._tasks.values())
+
+    @property
+    def task_ids(self) -> List[TaskID]:
+        """A list of task IDs."""
+        with self._lock:
+            return list(self._tasks.keys())
+
+    @property
+    def finished(self) -> bool:
+        """Check if all tasks have been completed."""
+        with self._lock:
+            if not self._tasks:
+                return True
+            return all(task.finished for task in self._tasks.values())
+
+    def start(self) -> None:
+        """Start the progress display."""
+        if not self.disable:
+            self.live.start(refresh=True)
+
+    def stop(self) -> None:
+        """Stop the progress display."""
+        self.live.stop()
+        if not self.console.is_interactive:
+            self.console.print()
+
+    def __enter__(self) -> "Progress":
+        self.start()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.stop()
+
+    def track(
+        self,
+        sequence: Union[Iterable[ProgressType], Sequence[ProgressType]],
+        total: Optional[float] = None,
+        task_id: Optional[TaskID] = None,
+        description: str = "Working...",
+        update_period: float = 0.1,
+    ) -> Iterable[ProgressType]:
+        """Track progress by iterating over a sequence.
+
+        Args:
+            sequence (Sequence[ProgressType]): A sequence of values you want to iterate over and track progress.
+            total: (float, optional): Total number of steps. Default is len(sequence).
+            task_id: (TaskID): Task to track. Default is new task.
+            description: (str, optional): Description of task, if new task is created.
+            update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1.
+
+        Returns:
+            Iterable[ProgressType]: An iterable of values taken from the provided sequence.
+        """
+
+        if total is None:
+            if isinstance(sequence, Sized):
+                task_total = float(len(sequence))
+            else:
+                raise ValueError(
+                    f"unable to get size of {sequence!r}, please specify 'total'"
+                )
+        else:
+            task_total = total
+
+        if task_id is None:
+            task_id = self.add_task(description, total=task_total)
+        else:
+            self.update(task_id, total=task_total)
+
+        if self.live.auto_refresh:
+            with _TrackThread(self, task_id, update_period) as track_thread:
+                for value in sequence:
+                    yield value
+                    track_thread.completed += 1
+        else:
+            advance = self.advance
+            refresh = self.refresh
+            for value in sequence:
+                yield value
+                advance(task_id, 1)
+                refresh()
+
+    def start_task(self, task_id: TaskID) -> None:
+        """Start a task.
+
+        Starts a task (used when calculating elapsed time). You may need to call this manually,
+        if you called ``add_task`` with ``start=False``.
+
+        Args:
+            task_id (TaskID): ID of task.
+        """
+        with self._lock:
+            task = self._tasks[task_id]
+            if task.start_time is None:
+                task.start_time = self.get_time()
+
+    def stop_task(self, task_id: TaskID) -> None:
+        """Stop a task.
+
+        This will freeze the elapsed time on the task.
+
+        Args:
+            task_id (TaskID): ID of task.
+        """
+        with self._lock:
+            task = self._tasks[task_id]
+            current_time = self.get_time()
+            if task.start_time is None:
+                task.start_time = current_time
+            task.stop_time = current_time
+
+    def update(
+        self,
+        task_id: TaskID,
+        *,
+        total: Optional[float] = None,
+        completed: Optional[float] = None,
+        advance: Optional[float] = None,
+        description: Optional[str] = None,
+        visible: Optional[bool] = None,
+        refresh: bool = False,
+        **fields: Any,
+    ) -> None:
+        """Update information associated with a task.
+
+        Args:
+            task_id (TaskID): Task id (returned by add_task).
+            total (float, optional): Updates task.total if not None.
+            completed (float, optional): Updates task.completed if not None.
+            advance (float, optional): Add a value to task.completed if not None.
+            description (str, optional): Change task description if not None.
+            visible (bool, optional): Set visible flag if not None.
+            refresh (bool): Force a refresh of progress information. Default is False.
+            **fields (Any): Additional data fields required for rendering.
+        """
+        with self._lock:
+            task = self._tasks[task_id]
+            completed_start = task.completed
+
+            if total is not None and total != task.total:
+                task.total = total
+                task._reset()
+            if advance is not None:
+                task.completed += advance
+            if completed is not None:
+                task.completed = completed
+            if description is not None:
+                task.description = description
+            if visible is not None:
+                task.visible = visible
+            task.fields.update(fields)
+            update_completed = task.completed - completed_start
+
+            current_time = self.get_time()
+            old_sample_time = current_time - self.speed_estimate_period
+            _progress = task._progress
+
+            popleft = _progress.popleft
+            while _progress and _progress[0].timestamp < old_sample_time:
+                popleft()
+            while len(_progress) > 1000:
+                popleft()
+            if update_completed > 0:
+                _progress.append(ProgressSample(current_time, update_completed))
+            if task.completed >= task.total and task.finished_time is None:
+                task.finished_time = task.elapsed
+
+        if refresh:
+            self.refresh()
+
+    def reset(
+        self,
+        task_id: TaskID,
+        *,
+        start: bool = True,
+        total: Optional[float] = None,
+        completed: int = 0,
+        visible: Optional[bool] = None,
+        description: Optional[str] = None,
+        **fields: Any,
+    ) -> None:
+        """Reset a task so completed is 0 and the clock is reset.
+
+        Args:
+            task_id (TaskID): ID of task.
+            start (bool, optional): Start the task after reset. Defaults to True.
+            total (float, optional): New total steps in task, or None to use current total. Defaults to None.
+            completed (int, optional): Number of steps completed. Defaults to 0.
+            **fields (str): Additional data fields required for rendering.
+        """
+        current_time = self.get_time()
+        with self._lock:
+            task = self._tasks[task_id]
+            task._reset()
+            task.start_time = current_time if start else None
+            if total is not None:
+                task.total = total
+            task.completed = completed
+            if visible is not None:
+                task.visible = visible
+            if fields:
+                task.fields = fields
+            if description is not None:
+                task.description = description
+            task.finished_time = None
+        self.refresh()
+
+    def advance(self, task_id: TaskID, advance: float = 1) -> None:
+        """Advance task by a number of steps.
+
+        Args:
+            task_id (TaskID): ID of task.
+            advance (float): Number of steps to advance. Default is 1.
+        """
+        current_time = self.get_time()
+        with self._lock:
+            task = self._tasks[task_id]
+            completed_start = task.completed
+            task.completed += advance
+            update_completed = task.completed - completed_start
+            old_sample_time = current_time - self.speed_estimate_period
+            _progress = task._progress
+
+            popleft = _progress.popleft
+            while _progress and _progress[0].timestamp < old_sample_time:
+                popleft()
+            while len(_progress) > 1000:
+                popleft()
+            _progress.append(ProgressSample(current_time, update_completed))
+            if task.completed >= task.total and task.finished_time is None:
+                task.finished_time = task.elapsed
+                task.finished_speed = task.speed
+
+    def refresh(self) -> None:
+        """Refresh (render) the progress information."""
+        if not self.disable and self.live.is_started:
+            self.live.refresh()
+
+    def get_renderable(self) -> RenderableType:
+        """Get a renderable for the progress display."""
+        renderable = Group(*self.get_renderables())
+        return renderable
+
+    def get_renderables(self) -> Iterable[RenderableType]:
+        """Get a number of renderables for the progress display."""
+        table = self.make_tasks_table(self.tasks)
+        yield table
+
+    def make_tasks_table(self, tasks: Iterable[Task]) -> Table:
+        """Get a table to render the Progress display.
+
+        Args:
+            tasks (Iterable[Task]): An iterable of Task instances, one per row of the table.
+
+        Returns:
+            Table: A table instance.
+        """
+        table_columns = (
+            (
+                Column(no_wrap=True)
+                if isinstance(_column, str)
+                else _column.get_table_column().copy()
+            )
+            for _column in self.columns
+        )
+        table = Table.grid(*table_columns, padding=(0, 1), expand=self.expand)
+
+        for task in tasks:
+            if task.visible:
+                table.add_row(
+                    *(
+                        (
+                            column.format(task=task)
+                            if isinstance(column, str)
+                            else column(task)
+                        )
+                        for column in self.columns
+                    )
+                )
+        return table
+
+    def __rich__(self) -> RenderableType:
+        """Makes the Progress class itself renderable."""
+        with self._lock:
+            return self.get_renderable()
+
+    def add_task(
+        self,
+        description: str,
+        start: bool = True,
+        total: float = 100.0,
+        completed: int = 0,
+        visible: bool = True,
+        **fields: Any,
+    ) -> TaskID:
+        """Add a new 'task' to the Progress display.
+
+        Args:
+            description (str): A description of the task.
+            start (bool, optional): Start the task immediately (to calculate elapsed time). If set to False,
+                you will need to call `start` manually. Defaults to True.
+            total (float, optional): Number of total steps in the progress if know. Defaults to 100.
+            completed (int, optional): Number of steps completed so far.. Defaults to 0.
+            visible (bool, optional): Enable display of the task. Defaults to True.
+            **fields (str): Additional data fields required for rendering.
+
+        Returns:
+            TaskID: An ID you can use when calling `update`.
+        """
+        with self._lock:
+            task = Task(
+                self._task_index,
+                description,
+                total,
+                completed,
+                visible=visible,
+                fields=fields,
+                _get_time=self.get_time,
+                _lock=self._lock,
+            )
+            self._tasks[self._task_index] = task
+            if start:
+                self.start_task(self._task_index)
+            new_task_index = self._task_index
+            self._task_index = TaskID(int(self._task_index) + 1)
+        self.refresh()
+        return new_task_index
+
+    def remove_task(self, task_id: TaskID) -> None:
+        """Delete a task if it exists.
+
+        Args:
+            task_id (TaskID): A task ID.
+
+        """
+        with self._lock:
+            del self._tasks[task_id]
+
+
+if __name__ == "__main__":  # pragma: no coverage
+
+    import random
+    import time
+
+    from .panel import Panel
+    from .rule import Rule
+    from .syntax import Syntax
+    from .table import Table
+
+    syntax = Syntax(
+        '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:
+    """Iterate and generate a tuple with a flag for last value."""
+    iter_values = iter(values)
+    try:
+        previous_value = next(iter_values)
+    except StopIteration:
+        return
+    for value in iter_values:
+        yield False, previous_value
+        previous_value = value
+    yield True, previous_value''',
+        "python",
+        line_numbers=True,
+    )
+
+    table = Table("foo", "bar", "baz")
+    table.add_row("1", "2", "3")
+
+    progress_renderables = [
+        "Text may be printed while the progress bars are rendering.",
+        Panel("In fact, [i]any[/i] renderable will work"),
+        "Such as [magenta]tables[/]...",
+        table,
+        "Pretty printed structures...",
+        {"type": "example", "text": "Pretty printed"},
+        "Syntax...",
+        syntax,
+        Rule("Give it a try!"),
+    ]
+
+    from itertools import cycle
+
+    examples = cycle(progress_renderables)
+
+    console = Console(record=True)
+
+    with Progress(
+        SpinnerColumn(),
+        TextColumn("[progress.description]{task.description}"),
+        BarColumn(),
+        TextColumn("[progress.percentage]{task.percentage:>3.0f}%"),
+        TimeRemainingColumn(),
+        TimeElapsedColumn(),
+        console=console,
+        transient=True,
+    ) as progress:
+
+        task1 = progress.add_task("[red]Downloading", total=1000)
+        task2 = progress.add_task("[green]Processing", total=1000)
+        task3 = progress.add_task("[yellow]Thinking", total=1000, start=False)
+
+        while not progress.finished:
+            progress.update(task1, advance=0.5)
+            progress.update(task2, advance=0.3)
+            time.sleep(0.01)
+            if random.randint(0, 100) < 1:
+                progress.log(next(examples))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/progress_bar.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/progress_bar.py
new file mode 100644
index 0000000000000000000000000000000000000000..1797b5f786eb0d5adb2f5d1e3e5ee0e2b4541eaf
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/progress_bar.py
@@ -0,0 +1,216 @@
+import math
+from functools import lru_cache
+from time import monotonic
+from typing import Iterable, List, Optional
+
+from .color import Color, blend_rgb
+from .color_triplet import ColorTriplet
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleType
+
+# Number of characters before 'pulse' animation repeats
+PULSE_SIZE = 20
+
+
+class ProgressBar(JupyterMixin):
+    """Renders a (progress) bar. Used by rich.progress.
+
+    Args:
+        total (float, optional): Number of steps in the bar. Defaults to 100.
+        completed (float, optional): Number of steps completed. Defaults to 0.
+        width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None.
+        pulse (bool, optional): Enable pulse effect. Defaults to False.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        animation_time (Optional[float], optional): Time in seconds to use for animation, or None to use system time.
+    """
+
+    def __init__(
+        self,
+        total: float = 100.0,
+        completed: float = 0,
+        width: Optional[int] = None,
+        pulse: bool = False,
+        style: StyleType = "bar.back",
+        complete_style: StyleType = "bar.complete",
+        finished_style: StyleType = "bar.finished",
+        pulse_style: StyleType = "bar.pulse",
+        animation_time: Optional[float] = None,
+    ):
+        self.total = total
+        self.completed = completed
+        self.width = width
+        self.pulse = pulse
+        self.style = style
+        self.complete_style = complete_style
+        self.finished_style = finished_style
+        self.pulse_style = pulse_style
+        self.animation_time = animation_time
+
+        self._pulse_segments: Optional[List[Segment]] = None
+
+    def __repr__(self) -> str:
+        return f"<Bar {self.completed!r} of {self.total!r}>"
+
+    @property
+    def percentage_completed(self) -> float:
+        """Calculate percentage complete."""
+        completed = (self.completed / self.total) * 100.0
+        completed = min(100, max(0.0, completed))
+        return completed
+
+    @lru_cache(maxsize=16)
+    def _get_pulse_segments(
+        self,
+        fore_style: Style,
+        back_style: Style,
+        color_system: str,
+        no_color: bool,
+        ascii: bool = False,
+    ) -> List[Segment]:
+        """Get a list of segments to render a pulse animation.
+
+        Returns:
+            List[Segment]: A list of segments, one segment per character.
+        """
+        bar = "-" if ascii else "━"
+        segments: List[Segment] = []
+        if color_system not in ("standard", "eight_bit", "truecolor") or no_color:
+            segments += [Segment(bar, fore_style)] * (PULSE_SIZE // 2)
+            segments += [Segment(" " if no_color else bar, back_style)] * (
+                PULSE_SIZE - (PULSE_SIZE // 2)
+            )
+            return segments
+
+        append = segments.append
+        fore_color = (
+            fore_style.color.get_truecolor()
+            if fore_style.color
+            else ColorTriplet(255, 0, 255)
+        )
+        back_color = (
+            back_style.color.get_truecolor()
+            if back_style.color
+            else ColorTriplet(0, 0, 0)
+        )
+        cos = math.cos
+        pi = math.pi
+        _Segment = Segment
+        _Style = Style
+        from_triplet = Color.from_triplet
+
+        for index in range(PULSE_SIZE):
+            position = index / PULSE_SIZE
+            fade = 0.5 + cos((position * pi * 2)) / 2.0
+            color = blend_rgb(fore_color, back_color, cross_fade=fade)
+            append(_Segment(bar, _Style(color=from_triplet(color))))
+        return segments
+
+    def update(self, completed: float, total: Optional[float] = None) -> None:
+        """Update progress with new values.
+
+        Args:
+            completed (float): Number of steps completed.
+            total (float, optional): Total number of steps, or ``None`` to not change. Defaults to None.
+        """
+        self.completed = completed
+        self.total = total if total is not None else self.total
+
+    def _render_pulse(
+        self, console: Console, width: int, ascii: bool = False
+    ) -> Iterable[Segment]:
+        """Renders the pulse animation.
+
+        Args:
+            console (Console): Console instance.
+            width (int): Width in characters of pulse animation.
+
+        Returns:
+            RenderResult: [description]
+
+        Yields:
+            Iterator[Segment]: Segments to render pulse
+        """
+        fore_style = console.get_style(self.pulse_style, default="white")
+        back_style = console.get_style(self.style, default="black")
+
+        pulse_segments = self._get_pulse_segments(
+            fore_style, back_style, console.color_system, console.no_color, ascii=ascii
+        )
+        segment_count = len(pulse_segments)
+        current_time = (
+            monotonic() if self.animation_time is None else self.animation_time
+        )
+        segments = pulse_segments * (int(width / segment_count) + 2)
+        offset = int(-current_time * 15) % segment_count
+        segments = segments[offset : offset + width]
+        yield from segments
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        width = min(self.width or options.max_width, options.max_width)
+        ascii = options.legacy_windows or options.ascii_only
+        if self.pulse:
+            yield from self._render_pulse(console, width, ascii=ascii)
+            return
+
+        completed = min(self.total, max(0, self.completed))
+
+        bar = "-" if ascii else "━"
+        half_bar_right = " " if ascii else "╸"
+        half_bar_left = " " if ascii else "╺"
+        complete_halves = (
+            int(width * 2 * completed / self.total) if self.total else width * 2
+        )
+        bar_count = complete_halves // 2
+        half_bar_count = complete_halves % 2
+        style = console.get_style(self.style)
+        complete_style = console.get_style(
+            self.complete_style if self.completed < self.total else self.finished_style
+        )
+        _Segment = Segment
+        if bar_count:
+            yield _Segment(bar * bar_count, complete_style)
+        if half_bar_count:
+            yield _Segment(half_bar_right * half_bar_count, complete_style)
+
+        if not console.no_color:
+            remaining_bars = width - bar_count - half_bar_count
+            if remaining_bars and console.color_system is not None:
+                if not half_bar_count and bar_count:
+                    yield _Segment(half_bar_left, style)
+                    remaining_bars -= 1
+                if remaining_bars:
+                    yield _Segment(bar * remaining_bars, style)
+
+    def __rich_measure__(
+        self, console: Console, options: ConsoleOptions
+    ) -> Measurement:
+        return (
+            Measurement(self.width, self.width)
+            if self.width is not None
+            else Measurement(4, options.max_width)
+        )
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console()
+    bar = ProgressBar(width=50, total=100)
+
+    import time
+
+    console.show_cursor(False)
+    for n in range(0, 101, 1):
+        bar.update(n)
+        console.print(bar)
+        console.file.write("\r")
+        time.sleep(0.05)
+    console.show_cursor(True)
+    console.print()
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/prompt.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/prompt.py
new file mode 100644
index 0000000000000000000000000000000000000000..b2cea2b529a3cdf265bb6d2259ead42227958072
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/prompt.py
@@ -0,0 +1,376 @@
+from typing import Any, Generic, List, Optional, TextIO, TypeVar, Union, overload
+
+from . import get_console
+from .console import Console
+from .text import Text, TextType
+
+PromptType = TypeVar("PromptType")
+DefaultType = TypeVar("DefaultType")
+
+
+class PromptError(Exception):
+    """Exception base class for prompt related errors."""
