Add files using upload-large-folder tool

env-llmeval/lib/python3.10/site-packages/scipy/linalg/__init__.py

@@ -0,0 +1,236 @@
+"""
+====================================
+Linear algebra (:mod:`scipy.linalg`)
+====================================
+
+.. currentmodule:: scipy.linalg
+
+.. toctree::
+   :hidden:
+
+   linalg.blas
+   linalg.cython_blas
+   linalg.cython_lapack
+   linalg.interpolative
+   linalg.lapack
+
+Linear algebra functions.
+
+.. eventually, we should replace the numpy.linalg HTML link with just `numpy.linalg`
+
+.. seealso::
+
+   `numpy.linalg <https://www.numpy.org/devdocs/reference/routines.linalg.html>`__
+   for more linear algebra functions. Note that
+   although `scipy.linalg` imports most of them, identically named
+   functions from `scipy.linalg` may offer more or slightly differing
+   functionality.
+
+
+Basics
+======
+
+.. autosummary::
+   :toctree: generated/
+
+   inv - Find the inverse of a square matrix
+   solve - Solve a linear system of equations
+   solve_banded - Solve a banded linear system
+   solveh_banded - Solve a Hermitian or symmetric banded system
+   solve_circulant - Solve a circulant system
+   solve_triangular - Solve a triangular matrix
+   solve_toeplitz - Solve a toeplitz matrix
+   matmul_toeplitz - Multiply a Toeplitz matrix with an array.
+   det - Find the determinant of a square matrix
+   norm - Matrix and vector norm
+   lstsq - Solve a linear least-squares problem
+   pinv - Pseudo-inverse (Moore-Penrose) using lstsq
+   pinvh - Pseudo-inverse of hermitian matrix
+   kron - Kronecker product of two arrays
+   khatri_rao - Khatri-Rao product of two arrays
+   orthogonal_procrustes - Solve an orthogonal Procrustes problem
+   matrix_balance - Balance matrix entries with a similarity transformation
+   subspace_angles - Compute the subspace angles between two matrices
+   bandwidth - Return the lower and upper bandwidth of an array
+   issymmetric - Check if a square 2D array is symmetric
+   ishermitian - Check if a square 2D array is Hermitian
+   LinAlgError
+   LinAlgWarning
+
+Eigenvalue Problems
+===================
+
+.. autosummary::
+   :toctree: generated/
+
+   eig - Find the eigenvalues and eigenvectors of a square matrix
+   eigvals - Find just the eigenvalues of a square matrix
+   eigh - Find the e-vals and e-vectors of a Hermitian or symmetric matrix
+   eigvalsh - Find just the eigenvalues of a Hermitian or symmetric matrix
+   eig_banded - Find the eigenvalues and eigenvectors of a banded matrix
+   eigvals_banded - Find just the eigenvalues of a banded matrix
+   eigh_tridiagonal - Find the eigenvalues and eigenvectors of a tridiagonal matrix
+   eigvalsh_tridiagonal - Find just the eigenvalues of a tridiagonal matrix
+
+Decompositions
+==============
+
+.. autosummary::
+   :toctree: generated/
+
+   lu - LU decomposition of a matrix
+   lu_factor - LU decomposition returning unordered matrix and pivots
+   lu_solve - Solve Ax=b using back substitution with output of lu_factor
+   svd - Singular value decomposition of a matrix
+   svdvals - Singular values of a matrix
+   diagsvd - Construct matrix of singular values from output of svd
+   orth - Construct orthonormal basis for the range of A using svd
+   null_space - Construct orthonormal basis for the null space of A using svd
+   ldl - LDL.T decomposition of a Hermitian or a symmetric matrix.
+   cholesky - Cholesky decomposition of a matrix
+   cholesky_banded - Cholesky decomp. of a sym. or Hermitian banded matrix
+   cho_factor - Cholesky decomposition for use in solving a linear system
+   cho_solve - Solve previously factored linear system
+   cho_solve_banded - Solve previously factored banded linear system
+   polar - Compute the polar decomposition.
+   qr - QR decomposition of a matrix
+   qr_multiply - QR decomposition and multiplication by Q
+   qr_update - Rank k QR update
+   qr_delete - QR downdate on row or column deletion
+   qr_insert - QR update on row or column insertion
+   rq - RQ decomposition of a matrix
+   qz - QZ decomposition of a pair of matrices
+   ordqz - QZ decomposition of a pair of matrices with reordering
+   schur - Schur decomposition of a matrix
+   rsf2csf - Real to complex Schur form
+   hessenberg - Hessenberg form of a matrix
+   cdf2rdf - Complex diagonal form to real diagonal block form
+   cossin - Cosine sine decomposition of a unitary or orthogonal matrix
+
+.. seealso::
+
+   `scipy.linalg.interpolative` -- Interpolative matrix decompositions
+
+
+Matrix Functions
+================
+
+.. autosummary::
+   :toctree: generated/
+
+   expm - Matrix exponential
+   logm - Matrix logarithm
+   cosm - Matrix cosine
+   sinm - Matrix sine
+   tanm - Matrix tangent
+   coshm - Matrix hyperbolic cosine
+   sinhm - Matrix hyperbolic sine
+   tanhm - Matrix hyperbolic tangent
+   signm - Matrix sign
+   sqrtm - Matrix square root
+   funm - Evaluating an arbitrary matrix function
+   expm_frechet - Frechet derivative of the matrix exponential
+   expm_cond - Relative condition number of expm in the Frobenius norm
+   fractional_matrix_power - Fractional matrix power
+
+
+Matrix Equation Solvers
+=======================
+
+.. autosummary::
+   :toctree: generated/
+
+   solve_sylvester - Solve the Sylvester matrix equation
+   solve_continuous_are - Solve the continuous-time algebraic Riccati equation
+   solve_discrete_are - Solve the discrete-time algebraic Riccati equation
+   solve_continuous_lyapunov - Solve the continuous-time Lyapunov equation
+   solve_discrete_lyapunov - Solve the discrete-time Lyapunov equation
+
+
+Sketches and Random Projections
+===============================
+
+.. autosummary::
+   :toctree: generated/
+
+   clarkson_woodruff_transform - Applies the Clarkson Woodruff Sketch (a.k.a CountMin Sketch)
+
+Special Matrices
+================
+
+.. autosummary::
+   :toctree: generated/
+
+   block_diag - Construct a block diagonal matrix from submatrices
+   circulant - Circulant matrix
+   companion - Companion matrix
+   convolution_matrix - Convolution matrix
+   dft - Discrete Fourier transform matrix
+   fiedler - Fiedler matrix
+   fiedler_companion - Fiedler companion matrix
+   hadamard - Hadamard matrix of order 2**n
+   hankel - Hankel matrix
+   helmert - Helmert matrix
+   hilbert - Hilbert matrix
+   invhilbert - Inverse Hilbert matrix
+   leslie - Leslie matrix
+   pascal - Pascal matrix
+   invpascal - Inverse Pascal matrix
+   toeplitz - Toeplitz matrix
+
+Low-level routines
+==================
+
+.. autosummary::
+   :toctree: generated/
+
+   get_blas_funcs
+   get_lapack_funcs
+   find_best_blas_type
+
+.. seealso::
+
+   `scipy.linalg.blas` -- Low-level BLAS functions
+
+   `scipy.linalg.lapack` -- Low-level LAPACK functions
+
+   `scipy.linalg.cython_blas` -- Low-level BLAS functions for Cython
+
+   `scipy.linalg.cython_lapack` -- Low-level LAPACK functions for Cython
+
+"""  # noqa: E501
+
+from ._misc import *
+from ._cythonized_array_utils import *
+from ._basic import *
+from ._decomp import *
+from ._decomp_lu import *
+from ._decomp_ldl import *
+from ._decomp_cholesky import *
+from ._decomp_qr import *
+from ._decomp_qz import *
+from ._decomp_svd import *
+from ._decomp_schur import *
+from ._decomp_polar import *
+from ._matfuncs import *
+from .blas import *
+from .lapack import *
+from ._special_matrices import *
+from ._solvers import *
+from ._procrustes import *
+from ._decomp_update import *
+from ._sketches import *
+from ._decomp_cossin import *
+
+# Deprecated namespaces, to be removed in v2.0.0
+from . import (
+    decomp, decomp_cholesky, decomp_lu, decomp_qr, decomp_svd, decomp_schur,
+    basic, misc, special_matrices, matfuncs,
+)
+
+__all__ = [s for s in dir() if not s.startswith('_')]
+
+
+from scipy._lib._testutils import PytestTester
+test = PytestTester(__name__)
+del PytestTester

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_basic.py

@@ -0,0 +1,1919 @@
+#
+# Author: Pearu Peterson, March 2002
+#
+# w/ additions by Travis Oliphant, March 2002
+#              and Jake Vanderplas, August 2012
+
+from warnings import warn
+from itertools import product
+import numpy as np
+from numpy import atleast_1d, atleast_2d
+from .lapack import get_lapack_funcs, _compute_lwork
+from ._misc import LinAlgError, _datacopied, LinAlgWarning
+from ._decomp import _asarray_validated
+from . import _decomp, _decomp_svd
+from ._solve_toeplitz import levinson
+from ._cythonized_array_utils import find_det_from_lu
+from scipy._lib.deprecation import _NoValue, _deprecate_positional_args
+
+__all__ = ['solve', 'solve_triangular', 'solveh_banded', 'solve_banded',
+           'solve_toeplitz', 'solve_circulant', 'inv', 'det', 'lstsq',
+           'pinv', 'pinvh', 'matrix_balance', 'matmul_toeplitz']
+
+
+# The numpy facilities for type-casting checks are too slow for small sized
+# arrays and eat away the time budget for the checkups. Here we set a
+# precomputed dict container of the numpy.can_cast() table.
+
+# It can be used to determine quickly what a dtype can be cast to LAPACK
+# compatible types, i.e., 'float32, float64, complex64, complex128'.
+# Then it can be checked via "casting_dict[arr.dtype.char]"
+lapack_cast_dict = {x: ''.join([y for y in 'fdFD' if np.can_cast(x, y)])
+                    for x in np.typecodes['All']}
+
+
+# Linear equations
+def _solve_check(n, info, lamch=None, rcond=None):
+    """ Check arguments during the different steps of the solution phase """
+    if info < 0:
+        raise ValueError(f'LAPACK reported an illegal value in {-info}-th argument.')
+    elif 0 < info:
+        raise LinAlgError('Matrix is singular.')
+
+    if lamch is None:
+        return
+    E = lamch('E')
+    if rcond < E:
+        warn(f'Ill-conditioned matrix (rcond={rcond:.6g}): '
+             'result may not be accurate.',
+             LinAlgWarning, stacklevel=3)
+
+
+def solve(a, b, lower=False, overwrite_a=False,
+          overwrite_b=False, check_finite=True, assume_a='gen',
+          transposed=False):
+    """
+    Solves the linear equation set ``a @ x == b`` for the unknown ``x``
+    for square `a` matrix.
+
+    If the data matrix is known to be a particular type then supplying the
+    corresponding string to ``assume_a`` key chooses the dedicated solver.
+    The available options are
+
+    ===================  ========
+     generic matrix       'gen'
+     symmetric            'sym'
+     hermitian            'her'
+     positive definite    'pos'
+    ===================  ========
+
+    If omitted, ``'gen'`` is the default structure.
+
+    The datatype of the arrays define which solver is called regardless
+    of the values. In other words, even when the complex array entries have
+    precisely zero imaginary parts, the complex solver will be called based
+    on the data type of the array.
+
+    Parameters
+    ----------
+    a : (N, N) array_like
+        Square input data
+    b : (N, NRHS) array_like
+        Input data for the right hand side.
+    lower : bool, default: False
+        Ignored if ``assume_a == 'gen'`` (the default). If True, the
+        calculation uses only the data in the lower triangle of `a`;
+        entries above the diagonal are ignored. If False (default), the
+        calculation uses only the data in the upper triangle of `a`; entries
+        below the diagonal are ignored.
+    overwrite_a : bool, default: False
+        Allow overwriting data in `a` (may enhance performance).
+    overwrite_b : bool, default: False
+        Allow overwriting data in `b` (may enhance performance).
+    check_finite : bool, default: True
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+    assume_a : str, {'gen', 'sym', 'her', 'pos'}
+        Valid entries are explained above.
+    transposed : bool, default: False
+        If True, solve ``a.T @ x == b``. Raises `NotImplementedError`
+        for complex `a`.
+
+    Returns
+    -------
+    x : (N, NRHS) ndarray
+        The solution array.
+
+    Raises
+    ------
+    ValueError
+        If size mismatches detected or input a is not square.
+    LinAlgError
+        If the matrix is singular.
+    LinAlgWarning
+        If an ill-conditioned input a is detected.
+    NotImplementedError
+        If transposed is True and input a is a complex matrix.
+
+    Notes
+    -----
+    If the input b matrix is a 1-D array with N elements, when supplied
+    together with an NxN input a, it is assumed as a valid column vector
+    despite the apparent size mismatch. This is compatible with the
+    numpy.dot() behavior and the returned result is still 1-D array.
+
+    The generic, symmetric, Hermitian and positive definite solutions are
+    obtained via calling ?GESV, ?SYSV, ?HESV, and ?POSV routines of
+    LAPACK respectively.
+
+    Examples
+    --------
+    Given `a` and `b`, solve for `x`:
+
+    >>> import numpy as np
+    >>> a = np.array([[3, 2, 0], [1, -1, 0], [0, 5, 1]])
+    >>> b = np.array([2, 4, -1])
+    >>> from scipy import linalg
+    >>> x = linalg.solve(a, b)
+    >>> x
+    array([ 2., -2.,  9.])
+    >>> np.dot(a, x) == b
+    array([ True,  True,  True], dtype=bool)
+
+    """
+    # Flags for 1-D or N-D right-hand side
+    b_is_1D = False
+
+    a1 = atleast_2d(_asarray_validated(a, check_finite=check_finite))
+    b1 = atleast_1d(_asarray_validated(b, check_finite=check_finite))
+    n = a1.shape[0]
+
+    overwrite_a = overwrite_a or _datacopied(a1, a)
+    overwrite_b = overwrite_b or _datacopied(b1, b)
+
+    if a1.shape[0] != a1.shape[1]:
+        raise ValueError('Input a needs to be a square matrix.')
+
+    if n != b1.shape[0]:
+        # Last chance to catch 1x1 scalar a and 1-D b arrays
+        if not (n == 1 and b1.size != 0):
+            raise ValueError('Input b has to have same number of rows as '
+                             'input a')
+
+    # accommodate empty arrays
+    if b1.size == 0:
+        return np.asfortranarray(b1.copy())
+
+    # regularize 1-D b arrays to 2D
+    if b1.ndim == 1:
+        if n == 1:
+            b1 = b1[None, :]
+        else:
+            b1 = b1[:, None]
+        b_is_1D = True
+
+    if assume_a not in ('gen', 'sym', 'her', 'pos'):
+        raise ValueError(f'{assume_a} is not a recognized matrix structure')
+
+    # for a real matrix, describe it as "symmetric", not "hermitian"
+    # (lapack doesn't know what to do with real hermitian matrices)
+    if assume_a == 'her' and not np.iscomplexobj(a1):
+        assume_a = 'sym'
+
+    # Get the correct lamch function.
+    # The LAMCH functions only exists for S and D
+    # So for complex values we have to convert to real/double.
+    if a1.dtype.char in 'fF':  # single precision
+        lamch = get_lapack_funcs('lamch', dtype='f')
+    else:
+        lamch = get_lapack_funcs('lamch', dtype='d')
+
+    # Currently we do not have the other forms of the norm calculators
+    #   lansy, lanpo, lanhe.
+    # However, in any case they only reduce computations slightly...
+    lange = get_lapack_funcs('lange', (a1,))
+
+    # Since the I-norm and 1-norm are the same for symmetric matrices
+    # we can collect them all in this one call
+    # Note however, that when issuing 'gen' and form!='none', then
+    # the I-norm should be used
+    if transposed:
+        trans = 1
+        norm = 'I'
+        if np.iscomplexobj(a1):
+            raise NotImplementedError('scipy.linalg.solve can currently '
+                                      'not solve a^T x = b or a^H x = b '
+                                      'for complex matrices.')
+    else:
+        trans = 0
+        norm = '1'
+
+    anorm = lange(norm, a1)
+
+    # Generalized case 'gesv'
+    if assume_a == 'gen':
+        gecon, getrf, getrs = get_lapack_funcs(('gecon', 'getrf', 'getrs'),
+                                               (a1, b1))
+        lu, ipvt, info = getrf(a1, overwrite_a=overwrite_a)
+        _solve_check(n, info)
+        x, info = getrs(lu, ipvt, b1,
+                        trans=trans, overwrite_b=overwrite_b)
+        _solve_check(n, info)
+        rcond, info = gecon(lu, anorm, norm=norm)
+    # Hermitian case 'hesv'
+    elif assume_a == 'her':
+        hecon, hesv, hesv_lw = get_lapack_funcs(('hecon', 'hesv',
+                                                 'hesv_lwork'), (a1, b1))
+        lwork = _compute_lwork(hesv_lw, n, lower)
+        lu, ipvt, x, info = hesv(a1, b1, lwork=lwork,
+                                 lower=lower,
+                                 overwrite_a=overwrite_a,
+                                 overwrite_b=overwrite_b)
+        _solve_check(n, info)
+        rcond, info = hecon(lu, ipvt, anorm)
+    # Symmetric case 'sysv'
+    elif assume_a == 'sym':
+        sycon, sysv, sysv_lw = get_lapack_funcs(('sycon', 'sysv',
+                                                 'sysv_lwork'), (a1, b1))
+        lwork = _compute_lwork(sysv_lw, n, lower)
+        lu, ipvt, x, info = sysv(a1, b1, lwork=lwork,
+                                 lower=lower,
+                                 overwrite_a=overwrite_a,
+                                 overwrite_b=overwrite_b)
+        _solve_check(n, info)
+        rcond, info = sycon(lu, ipvt, anorm)
+    # Positive definite case 'posv'
+    else:
+        pocon, posv = get_lapack_funcs(('pocon', 'posv'),
+                                       (a1, b1))
+        lu, x, info = posv(a1, b1, lower=lower,
+                           overwrite_a=overwrite_a,
+                           overwrite_b=overwrite_b)
+        _solve_check(n, info)
+        rcond, info = pocon(lu, anorm)
+
+    _solve_check(n, info, lamch, rcond)
+
+    if b_is_1D:
+        x = x.ravel()
+
+    return x
+
+
+def solve_triangular(a, b, trans=0, lower=False, unit_diagonal=False,
+                     overwrite_b=False, check_finite=True):
+    """
+    Solve the equation `a x = b` for `x`, assuming a is a triangular matrix.
+
+    Parameters
+    ----------
+    a : (M, M) array_like
+        A triangular matrix
+    b : (M,) or (M, N) array_like
+        Right-hand side matrix in `a x = b`
+    lower : bool, optional
+        Use only data contained in the lower triangle of `a`.
+        Default is to use upper triangle.
+    trans : {0, 1, 2, 'N', 'T', 'C'}, optional
+        Type of system to solve:
+
+        ========  =========
+        trans     system
+        ========  =========
+        0 or 'N'  a x  = b
+        1 or 'T'  a^T x = b
+        2 or 'C'  a^H x = b
+        ========  =========
+    unit_diagonal : bool, optional
+        If True, diagonal elements of `a` are assumed to be 1 and
+        will not be referenced.
+    overwrite_b : bool, optional
+        Allow overwriting data in `b` (may enhance performance)
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    x : (M,) or (M, N) ndarray
+        Solution to the system `a x = b`.  Shape of return matches `b`.
+
+    Raises
+    ------
+    LinAlgError
+        If `a` is singular
+
+    Notes
+    -----
+    .. versionadded:: 0.9.0
+
+    Examples
+    --------
+    Solve the lower triangular system a x = b, where::
+
+             [3  0  0  0]       [4]
+        a =  [2  1  0  0]   b = [2]
+             [1  0  1  0]       [4]
+             [1  1  1  1]       [2]
+
+    >>> import numpy as np
+    >>> from scipy.linalg import solve_triangular
+    >>> a = np.array([[3, 0, 0, 0], [2, 1, 0, 0], [1, 0, 1, 0], [1, 1, 1, 1]])
+    >>> b = np.array([4, 2, 4, 2])
+    >>> x = solve_triangular(a, b, lower=True)
+    >>> x
+    array([ 1.33333333, -0.66666667,  2.66666667, -1.33333333])
+    >>> a.dot(x)  # Check the result
+    array([ 4.,  2.,  4.,  2.])
+
+    """
+
+    a1 = _asarray_validated(a, check_finite=check_finite)
+    b1 = _asarray_validated(b, check_finite=check_finite)
+    if len(a1.shape) != 2 or a1.shape[0] != a1.shape[1]:
+        raise ValueError('expected square matrix')
+    if a1.shape[0] != b1.shape[0]:
+        raise ValueError(f'shapes of a {a1.shape} and b {b1.shape} are incompatible')
+    overwrite_b = overwrite_b or _datacopied(b1, b)
+
+    trans = {'N': 0, 'T': 1, 'C': 2}.get(trans, trans)
+    trtrs, = get_lapack_funcs(('trtrs',), (a1, b1))
+    if a1.flags.f_contiguous or trans == 2:
+        x, info = trtrs(a1, b1, overwrite_b=overwrite_b, lower=lower,
+                        trans=trans, unitdiag=unit_diagonal)
+    else:
+        # transposed system is solved since trtrs expects Fortran ordering
+        x, info = trtrs(a1.T, b1, overwrite_b=overwrite_b, lower=not lower,
+                        trans=not trans, unitdiag=unit_diagonal)
+
+    if info == 0:
+        return x
+    if info > 0:
+        raise LinAlgError("singular matrix: resolution failed at diagonal %d" %
+                          (info-1))
+    raise ValueError('illegal value in %dth argument of internal trtrs' %
+                     (-info))
+
+
+def solve_banded(l_and_u, ab, b, overwrite_ab=False, overwrite_b=False,
+                 check_finite=True):
+    """
+    Solve the equation a x = b for x, assuming a is banded matrix.
+
+    The matrix a is stored in `ab` using the matrix diagonal ordered form::
+
+        ab[u + i - j, j] == a[i,j]
+
+    Example of `ab` (shape of a is (6,6), `u` =1, `l` =2)::
+
+        *    a01  a12  a23  a34  a45
+        a00  a11  a22  a33  a44  a55
+        a10  a21  a32  a43  a54   *
+        a20  a31  a42  a53   *    *
+
+    Parameters
+    ----------
+    (l, u) : (integer, integer)
+        Number of non-zero lower and upper diagonals
+    ab : (`l` + `u` + 1, M) array_like
+        Banded matrix
+    b : (M,) or (M, K) array_like
+        Right-hand side
+    overwrite_ab : bool, optional
+        Discard data in `ab` (may enhance performance)
+    overwrite_b : bool, optional
+        Discard data in `b` (may enhance performance)
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    x : (M,) or (M, K) ndarray
+        The solution to the system a x = b. Returned shape depends on the
+        shape of `b`.
+
+    Examples
+    --------
+    Solve the banded system a x = b, where::
+
+            [5  2 -1  0  0]       [0]
+            [1  4  2 -1  0]       [1]
+        a = [0  1  3  2 -1]   b = [2]
+            [0  0  1  2  2]       [2]
+            [0  0  0  1  1]       [3]
+
+    There is one nonzero diagonal below the main diagonal (l = 1), and
+    two above (u = 2). The diagonal banded form of the matrix is::
+
+             [*  * -1 -1 -1]
+        ab = [*  2  2  2  2]
+             [5  4  3  2  1]
+             [1  1  1  1  *]
+
+    >>> import numpy as np
+    >>> from scipy.linalg import solve_banded
+    >>> ab = np.array([[0,  0, -1, -1, -1],
+    ...                [0,  2,  2,  2,  2],
+    ...                [5,  4,  3,  2,  1],
+    ...                [1,  1,  1,  1,  0]])
+    >>> b = np.array([0, 1, 2, 2, 3])
+    >>> x = solve_banded((1, 2), ab, b)
+    >>> x
+    array([-2.37288136,  3.93220339, -4.        ,  4.3559322 , -1.3559322 ])
+
+    """
+
+    a1 = _asarray_validated(ab, check_finite=check_finite, as_inexact=True)
+    b1 = _asarray_validated(b, check_finite=check_finite, as_inexact=True)
+    # Validate shapes.
+    if a1.shape[-1] != b1.shape[0]:
+        raise ValueError("shapes of ab and b are not compatible.")
+    (nlower, nupper) = l_and_u
+    if nlower + nupper + 1 != a1.shape[0]:
+        raise ValueError("invalid values for the number of lower and upper "
+                         "diagonals: l+u+1 (%d) does not equal ab.shape[0] "
+                         "(%d)" % (nlower + nupper + 1, ab.shape[0]))
+
+    overwrite_b = overwrite_b or _datacopied(b1, b)
+    if a1.shape[-1] == 1:
+        b2 = np.array(b1, copy=(not overwrite_b))
+        b2 /= a1[1, 0]
+        return b2
+    if nlower == nupper == 1:
+        overwrite_ab = overwrite_ab or _datacopied(a1, ab)
+        gtsv, = get_lapack_funcs(('gtsv',), (a1, b1))
+        du = a1[0, 1:]
+        d = a1[1, :]
+        dl = a1[2, :-1]
+        du2, d, du, x, info = gtsv(dl, d, du, b1, overwrite_ab, overwrite_ab,
+                                   overwrite_ab, overwrite_b)
+    else:
+        gbsv, = get_lapack_funcs(('gbsv',), (a1, b1))
+        a2 = np.zeros((2*nlower + nupper + 1, a1.shape[1]), dtype=gbsv.dtype)
+        a2[nlower:, :] = a1
+        lu, piv, x, info = gbsv(nlower, nupper, a2, b1, overwrite_ab=True,
+                                overwrite_b=overwrite_b)
+    if info == 0:
+        return x
+    if info > 0:
+        raise LinAlgError("singular matrix")
+    raise ValueError('illegal value in %d-th argument of internal '
+                     'gbsv/gtsv' % -info)
+
+
+def solveh_banded(ab, b, overwrite_ab=False, overwrite_b=False, lower=False,
+                  check_finite=True):
+    """
+    Solve equation a x = b. a is Hermitian positive-definite banded matrix.
+
+    Uses Thomas' Algorithm, which is more efficient than standard LU
+    factorization, but should only be used for Hermitian positive-definite
+    matrices.
+
+    The matrix ``a`` is stored in `ab` either in lower diagonal or upper
+    diagonal ordered form:
+
+        ab[u + i - j, j] == a[i,j]        (if upper form; i <= j)
+        ab[    i - j, j] == a[i,j]        (if lower form; i >= j)
+
+    Example of `ab` (shape of ``a`` is (6, 6), number of upper diagonals,
+    ``u`` =2)::
+
+        upper form:
+        *   *   a02 a13 a24 a35
+        *   a01 a12 a23 a34 a45
+        a00 a11 a22 a33 a44 a55
+
+        lower form:
+        a00 a11 a22 a33 a44 a55
+        a10 a21 a32 a43 a54 *
+        a20 a31 a42 a53 *   *
+
+    Cells marked with * are not used.
+
+    Parameters
+    ----------
+    ab : (``u`` + 1, M) array_like
+        Banded matrix
+    b : (M,) or (M, K) array_like
+        Right-hand side
+    overwrite_ab : bool, optional
+        Discard data in `ab` (may enhance performance)
+    overwrite_b : bool, optional
+        Discard data in `b` (may enhance performance)
+    lower : bool, optional
+        Is the matrix in the lower form. (Default is upper form)
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    x : (M,) or (M, K) ndarray
+        The solution to the system ``a x = b``. Shape of return matches shape
+        of `b`.
+
+    Notes
+    -----
+    In the case of a non-positive definite matrix ``a``, the solver
+    `solve_banded` may be used.
+
+    Examples
+    --------
+    Solve the banded system ``A x = b``, where::
+
+            [ 4  2 -1  0  0  0]       [1]
+            [ 2  5  2 -1  0  0]       [2]
+        A = [-1  2  6  2 -1  0]   b = [2]
+            [ 0 -1  2  7  2 -1]       [3]
+            [ 0  0 -1  2  8  2]       [3]
+            [ 0  0  0 -1  2  9]       [3]
+
+    >>> import numpy as np
+    >>> from scipy.linalg import solveh_banded
+
+    ``ab`` contains the main diagonal and the nonzero diagonals below the
+    main diagonal. That is, we use the lower form:
+
+    >>> ab = np.array([[ 4,  5,  6,  7, 8, 9],
+    ...                [ 2,  2,  2,  2, 2, 0],
+    ...                [-1, -1, -1, -1, 0, 0]])
+    >>> b = np.array([1, 2, 2, 3, 3, 3])
+    >>> x = solveh_banded(ab, b, lower=True)
+    >>> x
+    array([ 0.03431373,  0.45938375,  0.05602241,  0.47759104,  0.17577031,
+            0.34733894])
+
+
+    Solve the Hermitian banded system ``H x = b``, where::
+
+            [ 8   2-1j   0     0  ]        [ 1  ]
+        H = [2+1j  5     1j    0  ]    b = [1+1j]
+            [ 0   -1j    9   -2-1j]        [1-2j]
+            [ 0    0   -2+1j   6  ]        [ 0  ]
+
+    In this example, we put the upper diagonals in the array ``hb``:
+
+    >>> hb = np.array([[0, 2-1j, 1j, -2-1j],
+    ...                [8,  5,    9,   6  ]])
+    >>> b = np.array([1, 1+1j, 1-2j, 0])
+    >>> x = solveh_banded(hb, b)
+    >>> x
+    array([ 0.07318536-0.02939412j,  0.11877624+0.17696461j,
+            0.10077984-0.23035393j, -0.00479904-0.09358128j])
+
+    """
+    a1 = _asarray_validated(ab, check_finite=check_finite)
+    b1 = _asarray_validated(b, check_finite=check_finite)
+    # Validate shapes.
+    if a1.shape[-1] != b1.shape[0]:
+        raise ValueError("shapes of ab and b are not compatible.")
+
+    overwrite_b = overwrite_b or _datacopied(b1, b)
+    overwrite_ab = overwrite_ab or _datacopied(a1, ab)
+
+    if a1.shape[0] == 2:
+        ptsv, = get_lapack_funcs(('ptsv',), (a1, b1))
+        if lower:
+            d = a1[0, :].real
+            e = a1[1, :-1]
+        else:
+            d = a1[1, :].real
+            e = a1[0, 1:].conj()
+        d, du, x, info = ptsv(d, e, b1, overwrite_ab, overwrite_ab,
+                              overwrite_b)
+    else:
+        pbsv, = get_lapack_funcs(('pbsv',), (a1, b1))
+        c, x, info = pbsv(a1, b1, lower=lower, overwrite_ab=overwrite_ab,
+                          overwrite_b=overwrite_b)
+    if info > 0:
+        raise LinAlgError("%dth leading minor not positive definite" % info)
+    if info < 0:
+        raise ValueError('illegal value in %dth argument of internal '
+                         'pbsv' % -info)
+    return x
+
+
+def solve_toeplitz(c_or_cr, b, check_finite=True):
+    """Solve a Toeplitz system using Levinson Recursion
+
+    The Toeplitz matrix has constant diagonals, with c as its first column
+    and r as its first row. If r is not given, ``r == conjugate(c)`` is
+    assumed.
+
+    Parameters
+    ----------
+    c_or_cr : array_like or tuple of (array_like, array_like)
+        The vector ``c``, or a tuple of arrays (``c``, ``r``). Whatever the
+        actual shape of ``c``, it will be converted to a 1-D array. If not
+        supplied, ``r = conjugate(c)`` is assumed; in this case, if c[0] is
+        real, the Toeplitz matrix is Hermitian. r[0] is ignored; the first row
+        of the Toeplitz matrix is ``[c[0], r[1:]]``. Whatever the actual shape
+        of ``r``, it will be converted to a 1-D array.
+    b : (M,) or (M, K) array_like
+        Right-hand side in ``T x = b``.
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (result entirely NaNs) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    x : (M,) or (M, K) ndarray
+        The solution to the system ``T x = b``. Shape of return matches shape
+        of `b`.
+
+    See Also
+    --------
+    toeplitz : Toeplitz matrix
+
+    Notes
+    -----
+    The solution is computed using Levinson-Durbin recursion, which is faster
+    than generic least-squares methods, but can be less numerically stable.
+
+    Examples
+    --------
+    Solve the Toeplitz system T x = b, where::
+
+            [ 1 -1 -2 -3]       [1]
+        T = [ 3  1 -1 -2]   b = [2]
+            [ 6  3  1 -1]       [2]
+            [10  6  3  1]       [5]
+
+    To specify the Toeplitz matrix, only the first column and the first
+    row are needed.
+
+    >>> import numpy as np
+    >>> c = np.array([1, 3, 6, 10])    # First column of T
+    >>> r = np.array([1, -1, -2, -3])  # First row of T
+    >>> b = np.array([1, 2, 2, 5])
+
+    >>> from scipy.linalg import solve_toeplitz, toeplitz
+    >>> x = solve_toeplitz((c, r), b)
+    >>> x
+    array([ 1.66666667, -1.        , -2.66666667,  2.33333333])
+
+    Check the result by creating the full Toeplitz matrix and
+    multiplying it by `x`.  We should get `b`.
+
+    >>> T = toeplitz(c, r)
+    >>> T.dot(x)
+    array([ 1.,  2.,  2.,  5.])
+
+    """
+    # If numerical stability of this algorithm is a problem, a future
+    # developer might consider implementing other O(N^2) Toeplitz solvers,
+    # such as GKO (https://www.jstor.org/stable/2153371) or Bareiss.
+
+    r, c, b, dtype, b_shape = _validate_args_for_toeplitz_ops(
+        c_or_cr, b, check_finite, keep_b_shape=True)
+
+    # Form a 1-D array of values to be used in the matrix, containing a
+    # reversed copy of r[1:], followed by c.
+    vals = np.concatenate((r[-1:0:-1], c))
+    if b is None:
+        raise ValueError('illegal value, `b` is a required argument')
+
+    if b.ndim == 1:
+        x, _ = levinson(vals, np.ascontiguousarray(b))
+    else:
+        x = np.column_stack([levinson(vals, np.ascontiguousarray(b[:, i]))[0]
+                             for i in range(b.shape[1])])
+        x = x.reshape(*b_shape)
+
+    return x
+
+
+def _get_axis_len(aname, a, axis):
+    ax = axis
+    if ax < 0:
+        ax += a.ndim
+    if 0 <= ax < a.ndim:
+        return a.shape[ax]
+    raise ValueError(f"'{aname}axis' entry is out of bounds")
+
+
+def solve_circulant(c, b, singular='raise', tol=None,
+                    caxis=-1, baxis=0, outaxis=0):
+    """Solve C x = b for x, where C is a circulant matrix.
+
+    `C` is the circulant matrix associated with the vector `c`.
+
+    The system is solved by doing division in Fourier space. The
+    calculation is::
+
+        x = ifft(fft(b) / fft(c))
+
+    where `fft` and `ifft` are the fast Fourier transform and its inverse,
+    respectively. For a large vector `c`, this is *much* faster than
+    solving the system with the full circulant matrix.
+
+    Parameters
+    ----------
+    c : array_like
+        The coefficients of the circulant matrix.
+    b : array_like
+        Right-hand side matrix in ``a x = b``.
+    singular : str, optional
+        This argument controls how a near singular circulant matrix is
+        handled.  If `singular` is "raise" and the circulant matrix is
+        near singular, a `LinAlgError` is raised. If `singular` is
+        "lstsq", the least squares solution is returned. Default is "raise".
+    tol : float, optional
+        If any eigenvalue of the circulant matrix has an absolute value
+        that is less than or equal to `tol`, the matrix is considered to be
+        near singular. If not given, `tol` is set to::
+
+            tol = abs_eigs.max() * abs_eigs.size * np.finfo(np.float64).eps
+
+        where `abs_eigs` is the array of absolute values of the eigenvalues
+        of the circulant matrix.
+    caxis : int
+        When `c` has dimension greater than 1, it is viewed as a collection
+        of circulant vectors. In this case, `caxis` is the axis of `c` that
+        holds the vectors of circulant coefficients.
+    baxis : int
+        When `b` has dimension greater than 1, it is viewed as a collection
+        of vectors. In this case, `baxis` is the axis of `b` that holds the
+        right-hand side vectors.
+    outaxis : int
+        When `c` or `b` are multidimensional, the value returned by
+        `solve_circulant` is multidimensional. In this case, `outaxis` is
+        the axis of the result that holds the solution vectors.
+
+    Returns
+    -------
+    x : ndarray
+        Solution to the system ``C x = b``.
+
+    Raises
+    ------
+    LinAlgError
+        If the circulant matrix associated with `c` is near singular.
+
+    See Also
+    --------
+    circulant : circulant matrix
+
+    Notes
+    -----
+    For a 1-D vector `c` with length `m`, and an array `b`
+    with shape ``(m, ...)``,
+
+        solve_circulant(c, b)
+
+    returns the same result as
+
+        solve(circulant(c), b)
+
+    where `solve` and `circulant` are from `scipy.linalg`.
+
+    .. versionadded:: 0.16.0
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import solve_circulant, solve, circulant, lstsq
+
+    >>> c = np.array([2, 2, 4])
+    >>> b = np.array([1, 2, 3])
+    >>> solve_circulant(c, b)
+    array([ 0.75, -0.25,  0.25])
+
+    Compare that result to solving the system with `scipy.linalg.solve`:
+
+    >>> solve(circulant(c), b)
+    array([ 0.75, -0.25,  0.25])
+
+    A singular example:
+
+    >>> c = np.array([1, 1, 0, 0])
+    >>> b = np.array([1, 2, 3, 4])
+
+    Calling ``solve_circulant(c, b)`` will raise a `LinAlgError`.  For the
+    least square solution, use the option ``singular='lstsq'``:
+
+    >>> solve_circulant(c, b, singular='lstsq')
+    array([ 0.25,  1.25,  2.25,  1.25])
+
+    Compare to `scipy.linalg.lstsq`:
+
+    >>> x, resid, rnk, s = lstsq(circulant(c), b)
+    >>> x
+    array([ 0.25,  1.25,  2.25,  1.25])
+
+    A broadcasting example:
+
+    Suppose we have the vectors of two circulant matrices stored in an array
+    with shape (2, 5), and three `b` vectors stored in an array with shape
+    (3, 5).  For example,
+
+    >>> c = np.array([[1.5, 2, 3, 0, 0], [1, 1, 4, 3, 2]])
+    >>> b = np.arange(15).reshape(-1, 5)
+
+    We want to solve all combinations of circulant matrices and `b` vectors,
+    with the result stored in an array with shape (2, 3, 5). When we
+    disregard the axes of `c` and `b` that hold the vectors of coefficients,
+    the shapes of the collections are (2,) and (3,), respectively, which are
+    not compatible for broadcasting. To have a broadcast result with shape
+    (2, 3), we add a trivial dimension to `c`: ``c[:, np.newaxis, :]`` has
+    shape (2, 1, 5). The last dimension holds the coefficients of the
+    circulant matrices, so when we call `solve_circulant`, we can use the
+    default ``caxis=-1``. The coefficients of the `b` vectors are in the last
+    dimension of the array `b`, so we use ``baxis=-1``. If we use the
+    default `outaxis`, the result will have shape (5, 2, 3), so we'll use
+    ``outaxis=-1`` to put the solution vectors in the last dimension.
+
+    >>> x = solve_circulant(c[:, np.newaxis, :], b, baxis=-1, outaxis=-1)
+    >>> x.shape
+    (2, 3, 5)
+    >>> np.set_printoptions(precision=3)  # For compact output of numbers.
+    >>> x
+    array([[[-0.118,  0.22 ,  1.277, -0.142,  0.302],
+            [ 0.651,  0.989,  2.046,  0.627,  1.072],
+            [ 1.42 ,  1.758,  2.816,  1.396,  1.841]],
+           [[ 0.401,  0.304,  0.694, -0.867,  0.377],
+            [ 0.856,  0.758,  1.149, -0.412,  0.831],
+            [ 1.31 ,  1.213,  1.603,  0.042,  1.286]]])
+
+    Check by solving one pair of `c` and `b` vectors (cf. ``x[1, 1, :]``):
+
+    >>> solve_circulant(c[1], b[1, :])
+    array([ 0.856,  0.758,  1.149, -0.412,  0.831])
+
+    """
+    c = np.atleast_1d(c)
+    nc = _get_axis_len("c", c, caxis)
+    b = np.atleast_1d(b)
+    nb = _get_axis_len("b", b, baxis)
+    if nc != nb:
+        raise ValueError(f'Shapes of c {c.shape} and b {b.shape} are incompatible')
+
+    fc = np.fft.fft(np.moveaxis(c, caxis, -1), axis=-1)
+    abs_fc = np.abs(fc)
+    if tol is None:
+        # This is the same tolerance as used in np.linalg.matrix_rank.
+        tol = abs_fc.max(axis=-1) * nc * np.finfo(np.float64).eps
+        if tol.shape != ():
+            tol.shape = tol.shape + (1,)
+        else:
+            tol = np.atleast_1d(tol)
+
+    near_zeros = abs_fc <= tol
+    is_near_singular = np.any(near_zeros)
+    if is_near_singular:
+        if singular == 'raise':
+            raise LinAlgError("near singular circulant matrix.")
+        else:
+            # Replace the small values with 1 to avoid errors in the
+            # division fb/fc below.
+            fc[near_zeros] = 1
+
+    fb = np.fft.fft(np.moveaxis(b, baxis, -1), axis=-1)
+
+    q = fb / fc
+
+    if is_near_singular:
+        # `near_zeros` is a boolean array, same shape as `c`, that is
+        # True where `fc` is (near) zero. `q` is the broadcasted result
+        # of fb / fc, so to set the values of `q` to 0 where `fc` is near
+        # zero, we use a mask that is the broadcast result of an array
+        # of True values shaped like `b` with `near_zeros`.
+        mask = np.ones_like(b, dtype=bool) & near_zeros
+        q[mask] = 0
+
+    x = np.fft.ifft(q, axis=-1)
+    if not (np.iscomplexobj(c) or np.iscomplexobj(b)):
+        x = x.real
+    if outaxis != -1:
+        x = np.moveaxis(x, -1, outaxis)
+    return x
+
+
+# matrix inversion
+def inv(a, overwrite_a=False, check_finite=True):
+    """
+    Compute the inverse of a matrix.
+
+    Parameters
+    ----------
+    a : array_like
+        Square matrix to be inverted.
+    overwrite_a : bool, optional
+        Discard data in `a` (may improve performance). Default is False.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    ainv : ndarray
+        Inverse of the matrix `a`.
+
+    Raises
+    ------
+    LinAlgError
+        If `a` is singular.
+    ValueError
+        If `a` is not square, or not 2D.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> a = np.array([[1., 2.], [3., 4.]])
+    >>> linalg.inv(a)
+    array([[-2. ,  1. ],
+           [ 1.5, -0.5]])
+    >>> np.dot(a, linalg.inv(a))
+    array([[ 1.,  0.],
+           [ 0.,  1.]])
+
+    """
+    a1 = _asarray_validated(a, check_finite=check_finite)
+    if len(a1.shape) != 2 or a1.shape[0] != a1.shape[1]:
+        raise ValueError('expected square matrix')
+    overwrite_a = overwrite_a or _datacopied(a1, a)
+    getrf, getri, getri_lwork = get_lapack_funcs(('getrf', 'getri',
+                                                  'getri_lwork'),
+                                                 (a1,))
+    lu, piv, info = getrf(a1, overwrite_a=overwrite_a)
+    if info == 0:
+        lwork = _compute_lwork(getri_lwork, a1.shape[0])
+
+        # XXX: the following line fixes curious SEGFAULT when
+        # benchmarking 500x500 matrix inverse. This seems to
+        # be a bug in LAPACK ?getri routine because if lwork is
+        # minimal (when using lwork[0] instead of lwork[1]) then
+        # all tests pass. Further investigation is required if
+        # more such SEGFAULTs occur.
+        lwork = int(1.01 * lwork)
+        inv_a, info = getri(lu, piv, lwork=lwork, overwrite_lu=1)
+    if info > 0:
+        raise LinAlgError("singular matrix")
+    if info < 0:
+        raise ValueError('illegal value in %d-th argument of internal '
+                         'getrf|getri' % -info)
+    return inv_a
+
+
+# Determinant
+
+def det(a, overwrite_a=False, check_finite=True):
+    """
+    Compute the determinant of a matrix
+
+    The determinant is a scalar that is a function of the associated square
+    matrix coefficients. The determinant value is zero for singular matrices.
+
+    Parameters
+    ----------
+    a : (..., M, M) array_like
+        Input array to compute determinants for.
+    overwrite_a : bool, optional
+        Allow overwriting data in a (may enhance performance).
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    det : (...) float or complex
+        Determinant of `a`. For stacked arrays, a scalar is returned for each
+        (m, m) slice in the last two dimensions of the input. For example, an
+        input of shape (p, q, m, m) will produce a result of shape (p, q). If
+        all dimensions are 1 a scalar is returned regardless of ndim.
+
+    Notes
+    -----
+    The determinant is computed by performing an LU factorization of the
+    input with LAPACK routine 'getrf', and then calculating the product of
+    diagonal entries of the U factor.
+
+    Even the input array is single precision (float32 or complex64), the result
+    will be returned in double precision (float64 or complex128) to prevent
+    overflows.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> a = np.array([[1,2,3], [4,5,6], [7,8,9]])  # A singular matrix
+    >>> linalg.det(a)
+    0.0
+    >>> b = np.array([[0,2,3], [4,5,6], [7,8,9]])
+    >>> linalg.det(b)
+    3.0
+    >>> # An array with the shape (3, 2, 2, 2)
+    >>> c = np.array([[[[1., 2.], [3., 4.]],
+    ...                [[5., 6.], [7., 8.]]],
+    ...               [[[9., 10.], [11., 12.]],
+    ...                [[13., 14.], [15., 16.]]],
+    ...               [[[17., 18.], [19., 20.]],
+    ...                [[21., 22.], [23., 24.]]]])
+    >>> linalg.det(c)  # The resulting shape is (3, 2)
+    array([[-2., -2.],
+           [-2., -2.],
+           [-2., -2.]])
+    >>> linalg.det(c[0, 0])  # Confirm the (0, 0) slice, [[1, 2], [3, 4]]
+    -2.0
+    """
+    # The goal is to end up with a writable contiguous array to pass to Cython
+
+    # First we check and make arrays.
+    a1 = np.asarray_chkfinite(a) if check_finite else np.asarray(a)
+    if a1.ndim < 2:
+        raise ValueError('The input array must be at least two-dimensional.')
+    if a1.shape[-1] != a1.shape[-2]:
+        raise ValueError('Last 2 dimensions of the array must be square'
+                         f' but received shape {a1.shape}.')
+
+    # Also check if dtype is LAPACK compatible
+    if a1.dtype.char not in 'fdFD':
+        dtype_char = lapack_cast_dict[a1.dtype.char]
+        if not dtype_char:  # No casting possible
+            raise TypeError(f'The dtype "{a1.dtype.name}" cannot be cast '
+                            'to float(32, 64) or complex(64, 128).')
+
+        a1 = a1.astype(dtype_char[0])  # makes a copy, free to scratch
+        overwrite_a = True
+
+    # Empty array has determinant 1 because math.
+    if min(*a1.shape) == 0:
+        if a1.ndim == 2:
+            return np.float64(1.)
+        else:
+            return np.ones(shape=a1.shape[:-2], dtype=np.float64)
+
+    # Scalar case
+    if a1.shape[-2:] == (1, 1):
+        # Either ndarray with spurious singletons or a single element
+        if max(*a1.shape) > 1:
+            temp = np.squeeze(a1)
+            if a1.dtype.char in 'dD':
+                return temp
+            else:
+                return (temp.astype('d') if a1.dtype.char == 'f' else
+                        temp.astype('D'))
+        else:
+            return (np.float64(a1.item()) if a1.dtype.char in 'fd' else
+                    np.complex128(a1.item()))
+
+    # Then check overwrite permission
+    if not _datacopied(a1, a):  # "a"  still alive through "a1"
+        if not overwrite_a:
+            # Data belongs to "a" so make a copy
+            a1 = a1.copy(order='C')
+        #  else: Do nothing we'll use "a" if possible
+    # else:  a1 has its own data thus free to scratch
+
+    # Then layout checks, might happen that overwrite is allowed but original
+    # array was read-only or non-C-contiguous.
+    if not (a1.flags['C_CONTIGUOUS'] and a1.flags['WRITEABLE']):
+        a1 = a1.copy(order='C')
+
+    if a1.ndim == 2:
+        det = find_det_from_lu(a1)
+        # Convert float, complex to to NumPy scalars
+        return (np.float64(det) if np.isrealobj(det) else np.complex128(det))
+
+    # loop over the stacked array, and avoid overflows for single precision
+    # Cf. np.linalg.det(np.diag([1e+38, 1e+38]).astype(np.float32))
+    dtype_char = a1.dtype.char
+    if dtype_char in 'fF':
+        dtype_char = 'd' if dtype_char.islower() else 'D'
+
+    det = np.empty(a1.shape[:-2], dtype=dtype_char)
+    for ind in product(*[range(x) for x in a1.shape[:-2]]):
+        det[ind] = find_det_from_lu(a1[ind])
+    return det
+
+
+# Linear Least Squares
+def lstsq(a, b, cond=None, overwrite_a=False, overwrite_b=False,
+          check_finite=True, lapack_driver=None):
+    """
+    Compute least-squares solution to equation Ax = b.
+
+    Compute a vector x such that the 2-norm ``|b - A x|`` is minimized.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Left-hand side array
+    b : (M,) or (M, K) array_like
+        Right hand side array
+    cond : float, optional
+        Cutoff for 'small' singular values; used to determine effective
+        rank of a. Singular values smaller than
+        ``cond * largest_singular_value`` are considered zero.
+    overwrite_a : bool, optional
+        Discard data in `a` (may enhance performance). Default is False.
+    overwrite_b : bool, optional
+        Discard data in `b` (may enhance performance). Default is False.
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+    lapack_driver : str, optional
+        Which LAPACK driver is used to solve the least-squares problem.
+        Options are ``'gelsd'``, ``'gelsy'``, ``'gelss'``. Default
+        (``'gelsd'``) is a good choice.  However, ``'gelsy'`` can be slightly
+        faster on many problems.  ``'gelss'`` was used historically.  It is
+        generally slow but uses less memory.
+
+        .. versionadded:: 0.17.0
+
+    Returns
+    -------
+    x : (N,) or (N, K) ndarray
+        Least-squares solution.
+    residues : (K,) ndarray or float
+        Square of the 2-norm for each column in ``b - a x``, if ``M > N`` and
+        ``rank(A) == n`` (returns a scalar if ``b`` is 1-D). Otherwise a
+        (0,)-shaped array is returned.
+    rank : int
+        Effective rank of `a`.
+    s : (min(M, N),) ndarray or None
+        Singular values of `a`. The condition number of ``a`` is
+        ``s[0] / s[-1]``.
+
+    Raises
+    ------
+    LinAlgError
+        If computation does not converge.
+
+    ValueError
+        When parameters are not compatible.
+
+    See Also
+    --------
+    scipy.optimize.nnls : linear least squares with non-negativity constraint
+
+    Notes
+    -----
+    When ``'gelsy'`` is used as a driver, `residues` is set to a (0,)-shaped
+    array and `s` is always ``None``.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import lstsq
+    >>> import matplotlib.pyplot as plt
+
+    Suppose we have the following data:
+
+    >>> x = np.array([1, 2.5, 3.5, 4, 5, 7, 8.5])
+    >>> y = np.array([0.3, 1.1, 1.5, 2.0, 3.2, 6.6, 8.6])
+
+    We want to fit a quadratic polynomial of the form ``y = a + b*x**2``
+    to this data.  We first form the "design matrix" M, with a constant
+    column of 1s and a column containing ``x**2``:
+
+    >>> M = x[:, np.newaxis]**[0, 2]
+    >>> M
+    array([[  1.  ,   1.  ],
+           [  1.  ,   6.25],
+           [  1.  ,  12.25],
+           [  1.  ,  16.  ],
+           [  1.  ,  25.  ],
+           [  1.  ,  49.  ],
+           [  1.  ,  72.25]])
+
+    We want to find the least-squares solution to ``M.dot(p) = y``,
+    where ``p`` is a vector with length 2 that holds the parameters
+    ``a`` and ``b``.
+
+    >>> p, res, rnk, s = lstsq(M, y)
+    >>> p
+    array([ 0.20925829,  0.12013861])
+
+    Plot the data and the fitted curve.
+
+    >>> plt.plot(x, y, 'o', label='data')
+    >>> xx = np.linspace(0, 9, 101)
+    >>> yy = p[0] + p[1]*xx**2
+    >>> plt.plot(xx, yy, label='least squares fit, $y = a + bx^2$')
+    >>> plt.xlabel('x')
+    >>> plt.ylabel('y')
+    >>> plt.legend(framealpha=1, shadow=True)
+    >>> plt.grid(alpha=0.25)
+    >>> plt.show()
+
+    """
+    a1 = _asarray_validated(a, check_finite=check_finite)
+    b1 = _asarray_validated(b, check_finite=check_finite)
+    if len(a1.shape) != 2:
+        raise ValueError('Input array a should be 2D')
+    m, n = a1.shape
+    if len(b1.shape) == 2:
+        nrhs = b1.shape[1]
+    else:
+        nrhs = 1
+    if m != b1.shape[0]:
+        raise ValueError('Shape mismatch: a and b should have the same number'
+                         f' of rows ({m} != {b1.shape[0]}).')
+    if m == 0 or n == 0:  # Zero-sized problem, confuses LAPACK
+        x = np.zeros((n,) + b1.shape[1:], dtype=np.common_type(a1, b1))
+        if n == 0:
+            residues = np.linalg.norm(b1, axis=0)**2
+        else:
+            residues = np.empty((0,))
+        return x, residues, 0, np.empty((0,))
+
+    driver = lapack_driver
+    if driver is None:
+        driver = lstsq.default_lapack_driver
+    if driver not in ('gelsd', 'gelsy', 'gelss'):
+        raise ValueError('LAPACK driver "%s" is not found' % driver)
+
+    lapack_func, lapack_lwork = get_lapack_funcs((driver,
+                                                 '%s_lwork' % driver),
+                                                 (a1, b1))
+    real_data = True if (lapack_func.dtype.kind == 'f') else False
+
+    if m < n:
+        # need to extend b matrix as it will be filled with
+        # a larger solution matrix
+        if len(b1.shape) == 2:
+            b2 = np.zeros((n, nrhs), dtype=lapack_func.dtype)
+            b2[:m, :] = b1
+        else:
+            b2 = np.zeros(n, dtype=lapack_func.dtype)
+            b2[:m] = b1
+        b1 = b2
+
+    overwrite_a = overwrite_a or _datacopied(a1, a)
+    overwrite_b = overwrite_b or _datacopied(b1, b)
+
+    if cond is None:
+        cond = np.finfo(lapack_func.dtype).eps
+
+    if driver in ('gelss', 'gelsd'):
+        if driver == 'gelss':
+            lwork = _compute_lwork(lapack_lwork, m, n, nrhs, cond)
+            v, x, s, rank, work, info = lapack_func(a1, b1, cond, lwork,
+                                                    overwrite_a=overwrite_a,
+                                                    overwrite_b=overwrite_b)
+
+        elif driver == 'gelsd':
+            if real_data:
+                lwork, iwork = _compute_lwork(lapack_lwork, m, n, nrhs, cond)
+                x, s, rank, info = lapack_func(a1, b1, lwork,
+                                               iwork, cond, False, False)
+            else:  # complex data
+                lwork, rwork, iwork = _compute_lwork(lapack_lwork, m, n,
+                                                     nrhs, cond)
+                x, s, rank, info = lapack_func(a1, b1, lwork, rwork, iwork,
+                                               cond, False, False)
+        if info > 0:
+            raise LinAlgError("SVD did not converge in Linear Least Squares")
+        if info < 0:
+            raise ValueError('illegal value in %d-th argument of internal %s'
+                             % (-info, lapack_driver))
+        resids = np.asarray([], dtype=x.dtype)
+        if m > n:
+            x1 = x[:n]
+            if rank == n:
+                resids = np.sum(np.abs(x[n:])**2, axis=0)
+            x = x1
+        return x, resids, rank, s
+
+    elif driver == 'gelsy':
+        lwork = _compute_lwork(lapack_lwork, m, n, nrhs, cond)
+        jptv = np.zeros((a1.shape[1], 1), dtype=np.int32)
+        v, x, j, rank, info = lapack_func(a1, b1, jptv, cond,
+                                          lwork, False, False)
+        if info < 0:
+            raise ValueError("illegal value in %d-th argument of internal "
+                             "gelsy" % -info)
+        if m > n:
+            x1 = x[:n]
+            x = x1
+        return x, np.array([], x.dtype), rank, None
+
+
+lstsq.default_lapack_driver = 'gelsd'
+
+
+@_deprecate_positional_args(version="1.14")
+def pinv(a, *, atol=None, rtol=None, return_rank=False, check_finite=True,
+         cond=_NoValue, rcond=_NoValue):
+    """
+    Compute the (Moore-Penrose) pseudo-inverse of a matrix.
+
+    Calculate a generalized inverse of a matrix using its
+    singular-value decomposition ``U @ S @ V`` in the economy mode and picking
+    up only the columns/rows that are associated with significant singular
+    values.
+
+    If ``s`` is the maximum singular value of ``a``, then the
+    significance cut-off value is determined by ``atol + rtol * s``. Any
+    singular value below this value is assumed insignificant.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Matrix to be pseudo-inverted.
+    atol : float, optional
+        Absolute threshold term, default value is 0.
+
+        .. versionadded:: 1.7.0
+
+    rtol : float, optional
+        Relative threshold term, default value is ``max(M, N) * eps`` where
+        ``eps`` is the machine precision value of the datatype of ``a``.
+
+        .. versionadded:: 1.7.0
+
+    return_rank : bool, optional
+        If True, return the effective rank of the matrix.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+    cond, rcond : float, optional
+        In older versions, these values were meant to be used as ``atol`` with
+        ``rtol=0``. If both were given ``rcond`` overwrote ``cond`` and hence
+        the code was not correct. Thus using these are strongly discouraged and
+        the tolerances above are recommended instead. In fact, if provided,
+        atol, rtol takes precedence over these keywords.
+
+        .. deprecated:: 1.7.0
+            Deprecated in favor of ``rtol`` and ``atol`` parameters above and
+            will be removed in SciPy 1.14.0.
+
+        .. versionchanged:: 1.3.0
+            Previously the default cutoff value was just ``eps*f`` where ``f``
+            was ``1e3`` for single precision and ``1e6`` for double precision.
+
+    Returns
+    -------
+    B : (N, M) ndarray
+        The pseudo-inverse of matrix `a`.
+    rank : int
+        The effective rank of the matrix. Returned if `return_rank` is True.
+
+    Raises
+    ------
+    LinAlgError
+        If SVD computation does not converge.
+
+    See Also
+    --------
+    pinvh : Moore-Penrose pseudoinverse of a hermitian matrix.
+
+    Notes
+    -----
+    If ``A`` is invertible then the Moore-Penrose pseudoinverse is exactly
+    the inverse of ``A`` [1]_. If ``A`` is not invertible then the
+    Moore-Penrose pseudoinverse computes the ``x`` solution to ``Ax = b`` such
+    that ``||Ax - b||`` is minimized [1]_.
+
+    References
+    ----------
+    .. [1] Penrose, R. (1956). On best approximate solutions of linear matrix
+           equations. Mathematical Proceedings of the Cambridge Philosophical
+           Society, 52(1), 17-19. doi:10.1017/S0305004100030929
+
+    Examples
+    --------
+
+    Given an ``m x n`` matrix ``A`` and an ``n x m`` matrix ``B`` the four
+    Moore-Penrose conditions are:
+
+    1. ``ABA = A`` (``B`` is a generalized inverse of ``A``),
+    2. ``BAB = B`` (``A`` is a generalized inverse of ``B``),
+    3. ``(AB)* = AB`` (``AB`` is hermitian),
+    4. ``(BA)* = BA`` (``BA`` is hermitian) [1]_.
+
+    Here, ``A*`` denotes the conjugate transpose. The Moore-Penrose
+    pseudoinverse is a unique ``B`` that satisfies all four of these
+    conditions and exists for any ``A``. Note that, unlike the standard
+    matrix inverse, ``A`` does not have to be a square matrix or have
+    linearly independent columns/rows.
+
+    As an example, we can calculate the Moore-Penrose pseudoinverse of a
+    random non-square matrix and verify it satisfies the four conditions.
+
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> rng = np.random.default_rng()
+    >>> A = rng.standard_normal((9, 6))
+    >>> B = linalg.pinv(A)
+    >>> np.allclose(A @ B @ A, A)  # Condition 1
+    True
+    >>> np.allclose(B @ A @ B, B)  # Condition 2
+    True
+    >>> np.allclose((A @ B).conj().T, A @ B)  # Condition 3
+    True
+    >>> np.allclose((B @ A).conj().T, B @ A)  # Condition 4
+    True
+
+    """
+    a = _asarray_validated(a, check_finite=check_finite)
+    u, s, vh = _decomp_svd.svd(a, full_matrices=False, check_finite=False)
+    t = u.dtype.char.lower()
+    maxS = np.max(s)
+
+    if rcond is not _NoValue or cond is not _NoValue:
+        warn('Use of the "cond" and "rcond" keywords are deprecated and '
+             'will be removed in SciPy 1.14.0. Use "atol" and '
+             '"rtol" keywords instead', DeprecationWarning, stacklevel=2)
+
+    # backwards compatible only atol and rtol are both missing
+    if ((rcond not in (_NoValue, None) or cond not in (_NoValue, None))
+            and (atol is None) and (rtol is None)):
+        atol = rcond if rcond not in (_NoValue, None) else cond
+        rtol = 0.
+
+    atol = 0. if atol is None else atol
+    rtol = max(a.shape) * np.finfo(t).eps if (rtol is None) else rtol
+
+    if (atol < 0.) or (rtol < 0.):
+        raise ValueError("atol and rtol values must be positive.")
+
+    val = atol + maxS * rtol
+    rank = np.sum(s > val)
+
+    u = u[:, :rank]
+    u /= s[:rank]
+    B = (u @ vh[:rank]).conj().T
+
+    if return_rank:
+        return B, rank
+    else:
+        return B
+
+
+def pinvh(a, atol=None, rtol=None, lower=True, return_rank=False,
+          check_finite=True):
+    """
+    Compute the (Moore-Penrose) pseudo-inverse of a Hermitian matrix.
+
+    Calculate a generalized inverse of a complex Hermitian/real symmetric
+    matrix using its eigenvalue decomposition and including all eigenvalues
+    with 'large' absolute value.
+
+    Parameters
+    ----------
+    a : (N, N) array_like
+        Real symmetric or complex hermetian matrix to be pseudo-inverted
+
+    atol : float, optional
+        Absolute threshold term, default value is 0.
+
+        .. versionadded:: 1.7.0
+
+    rtol : float, optional
+        Relative threshold term, default value is ``N * eps`` where
+        ``eps`` is the machine precision value of the datatype of ``a``.
+
+        .. versionadded:: 1.7.0
+
+    lower : bool, optional
+        Whether the pertinent array data is taken from the lower or upper
+        triangle of `a`. (Default: lower)
+    return_rank : bool, optional
+        If True, return the effective rank of the matrix.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    B : (N, N) ndarray
+        The pseudo-inverse of matrix `a`.
+    rank : int
+        The effective rank of the matrix.  Returned if `return_rank` is True.
+
+    Raises
+    ------
+    LinAlgError
+        If eigenvalue algorithm does not converge.
+
+    See Also
+    --------
+    pinv : Moore-Penrose pseudoinverse of a matrix.
+
+    Examples
+    --------
+
+    For a more detailed example see `pinv`.
+
+    >>> import numpy as np
+    >>> from scipy.linalg import pinvh
+    >>> rng = np.random.default_rng()
+    >>> a = rng.standard_normal((9, 6))
+    >>> a = np.dot(a, a.T)
+    >>> B = pinvh(a)
+    >>> np.allclose(a, a @ B @ a)
+    True
+    >>> np.allclose(B, B @ a @ B)
+    True
+
+    """
+    a = _asarray_validated(a, check_finite=check_finite)
+    s, u = _decomp.eigh(a, lower=lower, check_finite=False)
+    t = u.dtype.char.lower()
+    maxS = np.max(np.abs(s))
+
+    atol = 0. if atol is None else atol
+    rtol = max(a.shape) * np.finfo(t).eps if (rtol is None) else rtol
+
+    if (atol < 0.) or (rtol < 0.):
+        raise ValueError("atol and rtol values must be positive.")
+
+    val = atol + maxS * rtol
+    above_cutoff = (abs(s) > val)
+
+    psigma_diag = 1.0 / s[above_cutoff]
+    u = u[:, above_cutoff]
+
+    B = (u * psigma_diag) @ u.conj().T
+
+    if return_rank:
+        return B, len(psigma_diag)
+    else:
+        return B
+
+
+def matrix_balance(A, permute=True, scale=True, separate=False,
+                   overwrite_a=False):
+    """
+    Compute a diagonal similarity transformation for row/column balancing.
+
+    The balancing tries to equalize the row and column 1-norms by applying
+    a similarity transformation such that the magnitude variation of the
+    matrix entries is reflected to the scaling matrices.
+
+    Moreover, if enabled, the matrix is first permuted to isolate the upper
+    triangular parts of the matrix and, again if scaling is also enabled,
+    only the remaining subblocks are subjected to scaling.
+
+    The balanced matrix satisfies the following equality
+
+    .. math::
+
+                        B = T^{-1} A T
+
+    The scaling coefficients are approximated to the nearest power of 2
+    to avoid round-off errors.
+
+    Parameters
+    ----------
+    A : (n, n) array_like
+        Square data matrix for the balancing.
+    permute : bool, optional
+        The selector to define whether permutation of A is also performed
+        prior to scaling.
+    scale : bool, optional
+        The selector to turn on and off the scaling. If False, the matrix
+        will not be scaled.
+    separate : bool, optional
+        This switches from returning a full matrix of the transformation
+        to a tuple of two separate 1-D permutation and scaling arrays.
+    overwrite_a : bool, optional
+        This is passed to xGEBAL directly. Essentially, overwrites the result
+        to the data. It might increase the space efficiency. See LAPACK manual
+        for details. This is False by default.
+
+    Returns
+    -------
+    B : (n, n) ndarray
+        Balanced matrix
+    T : (n, n) ndarray
+        A possibly permuted diagonal matrix whose nonzero entries are
+        integer powers of 2 to avoid numerical truncation errors.
+    scale, perm : (n,) ndarray
+        If ``separate`` keyword is set to True then instead of the array
+        ``T`` above, the scaling and the permutation vectors are given
+        separately as a tuple without allocating the full array ``T``.
+
+    Notes
+    -----
+    This algorithm is particularly useful for eigenvalue and matrix
+    decompositions and in many cases it is already called by various
+    LAPACK routines.
+
+    The algorithm is based on the well-known technique of [1]_ and has
+    been modified to account for special cases. See [2]_ for details
+    which have been implemented since LAPACK v3.5.0. Before this version
+    there are corner cases where balancing can actually worsen the
+    conditioning. See [3]_ for such examples.
+
+    The code is a wrapper around LAPACK's xGEBAL routine family for matrix
+    balancing.
+
+    .. versionadded:: 0.19.0
+
+    References
+    ----------
+    .. [1] B.N. Parlett and C. Reinsch, "Balancing a Matrix for
+       Calculation of Eigenvalues and Eigenvectors", Numerische Mathematik,
+       Vol.13(4), 1969, :doi:`10.1007/BF02165404`
+    .. [2] R. James, J. Langou, B.R. Lowery, "On matrix balancing and
+       eigenvector computation", 2014, :arxiv:`1401.5766`
+    .. [3] D.S. Watkins. A case where balancing is harmful.
+       Electron. Trans. Numer. Anal, Vol.23, 2006.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> x = np.array([[1,2,0], [9,1,0.01], [1,2,10*np.pi]])
+
+    >>> y, permscale = linalg.matrix_balance(x)
+    >>> np.abs(x).sum(axis=0) / np.abs(x).sum(axis=1)
+    array([ 3.66666667,  0.4995005 ,  0.91312162])
+
+    >>> np.abs(y).sum(axis=0) / np.abs(y).sum(axis=1)
+    array([ 1.2       ,  1.27041742,  0.92658316])  # may vary
+
+    >>> permscale  # only powers of 2 (0.5 == 2^(-1))
+    array([[  0.5,   0. ,  0. ],  # may vary
+           [  0. ,   1. ,  0. ],
+           [  0. ,   0. ,  1. ]])
+
+    """
+
+    A = np.atleast_2d(_asarray_validated(A, check_finite=True))
+
+    if not np.equal(*A.shape):
+        raise ValueError('The data matrix for balancing should be square.')
+
+    gebal = get_lapack_funcs(('gebal'), (A,))
+    B, lo, hi, ps, info = gebal(A, scale=scale, permute=permute,
+                                overwrite_a=overwrite_a)
+
+    if info < 0:
+        raise ValueError('xGEBAL exited with the internal error '
+                         f'"illegal value in argument number {-info}.". See '
+                         'LAPACK documentation for the xGEBAL error codes.')
+
+    # Separate the permutations from the scalings and then convert to int
+    scaling = np.ones_like(ps, dtype=float)
+    scaling[lo:hi+1] = ps[lo:hi+1]
+
+    # gebal uses 1-indexing
+    ps = ps.astype(int, copy=False) - 1
+    n = A.shape[0]
+    perm = np.arange(n)
+
+    # LAPACK permutes with the ordering n --> hi, then 0--> lo
+    if hi < n:
+        for ind, x in enumerate(ps[hi+1:][::-1], 1):
+            if n-ind == x:
+                continue
+            perm[[x, n-ind]] = perm[[n-ind, x]]
+
+    if lo > 0:
+        for ind, x in enumerate(ps[:lo]):
+            if ind == x:
+                continue
+            perm[[x, ind]] = perm[[ind, x]]
+
+    if separate:
+        return B, (scaling, perm)
+
+    # get the inverse permutation
+    iperm = np.empty_like(perm)
+    iperm[perm] = np.arange(n)
+
+    return B, np.diag(scaling)[iperm, :]
+
+
+def _validate_args_for_toeplitz_ops(c_or_cr, b, check_finite, keep_b_shape,
+                                    enforce_square=True):
+    """Validate arguments and format inputs for toeplitz functions
+
+    Parameters
+    ----------
+    c_or_cr : array_like or tuple of (array_like, array_like)
+        The vector ``c``, or a tuple of arrays (``c``, ``r``). Whatever the
+        actual shape of ``c``, it will be converted to a 1-D array. If not
+        supplied, ``r = conjugate(c)`` is assumed; in this case, if c[0] is
+        real, the Toeplitz matrix is Hermitian. r[0] is ignored; the first row
+        of the Toeplitz matrix is ``[c[0], r[1:]]``. Whatever the actual shape
+        of ``r``, it will be converted to a 1-D array.
+    b : (M,) or (M, K) array_like
+        Right-hand side in ``T x = b``.
+    check_finite : bool
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (result entirely NaNs) if the inputs do contain infinities or NaNs.
+    keep_b_shape : bool
+        Whether to convert a (M,) dimensional b into a (M, 1) dimensional
+        matrix.
+    enforce_square : bool, optional
+        If True (default), this verifies that the Toeplitz matrix is square.
+
+    Returns
+    -------
+    r : array
+        1d array corresponding to the first row of the Toeplitz matrix.
+    c: array
+        1d array corresponding to the first column of the Toeplitz matrix.
+    b: array
+        (M,), (M, 1) or (M, K) dimensional array, post validation,
+        corresponding to ``b``.
+    dtype: numpy datatype
+        ``dtype`` stores the datatype of ``r``, ``c`` and ``b``. If any of
+        ``r``, ``c`` or ``b`` are complex, ``dtype`` is ``np.complex128``,
+        otherwise, it is ``np.float``.
+    b_shape: tuple
+        Shape of ``b`` after passing it through ``_asarray_validated``.
+
+    """
+
+    if isinstance(c_or_cr, tuple):
+        c, r = c_or_cr
+        c = _asarray_validated(c, check_finite=check_finite).ravel()
+        r = _asarray_validated(r, check_finite=check_finite).ravel()
+    else:
+        c = _asarray_validated(c_or_cr, check_finite=check_finite).ravel()
+        r = c.conjugate()
+
+    if b is None:
+        raise ValueError('`b` must be an array, not None.')
+
+    b = _asarray_validated(b, check_finite=check_finite)
+    b_shape = b.shape
+
+    is_not_square = r.shape[0] != c.shape[0]
+    if (enforce_square and is_not_square) or b.shape[0] != r.shape[0]:
+        raise ValueError('Incompatible dimensions.')
+
+    is_cmplx = np.iscomplexobj(r) or np.iscomplexobj(c) or np.iscomplexobj(b)
+    dtype = np.complex128 if is_cmplx else np.float64
+    r, c, b = (np.asarray(i, dtype=dtype) for i in (r, c, b))
+
+    if b.ndim == 1 and not keep_b_shape:
+        b = b.reshape(-1, 1)
+    elif b.ndim != 1:
+        b = b.reshape(b.shape[0], -1)
+
+    return r, c, b, dtype, b_shape
+
+
+def matmul_toeplitz(c_or_cr, x, check_finite=False, workers=None):
+    """Efficient Toeplitz Matrix-Matrix Multiplication using FFT
+
+    This function returns the matrix multiplication between a Toeplitz
+    matrix and a dense matrix.
+
+    The Toeplitz matrix has constant diagonals, with c as its first column
+    and r as its first row. If r is not given, ``r == conjugate(c)`` is
+    assumed.
+
+    Parameters
+    ----------
+    c_or_cr : array_like or tuple of (array_like, array_like)
+        The vector ``c``, or a tuple of arrays (``c``, ``r``). Whatever the
+        actual shape of ``c``, it will be converted to a 1-D array. If not
+        supplied, ``r = conjugate(c)`` is assumed; in this case, if c[0] is
+        real, the Toeplitz matrix is Hermitian. r[0] is ignored; the first row
+        of the Toeplitz matrix is ``[c[0], r[1:]]``. Whatever the actual shape
+        of ``r``, it will be converted to a 1-D array.
+    x : (M,) or (M, K) array_like
+        Matrix with which to multiply.
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (result entirely NaNs) if the inputs do contain infinities or NaNs.
+    workers : int, optional
+        To pass to scipy.fft.fft and ifft. Maximum number of workers to use
+        for parallel computation. If negative, the value wraps around from
+        ``os.cpu_count()``. See scipy.fft.fft for more details.
+
+    Returns
+    -------
+    T @ x : (M,) or (M, K) ndarray
+        The result of the matrix multiplication ``T @ x``. Shape of return
+        matches shape of `x`.
+
+    See Also
+    --------
+    toeplitz : Toeplitz matrix
+    solve_toeplitz : Solve a Toeplitz system using Levinson Recursion
+
+    Notes
+    -----
+    The Toeplitz matrix is embedded in a circulant matrix and the FFT is used
+    to efficiently calculate the matrix-matrix product.
+
+    Because the computation is based on the FFT, integer inputs will
+    result in floating point outputs.  This is unlike NumPy's `matmul`,
+    which preserves the data type of the input.
+
+    This is partly based on the implementation that can be found in [1]_,
+    licensed under the MIT license. More information about the method can be
+    found in reference [2]_. References [3]_ and [4]_ have more reference
+    implementations in Python.
+
+    .. versionadded:: 1.6.0
+
+    References
+    ----------
+    .. [1] Jacob R Gardner, Geoff Pleiss, David Bindel, Kilian
+       Q Weinberger, Andrew Gordon Wilson, "GPyTorch: Blackbox Matrix-Matrix
+       Gaussian Process Inference with GPU Acceleration" with contributions
+       from Max Balandat and Ruihan Wu. Available online:
+       https://github.com/cornellius-gp/gpytorch
+
+    .. [2] J. Demmel, P. Koev, and X. Li, "A Brief Survey of Direct Linear
+       Solvers". In Z. Bai, J. Demmel, J. Dongarra, A. Ruhe, and H. van der
+       Vorst, editors. Templates for the Solution of Algebraic Eigenvalue
+       Problems: A Practical Guide. SIAM, Philadelphia, 2000. Available at:
+       http://www.netlib.org/utk/people/JackDongarra/etemplates/node384.html
+
+    .. [3] R. Scheibler, E. Bezzam, I. Dokmanic, Pyroomacoustics: A Python
+       package for audio room simulations and array processing algorithms,
+       Proc. IEEE ICASSP, Calgary, CA, 2018.
+       https://github.com/LCAV/pyroomacoustics/blob/pypi-release/
+       pyroomacoustics/adaptive/util.py
+
+    .. [4] Marano S, Edwards B, Ferrari G and Fah D (2017), "Fitting
+       Earthquake Spectra: Colored Noise and Incomplete Data", Bulletin of
+       the Seismological Society of America., January, 2017. Vol. 107(1),
+       pp. 276-291.
+
+    Examples
+    --------
+    Multiply the Toeplitz matrix T with matrix x::
+
+            [ 1 -1 -2 -3]       [1 10]
+        T = [ 3  1 -1 -2]   x = [2 11]
+            [ 6  3  1 -1]       [2 11]
+            [10  6  3  1]       [5 19]
+
+    To specify the Toeplitz matrix, only the first column and the first
+    row are needed.
+
+    >>> import numpy as np
+    >>> c = np.array([1, 3, 6, 10])    # First column of T
+    >>> r = np.array([1, -1, -2, -3])  # First row of T
+    >>> x = np.array([[1, 10], [2, 11], [2, 11], [5, 19]])
+
+    >>> from scipy.linalg import toeplitz, matmul_toeplitz
+    >>> matmul_toeplitz((c, r), x)
+    array([[-20., -80.],
+           [ -7.,  -8.],
+           [  9.,  85.],
+           [ 33., 218.]])
+
+    Check the result by creating the full Toeplitz matrix and
+    multiplying it by ``x``.
+
+    >>> toeplitz(c, r) @ x
+    array([[-20, -80],
+           [ -7,  -8],
+           [  9,  85],
+           [ 33, 218]])
+
+    The full matrix is never formed explicitly, so this routine
+    is suitable for very large Toeplitz matrices.
+
+    >>> n = 1000000
+    >>> matmul_toeplitz([1] + [0]*(n-1), np.ones(n))
+    array([1., 1., 1., ..., 1., 1., 1.])
+
+    """
+
+    from ..fft import fft, ifft, rfft, irfft
+
+    r, c, x, dtype, x_shape = _validate_args_for_toeplitz_ops(
+        c_or_cr, x, check_finite, keep_b_shape=False, enforce_square=False)
+    n, m = x.shape
+
+    T_nrows = len(c)
+    T_ncols = len(r)
+    p = T_nrows + T_ncols - 1  # equivalent to len(embedded_col)
+
+    embedded_col = np.concatenate((c, r[-1:0:-1]))
+
+    if np.iscomplexobj(embedded_col) or np.iscomplexobj(x):
+        fft_mat = fft(embedded_col, axis=0, workers=workers).reshape(-1, 1)
+        fft_x = fft(x, n=p, axis=0, workers=workers)
+
+        mat_times_x = ifft(fft_mat*fft_x, axis=0,
+                           workers=workers)[:T_nrows, :]
+    else:
+        # Real inputs; using rfft is faster
+        fft_mat = rfft(embedded_col, axis=0, workers=workers).reshape(-1, 1)
+        fft_x = rfft(x, n=p, axis=0, workers=workers)
+
+        mat_times_x = irfft(fft_mat*fft_x, axis=0,
+                            workers=workers, n=p)[:T_nrows, :]
+
+    return_shape = (T_nrows,) if len(x_shape) == 1 else (T_nrows, m)
+    return mat_times_x.reshape(*return_shape)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_cythonized_array_utils.pyi

@@ -0,0 +1,16 @@
+from numpy.typing import NDArray
+from typing import Any
+
+def bandwidth(a: NDArray[Any]) -> tuple[int, int]: ...
+
+def issymmetric(
+    a: NDArray[Any],
+    atol: None | float = ...,
+    rtol: None | float = ...,
+) -> bool: ...
+
+def ishermitian(
+    a: NDArray[Any],
+    atol: None | float = ...,
+    rtol: None | float = ...,
+) -> bool: ...