+
+
+class InvalidResponse(PromptError):
+    """Exception to indicate a response was invalid. Raise this within process_response() to indicate an error
+    and provide an error message.
+
+    Args:
+        message (Union[str, Text]): Error message.
+    """
+
+    def __init__(self, message: TextType) -> None:
+        self.message = message
+
+    def __rich__(self) -> TextType:
+        return self.message
+
+
+class PromptBase(Generic[PromptType]):
+    """Ask the user for input until a valid response is received. This is the base class, see one of
+    the concrete classes for examples.
+
+    Args:
+        prompt (TextType, optional): Prompt text. Defaults to "".
+        console (Console, optional): A Console instance or None to use global console. Defaults to None.
+        password (bool, optional): Enable password input. Defaults to False.
+        choices (List[str], optional): A list of valid choices. Defaults to None.
+        show_default (bool, optional): Show default in prompt. Defaults to True.
+        show_choices (bool, optional): Show choices in prompt. Defaults to True.
+    """
+
+    response_type: type = str
+
+    validate_error_message = "[prompt.invalid]Please enter a valid value"
+    illegal_choice_message = (
+        "[prompt.invalid.choice]Please select one of the available options"
+    )
+    prompt_suffix = ": "
+
+    choices: Optional[List[str]] = None
+
+    def __init__(
+        self,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        show_default: bool = True,
+        show_choices: bool = True,
+    ) -> None:
+        self.console = console or get_console()
+        self.prompt = (
+            Text.from_markup(prompt, style="prompt")
+            if isinstance(prompt, str)
+            else prompt
+        )
+        self.password = password
+        if choices is not None:
+            self.choices = choices
+        self.show_default = show_default
+        self.show_choices = show_choices
+
+    @classmethod
+    @overload
+    def ask(
+        cls,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        show_default: bool = True,
+        show_choices: bool = True,
+        default: DefaultType,
+        stream: Optional[TextIO] = None,
+    ) -> Union[DefaultType, PromptType]:
+        ...
+
+    @classmethod
+    @overload
+    def ask(
+        cls,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        show_default: bool = True,
+        show_choices: bool = True,
+        stream: Optional[TextIO] = None,
+    ) -> PromptType:
+        ...
+
+    @classmethod
+    def ask(
+        cls,
+        prompt: TextType = "",
+        *,
+        console: Optional[Console] = None,
+        password: bool = False,
+        choices: Optional[List[str]] = None,
+        show_default: bool = True,
+        show_choices: bool = True,
+        default: Any = ...,
+        stream: Optional[TextIO] = None,
+    ) -> Any:
+        """Shortcut to construct and run a prompt loop and return the result.
+
+        Example:
+            >>> filename = Prompt.ask("Enter a filename")
+
+        Args:
+            prompt (TextType, optional): Prompt text. Defaults to "".
+            console (Console, optional): A Console instance or None to use global console. Defaults to None.
+            password (bool, optional): Enable password input. Defaults to False.
+            choices (List[str], optional): A list of valid choices. Defaults to None.
+            show_default (bool, optional): Show default in prompt. Defaults to True.
+            show_choices (bool, optional): Show choices in prompt. Defaults to True.
+            stream (TextIO, optional): Optional text file open for reading to get input. Defaults to None.
+        """
+        _prompt = cls(
+            prompt,
+            console=console,
+            password=password,
+            choices=choices,
+            show_default=show_default,
+            show_choices=show_choices,
+        )
+        return _prompt(default=default, stream=stream)
+
+    def render_default(self, default: DefaultType) -> Text:
+        """Turn the supplied default in to a Text instance.
+
+        Args:
+            default (DefaultType): Default value.
+
+        Returns:
+            Text: Text containing rendering of default value.
+        """
+        return Text(f"({default})", "prompt.default")
+
+    def make_prompt(self, default: DefaultType) -> Text:
+        """Make prompt text.
+
+        Args:
+            default (DefaultType): Default value.
+
+        Returns:
+            Text: Text to display in prompt.
+        """
+        prompt = self.prompt.copy()
+        prompt.end = ""
+
+        if self.show_choices and self.choices:
+            _choices = "/".join(self.choices)
+            choices = f"[{_choices}]"
+            prompt.append(" ")
+            prompt.append(choices, "prompt.choices")
+
+        if (
+            default != ...
+            and self.show_default
+            and isinstance(default, (str, self.response_type))
+        ):
+            prompt.append(" ")
+            _default = self.render_default(default)
+            prompt.append(_default)
+
+        prompt.append(self.prompt_suffix)
+
+        return prompt
+
+    @classmethod
+    def get_input(
+        cls,
+        console: Console,
+        prompt: TextType,
+        password: bool,
+        stream: Optional[TextIO] = None,
+    ) -> str:
+        """Get input from user.
+
+        Args:
+            console (Console): Console instance.
+            prompt (TextType): Prompt text.
+            password (bool): Enable password entry.
+
+        Returns:
+            str: String from user.
+        """
+        return console.input(prompt, password=password, stream=stream)
+
+    def check_choice(self, value: str) -> bool:
+        """Check value is in the list of valid choices.
+
+        Args:
+            value (str): Value entered by user.
+
+        Returns:
+            bool: True if choice was valid, otherwise False.
+        """
+        assert self.choices is not None
+        return value.strip() in self.choices
+
+    def process_response(self, value: str) -> PromptType:
+        """Process response from user, convert to prompt type.
+
+        Args:
+            value (str): String typed by user.
+
+        Raises:
+            InvalidResponse: If ``value`` is invalid.
+
+        Returns:
+            PromptType: The value to be returned from ask method.
+        """
+        value = value.strip()
+        try:
+            return_value = self.response_type(value)
+        except ValueError:
+            raise InvalidResponse(self.validate_error_message)
+
+        if self.choices is not None and not self.check_choice(value):
+            raise InvalidResponse(self.illegal_choice_message)
+
+        return return_value  # type: ignore
+
+    def on_validate_error(self, value: str, error: InvalidResponse) -> None:
+        """Called to handle validation error.
+
+        Args:
+            value (str): String entered by user.
+            error (InvalidResponse): Exception instance the initiated the error.
+        """
+        self.console.print(error)
+
+    def pre_prompt(self) -> None:
+        """Hook to display something before the prompt."""
+
+    @overload
+    def __call__(self, *, stream: Optional[TextIO] = None) -> PromptType:
+        ...
+
+    @overload
+    def __call__(
+        self, *, default: DefaultType, stream: Optional[TextIO] = None
+    ) -> Union[PromptType, DefaultType]:
+        ...
+
+    def __call__(self, *, default: Any = ..., stream: Optional[TextIO] = None) -> Any:
+        """Run the prompt loop.
+
+        Args:
+            default (Any, optional): Optional default value.
+
+        Returns:
+            PromptType: Processed value.
+        """
+        while True:
+            self.pre_prompt()
+            prompt = self.make_prompt(default)
+            value = self.get_input(self.console, prompt, self.password, stream=stream)
+            if value == "" and default != ...:
+                return default
+            try:
+                return_value = self.process_response(value)
+            except InvalidResponse as error:
+                self.on_validate_error(value, error)
+                continue
+            else:
+                return return_value
+
+
+class Prompt(PromptBase[str]):
+    """A prompt that returns a str.
+
+    Example:
+        >>> name = Prompt.ask("Enter your name")
+
+
+    """
+
+    response_type = str
+
+
+class IntPrompt(PromptBase[int]):
+    """A prompt that returns an integer.
+
+    Example:
+        >>> burrito_count = IntPrompt.ask("How many burritos do you want to order")
+
+    """
+
+    response_type = int
+    validate_error_message = "[prompt.invalid]Please enter a valid integer number"
+
+
+class FloatPrompt(PromptBase[int]):
+    """A prompt that returns a float.
+
+    Example:
+        >>> temperature = FloatPrompt.ask("Enter desired temperature")
+
+    """
+
+    response_type = float
+    validate_error_message = "[prompt.invalid]Please enter a number"
+
+
+class Confirm(PromptBase[bool]):
+    """A yes / no confirmation prompt.
+
+    Example:
+        >>> if Confirm.ask("Continue"):
+                run_job()
+
+    """
+
+    response_type = bool
+    validate_error_message = "[prompt.invalid]Please enter Y or N"
+    choices: List[str] = ["y", "n"]
+
+    def render_default(self, default: DefaultType) -> Text:
+        """Render the default as (y) or (n) rather than True/False."""
+        yes, no = self.choices
+        return Text(f"({yes})" if default else f"({no})", style="prompt.default")
+
+    def process_response(self, value: str) -> bool:
+        """Convert choices to a bool."""
+        value = value.strip().lower()
+        if value not in self.choices:
+            raise InvalidResponse(self.validate_error_message)
+        return value == self.choices[0]
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from pip._vendor.rich import print
+
+    if Confirm.ask("Run [i]prompt[/i] tests?", default=True):
+        while True:
+            result = IntPrompt.ask(
+                ":rocket: Enter a number between [b]1[/b] and [b]10[/b]", default=5
+            )
+            if result >= 1 and result <= 10:
+                break
+            print(":pile_of_poo: [prompt.invalid]Number must be between 1 and 10")
+        print(f"number={result}")
+
+        while True:
+            password = Prompt.ask(
+                "Please enter a password [cyan](must be at least 5 characters)",
+                password=True,
+            )
+            if len(password) >= 5:
+                break
+            print("[prompt.invalid]password too short")
+        print(f"password={password!r}")
+
+        fruit = Prompt.ask("Enter a fruit", choices=["apple", "orange", "pear"])
+        print(f"fruit={fruit!r}")
+
+    else:
+        print("[b]OK :loudly_crying_face:")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/protocol.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/protocol.py
new file mode 100644
index 0000000000000000000000000000000000000000..6248052119ac68bd6be0e188cbd83ef4b4deffd7
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/protocol.py
@@ -0,0 +1,42 @@
+from typing import Any, Callable, cast, Set, TYPE_CHECKING
+from inspect import isclass
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.console import RenderableType
+
+_GIBBERISH = """aihwerij235234ljsdnp34ksodfipwoe234234jlskjdf"""
+
+
+def is_renderable(check_object: Any) -> bool:
+    """Check if an object may be rendered by Rich."""
+    return (
+        isinstance(check_object, str)
+        or hasattr(check_object, "__rich__")
+        or hasattr(check_object, "__rich_console__")
+    )
+
+
+def rich_cast(renderable: object) -> "RenderableType":
+    """Cast an object to a renderable by calling __rich__ if present.
+
+    Args:
+        renderable (object): A potentially renderable object
+
+    Returns:
+        object: The result of recursively calling __rich__.
+    """
+    from pip._vendor.rich.console import RenderableType
+
+    rich_visited_set: Set[type] = set()  # Prevent potential infinite loop
+    while hasattr(renderable, "__rich__") and not isclass(renderable):
+        # Detect object which claim to have all the attributes
+        if hasattr(renderable, _GIBBERISH):
+            return repr(renderable)
+        cast_method = getattr(renderable, "__rich__")
+        renderable = cast_method()
+        renderable_type = type(renderable)
+        if renderable_type in rich_visited_set:
+            break
+        rich_visited_set.add(renderable_type)
+
+    return cast(RenderableType, renderable)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/region.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/region.py
new file mode 100644
index 0000000000000000000000000000000000000000..75b3631c3879294549f1f27418859aefb63925a7
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/region.py
@@ -0,0 +1,10 @@
+from typing import NamedTuple
+
+
+class Region(NamedTuple):
+    """Defines a rectangular region of the screen."""
+
+    x: int
+    y: int
+    width: int
+    height: int
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/repr.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/repr.py
new file mode 100644
index 0000000000000000000000000000000000000000..17147fd4be2efedeb625c2b58293d0588c2c5d64
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/repr.py
@@ -0,0 +1,151 @@
+from functools import partial
+import inspect
+
+from typing import (
+    Any,
+    Callable,
+    Iterable,
+    List,
+    Optional,
+    overload,
+    Union,
+    Tuple,
+    Type,
+    TypeVar,
+)
+
+
+T = TypeVar("T")
+
+
+Result = Iterable[Union[Any, Tuple[Any], Tuple[str, Any], Tuple[str, Any, Any]]]
+RichReprResult = Result
+
+
+class ReprError(Exception):
+    """An error occurred when attempting to build a repr."""
+
+
+@overload
+def auto(cls: Optional[T]) -> T:
+    ...
+
+
+@overload
+def auto(*, angular: bool = False) -> Callable[[T], T]:
+    ...
+
+
+def auto(
+    cls: Optional[T] = None, *, angular: Optional[bool] = None
+) -> Union[T, Callable[[T], T]]:
+    """Class decorator to create __repr__ from __rich_repr__"""
+
+    def do_replace(cls: Type[T], angular: Optional[bool] = None) -> Type[T]:
+        def auto_repr(self: Type[T]) -> str:
+            """Create repr string from __rich_repr__"""
+            repr_str: List[str] = []
+            append = repr_str.append
+
+            angular = getattr(self.__rich_repr__, "angular", False)  # type: ignore
+            for arg in self.__rich_repr__():  # type: ignore
+                if isinstance(arg, tuple):
+                    if len(arg) == 1:
+                        append(repr(arg[0]))
+                    else:
+                        key, value, *default = arg
+                        if key is None:
+                            append(repr(value))
+                        else:
+                            if len(default) and default[0] == value:
+                                continue
+                            append(f"{key}={value!r}")
+                else:
+                    append(repr(arg))
+            if angular:
+                return f"<{self.__class__.__name__} {' '.join(repr_str)}>"
+            else:
+                return f"{self.__class__.__name__}({', '.join(repr_str)})"
+
+        def auto_rich_repr(self: Type[T]) -> Result:
+            """Auto generate __rich_rep__ from signature of __init__"""
+            try:
+                signature = inspect.signature(self.__init__)  ## type: ignore
+                for name, param in signature.parameters.items():
+                    if param.kind == param.POSITIONAL_ONLY:
+                        yield getattr(self, name)
+                    elif param.kind in (
+                        param.POSITIONAL_OR_KEYWORD,
+                        param.KEYWORD_ONLY,
+                    ):
+                        if param.default == param.empty:
+                            yield getattr(self, param.name)
+                        else:
+                            yield param.name, getattr(self, param.name), param.default
+            except Exception as error:
+                raise ReprError(
+                    f"Failed to auto generate __rich_repr__; {error}"
+                ) from None
+
+        if not hasattr(cls, "__rich_repr__"):
+            auto_rich_repr.__doc__ = "Build a rich repr"
+            cls.__rich_repr__ = auto_rich_repr  # type: ignore
+
+        auto_repr.__doc__ = "Return repr(self)"
+        cls.__repr__ = auto_repr  # type: ignore
+        if angular is not None:
+            cls.__rich_repr__.angular = angular  # type: ignore
+        return cls
+
+    if cls is None:
+        return partial(do_replace, angular=angular)  # type: ignore
+    else:
+        return do_replace(cls, angular=angular)  # type: ignore
+
+
+@overload
+def rich_repr(cls: Optional[T]) -> T:
+    ...
+
+
+@overload
+def rich_repr(*, angular: bool = False) -> Callable[[T], T]:
+    ...
+
+
+def rich_repr(
+    cls: Optional[T] = None, *, angular: bool = False
+) -> Union[T, Callable[[T], T]]:
+    if cls is None:
+        return auto(angular=angular)
+    else:
+        return auto(cls)
+
+
+if __name__ == "__main__":
+
+    @auto
+    class Foo:
+        def __rich_repr__(self) -> Result:
+            yield "foo"
+            yield "bar", {"shopping": ["eggs", "ham", "pineapple"]}
+            yield "buy", "hand sanitizer"
+
+    foo = Foo()
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+
+    console.rule("Standard repr")
+    console.print(foo)
+
+    console.print(foo, width=60)
+    console.print(foo, width=30)
+
+    console.rule("Angular repr")
+    Foo.__rich_repr__.angular = True  # type: ignore
+
+    console.print(foo)
+
+    console.print(foo, width=60)
+    console.print(foo, width=30)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/rule.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/rule.py
new file mode 100644
index 0000000000000000000000000000000000000000..ce4754f6a8c0de77f1abd6bd61ad5c4dd9882cba
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/rule.py
@@ -0,0 +1,115 @@
+from typing import Union
+
+from .align import AlignMethod
+from .cells import cell_len, set_cell_size
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .style import Style
+from .text import Text
+
+
+class Rule(JupyterMixin):
+    """A console renderable to draw a horizontal rule (line).
+
+    Args:
+        title (Union[str, Text], optional): Text to render in the rule. Defaults to "".
+        characters (str, optional): Character(s) used to draw the line. Defaults to "─".
+        style (StyleType, optional): Style of Rule. Defaults to "rule.line".
+        end (str, optional): Character at end of Rule. defaults to "\\\\n"
+        align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center".
+    """
+
+    def __init__(
+        self,
+        title: Union[str, Text] = "",
+        *,
+        characters: str = "─",
+        style: Union[str, Style] = "rule.line",
+        end: str = "\n",
+        align: AlignMethod = "center",
+    ) -> None:
+        if cell_len(characters) < 1:
+            raise ValueError(
+                "'characters' argument must have a cell width of at least 1"
+            )
+        if align not in ("left", "center", "right"):
+            raise ValueError(
+                f'invalid value for align, expected "left", "center", "right" (not {align!r})'
+            )
+        self.title = title
+        self.characters = characters
+        self.style = style
+        self.end = end
+        self.align = align
+
+    def __repr__(self) -> str:
+        return f"Rule({self.title!r}, {self.characters!r})"
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        width = options.max_width
+
+        # Python3.6 doesn't have an isascii method on str
+        isascii = getattr(str, "isascii", None) or (
+            lambda s: all(ord(c) < 128 for c in s)
+        )
+        characters = (
+            "-"
+            if (options.ascii_only and not isascii(self.characters))
+            else self.characters
+        )
+
+        chars_len = cell_len(characters)
+        if not self.title:
+            rule_text = Text(characters * ((width // chars_len) + 1), self.style)
+            rule_text.truncate(width)
+            rule_text.plain = set_cell_size(rule_text.plain, width)
+            yield rule_text
+            return
+
+        if isinstance(self.title, Text):
+            title_text = self.title
+        else:
+            title_text = console.render_str(self.title, style="rule.text")
+
+        title_text.plain = title_text.plain.replace("\n", " ")
+        title_text.expand_tabs()
+        rule_text = Text(end=self.end)
+
+        if self.align == "center":
+            title_text.truncate(width - 4, overflow="ellipsis")
+            side_width = (width - cell_len(title_text.plain)) // 2
+            left = Text(characters * (side_width // chars_len + 1))
+            left.truncate(side_width - 1)
+            right_length = width - cell_len(left.plain) - cell_len(title_text.plain)
+            right = Text(characters * (side_width // chars_len + 1))
+            right.truncate(right_length)
+            rule_text.append(left.plain + " ", self.style)
+            rule_text.append(title_text)
+            rule_text.append(" " + right.plain, self.style)
+        elif self.align == "left":
+            title_text.truncate(width - 2, overflow="ellipsis")
+            rule_text.append(title_text)
+            rule_text.append(" ")
+            rule_text.append(characters * (width - rule_text.cell_len), self.style)
+        elif self.align == "right":
+            title_text.truncate(width - 2, overflow="ellipsis")
+            rule_text.append(characters * (width - title_text.cell_len - 1), self.style)
+            rule_text.append(" ")
+            rule_text.append(title_text)
+
+        rule_text.plain = set_cell_size(rule_text.plain, width)
+        yield rule_text
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+    import sys
+
+    try:
+        text = sys.argv[1]
+    except IndexError:
+        text = "Hello, World"
+    console = Console()
+    console.print(Rule(title=text))
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/scope.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/scope.py
new file mode 100644
index 0000000000000000000000000000000000000000..6822b8ca5429db9785881dd30e3964a655a64a88
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/scope.py
@@ -0,0 +1,86 @@
+from collections.abc import Mapping
+from typing import TYPE_CHECKING, Any, Optional, Tuple
+
+from .highlighter import ReprHighlighter
+from .panel import Panel
+from .pretty import Pretty
+from .table import Table
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import ConsoleRenderable
+
+
+def render_scope(
+    scope: "Mapping[str, Any]",
+    *,
+    title: Optional[TextType] = None,
+    sort_keys: bool = True,
+    indent_guides: bool = False,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+) -> "ConsoleRenderable":
+    """Render python variables in a given scope.