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_decomp_cossin.py

@@ -0,0 +1,221 @@
+from collections.abc import Iterable
+import numpy as np
+
+from scipy._lib._util import _asarray_validated
+from scipy.linalg import block_diag, LinAlgError
+from .lapack import _compute_lwork, get_lapack_funcs
+
+__all__ = ['cossin']
+
+
+def cossin(X, p=None, q=None, separate=False,
+           swap_sign=False, compute_u=True, compute_vh=True):
+    """
+    Compute the cosine-sine (CS) decomposition of an orthogonal/unitary matrix.
+
+    X is an ``(m, m)`` orthogonal/unitary matrix, partitioned as the following
+    where upper left block has the shape of ``(p, q)``::
+
+                                   ┌                   ┐
+                                   │ I  0  0 │ 0  0  0 │
+        ┌           ┐   ┌         ┐│ 0  C  0 │ 0 -S  0 │┌         ┐*
+        │ X11 │ X12 │   │ U1 │    ││ 0  0  0 │ 0  0 -I ││ V1 │    │
+        │ ────┼──── │ = │────┼────││─────────┼─────────││────┼────│
+        │ X21 │ X22 │   │    │ U2 ││ 0  0  0 │ I  0  0 ││    │ V2 │
+        └           ┘   └         ┘│ 0  S  0 │ 0  C  0 │└         ┘
+                                   │ 0  0  I │ 0  0  0 │
+                                   └                   ┘
+
+    ``U1``, ``U2``, ``V1``, ``V2`` are square orthogonal/unitary matrices of
+    dimensions ``(p,p)``, ``(m-p,m-p)``, ``(q,q)``, and ``(m-q,m-q)``
+    respectively, and ``C`` and ``S`` are ``(r, r)`` nonnegative diagonal
+    matrices satisfying ``C^2 + S^2 = I`` where ``r = min(p, m-p, q, m-q)``.
+
+    Moreover, the rank of the identity matrices are ``min(p, q) - r``,
+    ``min(p, m - q) - r``, ``min(m - p, q) - r``, and ``min(m - p, m - q) - r``
+    respectively.
+
+    X can be supplied either by itself and block specifications p, q or its
+    subblocks in an iterable from which the shapes would be derived. See the
+    examples below.
+
+    Parameters
+    ----------
+    X : array_like, iterable
+        complex unitary or real orthogonal matrix to be decomposed, or iterable
+        of subblocks ``X11``, ``X12``, ``X21``, ``X22``, when ``p``, ``q`` are
+        omitted.
+    p : int, optional
+        Number of rows of the upper left block ``X11``, used only when X is
+        given as an array.
+    q : int, optional
+        Number of columns of the upper left block ``X11``, used only when X is
+        given as an array.
+    separate : bool, optional
+        if ``True``, the low level components are returned instead of the
+        matrix factors, i.e. ``(u1,u2)``, ``theta``, ``(v1h,v2h)`` instead of
+        ``u``, ``cs``, ``vh``.
+    swap_sign : bool, optional
+        if ``True``, the ``-S``, ``-I`` block will be the bottom left,
+        otherwise (by default) they will be in the upper right block.
+    compute_u : bool, optional
+        if ``False``, ``u`` won't be computed and an empty array is returned.
+    compute_vh : bool, optional
+        if ``False``, ``vh`` won't be computed and an empty array is returned.
+
+    Returns
+    -------
+    u : ndarray
+        When ``compute_u=True``, contains the block diagonal orthogonal/unitary
+        matrix consisting of the blocks ``U1`` (``p`` x ``p``) and ``U2``
+        (``m-p`` x ``m-p``) orthogonal/unitary matrices. If ``separate=True``,
+        this contains the tuple of ``(U1, U2)``.
+    cs : ndarray
+        The cosine-sine factor with the structure described above.
+         If ``separate=True``, this contains the ``theta`` array containing the
+         angles in radians.
+    vh : ndarray
+        When ``compute_vh=True`, contains the block diagonal orthogonal/unitary
+        matrix consisting of the blocks ``V1H`` (``q`` x ``q``) and ``V2H``
+        (``m-q`` x ``m-q``) orthogonal/unitary matrices. If ``separate=True``,
+        this contains the tuple of ``(V1H, V2H)``.
+
+    References
+    ----------
+    .. [1] Brian D. Sutton. Computing the complete CS decomposition. Numer.
+           Algorithms, 50(1):33-65, 2009.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import cossin
+    >>> from scipy.stats import unitary_group
+    >>> x = unitary_group.rvs(4)
+    >>> u, cs, vdh = cossin(x, p=2, q=2)
+    >>> np.allclose(x, u @ cs @ vdh)
+    True
+
+    Same can be entered via subblocks without the need of ``p`` and ``q``. Also
+    let's skip the computation of ``u``
+
+    >>> ue, cs, vdh = cossin((x[:2, :2], x[:2, 2:], x[2:, :2], x[2:, 2:]),
+    ...                      compute_u=False)
+    >>> print(ue)
+    []
+    >>> np.allclose(x, u @ cs @ vdh)
+    True
+
+    """
+
+    if p or q:
+        p = 1 if p is None else int(p)
+        q = 1 if q is None else int(q)
+        X = _asarray_validated(X, check_finite=True)
+        if not np.equal(*X.shape):
+            raise ValueError("Cosine Sine decomposition only supports square"
+                             f" matrices, got {X.shape}")
+        m = X.shape[0]
+        if p >= m or p <= 0:
+            raise ValueError(f"invalid p={p}, 0<p<{X.shape[0]} must hold")
+        if q >= m or q <= 0:
+            raise ValueError(f"invalid q={q}, 0<q<{X.shape[0]} must hold")
+
+        x11, x12, x21, x22 = X[:p, :q], X[:p, q:], X[p:, :q], X[p:, q:]
+    elif not isinstance(X, Iterable):
+        raise ValueError("When p and q are None, X must be an Iterable"
+                         " containing the subblocks of X")
+    else:
+        if len(X) != 4:
+            raise ValueError("When p and q are None, exactly four arrays"
+                             f" should be in X, got {len(X)}")
+
+        x11, x12, x21, x22 = (np.atleast_2d(x) for x in X)
+        for name, block in zip(["x11", "x12", "x21", "x22"],
+                               [x11, x12, x21, x22]):
+            if block.shape[1] == 0:
+                raise ValueError(f"{name} can't be empty")
+        p, q = x11.shape
+        mmp, mmq = x22.shape
+
+        if x12.shape != (p, mmq):
+            raise ValueError(f"Invalid x12 dimensions: desired {(p, mmq)}, "
+                             f"got {x12.shape}")
+
+        if x21.shape != (mmp, q):
+            raise ValueError(f"Invalid x21 dimensions: desired {(mmp, q)}, "
+                             f"got {x21.shape}")
+
+        if p + mmp != q + mmq:
+            raise ValueError("The subblocks have compatible sizes but "
+                             "don't form a square array (instead they form a"
+                             " {}x{} array). This might be due to missing "
+                             "p, q arguments.".format(p + mmp, q + mmq))
+
+        m = p + mmp
+
+    cplx = any([np.iscomplexobj(x) for x in [x11, x12, x21, x22]])
+    driver = "uncsd" if cplx else "orcsd"
+    csd, csd_lwork = get_lapack_funcs([driver, driver + "_lwork"],
+                                      [x11, x12, x21, x22])
+    lwork = _compute_lwork(csd_lwork, m=m, p=p, q=q)
+    lwork_args = ({'lwork': lwork[0], 'lrwork': lwork[1]} if cplx else
+                  {'lwork': lwork})
+    *_, theta, u1, u2, v1h, v2h, info = csd(x11=x11, x12=x12, x21=x21, x22=x22,
+                                            compute_u1=compute_u,
+                                            compute_u2=compute_u,
+                                            compute_v1t=compute_vh,
+                                            compute_v2t=compute_vh,
+                                            trans=False, signs=swap_sign,
+                                            **lwork_args)
+
+    method_name = csd.typecode + driver
+    if info < 0:
+        raise ValueError(f'illegal value in argument {-info} '
+                         f'of internal {method_name}')
+    if info > 0:
+        raise LinAlgError(f"{method_name} did not converge: {info}")
+
+    if separate:
+        return (u1, u2), theta, (v1h, v2h)
+
+    U = block_diag(u1, u2)
+    VDH = block_diag(v1h, v2h)
+
+    # Construct the middle factor CS
+    c = np.diag(np.cos(theta))
+    s = np.diag(np.sin(theta))
+    r = min(p, q, m - p, m - q)
+    n11 = min(p, q) - r
+    n12 = min(p, m - q) - r
+    n21 = min(m - p, q) - r
+    n22 = min(m - p, m - q) - r
+    Id = np.eye(np.max([n11, n12, n21, n22, r]), dtype=theta.dtype)
+    CS = np.zeros((m, m), dtype=theta.dtype)
+
+    CS[:n11, :n11] = Id[:n11, :n11]
+
+    xs = n11 + r
+    xe = n11 + r + n12
+    ys = n11 + n21 + n22 + 2 * r
+    ye = n11 + n21 + n22 + 2 * r + n12
+    CS[xs: xe, ys:ye] = Id[:n12, :n12] if swap_sign else -Id[:n12, :n12]
+
+    xs = p + n22 + r
+    xe = p + n22 + r + + n21
+    ys = n11 + r
+    ye = n11 + r + n21
+    CS[xs:xe, ys:ye] = -Id[:n21, :n21] if swap_sign else Id[:n21, :n21]
+
+    CS[p:p + n22, q:q + n22] = Id[:n22, :n22]
+    CS[n11:n11 + r, n11:n11 + r] = c
+    CS[p + n22:p + n22 + r, r + n21 + n22:2 * r + n21 + n22] = c
+
+    xs = n11
+    xe = n11 + r
+    ys = n11 + n21 + n22 + r
+    ye = n11 + n21 + n22 + 2 * r
+    CS[xs:xe, ys:ye] = s if swap_sign else -s
+
+    CS[p + n22:p + n22 + r, n11:n11 + r] = -s if swap_sign else s
+
+    return U, CS, VDH

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_decomp_lu.py

@@ -0,0 +1,374 @@
+"""LU decomposition functions."""
+
+from warnings import warn
+
+from numpy import asarray, asarray_chkfinite
+import numpy as np
+from itertools import product
+
+# Local imports
+from ._misc import _datacopied, LinAlgWarning
+from .lapack import get_lapack_funcs
+from ._decomp_lu_cython import lu_dispatcher
+
+lapack_cast_dict = {x: ''.join([y for y in 'fdFD' if np.can_cast(x, y)])
+                    for x in np.typecodes['All']}
+
+__all__ = ['lu', 'lu_solve', 'lu_factor']
+
+
+def lu_factor(a, overwrite_a=False, check_finite=True):
+    """
+    Compute pivoted LU decomposition of a matrix.
+
+    The decomposition is::
+
+        A = P L U
+
+    where P is a permutation matrix, L lower triangular with unit
+    diagonal elements, and U upper triangular.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Matrix to decompose
+    overwrite_a : bool, optional
+        Whether to overwrite data in A (may increase performance)
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    lu : (M, N) ndarray
+        Matrix containing U in its upper triangle, and L in its lower triangle.
+        The unit diagonal elements of L are not stored.
+    piv : (K,) ndarray
+        Pivot indices representing the permutation matrix P:
+        row i of matrix was interchanged with row piv[i].
+        Of shape ``(K,)``, with ``K = min(M, N)``.
+
+    See Also
+    --------
+    lu : gives lu factorization in more user-friendly format
+    lu_solve : solve an equation system using the LU factorization of a matrix
+
+    Notes
+    -----
+    This is a wrapper to the ``*GETRF`` routines from LAPACK. Unlike
+    :func:`lu`, it outputs the L and U factors into a single array
+    and returns pivot indices instead of a permutation matrix.
+
+    While the underlying ``*GETRF`` routines return 1-based pivot indices, the
+    ``piv`` array returned by ``lu_factor`` contains 0-based indices.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import lu_factor
+    >>> A = np.array([[2, 5, 8, 7], [5, 2, 2, 8], [7, 5, 6, 6], [5, 4, 4, 8]])
+    >>> lu, piv = lu_factor(A)
+    >>> piv
+    array([2, 2, 3, 3], dtype=int32)
+
+    Convert LAPACK's ``piv`` array to NumPy index and test the permutation
+
+    >>> def pivot_to_permutation(piv):
+    ...     perm = np.arange(len(piv))
+    ...     for i in range(len(piv)):
+    ...         perm[i], perm[piv[i]] = perm[piv[i]], perm[i]
+    ...     return perm
+    ...
+    >>> p_inv = pivot_to_permutation(piv)
+    >>> p_inv
+    array([2, 0, 3, 1])
+    >>> L, U = np.tril(lu, k=-1) + np.eye(4), np.triu(lu)
+    >>> np.allclose(A[p_inv] - L @ U, np.zeros((4, 4)))
+    True
+
+    The P matrix in P L U is defined by the inverse permutation and
+    can be recovered using argsort:
+
+    >>> p = np.argsort(p_inv)
+    >>> p
+    array([1, 3, 0, 2])
+    >>> np.allclose(A - L[p] @ U, np.zeros((4, 4)))
+    True
+
+    or alternatively:
+
+    >>> P = np.eye(4)[p]
+    >>> np.allclose(A - P @ L @ U, np.zeros((4, 4)))
+    True
+    """
+    if check_finite:
+        a1 = asarray_chkfinite(a)
+    else:
+        a1 = asarray(a)
+    overwrite_a = overwrite_a or (_datacopied(a1, a))
+    getrf, = get_lapack_funcs(('getrf',), (a1,))
+    lu, piv, info = getrf(a1, overwrite_a=overwrite_a)
+    if info < 0:
+        raise ValueError('illegal value in %dth argument of '
+                         'internal getrf (lu_factor)' % -info)
+    if info > 0:
+        warn("Diagonal number %d is exactly zero. Singular matrix." % info,
+             LinAlgWarning, stacklevel=2)
+    return lu, piv
+
+
+def lu_solve(lu_and_piv, b, trans=0, overwrite_b=False, check_finite=True):
+    """Solve an equation system, a x = b, given the LU factorization of a
+
+    Parameters
+    ----------
+    (lu, piv)
+        Factorization of the coefficient matrix a, as given by lu_factor.
+        In particular piv are 0-indexed pivot indices.
+    b : array
+        Right-hand side
+    trans : {0, 1, 2}, optional
+        Type of system to solve:
+
+        =====  =========
+        trans  system
+        =====  =========
+        0      a x   = b
+        1      a^T x = b
+        2      a^H x = b
+        =====  =========
+    overwrite_b : bool, optional
+        Whether to overwrite data in b (may increase performance)
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    x : array
+        Solution to the system
+
+    See Also
+    --------
+    lu_factor : LU factorize a matrix
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import lu_factor, lu_solve
+    >>> A = np.array([[2, 5, 8, 7], [5, 2, 2, 8], [7, 5, 6, 6], [5, 4, 4, 8]])
+    >>> b = np.array([1, 1, 1, 1])
+    >>> lu, piv = lu_factor(A)
+    >>> x = lu_solve((lu, piv), b)
+    >>> np.allclose(A @ x - b, np.zeros((4,)))
+    True
+
+    """
+    (lu, piv) = lu_and_piv
+    if check_finite:
+        b1 = asarray_chkfinite(b)
+    else:
+        b1 = asarray(b)
+    overwrite_b = overwrite_b or _datacopied(b1, b)
+    if lu.shape[0] != b1.shape[0]:
+        raise ValueError(f"Shapes of lu {lu.shape} and b {b1.shape} are incompatible")
+
+    getrs, = get_lapack_funcs(('getrs',), (lu, b1))
+    x, info = getrs(lu, piv, b1, trans=trans, overwrite_b=overwrite_b)
+    if info == 0:
+        return x
+    raise ValueError('illegal value in %dth argument of internal gesv|posv'
+                     % -info)
+
+
+def lu(a, permute_l=False, overwrite_a=False, check_finite=True,
+       p_indices=False):
+    """
+    Compute LU decomposition of a matrix with partial pivoting.
+
+    The decomposition satisfies::
+
+        A = P @ L @ U
+
+    where ``P`` is a permutation matrix, ``L`` lower triangular with unit
+    diagonal elements, and ``U`` upper triangular. If `permute_l` is set to
+    ``True`` then ``L`` is returned already permuted and hence satisfying
+    ``A = L @ U``.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Array to decompose
+    permute_l : bool, optional
+        Perform the multiplication P*L (Default: do not permute)
+    overwrite_a : bool, optional
+        Whether to overwrite data in a (may improve performance)
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+    p_indices : bool, optional
+        If ``True`` the permutation information is returned as row indices.
+        The default is ``False`` for backwards-compatibility reasons.
+
+    Returns
+    -------
+    **(If `permute_l` is ``False``)**
+
+    p : (..., M, M) ndarray
+        Permutation arrays or vectors depending on `p_indices`
+    l : (..., M, K) ndarray
+        Lower triangular or trapezoidal array with unit diagonal.
+        ``K = min(M, N)``
+    u : (..., K, N) ndarray
+        Upper triangular or trapezoidal array
+
+    **(If `permute_l` is ``True``)**
+
+    pl : (..., M, K) ndarray
+        Permuted L matrix.
+        ``K = min(M, N)``
+    u : (..., K, N) ndarray
+        Upper triangular or trapezoidal array
+
+    Notes
+    -----
+    Permutation matrices are costly since they are nothing but row reorder of
+    ``L`` and hence indices are strongly recommended to be used instead if the
+    permutation is required. The relation in the 2D case then becomes simply
+    ``A = L[P, :] @ U``. In higher dimensions, it is better to use `permute_l`
+    to avoid complicated indexing tricks.
+
+    In 2D case, if one has the indices however, for some reason, the
+    permutation matrix is still needed then it can be constructed by
+    ``np.eye(M)[P, :]``.
+
+    Examples
+    --------
+
+    >>> import numpy as np
+    >>> from scipy.linalg import lu
+    >>> A = np.array([[2, 5, 8, 7], [5, 2, 2, 8], [7, 5, 6, 6], [5, 4, 4, 8]])
+    >>> p, l, u = lu(A)
+    >>> np.allclose(A, p @ l @ u)
+    True
+    >>> p  # Permutation matrix
+    array([[0., 1., 0., 0.],  # Row index 1
+           [0., 0., 0., 1.],  # Row index 3
+           [1., 0., 0., 0.],  # Row index 0
+           [0., 0., 1., 0.]]) # Row index 2
+    >>> p, _, _ = lu(A, p_indices=True)
+    >>> p
+    array([1, 3, 0, 2])  # as given by row indices above
+    >>> np.allclose(A, l[p, :] @ u)
+    True
+
+    We can also use nd-arrays, for example, a demonstration with 4D array:
+
+    >>> rng = np.random.default_rng()
+    >>> A = rng.uniform(low=-4, high=4, size=[3, 2, 4, 8])
+    >>> p, l, u = lu(A)
+    >>> p.shape, l.shape, u.shape
+    ((3, 2, 4, 4), (3, 2, 4, 4), (3, 2, 4, 8))
+    >>> np.allclose(A, p @ l @ u)
+    True
+    >>> PL, U = lu(A, permute_l=True)
+    >>> np.allclose(A, PL @ U)
+    True
+
+    """
+    a1 = np.asarray_chkfinite(a) if check_finite else np.asarray(a)
+    if a1.ndim < 2:
+        raise ValueError('The input array must be at least two-dimensional.')
+
+    # Also check if dtype is LAPACK compatible
+    if a1.dtype.char not in 'fdFD':
+        dtype_char = lapack_cast_dict[a1.dtype.char]
+        if not dtype_char:  # No casting possible
+            raise TypeError(f'The dtype {a1.dtype} cannot be cast '
+                            'to float(32, 64) or complex(64, 128).')
+
+        a1 = a1.astype(dtype_char[0])  # makes a copy, free to scratch
+        overwrite_a = True
+
+    *nd, m, n = a1.shape
+    k = min(m, n)
+    real_dchar = 'f' if a1.dtype.char in 'fF' else 'd'
+
+    # Empty input
+    if min(*a1.shape) == 0:
+        if permute_l:
+            PL = np.empty(shape=[*nd, m, k], dtype=a1.dtype)
+            U = np.empty(shape=[*nd, k, n], dtype=a1.dtype)
+            return PL, U
+        else:
+            P = (np.empty([*nd, 0], dtype=np.int32) if p_indices else
+                 np.empty([*nd, 0, 0], dtype=real_dchar))
+            L = np.empty(shape=[*nd, m, k], dtype=a1.dtype)
+            U = np.empty(shape=[*nd, k, n], dtype=a1.dtype)
+            return P, L, U
+
+    # Scalar case
+    if a1.shape[-2:] == (1, 1):
+        if permute_l:
+            return np.ones_like(a1), (a1 if overwrite_a else a1.copy())
+        else:
+            P = (np.zeros(shape=[*nd, m], dtype=int) if p_indices
+                 else np.ones_like(a1))
+            return P, np.ones_like(a1), (a1 if overwrite_a else a1.copy())
+
+    # Then check overwrite permission
+    if not _datacopied(a1, a):  # "a"  still alive through "a1"
+        if not overwrite_a:
+            # Data belongs to "a" so make a copy
+            a1 = a1.copy(order='C')
+        #  else: Do nothing we'll use "a" if possible
+    # else:  a1 has its own data thus free to scratch
+
+    # Then layout checks, might happen that overwrite is allowed but original
+    # array was read-only or non-contiguous.
+
+    if not (a1.flags['C_CONTIGUOUS'] and a1.flags['WRITEABLE']):
+        a1 = a1.copy(order='C')
+
+    if not nd:  # 2D array
+
+        p = np.empty(m, dtype=np.int32)
+        u = np.zeros([k, k], dtype=a1.dtype)
+        lu_dispatcher(a1, u, p, permute_l)
+        P, L, U = (p, a1, u) if m > n else (p, u, a1)
+
+    else:  # Stacked array
+
+        # Prepare the contiguous data holders
+        P = np.empty([*nd, m], dtype=np.int32)  # perm vecs
+
+        if m > n:  # Tall arrays, U will be created
+            U = np.zeros([*nd, k, k], dtype=a1.dtype)
+            for ind in product(*[range(x) for x in a1.shape[:-2]]):
+                lu_dispatcher(a1[ind], U[ind], P[ind], permute_l)
+            L = a1
+
+        else:  # Fat arrays, L will be created
+            L = np.zeros([*nd, k, k], dtype=a1.dtype)
+            for ind in product(*[range(x) for x in a1.shape[:-2]]):
+                lu_dispatcher(a1[ind], L[ind], P[ind], permute_l)
+            U = a1
+
+    # Convert permutation vecs to permutation arrays
+    # permute_l=False needed to enter here to avoid wasted efforts
+    if (not p_indices) and (not permute_l):
+        if nd:
+            Pa = np.zeros([*nd, m, m], dtype=real_dchar)
+            # An unreadable index hack - One-hot encoding for perm matrices
+            nd_ix = np.ix_(*([np.arange(x) for x in nd]+[np.arange(m)]))
+            Pa[(*nd_ix, P)] = 1
+            P = Pa
+        else:  # 2D case
+            Pa = np.zeros([m, m], dtype=real_dchar)
+            Pa[np.arange(m), P] = 1
+            P = Pa
+
+    return (L, U) if permute_l else (P, L, U)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_decomp_lu_cython.pyi

@@ -0,0 +1,6 @@
+from numpy.typing import NDArray
+from typing import Any
+
+def lu_decompose(a: NDArray[Any], lu: NDArray[Any], perm: NDArray[Any], permute_l: bool) -> None: ...  # noqa: E501
+
+def lu_dispatcher(a: NDArray[Any], lu: NDArray[Any], perm: NDArray[Any], permute_l: bool) -> None: ...  # noqa: E501

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_decomp_polar.py

@@ -0,0 +1,111 @@
+import numpy as np
+from scipy.linalg import svd
+
+
+__all__ = ['polar']
+
+
+def polar(a, side="right"):
+    """
+    Compute the polar decomposition.
+
+    Returns the factors of the polar decomposition [1]_ `u` and `p` such
+    that ``a = up`` (if `side` is "right") or ``a = pu`` (if `side` is
+    "left"), where `p` is positive semidefinite. Depending on the shape
+    of `a`, either the rows or columns of `u` are orthonormal. When `a`
+    is a square array, `u` is a square unitary array. When `a` is not
+    square, the "canonical polar decomposition" [2]_ is computed.
+
+    Parameters
+    ----------
+    a : (m, n) array_like
+        The array to be factored.
+    side : {'left', 'right'}, optional
+        Determines whether a right or left polar decomposition is computed.
+        If `side` is "right", then ``a = up``.  If `side` is "left",  then
+        ``a = pu``.  The default is "right".
+
+    Returns
+    -------
+    u : (m, n) ndarray
+        If `a` is square, then `u` is unitary. If m > n, then the columns
+        of `a` are orthonormal, and if m < n, then the rows of `u` are
+        orthonormal.
+    p : ndarray
+        `p` is Hermitian positive semidefinite. If `a` is nonsingular, `p`
+        is positive definite. The shape of `p` is (n, n) or (m, m), depending
+        on whether `side` is "right" or "left", respectively.
+
+    References
+    ----------
+    .. [1] R. A. Horn and C. R. Johnson, "Matrix Analysis", Cambridge
+           University Press, 1985.
+    .. [2] N. J. Higham, "Functions of Matrices: Theory and Computation",
+           SIAM, 2008.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import polar
+    >>> a = np.array([[1, -1], [2, 4]])
+    >>> u, p = polar(a)
+    >>> u
+    array([[ 0.85749293, -0.51449576],
+           [ 0.51449576,  0.85749293]])
+    >>> p
+    array([[ 1.88648444,  1.2004901 ],
+           [ 1.2004901 ,  3.94446746]])
+
+    A non-square example, with m < n:
+
+    >>> b = np.array([[0.5, 1, 2], [1.5, 3, 4]])
+    >>> u, p = polar(b)
+    >>> u
+    array([[-0.21196618, -0.42393237,  0.88054056],
+           [ 0.39378971,  0.78757942,  0.4739708 ]])
+    >>> p
+    array([[ 0.48470147,  0.96940295,  1.15122648],
+           [ 0.96940295,  1.9388059 ,  2.30245295],
+           [ 1.15122648,  2.30245295,  3.65696431]])
+    >>> u.dot(p)   # Verify the decomposition.
+    array([[ 0.5,  1. ,  2. ],
+           [ 1.5,  3. ,  4. ]])
+    >>> u.dot(u.T)   # The rows of u are orthonormal.
+    array([[  1.00000000e+00,  -2.07353665e-17],
+           [ -2.07353665e-17,   1.00000000e+00]])
+
+    Another non-square example, with m > n:
+
+    >>> c = b.T
+    >>> u, p = polar(c)
+    >>> u
+    array([[-0.21196618,  0.39378971],
+           [-0.42393237,  0.78757942],
+           [ 0.88054056,  0.4739708 ]])
+    >>> p
+    array([[ 1.23116567,  1.93241587],
+           [ 1.93241587,  4.84930602]])
+    >>> u.dot(p)   # Verify the decomposition.
+    array([[ 0.5,  1.5],
+           [ 1. ,  3. ],
+           [ 2. ,  4. ]])
+    >>> u.T.dot(u)  # The columns of u are orthonormal.
+    array([[  1.00000000e+00,  -1.26363763e-16],
+           [ -1.26363763e-16,   1.00000000e+00]])
+
+    """
+    if side not in ['right', 'left']:
+        raise ValueError("`side` must be either 'right' or 'left'")
+    a = np.asarray(a)
+    if a.ndim != 2:
+        raise ValueError("`a` must be a 2-D array.")
+
+    w, s, vh = svd(a, full_matrices=False)
+    u = w.dot(vh)
+    if side == 'right':
+        # a = up
+        p = (vh.T.conj() * s).dot(vh)
+    else:
+        # a = pu
+        p = (w * s).dot(w.T.conj())
+    return u, p

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_decomp_qr.py

@@ -0,0 +1,430 @@
+"""QR decomposition functions."""
+import numpy
+
+# Local imports
+from .lapack import get_lapack_funcs
+from ._misc import _datacopied
+
+__all__ = ['qr', 'qr_multiply', 'rq']
+
+
+def safecall(f, name, *args, **kwargs):
+    """Call a LAPACK routine, determining lwork automatically and handling
+    error return values"""
+    lwork = kwargs.get("lwork", None)
+    if lwork in (None, -1):
+        kwargs['lwork'] = -1
+        ret = f(*args, **kwargs)
+        kwargs['lwork'] = ret[-2][0].real.astype(numpy.int_)
+    ret = f(*args, **kwargs)
+    if ret[-1] < 0:
+        raise ValueError("illegal value in %dth argument of internal %s"
+                         % (-ret[-1], name))
+    return ret[:-2]
+
+
+def qr(a, overwrite_a=False, lwork=None, mode='full', pivoting=False,
+       check_finite=True):
+    """
+    Compute QR decomposition of a matrix.
+
+    Calculate the decomposition ``A = Q R`` where Q is unitary/orthogonal
+    and R upper triangular.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Matrix to be decomposed
+    overwrite_a : bool, optional
+        Whether data in `a` is overwritten (may improve performance if
+        `overwrite_a` is set to True by reusing the existing input data
+        structure rather than creating a new one.)
+    lwork : int, optional
+        Work array size, lwork >= a.shape[1]. If None or -1, an optimal size
+        is computed.
+    mode : {'full', 'r', 'economic', 'raw'}, optional
+        Determines what information is to be returned: either both Q and R
+        ('full', default), only R ('r') or both Q and R but computed in
+        economy-size ('economic', see Notes). The final option 'raw'
+        (added in SciPy 0.11) makes the function return two matrices
+        (Q, TAU) in the internal format used by LAPACK.
+    pivoting : bool, optional
+        Whether or not factorization should include pivoting for rank-revealing
+        qr decomposition. If pivoting, compute the decomposition
+        ``A[:, P] = Q @ R`` as above, but where P is chosen such that the 
+        diagonal of R is non-increasing.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    Q : float or complex ndarray
+        Of shape (M, M), or (M, K) for ``mode='economic'``. Not returned
+        if ``mode='r'``. Replaced by tuple ``(Q, TAU)`` if ``mode='raw'``.
+    R : float or complex ndarray
+        Of shape (M, N), or (K, N) for ``mode in ['economic', 'raw']``.
+        ``K = min(M, N)``.
+    P : int ndarray
+        Of shape (N,) for ``pivoting=True``. Not returned if
+        ``pivoting=False``.
+
+    Raises
+    ------
+    LinAlgError
+        Raised if decomposition fails
+
+    Notes
+    -----
+    This is an interface to the LAPACK routines dgeqrf, zgeqrf,
+    dorgqr, zungqr, dgeqp3, and zgeqp3.
+
+    If ``mode=economic``, the shapes of Q and R are (M, K) and (K, N) instead
+    of (M,M) and (M,N), with ``K=min(M,N)``.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> rng = np.random.default_rng()
+    >>> a = rng.standard_normal((9, 6))
+
+    >>> q, r = linalg.qr(a)
+    >>> np.allclose(a, np.dot(q, r))
+    True
+    >>> q.shape, r.shape
+    ((9, 9), (9, 6))
+
+    >>> r2 = linalg.qr(a, mode='r')
+    >>> np.allclose(r, r2)
+    True
+
+    >>> q3, r3 = linalg.qr(a, mode='economic')
+    >>> q3.shape, r3.shape
+    ((9, 6), (6, 6))
+
+    >>> q4, r4, p4 = linalg.qr(a, pivoting=True)
+    >>> d = np.abs(np.diag(r4))
+    >>> np.all(d[1:] <= d[:-1])
+    True
+    >>> np.allclose(a[:, p4], np.dot(q4, r4))
+    True
+    >>> q4.shape, r4.shape, p4.shape
+    ((9, 9), (9, 6), (6,))
+
+    >>> q5, r5, p5 = linalg.qr(a, mode='economic', pivoting=True)
+    >>> q5.shape, r5.shape, p5.shape
+    ((9, 6), (6, 6), (6,))
+
+    """
+    # 'qr' was the old default, equivalent to 'full'. Neither 'full' nor
+    # 'qr' are used below.
+    # 'raw' is used internally by qr_multiply
+    if mode not in ['full', 'qr', 'r', 'economic', 'raw']:
+        raise ValueError("Mode argument should be one of ['full', 'r',"
+                         "'economic', 'raw']")
+
+    if check_finite:
+        a1 = numpy.asarray_chkfinite(a)
+    else:
+        a1 = numpy.asarray(a)
+    if len(a1.shape) != 2:
+        raise ValueError("expected a 2-D array")
+    M, N = a1.shape
+    overwrite_a = overwrite_a or (_datacopied(a1, a))
+
+    if pivoting:
+        geqp3, = get_lapack_funcs(('geqp3',), (a1,))
+        qr, jpvt, tau = safecall(geqp3, "geqp3", a1, overwrite_a=overwrite_a)
+        jpvt -= 1  # geqp3 returns a 1-based index array, so subtract 1
+    else:
+        geqrf, = get_lapack_funcs(('geqrf',), (a1,))
+        qr, tau = safecall(geqrf, "geqrf", a1, lwork=lwork,
+                           overwrite_a=overwrite_a)
+
+    if mode not in ['economic', 'raw'] or M < N:
+        R = numpy.triu(qr)
+    else:
+        R = numpy.triu(qr[:N, :])
+
+    if pivoting:
+        Rj = R, jpvt
+    else:
+        Rj = R,
+
+    if mode == 'r':
+        return Rj
+    elif mode == 'raw':
+        return ((qr, tau),) + Rj
+
+    gor_un_gqr, = get_lapack_funcs(('orgqr',), (qr,))
+
+    if M < N:
+        Q, = safecall(gor_un_gqr, "gorgqr/gungqr", qr[:, :M], tau,
+                      lwork=lwork, overwrite_a=1)
+    elif mode == 'economic':
+        Q, = safecall(gor_un_gqr, "gorgqr/gungqr", qr, tau, lwork=lwork,
+                      overwrite_a=1)
+    else:
+        t = qr.dtype.char
+        qqr = numpy.empty((M, M), dtype=t)
+        qqr[:, :N] = qr
+        Q, = safecall(gor_un_gqr, "gorgqr/gungqr", qqr, tau, lwork=lwork,
+                      overwrite_a=1)
+
+    return (Q,) + Rj
+
+
+def qr_multiply(a, c, mode='right', pivoting=False, conjugate=False,
+                overwrite_a=False, overwrite_c=False):
+    """
+    Calculate the QR decomposition and multiply Q with a matrix.
+
+    Calculate the decomposition ``A = Q R`` where Q is unitary/orthogonal
+    and R upper triangular. Multiply Q with a vector or a matrix c.
+
+    Parameters
+    ----------
+    a : (M, N), array_like
+        Input array
+    c : array_like
+        Input array to be multiplied by ``q``.
+    mode : {'left', 'right'}, optional
+        ``Q @ c`` is returned if mode is 'left', ``c @ Q`` is returned if
+        mode is 'right'.
+        The shape of c must be appropriate for the matrix multiplications,
+        if mode is 'left', ``min(a.shape) == c.shape[0]``,
+        if mode is 'right', ``a.shape[0] == c.shape[1]``.
+    pivoting : bool, optional
+        Whether or not factorization should include pivoting for rank-revealing
+        qr decomposition, see the documentation of qr.
+    conjugate : bool, optional
+        Whether Q should be complex-conjugated. This might be faster
+        than explicit conjugation.
+    overwrite_a : bool, optional
+        Whether data in a is overwritten (may improve performance)
+    overwrite_c : bool, optional
+        Whether data in c is overwritten (may improve performance).
+        If this is used, c must be big enough to keep the result,
+        i.e. ``c.shape[0]`` = ``a.shape[0]`` if mode is 'left'.
+
+    Returns
+    -------
+    CQ : ndarray
+        The product of ``Q`` and ``c``.
+    R : (K, N), ndarray
+        R array of the resulting QR factorization where ``K = min(M, N)``.
+    P : (N,) ndarray
+        Integer pivot array. Only returned when ``pivoting=True``.
+
+    Raises
+    ------
+    LinAlgError
+        Raised if QR decomposition fails.
+
+    Notes
+    -----
+    This is an interface to the LAPACK routines ``?GEQRF``, ``?ORMQR``,
+    ``?UNMQR``, and ``?GEQP3``.
+
+    .. versionadded:: 0.11.0
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import qr_multiply, qr
+    >>> A = np.array([[1, 3, 3], [2, 3, 2], [2, 3, 3], [1, 3, 2]])
+    >>> qc, r1, piv1 = qr_multiply(A, 2*np.eye(4), pivoting=1)
+    >>> qc
+    array([[-1.,  1., -1.],
+           [-1., -1.,  1.],
+           [-1., -1., -1.],
+           [-1.,  1.,  1.]])
+    >>> r1
+    array([[-6., -3., -5.            ],
+           [ 0., -1., -1.11022302e-16],
+           [ 0.,  0., -1.            ]])
+    >>> piv1
+    array([1, 0, 2], dtype=int32)
+    >>> q2, r2, piv2 = qr(A, mode='economic', pivoting=1)
+    >>> np.allclose(2*q2 - qc, np.zeros((4, 3)))
+    True
+
+    """
+    if mode not in ['left', 'right']:
+        raise ValueError("Mode argument can only be 'left' or 'right' but "
+                         f"not '{mode}'")
+    c = numpy.asarray_chkfinite(c)
+    if c.ndim < 2:
+        onedim = True
+        c = numpy.atleast_2d(c)
+        if mode == "left":
+            c = c.T
+    else:
+        onedim = False
+
+    a = numpy.atleast_2d(numpy.asarray(a))  # chkfinite done in qr
+    M, N = a.shape
+
+    if mode == 'left':
+        if c.shape[0] != min(M, N + overwrite_c*(M-N)):
+            raise ValueError('Array shapes are not compatible for Q @ c'
+                             f' operation: {a.shape} vs {c.shape}')
+    else:
+        if M != c.shape[1]:
+            raise ValueError('Array shapes are not compatible for c @ Q'
+                             f' operation: {c.shape} vs {a.shape}')
+
+    raw = qr(a, overwrite_a, None, "raw", pivoting)
+    Q, tau = raw[0]
+
+    gor_un_mqr, = get_lapack_funcs(('ormqr',), (Q,))
+    if gor_un_mqr.typecode in ('s', 'd'):
+        trans = "T"
+    else:
+        trans = "C"
+
+    Q = Q[:, :min(M, N)]
+    if M > N and mode == "left" and not overwrite_c:
+        if conjugate:
+            cc = numpy.zeros((c.shape[1], M), dtype=c.dtype, order="F")
+            cc[:, :N] = c.T
+        else:
+            cc = numpy.zeros((M, c.shape[1]), dtype=c.dtype, order="F")
+            cc[:N, :] = c
+            trans = "N"
+        if conjugate:
+            lr = "R"
+        else:
+            lr = "L"
+        overwrite_c = True
+    elif c.flags["C_CONTIGUOUS"] and trans == "T" or conjugate:
+        cc = c.T
+        if mode == "left":
+            lr = "R"
+        else:
+            lr = "L"
+    else:
+        trans = "N"
+        cc = c
+        if mode == "left":
+            lr = "L"
+        else:
+            lr = "R"
+    cQ, = safecall(gor_un_mqr, "gormqr/gunmqr", lr, trans, Q, tau, cc,
+                   overwrite_c=overwrite_c)
+    if trans != "N":
+        cQ = cQ.T
+    if mode == "right":
+        cQ = cQ[:, :min(M, N)]
+    if onedim:
+        cQ = cQ.ravel()
+
+    return (cQ,) + raw[1:]
+
+
+def rq(a, overwrite_a=False, lwork=None, mode='full', check_finite=True):
+    """
+    Compute RQ decomposition of a matrix.
+
+    Calculate the decomposition ``A = R Q`` where Q is unitary/orthogonal
+    and R upper triangular.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Matrix to be decomposed
+    overwrite_a : bool, optional
+        Whether data in a is overwritten (may improve performance)
+    lwork : int, optional
+        Work array size, lwork >= a.shape[1]. If None or -1, an optimal size
+        is computed.
+    mode : {'full', 'r', 'economic'}, optional
+        Determines what information is to be returned: either both Q and R
+        ('full', default), only R ('r') or both Q and R but computed in
+        economy-size ('economic', see Notes).
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    R : float or complex ndarray
+        Of shape (M, N) or (M, K) for ``mode='economic'``. ``K = min(M, N)``.
+    Q : float or complex ndarray
+        Of shape (N, N) or (K, N) for ``mode='economic'``. Not returned
+        if ``mode='r'``.
+
+    Raises
+    ------
+    LinAlgError
+        If decomposition fails.
+
+    Notes
+    -----
+    This is an interface to the LAPACK routines sgerqf, dgerqf, cgerqf, zgerqf,
+    sorgrq, dorgrq, cungrq and zungrq.
+
+    If ``mode=economic``, the shapes of Q and R are (K, N) and (M, K) instead
+    of (N,N) and (M,N), with ``K=min(M,N)``.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> rng = np.random.default_rng()
+    >>> a = rng.standard_normal((6, 9))
+    >>> r, q = linalg.rq(a)
+    >>> np.allclose(a, r @ q)
+    True
+    >>> r.shape, q.shape
+    ((6, 9), (9, 9))
+    >>> r2 = linalg.rq(a, mode='r')
+    >>> np.allclose(r, r2)
+    True
+    >>> r3, q3 = linalg.rq(a, mode='economic')
+    >>> r3.shape, q3.shape
+    ((6, 6), (6, 9))
+
+    """
+    if mode not in ['full', 'r', 'economic']:
+        raise ValueError(
+                 "Mode argument should be one of ['full', 'r', 'economic']")
+
+    if check_finite:
+        a1 = numpy.asarray_chkfinite(a)
+    else:
+        a1 = numpy.asarray(a)
+    if len(a1.shape) != 2:
+        raise ValueError('expected matrix')
+    M, N = a1.shape
+    overwrite_a = overwrite_a or (_datacopied(a1, a))
+
+    gerqf, = get_lapack_funcs(('gerqf',), (a1,))
+    rq, tau = safecall(gerqf, 'gerqf', a1, lwork=lwork,
+                       overwrite_a=overwrite_a)
+    if not mode == 'economic' or N < M:
+        R = numpy.triu(rq, N-M)
+    else:
+        R = numpy.triu(rq[-M:, -M:])
+
+    if mode == 'r':
+        return R
+
+    gor_un_grq, = get_lapack_funcs(('orgrq',), (rq,))
+
+    if N < M:
+        Q, = safecall(gor_un_grq, "gorgrq/gungrq", rq[-N:], tau, lwork=lwork,
+                      overwrite_a=1)
+    elif mode == 'economic':
+        Q, = safecall(gor_un_grq, "gorgrq/gungrq", rq, tau, lwork=lwork,
+                      overwrite_a=1)
+    else:
+        rq1 = numpy.empty((N, N), dtype=rq.dtype)
+        rq1[-M:] = rq
+        Q, = safecall(gor_un_grq, "gorgrq/gungrq", rq1, tau, lwork=lwork,
+                      overwrite_a=1)
+
+    return R, Q

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_decomp_svd.py

@@ -0,0 +1,517 @@
+"""SVD decomposition functions."""
+import numpy
+from numpy import zeros, r_, diag, dot, arccos, arcsin, where, clip
+
+# Local imports.
+from ._misc import LinAlgError, _datacopied
+from .lapack import get_lapack_funcs, _compute_lwork
+from ._decomp import _asarray_validated
+
+__all__ = ['svd', 'svdvals', 'diagsvd', 'orth', 'subspace_angles', 'null_space']
+
+
+def svd(a, full_matrices=True, compute_uv=True, overwrite_a=False,
+        check_finite=True, lapack_driver='gesdd'):
+    """
+    Singular Value Decomposition.
+
+    Factorizes the matrix `a` into two unitary matrices ``U`` and ``Vh``, and
+    a 1-D array ``s`` of singular values (real, non-negative) such that
+    ``a == U @ S @ Vh``, where ``S`` is a suitably shaped matrix of zeros with
+    main diagonal ``s``.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Matrix to decompose.
+    full_matrices : bool, optional
+        If True (default), `U` and `Vh` are of shape ``(M, M)``, ``(N, N)``.
+        If False, the shapes are ``(M, K)`` and ``(K, N)``, where
+        ``K = min(M, N)``.
+    compute_uv : bool, optional
+        Whether to compute also ``U`` and ``Vh`` in addition to ``s``.
+        Default is True.
+    overwrite_a : bool, optional
+        Whether to overwrite `a`; may improve performance.
+        Default is False.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+    lapack_driver : {'gesdd', 'gesvd'}, optional
+        Whether to use the more efficient divide-and-conquer approach
+        (``'gesdd'``) or general rectangular approach (``'gesvd'``)
+        to compute the SVD. MATLAB and Octave use the ``'gesvd'`` approach.
+        Default is ``'gesdd'``.
+
+        .. versionadded:: 0.18
+
+    Returns
+    -------
+    U : ndarray
+        Unitary matrix having left singular vectors as columns.
+        Of shape ``(M, M)`` or ``(M, K)``, depending on `full_matrices`.
+    s : ndarray
+        The singular values, sorted in non-increasing order.
+        Of shape (K,), with ``K = min(M, N)``.
+    Vh : ndarray
+        Unitary matrix having right singular vectors as rows.
+        Of shape ``(N, N)`` or ``(K, N)`` depending on `full_matrices`.
+
+    For ``compute_uv=False``, only ``s`` is returned.
+
+    Raises
+    ------
+    LinAlgError
+        If SVD computation does not converge.
+
+    See Also
+    --------
+    svdvals : Compute singular values of a matrix.
+    diagsvd : Construct the Sigma matrix, given the vector s.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> rng = np.random.default_rng()
+    >>> m, n = 9, 6
+    >>> a = rng.standard_normal((m, n)) + 1.j*rng.standard_normal((m, n))
+    >>> U, s, Vh = linalg.svd(a)
+    >>> U.shape,  s.shape, Vh.shape
+    ((9, 9), (6,), (6, 6))
+
+    Reconstruct the original matrix from the decomposition:
+
+    >>> sigma = np.zeros((m, n))
+    >>> for i in range(min(m, n)):
+    ...     sigma[i, i] = s[i]
+    >>> a1 = np.dot(U, np.dot(sigma, Vh))
+    >>> np.allclose(a, a1)
+    True
+
+    Alternatively, use ``full_matrices=False`` (notice that the shape of
+    ``U`` is then ``(m, n)`` instead of ``(m, m)``):
+
+    >>> U, s, Vh = linalg.svd(a, full_matrices=False)
+    >>> U.shape, s.shape, Vh.shape
+    ((9, 6), (6,), (6, 6))
+    >>> S = np.diag(s)
+    >>> np.allclose(a, np.dot(U, np.dot(S, Vh)))
+    True
+
+    >>> s2 = linalg.svd(a, compute_uv=False)
+    >>> np.allclose(s, s2)
+    True
+
+    """
+    a1 = _asarray_validated(a, check_finite=check_finite)
+    if len(a1.shape) != 2:
+        raise ValueError('expected matrix')
+    m, n = a1.shape
+    overwrite_a = overwrite_a or (_datacopied(a1, a))
+
+    if not isinstance(lapack_driver, str):
+        raise TypeError('lapack_driver must be a string')
+    if lapack_driver not in ('gesdd', 'gesvd'):
+        message = f'lapack_driver must be "gesdd" or "gesvd", not "{lapack_driver}"'
+        raise ValueError(message)
+
+    if lapack_driver == 'gesdd' and compute_uv:
+        # XXX: revisit int32 when ILP64 lapack becomes a thing
+        max_mn, min_mn = (m, n) if m > n else (n, m)
+        if full_matrices:
+            if max_mn*max_mn > numpy.iinfo(numpy.int32).max:
+                raise ValueError(f"Indexing a matrix size {max_mn} x {max_mn} "
+                                  " would incur integer overflow in LAPACK.")
+        else:
+            sz = max(m * min_mn, n * min_mn)
+            if max(m * min_mn, n * min_mn) > numpy.iinfo(numpy.int32).max:
+                raise ValueError(f"Indexing a matrix of {sz} elements would "
+                                  "incur an in integer overflow in LAPACK.")
+
+    funcs = (lapack_driver, lapack_driver + '_lwork')
+    gesXd, gesXd_lwork = get_lapack_funcs(funcs, (a1,), ilp64='preferred')
+
+    # compute optimal lwork
+    lwork = _compute_lwork(gesXd_lwork, a1.shape[0], a1.shape[1],
+                           compute_uv=compute_uv, full_matrices=full_matrices)
+
+    # perform decomposition
+    u, s, v, info = gesXd(a1, compute_uv=compute_uv, lwork=lwork,
+                          full_matrices=full_matrices, overwrite_a=overwrite_a)
+
+    if info > 0:
+        raise LinAlgError("SVD did not converge")
+    if info < 0:
+        raise ValueError('illegal value in %dth argument of internal gesdd'
+                         % -info)
+    if compute_uv:
+        return u, s, v
+    else:
+        return s
+
+
+def svdvals(a, overwrite_a=False, check_finite=True):
+    """
+    Compute singular values of a matrix.
+
+    Parameters
+    ----------
+    a : (M, N) array_like
+        Matrix to decompose.
+    overwrite_a : bool, optional
+        Whether to overwrite `a`; may improve performance.
+        Default is False.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    s : (min(M, N),) ndarray
+        The singular values, sorted in decreasing order.
+
+    Raises
+    ------
+    LinAlgError
+        If SVD computation does not converge.
+
+    See Also
+    --------
+    svd : Compute the full singular value decomposition of a matrix.
+    diagsvd : Construct the Sigma matrix, given the vector s.
+
+    Notes
+    -----
+    ``svdvals(a)`` only differs from ``svd(a, compute_uv=False)`` by its
+    handling of the edge case of empty ``a``, where it returns an
+    empty sequence:
+
+    >>> import numpy as np
+    >>> a = np.empty((0, 2))
+    >>> from scipy.linalg import svdvals
+    >>> svdvals(a)
+    array([], dtype=float64)
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import svdvals
+    >>> m = np.array([[1.0, 0.0],
+    ...               [2.0, 3.0],
+    ...               [1.0, 1.0],
+    ...               [0.0, 2.0],
+    ...               [1.0, 0.0]])
+    >>> svdvals(m)
+    array([ 4.28091555,  1.63516424])
+
+    We can verify the maximum singular value of `m` by computing the maximum
+    length of `m.dot(u)` over all the unit vectors `u` in the (x,y) plane.
+    We approximate "all" the unit vectors with a large sample. Because
+    of linearity, we only need the unit vectors with angles in [0, pi].
+
+    >>> t = np.linspace(0, np.pi, 2000)
+    >>> u = np.array([np.cos(t), np.sin(t)])
+    >>> np.linalg.norm(m.dot(u), axis=0).max()
+    4.2809152422538475
+
+    `p` is a projection matrix with rank 1. With exact arithmetic,
+    its singular values would be [1, 0, 0, 0].
+
+    >>> v = np.array([0.1, 0.3, 0.9, 0.3])
+    >>> p = np.outer(v, v)
+    >>> svdvals(p)
+    array([  1.00000000e+00,   2.02021698e-17,   1.56692500e-17,
+             8.15115104e-34])
+
+    The singular values of an orthogonal matrix are all 1. Here, we
+    create a random orthogonal matrix by using the `rvs()` method of
+    `scipy.stats.ortho_group`.
+
+    >>> from scipy.stats import ortho_group
+    >>> orth = ortho_group.rvs(4)
+    >>> svdvals(orth)
+    array([ 1.,  1.,  1.,  1.])
+
+    """
+    a = _asarray_validated(a, check_finite=check_finite)
+    if a.size:
+        return svd(a, compute_uv=0, overwrite_a=overwrite_a,
+                   check_finite=False)
+    elif len(a.shape) != 2:
+        raise ValueError('expected matrix')
+    else:
+        return numpy.empty(0)
+
+
+def diagsvd(s, M, N):
+    """
+    Construct the sigma matrix in SVD from singular values and size M, N.
+
+    Parameters
+    ----------
+    s : (M,) or (N,) array_like
+        Singular values
+    M : int
+        Size of the matrix whose singular values are `s`.
+    N : int
+        Size of the matrix whose singular values are `s`.
+
+    Returns
+    -------
+    S : (M, N) ndarray
+        The S-matrix in the singular value decomposition
+
+    See Also
+    --------
+    svd : Singular value decomposition of a matrix
+    svdvals : Compute singular values of a matrix.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import diagsvd
+    >>> vals = np.array([1, 2, 3])  # The array representing the computed svd
+    >>> diagsvd(vals, 3, 4)
+    array([[1, 0, 0, 0],
+           [0, 2, 0, 0],
+           [0, 0, 3, 0]])
+    >>> diagsvd(vals, 4, 3)
+    array([[1, 0, 0],
+           [0, 2, 0],
+           [0, 0, 3],
+           [0, 0, 0]])
+
+    """
+    part = diag(s)
+    typ = part.dtype.char
+    MorN = len(s)
+    if MorN == M:
+        return numpy.hstack((part, zeros((M, N - M), dtype=typ)))
+    elif MorN == N:
+        return r_[part, zeros((M - N, N), dtype=typ)]
+    else:
+        raise ValueError("Length of s must be M or N.")
+
+
+# Orthonormal decomposition
+
+def orth(A, rcond=None):
+    """
+    Construct an orthonormal basis for the range of A using SVD
+
+    Parameters
+    ----------
+    A : (M, N) array_like
+        Input array
+    rcond : float, optional
+        Relative condition number. Singular values ``s`` smaller than
+        ``rcond * max(s)`` are considered zero.
+        Default: floating point eps * max(M,N).
+
+    Returns
+    -------
+    Q : (M, K) ndarray
+        Orthonormal basis for the range of A.
+        K = effective rank of A, as determined by rcond
+
+    See Also
+    --------
+    svd : Singular value decomposition of a matrix
+    null_space : Matrix null space
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import orth
+    >>> A = np.array([[2, 0, 0], [0, 5, 0]])  # rank 2 array
+    >>> orth(A)
+    array([[0., 1.],
+           [1., 0.]])
+    >>> orth(A.T)
+    array([[0., 1.],
+           [1., 0.],
+           [0., 0.]])
+
+    """
+    u, s, vh = svd(A, full_matrices=False)
+    M, N = u.shape[0], vh.shape[1]
+    if rcond is None:
+        rcond = numpy.finfo(s.dtype).eps * max(M, N)
+    tol = numpy.amax(s) * rcond
+    num = numpy.sum(s > tol, dtype=int)
+    Q = u[:, :num]
+    return Q
+
+
+def null_space(A, rcond=None):
+    """
+    Construct an orthonormal basis for the null space of A using SVD
+
+    Parameters
+    ----------
+    A : (M, N) array_like
+        Input array
+    rcond : float, optional
+        Relative condition number. Singular values ``s`` smaller than
+        ``rcond * max(s)`` are considered zero.
+        Default: floating point eps * max(M,N).
+
+    Returns
+    -------
+    Z : (N, K) ndarray
+        Orthonormal basis for the null space of A.
+        K = dimension of effective null space, as determined by rcond
+
+    See Also
+    --------
+    svd : Singular value decomposition of a matrix
+    orth : Matrix range
+
+    Examples
+    --------
+    1-D null space:
+
+    >>> import numpy as np
+    >>> from scipy.linalg import null_space
+    >>> A = np.array([[1, 1], [1, 1]])
+    >>> ns = null_space(A)
+    >>> ns * np.copysign(1, ns[0,0])  # Remove the sign ambiguity of the vector
+    array([[ 0.70710678],
+           [-0.70710678]])
+
+    2-D null space:
+
+    >>> from numpy.random import default_rng
+    >>> rng = default_rng()
+    >>> B = rng.random((3, 5))
+    >>> Z = null_space(B)
+    >>> Z.shape
+    (5, 2)
+    >>> np.allclose(B.dot(Z), 0)
+    True
+
+    The basis vectors are orthonormal (up to rounding error):
+
+    >>> Z.T.dot(Z)
+    array([[  1.00000000e+00,   6.92087741e-17],
+           [  6.92087741e-17,   1.00000000e+00]])
+
+    """
+    u, s, vh = svd(A, full_matrices=True)
+    M, N = u.shape[0], vh.shape[1]
+    if rcond is None:
+        rcond = numpy.finfo(s.dtype).eps * max(M, N)
+    tol = numpy.amax(s) * rcond
+    num = numpy.sum(s > tol, dtype=int)
+    Q = vh[num:,:].T.conj()
+    return Q
+
+
+def subspace_angles(A, B):
+    r"""
+    Compute the subspace angles between two matrices.
+
+    Parameters
+    ----------
+    A : (M, N) array_like
+        The first input array.
+    B : (M, K) array_like
+        The second input array.
+
+    Returns
+    -------
+    angles : ndarray, shape (min(N, K),)
+        The subspace angles between the column spaces of `A` and `B` in
+        descending order.
+
+    See Also
+    --------
+    orth
+    svd
+
+    Notes
+    -----
+    This computes the subspace angles according to the formula
+    provided in [1]_. For equivalence with MATLAB and Octave behavior,
+    use ``angles[0]``.
+
+    .. versionadded:: 1.0
+
+    References
+    ----------
+    .. [1] Knyazev A, Argentati M (2002) Principal Angles between Subspaces
+           in an A-Based Scalar Product: Algorithms and Perturbation
+           Estimates. SIAM J. Sci. Comput. 23:2008-2040.
+
+    Examples
+    --------
+    An Hadamard matrix, which has orthogonal columns, so we expect that
+    the suspace angle to be :math:`\frac{\pi}{2}`:
+
+    >>> import numpy as np
+    >>> from scipy.linalg import hadamard, subspace_angles
+    >>> rng = np.random.default_rng()
+    >>> H = hadamard(4)
+    >>> print(H)
+    [[ 1  1  1  1]
+     [ 1 -1  1 -1]
+     [ 1  1 -1 -1]
+     [ 1 -1 -1  1]]
+    >>> np.rad2deg(subspace_angles(H[:, :2], H[:, 2:]))
+    array([ 90.,  90.])
+
+    And the subspace angle of a matrix to itself should be zero:
+
+    >>> subspace_angles(H[:, :2], H[:, :2]) <= 2 * np.finfo(float).eps
+    array([ True,  True], dtype=bool)
+
+    The angles between non-orthogonal subspaces are in between these extremes:
+
+    >>> x = rng.standard_normal((4, 3))
+    >>> np.rad2deg(subspace_angles(x[:, :2], x[:, [2]]))
+    array([ 55.832])  # random
+    """
+    # Steps here omit the U and V calculation steps from the paper
+
+    # 1. Compute orthonormal bases of column-spaces
+    A = _asarray_validated(A, check_finite=True)
+    if len(A.shape) != 2:
+        raise ValueError(f'expected 2D array, got shape {A.shape}')
+    QA = orth(A)
+    del A
+
+    B = _asarray_validated(B, check_finite=True)
+    if len(B.shape) != 2:
+        raise ValueError(f'expected 2D array, got shape {B.shape}')
+    if len(B) != len(QA):
+        raise ValueError('A and B must have the same number of rows, got '
+                         f'{QA.shape[0]} and {B.shape[0]}')
+    QB = orth(B)
+    del B
+
+    # 2. Compute SVD for cosine
+    QA_H_QB = dot(QA.T.conj(), QB)
+    sigma = svdvals(QA_H_QB)
+
+    # 3. Compute matrix B
+    if QA.shape[1] >= QB.shape[1]:
+        B = QB - dot(QA, QA_H_QB)
+    else:
+        B = QA - dot(QB, QA_H_QB.T.conj())
+    del QA, QB, QA_H_QB
+
+    # 4. Compute SVD for sine
+    mask = sigma ** 2 >= 0.5
+    if mask.any():
+        mu_arcsin = arcsin(clip(svdvals(B, overwrite_a=True), -1., 1.))
+    else:
+        mu_arcsin = 0.
+
+    # 5. Compute the principal angles
+    # with reverse ordering of sigma because smallest sigma belongs to largest
+    # angle theta
+    theta = where(mask, mu_arcsin, arccos(clip(sigma[::-1], -1., 1.)))
+    return theta

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_expm_frechet.py

@@ -0,0 +1,413 @@
+"""Frechet derivative of the matrix exponential."""
+import numpy as np
+import scipy.linalg
+
+__all__ = ['expm_frechet', 'expm_cond']
+
+
+def expm_frechet(A, E, method=None, compute_expm=True, check_finite=True):
+    """
+    Frechet derivative of the matrix exponential of A in the direction E.
+
+    Parameters
+    ----------
+    A : (N, N) array_like
+        Matrix of which to take the matrix exponential.
+    E : (N, N) array_like
+        Matrix direction in which to take the Frechet derivative.
+    method : str, optional
+        Choice of algorithm. Should be one of
+
+        - `SPS` (default)
+        - `blockEnlarge`
+
+    compute_expm : bool, optional
+        Whether to compute also `expm_A` in addition to `expm_frechet_AE`.
+        Default is True.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    expm_A : ndarray
+        Matrix exponential of A.
+    expm_frechet_AE : ndarray
+        Frechet derivative of the matrix exponential of A in the direction E.
+    For ``compute_expm = False``, only `expm_frechet_AE` is returned.
+
+    See Also
+    --------
+    expm : Compute the exponential of a matrix.
+
+    Notes
+    -----
+    This section describes the available implementations that can be selected
+    by the `method` parameter. The default method is *SPS*.
+
+    Method *blockEnlarge* is a naive algorithm.
+
+    Method *SPS* is Scaling-Pade-Squaring [1]_.
+    It is a sophisticated implementation which should take
+    only about 3/8 as much time as the naive implementation.
+    The asymptotics are the same.
+
+    .. versionadded:: 0.13.0
+
+    References
+    ----------
+    .. [1] Awad H. Al-Mohy and Nicholas J. Higham (2009)
+           Computing the Frechet Derivative of the Matrix Exponential,
+           with an application to Condition Number Estimation.
+           SIAM Journal On Matrix Analysis and Applications.,
+           30 (4). pp. 1639-1657. ISSN 1095-7162
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> rng = np.random.default_rng()
+
+    >>> A = rng.standard_normal((3, 3))
+    >>> E = rng.standard_normal((3, 3))
+    >>> expm_A, expm_frechet_AE = linalg.expm_frechet(A, E)
+    >>> expm_A.shape, expm_frechet_AE.shape
+    ((3, 3), (3, 3))
+
+    Create a 6x6 matrix containing [[A, E], [0, A]]:
+
+    >>> M = np.zeros((6, 6))
+    >>> M[:3, :3] = A
+    >>> M[:3, 3:] = E
+    >>> M[3:, 3:] = A
+
+    >>> expm_M = linalg.expm(M)
+    >>> np.allclose(expm_A, expm_M[:3, :3])
+    True
+    >>> np.allclose(expm_frechet_AE, expm_M[:3, 3:])
+    True
+
+    """
+    if check_finite:
+        A = np.asarray_chkfinite(A)
+        E = np.asarray_chkfinite(E)
+    else:
+        A = np.asarray(A)
+        E = np.asarray(E)
+    if A.ndim != 2 or A.shape[0] != A.shape[1]:
+        raise ValueError('expected A to be a square matrix')
+    if E.ndim != 2 or E.shape[0] != E.shape[1]:
+        raise ValueError('expected E to be a square matrix')
+    if A.shape != E.shape:
+        raise ValueError('expected A and E to be the same shape')
+    if method is None:
+        method = 'SPS'
+    if method == 'SPS':
+        expm_A, expm_frechet_AE = expm_frechet_algo_64(A, E)
+    elif method == 'blockEnlarge':
+        expm_A, expm_frechet_AE = expm_frechet_block_enlarge(A, E)
+    else:
+        raise ValueError('Unknown implementation %s' % method)
+    if compute_expm:
+        return expm_A, expm_frechet_AE
+    else:
+        return expm_frechet_AE
+
+
+def expm_frechet_block_enlarge(A, E):
+    """
+    This is a helper function, mostly for testing and profiling.
+    Return expm(A), frechet(A, E)
+    """
+    n = A.shape[0]
+    M = np.vstack([
+        np.hstack([A, E]),
+        np.hstack([np.zeros_like(A), A])])
+    expm_M = scipy.linalg.expm(M)
+    return expm_M[:n, :n], expm_M[:n, n:]
+
+
+"""
+Maximal values ell_m of ||2**-s A|| such that the backward error bound
+does not exceed 2**-53.
+"""
+ell_table_61 = (
+        None,
+        # 1
+        2.11e-8,
+        3.56e-4,
+        1.08e-2,
+        6.49e-2,
+        2.00e-1,
+        4.37e-1,
+        7.83e-1,
+        1.23e0,
+        1.78e0,
+        2.42e0,
+        # 11
+        3.13e0,
+        3.90e0,
+        4.74e0,
+        5.63e0,
+        6.56e0,
+        7.52e0,
+        8.53e0,
+        9.56e0,
+        1.06e1,
+        1.17e1,
+        )
+
+
+# The b vectors and U and V are copypasted
+# from scipy.sparse.linalg.matfuncs.py.
+# M, Lu, Lv follow (6.11), (6.12), (6.13), (3.3)
+
+def _diff_pade3(A, E, ident):
+    b = (120., 60., 12., 1.)
+    A2 = A.dot(A)
+    M2 = np.dot(A, E) + np.dot(E, A)
+    U = A.dot(b[3]*A2 + b[1]*ident)
+    V = b[2]*A2 + b[0]*ident
+    Lu = A.dot(b[3]*M2) + E.dot(b[3]*A2 + b[1]*ident)
+    Lv = b[2]*M2
+    return U, V, Lu, Lv
+
+
+def _diff_pade5(A, E, ident):
+    b = (30240., 15120., 3360., 420., 30., 1.)
+    A2 = A.dot(A)
+    M2 = np.dot(A, E) + np.dot(E, A)
+    A4 = np.dot(A2, A2)
+    M4 = np.dot(A2, M2) + np.dot(M2, A2)
+    U = A.dot(b[5]*A4 + b[3]*A2 + b[1]*ident)
+    V = b[4]*A4 + b[2]*A2 + b[0]*ident
+    Lu = (A.dot(b[5]*M4 + b[3]*M2) +
+            E.dot(b[5]*A4 + b[3]*A2 + b[1]*ident))
+    Lv = b[4]*M4 + b[2]*M2
+    return U, V, Lu, Lv
+
+
+def _diff_pade7(A, E, ident):
+    b = (17297280., 8648640., 1995840., 277200., 25200., 1512., 56., 1.)
+    A2 = A.dot(A)
+    M2 = np.dot(A, E) + np.dot(E, A)
+    A4 = np.dot(A2, A2)
+    M4 = np.dot(A2, M2) + np.dot(M2, A2)
+    A6 = np.dot(A2, A4)
+    M6 = np.dot(A4, M2) + np.dot(M4, A2)
+    U = A.dot(b[7]*A6 + b[5]*A4 + b[3]*A2 + b[1]*ident)
+    V = b[6]*A6 + b[4]*A4 + b[2]*A2 + b[0]*ident
+    Lu = (A.dot(b[7]*M6 + b[5]*M4 + b[3]*M2) +
+            E.dot(b[7]*A6 + b[5]*A4 + b[3]*A2 + b[1]*ident))
+    Lv = b[6]*M6 + b[4]*M4 + b[2]*M2
+    return U, V, Lu, Lv
+
+
+def _diff_pade9(A, E, ident):
+    b = (17643225600., 8821612800., 2075673600., 302702400., 30270240.,
+            2162160., 110880., 3960., 90., 1.)
+    A2 = A.dot(A)
+    M2 = np.dot(A, E) + np.dot(E, A)
+    A4 = np.dot(A2, A2)
+    M4 = np.dot(A2, M2) + np.dot(M2, A2)
+    A6 = np.dot(A2, A4)
+    M6 = np.dot(A4, M2) + np.dot(M4, A2)
+    A8 = np.dot(A4, A4)
+    M8 = np.dot(A4, M4) + np.dot(M4, A4)
+    U = A.dot(b[9]*A8 + b[7]*A6 + b[5]*A4 + b[3]*A2 + b[1]*ident)
+    V = b[8]*A8 + b[6]*A6 + b[4]*A4 + b[2]*A2 + b[0]*ident
+    Lu = (A.dot(b[9]*M8 + b[7]*M6 + b[5]*M4 + b[3]*M2) +
+            E.dot(b[9]*A8 + b[7]*A6 + b[5]*A4 + b[3]*A2 + b[1]*ident))
+    Lv = b[8]*M8 + b[6]*M6 + b[4]*M4 + b[2]*M2
+    return U, V, Lu, Lv
+
+
+def expm_frechet_algo_64(A, E):
+    n = A.shape[0]
+    s = None
+    ident = np.identity(n)
+    A_norm_1 = scipy.linalg.norm(A, 1)
+    m_pade_pairs = (
+            (3, _diff_pade3),
+            (5, _diff_pade5),
+            (7, _diff_pade7),
+            (9, _diff_pade9))
+    for m, pade in m_pade_pairs:
+        if A_norm_1 <= ell_table_61[m]:
+            U, V, Lu, Lv = pade(A, E, ident)
+            s = 0
+            break
+    if s is None:
+        # scaling
+        s = max(0, int(np.ceil(np.log2(A_norm_1 / ell_table_61[13]))))
+        A = A * 2.0**-s
+        E = E * 2.0**-s
+        # pade order 13
+        A2 = np.dot(A, A)
+        M2 = np.dot(A, E) + np.dot(E, A)
+        A4 = np.dot(A2, A2)
+        M4 = np.dot(A2, M2) + np.dot(M2, A2)
+        A6 = np.dot(A2, A4)
+        M6 = np.dot(A4, M2) + np.dot(M4, A2)
+        b = (64764752532480000., 32382376266240000., 7771770303897600.,
+                1187353796428800., 129060195264000., 10559470521600.,
+                670442572800., 33522128640., 1323241920., 40840800., 960960.,
+                16380., 182., 1.)
+        W1 = b[13]*A6 + b[11]*A4 + b[9]*A2
+        W2 = b[7]*A6 + b[5]*A4 + b[3]*A2 + b[1]*ident
+        Z1 = b[12]*A6 + b[10]*A4 + b[8]*A2
+        Z2 = b[6]*A6 + b[4]*A4 + b[2]*A2 + b[0]*ident
+        W = np.dot(A6, W1) + W2
+        U = np.dot(A, W)
+        V = np.dot(A6, Z1) + Z2
+        Lw1 = b[13]*M6 + b[11]*M4 + b[9]*M2
+        Lw2 = b[7]*M6 + b[5]*M4 + b[3]*M2
+        Lz1 = b[12]*M6 + b[10]*M4 + b[8]*M2
+        Lz2 = b[6]*M6 + b[4]*M4 + b[2]*M2
+        Lw = np.dot(A6, Lw1) + np.dot(M6, W1) + Lw2
+        Lu = np.dot(A, Lw) + np.dot(E, W)
+        Lv = np.dot(A6, Lz1) + np.dot(M6, Z1) + Lz2
+    # factor once and solve twice
+    lu_piv = scipy.linalg.lu_factor(-U + V)
+    R = scipy.linalg.lu_solve(lu_piv, U + V)
+    L = scipy.linalg.lu_solve(lu_piv, Lu + Lv + np.dot((Lu - Lv), R))
+    # squaring
+    for k in range(s):
+        L = np.dot(R, L) + np.dot(L, R)
+        R = np.dot(R, R)
+    return R, L
+
+
+def vec(M):
+    """
+    Stack columns of M to construct a single vector.
+
+    This is somewhat standard notation in linear algebra.
+
+    Parameters
+    ----------
+    M : 2-D array_like
+        Input matrix
+
+    Returns
+    -------
+    v : 1-D ndarray
+        Output vector
+
+    """
+    return M.T.ravel()
+
+
+def expm_frechet_kronform(A, method=None, check_finite=True):
+    """
+    Construct the Kronecker form of the Frechet derivative of expm.
+
+    Parameters
+    ----------
+    A : array_like with shape (N, N)
+        Matrix to be expm'd.
+    method : str, optional
+        Extra keyword to be passed to expm_frechet.
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    K : 2-D ndarray with shape (N*N, N*N)
+        Kronecker form of the Frechet derivative of the matrix exponential.
+
+    Notes
+    -----
+    This function is used to help compute the condition number
+    of the matrix exponential.
+
+    See Also
+    --------
+    expm : Compute a matrix exponential.
+    expm_frechet : Compute the Frechet derivative of the matrix exponential.
+    expm_cond : Compute the relative condition number of the matrix exponential
+                in the Frobenius norm.
+
+    """
+    if check_finite:
+        A = np.asarray_chkfinite(A)
+    else:
+        A = np.asarray(A)
+    if len(A.shape) != 2 or A.shape[0] != A.shape[1]:
+        raise ValueError('expected a square matrix')
+
+    n = A.shape[0]
+    ident = np.identity(n)
+    cols = []
+    for i in range(n):
+        for j in range(n):
+            E = np.outer(ident[i], ident[j])
+            F = expm_frechet(A, E,
+                    method=method, compute_expm=False, check_finite=False)
+            cols.append(vec(F))
+    return np.vstack(cols).T
+
+
+def expm_cond(A, check_finite=True):
+    """
+    Relative condition number of the matrix exponential in the Frobenius norm.
+
+    Parameters
+    ----------
+    A : 2-D array_like
+        Square input matrix with shape (N, N).
+    check_finite : bool, optional
+        Whether to check that the input matrix contains only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+
+    Returns
+    -------
+    kappa : float
+        The relative condition number of the matrix exponential
+        in the Frobenius norm
+
+    See Also
+    --------
+    expm : Compute the exponential of a matrix.
+    expm_frechet : Compute the Frechet derivative of the matrix exponential.
+
+    Notes
+    -----
+    A faster estimate for the condition number in the 1-norm
+    has been published but is not yet implemented in SciPy.
+
+    .. versionadded:: 0.14.0
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.linalg import expm_cond
+    >>> A = np.array([[-0.3, 0.2, 0.6], [0.6, 0.3, -0.1], [-0.7, 1.2, 0.9]])
+    >>> k = expm_cond(A)
+    >>> k
+    1.7787805864469866
+
+    """
+    if check_finite:
+        A = np.asarray_chkfinite(A)
+    else:
+        A = np.asarray(A)
+    if len(A.shape) != 2 or A.shape[0] != A.shape[1]:
+        raise ValueError('expected a square matrix')
+
+    X = scipy.linalg.expm(A)
+    K = expm_frechet_kronform(A, check_finite=False)
+
+    # The following norm choices are deliberate.
+    # The norms of A and X are Frobenius norms,
+    # and the norm of K is the induced 2-norm.
+    A_norm = scipy.linalg.norm(A, 'fro')
+    X_norm = scipy.linalg.norm(X, 'fro')
+    K_norm = scipy.linalg.norm(K, 2)
+
+    kappa = (K_norm * A_norm) / X_norm
+    return kappa