+
+    Args:
+        scope (Mapping): A mapping containing variable names and values.
+        title (str, optional): Optional title. Defaults to None.
+        sort_keys (bool, optional): Enable sorting of items. Defaults to True.
+        indent_guides (bool, optional): Enable indentaton guides. Defaults to False.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None.
+
+    Returns:
+        ConsoleRenderable: A renderable object.
+    """
+    highlighter = ReprHighlighter()
+    items_table = Table.grid(padding=(0, 1), expand=False)
+    items_table.add_column(justify="right")
+
+    def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]:
+        """Sort special variables first, then alphabetically."""
+        key, _ = item
+        return (not key.startswith("__"), key.lower())
+
+    items = sorted(scope.items(), key=sort_items) if sort_keys else scope.items()
+    for key, value in items:
+        key_text = Text.assemble(
+            (key, "scope.key.special" if key.startswith("__") else "scope.key"),
+            (" =", "scope.equals"),
+        )
+        items_table.add_row(
+            key_text,
+            Pretty(
+                value,
+                highlighter=highlighter,
+                indent_guides=indent_guides,
+                max_length=max_length,
+                max_string=max_string,
+            ),
+        )
+    return Panel.fit(
+        items_table,
+        title=title,
+        border_style="scope.border",
+        padding=(0, 1),
+    )
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich import print
+
+    print()
+
+    def test(foo: float, bar: float) -> None:
+        list_of_things = [1, 2, 3, None, 4, True, False, "Hello World"]
+        dict_of_things = {
+            "version": "1.1",
+            "method": "confirmFruitPurchase",
+            "params": [["apple", "orange", "mangoes", "pomelo"], 1.123],
+            "id": "194521489",
+        }
+        print(render_scope(locals(), title="[i]locals", sort_keys=False))
+
+    test(20.3423, 3.1427)
+    print()
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/segment.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/segment.py
new file mode 100644
index 0000000000000000000000000000000000000000..94ca73076d8ec9c7a6d47e401736dad084070437
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/segment.py
@@ -0,0 +1,720 @@
+from enum import IntEnum
+from functools import lru_cache
+from itertools import filterfalse
+from logging import getLogger
+from operator import attrgetter
+from typing import (
+    TYPE_CHECKING,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Tuple,
+    Type,
+    Union,
+)
+
+from .cells import (
+    _is_single_cell_widths,
+    cell_len,
+    get_character_cell_size,
+    set_cell_size,
+)
+from .repr import Result, rich_repr
+from .style import Style
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult
+
+log = getLogger("rich")
+
+
+class ControlType(IntEnum):
+    """Non-printable control codes which typically translate to ANSI codes."""
+
+    BELL = 1
+    CARRIAGE_RETURN = 2
+    HOME = 3
+    CLEAR = 4
+    SHOW_CURSOR = 5
+    HIDE_CURSOR = 6
+    ENABLE_ALT_SCREEN = 7
+    DISABLE_ALT_SCREEN = 8
+    CURSOR_UP = 9
+    CURSOR_DOWN = 10
+    CURSOR_FORWARD = 11
+    CURSOR_BACKWARD = 12
+    CURSOR_MOVE_TO_COLUMN = 13
+    CURSOR_MOVE_TO = 14
+    ERASE_IN_LINE = 15
+
+
+ControlCode = Union[
+    Tuple[ControlType], Tuple[ControlType, int], Tuple[ControlType, int, int]
+]
+
+
+@rich_repr()
+class Segment(NamedTuple):
+    """A piece of text with associated style. Segments are produced by the Console render process and
+    are ultimately converted in to strings to be written to the terminal.
+
+    Args:
+        text (str): A piece of text.
+        style (:class:`~rich.style.Style`, optional): An optional style to apply to the text.
+        control (Tuple[ControlCode..], optional): Optional sequence of control codes.
+    """
+
+    text: str = ""
+    """Raw text."""
+    style: Optional[Style] = None
+    """An optional style."""
+    control: Optional[Sequence[ControlCode]] = None
+    """Optional sequence of control codes."""
+
+    def __rich_repr__(self) -> Result:
+        yield self.text
+        if self.control is None:
+            if self.style is not None:
+                yield self.style
+        else:
+            yield self.style
+            yield self.control
+
+    def __bool__(self) -> bool:
+        """Check if the segment contains text."""
+        return bool(self.text)
+
+    @property
+    def cell_length(self) -> int:
+        """Get cell length of segment."""
+        return 0 if self.control else cell_len(self.text)
+
+    @property
+    def is_control(self) -> bool:
+        """Check if the segment contains control codes."""
+        return self.control is not None
+
+    @classmethod
+    @lru_cache(1024 * 16)
+    def _split_cells(cls, segment: "Segment", cut: int) -> Tuple["Segment", "Segment"]:  # type: ignore
+
+        text, style, control = segment
+        _Segment = Segment
+
+        cell_length = segment.cell_length
+        if cut >= cell_length:
+            return segment, _Segment("", style, control)
+
+        cell_size = get_character_cell_size
+
+        pos = int((cut / cell_length) * len(text))
+
+        before = text[:pos]
+        cell_pos = cell_len(before)
+        if cell_pos == cut:
+            return (
+                _Segment(before, style, control),
+                _Segment(text[pos:], style, control),
+            )
+        while pos < len(text):
+            char = text[pos]
+            pos += 1
+            cell_pos += cell_size(char)
+            before = text[:pos]
+            if cell_pos == cut:
+                return (
+                    _Segment(before, style, control),
+                    _Segment(text[pos:], style, control),
+                )
+            if cell_pos > cut:
+                return (
+                    _Segment(before[: pos - 1] + " ", style, control),
+                    _Segment(" " + text[pos:], style, control),
+                )
+
+    def split_cells(self, cut: int) -> Tuple["Segment", "Segment"]:
+        """Split segment in to two segments at the specified column.
+
+        If the cut point falls in the middle of a 2-cell wide character then it is replaced
+        by two spaces, to preserve the display width of the parent segment.
+
+        Returns:
+            Tuple[Segment, Segment]: Two segments.
+        """
+        text, style, control = self
+
+        if _is_single_cell_widths(text):
+            # Fast path with all 1 cell characters
+            if cut >= len(text):
+                return self, Segment("", style, control)
+            return (
+                Segment(text[:cut], style, control),
+                Segment(text[cut:], style, control),
+            )
+
+        return self._split_cells(self, cut)
+
+    @classmethod
+    def line(cls) -> "Segment":
+        """Make a new line segment."""
+        return cls("\n")
+
+    @classmethod
+    def apply_style(
+        cls,
+        segments: Iterable["Segment"],
+        style: Optional[Style] = None,
+        post_style: Optional[Style] = None,
+    ) -> Iterable["Segment"]:
+        """Apply style(s) to an iterable of segments.
+
+        Returns an iterable of segments where the style is replaced by ``style + segment.style + post_style``.
+
+        Args:
+            segments (Iterable[Segment]): Segments to process.
+            style (Style, optional): Base style. Defaults to None.
+            post_style (Style, optional): Style to apply on top of segment style. Defaults to None.
+
+        Returns:
+            Iterable[Segments]: A new iterable of segments (possibly the same iterable).
+        """
+        result_segments = segments
+        if style:
+            apply = style.__add__
+            result_segments = (
+                cls(text, None if control else apply(_style), control)
+                for text, _style, control in result_segments
+            )
+        if post_style:
+            result_segments = (
+                cls(
+                    text,
+                    (
+                        None
+                        if control
+                        else (_style + post_style if _style else post_style)
+                    ),
+                    control,
+                )
+                for text, _style, control in result_segments
+            )
+        return result_segments
+
+    @classmethod
+    def filter_control(
+        cls, segments: Iterable["Segment"], is_control: bool = False
+    ) -> Iterable["Segment"]:
+        """Filter segments by ``is_control`` attribute.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of Segment instances.
+            is_control (bool, optional): is_control flag to match in search.
+
+        Returns:
+            Iterable[Segment]: And iterable of Segment instances.
+
+        """
+        if is_control:
+            return filter(attrgetter("control"), segments)
+        else:
+            return filterfalse(attrgetter("control"), segments)
+
+    @classmethod
+    def split_lines(cls, segments: Iterable["Segment"]) -> Iterable[List["Segment"]]:
+        """Split a sequence of segments in to a list of lines.
+
+        Args:
+            segments (Iterable[Segment]): Segments potentially containing line feeds.
+
+        Yields:
+            Iterable[List[Segment]]: Iterable of segment lists, one per line.
+        """
+        line: List[Segment] = []
+        append = line.append
+
+        for segment in segments:
+            if "\n" in segment.text and not segment.control:
+                text, style, _ = segment
+                while text:
+                    _text, new_line, text = text.partition("\n")
+                    if _text:
+                        append(cls(_text, style))
+                    if new_line:
+                        yield line
+                        line = []
+                        append = line.append
+            else:
+                append(segment)
+        if line:
+            yield line
+
+    @classmethod
+    def split_and_crop_lines(
+        cls,
+        segments: Iterable["Segment"],
+        length: int,
+        style: Optional[Style] = None,
+        pad: bool = True,
+        include_new_lines: bool = True,
+    ) -> Iterable[List["Segment"]]:
+        """Split segments in to lines, and crop lines greater than a given length.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of segments, probably
+                generated from console.render.
+            length (int): Desired line length.
+            style (Style, optional): Style to use for any padding.
+            pad (bool): Enable padding of lines that are less than `length`.
+
+        Returns:
+            Iterable[List[Segment]]: An iterable of lines of segments.
+        """
+        line: List[Segment] = []
+        append = line.append
+
+        adjust_line_length = cls.adjust_line_length
+        new_line_segment = cls("\n")
+
+        for segment in segments:
+            if "\n" in segment.text and not segment.control:
+                text, style, _ = segment
+                while text:
+                    _text, new_line, text = text.partition("\n")
+                    if _text:
+                        append(cls(_text, style))
+                    if new_line:
+                        cropped_line = adjust_line_length(
+                            line, length, style=style, pad=pad
+                        )
+                        if include_new_lines:
+                            cropped_line.append(new_line_segment)
+                        yield cropped_line
+                        del line[:]
+            else:
+                append(segment)
+        if line:
+            yield adjust_line_length(line, length, style=style, pad=pad)
+
+    @classmethod
+    def adjust_line_length(
+        cls,
+        line: List["Segment"],
+        length: int,
+        style: Optional[Style] = None,
+        pad: bool = True,
+    ) -> List["Segment"]:
+        """Adjust a line to a given width (cropping or padding as required).
+
+        Args:
+            segments (Iterable[Segment]): A list of segments in a single line.
+            length (int): The desired width of the line.
+            style (Style, optional): The style of padding if used (space on the end). Defaults to None.
+            pad (bool, optional): Pad lines with spaces if they are shorter than `length`. Defaults to True.
+
+        Returns:
+            List[Segment]: A line of segments with the desired length.
+        """
+        line_length = sum(segment.cell_length for segment in line)
+        new_line: List[Segment]
+
+        if line_length < length:
+            if pad:
+                new_line = line + [cls(" " * (length - line_length), style)]
+            else:
+                new_line = line[:]
+        elif line_length > length:
+            new_line = []
+            append = new_line.append
+            line_length = 0
+            for segment in line:
+                segment_length = segment.cell_length
+                if line_length + segment_length < length or segment.control:
+                    append(segment)
+                    line_length += segment_length
+                else:
+                    text, segment_style, _ = segment
+                    text = set_cell_size(text, length - line_length)
+                    append(cls(text, segment_style))
+                    break
+        else:
+            new_line = line[:]
+        return new_line
+
+    @classmethod
+    def get_line_length(cls, line: List["Segment"]) -> int:
+        """Get the length of list of segments.
+
+        Args:
+            line (List[Segment]): A line encoded as a list of Segments (assumes no '\\\\n' characters),
+
+        Returns:
+            int: The length of the line.
+        """
+        _cell_len = cell_len
+        return sum(_cell_len(segment.text) for segment in line)
+
+    @classmethod
+    def get_shape(cls, lines: List[List["Segment"]]) -> Tuple[int, int]:
+        """Get the shape (enclosing rectangle) of a list of lines.
+
+        Args:
+            lines (List[List[Segment]]): A list of lines (no '\\\\n' characters).
+
+        Returns:
+            Tuple[int, int]: Width and height in characters.
+        """
+        get_line_length = cls.get_line_length
+        max_width = max(get_line_length(line) for line in lines) if lines else 0
+        return (max_width, len(lines))
+
+    @classmethod
+    def set_shape(
+        cls,
+        lines: List[List["Segment"]],
+        width: int,
+        height: Optional[int] = None,
+        style: Optional[Style] = None,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Set the shape of a list of lines (enclosing rectangle).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style, optional): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        _height = height or len(lines)
+
+        blank = (
+            [cls(" " * width + "\n", style)] if new_lines else [cls(" " * width, style)]
+        )
+
+        adjust_line_length = cls.adjust_line_length
+        shaped_lines = lines[:_height]
+        shaped_lines[:] = [
+            adjust_line_length(line, width, style=style) for line in lines
+        ]
+        if len(shaped_lines) < _height:
+            shaped_lines.extend([blank] * (_height - len(shaped_lines)))
+        return shaped_lines
+
+    @classmethod
+    def align_top(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns lines to top (adds extra lines to bottom as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        lines = lines + [[blank]] * extra_lines
+        return lines
+
+    @classmethod
+    def align_bottom(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns render to bottom (adds extra lines above as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added. Defaults to None.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        lines = [[blank]] * extra_lines + lines
+        return lines
+
+    @classmethod
+    def align_middle(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns lines to middle (adds extra lines to above and below as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        top_lines = extra_lines // 2
+        bottom_lines = extra_lines - top_lines
+        lines = [[blank]] * top_lines + lines + [[blank]] * bottom_lines
+        return lines
+
+    @classmethod
+    def simplify(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Simplify an iterable of segments by combining contiguous segments with the same style.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of segments.
+
+        Returns:
+            Iterable[Segment]: A possibly smaller iterable of segments that will render the same way.
+        """
+        iter_segments = iter(segments)
+        try:
+            last_segment = next(iter_segments)
+        except StopIteration:
+            return
+
+        _Segment = Segment
+        for segment in iter_segments:
+            if last_segment.style == segment.style and not segment.control:
+                last_segment = _Segment(
+                    last_segment.text + segment.text, last_segment.style
+                )
+            else:
+                yield last_segment
+                last_segment = segment
+        yield last_segment
+
+    @classmethod
+    def strip_links(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all links from an iterable of styles.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with link removed.
+        """
+        for segment in segments:
+            if segment.control or segment.style is None:
+                yield segment
+            else:
+                text, style, _control = segment
+                yield cls(text, style.update_link(None) if style else None)
+
+    @classmethod
+    def strip_styles(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all styles from an iterable of segments.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with styles replace with None
+        """
+        for text, _style, control in segments:
+            yield cls(text, None, control)
+
+    @classmethod
+    def remove_color(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all color from an iterable of segments.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with colorless style.
+        """
+
+        cache: Dict[Style, Style] = {}
+        for text, style, control in segments:
+            if style:
+                colorless_style = cache.get(style)
+                if colorless_style is None:
+                    colorless_style = style.without_color
+                    cache[style] = colorless_style
+                yield cls(text, colorless_style, control)
+            else:
+                yield cls(text, None, control)
+
+    @classmethod
+    def divide(
+        cls, segments: Iterable["Segment"], cuts: Iterable[int]
+    ) -> Iterable[List["Segment"]]:
+        """Divides an iterable of segments in to portions.
+
+        Args:
+            cuts (Iterable[int]): Cell positions where to divide.
+
+        Yields:
+            [Iterable[List[Segment]]]: An iterable of Segments in List.
+        """
+        split_segments: List["Segment"] = []
+        add_segment = split_segments.append
+
+        iter_cuts = iter(cuts)
+
+        while True:
+            try:
+                cut = next(iter_cuts)
+            except StopIteration:
+                return []
+            if cut != 0:
+                break
+            yield []
+        pos = 0
+
+        for segment in segments:
+            while segment.text:
+                end_pos = pos + segment.cell_length
+                if end_pos < cut:
+                    add_segment(segment)
+                    pos = end_pos
+                    break
+
+                try:
+                    if end_pos == cut:
+                        add_segment(segment)
+                        yield split_segments[:]
+                        del split_segments[:]
+                        pos = end_pos
+                        break
+                    else:
+                        before, segment = segment.split_cells(cut - pos)
+                        add_segment(before)
+                        yield split_segments[:]
+                        del split_segments[:]
+                        pos = cut
+                finally:
+                    try:
+                        cut = next(iter_cuts)
+                    except StopIteration:
+                        if split_segments:
+                            yield split_segments[:]
+                        return
+        yield split_segments[:]
+
+
+class Segments:
+    """A simple renderable to render an iterable of segments. This class may be useful if
+    you want to print segments outside of a __rich_console__ method.
+
+    Args:
+        segments (Iterable[Segment]): An iterable of segments.
+        new_lines (bool, optional): Add new lines between segments. Defaults to False.
+    """
+
+    def __init__(self, segments: Iterable[Segment], new_lines: bool = False) -> None:
+        self.segments = list(segments)
+        self.new_lines = new_lines
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.new_lines:
+            line = Segment.line()
+            for segment in self.segments:
+                yield segment
+                yield line
+        else:
+            yield from self.segments
+
+
+class SegmentLines:
+    def __init__(self, lines: Iterable[List[Segment]], new_lines: bool = False) -> None:
+        """A simple renderable containing a number of lines of segments. May be used as an intermediate
+        in rendering process.
+
+        Args:
+            lines (Iterable[List[Segment]]): Lists of segments forming lines.
+            new_lines (bool, optional): Insert new lines after each line. Defaults to False.
+        """
+        self.lines = list(lines)
+        self.new_lines = new_lines
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.new_lines:
+            new_line = Segment.line()
+            for line in self.lines:
+                yield from line
+                yield new_line
+        else:
+            for line in self.lines:
+                yield from line
+
+
+if __name__ == "__main__":
+
+    if __name__ == "__main__":  # pragma: no cover
+        from pip._vendor.rich.console import Console
+        from pip._vendor.rich.syntax import Syntax
+        from pip._vendor.rich.text import Text
+
+        code = """from rich.console import Console
+    console = Console()
+    text = Text.from_markup("Hello, [bold magenta]World[/]!")
+    console.print(text)"""
+
+        text = Text.from_markup("Hello, [bold magenta]World[/]!")
+
+        console = Console()
+
+        console.rule("rich.Segment")
+        console.print(
+            "A Segment is the last step in the Rich render process before generating text with ANSI codes."
+        )
+        console.print("\nConsider the following code:\n")
+        console.print(Syntax(code, "python", line_numbers=True))
+        console.print()
+        console.print(
+            "When you call [b]print()[/b], Rich [i]renders[/i] the object in to the the following:\n"
+        )
+        fragments = list(console.render(text))
+        console.print(fragments)
+        console.print()
+        console.print(
+            "The Segments are then processed to produce the following output:\n"
+        )
+        console.print(text)
+        console.print(
+            "\nYou will only need to know this if you are implementing your own Rich renderables."
+        )
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/spinner.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/spinner.py
new file mode 100644
index 0000000000000000000000000000000000000000..5b13b1e9ba2c495ee4f00b8bc1f750625b7b6ff7
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/spinner.py
@@ -0,0 +1,134 @@
+from typing import cast, List, Optional, TYPE_CHECKING
+
+from ._spinners import SPINNERS
+from .measure import Measurement
+from .table import Table
+from .text import Text
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult, RenderableType
+    from .style import StyleType
+
+
+class Spinner:
+    def __init__(
+        self,
+        name: str,
+        text: "RenderableType" = "",
+        *,
+        style: Optional["StyleType"] = None,
+        speed: float = 1.0,
+    ) -> None:
+        """A spinner animation.
+
+        Args:
+            name (str): Name of spinner (run python -m rich.spinner).
+            text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "".
+            style (StyleType, optional): Style for spinner animation. Defaults to None.
+            speed (float, optional): Speed factor for animation. Defaults to 1.0.
+
+        Raises:
+            KeyError: If name isn't one of the supported spinner animations.
+        """
+        try:
+            spinner = SPINNERS[name]
+        except KeyError:
+            raise KeyError(f"no spinner called {name!r}")
+        self.text = Text.from_markup(text) if isinstance(text, str) else text
+        self.frames = cast(List[str], spinner["frames"])[:]
+        self.interval = cast(float, spinner["interval"])
+        self.start_time: Optional[float] = None
+        self.style = style
+        self.speed = speed
+        self.frame_no_offset: float = 0.0
+        self._update_speed = 0.0
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        yield self.render(console.get_time())
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        text = self.render(0)
+        return Measurement.get(console, options, text)
+
+    def render(self, time: float) -> "RenderableType":
+        """Render the spinner for a given time.
+
+        Args:
+            time (float): Time in seconds.
+
+        Returns:
+            RenderableType: A renderable containing animation frame.
+        """
+        if self.start_time is None:
+            self.start_time = time
+
+        frame_no = ((time - self.start_time) * self.speed) / (
+            self.interval / 1000.0
+        ) + self.frame_no_offset
+        frame = Text(
+            self.frames[int(frame_no) % len(self.frames)], style=self.style or ""
+        )
+
+        if self._update_speed:
+            self.frame_no_offset = frame_no
+            self.start_time = time
+            self.speed = self._update_speed
+            self._update_speed = 0.0
+
+        if not self.text:
+            return frame
+        elif isinstance(self.text, (str, Text)):
+            return Text.assemble(frame, " ", self.text)
+        else:
+            table = Table.grid(padding=1)
+            table.add_row(frame, self.text)
+            return table
+
+    def update(
+        self,
+        *,
+        text: "RenderableType" = "",
+        style: Optional["StyleType"] = None,
+        speed: Optional[float] = None,
+    ) -> None:
+        """Updates attributes of a spinner after it has been started.
+
+        Args:
+            text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "".
+            style (StyleType, optional): Style for spinner animation. Defaults to None.
+            speed (float, optional): Speed factor for animation. Defaults to None.
+        """
+        if text:
+            self.text = Text.from_markup(text) if isinstance(text, str) else text
+        if style:
+            self.style = style
+        if speed:
+            self._update_speed = speed
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from time import sleep
+
+    from .columns import Columns
+    from .panel import Panel
+    from .live import Live
+
+    all_spinners = Columns(
+        [
+            Spinner(spinner_name, text=Text(repr(spinner_name), style="green"))
+            for spinner_name in sorted(SPINNERS.keys())
+        ],
+        column_first=True,
+        expand=True,
+    )
+
+    with Live(
+        Panel(all_spinners, title="Spinners", border_style="blue"),
+        refresh_per_second=20,
+    ) as live:
+        while True:
+            sleep(0.1)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/status.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/status.py
new file mode 100644
index 0000000000000000000000000000000000000000..09eff405ec194ee2884f203cb48c5df54ff0b9c7
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/status.py
@@ -0,0 +1,132 @@
+from types import TracebackType
+from typing import Optional, Type
+
+from .console import Console, RenderableType
+from .jupyter import JupyterMixin
+from .live import Live
+from .spinner import Spinner
+from .style import StyleType
+
+
+class Status(JupyterMixin):
+    """Displays a status indicator with a 'spinner' animation.
+
+    Args:
+        status (RenderableType): A status renderable (str or Text typically).
+        console (Console, optional): Console instance to use, or None for global console. Defaults to None.
+        spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots".
+        spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner".
+        speed (float, optional): Speed factor for spinner animation. Defaults to 1.0.
+        refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5.
+    """
+
+    def __init__(
+        self,
+        status: RenderableType,
+        *,
+        console: Optional[Console] = None,
+        spinner: str = "dots",
+        spinner_style: StyleType = "status.spinner",
+        speed: float = 1.0,
+        refresh_per_second: float = 12.5,
+    ):
+        self.status = status
+        self.spinner_style = spinner_style
+        self.speed = speed
+        self._spinner = Spinner(spinner, text=status, style=spinner_style, speed=speed)
+        self._live = Live(
+            self.renderable,
+            console=console,
+            refresh_per_second=refresh_per_second,
+            transient=True,
+        )
+
+    @property
+    def renderable(self) -> Spinner:
+        return self._spinner
+
+    @property
+    def console(self) -> "Console":
+        """Get the Console used by the Status objects."""
+        return self._live.console
+
+    def update(
+        self,
+        status: Optional[RenderableType] = None,
+        *,
+        spinner: Optional[str] = None,
+        spinner_style: Optional[StyleType] = None,
+        speed: Optional[float] = None,
+    ) -> None:
+        """Update status.
+
+        Args:
+            status (Optional[RenderableType], optional): New status renderable or None for no change. Defaults to None.
+            spinner (Optional[str], optional): New spinner or None for no change. Defaults to None.
+            spinner_style (Optional[StyleType], optional): New spinner style or None for no change. Defaults to None.
+            speed (Optional[float], optional): Speed factor for spinner animation or None for no change. Defaults to None.
+        """
+        if status is not None:
+            self.status = status
+        if spinner_style is not None:
+            self.spinner_style = spinner_style
+        if speed is not None:
+            self.speed = speed
+        if spinner is not None:
+            self._spinner = Spinner(
+                spinner, text=self.status, style=self.spinner_style, speed=self.speed
+            )
+            self._live.update(self.renderable, refresh=True)
+        else:
+            self._spinner.update(
+                text=self.status, style=self.spinner_style, speed=self.speed
+            )
+
+    def start(self) -> None:
+        """Start the status animation."""
+        self._live.start()
+
+    def stop(self) -> None:
+        """Stop the spinner animation."""
+        self._live.stop()
+
+    def __rich__(self) -> RenderableType:
+        return self.renderable
+
+    def __enter__(self) -> "Status":
+        self.start()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.stop()
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from time import sleep
+
+    from .console import Console
+
+    console = Console()
+    with console.status("[magenta]Covid detector booting up") as status:
+        sleep(3)
+        console.log("Importing advanced AI")
+        sleep(3)
+        console.log("Advanced Covid AI Ready")
+        sleep(3)
+        status.update(status="[bold blue] Scanning for Covid", spinner="earth")
+        sleep(3)
+        console.log("Found 10,000,000,000 copies of Covid32.exe")
+        sleep(3)
+        status.update(
+            status="[bold red]Moving Covid32.exe to Trash",
+            spinner="bouncingBall",
+            spinner_style="yellow",
+        )
+        sleep(5)
+    console.print("[bold green]Covid deleted successfully")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/syntax.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/syntax.py
new file mode 100644
index 0000000000000000000000000000000000000000..58cc1037fae77d5d71f3280a73a2cf2cbdbb1ac9
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/syntax.py
@@ -0,0 +1,735 @@
+import os.path
+import platform
+from pip._vendor.rich.containers import Lines
+import textwrap
+from abc import ABC, abstractmethod
+from typing import Any, Dict, Iterable, List, Optional, Set, Tuple, Type, Union
+
+from pip._vendor.pygments.lexer import Lexer
+from pip._vendor.pygments.lexers import get_lexer_by_name, guess_lexer_for_filename
+from pip._vendor.pygments.style import Style as PygmentsStyle
+from pip._vendor.pygments.styles import get_style_by_name
+from pip._vendor.pygments.token import (
+    Comment,
+    Error,
+    Generic,
+    Keyword,
+    Name,
+    Number,
+    Operator,
+    String,
+    Token,
+    Whitespace,
+)
+from pip._vendor.pygments.util import ClassNotFound
+
+from ._loop import loop_first
+from .color import Color, blend_rgb
+from .console import Console, ConsoleOptions, JustifyMethod, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style
+from .text import Text
+
+TokenType = Tuple[str, ...]
+
+WINDOWS = platform.system() == "Windows"
+DEFAULT_THEME = "monokai"
+
+# The following styles are based on https://github.com/pygments/pygments/blob/master/pygments/formatters/terminal.py
+# A few modifications were made
+
+ANSI_LIGHT: Dict[TokenType, Style] = {
+    Token: Style(),
+    Whitespace: Style(color="white"),
+    Comment: Style(dim=True),
+    Comment.Preproc: Style(color="cyan"),
+    Keyword: Style(color="blue"),
+    Keyword.Type: Style(color="cyan"),
+    Operator.Word: Style(color="magenta"),
+    Name.Builtin: Style(color="cyan"),
+    Name.Function: Style(color="green"),
+    Name.Namespace: Style(color="cyan", underline=True),
+    Name.Class: Style(color="green", underline=True),
+    Name.Exception: Style(color="cyan"),
+    Name.Decorator: Style(color="magenta", bold=True),
+    Name.Variable: Style(color="red"),
+    Name.Constant: Style(color="red"),
+    Name.Attribute: Style(color="cyan"),
+    Name.Tag: Style(color="bright_blue"),
+    String: Style(color="yellow"),
+    Number: Style(color="blue"),
+    Generic.Deleted: Style(color="bright_red"),
+    Generic.Inserted: Style(color="green"),
+    Generic.Heading: Style(bold=True),
+    Generic.Subheading: Style(color="magenta", bold=True),
+    Generic.Prompt: Style(bold=True),
+    Generic.Error: Style(color="bright_red"),
+    Error: Style(color="red", underline=True),
+}
+
+ANSI_DARK: Dict[TokenType, Style] = {
+    Token: Style(),
+    Whitespace: Style(color="bright_black"),
+    Comment: Style(dim=True),
+    Comment.Preproc: Style(color="bright_cyan"),
+    Keyword: Style(color="bright_blue"),
+    Keyword.Type: Style(color="bright_cyan"),
+    Operator.Word: Style(color="bright_magenta"),
+    Name.Builtin: Style(color="bright_cyan"),
+    Name.Function: Style(color="bright_green"),
+    Name.Namespace: Style(color="bright_cyan", underline=True),
+    Name.Class: Style(color="bright_green", underline=True),
+    Name.Exception: Style(color="bright_cyan"),
+    Name.Decorator: Style(color="bright_magenta", bold=True),
+    Name.Variable: Style(color="bright_red"),
+    Name.Constant: Style(color="bright_red"),
+    Name.Attribute: Style(color="bright_cyan"),
+    Name.Tag: Style(color="bright_blue"),
+    String: Style(color="yellow"),
+    Number: Style(color="bright_blue"),
+    Generic.Deleted: Style(color="bright_red"),
+    Generic.Inserted: Style(color="bright_green"),
+    Generic.Heading: Style(bold=True),
+    Generic.Subheading: Style(color="bright_magenta", bold=True),
+    Generic.Prompt: Style(bold=True),
+    Generic.Error: Style(color="bright_red"),
+    Error: Style(color="red", underline=True),
+}
+
+RICH_SYNTAX_THEMES = {"ansi_light": ANSI_LIGHT, "ansi_dark": ANSI_DARK}
+
+
+class SyntaxTheme(ABC):
+    """Base class for a syntax theme."""
+
+    @abstractmethod
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Get a style for a given Pygments token."""
+        raise NotImplementedError  # pragma: no cover
+
+    @abstractmethod
+    def get_background_style(self) -> Style:
+        """Get the background color."""
+        raise NotImplementedError  # pragma: no cover
+
+
+class PygmentsSyntaxTheme(SyntaxTheme):
+    """Syntax theme that delegates to Pygments theme."""
+
+    def __init__(self, theme: Union[str, Type[PygmentsStyle]]) -> None:
+        self._style_cache: Dict[TokenType, Style] = {}
+        if isinstance(theme, str):
+            try:
+                self._pygments_style_class = get_style_by_name(theme)
+            except ClassNotFound:
+                self._pygments_style_class = get_style_by_name("default")
+        else:
+            self._pygments_style_class = theme
+
+        self._background_color = self._pygments_style_class.background_color
+        self._background_style = Style(bgcolor=self._background_color)
+
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Get a style from a Pygments class."""
+        try:
+            return self._style_cache[token_type]
+        except KeyError:
+            try:
+                pygments_style = self._pygments_style_class.style_for_token(token_type)
+            except KeyError:
+                style = Style.null()
+            else:
+                color = pygments_style["color"]
+                bgcolor = pygments_style["bgcolor"]
+                style = Style(
+                    color="#" + color if color else "#000000",
+                    bgcolor="#" + bgcolor if bgcolor else self._background_color,
+                    bold=pygments_style["bold"],
+                    italic=pygments_style["italic"],
+                    underline=pygments_style["underline"],
+                )
+            self._style_cache[token_type] = style
+        return style
+
+    def get_background_style(self) -> Style:
+        return self._background_style
+
+
+class ANSISyntaxTheme(SyntaxTheme):
+    """Syntax theme to use standard colors."""
+
+    def __init__(self, style_map: Dict[TokenType, Style]) -> None:
+        self.style_map = style_map
+        self._missing_style = Style.null()
+        self._background_style = Style.null()
+        self._style_cache: Dict[TokenType, Style] = {}
+
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Look up style in the style map."""
+        try:
+            return self._style_cache[token_type]
+        except KeyError:
+            # Styles form a hierarchy
+            # We need to go from most to least specific
+            # e.g. ("foo", "bar", "baz") to ("foo", "bar")  to ("foo",)
+            get_style = self.style_map.get
+            token = tuple(token_type)
+            style = self._missing_style
+            while token:
+                _style = get_style(token)
+                if _style is not None:
+                    style = _style
+                    break
+                token = token[:-1]
+            self._style_cache[token_type] = style
+            return style
+
+    def get_background_style(self) -> Style:
+        return self._background_style
+
+
+class Syntax(JupyterMixin):
+    """Construct a Syntax object to render syntax highlighted code.
+
+    Args:
+        code (str): Code to highlight.
+        lexer (Lexer | str): Lexer to use (see https://pygments.org/docs/lexers/)
+        theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "monokai".
+        dedent (bool, optional): Enable stripping of initial whitespace. Defaults to False.
+        line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False.
+        start_line (int, optional): Starting number for line numbers. Defaults to 1.
+        line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render.
+        highlight_lines (Set[int]): A set of line numbers to highlight.
+        code_width: Width of code to render (not including line numbers), or ``None`` to use all available width.
+        tab_size (int, optional): Size of tabs. Defaults to 4.
+        word_wrap (bool, optional): Enable word wrapping.
+        background_color (str, optional): Optional background color, or None to use theme color. Defaults to None.
+        indent_guides (bool, optional): Show indent guides. Defaults to False.
+    """
+
+    _pygments_style_class: Type[PygmentsStyle]
+    _theme: SyntaxTheme
+
+    @classmethod
+    def get_theme(cls, name: Union[str, SyntaxTheme]) -> SyntaxTheme:
+        """Get a syntax theme instance."""
+        if isinstance(name, SyntaxTheme):
+            return name
+        theme: SyntaxTheme
+        if name in RICH_SYNTAX_THEMES:
+            theme = ANSISyntaxTheme(RICH_SYNTAX_THEMES[name])
+        else:
+            theme = PygmentsSyntaxTheme(name)
+        return theme
+
+    def __init__(
+        self,
+        code: str,
+        lexer: Union[Lexer, str],
+        *,
+        theme: Union[str, SyntaxTheme] = DEFAULT_THEME,
+        dedent: bool = False,
+        line_numbers: bool = False,
+        start_line: int = 1,
+        line_range: Optional[Tuple[int, int]] = None,
+        highlight_lines: Optional[Set[int]] = None,
+        code_width: Optional[int] = None,
+        tab_size: int = 4,
+        word_wrap: bool = False,
+        background_color: Optional[str] = None,
+        indent_guides: bool = False,
+    ) -> None:
+        self.code = code
+        self._lexer = lexer
+        self.dedent = dedent
+        self.line_numbers = line_numbers
+        self.start_line = start_line
+        self.line_range = line_range
+        self.highlight_lines = highlight_lines or set()
+        self.code_width = code_width
+        self.tab_size = tab_size
+        self.word_wrap = word_wrap
+        self.background_color = background_color
+        self.background_style = (
+            Style(bgcolor=background_color) if background_color else Style()
+        )
+        self.indent_guides = indent_guides
+
+        self._theme = self.get_theme(theme)
+
+    @classmethod
+    def from_path(
+        cls,
+        path: str,
+        encoding: str = "utf-8",
+        theme: Union[str, SyntaxTheme] = DEFAULT_THEME,
+        dedent: bool = False,
+        line_numbers: bool = False,
+        line_range: Optional[Tuple[int, int]] = None,
+        start_line: int = 1,
+        highlight_lines: Optional[Set[int]] = None,
+        code_width: Optional[int] = None,
+        tab_size: int = 4,
+        word_wrap: bool = False,
+        background_color: Optional[str] = None,
+        indent_guides: bool = False,
+    ) -> "Syntax":
+        """Construct a Syntax object from a file.