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_interpolative_backend.py

@@ -0,0 +1,1681 @@
+#******************************************************************************
+#   Copyright (C) 2013 Kenneth L. Ho
+#
+#   Redistribution and use in source and binary forms, with or without
+#   modification, are permitted provided that the following conditions are met:
+#
+#   Redistributions of source code must retain the above copyright notice, this
+#   list of conditions and the following disclaimer. Redistributions in binary
+#   form must reproduce the above copyright notice, this list of conditions and
+#   the following disclaimer in the documentation and/or other materials
+#   provided with the distribution.
+#
+#   None of the names of the copyright holders may be used to endorse or
+#   promote products derived from this software without specific prior written
+#   permission.
+#
+#   THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+#   AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+#   IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+#   ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE
+#   LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+#   CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+#   SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+#   INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+#   CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+#   ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+#   POSSIBILITY OF SUCH DAMAGE.
+#******************************************************************************
+
+"""
+Direct wrappers for Fortran `id_dist` backend.
+"""
+
+import scipy.linalg._interpolative as _id
+import numpy as np
+
+_RETCODE_ERROR = RuntimeError("nonzero return code")
+
+
+def _asfortranarray_copy(A):
+    """
+    Same as np.asfortranarray, but ensure a copy
+    """
+    A = np.asarray(A)
+    if A.flags.f_contiguous:
+        A = A.copy(order="F")
+    else:
+        A = np.asfortranarray(A)
+    return A
+
+
+#------------------------------------------------------------------------------
+# id_rand.f
+#------------------------------------------------------------------------------
+
+def id_srand(n):
+    """
+    Generate standard uniform pseudorandom numbers via a very efficient lagged
+    Fibonacci method.
+
+    :param n:
+        Number of pseudorandom numbers to generate.
+    :type n: int
+
+    :return:
+        Pseudorandom numbers.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.id_srand(n)
+
+
+def id_srandi(t):
+    """
+    Initialize seed values for :func:`id_srand` (any appropriately random
+    numbers will do).
+
+    :param t:
+        Array of 55 seed values.
+    :type t: :class:`numpy.ndarray`
+    """
+    t = np.asfortranarray(t)
+    _id.id_srandi(t)
+
+
+def id_srando():
+    """
+    Reset seed values to their original values.
+    """
+    _id.id_srando()
+
+
+#------------------------------------------------------------------------------
+# idd_frm.f
+#------------------------------------------------------------------------------
+
+def idd_frm(n, w, x):
+    """
+    Transform real vector via a composition of Rokhlin's random transform,
+    random subselection, and an FFT.
+
+    In contrast to :func:`idd_sfrm`, this routine works best when the length of
+    the transformed vector is the power-of-two integer output by
+    :func:`idd_frmi`, or when the length is not specified but instead
+    determined a posteriori from the output. The returned transformed vector is
+    randomly permuted.
+
+    :param n:
+        Greatest power-of-two integer satisfying `n <= x.size` as obtained from
+        :func:`idd_frmi`; `n` is also the length of the output vector.
+    :type n: int
+    :param w:
+        Initialization array constructed by :func:`idd_frmi`.
+    :type w: :class:`numpy.ndarray`
+    :param x:
+        Vector to be transformed.
+    :type x: :class:`numpy.ndarray`
+
+    :return:
+        Transformed vector.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idd_frm(n, w, x)
+
+
+def idd_sfrm(l, n, w, x):
+    """
+    Transform real vector via a composition of Rokhlin's random transform,
+    random subselection, and an FFT.
+
+    In contrast to :func:`idd_frm`, this routine works best when the length of
+    the transformed vector is known a priori.
+
+    :param l:
+        Length of transformed vector, satisfying `l <= n`.
+    :type l: int
+    :param n:
+        Greatest power-of-two integer satisfying `n <= x.size` as obtained from
+        :func:`idd_sfrmi`.
+    :type n: int
+    :param w:
+        Initialization array constructed by :func:`idd_sfrmi`.
+    :type w: :class:`numpy.ndarray`
+    :param x:
+        Vector to be transformed.
+    :type x: :class:`numpy.ndarray`
+
+    :return:
+        Transformed vector.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idd_sfrm(l, n, w, x)
+
+
+def idd_frmi(m):
+    """
+    Initialize data for :func:`idd_frm`.
+
+    :param m:
+        Length of vector to be transformed.
+    :type m: int
+
+    :return:
+        Greatest power-of-two integer `n` satisfying `n <= m`.
+    :rtype: int
+    :return:
+        Initialization array to be used by :func:`idd_frm`.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idd_frmi(m)
+
+
+def idd_sfrmi(l, m):
+    """
+    Initialize data for :func:`idd_sfrm`.
+
+    :param l:
+        Length of output transformed vector.
+    :type l: int
+    :param m:
+        Length of the vector to be transformed.
+    :type m: int
+
+    :return:
+        Greatest power-of-two integer `n` satisfying `n <= m`.
+    :rtype: int
+    :return:
+        Initialization array to be used by :func:`idd_sfrm`.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idd_sfrmi(l, m)
+
+
+#------------------------------------------------------------------------------
+# idd_id.f
+#------------------------------------------------------------------------------
+
+def iddp_id(eps, A):
+    """
+    Compute ID of a real matrix to a specified relative precision.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Rank of ID.
+    :rtype: int
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = _asfortranarray_copy(A)
+    k, idx, rnorms = _id.iddp_id(eps, A)
+    n = A.shape[1]
+    proj = A.T.ravel()[:k*(n-k)].reshape((k, n-k), order='F')
+    return k, idx, proj
+
+
+def iddr_id(A, k):
+    """
+    Compute ID of a real matrix to a specified rank.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = _asfortranarray_copy(A)
+    idx, rnorms = _id.iddr_id(A, k)
+    n = A.shape[1]
+    proj = A.T.ravel()[:k*(n-k)].reshape((k, n-k), order='F')
+    return idx, proj
+
+
+def idd_reconid(B, idx, proj):
+    """
+    Reconstruct matrix from real ID.
+
+    :param B:
+        Skeleton matrix.
+    :type B: :class:`numpy.ndarray`
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+    :param proj:
+        Interpolation coefficients.
+    :type proj: :class:`numpy.ndarray`
+
+    :return:
+        Reconstructed matrix.
+    :rtype: :class:`numpy.ndarray`
+    """
+    B = np.asfortranarray(B)
+    if proj.size > 0:
+        return _id.idd_reconid(B, idx, proj)
+    else:
+        return B[:, np.argsort(idx)]
+
+
+def idd_reconint(idx, proj):
+    """
+    Reconstruct interpolation matrix from real ID.
+
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+    :param proj:
+        Interpolation coefficients.
+    :type proj: :class:`numpy.ndarray`
+
+    :return:
+        Interpolation matrix.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idd_reconint(idx, proj)
+
+
+def idd_copycols(A, k, idx):
+    """
+    Reconstruct skeleton matrix from real ID.
+
+    :param A:
+        Original matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of ID.
+    :type k: int
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+
+    :return:
+        Skeleton matrix.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    return _id.idd_copycols(A, k, idx)
+
+
+#------------------------------------------------------------------------------
+# idd_id2svd.f
+#------------------------------------------------------------------------------
+
+def idd_id2svd(B, idx, proj):
+    """
+    Convert real ID to SVD.
+
+    :param B:
+        Skeleton matrix.
+    :type B: :class:`numpy.ndarray`
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+    :param proj:
+        Interpolation coefficients.
+    :type proj: :class:`numpy.ndarray`
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    B = np.asfortranarray(B)
+    U, V, S, ier = _id.idd_id2svd(B, idx, proj)
+    if ier:
+        raise _RETCODE_ERROR
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# idd_snorm.f
+#------------------------------------------------------------------------------
+
+def idd_snorm(m, n, matvect, matvec, its=20):
+    """
+    Estimate spectral norm of a real matrix by the randomized power method.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matvect:
+        Function to apply the matrix transpose to a vector, with call signature
+        `y = matvect(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvect: function
+    :param matvec:
+        Function to apply the matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+    :param its:
+        Number of power method iterations.
+    :type its: int
+
+    :return:
+        Spectral norm estimate.
+    :rtype: float
+    """
+    snorm, v = _id.idd_snorm(m, n, matvect, matvec, its)
+    return snorm
+
+
+def idd_diffsnorm(m, n, matvect, matvect2, matvec, matvec2, its=20):
+    """
+    Estimate spectral norm of the difference of two real matrices by the
+    randomized power method.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matvect:
+        Function to apply the transpose of the first matrix to a vector, with
+        call signature `y = matvect(x)`, where `x` and `y` are the input and
+        output vectors, respectively.
+    :type matvect: function
+    :param matvect2:
+        Function to apply the transpose of the second matrix to a vector, with
+        call signature `y = matvect2(x)`, where `x` and `y` are the input and
+        output vectors, respectively.
+    :type matvect2: function
+    :param matvec:
+        Function to apply the first matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+    :param matvec2:
+        Function to apply the second matrix to a vector, with call signature
+        `y = matvec2(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec2: function
+    :param its:
+        Number of power method iterations.
+    :type its: int
+
+    :return:
+        Spectral norm estimate of matrix difference.
+    :rtype: float
+    """
+    return _id.idd_diffsnorm(m, n, matvect, matvect2, matvec, matvec2, its)
+
+
+#------------------------------------------------------------------------------
+# idd_svd.f
+#------------------------------------------------------------------------------
+
+def iddr_svd(A, k):
+    """
+    Compute SVD of a real matrix to a specified rank.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of SVD.
+    :type k: int
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    U, V, S, ier = _id.iddr_svd(A, k)
+    if ier:
+        raise _RETCODE_ERROR
+    return U, V, S
+
+
+def iddp_svd(eps, A):
+    """
+    Compute SVD of a real matrix to a specified relative precision.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    k, iU, iV, iS, w, ier = _id.iddp_svd(eps, A)
+    if ier:
+        raise _RETCODE_ERROR
+    U = w[iU-1:iU+m*k-1].reshape((m, k), order='F')
+    V = w[iV-1:iV+n*k-1].reshape((n, k), order='F')
+    S = w[iS-1:iS+k-1]
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# iddp_aid.f
+#------------------------------------------------------------------------------
+
+def iddp_aid(eps, A):
+    """
+    Compute ID of a real matrix to a specified relative precision using random
+    sampling.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Rank of ID.
+    :rtype: int
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    n2, w = idd_frmi(m)
+    proj = np.empty(n*(2*n2 + 1) + n2 + 1, order='F')
+    k, idx, proj = _id.iddp_aid(eps, A, w, proj)
+    proj = proj[:k*(n-k)].reshape((k, n-k), order='F')
+    return k, idx, proj
+
+
+def idd_estrank(eps, A):
+    """
+    Estimate rank of a real matrix to a specified relative precision using
+    random sampling.
+
+    The output rank is typically about 8 higher than the actual rank.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Rank estimate.
+    :rtype: int
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    n2, w = idd_frmi(m)
+    ra = np.empty(n*n2 + (n + 1)*(n2 + 1), order='F')
+    k, ra = _id.idd_estrank(eps, A, w, ra)
+    return k
+
+
+#------------------------------------------------------------------------------
+# iddp_asvd.f
+#------------------------------------------------------------------------------
+
+def iddp_asvd(eps, A):
+    """
+    Compute SVD of a real matrix to a specified relative precision using random
+    sampling.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    n2, winit = _id.idd_frmi(m)
+    w = np.empty(
+        max((min(m, n) + 1)*(3*m + 5*n + 1) + 25*min(m, n)**2,
+            (2*n + 1)*(n2 + 1)),
+        order='F')
+    k, iU, iV, iS, w, ier = _id.iddp_asvd(eps, A, winit, w)
+    if ier:
+        raise _RETCODE_ERROR
+    U = w[iU-1:iU+m*k-1].reshape((m, k), order='F')
+    V = w[iV-1:iV+n*k-1].reshape((n, k), order='F')
+    S = w[iS-1:iS+k-1]
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# iddp_rid.f
+#------------------------------------------------------------------------------
+
+def iddp_rid(eps, m, n, matvect):
+    """
+    Compute ID of a real matrix to a specified relative precision using random
+    matrix-vector multiplication.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matvect:
+        Function to apply the matrix transpose to a vector, with call signature
+        `y = matvect(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvect: function
+
+    :return:
+        Rank of ID.
+    :rtype: int
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    proj = np.empty(m + 1 + 2*n*(min(m, n) + 1), order='F')
+    k, idx, proj, ier = _id.iddp_rid(eps, m, n, matvect, proj)
+    if ier != 0:
+        raise _RETCODE_ERROR
+    proj = proj[:k*(n-k)].reshape((k, n-k), order='F')
+    return k, idx, proj
+
+
+def idd_findrank(eps, m, n, matvect):
+    """
+    Estimate rank of a real matrix to a specified relative precision using
+    random matrix-vector multiplication.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matvect:
+        Function to apply the matrix transpose to a vector, with call signature
+        `y = matvect(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvect: function
+
+    :return:
+        Rank estimate.
+    :rtype: int
+    """
+    k, ra, ier = _id.idd_findrank(eps, m, n, matvect)
+    if ier:
+        raise _RETCODE_ERROR
+    return k
+
+
+#------------------------------------------------------------------------------
+# iddp_rsvd.f
+#------------------------------------------------------------------------------
+
+def iddp_rsvd(eps, m, n, matvect, matvec):
+    """
+    Compute SVD of a real matrix to a specified relative precision using random
+    matrix-vector multiplication.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matvect:
+        Function to apply the matrix transpose to a vector, with call signature
+        `y = matvect(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvect: function
+    :param matvec:
+        Function to apply the matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    k, iU, iV, iS, w, ier = _id.iddp_rsvd(eps, m, n, matvect, matvec)
+    if ier:
+        raise _RETCODE_ERROR
+    U = w[iU-1:iU+m*k-1].reshape((m, k), order='F')
+    V = w[iV-1:iV+n*k-1].reshape((n, k), order='F')
+    S = w[iS-1:iS+k-1]
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# iddr_aid.f
+#------------------------------------------------------------------------------
+
+def iddr_aid(A, k):
+    """
+    Compute ID of a real matrix to a specified rank using random sampling.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    w = iddr_aidi(m, n, k)
+    idx, proj = _id.iddr_aid(A, k, w)
+    if k == n:
+        proj = np.empty((k, n-k), dtype='float64', order='F')
+    else:
+        proj = proj.reshape((k, n-k), order='F')
+    return idx, proj
+
+
+def iddr_aidi(m, n, k):
+    """
+    Initialize array for :func:`iddr_aid`.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Initialization array to be used by :func:`iddr_aid`.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.iddr_aidi(m, n, k)
+
+
+#------------------------------------------------------------------------------
+# iddr_asvd.f
+#------------------------------------------------------------------------------
+
+def iddr_asvd(A, k):
+    """
+    Compute SVD of a real matrix to a specified rank using random sampling.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of SVD.
+    :type k: int
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    w = np.empty((2*k + 28)*m + (6*k + 21)*n + 25*k**2 + 100, order='F')
+    w_ = iddr_aidi(m, n, k)
+    w[:w_.size] = w_
+    U, V, S, ier = _id.iddr_asvd(A, k, w)
+    if ier != 0:
+        raise _RETCODE_ERROR
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# iddr_rid.f
+#------------------------------------------------------------------------------
+
+def iddr_rid(m, n, matvect, k):
+    """
+    Compute ID of a real matrix to a specified rank using random matrix-vector
+    multiplication.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matvect:
+        Function to apply the matrix transpose to a vector, with call signature
+        `y = matvect(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvect: function
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    idx, proj = _id.iddr_rid(m, n, matvect, k)
+    proj = proj[:k*(n-k)].reshape((k, n-k), order='F')
+    return idx, proj
+
+
+#------------------------------------------------------------------------------
+# iddr_rsvd.f
+#------------------------------------------------------------------------------
+
+def iddr_rsvd(m, n, matvect, matvec, k):
+    """
+    Compute SVD of a real matrix to a specified rank using random matrix-vector
+    multiplication.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matvect:
+        Function to apply the matrix transpose to a vector, with call signature
+        `y = matvect(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvect: function
+    :param matvec:
+        Function to apply the matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+    :param k:
+        Rank of SVD.
+    :type k: int
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    U, V, S, ier = _id.iddr_rsvd(m, n, matvect, matvec, k)
+    if ier != 0:
+        raise _RETCODE_ERROR
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# idz_frm.f
+#------------------------------------------------------------------------------
+
+def idz_frm(n, w, x):
+    """
+    Transform complex vector via a composition of Rokhlin's random transform,
+    random subselection, and an FFT.
+
+    In contrast to :func:`idz_sfrm`, this routine works best when the length of
+    the transformed vector is the power-of-two integer output by
+    :func:`idz_frmi`, or when the length is not specified but instead
+    determined a posteriori from the output. The returned transformed vector is
+    randomly permuted.
+
+    :param n:
+        Greatest power-of-two integer satisfying `n <= x.size` as obtained from
+        :func:`idz_frmi`; `n` is also the length of the output vector.
+    :type n: int
+    :param w:
+        Initialization array constructed by :func:`idz_frmi`.
+    :type w: :class:`numpy.ndarray`
+    :param x:
+        Vector to be transformed.
+    :type x: :class:`numpy.ndarray`
+
+    :return:
+        Transformed vector.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idz_frm(n, w, x)
+
+
+def idz_sfrm(l, n, w, x):
+    """
+    Transform complex vector via a composition of Rokhlin's random transform,
+    random subselection, and an FFT.
+
+    In contrast to :func:`idz_frm`, this routine works best when the length of
+    the transformed vector is known a priori.
+
+    :param l:
+        Length of transformed vector, satisfying `l <= n`.
+    :type l: int
+    :param n:
+        Greatest power-of-two integer satisfying `n <= x.size` as obtained from
+        :func:`idz_sfrmi`.
+    :type n: int
+    :param w:
+        Initialization array constructed by :func:`idd_sfrmi`.
+    :type w: :class:`numpy.ndarray`
+    :param x:
+        Vector to be transformed.
+    :type x: :class:`numpy.ndarray`
+
+    :return:
+        Transformed vector.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idz_sfrm(l, n, w, x)
+
+
+def idz_frmi(m):
+    """
+    Initialize data for :func:`idz_frm`.
+
+    :param m:
+        Length of vector to be transformed.
+    :type m: int
+
+    :return:
+        Greatest power-of-two integer `n` satisfying `n <= m`.
+    :rtype: int
+    :return:
+        Initialization array to be used by :func:`idz_frm`.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idz_frmi(m)
+
+
+def idz_sfrmi(l, m):
+    """
+    Initialize data for :func:`idz_sfrm`.
+
+    :param l:
+        Length of output transformed vector.
+    :type l: int
+    :param m:
+        Length of the vector to be transformed.
+    :type m: int
+
+    :return:
+        Greatest power-of-two integer `n` satisfying `n <= m`.
+    :rtype: int
+    :return:
+        Initialization array to be used by :func:`idz_sfrm`.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idz_sfrmi(l, m)
+
+
+#------------------------------------------------------------------------------
+# idz_id.f
+#------------------------------------------------------------------------------
+
+def idzp_id(eps, A):
+    """
+    Compute ID of a complex matrix to a specified relative precision.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Rank of ID.
+    :rtype: int
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = _asfortranarray_copy(A)
+    k, idx, rnorms = _id.idzp_id(eps, A)
+    n = A.shape[1]
+    proj = A.T.ravel()[:k*(n-k)].reshape((k, n-k), order='F')
+    return k, idx, proj
+
+
+def idzr_id(A, k):
+    """
+    Compute ID of a complex matrix to a specified rank.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = _asfortranarray_copy(A)
+    idx, rnorms = _id.idzr_id(A, k)
+    n = A.shape[1]
+    proj = A.T.ravel()[:k*(n-k)].reshape((k, n-k), order='F')
+    return idx, proj
+
+
+def idz_reconid(B, idx, proj):
+    """
+    Reconstruct matrix from complex ID.
+
+    :param B:
+        Skeleton matrix.
+    :type B: :class:`numpy.ndarray`
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+    :param proj:
+        Interpolation coefficients.
+    :type proj: :class:`numpy.ndarray`
+
+    :return:
+        Reconstructed matrix.
+    :rtype: :class:`numpy.ndarray`
+    """
+    B = np.asfortranarray(B)
+    if proj.size > 0:
+        return _id.idz_reconid(B, idx, proj)
+    else:
+        return B[:, np.argsort(idx)]
+
+
+def idz_reconint(idx, proj):
+    """
+    Reconstruct interpolation matrix from complex ID.
+
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+    :param proj:
+        Interpolation coefficients.
+    :type proj: :class:`numpy.ndarray`
+
+    :return:
+        Interpolation matrix.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idz_reconint(idx, proj)
+
+
+def idz_copycols(A, k, idx):
+    """
+    Reconstruct skeleton matrix from complex ID.
+
+    :param A:
+        Original matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of ID.
+    :type k: int
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+
+    :return:
+        Skeleton matrix.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    return _id.idz_copycols(A, k, idx)
+
+
+#------------------------------------------------------------------------------
+# idz_id2svd.f
+#------------------------------------------------------------------------------
+
+def idz_id2svd(B, idx, proj):
+    """
+    Convert complex ID to SVD.
+
+    :param B:
+        Skeleton matrix.
+    :type B: :class:`numpy.ndarray`
+    :param idx:
+        Column index array.
+    :type idx: :class:`numpy.ndarray`
+    :param proj:
+        Interpolation coefficients.
+    :type proj: :class:`numpy.ndarray`
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    B = np.asfortranarray(B)
+    U, V, S, ier = _id.idz_id2svd(B, idx, proj)
+    if ier:
+        raise _RETCODE_ERROR
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# idz_snorm.f
+#------------------------------------------------------------------------------
+
+def idz_snorm(m, n, matveca, matvec, its=20):
+    """
+    Estimate spectral norm of a complex matrix by the randomized power method.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matveca:
+        Function to apply the matrix adjoint to a vector, with call signature
+        `y = matveca(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matveca: function
+    :param matvec:
+        Function to apply the matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+    :param its:
+        Number of power method iterations.
+    :type its: int
+
+    :return:
+        Spectral norm estimate.
+    :rtype: float
+    """
+    snorm, v = _id.idz_snorm(m, n, matveca, matvec, its)
+    return snorm
+
+
+def idz_diffsnorm(m, n, matveca, matveca2, matvec, matvec2, its=20):
+    """
+    Estimate spectral norm of the difference of two complex matrices by the
+    randomized power method.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matveca:
+        Function to apply the adjoint of the first matrix to a vector, with
+        call signature `y = matveca(x)`, where `x` and `y` are the input and
+        output vectors, respectively.
+    :type matveca: function
+    :param matveca2:
+        Function to apply the adjoint of the second matrix to a vector, with
+        call signature `y = matveca2(x)`, where `x` and `y` are the input and
+        output vectors, respectively.
+    :type matveca2: function
+    :param matvec:
+        Function to apply the first matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+    :param matvec2:
+        Function to apply the second matrix to a vector, with call signature
+        `y = matvec2(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec2: function
+    :param its:
+        Number of power method iterations.
+    :type its: int
+
+    :return:
+        Spectral norm estimate of matrix difference.
+    :rtype: float
+    """
+    return _id.idz_diffsnorm(m, n, matveca, matveca2, matvec, matvec2, its)
+
+
+#------------------------------------------------------------------------------
+# idz_svd.f
+#------------------------------------------------------------------------------
+
+def idzr_svd(A, k):
+    """
+    Compute SVD of a complex matrix to a specified rank.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of SVD.
+    :type k: int
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    U, V, S, ier = _id.idzr_svd(A, k)
+    if ier:
+        raise _RETCODE_ERROR
+    return U, V, S
+
+
+def idzp_svd(eps, A):
+    """
+    Compute SVD of a complex matrix to a specified relative precision.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    k, iU, iV, iS, w, ier = _id.idzp_svd(eps, A)
+    if ier:
+        raise _RETCODE_ERROR
+    U = w[iU-1:iU+m*k-1].reshape((m, k), order='F')
+    V = w[iV-1:iV+n*k-1].reshape((n, k), order='F')
+    S = w[iS-1:iS+k-1]
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# idzp_aid.f
+#------------------------------------------------------------------------------
+
+def idzp_aid(eps, A):
+    """
+    Compute ID of a complex matrix to a specified relative precision using
+    random sampling.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Rank of ID.
+    :rtype: int
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    n2, w = idz_frmi(m)
+    proj = np.empty(n*(2*n2 + 1) + n2 + 1, dtype='complex128', order='F')
+    k, idx, proj = _id.idzp_aid(eps, A, w, proj)
+    proj = proj[:k*(n-k)].reshape((k, n-k), order='F')
+    return k, idx, proj
+
+
+def idz_estrank(eps, A):
+    """
+    Estimate rank of a complex matrix to a specified relative precision using
+    random sampling.
+
+    The output rank is typically about 8 higher than the actual rank.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Rank estimate.
+    :rtype: int
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    n2, w = idz_frmi(m)
+    ra = np.empty(n*n2 + (n + 1)*(n2 + 1), dtype='complex128', order='F')
+    k, ra = _id.idz_estrank(eps, A, w, ra)
+    return k
+
+
+#------------------------------------------------------------------------------
+# idzp_asvd.f
+#------------------------------------------------------------------------------
+
+def idzp_asvd(eps, A):
+    """
+    Compute SVD of a complex matrix to a specified relative precision using
+    random sampling.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    n2, winit = _id.idz_frmi(m)
+    w = np.empty(
+        max((min(m, n) + 1)*(3*m + 5*n + 11) + 8*min(m, n)**2,
+            (2*n + 1)*(n2 + 1)),
+        dtype=np.complex128, order='F')
+    k, iU, iV, iS, w, ier = _id.idzp_asvd(eps, A, winit, w)
+    if ier:
+        raise _RETCODE_ERROR
+    U = w[iU-1:iU+m*k-1].reshape((m, k), order='F')
+    V = w[iV-1:iV+n*k-1].reshape((n, k), order='F')
+    S = w[iS-1:iS+k-1]
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# idzp_rid.f
+#------------------------------------------------------------------------------
+
+def idzp_rid(eps, m, n, matveca):
+    """
+    Compute ID of a complex matrix to a specified relative precision using
+    random matrix-vector multiplication.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matveca:
+        Function to apply the matrix adjoint to a vector, with call signature
+        `y = matveca(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matveca: function
+
+    :return:
+        Rank of ID.
+    :rtype: int
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    proj = np.empty(
+        m + 1 + 2*n*(min(m, n) + 1),
+        dtype=np.complex128, order='F')
+    k, idx, proj, ier = _id.idzp_rid(eps, m, n, matveca, proj)
+    if ier:
+        raise _RETCODE_ERROR
+    proj = proj[:k*(n-k)].reshape((k, n-k), order='F')
+    return k, idx, proj
+
+
+def idz_findrank(eps, m, n, matveca):
+    """
+    Estimate rank of a complex matrix to a specified relative precision using
+    random matrix-vector multiplication.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matveca:
+        Function to apply the matrix adjoint to a vector, with call signature
+        `y = matveca(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matveca: function
+
+    :return:
+        Rank estimate.
+    :rtype: int
+    """
+    k, ra, ier = _id.idz_findrank(eps, m, n, matveca)
+    if ier:
+        raise _RETCODE_ERROR
+    return k
+
+
+#------------------------------------------------------------------------------
+# idzp_rsvd.f
+#------------------------------------------------------------------------------
+
+def idzp_rsvd(eps, m, n, matveca, matvec):
+    """
+    Compute SVD of a complex matrix to a specified relative precision using
+    random matrix-vector multiplication.
+
+    :param eps:
+        Relative precision.
+    :type eps: float
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matveca:
+        Function to apply the matrix adjoint to a vector, with call signature
+        `y = matveca(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matveca: function
+    :param matvec:
+        Function to apply the matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    k, iU, iV, iS, w, ier = _id.idzp_rsvd(eps, m, n, matveca, matvec)
+    if ier:
+        raise _RETCODE_ERROR
+    U = w[iU-1:iU+m*k-1].reshape((m, k), order='F')
+    V = w[iV-1:iV+n*k-1].reshape((n, k), order='F')
+    S = w[iS-1:iS+k-1]
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# idzr_aid.f
+#------------------------------------------------------------------------------
+
+def idzr_aid(A, k):
+    """
+    Compute ID of a complex matrix to a specified rank using random sampling.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    w = idzr_aidi(m, n, k)
+    idx, proj = _id.idzr_aid(A, k, w)
+    if k == n:
+        proj = np.empty((k, n-k), dtype='complex128', order='F')
+    else:
+        proj = proj.reshape((k, n-k), order='F')
+    return idx, proj
+
+
+def idzr_aidi(m, n, k):
+    """
+    Initialize array for :func:`idzr_aid`.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Initialization array to be used by :func:`idzr_aid`.
+    :rtype: :class:`numpy.ndarray`
+    """
+    return _id.idzr_aidi(m, n, k)
+
+
+#------------------------------------------------------------------------------
+# idzr_asvd.f
+#------------------------------------------------------------------------------
+
+def idzr_asvd(A, k):
+    """
+    Compute SVD of a complex matrix to a specified rank using random sampling.
+
+    :param A:
+        Matrix.
+    :type A: :class:`numpy.ndarray`
+    :param k:
+        Rank of SVD.
+    :type k: int
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    A = np.asfortranarray(A)
+    m, n = A.shape
+    w = np.empty(
+        (2*k + 22)*m + (6*k + 21)*n + 8*k**2 + 10*k + 90,
+        dtype='complex128', order='F')
+    w_ = idzr_aidi(m, n, k)
+    w[:w_.size] = w_
+    U, V, S, ier = _id.idzr_asvd(A, k, w)
+    if ier:
+        raise _RETCODE_ERROR
+    return U, V, S
+
+
+#------------------------------------------------------------------------------
+# idzr_rid.f
+#------------------------------------------------------------------------------
+
+def idzr_rid(m, n, matveca, k):
+    """
+    Compute ID of a complex matrix to a specified rank using random
+    matrix-vector multiplication.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matveca:
+        Function to apply the matrix adjoint to a vector, with call signature
+        `y = matveca(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matveca: function
+    :param k:
+        Rank of ID.
+    :type k: int
+
+    :return:
+        Column index array.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Interpolation coefficients.
+    :rtype: :class:`numpy.ndarray`
+    """
+    idx, proj = _id.idzr_rid(m, n, matveca, k)
+    proj = proj[:k*(n-k)].reshape((k, n-k), order='F')
+    return idx, proj
+
+
+#------------------------------------------------------------------------------
+# idzr_rsvd.f
+#------------------------------------------------------------------------------
+
+def idzr_rsvd(m, n, matveca, matvec, k):
+    """
+    Compute SVD of a complex matrix to a specified rank using random
+    matrix-vector multiplication.
+
+    :param m:
+        Matrix row dimension.
+    :type m: int
+    :param n:
+        Matrix column dimension.
+    :type n: int
+    :param matveca:
+        Function to apply the matrix adjoint to a vector, with call signature
+        `y = matveca(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matveca: function
+    :param matvec:
+        Function to apply the matrix to a vector, with call signature
+        `y = matvec(x)`, where `x` and `y` are the input and output vectors,
+        respectively.
+    :type matvec: function
+    :param k:
+        Rank of SVD.
+    :type k: int
+
+    :return:
+        Left singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Right singular vectors.
+    :rtype: :class:`numpy.ndarray`
+    :return:
+        Singular values.
+    :rtype: :class:`numpy.ndarray`
+    """
+    U, V, S, ier = _id.idzr_rsvd(m, n, matveca, matvec, k)
+    if ier:
+        raise _RETCODE_ERROR
+    return U, V, S

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_matfuncs_expm.pyi

@@ -0,0 +1,6 @@
+from numpy.typing import NDArray
+from typing import Any
+
+def pick_pade_structure(a: NDArray[Any]) -> tuple[int, int]: ...
+
+def pade_UV_calc(Am: NDArray[Any], n: int, m: int) -> None: ...