+
+        Args:
+            path (str): Path to file to highlight.
+            encoding (str): Encoding of file.
+            theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "emacs".
+            dedent (bool, optional): Enable stripping of initial whitespace. Defaults to True.
+            line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False.
+            start_line (int, optional): Starting number for line numbers. Defaults to 1.
+            line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render.
+            highlight_lines (Set[int]): A set of line numbers to highlight.
+            code_width: Width of code to render (not including line numbers), or ``None`` to use all available width.
+            tab_size (int, optional): Size of tabs. Defaults to 4.
+            word_wrap (bool, optional): Enable word wrapping of code.
+            background_color (str, optional): Optional background color, or None to use theme color. Defaults to None.
+            indent_guides (bool, optional): Show indent guides. Defaults to False.
+
+        Returns:
+            [Syntax]: A Syntax object that may be printed to the console
+        """
+        with open(path, "rt", encoding=encoding) as code_file:
+            code = code_file.read()
+
+        lexer = None
+        lexer_name = "default"
+        try:
+            _, ext = os.path.splitext(path)
+            if ext:
+                extension = ext.lstrip(".").lower()
+                lexer = get_lexer_by_name(extension)
+                lexer_name = lexer.name
+        except ClassNotFound:
+            pass
+
+        if lexer is None:
+            try:
+                lexer_name = guess_lexer_for_filename(path, code).name
+            except ClassNotFound:
+                pass
+
+        return cls(
+            code,
+            lexer_name,
+            theme=theme,
+            dedent=dedent,
+            line_numbers=line_numbers,
+            line_range=line_range,
+            start_line=start_line,
+            highlight_lines=highlight_lines,
+            code_width=code_width,
+            tab_size=tab_size,
+            word_wrap=word_wrap,
+            background_color=background_color,
+            indent_guides=indent_guides,
+        )
+
+    def _get_base_style(self) -> Style:
+        """Get the base style."""
+        default_style = self._theme.get_background_style() + self.background_style
+        return default_style
+
+    def _get_token_color(self, token_type: TokenType) -> Optional[Color]:
+        """Get a color (if any) for the given token.
+
+        Args:
+            token_type (TokenType): A token type tuple from Pygments.
+
+        Returns:
+            Optional[Color]: Color from theme, or None for no color.
+        """
+        style = self._theme.get_style_for_token(token_type)
+        return style.color
+
+    @property
+    def lexer(self) -> Optional[Lexer]:
+        """The lexer for this syntax, or None if no lexer was found.
+
+        Tries to find the lexer by name if a string was passed to the constructor.
+        """
+
+        if isinstance(self._lexer, Lexer):
+            return self._lexer
+        try:
+            return get_lexer_by_name(
+                self._lexer,
+                stripnl=False,
+                ensurenl=True,
+                tabsize=self.tab_size,
+            )
+        except ClassNotFound:
+            return None
+
+    def highlight(
+        self, code: str, line_range: Optional[Tuple[int, int]] = None
+    ) -> Text:
+        """Highlight code and return a Text instance.
+
+        Args:
+            code (str): Code to highlight.
+            line_range(Tuple[int, int], optional): Optional line range to highlight.
+
+        Returns:
+            Text: A text instance containing highlighted syntax.
+        """
+
+        base_style = self._get_base_style()
+        justify: JustifyMethod = (
+            "default" if base_style.transparent_background else "left"
+        )
+
+        text = Text(
+            justify=justify,
+            style=base_style,
+            tab_size=self.tab_size,
+            no_wrap=not self.word_wrap,
+        )
+        _get_theme_style = self._theme.get_style_for_token
+
+        lexer = self.lexer
+
+        if lexer is None:
+            text.append(code)
+        else:
+            if line_range:
+                # More complicated path to only stylize a portion of the code
+                # This speeds up further operations as there are less spans to process
+                line_start, line_end = line_range
+
+                def line_tokenize() -> Iterable[Tuple[Any, str]]:
+                    """Split tokens to one per line."""
+                    assert lexer
+
+                    for token_type, token in lexer.get_tokens(code):
+                        while token:
+                            line_token, new_line, token = token.partition("\n")
+                            yield token_type, line_token + new_line
+
+                def tokens_to_spans() -> Iterable[Tuple[str, Optional[Style]]]:
+                    """Convert tokens to spans."""
+                    tokens = iter(line_tokenize())
+                    line_no = 0
+                    _line_start = line_start - 1
+
+                    # Skip over tokens until line start
+                    while line_no < _line_start:
+                        _token_type, token = next(tokens)
+                        yield (token, None)
+                        if token.endswith("\n"):
+                            line_no += 1
+                    # Generate spans until line end
+                    for token_type, token in tokens:
+                        yield (token, _get_theme_style(token_type))
+                        if token.endswith("\n"):
+                            line_no += 1
+                            if line_no >= line_end:
+                                break
+
+                text.append_tokens(tokens_to_spans())
+
+            else:
+                text.append_tokens(
+                    (token, _get_theme_style(token_type))
+                    for token_type, token in lexer.get_tokens(code)
+                )
+            if self.background_color is not None:
+                text.stylize(f"on {self.background_color}")
+        return text
+
+    def _get_line_numbers_color(self, blend: float = 0.3) -> Color:
+        background_style = self._theme.get_background_style() + self.background_style
+        background_color = background_style.bgcolor
+        if background_color is None or background_color.is_system_defined:
+            return Color.default()
+        foreground_color = self._get_token_color(Token.Text)
+        if foreground_color is None or foreground_color.is_system_defined:
+            return foreground_color or Color.default()
+        new_color = blend_rgb(
+            background_color.get_truecolor(),
+            foreground_color.get_truecolor(),
+            cross_fade=blend,
+        )
+        return Color.from_triplet(new_color)
+
+    @property
+    def _numbers_column_width(self) -> int:
+        """Get the number of characters used to render the numbers column."""
+        column_width = 0
+        if self.line_numbers:
+            column_width = len(str(self.start_line + self.code.count("\n"))) + 2
+        return column_width
+
+    def _get_number_styles(self, console: Console) -> Tuple[Style, Style, Style]:
+        """Get background, number, and highlight styles for line numbers."""
+        background_style = self._get_base_style()
+        if background_style.transparent_background:
+            return Style.null(), Style(dim=True), Style.null()
+        if console.color_system in ("256", "truecolor"):
+            number_style = Style.chain(
+                background_style,
+                self._theme.get_style_for_token(Token.Text),
+                Style(color=self._get_line_numbers_color()),
+                self.background_style,
+            )
+            highlight_number_style = Style.chain(
+                background_style,
+                self._theme.get_style_for_token(Token.Text),
+                Style(bold=True, color=self._get_line_numbers_color(0.9)),
+                self.background_style,
+            )
+        else:
+            number_style = background_style + Style(dim=True)
+            highlight_number_style = background_style + Style(dim=False)
+        return background_style, number_style, highlight_number_style
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.code_width is not None:
+            width = self.code_width + self._numbers_column_width
+            return Measurement(self._numbers_column_width, width)
+        return Measurement(self._numbers_column_width, options.max_width)
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        transparent_background = self._get_base_style().transparent_background
+        code_width = (
+            (
+                (options.max_width - self._numbers_column_width - 1)
+                if self.line_numbers
+                else options.max_width
+            )
+            if self.code_width is None
+            else self.code_width
+        )
+
+        line_offset = 0
+        if self.line_range:
+            start_line, end_line = self.line_range
+            line_offset = max(0, start_line - 1)
+
+        ends_on_nl = self.code.endswith("\n")
+        code = self.code if ends_on_nl else self.code + "\n"
+        code = textwrap.dedent(code) if self.dedent else code
+        code = code.expandtabs(self.tab_size)
+        text = self.highlight(code, self.line_range)
+
+        (
+            background_style,
+            number_style,
+            highlight_number_style,
+        ) = self._get_number_styles(console)
+
+        if not self.line_numbers and not self.word_wrap and not self.line_range:
+            if not ends_on_nl:
+                text.remove_suffix("\n")
+            # Simple case of just rendering text
+            style = (
+                self._get_base_style()
+                + self._theme.get_style_for_token(Comment)
+                + Style(dim=True)
+                + self.background_style
+            )
+            if self.indent_guides and not options.ascii_only:
+                text = text.with_indent_guides(self.tab_size, style=style)
+                text.overflow = "crop"
+            if style.transparent_background:
+                yield from console.render(
+                    text, options=options.update(width=code_width)
+                )
+            else:
+                syntax_lines = console.render_lines(
+                    text,
+                    options.update(width=code_width, height=None),
+                    style=self.background_style,
+                    pad=True,
+                    new_lines=True,
+                )
+                for syntax_line in syntax_lines:
+                    yield from syntax_line
+            return
+
+        lines: Union[List[Text], Lines] = text.split("\n", allow_blank=ends_on_nl)
+        if self.line_range:
+            lines = lines[line_offset:end_line]
+
+        if self.indent_guides and not options.ascii_only:
+            style = (
+                self._get_base_style()
+                + self._theme.get_style_for_token(Comment)
+                + Style(dim=True)
+                + self.background_style
+            )
+            lines = (
+                Text("\n")
+                .join(lines)
+                .with_indent_guides(self.tab_size, style=style)
+                .split("\n", allow_blank=True)
+            )
+
+        numbers_column_width = self._numbers_column_width
+        render_options = options.update(width=code_width)
+
+        highlight_line = self.highlight_lines.__contains__
+        _Segment = Segment
+        padding = _Segment(" " * numbers_column_width + " ", background_style)
+        new_line = _Segment("\n")
+
+        line_pointer = "> " if options.legacy_windows else "❱ "
+
+        for line_no, line in enumerate(lines, self.start_line + line_offset):
+            if self.word_wrap:
+                wrapped_lines = console.render_lines(
+                    line,
+                    render_options.update(height=None),
+                    style=background_style,
+                    pad=not transparent_background,
+                )
+
+            else:
+                segments = list(line.render(console, end=""))
+                if options.no_wrap:
+                    wrapped_lines = [segments]
+                else:
+                    wrapped_lines = [
+                        _Segment.adjust_line_length(
+                            segments,
+                            render_options.max_width,
+                            style=background_style,
+                            pad=not transparent_background,
+                        )
+                    ]
+            if self.line_numbers:
+                for first, wrapped_line in loop_first(wrapped_lines):
+                    if first:
+                        line_column = str(line_no).rjust(numbers_column_width - 2) + " "
+                        if highlight_line(line_no):
+                            yield _Segment(line_pointer, Style(color="red"))
+                            yield _Segment(line_column, highlight_number_style)
+                        else:
+                            yield _Segment("  ", highlight_number_style)
+                            yield _Segment(line_column, number_style)
+                    else:
+                        yield padding
+                    yield from wrapped_line
+                    yield new_line
+            else:
+                for wrapped_line in wrapped_lines:
+                    yield from wrapped_line
+                    yield new_line
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    import argparse
+    import sys
+
+    parser = argparse.ArgumentParser(
+        description="Render syntax to the console with Rich"
+    )
+    parser.add_argument(
+        "path",
+        metavar="PATH",
+        help="path to file, or - for stdin",
+    )
+    parser.add_argument(
+        "-c",
+        "--force-color",
+        dest="force_color",
+        action="store_true",
+        default=None,
+        help="force color for non-terminals",
+    )
+    parser.add_argument(
+        "-i",
+        "--indent-guides",
+        dest="indent_guides",
+        action="store_true",
+        default=False,
+        help="display indent guides",
+    )
+    parser.add_argument(
+        "-l",
+        "--line-numbers",
+        dest="line_numbers",
+        action="store_true",
+        help="render line numbers",
+    )
+    parser.add_argument(
+        "-w",
+        "--width",
+        type=int,
+        dest="width",
+        default=None,
+        help="width of output (default will auto-detect)",
+    )
+    parser.add_argument(
+        "-r",
+        "--wrap",
+        dest="word_wrap",
+        action="store_true",
+        default=False,
+        help="word wrap long lines",
+    )
+    parser.add_argument(
+        "-s",
+        "--soft-wrap",
+        action="store_true",
+        dest="soft_wrap",
+        default=False,
+        help="enable soft wrapping mode",
+    )
+    parser.add_argument(
+        "-t", "--theme", dest="theme", default="monokai", help="pygments theme"
+    )
+    parser.add_argument(
+        "-b",
+        "--background-color",
+        dest="background_color",
+        default=None,
+        help="Override background color",
+    )
+    parser.add_argument(
+        "-x",
+        "--lexer",
+        default="default",
+        dest="lexer_name",
+        help="Lexer name",
+    )
+    args = parser.parse_args()
+
+    from pip._vendor.rich.console import Console
+
+    console = Console(force_terminal=args.force_color, width=args.width)
+
+    if args.path == "-":
+        code = sys.stdin.read()
+        syntax = Syntax(
+            code=code,
+            lexer=args.lexer_name,
+            line_numbers=args.line_numbers,
+            word_wrap=args.word_wrap,
+            theme=args.theme,
+            background_color=args.background_color,
+            indent_guides=args.indent_guides,
+        )
+    else:
+        syntax = Syntax.from_path(
+            args.path,
+            line_numbers=args.line_numbers,
+            word_wrap=args.word_wrap,
+            theme=args.theme,
+            background_color=args.background_color,
+            indent_guides=args.indent_guides,
+        )
+    console.print(syntax, soft_wrap=args.soft_wrap)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/table.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/table.py
new file mode 100644
index 0000000000000000000000000000000000000000..da4386085a8191256a882579b37faaa01e59f731
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/table.py
@@ -0,0 +1,968 @@
+from dataclasses import dataclass, field, replace
+from typing import (
+    TYPE_CHECKING,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Tuple,
+    Union,
+)
+
+from . import box, errors
+from ._loop import loop_first_last, loop_last
+from ._pick import pick_bool
+from ._ratio import ratio_distribute, ratio_reduce
+from .align import VerticalAlignMethod
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .padding import Padding, PaddingDimensions
+from .protocol import is_renderable
+from .segment import Segment
+from .style import Style, StyleType
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import (
+        Console,
+        ConsoleOptions,
+        JustifyMethod,
+        OverflowMethod,
+        RenderableType,
+        RenderResult,
+    )
+
+
+@dataclass
+class Column:
+    """Defines a column in a table."""
+
+    header: "RenderableType" = ""
+    """RenderableType: Renderable for the header (typically a string)"""
+
+    footer: "RenderableType" = ""
+    """RenderableType: Renderable for the footer (typically a string)"""
+
+    header_style: StyleType = ""
+    """StyleType: The style of the header."""
+
+    footer_style: StyleType = ""
+    """StyleType: The style of the footer."""
+
+    style: StyleType = ""
+    """StyleType: The style of the column."""
+
+    justify: "JustifyMethod" = "left"
+    """str: How to justify text within the column ("left", "center", "right", or "full")"""
+
+    vertical: "VerticalAlignMethod" = "top"
+    """str: How to vertically align content ("top", "middle", or "bottom")"""
+
+    overflow: "OverflowMethod" = "ellipsis"
+    """str: Overflow method."""
+
+    width: Optional[int] = None
+    """Optional[int]: Width of the column, or ``None`` (default) to auto calculate width."""
+
+    min_width: Optional[int] = None
+    """Optional[int]: Minimum width of column, or ``None`` for no minimum. Defaults to None."""
+
+    max_width: Optional[int] = None
+    """Optional[int]: Maximum width of column, or ``None`` for no maximum. Defaults to None."""
+
+    ratio: Optional[int] = None
+    """Optional[int]: Ratio to use when calculating column width, or ``None`` (default) to adapt to column contents."""
+
+    no_wrap: bool = False
+    """bool: Prevent wrapping of text within the column. Defaults to ``False``."""
+
+    _index: int = 0
+    """Index of column."""
+
+    _cells: List["RenderableType"] = field(default_factory=list)
+
+    def copy(self) -> "Column":
+        """Return a copy of this Column."""
+        return replace(self, _cells=[])
+
+    @property
+    def cells(self) -> Iterable["RenderableType"]:
+        """Get all cells in the column, not including header."""
+        yield from self._cells
+
+    @property
+    def flexible(self) -> bool:
+        """Check if this column is flexible."""
+        return self.ratio is not None
+
+
+@dataclass
+class Row:
+    """Information regarding a row."""
+
+    style: Optional[StyleType] = None
+    """Style to apply to row."""
+
+    end_section: bool = False
+    """Indicated end of section, which will force a line beneath the row."""
+
+
+class _Cell(NamedTuple):
+    """A single cell in a table."""
+
+    style: StyleType
+    """Style to apply to cell."""
+    renderable: "RenderableType"
+    """Cell renderable."""
+    vertical: VerticalAlignMethod
+    """Cell vertical alignment."""
+
+
+class Table(JupyterMixin):
+    """A console renderable to draw a table.
+
+    Args:
+        *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance.
+        title (Union[str, Text], optional): The title of the table rendered at the top. Defaults to None.
+        caption (Union[str, Text], optional): The table caption rendered below. Defaults to None.
+        width (int, optional): The width in characters of the table, or ``None`` to automatically fit. Defaults to None.
+        min_width (Optional[int], optional): The minimum width of the table, or ``None`` for no minimum. Defaults to None.
+        box (box.Box, optional): One of the constants in box.py used to draw the edges (see :ref:`appendix_box`), or ``None`` for no box lines. Defaults to box.HEAVY_HEAD.
+        safe_box (Optional[bool], optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True.
+        padding (PaddingDimensions, optional): Padding for cells (top, right, bottom, left). Defaults to (0, 1).
+        collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to False.
+        pad_edge (bool, optional): Enable padding of edge cells. Defaults to True.
+        expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False.
+        show_header (bool, optional): Show a header row. Defaults to True.
+        show_footer (bool, optional): Show a footer row. Defaults to False.
+        show_edge (bool, optional): Draw a box around the outside of the table. Defaults to True.
+        show_lines (bool, optional): Draw lines between every row. Defaults to False.
+        leading (bool, optional): Number of blank lines between rows (precludes ``show_lines``). Defaults to 0.
+        style (Union[str, Style], optional): Default style for the table. Defaults to "none".
+        row_styles (List[Union, str], optional): Optional list of row styles, if more than one style is given then the styles will alternate. Defaults to None.
+        header_style (Union[str, Style], optional): Style of the header. Defaults to "table.header".
+        footer_style (Union[str, Style], optional): Style of the footer. Defaults to "table.footer".
+        border_style (Union[str, Style], optional): Style of the border. Defaults to None.
+        title_style (Union[str, Style], optional): Style of the title. Defaults to None.
+        caption_style (Union[str, Style], optional): Style of the caption. Defaults to None.
+        title_justify (str, optional): Justify method for title. Defaults to "center".
+        caption_justify (str, optional): Justify method for caption. Defaults to "center".
+        highlight (bool, optional): Highlight cell contents (if str). Defaults to False.
+    """
+
+    columns: List[Column]
+    rows: List[Row]
+
+    def __init__(
+        self,
+        *headers: Union[Column, str],
+        title: Optional[TextType] = None,
+        caption: Optional[TextType] = None,
+        width: Optional[int] = None,
+        min_width: Optional[int] = None,
+        box: Optional[box.Box] = box.HEAVY_HEAD,
+        safe_box: Optional[bool] = None,
+        padding: PaddingDimensions = (0, 1),
+        collapse_padding: bool = False,
+        pad_edge: bool = True,
+        expand: bool = False,
+        show_header: bool = True,
+        show_footer: bool = False,
+        show_edge: bool = True,
+        show_lines: bool = False,
+        leading: int = 0,
+        style: StyleType = "none",
+        row_styles: Optional[Iterable[StyleType]] = None,
+        header_style: Optional[StyleType] = "table.header",
+        footer_style: Optional[StyleType] = "table.footer",
+        border_style: Optional[StyleType] = None,
+        title_style: Optional[StyleType] = None,
+        caption_style: Optional[StyleType] = None,
+        title_justify: "JustifyMethod" = "center",
+        caption_justify: "JustifyMethod" = "center",
+        highlight: bool = False,
+    ) -> None:
+
+        self.columns: List[Column] = []
+        self.rows: List[Row] = []
+        self.title = title
+        self.caption = caption
+        self.width = width
+        self.min_width = min_width
+        self.box = box
+        self.safe_box = safe_box
+        self._padding = Padding.unpack(padding)
+        self.pad_edge = pad_edge
+        self._expand = expand
+        self.show_header = show_header
+        self.show_footer = show_footer
+        self.show_edge = show_edge
+        self.show_lines = show_lines
+        self.leading = leading
+        self.collapse_padding = collapse_padding
+        self.style = style
+        self.header_style = header_style or ""
+        self.footer_style = footer_style or ""
+        self.border_style = border_style
+        self.title_style = title_style
+        self.caption_style = caption_style
+        self.title_justify: "JustifyMethod" = title_justify
+        self.caption_justify: "JustifyMethod" = caption_justify
+        self.highlight = highlight
+        self.row_styles: Sequence[StyleType] = list(row_styles or [])
+        append_column = self.columns.append
+        for header in headers:
+            if isinstance(header, str):
+                self.add_column(header=header)
+            else:
+                header._index = len(self.columns)
+                append_column(header)
+
+    @classmethod
+    def grid(
+        cls,
+        *headers: Union[Column, str],
+        padding: PaddingDimensions = 0,
+        collapse_padding: bool = True,
+        pad_edge: bool = False,
+        expand: bool = False,
+    ) -> "Table":
+        """Get a table with no lines, headers, or footer.
+
+        Args:
+            *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance.
+            padding (PaddingDimensions, optional): Get padding around cells. Defaults to 0.
+            collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to True.
+            pad_edge (bool, optional): Enable padding around edges of table. Defaults to False.
+            expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False.
+
+        Returns:
+            Table: A table instance.
+        """
+        return cls(
+            *headers,
+            box=None,
+            padding=padding,
+            collapse_padding=collapse_padding,
+            show_header=False,
+            show_footer=False,
+            show_edge=False,
+            pad_edge=pad_edge,
+            expand=expand,
+        )
+
+    @property
+    def expand(self) -> bool:
+        """Setting a non-None self.width implies expand."""
+        return self._expand or self.width is not None
+
+    @expand.setter
+    def expand(self, expand: bool) -> None:
+        """Set expand."""
+        self._expand = expand
+
+    @property
+    def _extra_width(self) -> int:
+        """Get extra width to add to cell content."""
+        width = 0
+        if self.box and self.show_edge:
+            width += 2
+        if self.box:
+            width += len(self.columns) - 1
+        return width
+
+    @property
+    def row_count(self) -> int:
+        """Get the current number of rows."""
+        return len(self.rows)
+
+    def get_row_style(self, console: "Console", index: int) -> StyleType:
+        """Get the current row style."""
+        style = Style.null()
+        if self.row_styles:
+            style += console.get_style(self.row_styles[index % len(self.row_styles)])
+        row_style = self.rows[index].style
+        if row_style is not None:
+            style += console.get_style(row_style)
+        return style
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        max_width = options.max_width
+        if self.width is not None:
+            max_width = self.width
+        if max_width < 0:
+            return Measurement(0, 0)
+
+        extra_width = self._extra_width
+        max_width = sum(
+            self._calculate_column_widths(
+                console, options.update_width(max_width - extra_width)
+            )
+        )
+        _measure_column = self._measure_column
+
+        measurements = [
+            _measure_column(console, options.update_width(max_width), column)
+            for column in self.columns
+        ]
+        minimum_width = (
+            sum(measurement.minimum for measurement in measurements) + extra_width
+        )
+        maximum_width = (
+            sum(measurement.maximum for measurement in measurements) + extra_width
+            if (self.width is None)
+            else self.width
+        )
+        measurement = Measurement(minimum_width, maximum_width)
+        measurement = measurement.clamp(self.min_width)
+        return measurement
+
+    @property
+    def padding(self) -> Tuple[int, int, int, int]:
+        """Get cell padding."""
+        return self._padding
+
+    @padding.setter
+    def padding(self, padding: PaddingDimensions) -> "Table":
+        """Set cell padding."""
+        self._padding = Padding.unpack(padding)
+        return self
+
+    def add_column(
+        self,
+        header: "RenderableType" = "",
+        footer: "RenderableType" = "",
+        *,
+        header_style: Optional[StyleType] = None,
+        footer_style: Optional[StyleType] = None,
+        style: Optional[StyleType] = None,
+        justify: "JustifyMethod" = "left",
+        vertical: "VerticalAlignMethod" = "top",
+        overflow: "OverflowMethod" = "ellipsis",
+        width: Optional[int] = None,
+        min_width: Optional[int] = None,
+        max_width: Optional[int] = None,
+        ratio: Optional[int] = None,
+        no_wrap: bool = False,
+    ) -> None:
+        """Add a column to the table.
+
+        Args:
+            header (RenderableType, optional): Text or renderable for the header.
+                Defaults to "".
+            footer (RenderableType, optional): Text or renderable for the footer.
+                Defaults to "".
+            header_style (Union[str, Style], optional): Style for the header, or None for default. Defaults to None.
+            footer_style (Union[str, Style], optional): Style for the footer, or None for default. Defaults to None.
+            style (Union[str, Style], optional): Style for the column cells, or None for default. Defaults to None.
+            justify (JustifyMethod, optional): Alignment for cells. Defaults to "left".
+            vertical (VerticalAlignMethod, optional): Vertical alignment, one of "top", "middle", or "bottom". Defaults to "top".
+            overflow (OverflowMethod): Overflow method: "crop", "fold", "ellipsis". Defaults to "ellipsis".
+            width (int, optional): Desired width of column in characters, or None to fit to contents. Defaults to None.
+            min_width (Optional[int], optional): Minimum width of column, or ``None`` for no minimum. Defaults to None.
+            max_width (Optional[int], optional): Maximum width of column, or ``None`` for no maximum. Defaults to None.
+            ratio (int, optional): Flexible ratio for the column (requires ``Table.expand`` or ``Table.width``). Defaults to None.
+            no_wrap (bool, optional): Set to ``True`` to disable wrapping of this column.
+        """
+
+        column = Column(
+            _index=len(self.columns),
+            header=header,
+            footer=footer,
+            header_style=header_style or "",
+            footer_style=footer_style or "",
+            style=style or "",
+            justify=justify,
+            vertical=vertical,
+            overflow=overflow,
+            width=width,
+            min_width=min_width,
+            max_width=max_width,
+            ratio=ratio,
+            no_wrap=no_wrap,
+        )
+        self.columns.append(column)
+
+    def add_row(
+        self,
+        *renderables: Optional["RenderableType"],
+        style: Optional[StyleType] = None,
+        end_section: bool = False,
+    ) -> None:
+        """Add a row of renderables.
+
+        Args:
+            *renderables (None or renderable): Each cell in a row must be a renderable object (including str),
+                or ``None`` for a blank cell.
+            style (StyleType, optional): An optional style to apply to the entire row. Defaults to None.
+            end_section (bool, optional): End a section and draw a line. Defaults to False.
+
+        Raises:
+            errors.NotRenderableError: If you add something that can't be rendered.
+        """
+
+        def add_cell(column: Column, renderable: "RenderableType") -> None:
+            column._cells.append(renderable)
+
+        cell_renderables: List[Optional["RenderableType"]] = list(renderables)
+
+        columns = self.columns
+        if len(cell_renderables) < len(columns):
+            cell_renderables = [
+                *cell_renderables,
+                *[None] * (len(columns) - len(cell_renderables)),
+            ]
+        for index, renderable in enumerate(cell_renderables):
+            if index == len(columns):
+                column = Column(_index=index)
+                for _ in self.rows:
+                    add_cell(column, Text(""))
+                self.columns.append(column)
+            else:
+                column = columns[index]
+            if renderable is None:
+                add_cell(column, "")
+            elif is_renderable(renderable):
+                add_cell(column, renderable)
+            else:
+                raise errors.NotRenderableError(
+                    f"unable to render {type(renderable).__name__}; a string or other renderable object is required"
+                )
+        self.rows.append(Row(style=style, end_section=end_section))
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+
+        if not self.columns:
+            yield Segment("\n")
+            return
+
+        max_width = options.max_width
+        if self.width is not None:
+            max_width = self.width
+
+        extra_width = self._extra_width
+        widths = self._calculate_column_widths(
+            console, options.update_width(max_width - extra_width)
+        )
+        table_width = sum(widths) + extra_width
+
+        render_options = options.update(
+            width=table_width, highlight=self.highlight, height=None
+        )
+
+        def render_annotation(
+            text: TextType, style: StyleType, justify: "JustifyMethod" = "center"
+        ) -> "RenderResult":
+            render_text = (
+                console.render_str(text, style=style, highlight=False)
+                if isinstance(text, str)
+                else text
+            )
+            return console.render(
+                render_text, options=render_options.update(justify=justify)
+            )
+
+        if self.title:
+            yield from render_annotation(
+                self.title,
+                style=Style.pick_first(self.title_style, "table.title"),
+                justify=self.title_justify,
+            )
+        yield from self._render(console, render_options, widths)
+        if self.caption:
+            yield from render_annotation(
+                self.caption,
+                style=Style.pick_first(self.caption_style, "table.caption"),
+                justify=self.caption_justify,
+            )
+
+    def _calculate_column_widths(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> List[int]:
+        """Calculate the widths of each column, including padding, not including borders."""
+        max_width = options.max_width
+        columns = self.columns
+        width_ranges = [
+            self._measure_column(console, options, column) for column in columns
+        ]
+        widths = [_range.maximum or 1 for _range in width_ranges]
+        get_padding_width = self._get_padding_width
+        extra_width = self._extra_width
+        if self.expand:
+            ratios = [col.ratio or 0 for col in columns if col.flexible]
+            if any(ratios):
+                fixed_widths = [
+                    0 if column.flexible else _range.maximum
+                    for _range, column in zip(width_ranges, columns)
+                ]
+                flex_minimum = [
+                    (column.width or 1) + get_padding_width(column._index)
+                    for column in columns
+                    if column.flexible
+                ]
+                flexible_width = max_width - sum(fixed_widths)
+                flex_widths = ratio_distribute(flexible_width, ratios, flex_minimum)
+                iter_flex_widths = iter(flex_widths)
+                for index, column in enumerate(columns):
+                    if column.flexible:
+                        widths[index] = fixed_widths[index] + next(iter_flex_widths)
+        table_width = sum(widths)
+
+        if table_width > max_width:
+            widths = self._collapse_widths(
+                widths,
+                [(column.width is None and not column.no_wrap) for column in columns],
+                max_width,
+            )
+            table_width = sum(widths)
+            # last resort, reduce columns evenly
+            if table_width > max_width:
+                excess_width = table_width - max_width
+                widths = ratio_reduce(excess_width, [1] * len(widths), widths, widths)
+                table_width = sum(widths)
+
+            width_ranges = [
+                self._measure_column(console, options.update_width(width), column)
+                for width, column in zip(widths, columns)
+            ]
+            widths = [_range.maximum or 0 for _range in width_ranges]
+
+        if (table_width < max_width and self.expand) or (
+            self.min_width is not None and table_width < (self.min_width - extra_width)
+        ):
+            _max_width = (
+                max_width
+                if self.min_width is None
+                else min(self.min_width - extra_width, max_width)
+            )
+            pad_widths = ratio_distribute(_max_width - table_width, widths)
+            widths = [_width + pad for _width, pad in zip(widths, pad_widths)]
+
+        return widths
+
+    @classmethod
+    def _collapse_widths(
+        cls, widths: List[int], wrapable: List[bool], max_width: int
+    ) -> List[int]:
+        """Reduce widths so that the total is under max_width.
+
+        Args:
+            widths (List[int]): List of widths.
+            wrapable (List[bool]): List of booleans that indicate if a column may shrink.
+            max_width (int): Maximum width to reduce to.
+
+        Returns:
+            List[int]: A new list of widths.
+        """
+        total_width = sum(widths)
+        excess_width = total_width - max_width
+        if any(wrapable):
+            while total_width and excess_width > 0:
+                max_column = max(
+                    width for width, allow_wrap in zip(widths, wrapable) if allow_wrap
+                )
+                second_max_column = max(
+                    width if allow_wrap and width != max_column else 0
+                    for width, allow_wrap in zip(widths, wrapable)
+                )
+                column_difference = max_column - second_max_column
+                ratios = [
+                    (1 if (width == max_column and allow_wrap) else 0)
+                    for width, allow_wrap in zip(widths, wrapable)
+                ]
+                if not any(ratios) or not column_difference:
+                    break
+                max_reduce = [min(excess_width, column_difference)] * len(widths)
+                widths = ratio_reduce(excess_width, ratios, max_reduce, widths)
+
+                total_width = sum(widths)
+                excess_width = total_width - max_width
+        return widths
+
+    def _get_cells(
+        self, console: "Console", column_index: int, column: Column
+    ) -> Iterable[_Cell]:
+        """Get all the cells with padding and optional header."""
+
+        collapse_padding = self.collapse_padding
+        pad_edge = self.pad_edge
+        padding = self.padding
+        any_padding = any(padding)
+
+        first_column = column_index == 0
+        last_column = column_index == len(self.columns) - 1
+
+        _padding_cache: Dict[Tuple[bool, bool], Tuple[int, int, int, int]] = {}
+
+        def get_padding(first_row: bool, last_row: bool) -> Tuple[int, int, int, int]:
+            cached = _padding_cache.get((first_row, last_row))
+            if cached:
+                return cached
+            top, right, bottom, left = padding
+
+            if collapse_padding:
+                if not first_column:
+                    left = max(0, left - right)
+                if not last_row:
+                    bottom = max(0, top - bottom)
+
+            if not pad_edge:
+                if first_column:
+                    left = 0
+                if last_column:
+                    right = 0
+                if first_row:
+                    top = 0
+                if last_row:
+                    bottom = 0
+            _padding = (top, right, bottom, left)
+            _padding_cache[(first_row, last_row)] = _padding
+            return _padding
+
+        raw_cells: List[Tuple[StyleType, "RenderableType"]] = []
+        _append = raw_cells.append
+        get_style = console.get_style
+        if self.show_header:
+            header_style = get_style(self.header_style or "") + get_style(
+                column.header_style
+            )
+            _append((header_style, column.header))
+        cell_style = get_style(column.style or "")
+        for cell in column.cells:
+            _append((cell_style, cell))
+        if self.show_footer:
+            footer_style = get_style(self.footer_style or "") + get_style(
+                column.footer_style
+            )
+            _append((footer_style, column.footer))
+
+        if any_padding:
+            _Padding = Padding
+            for first, last, (style, renderable) in loop_first_last(raw_cells):
+                yield _Cell(
+                    style,
+                    _Padding(renderable, get_padding(first, last)),
+                    getattr(renderable, "vertical", None) or column.vertical,
+                )
+        else:
+            for (style, renderable) in raw_cells:
+                yield _Cell(
+                    style,
+                    renderable,
+                    getattr(renderable, "vertical", None) or column.vertical,
+                )
+
+    def _get_padding_width(self, column_index: int) -> int:
+        """Get extra width from padding."""
+        _, pad_right, _, pad_left = self.padding
+        if self.collapse_padding:
+            if column_index > 0:
+                pad_left = max(0, pad_left - pad_right)
+        return pad_left + pad_right
+
+    def _measure_column(
+        self,
+        console: "Console",
+        options: "ConsoleOptions",
+        column: Column,
+    ) -> Measurement:
+        """Get the minimum and maximum width of the column."""