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_matfuncs_inv_ssq.py

@@ -0,0 +1,886 @@
+"""
+Matrix functions that use Pade approximation with inverse scaling and squaring.
+
+"""
+import warnings
+
+import numpy as np
+
+from scipy.linalg._matfuncs_sqrtm import SqrtmError, _sqrtm_triu
+from scipy.linalg._decomp_schur import schur, rsf2csf
+from scipy.linalg._matfuncs import funm
+from scipy.linalg import svdvals, solve_triangular
+from scipy.sparse.linalg._interface import LinearOperator
+from scipy.sparse.linalg import onenormest
+import scipy.special
+
+
+class LogmRankWarning(UserWarning):
+    pass
+
+
+class LogmExactlySingularWarning(LogmRankWarning):
+    pass
+
+
+class LogmNearlySingularWarning(LogmRankWarning):
+    pass
+
+
+class LogmError(np.linalg.LinAlgError):
+    pass
+
+
+class FractionalMatrixPowerError(np.linalg.LinAlgError):
+    pass
+
+
+#TODO renovate or move this class when scipy operators are more mature
+class _MatrixM1PowerOperator(LinearOperator):
+    """
+    A representation of the linear operator (A - I)^p.
+    """
+
+    def __init__(self, A, p):
+        if A.ndim != 2 or A.shape[0] != A.shape[1]:
+            raise ValueError('expected A to be like a square matrix')
+        if p < 0 or p != int(p):
+            raise ValueError('expected p to be a non-negative integer')
+        self._A = A
+        self._p = p
+        self.ndim = A.ndim
+        self.shape = A.shape
+
+    def _matvec(self, x):
+        for i in range(self._p):
+            x = self._A.dot(x) - x
+        return x
+
+    def _rmatvec(self, x):
+        for i in range(self._p):
+            x = x.dot(self._A) - x
+        return x
+
+    def _matmat(self, X):
+        for i in range(self._p):
+            X = self._A.dot(X) - X
+        return X
+
+    def _adjoint(self):
+        return _MatrixM1PowerOperator(self._A.T, self._p)
+
+
+#TODO renovate or move this function when SciPy operators are more mature
+def _onenormest_m1_power(A, p,
+        t=2, itmax=5, compute_v=False, compute_w=False):
+    """
+    Efficiently estimate the 1-norm of (A - I)^p.
+
+    Parameters
+    ----------
+    A : ndarray
+        Matrix whose 1-norm of a power is to be computed.
+    p : int
+        Non-negative integer power.
+    t : int, optional
+        A positive parameter controlling the tradeoff between
+        accuracy versus time and memory usage.
+        Larger values take longer and use more memory
+        but give more accurate output.
+    itmax : int, optional
+        Use at most this many iterations.
+    compute_v : bool, optional
+        Request a norm-maximizing linear operator input vector if True.
+    compute_w : bool, optional
+        Request a norm-maximizing linear operator output vector if True.
+
+    Returns
+    -------
+    est : float
+        An underestimate of the 1-norm of the sparse matrix.
+    v : ndarray, optional
+        The vector such that ||Av||_1 == est*||v||_1.
+        It can be thought of as an input to the linear operator
+        that gives an output with particularly large norm.
+    w : ndarray, optional
+        The vector Av which has relatively large 1-norm.
+        It can be thought of as an output of the linear operator
+        that is relatively large in norm compared to the input.
+
+    """
+    return onenormest(_MatrixM1PowerOperator(A, p),
+            t=t, itmax=itmax, compute_v=compute_v, compute_w=compute_w)
+
+
+def _unwindk(z):
+    """
+    Compute the scalar unwinding number.
+
+    Uses Eq. (5.3) in [1]_, and should be equal to (z - log(exp(z)) / (2 pi i).
+    Note that this definition differs in sign from the original definition
+    in equations (5, 6) in [2]_.  The sign convention is justified in [3]_.
+
+    Parameters
+    ----------
+    z : complex
+        A complex number.
+
+    Returns
+    -------
+    unwinding_number : integer
+        The scalar unwinding number of z.
+
+    References
+    ----------
+    .. [1] Nicholas J. Higham and Lijing lin (2011)
+           "A Schur-Pade Algorithm for Fractional Powers of a Matrix."
+           SIAM Journal on Matrix Analysis and Applications,
+           32 (3). pp. 1056-1078. ISSN 0895-4798
+
+    .. [2] Robert M. Corless and David J. Jeffrey,
+           "The unwinding number." Newsletter ACM SIGSAM Bulletin
+           Volume 30, Issue 2, June 1996, Pages 28-35.
+
+    .. [3] Russell Bradford and Robert M. Corless and James H. Davenport and
+           David J. Jeffrey and Stephen M. Watt,
+           "Reasoning about the elementary functions of complex analysis"
+           Annals of Mathematics and Artificial Intelligence,
+           36: 303-318, 2002.
+
+    """
+    return int(np.ceil((z.imag - np.pi) / (2*np.pi)))
+
+
+def _briggs_helper_function(a, k):
+    """
+    Computes r = a^(1 / (2^k)) - 1.
+
+    This is algorithm (2) of [1]_.
+    The purpose is to avoid a danger of subtractive cancellation.
+    For more computational efficiency it should probably be cythonized.
+
+    Parameters
+    ----------
+    a : complex
+        A complex number.
+    k : integer
+        A nonnegative integer.
+
+    Returns
+    -------
+    r : complex
+        The value r = a^(1 / (2^k)) - 1 computed with less cancellation.
+
+    Notes
+    -----
+    The algorithm as formulated in the reference does not handle k=0 or k=1
+    correctly, so these are special-cased in this implementation.
+    This function is intended to not allow `a` to belong to the closed
+    negative real axis, but this constraint is relaxed.
+
+    References
+    ----------
+    .. [1] Awad H. Al-Mohy (2012)
+           "A more accurate Briggs method for the logarithm",
+           Numerical Algorithms, 59 : 393--402.
+
+    """
+    if k < 0 or int(k) != k:
+        raise ValueError('expected a nonnegative integer k')
+    if k == 0:
+        return a - 1
+    elif k == 1:
+        return np.sqrt(a) - 1
+    else:
+        k_hat = k
+        if np.angle(a) >= np.pi / 2:
+            a = np.sqrt(a)
+            k_hat = k - 1
+        z0 = a - 1
+        a = np.sqrt(a)
+        r = 1 + a
+        for j in range(1, k_hat):
+            a = np.sqrt(a)
+            r = r * (1 + a)
+        r = z0 / r
+        return r
+
+
+def _fractional_power_superdiag_entry(l1, l2, t12, p):
+    """
+    Compute a superdiagonal entry of a fractional matrix power.
+
+    This is Eq. (5.6) in [1]_.
+
+    Parameters
+    ----------
+    l1 : complex
+        A diagonal entry of the matrix.
+    l2 : complex
+        A diagonal entry of the matrix.
+    t12 : complex
+        A superdiagonal entry of the matrix.
+    p : float
+        A fractional power.
+
+    Returns
+    -------
+    f12 : complex
+        A superdiagonal entry of the fractional matrix power.
+
+    Notes
+    -----
+    Care has been taken to return a real number if possible when
+    all of the inputs are real numbers.
+
+    References
+    ----------
+    .. [1] Nicholas J. Higham and Lijing lin (2011)
+           "A Schur-Pade Algorithm for Fractional Powers of a Matrix."
+           SIAM Journal on Matrix Analysis and Applications,
+           32 (3). pp. 1056-1078. ISSN 0895-4798
+
+    """
+    if l1 == l2:
+        f12 = t12 * p * l1**(p-1)
+    elif abs(l2 - l1) > abs(l1 + l2) / 2:
+        f12 = t12 * ((l2**p) - (l1**p)) / (l2 - l1)
+    else:
+        # This is Eq. (5.5) in [1].
+        z = (l2 - l1) / (l2 + l1)
+        log_l1 = np.log(l1)
+        log_l2 = np.log(l2)
+        arctanh_z = np.arctanh(z)
+        tmp_a = t12 * np.exp((p/2)*(log_l2 + log_l1))
+        tmp_u = _unwindk(log_l2 - log_l1)
+        if tmp_u:
+            tmp_b = p * (arctanh_z + np.pi * 1j * tmp_u)
+        else:
+            tmp_b = p * arctanh_z
+        tmp_c = 2 * np.sinh(tmp_b) / (l2 - l1)
+        f12 = tmp_a * tmp_c
+    return f12
+
+
+def _logm_superdiag_entry(l1, l2, t12):
+    """
+    Compute a superdiagonal entry of a matrix logarithm.
+
+    This is like Eq. (11.28) in [1]_, except the determination of whether
+    l1 and l2 are sufficiently far apart has been modified.
+
+    Parameters
+    ----------
+    l1 : complex
+        A diagonal entry of the matrix.
+    l2 : complex
+        A diagonal entry of the matrix.
+    t12 : complex
+        A superdiagonal entry of the matrix.
+
+    Returns
+    -------
+    f12 : complex
+        A superdiagonal entry of the matrix logarithm.
+
+    Notes
+    -----
+    Care has been taken to return a real number if possible when
+    all of the inputs are real numbers.
+
+    References
+    ----------
+    .. [1] Nicholas J. Higham (2008)
+           "Functions of Matrices: Theory and Computation"
+           ISBN 978-0-898716-46-7
+
+    """
+    if l1 == l2:
+        f12 = t12 / l1
+    elif abs(l2 - l1) > abs(l1 + l2) / 2:
+        f12 = t12 * (np.log(l2) - np.log(l1)) / (l2 - l1)
+    else:
+        z = (l2 - l1) / (l2 + l1)
+        u = _unwindk(np.log(l2) - np.log(l1))
+        if u:
+            f12 = t12 * 2 * (np.arctanh(z) + np.pi*1j*u) / (l2 - l1)
+        else:
+            f12 = t12 * 2 * np.arctanh(z) / (l2 - l1)
+    return f12
+
+
+def _inverse_squaring_helper(T0, theta):
+    """
+    A helper function for inverse scaling and squaring for Pade approximation.
+
+    Parameters
+    ----------
+    T0 : (N, N) array_like upper triangular
+        Matrix involved in inverse scaling and squaring.
+    theta : indexable
+        The values theta[1] .. theta[7] must be available.
+        They represent bounds related to Pade approximation, and they depend
+        on the matrix function which is being computed.
+        For example, different values of theta are required for
+        matrix logarithm than for fractional matrix power.
+
+    Returns
+    -------
+    R : (N, N) array_like upper triangular
+        Composition of zero or more matrix square roots of T0, minus I.
+    s : non-negative integer
+        Number of square roots taken.
+    m : positive integer
+        The degree of the Pade approximation.
+
+    Notes
+    -----
+    This subroutine appears as a chunk of lines within
+    a couple of published algorithms; for example it appears
+    as lines 4--35 in algorithm (3.1) of [1]_, and
+    as lines 3--34 in algorithm (4.1) of [2]_.
+    The instances of 'goto line 38' in algorithm (3.1) of [1]_
+    probably mean 'goto line 36' and have been interpreted accordingly.
+
+    References
+    ----------
+    .. [1] Nicholas J. Higham and Lijing Lin (2013)
+           "An Improved Schur-Pade Algorithm for Fractional Powers
+           of a Matrix and their Frechet Derivatives."
+
+    .. [2] Awad H. Al-Mohy and Nicholas J. Higham (2012)
+           "Improved Inverse Scaling and Squaring Algorithms
+           for the Matrix Logarithm."
+           SIAM Journal on Scientific Computing, 34 (4). C152-C169.
+           ISSN 1095-7197
+
+    """
+    if len(T0.shape) != 2 or T0.shape[0] != T0.shape[1]:
+        raise ValueError('expected an upper triangular square matrix')
+    n, n = T0.shape
+    T = T0
+
+    # Find s0, the smallest s such that the spectral radius
+    # of a certain diagonal matrix is at most theta[7].
+    # Note that because theta[7] < 1,
+    # this search will not terminate if any diagonal entry of T is zero.
+    s0 = 0
+    tmp_diag = np.diag(T)
+    if np.count_nonzero(tmp_diag) != n:
+        raise Exception('Diagonal entries of T must be nonzero')
+    while np.max(np.absolute(tmp_diag - 1)) > theta[7]:
+        tmp_diag = np.sqrt(tmp_diag)
+        s0 += 1
+
+    # Take matrix square roots of T.
+    for i in range(s0):
+        T = _sqrtm_triu(T)
+
+    # Flow control in this section is a little odd.
+    # This is because I am translating algorithm descriptions
+    # which have GOTOs in the publication.
+    s = s0
+    k = 0
+    d2 = _onenormest_m1_power(T, 2) ** (1/2)
+    d3 = _onenormest_m1_power(T, 3) ** (1/3)
+    a2 = max(d2, d3)
+    m = None
+    for i in (1, 2):
+        if a2 <= theta[i]:
+            m = i
+            break
+    while m is None:
+        if s > s0:
+            d3 = _onenormest_m1_power(T, 3) ** (1/3)
+        d4 = _onenormest_m1_power(T, 4) ** (1/4)
+        a3 = max(d3, d4)
+        if a3 <= theta[7]:
+            j1 = min(i for i in (3, 4, 5, 6, 7) if a3 <= theta[i])
+            if j1 <= 6:
+                m = j1
+                break
+            elif a3 / 2 <= theta[5] and k < 2:
+                k += 1
+                T = _sqrtm_triu(T)
+                s += 1
+                continue
+        d5 = _onenormest_m1_power(T, 5) ** (1/5)
+        a4 = max(d4, d5)
+        eta = min(a3, a4)
+        for i in (6, 7):
+            if eta <= theta[i]:
+                m = i
+                break
+        if m is not None:
+            break
+        T = _sqrtm_triu(T)
+        s += 1
+
+    # The subtraction of the identity is redundant here,
+    # because the diagonal will be replaced for improved numerical accuracy,
+    # but this formulation should help clarify the meaning of R.
+    R = T - np.identity(n)
+
+    # Replace the diagonal and first superdiagonal of T0^(1/(2^s)) - I
+    # using formulas that have less subtractive cancellation.
+    # Skip this step if the principal branch
+    # does not exist at T0; this happens when a diagonal entry of T0
+    # is negative with imaginary part 0.
+    has_principal_branch = all(x.real > 0 or x.imag != 0 for x in np.diag(T0))
+    if has_principal_branch:
+        for j in range(n):
+            a = T0[j, j]
+            r = _briggs_helper_function(a, s)
+            R[j, j] = r
+        p = np.exp2(-s)
+        for j in range(n-1):
+            l1 = T0[j, j]
+            l2 = T0[j+1, j+1]
+            t12 = T0[j, j+1]
+            f12 = _fractional_power_superdiag_entry(l1, l2, t12, p)
+            R[j, j+1] = f12
+
+    # Return the T-I matrix, the number of square roots, and the Pade degree.
+    if not np.array_equal(R, np.triu(R)):
+        raise Exception('R is not upper triangular')
+    return R, s, m
+
+
+def _fractional_power_pade_constant(i, t):
+    # A helper function for matrix fractional power.
+    if i < 1:
+        raise ValueError('expected a positive integer i')
+    if not (-1 < t < 1):
+        raise ValueError('expected -1 < t < 1')
+    if i == 1:
+        return -t
+    elif i % 2 == 0:
+        j = i // 2
+        return (-j + t) / (2 * (2*j - 1))
+    elif i % 2 == 1:
+        j = (i - 1) // 2
+        return (-j - t) / (2 * (2*j + 1))
+    else:
+        raise Exception(f'unnexpected value of i, i = {i}')
+
+
+def _fractional_power_pade(R, t, m):
+    """
+    Evaluate the Pade approximation of a fractional matrix power.
+
+    Evaluate the degree-m Pade approximation of R
+    to the fractional matrix power t using the continued fraction
+    in bottom-up fashion using algorithm (4.1) in [1]_.
+
+    Parameters
+    ----------
+    R : (N, N) array_like
+        Upper triangular matrix whose fractional power to evaluate.
+    t : float
+        Fractional power between -1 and 1 exclusive.
+    m : positive integer
+        Degree of Pade approximation.
+
+    Returns
+    -------
+    U : (N, N) array_like
+        The degree-m Pade approximation of R to the fractional power t.
+        This matrix will be upper triangular.
+
+    References
+    ----------
+    .. [1] Nicholas J. Higham and Lijing lin (2011)
+           "A Schur-Pade Algorithm for Fractional Powers of a Matrix."
+           SIAM Journal on Matrix Analysis and Applications,
+           32 (3). pp. 1056-1078. ISSN 0895-4798
+
+    """
+    if m < 1 or int(m) != m:
+        raise ValueError('expected a positive integer m')
+    if not (-1 < t < 1):
+        raise ValueError('expected -1 < t < 1')
+    R = np.asarray(R)
+    if len(R.shape) != 2 or R.shape[0] != R.shape[1]:
+        raise ValueError('expected an upper triangular square matrix')
+    n, n = R.shape
+    ident = np.identity(n)
+    Y = R * _fractional_power_pade_constant(2*m, t)
+    for j in range(2*m - 1, 0, -1):
+        rhs = R * _fractional_power_pade_constant(j, t)
+        Y = solve_triangular(ident + Y, rhs)
+    U = ident + Y
+    if not np.array_equal(U, np.triu(U)):
+        raise Exception('U is not upper triangular')
+    return U
+
+
+def _remainder_matrix_power_triu(T, t):
+    """
+    Compute a fractional power of an upper triangular matrix.
+
+    The fractional power is restricted to fractions -1 < t < 1.
+    This uses algorithm (3.1) of [1]_.
+    The Pade approximation itself uses algorithm (4.1) of [2]_.
+
+    Parameters
+    ----------
+    T : (N, N) array_like
+        Upper triangular matrix whose fractional power to evaluate.
+    t : float
+        Fractional power between -1 and 1 exclusive.
+
+    Returns
+    -------
+    X : (N, N) array_like
+        The fractional power of the matrix.
+
+    References
+    ----------
+    .. [1] Nicholas J. Higham and Lijing Lin (2013)
+           "An Improved Schur-Pade Algorithm for Fractional Powers
+           of a Matrix and their Frechet Derivatives."
+
+    .. [2] Nicholas J. Higham and Lijing lin (2011)
+           "A Schur-Pade Algorithm for Fractional Powers of a Matrix."
+           SIAM Journal on Matrix Analysis and Applications,
+           32 (3). pp. 1056-1078. ISSN 0895-4798
+
+    """
+    m_to_theta = {
+            1: 1.51e-5,
+            2: 2.24e-3,
+            3: 1.88e-2,
+            4: 6.04e-2,
+            5: 1.24e-1,
+            6: 2.00e-1,
+            7: 2.79e-1,
+            }
+    n, n = T.shape
+    T0 = T
+    T0_diag = np.diag(T0)
+    if np.array_equal(T0, np.diag(T0_diag)):
+        U = np.diag(T0_diag ** t)
+    else:
+        R, s, m = _inverse_squaring_helper(T0, m_to_theta)
+
+        # Evaluate the Pade approximation.
+        # Note that this function expects the negative of the matrix
+        # returned by the inverse squaring helper.
+        U = _fractional_power_pade(-R, t, m)
+
+        # Undo the inverse scaling and squaring.
+        # Be less clever about this
+        # if the principal branch does not exist at T0;
+        # this happens when a diagonal entry of T0
+        # is negative with imaginary part 0.
+        eivals = np.diag(T0)
+        has_principal_branch = all(x.real > 0 or x.imag != 0 for x in eivals)
+        for i in range(s, -1, -1):
+            if i < s:
+                U = U.dot(U)
+            else:
+                if has_principal_branch:
+                    p = t * np.exp2(-i)
+                    U[np.diag_indices(n)] = T0_diag ** p
+                    for j in range(n-1):
+                        l1 = T0[j, j]
+                        l2 = T0[j+1, j+1]
+                        t12 = T0[j, j+1]
+                        f12 = _fractional_power_superdiag_entry(l1, l2, t12, p)
+                        U[j, j+1] = f12
+    if not np.array_equal(U, np.triu(U)):
+        raise Exception('U is not upper triangular')
+    return U
+
+
+def _remainder_matrix_power(A, t):
+    """
+    Compute the fractional power of a matrix, for fractions -1 < t < 1.
+
+    This uses algorithm (3.1) of [1]_.
+    The Pade approximation itself uses algorithm (4.1) of [2]_.
+
+    Parameters
+    ----------
+    A : (N, N) array_like
+        Matrix whose fractional power to evaluate.
+    t : float
+        Fractional power between -1 and 1 exclusive.
+
+    Returns
+    -------
+    X : (N, N) array_like
+        The fractional power of the matrix.
+
+    References
+    ----------
+    .. [1] Nicholas J. Higham and Lijing Lin (2013)
+           "An Improved Schur-Pade Algorithm for Fractional Powers
+           of a Matrix and their Frechet Derivatives."
+
+    .. [2] Nicholas J. Higham and Lijing lin (2011)
+           "A Schur-Pade Algorithm for Fractional Powers of a Matrix."
+           SIAM Journal on Matrix Analysis and Applications,
+           32 (3). pp. 1056-1078. ISSN 0895-4798
+
+    """
+    # This code block is copied from numpy.matrix_power().
+    A = np.asarray(A)
+    if len(A.shape) != 2 or A.shape[0] != A.shape[1]:
+        raise ValueError('input must be a square array')
+
+    # Get the number of rows and columns.
+    n, n = A.shape
+
+    # Triangularize the matrix if necessary,
+    # attempting to preserve dtype if possible.
+    if np.array_equal(A, np.triu(A)):
+        Z = None
+        T = A
+    else:
+        if np.isrealobj(A):
+            T, Z = schur(A)
+            if not np.array_equal(T, np.triu(T)):
+                T, Z = rsf2csf(T, Z)
+        else:
+            T, Z = schur(A, output='complex')
+
+    # Zeros on the diagonal of the triangular matrix are forbidden,
+    # because the inverse scaling and squaring cannot deal with it.
+    T_diag = np.diag(T)
+    if np.count_nonzero(T_diag) != n:
+        raise FractionalMatrixPowerError(
+                'cannot use inverse scaling and squaring to find '
+                'the fractional matrix power of a singular matrix')
+
+    # If the triangular matrix is real and has a negative
+    # entry on the diagonal, then force the matrix to be complex.
+    if np.isrealobj(T) and np.min(T_diag) < 0:
+        T = T.astype(complex)
+
+    # Get the fractional power of the triangular matrix,
+    # and de-triangularize it if necessary.
+    U = _remainder_matrix_power_triu(T, t)
+    if Z is not None:
+        ZH = np.conjugate(Z).T
+        return Z.dot(U).dot(ZH)
+    else:
+        return U
+
+
+def _fractional_matrix_power(A, p):
+    """
+    Compute the fractional power of a matrix.
+
+    See the fractional_matrix_power docstring in matfuncs.py for more info.
+
+    """
+    A = np.asarray(A)
+    if len(A.shape) != 2 or A.shape[0] != A.shape[1]:
+        raise ValueError('expected a square matrix')
+    if p == int(p):
+        return np.linalg.matrix_power(A, int(p))
+    # Compute singular values.
+    s = svdvals(A)
+    # Inverse scaling and squaring cannot deal with a singular matrix,
+    # because the process of repeatedly taking square roots
+    # would not converge to the identity matrix.
+    if s[-1]:
+        # Compute the condition number relative to matrix inversion,
+        # and use this to decide between floor(p) and ceil(p).
+        k2 = s[0] / s[-1]
+        p1 = p - np.floor(p)
+        p2 = p - np.ceil(p)
+        if p1 * k2 ** (1 - p1) <= -p2 * k2:
+            a = int(np.floor(p))
+            b = p1
+        else:
+            a = int(np.ceil(p))
+            b = p2
+        try:
+            R = _remainder_matrix_power(A, b)
+            Q = np.linalg.matrix_power(A, a)
+            return Q.dot(R)
+        except np.linalg.LinAlgError:
+            pass
+    # If p is negative then we are going to give up.
+    # If p is non-negative then we can fall back to generic funm.
+    if p < 0:
+        X = np.empty_like(A)
+        X.fill(np.nan)
+        return X
+    else:
+        p1 = p - np.floor(p)
+        a = int(np.floor(p))
+        b = p1
+        R, info = funm(A, lambda x: pow(x, b), disp=False)
+        Q = np.linalg.matrix_power(A, a)
+        return Q.dot(R)
+
+
+def _logm_triu(T):
+    """
+    Compute matrix logarithm of an upper triangular matrix.
+
+    The matrix logarithm is the inverse of
+    expm: expm(logm(`T`)) == `T`
+
+    Parameters
+    ----------
+    T : (N, N) array_like
+        Upper triangular matrix whose logarithm to evaluate
+
+    Returns
+    -------
+    logm : (N, N) ndarray
+        Matrix logarithm of `T`
+
+    References
+    ----------
+    .. [1] Awad H. Al-Mohy and Nicholas J. Higham (2012)
+           "Improved Inverse Scaling and Squaring Algorithms
+           for the Matrix Logarithm."
+           SIAM Journal on Scientific Computing, 34 (4). C152-C169.
+           ISSN 1095-7197
+
+    .. [2] Nicholas J. Higham (2008)
+           "Functions of Matrices: Theory and Computation"
+           ISBN 978-0-898716-46-7
+
+    .. [3] Nicholas J. Higham and Lijing lin (2011)
+           "A Schur-Pade Algorithm for Fractional Powers of a Matrix."
+           SIAM Journal on Matrix Analysis and Applications,
+           32 (3). pp. 1056-1078. ISSN 0895-4798
+
+    """
+    T = np.asarray(T)
+    if len(T.shape) != 2 or T.shape[0] != T.shape[1]:
+        raise ValueError('expected an upper triangular square matrix')
+    n, n = T.shape
+
+    # Construct T0 with the appropriate type,
+    # depending on the dtype and the spectrum of T.
+    T_diag = np.diag(T)
+    keep_it_real = np.isrealobj(T) and np.min(T_diag) >= 0
+    if keep_it_real:
+        T0 = T
+    else:
+        T0 = T.astype(complex)
+
+    # Define bounds given in Table (2.1).
+    theta = (None,
+            1.59e-5, 2.31e-3, 1.94e-2, 6.21e-2,
+            1.28e-1, 2.06e-1, 2.88e-1, 3.67e-1,
+            4.39e-1, 5.03e-1, 5.60e-1, 6.09e-1,
+            6.52e-1, 6.89e-1, 7.21e-1, 7.49e-1)
+
+    R, s, m = _inverse_squaring_helper(T0, theta)
+
+    # Evaluate U = 2**s r_m(T - I) using the partial fraction expansion (1.1).
+    # This requires the nodes and weights
+    # corresponding to degree-m Gauss-Legendre quadrature.
+    # These quadrature arrays need to be transformed from the [-1, 1] interval
+    # to the [0, 1] interval.
+    nodes, weights = scipy.special.p_roots(m)
+    nodes = nodes.real
+    if nodes.shape != (m,) or weights.shape != (m,):
+        raise Exception('internal error')
+    nodes = 0.5 + 0.5 * nodes
+    weights = 0.5 * weights
+    ident = np.identity(n)
+    U = np.zeros_like(R)
+    for alpha, beta in zip(weights, nodes):
+        U += solve_triangular(ident + beta*R, alpha*R)
+    U *= np.exp2(s)
+
+    # Skip this step if the principal branch
+    # does not exist at T0; this happens when a diagonal entry of T0
+    # is negative with imaginary part 0.
+    has_principal_branch = all(x.real > 0 or x.imag != 0 for x in np.diag(T0))
+    if has_principal_branch:
+
+        # Recompute diagonal entries of U.
+        U[np.diag_indices(n)] = np.log(np.diag(T0))
+
+        # Recompute superdiagonal entries of U.
+        # This indexing of this code should be renovated
+        # when newer np.diagonal() becomes available.
+        for i in range(n-1):
+            l1 = T0[i, i]
+            l2 = T0[i+1, i+1]
+            t12 = T0[i, i+1]
+            U[i, i+1] = _logm_superdiag_entry(l1, l2, t12)
+
+    # Return the logm of the upper triangular matrix.
+    if not np.array_equal(U, np.triu(U)):
+        raise Exception('U is not upper triangular')
+    return U
+
+
+def _logm_force_nonsingular_triangular_matrix(T, inplace=False):
+    # The input matrix should be upper triangular.
+    # The eps is ad hoc and is not meant to be machine precision.
+    tri_eps = 1e-20
+    abs_diag = np.absolute(np.diag(T))
+    if np.any(abs_diag == 0):
+        exact_singularity_msg = 'The logm input matrix is exactly singular.'
+        warnings.warn(exact_singularity_msg, LogmExactlySingularWarning, stacklevel=3)
+        if not inplace:
+            T = T.copy()
+        n = T.shape[0]
+        for i in range(n):
+            if not T[i, i]:
+                T[i, i] = tri_eps
+    elif np.any(abs_diag < tri_eps):
+        near_singularity_msg = 'The logm input matrix may be nearly singular.'
+        warnings.warn(near_singularity_msg, LogmNearlySingularWarning, stacklevel=3)
+    return T
+
+
+def _logm(A):
+    """
+    Compute the matrix logarithm.
+
+    See the logm docstring in matfuncs.py for more info.
+
+    Notes
+    -----
+    In this function we look at triangular matrices that are similar
+    to the input matrix. If any diagonal entry of such a triangular matrix
+    is exactly zero then the original matrix is singular.
+    The matrix logarithm does not exist for such matrices,
+    but in such cases we will pretend that the diagonal entries that are zero
+    are actually slightly positive by an ad-hoc amount, in the interest
+    of returning something more useful than NaN. This will cause a warning.
+
+    """
+    A = np.asarray(A)
+    if len(A.shape) != 2 or A.shape[0] != A.shape[1]:
+        raise ValueError('expected a square matrix')
+
+    # If the input matrix dtype is integer then copy to a float dtype matrix.
+    if issubclass(A.dtype.type, np.integer):
+        A = np.asarray(A, dtype=float)
+
+    keep_it_real = np.isrealobj(A)
+    try:
+        if np.array_equal(A, np.triu(A)):
+            A = _logm_force_nonsingular_triangular_matrix(A)
+            if np.min(np.diag(A)) < 0:
+                A = A.astype(complex)
+            return _logm_triu(A)
+        else:
+            if keep_it_real:
+                T, Z = schur(A)
+                if not np.array_equal(T, np.triu(T)):
+                    T, Z = rsf2csf(T, Z)
+            else:
+                T, Z = schur(A, output='complex')
+            T = _logm_force_nonsingular_triangular_matrix(T, inplace=True)
+            U = _logm_triu(T)
+            ZH = np.conjugate(Z).T
+            return Z.dot(U).dot(ZH)
+    except (SqrtmError, LogmError):
+        X = np.empty_like(A)
+        X.fill(np.nan)
+        return X

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_sketches.py

@@ -0,0 +1,179 @@
+""" Sketching-based Matrix Computations """
+
+# Author: Jordi Montes <[email protected]>
+# August 28, 2017
+
+import numpy as np
+
+from scipy._lib._util import check_random_state, rng_integers
+from scipy.sparse import csc_matrix
+
+__all__ = ['clarkson_woodruff_transform']
+
+
+def cwt_matrix(n_rows, n_columns, seed=None):
+    r"""
+    Generate a matrix S which represents a Clarkson-Woodruff transform.
+
+    Given the desired size of matrix, the method returns a matrix S of size
+    (n_rows, n_columns) where each column has all the entries set to 0
+    except for one position which has been randomly set to +1 or -1 with
+    equal probability.
+
+    Parameters
+    ----------
+    n_rows : int
+        Number of rows of S
+    n_columns : int
+        Number of columns of S
+    seed : {None, int, `numpy.random.Generator`, `numpy.random.RandomState`}, optional
+        If `seed` is None (or `np.random`), the `numpy.random.RandomState`
+        singleton is used.
+        If `seed` is an int, a new ``RandomState`` instance is used,
+        seeded with `seed`.
+        If `seed` is already a ``Generator`` or ``RandomState`` instance then
+        that instance is used.
+
+    Returns
+    -------
+    S : (n_rows, n_columns) csc_matrix
+        The returned matrix has ``n_columns`` nonzero entries.
+
+    Notes
+    -----
+    Given a matrix A, with probability at least 9/10,
+    .. math:: \|SA\| = (1 \pm \epsilon)\|A\|
+    Where the error epsilon is related to the size of S.
+    """
+    rng = check_random_state(seed)
+    rows = rng_integers(rng, 0, n_rows, n_columns)
+    cols = np.arange(n_columns+1)
+    signs = rng.choice([1, -1], n_columns)
+    S = csc_matrix((signs, rows, cols),shape=(n_rows, n_columns))
+    return S
+
+
+def clarkson_woodruff_transform(input_matrix, sketch_size, seed=None):
+    r"""
+    Applies a Clarkson-Woodruff Transform/sketch to the input matrix.
+
+    Given an input_matrix ``A`` of size ``(n, d)``, compute a matrix ``A'`` of
+    size (sketch_size, d) so that
+
+    .. math:: \|Ax\| \approx \|A'x\|
+
+    with high probability via the Clarkson-Woodruff Transform, otherwise
+    known as the CountSketch matrix.
+
+    Parameters
+    ----------
+    input_matrix : array_like
+        Input matrix, of shape ``(n, d)``.
+    sketch_size : int
+        Number of rows for the sketch.
+    seed : {None, int, `numpy.random.Generator`, `numpy.random.RandomState`}, optional
+        If `seed` is None (or `np.random`), the `numpy.random.RandomState`
+        singleton is used.
+        If `seed` is an int, a new ``RandomState`` instance is used,
+        seeded with `seed`.
+        If `seed` is already a ``Generator`` or ``RandomState`` instance then
+        that instance is used.
+
+    Returns
+    -------
+    A' : array_like
+        Sketch of the input matrix ``A``, of size ``(sketch_size, d)``.
+
+    Notes
+    -----
+    To make the statement
+
+    .. math:: \|Ax\| \approx \|A'x\|
+
+    precise, observe the following result which is adapted from the
+    proof of Theorem 14 of [2]_ via Markov's Inequality. If we have
+    a sketch size ``sketch_size=k`` which is at least
+
+    .. math:: k \geq \frac{2}{\epsilon^2\delta}
+
+    Then for any fixed vector ``x``,
+
+    .. math:: \|Ax\| = (1\pm\epsilon)\|A'x\|
+
+    with probability at least one minus delta.
+
+    This implementation takes advantage of sparsity: computing
+    a sketch takes time proportional to ``A.nnz``. Data ``A`` which
+    is in ``scipy.sparse.csc_matrix`` format gives the quickest
+    computation time for sparse input.
+
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> from scipy import sparse
+    >>> rng = np.random.default_rng()
+    >>> n_rows, n_columns, density, sketch_n_rows = 15000, 100, 0.01, 200
+    >>> A = sparse.rand(n_rows, n_columns, density=density, format='csc')
+    >>> B = sparse.rand(n_rows, n_columns, density=density, format='csr')
+    >>> C = sparse.rand(n_rows, n_columns, density=density, format='coo')
+    >>> D = rng.standard_normal((n_rows, n_columns))
+    >>> SA = linalg.clarkson_woodruff_transform(A, sketch_n_rows) # fastest
+    >>> SB = linalg.clarkson_woodruff_transform(B, sketch_n_rows) # fast
+    >>> SC = linalg.clarkson_woodruff_transform(C, sketch_n_rows) # slower
+    >>> SD = linalg.clarkson_woodruff_transform(D, sketch_n_rows) # slowest
+
+    That said, this method does perform well on dense inputs, just slower
+    on a relative scale.
+
+    References
+    ----------
+    .. [1] Kenneth L. Clarkson and David P. Woodruff. Low rank approximation
+           and regression in input sparsity time. In STOC, 2013.
+    .. [2] David P. Woodruff. Sketching as a tool for numerical linear algebra.
+           In Foundations and Trends in Theoretical Computer Science, 2014.
+
+    Examples
+    --------
+    Create a big dense matrix ``A`` for the example:
+
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> n_rows, n_columns  = 15000, 100
+    >>> rng = np.random.default_rng()
+    >>> A = rng.standard_normal((n_rows, n_columns))
+
+    Apply the transform to create a new matrix with 200 rows:
+
+    >>> sketch_n_rows = 200
+    >>> sketch = linalg.clarkson_woodruff_transform(A, sketch_n_rows, seed=rng)
+    >>> sketch.shape
+    (200, 100)
+
+    Now with high probability, the true norm is close to the sketched norm
+    in absolute value.
+
+    >>> linalg.norm(A)
+    1224.2812927123198
+    >>> linalg.norm(sketch)
+    1226.518328407333
+
+    Similarly, applying our sketch preserves the solution to a linear
+    regression of :math:`\min \|Ax - b\|`.
+
+    >>> b = rng.standard_normal(n_rows)
+    >>> x = linalg.lstsq(A, b)[0]
+    >>> Ab = np.hstack((A, b.reshape(-1, 1)))
+    >>> SAb = linalg.clarkson_woodruff_transform(Ab, sketch_n_rows, seed=rng)
+    >>> SA, Sb = SAb[:, :-1], SAb[:, -1]
+    >>> x_sketched = linalg.lstsq(SA, Sb)[0]
+
+    As with the matrix norm example, ``linalg.norm(A @ x - b)`` is close
+    to ``linalg.norm(A @ x_sketched - b)`` with high probability.
+
+    >>> linalg.norm(A @ x - b)
+    122.83242365433877
+    >>> linalg.norm(A @ x_sketched - b)
+    166.58473879945151
+
+    """
+    S = cwt_matrix(sketch_size, input_matrix.shape[0], seed)
+    return S.dot(input_matrix)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_solvers.py