+
+        max_width = options.max_width
+        if max_width < 1:
+            return Measurement(0, 0)
+
+        padding_width = self._get_padding_width(column._index)
+
+        if column.width is not None:
+            # Fixed width column
+            return Measurement(
+                column.width + padding_width, column.width + padding_width
+            ).with_maximum(max_width)
+        # Flexible column, we need to measure contents
+        min_widths: List[int] = []
+        max_widths: List[int] = []
+        append_min = min_widths.append
+        append_max = max_widths.append
+        get_render_width = Measurement.get
+        for cell in self._get_cells(console, column._index, column):
+            _min, _max = get_render_width(console, options, cell.renderable)
+            append_min(_min)
+            append_max(_max)
+
+        measurement = Measurement(
+            max(min_widths) if min_widths else 1,
+            max(max_widths) if max_widths else max_width,
+        ).with_maximum(max_width)
+        measurement = measurement.clamp(
+            None if column.min_width is None else column.min_width + padding_width,
+            None if column.max_width is None else column.max_width + padding_width,
+        )
+        return measurement
+
+    def _render(
+        self, console: "Console", options: "ConsoleOptions", widths: List[int]
+    ) -> "RenderResult":
+        table_style = console.get_style(self.style or "")
+
+        border_style = table_style + console.get_style(self.border_style or "")
+        _column_cells = (
+            self._get_cells(console, column_index, column)
+            for column_index, column in enumerate(self.columns)
+        )
+        row_cells: List[Tuple[_Cell, ...]] = list(zip(*_column_cells))
+        _box = (
+            self.box.substitute(
+                options, safe=pick_bool(self.safe_box, console.safe_box)
+            )
+            if self.box
+            else None
+        )
+
+        # _box = self.box
+        new_line = Segment.line()
+
+        columns = self.columns
+        show_header = self.show_header
+        show_footer = self.show_footer
+        show_edge = self.show_edge
+        show_lines = self.show_lines
+        leading = self.leading
+
+        _Segment = Segment
+        if _box:
+            box_segments = [
+                (
+                    _Segment(_box.head_left, border_style),
+                    _Segment(_box.head_right, border_style),
+                    _Segment(_box.head_vertical, border_style),
+                ),
+                (
+                    _Segment(_box.foot_left, border_style),
+                    _Segment(_box.foot_right, border_style),
+                    _Segment(_box.foot_vertical, border_style),
+                ),
+                (
+                    _Segment(_box.mid_left, border_style),
+                    _Segment(_box.mid_right, border_style),
+                    _Segment(_box.mid_vertical, border_style),
+                ),
+            ]
+            if show_edge:
+                yield _Segment(_box.get_top(widths), border_style)
+                yield new_line
+        else:
+            box_segments = []
+
+        get_row_style = self.get_row_style
+        get_style = console.get_style
+
+        for index, (first, last, row_cell) in enumerate(loop_first_last(row_cells)):
+            header_row = first and show_header
+            footer_row = last and show_footer
+            row = (
+                self.rows[index - show_header]
+                if (not header_row and not footer_row)
+                else None
+            )
+            max_height = 1
+            cells: List[List[List[Segment]]] = []
+            if header_row or footer_row:
+                row_style = Style.null()
+            else:
+                row_style = get_style(
+                    get_row_style(console, index - 1 if show_header else index)
+                )
+            for width, cell, column in zip(widths, row_cell, columns):
+                render_options = options.update(
+                    width=width,
+                    justify=column.justify,
+                    no_wrap=column.no_wrap,
+                    overflow=column.overflow,
+                    height=None,
+                )
+                lines = console.render_lines(
+                    cell.renderable,
+                    render_options,
+                    style=get_style(cell.style) + row_style,
+                )
+                max_height = max(max_height, len(lines))
+                cells.append(lines)
+
+            row_height = max(len(cell) for cell in cells)
+
+            def align_cell(
+                cell: List[List[Segment]],
+                vertical: "VerticalAlignMethod",
+                width: int,
+                style: Style,
+            ) -> List[List[Segment]]:
+                if header_row:
+                    vertical = "bottom"
+                elif footer_row:
+                    vertical = "top"
+
+                if vertical == "top":
+                    return _Segment.align_top(cell, width, row_height, style)
+                elif vertical == "middle":
+                    return _Segment.align_middle(cell, width, row_height, style)
+                return _Segment.align_bottom(cell, width, row_height, style)
+
+            cells[:] = [
+                _Segment.set_shape(
+                    align_cell(
+                        cell,
+                        _cell.vertical,
+                        width,
+                        get_style(_cell.style) + row_style,
+                    ),
+                    width,
+                    max_height,
+                )
+                for width, _cell, cell, column in zip(widths, row_cell, cells, columns)
+            ]
+
+            if _box:
+                if last and show_footer:
+                    yield _Segment(
+                        _box.get_row(widths, "foot", edge=show_edge), border_style
+                    )
+                    yield new_line
+                left, right, _divider = box_segments[0 if first else (2 if last else 1)]
+
+                # If the column divider is whitespace also style it with the row background
+                divider = (
+                    _divider
+                    if _divider.text.strip()
+                    else _Segment(
+                        _divider.text, row_style.background_style + _divider.style
+                    )
+                )
+                for line_no in range(max_height):
+                    if show_edge:
+                        yield left
+                    for last_cell, rendered_cell in loop_last(cells):
+                        yield from rendered_cell[line_no]
+                        if not last_cell:
+                            yield divider
+                    if show_edge:
+                        yield right
+                    yield new_line
+            else:
+                for line_no in range(max_height):
+                    for rendered_cell in cells:
+                        yield from rendered_cell[line_no]
+                    yield new_line
+            if _box and first and show_header:
+                yield _Segment(
+                    _box.get_row(widths, "head", edge=show_edge), border_style
+                )
+                yield new_line
+            end_section = row and row.end_section
+            if _box and (show_lines or leading or end_section):
+                if (
+                    not last
+                    and not (show_footer and index >= len(row_cells) - 2)
+                    and not (show_header and header_row)
+                ):
+                    if leading:
+                        yield _Segment(
+                            _box.get_row(widths, "mid", edge=show_edge) * leading,
+                            border_style,
+                        )
+                    else:
+                        yield _Segment(
+                            _box.get_row(widths, "row", edge=show_edge), border_style
+                        )
+                    yield new_line
+
+        if _box and show_edge:
+            yield _Segment(_box.get_bottom(widths), border_style)
+            yield new_line
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+    from pip._vendor.rich.highlighter import ReprHighlighter
+    from pip._vendor.rich.table import Table as Table
+
+    from ._timer import timer
+
+    with timer("Table render"):
+        table = Table(
+            title="Star Wars Movies",
+            caption="Rich example table",
+            caption_justify="right",
+        )
+
+        table.add_column(
+            "Released", header_style="bright_cyan", style="cyan", no_wrap=True
+        )
+        table.add_column("Title", style="magenta")
+        table.add_column("Box Office", justify="right", style="green")
+
+        table.add_row(
+            "Dec 20, 2019",
+            "Star Wars: The Rise of Skywalker",
+            "$952,110,690",
+        )
+        table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347")
+        table.add_row(
+            "Dec 15, 2017",
+            "Star Wars Ep. V111: The Last Jedi",
+            "$1,332,539,889",
+            style="on black",
+            end_section=True,
+        )
+        table.add_row(
+            "Dec 16, 2016",
+            "Rogue One: A Star Wars Story",
+            "$1,332,439,889",
+        )
+
+        def header(text: str) -> None:
+            console.print()
+            console.rule(highlight(text))
+            console.print()
+
+        console = Console()
+        highlight = ReprHighlighter()
+        header("Example Table")
+        console.print(table, justify="center")
+
+        table.expand = True
+        header("expand=True")
+        console.print(table)
+
+        table.width = 50
+        header("width=50")
+
+        console.print(table, justify="center")
+
+        table.width = None
+        table.expand = False
+        table.row_styles = ["dim", "none"]
+        header("row_styles=['dim', 'none']")
+
+        console.print(table, justify="center")
+
+        table.width = None
+        table.expand = False
+        table.row_styles = ["dim", "none"]
+        table.leading = 1
+        header("leading=1, row_styles=['dim', 'none']")
+        console.print(table, justify="center")
+
+        table.width = None
+        table.expand = False
+        table.row_styles = ["dim", "none"]
+        table.show_lines = True
+        table.leading = 0
+        header("show_lines=True, row_styles=['dim', 'none']")
+        console.print(table, justify="center")
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/terminal_theme.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/terminal_theme.py
new file mode 100644
index 0000000000000000000000000000000000000000..801ac0b7b8581632e4f77b436b1a04d3f94a876d
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/terminal_theme.py
@@ -0,0 +1,55 @@
+from typing import List, Optional, Tuple
+
+from .color_triplet import ColorTriplet
+from .palette import Palette
+
+_ColorTuple = Tuple[int, int, int]
+
+
+class TerminalTheme:
+    """A color theme used when exporting console content.
+
+    Args:
+        background (Tuple[int, int, int]): The background color.
+        foreground (Tuple[int, int, int]): The foreground (text) color.
+        normal (List[Tuple[int, int, int]]): A list of 8 normal intensity colors.
+        bright (List[Tuple[int, int, int]], optional): A list of 8 bright colors, or None
+            to repeat normal intensity. Defaults to None.
+    """
+
+    def __init__(
+        self,
+        background: _ColorTuple,
+        foreground: _ColorTuple,
+        normal: List[_ColorTuple],
+        bright: Optional[List[_ColorTuple]] = None,
+    ) -> None:
+        self.background_color = ColorTriplet(*background)
+        self.foreground_color = ColorTriplet(*foreground)
+        self.ansi_colors = Palette(normal + (bright or normal))
+
+
+DEFAULT_TERMINAL_THEME = TerminalTheme(
+    (255, 255, 255),
+    (0, 0, 0),
+    [
+        (0, 0, 0),
+        (128, 0, 0),
+        (0, 128, 0),
+        (128, 128, 0),
+        (0, 0, 128),
+        (128, 0, 128),
+        (0, 128, 128),
+        (192, 192, 192),
+    ],
+    [
+        (128, 128, 128),
+        (255, 0, 0),
+        (0, 255, 0),
+        (255, 255, 0),
+        (0, 0, 255),
+        (255, 0, 255),
+        (0, 255, 255),
+        (255, 255, 255),
+    ],
+)
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/traceback.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/traceback.py
new file mode 100644
index 0000000000000000000000000000000000000000..66a39ebab3c8d78fd116998330579c2d2c873375
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/traceback.py
@@ -0,0 +1,678 @@
+from __future__ import absolute_import
+
+import os
+import platform
+import sys
+from dataclasses import dataclass, field
+from traceback import walk_tb
+from types import ModuleType, TracebackType
+from typing import Any, Callable, Dict, Iterable, List, Optional, Sequence, Type, Union
+
+from pip._vendor.pygments.lexers import guess_lexer_for_filename
+from pip._vendor.pygments.token import Comment, Keyword, Name, Number, Operator, String
+from pip._vendor.pygments.token import Text as TextToken
+from pip._vendor.pygments.token import Token
+
+from . import pretty
+from ._loop import loop_first, loop_last
+from .columns import Columns
+from .console import Console, ConsoleOptions, ConsoleRenderable, RenderResult, group
+from .constrain import Constrain
+from .highlighter import RegexHighlighter, ReprHighlighter
+from .panel import Panel
+from .scope import render_scope
+from .style import Style
+from .syntax import Syntax
+from .text import Text
+from .theme import Theme
+
+WINDOWS = platform.system() == "Windows"
+
+LOCALS_MAX_LENGTH = 10
+LOCALS_MAX_STRING = 80
+
+
+def install(
+    *,
+    console: Optional[Console] = None,
+    width: Optional[int] = 100,
+    extra_lines: int = 3,
+    theme: Optional[str] = None,
+    word_wrap: bool = False,
+    show_locals: bool = False,
+    indent_guides: bool = True,
+    suppress: Iterable[Union[str, ModuleType]] = (),
+    max_frames: int = 100,
+) -> Callable[[Type[BaseException], BaseException, Optional[TracebackType]], Any]:
+    """Install a rich traceback handler.
+
+    Once installed, any tracebacks will be printed with syntax highlighting and rich formatting.
+
+
+    Args:
+        console (Optional[Console], optional): Console to write exception to. Default uses internal Console instance.
+        width (Optional[int], optional): Width (in characters) of traceback. Defaults to 100.
+        extra_lines (int, optional): Extra lines of code. Defaults to 3.
+        theme (Optional[str], optional): Pygments theme to use in traceback. Defaults to ``None`` which will pick
+            a theme appropriate for the platform.
+        word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+        show_locals (bool, optional): Enable display of local variables. Defaults to False.
+        indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.
+        suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+
+    Returns:
+        Callable: The previous exception handler that was replaced.
+
+    """
+    traceback_console = Console(file=sys.stderr) if console is None else console
+
+    def excepthook(
+        type_: Type[BaseException],
+        value: BaseException,
+        traceback: Optional[TracebackType],
+    ) -> None:
+        traceback_console.print(
+            Traceback.from_exception(
+                type_,
+                value,
+                traceback,
+                width=width,
+                extra_lines=extra_lines,
+                theme=theme,
+                word_wrap=word_wrap,
+                show_locals=show_locals,
+                indent_guides=indent_guides,
+                suppress=suppress,
+                max_frames=max_frames,
+            )
+        )
+
+    def ipy_excepthook_closure(ip: Any) -> None:  # pragma: no cover
+        tb_data = {}  # store information about showtraceback call
+        default_showtraceback = ip.showtraceback  # keep reference of default traceback
+
+        def ipy_show_traceback(*args: Any, **kwargs: Any) -> None:
+            """wrap the default ip.showtraceback to store info for ip._showtraceback"""
+            nonlocal tb_data
+            tb_data = kwargs
+            default_showtraceback(*args, **kwargs)
+
+        def ipy_display_traceback(
+            *args: Any, is_syntax: bool = False, **kwargs: Any
+        ) -> None:
+            """Internally called traceback from ip._showtraceback"""
+            nonlocal tb_data
+            exc_tuple = ip._get_exc_info()
+
+            # do not display trace on syntax error
+            tb: Optional[TracebackType] = None if is_syntax else exc_tuple[2]
+
+            # determine correct tb_offset
+            compiled = tb_data.get("running_compiled_code", False)
+            tb_offset = tb_data.get("tb_offset", 1 if compiled else 0)
+            # remove ipython internal frames from trace with tb_offset
+            for _ in range(tb_offset):
+                if tb is None:
+                    break
+                tb = tb.tb_next
+
+            excepthook(exc_tuple[0], exc_tuple[1], tb)
+            tb_data = {}  # clear data upon usage
+
+        # replace _showtraceback instead of showtraceback to allow ipython features such as debugging to work
+        # this is also what the ipython docs recommends to modify when subclassing InteractiveShell
+        ip._showtraceback = ipy_display_traceback
+        # add wrapper to capture tb_data
+        ip.showtraceback = ipy_show_traceback
+        ip.showsyntaxerror = lambda *args, **kwargs: ipy_display_traceback(
+            *args, is_syntax=True, **kwargs
+        )
+
+    try:  # pragma: no cover
+        # if within ipython, use customized traceback
+        ip = get_ipython()  # type: ignore
+        ipy_excepthook_closure(ip)
+        return sys.excepthook
+    except Exception:
+        # otherwise use default system hook
+        old_excepthook = sys.excepthook
+        sys.excepthook = excepthook
+        return old_excepthook
+
+
+@dataclass
+class Frame:
+    filename: str
+    lineno: int
+    name: str
+    line: str = ""
+    locals: Optional[Dict[str, pretty.Node]] = None
+
+
+@dataclass
+class _SyntaxError:
+    offset: int
+    filename: str
+    line: str
+    lineno: int
+    msg: str
+
+
+@dataclass
+class Stack:
+    exc_type: str
+    exc_value: str
+    syntax_error: Optional[_SyntaxError] = None
+    is_cause: bool = False
+    frames: List[Frame] = field(default_factory=list)
+
+
+@dataclass
+class Trace:
+    stacks: List[Stack]
+
+
+class PathHighlighter(RegexHighlighter):
+    highlights = [r"(?P<dim>.*/)(?P<bold>.+)"]
+
+
+class Traceback:
+    """A Console renderable that renders a traceback.
+
+    Args:
+        trace (Trace, optional): A `Trace` object produced from `extract`. Defaults to None, which uses
+            the last exception.
+        width (Optional[int], optional): Number of characters used to traceback. Defaults to 100.
+        extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+        theme (str, optional): Override pygments theme used in traceback.
+        word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+        show_locals (bool, optional): Enable display of local variables. Defaults to False.
+        indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.
+        locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to 10.
+        locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+        suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+        max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+
+    """
+
+    LEXERS = {
+        "": "text",
+        ".py": "python",
+        ".pxd": "cython",
+        ".pyx": "cython",
+        ".pxi": "pyrex",
+    }
+
+    def __init__(
+        self,
+        trace: Optional[Trace] = None,
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        indent_guides: bool = True,
+        locals_max_length: int = LOCALS_MAX_LENGTH,
+        locals_max_string: int = LOCALS_MAX_STRING,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ):
+        if trace is None:
+            exc_type, exc_value, traceback = sys.exc_info()
+            if exc_type is None or exc_value is None or traceback is None:
+                raise ValueError(
+                    "Value for 'trace' required if not called in except: block"
+                )
+            trace = self.extract(
+                exc_type, exc_value, traceback, show_locals=show_locals
+            )
+        self.trace = trace
+        self.width = width
+        self.extra_lines = extra_lines
+        self.theme = Syntax.get_theme(theme or "ansi_dark")
+        self.word_wrap = word_wrap
+        self.show_locals = show_locals
+        self.indent_guides = indent_guides
+        self.locals_max_length = locals_max_length
+        self.locals_max_string = locals_max_string
+
+        self.suppress: Sequence[str] = []
+        for suppress_entity in suppress:
+            if not isinstance(suppress_entity, str):
+                assert (
+                    suppress_entity.__file__ is not None
+                ), f"{suppress_entity!r} must be a module with '__file__' attribute"
+                path = os.path.dirname(suppress_entity.__file__)
+            else:
+                path = suppress_entity
+            path = os.path.normpath(os.path.abspath(path))
+            self.suppress.append(path)
+        self.max_frames = max(4, max_frames) if max_frames > 0 else 0
+
+    @classmethod
+    def from_exception(
+        cls,
+        exc_type: Type[Any],
+        exc_value: BaseException,
+        traceback: Optional[TracebackType],
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        indent_guides: bool = True,
+        locals_max_length: int = LOCALS_MAX_LENGTH,
+        locals_max_string: int = LOCALS_MAX_STRING,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ) -> "Traceback":
+        """Create a traceback from exception info
+
+        Args:
+            exc_type (Type[BaseException]): Exception type.
+            exc_value (BaseException): Exception value.
+            traceback (TracebackType): Python Traceback object.
+            width (Optional[int], optional): Number of characters used to traceback. Defaults to 100.
+            extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+            theme (str, optional): Override pygments theme used in traceback.
+            word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.
+            locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+                Defaults to 10.
+            locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+            suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+            max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+
+        Returns:
+            Traceback: A Traceback instance that may be printed.
+        """
+        rich_traceback = cls.extract(
+            exc_type, exc_value, traceback, show_locals=show_locals
+        )
+        return cls(
+            rich_traceback,
+            width=width,
+            extra_lines=extra_lines,
+            theme=theme,
+            word_wrap=word_wrap,
+            show_locals=show_locals,
+            indent_guides=indent_guides,
+            locals_max_length=locals_max_length,
+            locals_max_string=locals_max_string,
+            suppress=suppress,
+            max_frames=max_frames,
+        )
+
+    @classmethod
+    def extract(
+        cls,
+        exc_type: Type[BaseException],
+        exc_value: BaseException,
+        traceback: Optional[TracebackType],
+        show_locals: bool = False,
+        locals_max_length: int = LOCALS_MAX_LENGTH,
+        locals_max_string: int = LOCALS_MAX_STRING,
+    ) -> Trace:
+        """Extract traceback information.
+
+        Args:
+            exc_type (Type[BaseException]): Exception type.