@@ -0,0 +1,846 @@
+"""Matrix equation solver routines"""
+# Author: Jeffrey Armstrong <[email protected]>
+# February 24, 2012
+
+# Modified: Chad Fulton <[email protected]>
+# June 19, 2014
+
+# Modified: Ilhan Polat <[email protected]>
+# September 13, 2016
+
+import warnings
+import numpy as np
+from numpy.linalg import inv, LinAlgError, norm, cond, svd
+
+from ._basic import solve, solve_triangular, matrix_balance
+from .lapack import get_lapack_funcs
+from ._decomp_schur import schur
+from ._decomp_lu import lu
+from ._decomp_qr import qr
+from ._decomp_qz import ordqz
+from ._decomp import _asarray_validated
+from ._special_matrices import kron, block_diag
+
+__all__ = ['solve_sylvester',
+           'solve_continuous_lyapunov', 'solve_discrete_lyapunov',
+           'solve_lyapunov',
+           'solve_continuous_are', 'solve_discrete_are']
+
+
+def solve_sylvester(a, b, q):
+    """
+    Computes a solution (X) to the Sylvester equation :math:`AX + XB = Q`.
+
+    Parameters
+    ----------
+    a : (M, M) array_like
+        Leading matrix of the Sylvester equation
+    b : (N, N) array_like
+        Trailing matrix of the Sylvester equation
+    q : (M, N) array_like
+        Right-hand side
+
+    Returns
+    -------
+    x : (M, N) ndarray
+        The solution to the Sylvester equation.
+
+    Raises
+    ------
+    LinAlgError
+        If solution was not found
+
+    Notes
+    -----
+    Computes a solution to the Sylvester matrix equation via the Bartels-
+    Stewart algorithm. The A and B matrices first undergo Schur
+    decompositions. The resulting matrices are used to construct an
+    alternative Sylvester equation (``RY + YS^T = F``) where the R and S
+    matrices are in quasi-triangular form (or, when R, S or F are complex,
+    triangular form). The simplified equation is then solved using
+    ``*TRSYL`` from LAPACK directly.
+
+    .. versionadded:: 0.11.0
+
+    Examples
+    --------
+    Given `a`, `b`, and `q` solve for `x`:
+
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> a = np.array([[-3, -2, 0], [-1, -1, 3], [3, -5, -1]])
+    >>> b = np.array([[1]])
+    >>> q = np.array([[1],[2],[3]])
+    >>> x = linalg.solve_sylvester(a, b, q)
+    >>> x
+    array([[ 0.0625],
+           [-0.5625],
+           [ 0.6875]])
+    >>> np.allclose(a.dot(x) + x.dot(b), q)
+    True
+
+    """
+
+    # Compute the Schur decomposition form of a
+    r, u = schur(a, output='real')
+
+    # Compute the Schur decomposition of b
+    s, v = schur(b.conj().transpose(), output='real')
+
+    # Construct f = u'*q*v
+    f = np.dot(np.dot(u.conj().transpose(), q), v)
+
+    # Call the Sylvester equation solver
+    trsyl, = get_lapack_funcs(('trsyl',), (r, s, f))
+    if trsyl is None:
+        raise RuntimeError('LAPACK implementation does not contain a proper '
+                           'Sylvester equation solver (TRSYL)')
+    y, scale, info = trsyl(r, s, f, tranb='C')
+
+    y = scale*y
+
+    if info < 0:
+        raise LinAlgError("Illegal value encountered in "
+                          "the %d term" % (-info,))
+
+    return np.dot(np.dot(u, y), v.conj().transpose())
+
+
+def solve_continuous_lyapunov(a, q):
+    """
+    Solves the continuous Lyapunov equation :math:`AX + XA^H = Q`.
+
+    Uses the Bartels-Stewart algorithm to find :math:`X`.
+
+    Parameters
+    ----------
+    a : array_like
+        A square matrix
+
+    q : array_like
+        Right-hand side square matrix
+
+    Returns
+    -------
+    x : ndarray
+        Solution to the continuous Lyapunov equation
+
+    See Also
+    --------
+    solve_discrete_lyapunov : computes the solution to the discrete-time
+        Lyapunov equation
+    solve_sylvester : computes the solution to the Sylvester equation
+
+    Notes
+    -----
+    The continuous Lyapunov equation is a special form of the Sylvester
+    equation, hence this solver relies on LAPACK routine ?TRSYL.
+
+    .. versionadded:: 0.11.0
+
+    Examples
+    --------
+    Given `a` and `q` solve for `x`:
+
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> a = np.array([[-3, -2, 0], [-1, -1, 0], [0, -5, -1]])
+    >>> b = np.array([2, 4, -1])
+    >>> q = np.eye(3)
+    >>> x = linalg.solve_continuous_lyapunov(a, q)
+    >>> x
+    array([[ -0.75  ,   0.875 ,  -3.75  ],
+           [  0.875 ,  -1.375 ,   5.3125],
+           [ -3.75  ,   5.3125, -27.0625]])
+    >>> np.allclose(a.dot(x) + x.dot(a.T), q)
+    True
+    """
+
+    a = np.atleast_2d(_asarray_validated(a, check_finite=True))
+    q = np.atleast_2d(_asarray_validated(q, check_finite=True))
+
+    r_or_c = float
+
+    for ind, _ in enumerate((a, q)):
+        if np.iscomplexobj(_):
+            r_or_c = complex
+
+        if not np.equal(*_.shape):
+            raise ValueError("Matrix {} should be square.".format("aq"[ind]))
+
+    # Shape consistency check
+    if a.shape != q.shape:
+        raise ValueError("Matrix a and q should have the same shape.")
+
+    # Compute the Schur decomposition form of a
+    r, u = schur(a, output='real')
+
+    # Construct f = u'*q*u
+    f = u.conj().T.dot(q.dot(u))
+
+    # Call the Sylvester equation solver
+    trsyl = get_lapack_funcs('trsyl', (r, f))
+
+    dtype_string = 'T' if r_or_c == float else 'C'
+    y, scale, info = trsyl(r, r, f, tranb=dtype_string)
+
+    if info < 0:
+        raise ValueError('?TRSYL exited with the internal error '
+                         f'"illegal value in argument number {-info}.". See '
+                         'LAPACK documentation for the ?TRSYL error codes.')
+    elif info == 1:
+        warnings.warn('Input "a" has an eigenvalue pair whose sum is '
+                      'very close to or exactly zero. The solution is '
+                      'obtained via perturbing the coefficients.',
+                      RuntimeWarning, stacklevel=2)
+    y *= scale
+
+    return u.dot(y).dot(u.conj().T)
+
+
+# For backwards compatibility, keep the old name
+solve_lyapunov = solve_continuous_lyapunov
+
+
+def _solve_discrete_lyapunov_direct(a, q):
+    """
+    Solves the discrete Lyapunov equation directly.
+
+    This function is called by the `solve_discrete_lyapunov` function with
+    `method=direct`. It is not supposed to be called directly.
+    """
+
+    lhs = kron(a, a.conj())
+    lhs = np.eye(lhs.shape[0]) - lhs
+    x = solve(lhs, q.flatten())
+
+    return np.reshape(x, q.shape)
+
+
+def _solve_discrete_lyapunov_bilinear(a, q):
+    """
+    Solves the discrete Lyapunov equation using a bilinear transformation.
+
+    This function is called by the `solve_discrete_lyapunov` function with
+    `method=bilinear`. It is not supposed to be called directly.
+    """
+    eye = np.eye(a.shape[0])
+    aH = a.conj().transpose()
+    aHI_inv = inv(aH + eye)
+    b = np.dot(aH - eye, aHI_inv)
+    c = 2*np.dot(np.dot(inv(a + eye), q), aHI_inv)
+    return solve_lyapunov(b.conj().transpose(), -c)
+
+
+def solve_discrete_lyapunov(a, q, method=None):
+    """
+    Solves the discrete Lyapunov equation :math:`AXA^H - X + Q = 0`.
+
+    Parameters
+    ----------
+    a, q : (M, M) array_like
+        Square matrices corresponding to A and Q in the equation
+        above respectively. Must have the same shape.
+
+    method : {'direct', 'bilinear'}, optional
+        Type of solver.
+
+        If not given, chosen to be ``direct`` if ``M`` is less than 10 and
+        ``bilinear`` otherwise.
+
+    Returns
+    -------
+    x : ndarray
+        Solution to the discrete Lyapunov equation
+
+    See Also
+    --------
+    solve_continuous_lyapunov : computes the solution to the continuous-time
+        Lyapunov equation
+
+    Notes
+    -----
+    This section describes the available solvers that can be selected by the
+    'method' parameter. The default method is *direct* if ``M`` is less than 10
+    and ``bilinear`` otherwise.
+
+    Method *direct* uses a direct analytical solution to the discrete Lyapunov
+    equation. The algorithm is given in, for example, [1]_. However, it requires
+    the linear solution of a system with dimension :math:`M^2` so that
+    performance degrades rapidly for even moderately sized matrices.
+
+    Method *bilinear* uses a bilinear transformation to convert the discrete
+    Lyapunov equation to a continuous Lyapunov equation :math:`(BX+XB'=-C)`
+    where :math:`B=(A-I)(A+I)^{-1}` and
+    :math:`C=2(A' + I)^{-1} Q (A + I)^{-1}`. The continuous equation can be
+    efficiently solved since it is a special case of a Sylvester equation.
+    The transformation algorithm is from Popov (1964) as described in [2]_.
+
+    .. versionadded:: 0.11.0
+
+    References
+    ----------
+    .. [1] Hamilton, James D. Time Series Analysis, Princeton: Princeton
+       University Press, 1994.  265.  Print.
+       http://doc1.lbfl.li/aca/FLMF037168.pdf
+    .. [2] Gajic, Z., and M.T.J. Qureshi. 2008.
+       Lyapunov Matrix Equation in System Stability and Control.
+       Dover Books on Engineering Series. Dover Publications.
+
+    Examples
+    --------
+    Given `a` and `q` solve for `x`:
+
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> a = np.array([[0.2, 0.5],[0.7, -0.9]])
+    >>> q = np.eye(2)
+    >>> x = linalg.solve_discrete_lyapunov(a, q)
+    >>> x
+    array([[ 0.70872893,  1.43518822],
+           [ 1.43518822, -2.4266315 ]])
+    >>> np.allclose(a.dot(x).dot(a.T)-x, -q)
+    True
+
+    """
+    a = np.asarray(a)
+    q = np.asarray(q)
+    if method is None:
+        # Select automatically based on size of matrices
+        if a.shape[0] >= 10:
+            method = 'bilinear'
+        else:
+            method = 'direct'
+
+    meth = method.lower()
+
+    if meth == 'direct':
+        x = _solve_discrete_lyapunov_direct(a, q)
+    elif meth == 'bilinear':
+        x = _solve_discrete_lyapunov_bilinear(a, q)
+    else:
+        raise ValueError('Unknown solver %s' % method)
+
+    return x
+
+
+def solve_continuous_are(a, b, q, r, e=None, s=None, balanced=True):
+    r"""
+    Solves the continuous-time algebraic Riccati equation (CARE).
+
+    The CARE is defined as
+
+    .. math::
+
+          X A + A^H X - X B R^{-1} B^H X + Q = 0
+
+    The limitations for a solution to exist are :
+
+        * All eigenvalues of :math:`A` on the right half plane, should be
+          controllable.
+
+        * The associated hamiltonian pencil (See Notes), should have
+          eigenvalues sufficiently away from the imaginary axis.
+
+    Moreover, if ``e`` or ``s`` is not precisely ``None``, then the
+    generalized version of CARE
+
+    .. math::
+
+          E^HXA + A^HXE - (E^HXB + S) R^{-1} (B^HXE + S^H) + Q = 0
+
+    is solved. When omitted, ``e`` is assumed to be the identity and ``s``
+    is assumed to be the zero matrix with sizes compatible with ``a`` and
+    ``b``, respectively.
+
+    Parameters
+    ----------
+    a : (M, M) array_like
+        Square matrix
+    b : (M, N) array_like
+        Input
+    q : (M, M) array_like
+        Input
+    r : (N, N) array_like
+        Nonsingular square matrix
+    e : (M, M) array_like, optional
+        Nonsingular square matrix
+    s : (M, N) array_like, optional
+        Input
+    balanced : bool, optional
+        The boolean that indicates whether a balancing step is performed
+        on the data. The default is set to True.
+
+    Returns
+    -------
+    x : (M, M) ndarray
+        Solution to the continuous-time algebraic Riccati equation.
+
+    Raises
+    ------
+    LinAlgError
+        For cases where the stable subspace of the pencil could not be
+        isolated. See Notes section and the references for details.
+
+    See Also
+    --------
+    solve_discrete_are : Solves the discrete-time algebraic Riccati equation
+
+    Notes
+    -----
+    The equation is solved by forming the extended hamiltonian matrix pencil,
+    as described in [1]_, :math:`H - \lambda J` given by the block matrices ::
+
+        [ A    0    B ]             [ E   0    0 ]
+        [-Q  -A^H  -S ] - \lambda * [ 0  E^H   0 ]
+        [ S^H B^H   R ]             [ 0   0    0 ]
+
+    and using a QZ decomposition method.
+
+    In this algorithm, the fail conditions are linked to the symmetry
+    of the product :math:`U_2 U_1^{-1}` and condition number of
+    :math:`U_1`. Here, :math:`U` is the 2m-by-m matrix that holds the
+    eigenvectors spanning the stable subspace with 2-m rows and partitioned
+    into two m-row matrices. See [1]_ and [2]_ for more details.
+
+    In order to improve the QZ decomposition accuracy, the pencil goes
+    through a balancing step where the sum of absolute values of
+    :math:`H` and :math:`J` entries (after removing the diagonal entries of
+    the sum) is balanced following the recipe given in [3]_.
+
+    .. versionadded:: 0.11.0
+
+    References
+    ----------
+    .. [1]  P. van Dooren , "A Generalized Eigenvalue Approach For Solving
+       Riccati Equations.", SIAM Journal on Scientific and Statistical
+       Computing, Vol.2(2), :doi:`10.1137/0902010`
+
+    .. [2] A.J. Laub, "A Schur Method for Solving Algebraic Riccati
+       Equations.", Massachusetts Institute of Technology. Laboratory for
+       Information and Decision Systems. LIDS-R ; 859. Available online :
+       http://hdl.handle.net/1721.1/1301
+
+    .. [3] P. Benner, "Symplectic Balancing of Hamiltonian Matrices", 2001,
+       SIAM J. Sci. Comput., 2001, Vol.22(5), :doi:`10.1137/S1064827500367993`
+
+    Examples
+    --------
+    Given `a`, `b`, `q`, and `r` solve for `x`:
+
+    >>> import numpy as np
+    >>> from scipy import linalg
+    >>> a = np.array([[4, 3], [-4.5, -3.5]])
+    >>> b = np.array([[1], [-1]])
+    >>> q = np.array([[9, 6], [6, 4.]])
+    >>> r = 1
+    >>> x = linalg.solve_continuous_are(a, b, q, r)
+    >>> x
+    array([[ 21.72792206,  14.48528137],
+           [ 14.48528137,   9.65685425]])
+    >>> np.allclose(a.T.dot(x) + x.dot(a)-x.dot(b).dot(b.T).dot(x), -q)
+    True
+
+    """
+
+    # Validate input arguments
+    a, b, q, r, e, s, m, n, r_or_c, gen_are = _are_validate_args(
+                                                     a, b, q, r, e, s, 'care')
+
+    H = np.empty((2*m+n, 2*m+n), dtype=r_or_c)
+    H[:m, :m] = a
+    H[:m, m:2*m] = 0.
+    H[:m, 2*m:] = b
+    H[m:2*m, :m] = -q
+    H[m:2*m, m:2*m] = -a.conj().T
+    H[m:2*m, 2*m:] = 0. if s is None else -s
+    H[2*m:, :m] = 0. if s is None else s.conj().T
+    H[2*m:, m:2*m] = b.conj().T
+    H[2*m:, 2*m:] = r
+
+    if gen_are and e is not None:
+        J = block_diag(e, e.conj().T, np.zeros_like(r, dtype=r_or_c))
+    else:
+        J = block_diag(np.eye(2*m), np.zeros_like(r, dtype=r_or_c))
+
+    if balanced:
+        # xGEBAL does not remove the diagonals before scaling. Also
+        # to avoid destroying the Symplectic structure, we follow Ref.3
+        M = np.abs(H) + np.abs(J)
+        np.fill_diagonal(M, 0.)
+        _, (sca, _) = matrix_balance(M, separate=1, permute=0)
+        # do we need to bother?
+        if not np.allclose(sca, np.ones_like(sca)):
+            # Now impose diag(D,inv(D)) from Benner where D is
+            # square root of s_i/s_(n+i) for i=0,....
+            sca = np.log2(sca)
+            # NOTE: Py3 uses "Bankers Rounding: round to the nearest even" !!
+            s = np.round((sca[m:2*m] - sca[:m])/2)
+            sca = 2 ** np.r_[s, -s, sca[2*m:]]
+            # Elementwise multiplication via broadcasting.
+            elwisescale = sca[:, None] * np.reciprocal(sca)
+            H *= elwisescale
+            J *= elwisescale
+
+    # Deflate the pencil to 2m x 2m ala Ref.1, eq.(55)
+    q, r = qr(H[:, -n:])
+    H = q[:, n:].conj().T.dot(H[:, :2*m])
+    J = q[:2*m, n:].conj().T.dot(J[:2*m, :2*m])
+
+    # Decide on which output type is needed for QZ
+    out_str = 'real' if r_or_c == float else 'complex'
+
+    _, _, _, _, _, u = ordqz(H, J, sort='lhp', overwrite_a=True,
+                             overwrite_b=True, check_finite=False,
+                             output=out_str)
+
+    # Get the relevant parts of the stable subspace basis
+    if e is not None:
+        u, _ = qr(np.vstack((e.dot(u[:m, :m]), u[m:, :m])))
+    u00 = u[:m, :m]
+    u10 = u[m:, :m]
+
+    # Solve via back-substituion after checking the condition of u00
+    up, ul, uu = lu(u00)
+    if 1/cond(uu) < np.spacing(1.):
+        raise LinAlgError('Failed to find a finite solution.')
+
+    # Exploit the triangular structure
+    x = solve_triangular(ul.conj().T,
+                         solve_triangular(uu.conj().T,
+                                          u10.conj().T,
+                                          lower=True),
+                         unit_diagonal=True,
+                         ).conj().T.dot(up.conj().T)
+    if balanced:
+        x *= sca[:m, None] * sca[:m]
+
+    # Check the deviation from symmetry for lack of success
+    # See proof of Thm.5 item 3 in [2]
+    u_sym = u00.conj().T.dot(u10)
+    n_u_sym = norm(u_sym, 1)
+    u_sym = u_sym - u_sym.conj().T
+    sym_threshold = np.max([np.spacing(1000.), 0.1*n_u_sym])
+
+    if norm(u_sym, 1) > sym_threshold:
+        raise LinAlgError('The associated Hamiltonian pencil has eigenvalues '
+                          'too close to the imaginary axis')
+
+    return (x + x.conj().T)/2
+
+
+def solve_discrete_are(a, b, q, r, e=None, s=None, balanced=True):
+    r"""
+    Solves the discrete-time algebraic Riccati equation (DARE).
+
+    The DARE is defined as
+
+    .. math::
+
+          A^HXA - X - (A^HXB) (R + B^HXB)^{-1} (B^HXA) + Q = 0
+
+    The limitations for a solution to exist are :
+
+        * All eigenvalues of :math:`A` outside the unit disc, should be
+          controllable.
+
+        * The associated symplectic pencil (See Notes), should have
+          eigenvalues sufficiently away from the unit circle.
+
+    Moreover, if ``e`` and ``s`` are not both precisely ``None``, then the
+    generalized version of DARE
+
+    .. math::
+
+          A^HXA - E^HXE - (A^HXB+S) (R+B^HXB)^{-1} (B^HXA+S^H) + Q = 0
+
+    is solved. When omitted, ``e`` is assumed to be the identity and ``s``
+    is assumed to be the zero matrix.
+
+    Parameters
+    ----------
+    a : (M, M) array_like
+        Square matrix
+    b : (M, N) array_like
+        Input
+    q : (M, M) array_like
+        Input
+    r : (N, N) array_like
+        Square matrix
+    e : (M, M) array_like, optional
+        Nonsingular square matrix
+    s : (M, N) array_like, optional
+        Input
+    balanced : bool
+        The boolean that indicates whether a balancing step is performed
+        on the data. The default is set to True.
+
+    Returns
+    -------
+    x : (M, M) ndarray
+        Solution to the discrete algebraic Riccati equation.
+
+    Raises
+    ------
+    LinAlgError
+        For cases where the stable subspace of the pencil could not be
+        isolated. See Notes section and the references for details.
+
+    See Also
+    --------
+    solve_continuous_are : Solves the continuous algebraic Riccati equation
+
+    Notes
+    -----
+    The equation is solved by forming the extended symplectic matrix pencil,
+    as described in [1]_, :math:`H - \lambda J` given by the block matrices ::
+
+           [  A   0   B ]             [ E   0   B ]
+           [ -Q  E^H -S ] - \lambda * [ 0  A^H  0 ]
+           [ S^H  0   R ]             [ 0 -B^H  0 ]
+
+    and using a QZ decomposition method.
+
+    In this algorithm, the fail conditions are linked to the symmetry
+    of the product :math:`U_2 U_1^{-1}` and condition number of
+    :math:`U_1`. Here, :math:`U` is the 2m-by-m matrix that holds the
+    eigenvectors spanning the stable subspace with 2-m rows and partitioned
+    into two m-row matrices. See [1]_ and [2]_ for more details.
+
+    In order to improve the QZ decomposition accuracy, the pencil goes
+    through a balancing step where the sum of absolute values of
+    :math:`H` and :math:`J` rows/cols (after removing the diagonal entries)
+    is balanced following the recipe given in [3]_. If the data has small
+    numerical noise, balancing may amplify their effects and some clean up
+    is required.
+
+    .. versionadded:: 0.11.0
+
+    References
+    ----------
+    .. [1]  P. van Dooren , "A Generalized Eigenvalue Approach For Solving
+       Riccati Equations.", SIAM Journal on Scientific and Statistical
+       Computing, Vol.2(2), :doi:`10.1137/0902010`
+
+    .. [2] A.J. Laub, "A Schur Method for Solving Algebraic Riccati
+       Equations.", Massachusetts Institute of Technology. Laboratory for
+       Information and Decision Systems. LIDS-R ; 859. Available online :
+       http://hdl.handle.net/1721.1/1301
+
+    .. [3] P. Benner, "Symplectic Balancing of Hamiltonian Matrices", 2001,
+       SIAM J. Sci. Comput., 2001, Vol.22(5), :doi:`10.1137/S1064827500367993`
+
+    Examples
+    --------
+    Given `a`, `b`, `q`, and `r` solve for `x`:
+
+    >>> import numpy as np
+    >>> from scipy import linalg as la
+    >>> a = np.array([[0, 1], [0, -1]])
+    >>> b = np.array([[1, 0], [2, 1]])
+    >>> q = np.array([[-4, -4], [-4, 7]])
+    >>> r = np.array([[9, 3], [3, 1]])
+    >>> x = la.solve_discrete_are(a, b, q, r)
+    >>> x
+    array([[-4., -4.],
+           [-4.,  7.]])
+    >>> R = la.solve(r + b.T.dot(x).dot(b), b.T.dot(x).dot(a))
+    >>> np.allclose(a.T.dot(x).dot(a) - x - a.T.dot(x).dot(b).dot(R), -q)
+    True
+
+    """
+
+    # Validate input arguments
+    a, b, q, r, e, s, m, n, r_or_c, gen_are = _are_validate_args(
+                                                     a, b, q, r, e, s, 'dare')
+
+    # Form the matrix pencil
+    H = np.zeros((2*m+n, 2*m+n), dtype=r_or_c)
+    H[:m, :m] = a
+    H[:m, 2*m:] = b
+    H[m:2*m, :m] = -q
+    H[m:2*m, m:2*m] = np.eye(m) if e is None else e.conj().T
+    H[m:2*m, 2*m:] = 0. if s is None else -s
+    H[2*m:, :m] = 0. if s is None else s.conj().T
+    H[2*m:, 2*m:] = r
+
+    J = np.zeros_like(H, dtype=r_or_c)
+    J[:m, :m] = np.eye(m) if e is None else e
+    J[m:2*m, m:2*m] = a.conj().T
+    J[2*m:, m:2*m] = -b.conj().T
+
+    if balanced:
+        # xGEBAL does not remove the diagonals before scaling. Also
+        # to avoid destroying the Symplectic structure, we follow Ref.3
+        M = np.abs(H) + np.abs(J)
+        np.fill_diagonal(M, 0.)
+        _, (sca, _) = matrix_balance(M, separate=1, permute=0)
+        # do we need to bother?
+        if not np.allclose(sca, np.ones_like(sca)):
+            # Now impose diag(D,inv(D)) from Benner where D is
+            # square root of s_i/s_(n+i) for i=0,....
+            sca = np.log2(sca)
+            # NOTE: Py3 uses "Bankers Rounding: round to the nearest even" !!
+            s = np.round((sca[m:2*m] - sca[:m])/2)
+            sca = 2 ** np.r_[s, -s, sca[2*m:]]
+            # Elementwise multiplication via broadcasting.
+            elwisescale = sca[:, None] * np.reciprocal(sca)
+            H *= elwisescale
+            J *= elwisescale
+
+    # Deflate the pencil by the R column ala Ref.1
+    q_of_qr, _ = qr(H[:, -n:])
+    H = q_of_qr[:, n:].conj().T.dot(H[:, :2*m])
+    J = q_of_qr[:, n:].conj().T.dot(J[:, :2*m])
+
+    # Decide on which output type is needed for QZ
+    out_str = 'real' if r_or_c == float else 'complex'
+
+    _, _, _, _, _, u = ordqz(H, J, sort='iuc',
+                             overwrite_a=True,
+                             overwrite_b=True,
+                             check_finite=False,
+                             output=out_str)
+
+    # Get the relevant parts of the stable subspace basis
+    if e is not None:
+        u, _ = qr(np.vstack((e.dot(u[:m, :m]), u[m:, :m])))
+    u00 = u[:m, :m]
+    u10 = u[m:, :m]
+
+    # Solve via back-substituion after checking the condition of u00
+    up, ul, uu = lu(u00)
+
+    if 1/cond(uu) < np.spacing(1.):
+        raise LinAlgError('Failed to find a finite solution.')
+
+    # Exploit the triangular structure
+    x = solve_triangular(ul.conj().T,
+                         solve_triangular(uu.conj().T,
+                                          u10.conj().T,
+                                          lower=True),
+                         unit_diagonal=True,
+                         ).conj().T.dot(up.conj().T)
+    if balanced:
+        x *= sca[:m, None] * sca[:m]
+
+    # Check the deviation from symmetry for lack of success
+    # See proof of Thm.5 item 3 in [2]
+    u_sym = u00.conj().T.dot(u10)
+    n_u_sym = norm(u_sym, 1)
+    u_sym = u_sym - u_sym.conj().T
+    sym_threshold = np.max([np.spacing(1000.), 0.1*n_u_sym])
+
+    if norm(u_sym, 1) > sym_threshold:
+        raise LinAlgError('The associated symplectic pencil has eigenvalues '
+                          'too close to the unit circle')
+
+    return (x + x.conj().T)/2
+
+
+def _are_validate_args(a, b, q, r, e, s, eq_type='care'):
+    """
+    A helper function to validate the arguments supplied to the
+    Riccati equation solvers. Any discrepancy found in the input
+    matrices leads to a ``ValueError`` exception.
+
+    Essentially, it performs:
+
+        - a check whether the input is free of NaN and Infs
+        - a pass for the data through ``numpy.atleast_2d()``
+        - squareness check of the relevant arrays
+        - shape consistency check of the arrays
+        - singularity check of the relevant arrays
+        - symmetricity check of the relevant matrices
+        - a check whether the regular or the generalized version is asked.
+
+    This function is used by ``solve_continuous_are`` and
+    ``solve_discrete_are``.
+
+    Parameters
+    ----------
+    a, b, q, r, e, s : array_like
+        Input data
+    eq_type : str
+        Accepted arguments are 'care' and 'dare'.
+
+    Returns
+    -------
+    a, b, q, r, e, s : ndarray
+        Regularized input data
+    m, n : int
+        shape of the problem
+    r_or_c : type
+        Data type of the problem, returns float or complex
+    gen_or_not : bool
+        Type of the equation, True for generalized and False for regular ARE.
+
+    """
+
+    if eq_type.lower() not in ("dare", "care"):
+        raise ValueError("Equation type unknown. "
+                         "Only 'care' and 'dare' is understood")
+
+    a = np.atleast_2d(_asarray_validated(a, check_finite=True))
+    b = np.atleast_2d(_asarray_validated(b, check_finite=True))
+    q = np.atleast_2d(_asarray_validated(q, check_finite=True))
+    r = np.atleast_2d(_asarray_validated(r, check_finite=True))
+
+    # Get the correct data types otherwise NumPy complains
+    # about pushing complex numbers into real arrays.
+    r_or_c = complex if np.iscomplexobj(b) else float
+
+    for ind, mat in enumerate((a, q, r)):
+        if np.iscomplexobj(mat):
+            r_or_c = complex
+
+        if not np.equal(*mat.shape):
+            raise ValueError("Matrix {} should be square.".format("aqr"[ind]))
+
+    # Shape consistency checks
+    m, n = b.shape
+    if m != a.shape[0]:
+        raise ValueError("Matrix a and b should have the same number of rows.")
+    if m != q.shape[0]:
+        raise ValueError("Matrix a and q should have the same shape.")
+    if n != r.shape[0]:
+        raise ValueError("Matrix b and r should have the same number of cols.")
+
+    # Check if the data matrices q, r are (sufficiently) hermitian
+    for ind, mat in enumerate((q, r)):
+        if norm(mat - mat.conj().T, 1) > np.spacing(norm(mat, 1))*100:
+            raise ValueError("Matrix {} should be symmetric/hermitian."
+                             "".format("qr"[ind]))
+
+    # Continuous time ARE should have a nonsingular r matrix.
+    if eq_type == 'care':
+        min_sv = svd(r, compute_uv=False)[-1]
+        if min_sv == 0. or min_sv < np.spacing(1.)*norm(r, 1):
+            raise ValueError('Matrix r is numerically singular.')
+
+    # Check if the generalized case is required with omitted arguments
+    # perform late shape checking etc.
+    generalized_case = e is not None or s is not None
+
+    if generalized_case:
+        if e is not None:
+            e = np.atleast_2d(_asarray_validated(e, check_finite=True))
+            if not np.equal(*e.shape):
+                raise ValueError("Matrix e should be square.")
+            if m != e.shape[0]:
+                raise ValueError("Matrix a and e should have the same shape.")
+            # numpy.linalg.cond doesn't check for exact zeros and
+            # emits a runtime warning. Hence the following manual check.
+            min_sv = svd(e, compute_uv=False)[-1]
+            if min_sv == 0. or min_sv < np.spacing(1.) * norm(e, 1):
+                raise ValueError('Matrix e is numerically singular.')
+            if np.iscomplexobj(e):
+                r_or_c = complex
+        if s is not None:
+            s = np.atleast_2d(_asarray_validated(s, check_finite=True))
+            if s.shape != b.shape:
+                raise ValueError("Matrix b and s should have the same shape.")
+            if np.iscomplexobj(s):
+                r_or_c = complex
+
+    return a, b, q, r, e, s, m, n, r_or_c, generalized_case

env-llmeval/lib/python3.10/site-packages/scipy/linalg/_testutils.py

@@ -0,0 +1,63 @@
+import numpy as np
+
+
+class _FakeMatrix:
+    def __init__(self, data):
+        self._data = data
+        self.__array_interface__ = data.__array_interface__
+
+
+class _FakeMatrix2:
+    def __init__(self, data):
+        self._data = data
+
+    def __array__(self, dtype=None, copy=None):
+        return self._data
+
+
+def _get_array(shape, dtype):
+    """
+    Get a test array of given shape and data type.
+    Returned NxN matrices are posdef, and 2xN are banded-posdef.
+
+    """
+    if len(shape) == 2 and shape[0] == 2:
+        # yield a banded positive definite one
+        x = np.zeros(shape, dtype=dtype)
+        x[0, 1:] = -1
+        x[1] = 2
+        return x
+    elif len(shape) == 2 and shape[0] == shape[1]:
+        # always yield a positive definite matrix
+        x = np.zeros(shape, dtype=dtype)
+        j = np.arange(shape[0])
+        x[j, j] = 2
+        x[j[:-1], j[:-1]+1] = -1
+        x[j[:-1]+1, j[:-1]] = -1
+        return x
+    else:
+        np.random.seed(1234)
+        return np.random.randn(*shape).astype(dtype)
+
+
+def _id(x):
+    return x
+
+
+def assert_no_overwrite(call, shapes, dtypes=None):
+    """
+    Test that a call does not overwrite its input arguments
+    """
+
+    if dtypes is None:
+        dtypes = [np.float32, np.float64, np.complex64, np.complex128]
+
+    for dtype in dtypes:
+        for order in ["C", "F"]:
+            for faker in [_id, _FakeMatrix, _FakeMatrix2]:
+                orig_inputs = [_get_array(s, dtype) for s in shapes]
+                inputs = [faker(x.copy(order)) for x in orig_inputs]
+                call(*inputs)
+                msg = f"call modified inputs [{dtype!r}, {faker!r}]"
+                for a, b in zip(inputs, orig_inputs):
+                    np.testing.assert_equal(a, b, err_msg=msg)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/cython_blas.pxd

@@ -0,0 +1,169 @@
+"""
+This file was generated by _generate_pyx.py.
+Do not edit this file directly.
+"""
+
+# Within scipy, these wrappers can be used via relative or absolute cimport.
+# Examples:
+# from ..linalg cimport cython_blas
+# from scipy.linalg cimport cython_blas
+# cimport scipy.linalg.cython_blas as cython_blas
+# cimport ..linalg.cython_blas as cython_blas
+
+# Within SciPy, if BLAS functions are needed in C/C++/Fortran,
+# these wrappers should not be used.
+# The original libraries should be linked directly.
+
+ctypedef float s
+ctypedef double d
+ctypedef float complex c
+ctypedef double complex z
+
+cdef void caxpy(int *n, c *ca, c *cx, int *incx, c *cy, int *incy) noexcept nogil
+cdef void ccopy(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil
+cdef c cdotc(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil
+cdef c cdotu(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil
+cdef void cgbmv(char *trans, int *m, int *n, int *kl, int *ku, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil
+cdef void cgemm(char *transa, char *transb, int *m, int *n, int *k, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil
+cdef void cgemv(char *trans, int *m, int *n, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil
+cdef void cgerc(int *m, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *a, int *lda) noexcept nogil
+cdef void cgeru(int *m, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *a, int *lda) noexcept nogil
+cdef void chbmv(char *uplo, int *n, int *k, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil
+cdef void chemm(char *side, char *uplo, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil
+cdef void chemv(char *uplo, int *n, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil
+cdef void cher(char *uplo, int *n, s *alpha, c *x, int *incx, c *a, int *lda) noexcept nogil
+cdef void cher2(char *uplo, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *a, int *lda) noexcept nogil
+cdef void cher2k(char *uplo, char *trans, int *n, int *k, c *alpha, c *a, int *lda, c *b, int *ldb, s *beta, c *c, int *ldc) noexcept nogil
+cdef void cherk(char *uplo, char *trans, int *n, int *k, s *alpha, c *a, int *lda, s *beta, c *c, int *ldc) noexcept nogil
+cdef void chpmv(char *uplo, int *n, c *alpha, c *ap, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil
+cdef void chpr(char *uplo, int *n, s *alpha, c *x, int *incx, c *ap) noexcept nogil
+cdef void chpr2(char *uplo, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *ap) noexcept nogil
+cdef void crotg(c *ca, c *cb, s *c, c *s) noexcept nogil
+cdef void cscal(int *n, c *ca, c *cx, int *incx) noexcept nogil
+cdef void csrot(int *n, c *cx, int *incx, c *cy, int *incy, s *c, s *s) noexcept nogil
+cdef void csscal(int *n, s *sa, c *cx, int *incx) noexcept nogil
+cdef void cswap(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil
+cdef void csymm(char *side, char *uplo, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil
+cdef void csyr2k(char *uplo, char *trans, int *n, int *k, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil
+cdef void csyrk(char *uplo, char *trans, int *n, int *k, c *alpha, c *a, int *lda, c *beta, c *c, int *ldc) noexcept nogil
+cdef void ctbmv(char *uplo, char *trans, char *diag, int *n, int *k, c *a, int *lda, c *x, int *incx) noexcept nogil
+cdef void ctbsv(char *uplo, char *trans, char *diag, int *n, int *k, c *a, int *lda, c *x, int *incx) noexcept nogil
+cdef void ctpmv(char *uplo, char *trans, char *diag, int *n, c *ap, c *x, int *incx) noexcept nogil
+cdef void ctpsv(char *uplo, char *trans, char *diag, int *n, c *ap, c *x, int *incx) noexcept nogil
+cdef void ctrmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb) noexcept nogil
+cdef void ctrmv(char *uplo, char *trans, char *diag, int *n, c *a, int *lda, c *x, int *incx) noexcept nogil
+cdef void ctrsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb) noexcept nogil
+cdef void ctrsv(char *uplo, char *trans, char *diag, int *n, c *a, int *lda, c *x, int *incx) noexcept nogil
+cdef d dasum(int *n, d *dx, int *incx) noexcept nogil
+cdef void daxpy(int *n, d *da, d *dx, int *incx, d *dy, int *incy) noexcept nogil
+cdef d dcabs1(z *z) noexcept nogil
+cdef void dcopy(int *n, d *dx, int *incx, d *dy, int *incy) noexcept nogil
+cdef d ddot(int *n, d *dx, int *incx, d *dy, int *incy) noexcept nogil
+cdef void dgbmv(char *trans, int *m, int *n, int *kl, int *ku, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil
+cdef void dgemm(char *transa, char *transb, int *m, int *n, int *k, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) noexcept nogil
+cdef void dgemv(char *trans, int *m, int *n, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil
+cdef void dger(int *m, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *a, int *lda) noexcept nogil
+cdef d dnrm2(int *n, d *x, int *incx) noexcept nogil
+cdef void drot(int *n, d *dx, int *incx, d *dy, int *incy, d *c, d *s) noexcept nogil
+cdef void drotg(d *da, d *db, d *c, d *s) noexcept nogil
+cdef void drotm(int *n, d *dx, int *incx, d *dy, int *incy, d *dparam) noexcept nogil
+cdef void drotmg(d *dd1, d *dd2, d *dx1, d *dy1, d *dparam) noexcept nogil
+cdef void dsbmv(char *uplo, int *n, int *k, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil
+cdef void dscal(int *n, d *da, d *dx, int *incx) noexcept nogil
+cdef d dsdot(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil
+cdef void dspmv(char *uplo, int *n, d *alpha, d *ap, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil
+cdef void dspr(char *uplo, int *n, d *alpha, d *x, int *incx, d *ap) noexcept nogil
+cdef void dspr2(char *uplo, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *ap) noexcept nogil
+cdef void dswap(int *n, d *dx, int *incx, d *dy, int *incy) noexcept nogil
+cdef void dsymm(char *side, char *uplo, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) noexcept nogil
+cdef void dsymv(char *uplo, int *n, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil
+cdef void dsyr(char *uplo, int *n, d *alpha, d *x, int *incx, d *a, int *lda) noexcept nogil
+cdef void dsyr2(char *uplo, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *a, int *lda) noexcept nogil
+cdef void dsyr2k(char *uplo, char *trans, int *n, int *k, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) noexcept nogil
+cdef void dsyrk(char *uplo, char *trans, int *n, int *k, d *alpha, d *a, int *lda, d *beta, d *c, int *ldc) noexcept nogil
+cdef void dtbmv(char *uplo, char *trans, char *diag, int *n, int *k, d *a, int *lda, d *x, int *incx) noexcept nogil
+cdef void dtbsv(char *uplo, char *trans, char *diag, int *n, int *k, d *a, int *lda, d *x, int *incx) noexcept nogil
+cdef void dtpmv(char *uplo, char *trans, char *diag, int *n, d *ap, d *x, int *incx) noexcept nogil
+cdef void dtpsv(char *uplo, char *trans, char *diag, int *n, d *ap, d *x, int *incx) noexcept nogil
+cdef void dtrmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb) noexcept nogil
+cdef void dtrmv(char *uplo, char *trans, char *diag, int *n, d *a, int *lda, d *x, int *incx) noexcept nogil
+cdef void dtrsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb) noexcept nogil
+cdef void dtrsv(char *uplo, char *trans, char *diag, int *n, d *a, int *lda, d *x, int *incx) noexcept nogil
+cdef d dzasum(int *n, z *zx, int *incx) noexcept nogil
+cdef d dznrm2(int *n, z *x, int *incx) noexcept nogil
+cdef int icamax(int *n, c *cx, int *incx) noexcept nogil
+cdef int idamax(int *n, d *dx, int *incx) noexcept nogil
+cdef int isamax(int *n, s *sx, int *incx) noexcept nogil
+cdef int izamax(int *n, z *zx, int *incx) noexcept nogil
+cdef bint lsame(char *ca, char *cb) noexcept nogil
+cdef s sasum(int *n, s *sx, int *incx) noexcept nogil
+cdef void saxpy(int *n, s *sa, s *sx, int *incx, s *sy, int *incy) noexcept nogil
+cdef s scasum(int *n, c *cx, int *incx) noexcept nogil
+cdef s scnrm2(int *n, c *x, int *incx) noexcept nogil
+cdef void scopy(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil
+cdef s sdot(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil
+cdef s sdsdot(int *n, s *sb, s *sx, int *incx, s *sy, int *incy) noexcept nogil
+cdef void sgbmv(char *trans, int *m, int *n, int *kl, int *ku, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil
+cdef void sgemm(char *transa, char *transb, int *m, int *n, int *k, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) noexcept nogil
+cdef void sgemv(char *trans, int *m, int *n, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil
+cdef void sger(int *m, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *a, int *lda) noexcept nogil
+cdef s snrm2(int *n, s *x, int *incx) noexcept nogil
+cdef void srot(int *n, s *sx, int *incx, s *sy, int *incy, s *c, s *s) noexcept nogil
+cdef void srotg(s *sa, s *sb, s *c, s *s) noexcept nogil
+cdef void srotm(int *n, s *sx, int *incx, s *sy, int *incy, s *sparam) noexcept nogil
+cdef void srotmg(s *sd1, s *sd2, s *sx1, s *sy1, s *sparam) noexcept nogil
+cdef void ssbmv(char *uplo, int *n, int *k, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil
+cdef void sscal(int *n, s *sa, s *sx, int *incx) noexcept nogil
+cdef void sspmv(char *uplo, int *n, s *alpha, s *ap, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil
+cdef void sspr(char *uplo, int *n, s *alpha, s *x, int *incx, s *ap) noexcept nogil
+cdef void sspr2(char *uplo, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *ap) noexcept nogil
+cdef void sswap(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil
+cdef void ssymm(char *side, char *uplo, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) noexcept nogil
+cdef void ssymv(char *uplo, int *n, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil
+cdef void ssyr(char *uplo, int *n, s *alpha, s *x, int *incx, s *a, int *lda) noexcept nogil
+cdef void ssyr2(char *uplo, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *a, int *lda) noexcept nogil
+cdef void ssyr2k(char *uplo, char *trans, int *n, int *k, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) noexcept nogil
+cdef void ssyrk(char *uplo, char *trans, int *n, int *k, s *alpha, s *a, int *lda, s *beta, s *c, int *ldc) noexcept nogil
+cdef void stbmv(char *uplo, char *trans, char *diag, int *n, int *k, s *a, int *lda, s *x, int *incx) noexcept nogil
+cdef void stbsv(char *uplo, char *trans, char *diag, int *n, int *k, s *a, int *lda, s *x, int *incx) noexcept nogil
+cdef void stpmv(char *uplo, char *trans, char *diag, int *n, s *ap, s *x, int *incx) noexcept nogil
+cdef void stpsv(char *uplo, char *trans, char *diag, int *n, s *ap, s *x, int *incx) noexcept nogil
+cdef void strmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb) noexcept nogil
+cdef void strmv(char *uplo, char *trans, char *diag, int *n, s *a, int *lda, s *x, int *incx) noexcept nogil
+cdef void strsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb) noexcept nogil
+cdef void strsv(char *uplo, char *trans, char *diag, int *n, s *a, int *lda, s *x, int *incx) noexcept nogil
+cdef void zaxpy(int *n, z *za, z *zx, int *incx, z *zy, int *incy) noexcept nogil
+cdef void zcopy(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil
+cdef z zdotc(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil
+cdef z zdotu(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil
+cdef void zdrot(int *n, z *cx, int *incx, z *cy, int *incy, d *c, d *s) noexcept nogil
+cdef void zdscal(int *n, d *da, z *zx, int *incx) noexcept nogil
+cdef void zgbmv(char *trans, int *m, int *n, int *kl, int *ku, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil
+cdef void zgemm(char *transa, char *transb, int *m, int *n, int *k, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil
+cdef void zgemv(char *trans, int *m, int *n, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil
+cdef void zgerc(int *m, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *a, int *lda) noexcept nogil
+cdef void zgeru(int *m, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *a, int *lda) noexcept nogil
+cdef void zhbmv(char *uplo, int *n, int *k, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil
+cdef void zhemm(char *side, char *uplo, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil
+cdef void zhemv(char *uplo, int *n, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil
+cdef void zher(char *uplo, int *n, d *alpha, z *x, int *incx, z *a, int *lda) noexcept nogil
+cdef void zher2(char *uplo, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *a, int *lda) noexcept nogil
+cdef void zher2k(char *uplo, char *trans, int *n, int *k, z *alpha, z *a, int *lda, z *b, int *ldb, d *beta, z *c, int *ldc) noexcept nogil
+cdef void zherk(char *uplo, char *trans, int *n, int *k, d *alpha, z *a, int *lda, d *beta, z *c, int *ldc) noexcept nogil
+cdef void zhpmv(char *uplo, int *n, z *alpha, z *ap, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil
+cdef void zhpr(char *uplo, int *n, d *alpha, z *x, int *incx, z *ap) noexcept nogil
+cdef void zhpr2(char *uplo, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *ap) noexcept nogil
+cdef void zrotg(z *ca, z *cb, d *c, z *s) noexcept nogil
+cdef void zscal(int *n, z *za, z *zx, int *incx) noexcept nogil
+cdef void zswap(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil
+cdef void zsymm(char *side, char *uplo, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil
+cdef void zsyr2k(char *uplo, char *trans, int *n, int *k, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil
+cdef void zsyrk(char *uplo, char *trans, int *n, int *k, z *alpha, z *a, int *lda, z *beta, z *c, int *ldc) noexcept nogil
+cdef void ztbmv(char *uplo, char *trans, char *diag, int *n, int *k, z *a, int *lda, z *x, int *incx) noexcept nogil
+cdef void ztbsv(char *uplo, char *trans, char *diag, int *n, int *k, z *a, int *lda, z *x, int *incx) noexcept nogil
+cdef void ztpmv(char *uplo, char *trans, char *diag, int *n, z *ap, z *x, int *incx) noexcept nogil
+cdef void ztpsv(char *uplo, char *trans, char *diag, int *n, z *ap, z *x, int *incx) noexcept nogil
+cdef void ztrmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb) noexcept nogil
+cdef void ztrmv(char *uplo, char *trans, char *diag, int *n, z *a, int *lda, z *x, int *incx) noexcept nogil
+cdef void ztrsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb) noexcept nogil
+cdef void ztrsv(char *uplo, char *trans, char *diag, int *n, z *a, int *lda, z *x, int *incx) noexcept nogil