+            exc_value (BaseException): Exception value.
+            traceback (TracebackType): Python Traceback object.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+                Defaults to 10.
+            locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+
+        Returns:
+            Trace: A Trace instance which you can use to construct a `Traceback`.
+        """
+
+        stacks: List[Stack] = []
+        is_cause = False
+
+        from pip._vendor.rich import _IMPORT_CWD
+
+        def safe_str(_object: Any) -> str:
+            """Don't allow exceptions from __str__ to propegate."""
+            try:
+                return str(_object)
+            except Exception:
+                return "<exception str() failed>"
+
+        while True:
+            stack = Stack(
+                exc_type=safe_str(exc_type.__name__),
+                exc_value=safe_str(exc_value),
+                is_cause=is_cause,
+            )
+
+            if isinstance(exc_value, SyntaxError):
+                stack.syntax_error = _SyntaxError(
+                    offset=exc_value.offset or 0,
+                    filename=exc_value.filename or "?",
+                    lineno=exc_value.lineno or 0,
+                    line=exc_value.text or "",
+                    msg=exc_value.msg,
+                )
+
+            stacks.append(stack)
+            append = stack.frames.append
+
+            for frame_summary, line_no in walk_tb(traceback):
+                filename = frame_summary.f_code.co_filename
+                if filename and not filename.startswith("<"):
+                    if not os.path.isabs(filename):
+                        filename = os.path.join(_IMPORT_CWD, filename)
+                frame = Frame(
+                    filename=filename or "?",
+                    lineno=line_no,
+                    name=frame_summary.f_code.co_name,
+                    locals={
+                        key: pretty.traverse(
+                            value,
+                            max_length=locals_max_length,
+                            max_string=locals_max_string,
+                        )
+                        for key, value in frame_summary.f_locals.items()
+                    }
+                    if show_locals
+                    else None,
+                )
+                append(frame)
+                if "_rich_traceback_guard" in frame_summary.f_locals:
+                    del stack.frames[:]
+
+            cause = getattr(exc_value, "__cause__", None)
+            if cause and cause.__traceback__:
+                exc_type = cause.__class__
+                exc_value = cause
+                traceback = cause.__traceback__
+                if traceback:
+                    is_cause = True
+                    continue
+
+            cause = exc_value.__context__
+            if (
+                cause
+                and cause.__traceback__
+                and not getattr(exc_value, "__suppress_context__", False)
+            ):
+                exc_type = cause.__class__
+                exc_value = cause
+                traceback = cause.__traceback__
+                if traceback:
+                    is_cause = False
+                    continue
+            # No cover, code is reached but coverage doesn't recognize it.
+            break  # pragma: no cover
+
+        trace = Trace(stacks=stacks)
+        return trace
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        theme = self.theme
+        background_style = theme.get_background_style()
+        token_style = theme.get_style_for_token
+
+        traceback_theme = Theme(
+            {
+                "pretty": token_style(TextToken),
+                "pygments.text": token_style(Token),
+                "pygments.string": token_style(String),
+                "pygments.function": token_style(Name.Function),
+                "pygments.number": token_style(Number),
+                "repr.indent": token_style(Comment) + Style(dim=True),
+                "repr.str": token_style(String),
+                "repr.brace": token_style(TextToken) + Style(bold=True),
+                "repr.number": token_style(Number),
+                "repr.bool_true": token_style(Keyword.Constant),
+                "repr.bool_false": token_style(Keyword.Constant),
+                "repr.none": token_style(Keyword.Constant),
+                "scope.border": token_style(String.Delimiter),
+                "scope.equals": token_style(Operator),
+                "scope.key": token_style(Name),
+                "scope.key.special": token_style(Name.Constant) + Style(dim=True),
+            },
+            inherit=False,
+        )
+
+        highlighter = ReprHighlighter()
+        for last, stack in loop_last(reversed(self.trace.stacks)):
+            if stack.frames:
+                stack_renderable: ConsoleRenderable = Panel(
+                    self._render_stack(stack),
+                    title="[traceback.title]Traceback [dim](most recent call last)",
+                    style=background_style,
+                    border_style="traceback.border",
+                    expand=True,
+                    padding=(0, 1),
+                )
+                stack_renderable = Constrain(stack_renderable, self.width)
+                with console.use_theme(traceback_theme):
+                    yield stack_renderable
+            if stack.syntax_error is not None:
+                with console.use_theme(traceback_theme):
+                    yield Constrain(
+                        Panel(
+                            self._render_syntax_error(stack.syntax_error),
+                            style=background_style,
+                            border_style="traceback.border.syntax_error",
+                            expand=True,
+                            padding=(0, 1),
+                            width=self.width,
+                        ),
+                        self.width,
+                    )
+                yield Text.assemble(
+                    (f"{stack.exc_type}: ", "traceback.exc_type"),
+                    highlighter(stack.syntax_error.msg),
+                )
+            elif stack.exc_value:
+                yield Text.assemble(
+                    (f"{stack.exc_type}: ", "traceback.exc_type"),
+                    highlighter(stack.exc_value),
+                )
+            else:
+                yield Text.assemble((f"{stack.exc_type}", "traceback.exc_type"))
+
+            if not last:
+                if stack.is_cause:
+                    yield Text.from_markup(
+                        "\n[i]The above exception was the direct cause of the following exception:\n",
+                    )
+                else:
+                    yield Text.from_markup(
+                        "\n[i]During handling of the above exception, another exception occurred:\n",
+                    )
+
+    @group()
+    def _render_syntax_error(self, syntax_error: _SyntaxError) -> RenderResult:
+        highlighter = ReprHighlighter()
+        path_highlighter = PathHighlighter()
+        if syntax_error.filename != "<stdin>":
+            text = Text.assemble(
+                (f" {syntax_error.filename}", "pygments.string"),
+                (":", "pygments.text"),
+                (str(syntax_error.lineno), "pygments.number"),
+                style="pygments.text",
+            )
+            yield path_highlighter(text)
+        syntax_error_text = highlighter(syntax_error.line.rstrip())
+        syntax_error_text.no_wrap = True
+        offset = min(syntax_error.offset - 1, len(syntax_error_text))
+        syntax_error_text.stylize("bold underline", offset, offset)
+        syntax_error_text += Text.from_markup(
+            "\n" + " " * offset + "[traceback.offset]▲[/]",
+            style="pygments.text",
+        )
+        yield syntax_error_text
+
+    @classmethod
+    def _guess_lexer(cls, filename: str, code: str) -> str:
+        ext = os.path.splitext(filename)[-1]
+        if not ext:
+            # No extension, look at first line to see if it is a hashbang
+            # Note, this is an educated guess and not a guarantee
+            # If it fails, the only downside is that the code is highlighted strangely
+            new_line_index = code.index("\n")
+            first_line = code[:new_line_index] if new_line_index != -1 else code
+            if first_line.startswith("#!") and "python" in first_line.lower():
+                return "python"
+        lexer_name = (
+            cls.LEXERS.get(ext) or guess_lexer_for_filename(filename, code).name
+        )
+        return lexer_name
+
+    @group()
+    def _render_stack(self, stack: Stack) -> RenderResult:
+        path_highlighter = PathHighlighter()
+        theme = self.theme
+        code_cache: Dict[str, str] = {}
+
+        def read_code(filename: str) -> str:
+            """Read files, and cache results on filename.
+
+            Args:
+                filename (str): Filename to read
+
+            Returns:
+                str: Contents of file
+            """
+            code = code_cache.get(filename)
+            if code is None:
+                with open(
+                    filename, "rt", encoding="utf-8", errors="replace"
+                ) as code_file:
+                    code = code_file.read()
+                code_cache[filename] = code
+            return code
+
+        def render_locals(frame: Frame) -> Iterable[ConsoleRenderable]:
+            if frame.locals:
+                yield render_scope(
+                    frame.locals,
+                    title="locals",
+                    indent_guides=self.indent_guides,
+                    max_length=self.locals_max_length,
+                    max_string=self.locals_max_string,
+                )
+
+        exclude_frames: Optional[range] = None
+        if self.max_frames != 0:
+            exclude_frames = range(
+                self.max_frames // 2,
+                len(stack.frames) - self.max_frames // 2,
+            )
+
+        excluded = False
+        for frame_index, frame in enumerate(stack.frames):
+
+            if exclude_frames and frame_index in exclude_frames:
+                excluded = True
+                continue
+
+            if excluded:
+                assert exclude_frames is not None
+                yield Text(
+                    f"\n... {len(exclude_frames)} frames hidden ...",
+                    justify="center",
+                    style="traceback.error",
+                )
+                excluded = False
+
+            first = frame_index == 1
+            frame_filename = frame.filename
+            suppressed = any(frame_filename.startswith(path) for path in self.suppress)
+
+            text = Text.assemble(
+                path_highlighter(Text(frame.filename, style="pygments.string")),
+                (":", "pygments.text"),
+                (str(frame.lineno), "pygments.number"),
+                " in ",
+                (frame.name, "pygments.function"),
+                style="pygments.text",
+            )
+            if not frame.filename.startswith("<") and not first:
+                yield ""
+            yield text
+            if frame.filename.startswith("<"):
+                yield from render_locals(frame)
+                continue
+            if not suppressed:
+                try:
+                    code = read_code(frame.filename)
+                    lexer_name = self._guess_lexer(frame.filename, code)
+                    syntax = Syntax(
+                        code,
+                        lexer_name,
+                        theme=theme,
+                        line_numbers=True,
+                        line_range=(
+                            frame.lineno - self.extra_lines,
+                            frame.lineno + self.extra_lines,
+                        ),
+                        highlight_lines={frame.lineno},
+                        word_wrap=self.word_wrap,
+                        code_width=88,
+                        indent_guides=self.indent_guides,
+                        dedent=False,
+                    )
+                    yield ""
+                except Exception as error:
+                    yield Text.assemble(
+                        (f"\n{error}", "traceback.error"),
+                    )
+                else:
+                    yield (
+                        Columns(
+                            [
+                                syntax,
+                                *render_locals(frame),
+                            ],
+                            padding=1,
+                        )
+                        if frame.locals
+                        else syntax
+                    )
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from .console import Console
+
+    console = Console()
+    import sys
+
+    def bar(a: Any) -> None:  # 这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑
+        one = 1
+        print(one / a)
+
+    def foo(a: Any) -> None:
+        _rich_traceback_guard = True
+        zed = {
+            "characters": {
+                "Paul Atreides",
+                "Vladimir Harkonnen",
+                "Thufir Hawat",
+                "Duncan Idaho",
+            },
+            "atomic_types": (None, False, True),
+        }
+        bar(a)
+
+    def error() -> None:
+
+        try:
+            try:
+                foo(0)
+            except:
+                slfkjsldkfj  # type: ignore
+        except:
+            console.print_exception(show_locals=True)
+
+    error()
diff --git a/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/tree.py b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/tree.py
new file mode 100644
index 0000000000000000000000000000000000000000..c5ec27da93223300dd22648d29f53fd79797aae6
--- /dev/null
+++ b/llmeval-env/lib/python3.10/site-packages/pip/_vendor/rich/tree.py
@@ -0,0 +1,249 @@
+from typing import Iterator, List, Optional, Tuple
+
+from ._loop import loop_first, loop_last
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleStack, StyleType
+from .styled import Styled
+
+
+class Tree(JupyterMixin):
+    """A renderable for a tree structure.
+
+    Args:
+        label (RenderableType): The renderable or str for the tree label.
+        style (StyleType, optional): Style of this tree. Defaults to "tree".
+        guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line".
+        expanded (bool, optional): Also display children. Defaults to True.
+        highlight (bool, optional): Highlight renderable (if str). Defaults to False.
+    """
+
+    def __init__(
+        self,
+        label: RenderableType,
+        *,
+        style: StyleType = "tree",
+        guide_style: StyleType = "tree.line",
+        expanded: bool = True,
+        highlight: bool = False,
+        hide_root: bool = False,
+    ) -> None:
+        self.label = label
+        self.style = style
+        self.guide_style = guide_style
+        self.children: List[Tree] = []
+        self.expanded = expanded
+        self.highlight = highlight
+        self.hide_root = hide_root
+
+    def add(
+        self,
+        label: RenderableType,
+        *,
+        style: Optional[StyleType] = None,
+        guide_style: Optional[StyleType] = None,
+        expanded: bool = True,
+        highlight: bool = False,
+    ) -> "Tree":
+        """Add a child tree.
+
+        Args:
+            label (RenderableType): The renderable or str for the tree label.
+            style (StyleType, optional): Style of this tree. Defaults to "tree".
+            guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line".
+            expanded (bool, optional): Also display children. Defaults to True.
+            highlight (Optional[bool], optional): Highlight renderable (if str). Defaults to False.
+
+        Returns:
+            Tree: A new child Tree, which may be further modified.
+        """
+        node = Tree(
+            label,
+            style=self.style if style is None else style,
+            guide_style=self.guide_style if guide_style is None else guide_style,
+            expanded=expanded,
+            highlight=self.highlight if highlight is None else highlight,
+        )
+        self.children.append(node)
+        return node
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+
+        stack: List[Iterator[Tuple[bool, Tree]]] = []
+        pop = stack.pop
+        push = stack.append
+        new_line = Segment.line()
+
+        get_style = console.get_style
+        null_style = Style.null()
+        guide_style = get_style(self.guide_style, default="") or null_style
+        SPACE, CONTINUE, FORK, END = range(4)
+
+        ASCII_GUIDES = ("    ", "|   ", "+-- ", "`-- ")
+        TREE_GUIDES = [
+            ("    ", "│   ", "├── ", "└── "),
+            ("    ", "┃   ", "┣━━ ", "┗━━ "),
+            ("    ", "║   ", "╠══ ", "╚══ "),
+        ]
+        _Segment = Segment
+
+        def make_guide(index: int, style: Style) -> Segment:
+            """Make a Segment for a level of the guide lines."""
+            if options.ascii_only:
+                line = ASCII_GUIDES[index]
+            else:
+                guide = 1 if style.bold else (2 if style.underline2 else 0)
+                line = TREE_GUIDES[0 if options.legacy_windows else guide][index]
+            return _Segment(line, style)
+
+        levels: List[Segment] = [make_guide(CONTINUE, guide_style)]
+        push(iter(loop_last([self])))
+
+        guide_style_stack = StyleStack(get_style(self.guide_style))
+        style_stack = StyleStack(get_style(self.style))
+        remove_guide_styles = Style(bold=False, underline2=False)
+
+        depth = 0
+
+        while stack:
+            stack_node = pop()
+            try:
+                last, node = next(stack_node)
+            except StopIteration:
+                levels.pop()
+                if levels:
+                    guide_style = levels[-1].style or null_style
+                    levels[-1] = make_guide(FORK, guide_style)
+                    guide_style_stack.pop()
+                    style_stack.pop()
+                continue
+            push(stack_node)
+            if last:
+                levels[-1] = make_guide(END, levels[-1].style or null_style)
+
+            guide_style = guide_style_stack.current + get_style(node.guide_style)
+            style = style_stack.current + get_style(node.style)
+            prefix = levels[(2 if self.hide_root else 1) :]
+            renderable_lines = console.render_lines(
+                Styled(node.label, style),
+                options.update(
+                    width=options.max_width
+                    - sum(level.cell_length for level in prefix),
+                    highlight=self.highlight,
+                    height=None,
+                ),
+            )
+
+            if not (depth == 0 and self.hide_root):
+                for first, line in loop_first(renderable_lines):
+                    if prefix:
+                        yield from _Segment.apply_style(
+                            prefix,
+                            style.background_style,
+                            post_style=remove_guide_styles,
+                        )
+                    yield from line
+                    yield new_line
+                    if first and prefix:
+                        prefix[-1] = make_guide(
+                            SPACE if last else CONTINUE, prefix[-1].style or null_style
+                        )
+
+            if node.expanded and node.children:
+                levels[-1] = make_guide(
+                    SPACE if last else CONTINUE, levels[-1].style or null_style
+                )
+                levels.append(
+                    make_guide(END if len(node.children) == 1 else FORK, guide_style)
+                )
+                style_stack.push(get_style(node.style))
+                guide_style_stack.push(get_style(node.guide_style))
+                push(iter(loop_last(node.children)))
+                depth += 1
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        stack: List[Iterator[Tree]] = [iter([self])]
+        pop = stack.pop
+        push = stack.append
+        minimum = 0
+        maximum = 0
+        measure = Measurement.get
+        level = 0
+        while stack:
+            iter_tree = pop()
+            try:
+                tree = next(iter_tree)
+            except StopIteration:
+                level -= 1
+                continue
+            push(iter_tree)
+            min_measure, max_measure = measure(console, options, tree.label)
+            indent = level * 4
+            minimum = max(min_measure + indent, minimum)
+            maximum = max(max_measure + indent, maximum)
+            if tree.expanded and tree.children:
+                push(iter(tree.children))
+                level += 1
+        return Measurement(minimum, maximum)
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from pip._vendor.rich.console import Group
+    from pip._vendor.rich.markdown import Markdown
+    from pip._vendor.rich.panel import Panel
+    from pip._vendor.rich.syntax import Syntax
+    from pip._vendor.rich.table import Table
+
+    table = Table(row_styles=["", "dim"])
+
+    table.add_column("Released", style="cyan", no_wrap=True)
+    table.add_column("Title", style="magenta")
+    table.add_column("Box Office", justify="right", style="green")
+
+    table.add_row("Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$952,110,690")
+    table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347")
+    table.add_row("Dec 15, 2017", "Star Wars Ep. V111: The Last Jedi", "$1,332,539,889")
+    table.add_row("Dec 16, 2016", "Rogue One: A Star Wars Story", "$1,332,439,889")
+
+    code = """\
+class Segment(NamedTuple):
+    text: str = ""    
+    style: Optional[Style] = None    
+    is_control: bool = False    
+"""
+    syntax = Syntax(code, "python", theme="monokai", line_numbers=True)
+
+    markdown = Markdown(
+        """\
+### example.md
+> Hello, World!
+> 
+> Markdown _all_ the things
+"""
+    )
+
+    root = Tree("🌲 [b green]Rich Tree", highlight=True, hide_root=True)
+
+    node = root.add(":file_folder: Renderables", guide_style="red")
+    simple_node = node.add(":file_folder: [bold yellow]Atomic", guide_style="uu green")
+    simple_node.add(Group("📄 Syntax", syntax))
+    simple_node.add(Group("📄 Markdown", Panel(markdown, border_style="green")))
+
+    containers_node = node.add(
+        ":file_folder: [bold magenta]Containers", guide_style="bold magenta"
+    )
+    containers_node.expanded = True
+    panel = Panel.fit("Just a panel", border_style="red")
+    containers_node.add(Group("📄 Panels", panel))
+
+    containers_node.add(Group("📄 [b magenta]Table", table))
+
+    console = Console()
+    console.print(root)