env-llmeval/lib/python3.10/site-packages/scipy/linalg/cython_blas.pyx

@@ -0,0 +1,1422 @@
+# This file was generated by _generate_pyx.py.
+# Do not edit this file directly.
+# cython: boundscheck = False
+# cython: wraparound = False
+# cython: cdivision = True
+
+"""
+BLAS Functions for Cython
+=========================
+
+Usable from Cython via::
+
+    cimport scipy.linalg.cython_blas
+
+These wrappers do not check for alignment of arrays.
+Alignment should be checked before these wrappers are used.
+
+Raw function pointers (Fortran-style pointer arguments):
+
+- caxpy
+- ccopy
+- cdotc
+- cdotu
+- cgbmv
+- cgemm
+- cgemv
+- cgerc
+- cgeru
+- chbmv
+- chemm
+- chemv
+- cher
+- cher2
+- cher2k
+- cherk
+- chpmv
+- chpr
+- chpr2
+- crotg
+- cscal
+- csrot
+- csscal
+- cswap
+- csymm
+- csyr2k
+- csyrk
+- ctbmv
+- ctbsv
+- ctpmv
+- ctpsv
+- ctrmm
+- ctrmv
+- ctrsm
+- ctrsv
+- dasum
+- daxpy
+- dcabs1
+- dcopy
+- ddot
+- dgbmv
+- dgemm
+- dgemv
+- dger
+- dnrm2
+- drot
+- drotg
+- drotm
+- drotmg
+- dsbmv
+- dscal
+- dsdot
+- dspmv
+- dspr
+- dspr2
+- dswap
+- dsymm
+- dsymv
+- dsyr
+- dsyr2
+- dsyr2k
+- dsyrk
+- dtbmv
+- dtbsv
+- dtpmv
+- dtpsv
+- dtrmm
+- dtrmv
+- dtrsm
+- dtrsv
+- dzasum
+- dznrm2
+- icamax
+- idamax
+- isamax
+- izamax
+- lsame
+- sasum
+- saxpy
+- scasum
+- scnrm2
+- scopy
+- sdot
+- sdsdot
+- sgbmv
+- sgemm
+- sgemv
+- sger
+- snrm2
+- srot
+- srotg
+- srotm
+- srotmg
+- ssbmv
+- sscal
+- sspmv
+- sspr
+- sspr2
+- sswap
+- ssymm
+- ssymv
+- ssyr
+- ssyr2
+- ssyr2k
+- ssyrk
+- stbmv
+- stbsv
+- stpmv
+- stpsv
+- strmm
+- strmv
+- strsm
+- strsv
+- zaxpy
+- zcopy
+- zdotc
+- zdotu
+- zdrot
+- zdscal
+- zgbmv
+- zgemm
+- zgemv
+- zgerc
+- zgeru
+- zhbmv
+- zhemm
+- zhemv
+- zher
+- zher2
+- zher2k
+- zherk
+- zhpmv
+- zhpr
+- zhpr2
+- zrotg
+- zscal
+- zswap
+- zsymm
+- zsyr2k
+- zsyrk
+- ztbmv
+- ztbsv
+- ztpmv
+- ztpsv
+- ztrmm
+- ztrmv
+- ztrsm
+- ztrsv
+
+
+"""
+
+# Within SciPy, these wrappers can be used via relative or absolute cimport.
+# Examples:
+# from ..linalg cimport cython_blas
+# from scipy.linalg cimport cython_blas
+# cimport scipy.linalg.cython_blas as cython_blas
+# cimport ..linalg.cython_blas as cython_blas
+
+# Within SciPy, if BLAS functions are needed in C/C++/Fortran,
+# these wrappers should not be used.
+# The original libraries should be linked directly.
+
+cdef extern from "fortran_defs.h":
+    pass
+
+from numpy cimport npy_complex64, npy_complex128
+
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_caxpy "BLAS_FUNC(caxpy)"(int *n, npy_complex64 *ca, npy_complex64 *cx, int *incx, npy_complex64 *cy, int *incy) nogil
+cdef void caxpy(int *n, c *ca, c *cx, int *incx, c *cy, int *incy) noexcept nogil:
+    
+    _fortran_caxpy(n, <npy_complex64*>ca, <npy_complex64*>cx, incx, <npy_complex64*>cy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ccopy "BLAS_FUNC(ccopy)"(int *n, npy_complex64 *cx, int *incx, npy_complex64 *cy, int *incy) nogil
+cdef void ccopy(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil:
+    
+    _fortran_ccopy(n, <npy_complex64*>cx, incx, <npy_complex64*>cy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cdotc "(cdotcwrp_)"(npy_complex64 *out, int *n, npy_complex64 *cx, int *incx, npy_complex64 *cy, int *incy) nogil
+cdef c cdotc(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil:
+    cdef c out
+    _fortran_cdotc(<npy_complex64*>&out, n, <npy_complex64*>cx, incx, <npy_complex64*>cy, incy)
+    return out
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cdotu "(cdotuwrp_)"(npy_complex64 *out, int *n, npy_complex64 *cx, int *incx, npy_complex64 *cy, int *incy) nogil
+cdef c cdotu(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil:
+    cdef c out
+    _fortran_cdotu(<npy_complex64*>&out, n, <npy_complex64*>cx, incx, <npy_complex64*>cy, incy)
+    return out
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cgbmv "BLAS_FUNC(cgbmv)"(char *trans, int *m, int *n, int *kl, int *ku, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx, npy_complex64 *beta, npy_complex64 *y, int *incy) nogil
+cdef void cgbmv(char *trans, int *m, int *n, int *kl, int *ku, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil:
+    
+    _fortran_cgbmv(trans, m, n, kl, ku, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>x, incx, <npy_complex64*>beta, <npy_complex64*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cgemm "BLAS_FUNC(cgemm)"(char *transa, char *transb, int *m, int *n, int *k, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *b, int *ldb, npy_complex64 *beta, npy_complex64 *c, int *ldc) nogil
+cdef void cgemm(char *transa, char *transb, int *m, int *n, int *k, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil:
+    
+    _fortran_cgemm(transa, transb, m, n, k, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>b, ldb, <npy_complex64*>beta, <npy_complex64*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cgemv "BLAS_FUNC(cgemv)"(char *trans, int *m, int *n, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx, npy_complex64 *beta, npy_complex64 *y, int *incy) nogil
+cdef void cgemv(char *trans, int *m, int *n, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil:
+    
+    _fortran_cgemv(trans, m, n, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>x, incx, <npy_complex64*>beta, <npy_complex64*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cgerc "BLAS_FUNC(cgerc)"(int *m, int *n, npy_complex64 *alpha, npy_complex64 *x, int *incx, npy_complex64 *y, int *incy, npy_complex64 *a, int *lda) nogil
+cdef void cgerc(int *m, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *a, int *lda) noexcept nogil:
+    
+    _fortran_cgerc(m, n, <npy_complex64*>alpha, <npy_complex64*>x, incx, <npy_complex64*>y, incy, <npy_complex64*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cgeru "BLAS_FUNC(cgeru)"(int *m, int *n, npy_complex64 *alpha, npy_complex64 *x, int *incx, npy_complex64 *y, int *incy, npy_complex64 *a, int *lda) nogil
+cdef void cgeru(int *m, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *a, int *lda) noexcept nogil:
+    
+    _fortran_cgeru(m, n, <npy_complex64*>alpha, <npy_complex64*>x, incx, <npy_complex64*>y, incy, <npy_complex64*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_chbmv "BLAS_FUNC(chbmv)"(char *uplo, int *n, int *k, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx, npy_complex64 *beta, npy_complex64 *y, int *incy) nogil
+cdef void chbmv(char *uplo, int *n, int *k, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil:
+    
+    _fortran_chbmv(uplo, n, k, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>x, incx, <npy_complex64*>beta, <npy_complex64*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_chemm "BLAS_FUNC(chemm)"(char *side, char *uplo, int *m, int *n, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *b, int *ldb, npy_complex64 *beta, npy_complex64 *c, int *ldc) nogil
+cdef void chemm(char *side, char *uplo, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil:
+    
+    _fortran_chemm(side, uplo, m, n, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>b, ldb, <npy_complex64*>beta, <npy_complex64*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_chemv "BLAS_FUNC(chemv)"(char *uplo, int *n, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx, npy_complex64 *beta, npy_complex64 *y, int *incy) nogil
+cdef void chemv(char *uplo, int *n, c *alpha, c *a, int *lda, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil:
+    
+    _fortran_chemv(uplo, n, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>x, incx, <npy_complex64*>beta, <npy_complex64*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cher "BLAS_FUNC(cher)"(char *uplo, int *n, s *alpha, npy_complex64 *x, int *incx, npy_complex64 *a, int *lda) nogil
+cdef void cher(char *uplo, int *n, s *alpha, c *x, int *incx, c *a, int *lda) noexcept nogil:
+    
+    _fortran_cher(uplo, n, alpha, <npy_complex64*>x, incx, <npy_complex64*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cher2 "BLAS_FUNC(cher2)"(char *uplo, int *n, npy_complex64 *alpha, npy_complex64 *x, int *incx, npy_complex64 *y, int *incy, npy_complex64 *a, int *lda) nogil
+cdef void cher2(char *uplo, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *a, int *lda) noexcept nogil:
+    
+    _fortran_cher2(uplo, n, <npy_complex64*>alpha, <npy_complex64*>x, incx, <npy_complex64*>y, incy, <npy_complex64*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cher2k "BLAS_FUNC(cher2k)"(char *uplo, char *trans, int *n, int *k, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *b, int *ldb, s *beta, npy_complex64 *c, int *ldc) nogil
+cdef void cher2k(char *uplo, char *trans, int *n, int *k, c *alpha, c *a, int *lda, c *b, int *ldb, s *beta, c *c, int *ldc) noexcept nogil:
+    
+    _fortran_cher2k(uplo, trans, n, k, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>b, ldb, beta, <npy_complex64*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cherk "BLAS_FUNC(cherk)"(char *uplo, char *trans, int *n, int *k, s *alpha, npy_complex64 *a, int *lda, s *beta, npy_complex64 *c, int *ldc) nogil
+cdef void cherk(char *uplo, char *trans, int *n, int *k, s *alpha, c *a, int *lda, s *beta, c *c, int *ldc) noexcept nogil:
+    
+    _fortran_cherk(uplo, trans, n, k, alpha, <npy_complex64*>a, lda, beta, <npy_complex64*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_chpmv "BLAS_FUNC(chpmv)"(char *uplo, int *n, npy_complex64 *alpha, npy_complex64 *ap, npy_complex64 *x, int *incx, npy_complex64 *beta, npy_complex64 *y, int *incy) nogil
+cdef void chpmv(char *uplo, int *n, c *alpha, c *ap, c *x, int *incx, c *beta, c *y, int *incy) noexcept nogil:
+    
+    _fortran_chpmv(uplo, n, <npy_complex64*>alpha, <npy_complex64*>ap, <npy_complex64*>x, incx, <npy_complex64*>beta, <npy_complex64*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_chpr "BLAS_FUNC(chpr)"(char *uplo, int *n, s *alpha, npy_complex64 *x, int *incx, npy_complex64 *ap) nogil
+cdef void chpr(char *uplo, int *n, s *alpha, c *x, int *incx, c *ap) noexcept nogil:
+    
+    _fortran_chpr(uplo, n, alpha, <npy_complex64*>x, incx, <npy_complex64*>ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_chpr2 "BLAS_FUNC(chpr2)"(char *uplo, int *n, npy_complex64 *alpha, npy_complex64 *x, int *incx, npy_complex64 *y, int *incy, npy_complex64 *ap) nogil
+cdef void chpr2(char *uplo, int *n, c *alpha, c *x, int *incx, c *y, int *incy, c *ap) noexcept nogil:
+    
+    _fortran_chpr2(uplo, n, <npy_complex64*>alpha, <npy_complex64*>x, incx, <npy_complex64*>y, incy, <npy_complex64*>ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_crotg "BLAS_FUNC(crotg)"(npy_complex64 *ca, npy_complex64 *cb, s *c, npy_complex64 *s) nogil
+cdef void crotg(c *ca, c *cb, s *c, c *s) noexcept nogil:
+    
+    _fortran_crotg(<npy_complex64*>ca, <npy_complex64*>cb, c, <npy_complex64*>s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cscal "BLAS_FUNC(cscal)"(int *n, npy_complex64 *ca, npy_complex64 *cx, int *incx) nogil
+cdef void cscal(int *n, c *ca, c *cx, int *incx) noexcept nogil:
+    
+    _fortran_cscal(n, <npy_complex64*>ca, <npy_complex64*>cx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_csrot "BLAS_FUNC(csrot)"(int *n, npy_complex64 *cx, int *incx, npy_complex64 *cy, int *incy, s *c, s *s) nogil
+cdef void csrot(int *n, c *cx, int *incx, c *cy, int *incy, s *c, s *s) noexcept nogil:
+    
+    _fortran_csrot(n, <npy_complex64*>cx, incx, <npy_complex64*>cy, incy, c, s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_csscal "BLAS_FUNC(csscal)"(int *n, s *sa, npy_complex64 *cx, int *incx) nogil
+cdef void csscal(int *n, s *sa, c *cx, int *incx) noexcept nogil:
+    
+    _fortran_csscal(n, sa, <npy_complex64*>cx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_cswap "BLAS_FUNC(cswap)"(int *n, npy_complex64 *cx, int *incx, npy_complex64 *cy, int *incy) nogil
+cdef void cswap(int *n, c *cx, int *incx, c *cy, int *incy) noexcept nogil:
+    
+    _fortran_cswap(n, <npy_complex64*>cx, incx, <npy_complex64*>cy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_csymm "BLAS_FUNC(csymm)"(char *side, char *uplo, int *m, int *n, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *b, int *ldb, npy_complex64 *beta, npy_complex64 *c, int *ldc) nogil
+cdef void csymm(char *side, char *uplo, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil:
+    
+    _fortran_csymm(side, uplo, m, n, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>b, ldb, <npy_complex64*>beta, <npy_complex64*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_csyr2k "BLAS_FUNC(csyr2k)"(char *uplo, char *trans, int *n, int *k, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *b, int *ldb, npy_complex64 *beta, npy_complex64 *c, int *ldc) nogil
+cdef void csyr2k(char *uplo, char *trans, int *n, int *k, c *alpha, c *a, int *lda, c *b, int *ldb, c *beta, c *c, int *ldc) noexcept nogil:
+    
+    _fortran_csyr2k(uplo, trans, n, k, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>b, ldb, <npy_complex64*>beta, <npy_complex64*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_csyrk "BLAS_FUNC(csyrk)"(char *uplo, char *trans, int *n, int *k, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *beta, npy_complex64 *c, int *ldc) nogil
+cdef void csyrk(char *uplo, char *trans, int *n, int *k, c *alpha, c *a, int *lda, c *beta, c *c, int *ldc) noexcept nogil:
+    
+    _fortran_csyrk(uplo, trans, n, k, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>beta, <npy_complex64*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctbmv "BLAS_FUNC(ctbmv)"(char *uplo, char *trans, char *diag, int *n, int *k, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx) nogil
+cdef void ctbmv(char *uplo, char *trans, char *diag, int *n, int *k, c *a, int *lda, c *x, int *incx) noexcept nogil:
+    
+    _fortran_ctbmv(uplo, trans, diag, n, k, <npy_complex64*>a, lda, <npy_complex64*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctbsv "BLAS_FUNC(ctbsv)"(char *uplo, char *trans, char *diag, int *n, int *k, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx) nogil
+cdef void ctbsv(char *uplo, char *trans, char *diag, int *n, int *k, c *a, int *lda, c *x, int *incx) noexcept nogil:
+    
+    _fortran_ctbsv(uplo, trans, diag, n, k, <npy_complex64*>a, lda, <npy_complex64*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctpmv "BLAS_FUNC(ctpmv)"(char *uplo, char *trans, char *diag, int *n, npy_complex64 *ap, npy_complex64 *x, int *incx) nogil
+cdef void ctpmv(char *uplo, char *trans, char *diag, int *n, c *ap, c *x, int *incx) noexcept nogil:
+    
+    _fortran_ctpmv(uplo, trans, diag, n, <npy_complex64*>ap, <npy_complex64*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctpsv "BLAS_FUNC(ctpsv)"(char *uplo, char *trans, char *diag, int *n, npy_complex64 *ap, npy_complex64 *x, int *incx) nogil
+cdef void ctpsv(char *uplo, char *trans, char *diag, int *n, c *ap, c *x, int *incx) noexcept nogil:
+    
+    _fortran_ctpsv(uplo, trans, diag, n, <npy_complex64*>ap, <npy_complex64*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctrmm "BLAS_FUNC(ctrmm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *b, int *ldb) nogil
+cdef void ctrmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb) noexcept nogil:
+    
+    _fortran_ctrmm(side, uplo, transa, diag, m, n, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctrmv "BLAS_FUNC(ctrmv)"(char *uplo, char *trans, char *diag, int *n, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx) nogil
+cdef void ctrmv(char *uplo, char *trans, char *diag, int *n, c *a, int *lda, c *x, int *incx) noexcept nogil:
+    
+    _fortran_ctrmv(uplo, trans, diag, n, <npy_complex64*>a, lda, <npy_complex64*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctrsm "BLAS_FUNC(ctrsm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, npy_complex64 *alpha, npy_complex64 *a, int *lda, npy_complex64 *b, int *ldb) nogil
+cdef void ctrsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, c *alpha, c *a, int *lda, c *b, int *ldb) noexcept nogil:
+    
+    _fortran_ctrsm(side, uplo, transa, diag, m, n, <npy_complex64*>alpha, <npy_complex64*>a, lda, <npy_complex64*>b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ctrsv "BLAS_FUNC(ctrsv)"(char *uplo, char *trans, char *diag, int *n, npy_complex64 *a, int *lda, npy_complex64 *x, int *incx) nogil
+cdef void ctrsv(char *uplo, char *trans, char *diag, int *n, c *a, int *lda, c *x, int *incx) noexcept nogil:
+    
+    _fortran_ctrsv(uplo, trans, diag, n, <npy_complex64*>a, lda, <npy_complex64*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    d _fortran_dasum "BLAS_FUNC(dasum)"(int *n, d *dx, int *incx) nogil
+cdef d dasum(int *n, d *dx, int *incx) noexcept nogil:
+    
+    return _fortran_dasum(n, dx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_daxpy "BLAS_FUNC(daxpy)"(int *n, d *da, d *dx, int *incx, d *dy, int *incy) nogil
+cdef void daxpy(int *n, d *da, d *dx, int *incx, d *dy, int *incy) noexcept nogil:
+    
+    _fortran_daxpy(n, da, dx, incx, dy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    d _fortran_dcabs1 "BLAS_FUNC(dcabs1)"(npy_complex128 *z) nogil
+cdef d dcabs1(z *z) noexcept nogil:
+    
+    return _fortran_dcabs1(<npy_complex128*>z)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dcopy "BLAS_FUNC(dcopy)"(int *n, d *dx, int *incx, d *dy, int *incy) nogil
+cdef void dcopy(int *n, d *dx, int *incx, d *dy, int *incy) noexcept nogil:
+    
+    _fortran_dcopy(n, dx, incx, dy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    d _fortran_ddot "BLAS_FUNC(ddot)"(int *n, d *dx, int *incx, d *dy, int *incy) nogil
+cdef d ddot(int *n, d *dx, int *incx, d *dy, int *incy) noexcept nogil:
+    
+    return _fortran_ddot(n, dx, incx, dy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dgbmv "BLAS_FUNC(dgbmv)"(char *trans, int *m, int *n, int *kl, int *ku, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) nogil
+cdef void dgbmv(char *trans, int *m, int *n, int *kl, int *ku, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil:
+    
+    _fortran_dgbmv(trans, m, n, kl, ku, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dgemm "BLAS_FUNC(dgemm)"(char *transa, char *transb, int *m, int *n, int *k, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) nogil
+cdef void dgemm(char *transa, char *transb, int *m, int *n, int *k, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) noexcept nogil:
+    
+    _fortran_dgemm(transa, transb, m, n, k, alpha, a, lda, b, ldb, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dgemv "BLAS_FUNC(dgemv)"(char *trans, int *m, int *n, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) nogil
+cdef void dgemv(char *trans, int *m, int *n, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil:
+    
+    _fortran_dgemv(trans, m, n, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dger "BLAS_FUNC(dger)"(int *m, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *a, int *lda) nogil
+cdef void dger(int *m, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *a, int *lda) noexcept nogil:
+    
+    _fortran_dger(m, n, alpha, x, incx, y, incy, a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    d _fortran_dnrm2 "BLAS_FUNC(dnrm2)"(int *n, d *x, int *incx) nogil
+cdef d dnrm2(int *n, d *x, int *incx) noexcept nogil:
+    
+    return _fortran_dnrm2(n, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_drot "BLAS_FUNC(drot)"(int *n, d *dx, int *incx, d *dy, int *incy, d *c, d *s) nogil
+cdef void drot(int *n, d *dx, int *incx, d *dy, int *incy, d *c, d *s) noexcept nogil:
+    
+    _fortran_drot(n, dx, incx, dy, incy, c, s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_drotg "BLAS_FUNC(drotg)"(d *da, d *db, d *c, d *s) nogil
+cdef void drotg(d *da, d *db, d *c, d *s) noexcept nogil:
+    
+    _fortran_drotg(da, db, c, s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_drotm "BLAS_FUNC(drotm)"(int *n, d *dx, int *incx, d *dy, int *incy, d *dparam) nogil
+cdef void drotm(int *n, d *dx, int *incx, d *dy, int *incy, d *dparam) noexcept nogil:
+    
+    _fortran_drotm(n, dx, incx, dy, incy, dparam)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_drotmg "BLAS_FUNC(drotmg)"(d *dd1, d *dd2, d *dx1, d *dy1, d *dparam) nogil
+cdef void drotmg(d *dd1, d *dd2, d *dx1, d *dy1, d *dparam) noexcept nogil:
+    
+    _fortran_drotmg(dd1, dd2, dx1, dy1, dparam)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dsbmv "BLAS_FUNC(dsbmv)"(char *uplo, int *n, int *k, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) nogil
+cdef void dsbmv(char *uplo, int *n, int *k, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil:
+    
+    _fortran_dsbmv(uplo, n, k, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dscal "BLAS_FUNC(dscal)"(int *n, d *da, d *dx, int *incx) nogil
+cdef void dscal(int *n, d *da, d *dx, int *incx) noexcept nogil:
+    
+    _fortran_dscal(n, da, dx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    d _fortran_dsdot "BLAS_FUNC(dsdot)"(int *n, s *sx, int *incx, s *sy, int *incy) nogil
+cdef d dsdot(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil:
+    
+    return _fortran_dsdot(n, sx, incx, sy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dspmv "BLAS_FUNC(dspmv)"(char *uplo, int *n, d *alpha, d *ap, d *x, int *incx, d *beta, d *y, int *incy) nogil
+cdef void dspmv(char *uplo, int *n, d *alpha, d *ap, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil:
+    
+    _fortran_dspmv(uplo, n, alpha, ap, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dspr "BLAS_FUNC(dspr)"(char *uplo, int *n, d *alpha, d *x, int *incx, d *ap) nogil
+cdef void dspr(char *uplo, int *n, d *alpha, d *x, int *incx, d *ap) noexcept nogil:
+    
+    _fortran_dspr(uplo, n, alpha, x, incx, ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dspr2 "BLAS_FUNC(dspr2)"(char *uplo, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *ap) nogil
+cdef void dspr2(char *uplo, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *ap) noexcept nogil:
+    
+    _fortran_dspr2(uplo, n, alpha, x, incx, y, incy, ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dswap "BLAS_FUNC(dswap)"(int *n, d *dx, int *incx, d *dy, int *incy) nogil
+cdef void dswap(int *n, d *dx, int *incx, d *dy, int *incy) noexcept nogil:
+    
+    _fortran_dswap(n, dx, incx, dy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dsymm "BLAS_FUNC(dsymm)"(char *side, char *uplo, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) nogil
+cdef void dsymm(char *side, char *uplo, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) noexcept nogil:
+    
+    _fortran_dsymm(side, uplo, m, n, alpha, a, lda, b, ldb, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dsymv "BLAS_FUNC(dsymv)"(char *uplo, int *n, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) nogil
+cdef void dsymv(char *uplo, int *n, d *alpha, d *a, int *lda, d *x, int *incx, d *beta, d *y, int *incy) noexcept nogil:
+    
+    _fortran_dsymv(uplo, n, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dsyr "BLAS_FUNC(dsyr)"(char *uplo, int *n, d *alpha, d *x, int *incx, d *a, int *lda) nogil
+cdef void dsyr(char *uplo, int *n, d *alpha, d *x, int *incx, d *a, int *lda) noexcept nogil:
+    
+    _fortran_dsyr(uplo, n, alpha, x, incx, a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dsyr2 "BLAS_FUNC(dsyr2)"(char *uplo, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *a, int *lda) nogil
+cdef void dsyr2(char *uplo, int *n, d *alpha, d *x, int *incx, d *y, int *incy, d *a, int *lda) noexcept nogil:
+    
+    _fortran_dsyr2(uplo, n, alpha, x, incx, y, incy, a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dsyr2k "BLAS_FUNC(dsyr2k)"(char *uplo, char *trans, int *n, int *k, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) nogil
+cdef void dsyr2k(char *uplo, char *trans, int *n, int *k, d *alpha, d *a, int *lda, d *b, int *ldb, d *beta, d *c, int *ldc) noexcept nogil:
+    
+    _fortran_dsyr2k(uplo, trans, n, k, alpha, a, lda, b, ldb, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dsyrk "BLAS_FUNC(dsyrk)"(char *uplo, char *trans, int *n, int *k, d *alpha, d *a, int *lda, d *beta, d *c, int *ldc) nogil
+cdef void dsyrk(char *uplo, char *trans, int *n, int *k, d *alpha, d *a, int *lda, d *beta, d *c, int *ldc) noexcept nogil:
+    
+    _fortran_dsyrk(uplo, trans, n, k, alpha, a, lda, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtbmv "BLAS_FUNC(dtbmv)"(char *uplo, char *trans, char *diag, int *n, int *k, d *a, int *lda, d *x, int *incx) nogil
+cdef void dtbmv(char *uplo, char *trans, char *diag, int *n, int *k, d *a, int *lda, d *x, int *incx) noexcept nogil:
+    
+    _fortran_dtbmv(uplo, trans, diag, n, k, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtbsv "BLAS_FUNC(dtbsv)"(char *uplo, char *trans, char *diag, int *n, int *k, d *a, int *lda, d *x, int *incx) nogil
+cdef void dtbsv(char *uplo, char *trans, char *diag, int *n, int *k, d *a, int *lda, d *x, int *incx) noexcept nogil:
+    
+    _fortran_dtbsv(uplo, trans, diag, n, k, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtpmv "BLAS_FUNC(dtpmv)"(char *uplo, char *trans, char *diag, int *n, d *ap, d *x, int *incx) nogil
+cdef void dtpmv(char *uplo, char *trans, char *diag, int *n, d *ap, d *x, int *incx) noexcept nogil:
+    
+    _fortran_dtpmv(uplo, trans, diag, n, ap, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtpsv "BLAS_FUNC(dtpsv)"(char *uplo, char *trans, char *diag, int *n, d *ap, d *x, int *incx) nogil
+cdef void dtpsv(char *uplo, char *trans, char *diag, int *n, d *ap, d *x, int *incx) noexcept nogil:
+    
+    _fortran_dtpsv(uplo, trans, diag, n, ap, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtrmm "BLAS_FUNC(dtrmm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb) nogil
+cdef void dtrmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb) noexcept nogil:
+    
+    _fortran_dtrmm(side, uplo, transa, diag, m, n, alpha, a, lda, b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtrmv "BLAS_FUNC(dtrmv)"(char *uplo, char *trans, char *diag, int *n, d *a, int *lda, d *x, int *incx) nogil
+cdef void dtrmv(char *uplo, char *trans, char *diag, int *n, d *a, int *lda, d *x, int *incx) noexcept nogil:
+    
+    _fortran_dtrmv(uplo, trans, diag, n, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtrsm "BLAS_FUNC(dtrsm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb) nogil
+cdef void dtrsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, d *alpha, d *a, int *lda, d *b, int *ldb) noexcept nogil:
+    
+    _fortran_dtrsm(side, uplo, transa, diag, m, n, alpha, a, lda, b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_dtrsv "BLAS_FUNC(dtrsv)"(char *uplo, char *trans, char *diag, int *n, d *a, int *lda, d *x, int *incx) nogil
+cdef void dtrsv(char *uplo, char *trans, char *diag, int *n, d *a, int *lda, d *x, int *incx) noexcept nogil:
+    
+    _fortran_dtrsv(uplo, trans, diag, n, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    d _fortran_dzasum "BLAS_FUNC(dzasum)"(int *n, npy_complex128 *zx, int *incx) nogil
+cdef d dzasum(int *n, z *zx, int *incx) noexcept nogil:
+    
+    return _fortran_dzasum(n, <npy_complex128*>zx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    d _fortran_dznrm2 "BLAS_FUNC(dznrm2)"(int *n, npy_complex128 *x, int *incx) nogil
+cdef d dznrm2(int *n, z *x, int *incx) noexcept nogil:
+    
+    return _fortran_dznrm2(n, <npy_complex128*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    int _fortran_icamax "BLAS_FUNC(icamax)"(int *n, npy_complex64 *cx, int *incx) nogil
+cdef int icamax(int *n, c *cx, int *incx) noexcept nogil:
+    
+    return _fortran_icamax(n, <npy_complex64*>cx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    int _fortran_idamax "BLAS_FUNC(idamax)"(int *n, d *dx, int *incx) nogil
+cdef int idamax(int *n, d *dx, int *incx) noexcept nogil:
+    
+    return _fortran_idamax(n, dx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    int _fortran_isamax "BLAS_FUNC(isamax)"(int *n, s *sx, int *incx) nogil
+cdef int isamax(int *n, s *sx, int *incx) noexcept nogil:
+    
+    return _fortran_isamax(n, sx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    int _fortran_izamax "BLAS_FUNC(izamax)"(int *n, npy_complex128 *zx, int *incx) nogil
+cdef int izamax(int *n, z *zx, int *incx) noexcept nogil:
+    
+    return _fortran_izamax(n, <npy_complex128*>zx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    bint _fortran_lsame "BLAS_FUNC(lsame)"(char *ca, char *cb) nogil
+cdef bint lsame(char *ca, char *cb) noexcept nogil:
+    
+    return _fortran_lsame(ca, cb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    s _fortran_sasum "BLAS_FUNC(sasum)"(int *n, s *sx, int *incx) nogil
+cdef s sasum(int *n, s *sx, int *incx) noexcept nogil:
+    
+    return _fortran_sasum(n, sx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_saxpy "BLAS_FUNC(saxpy)"(int *n, s *sa, s *sx, int *incx, s *sy, int *incy) nogil
+cdef void saxpy(int *n, s *sa, s *sx, int *incx, s *sy, int *incy) noexcept nogil:
+    
+    _fortran_saxpy(n, sa, sx, incx, sy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    s _fortran_scasum "BLAS_FUNC(scasum)"(int *n, npy_complex64 *cx, int *incx) nogil
+cdef s scasum(int *n, c *cx, int *incx) noexcept nogil:
+    
+    return _fortran_scasum(n, <npy_complex64*>cx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    s _fortran_scnrm2 "BLAS_FUNC(scnrm2)"(int *n, npy_complex64 *x, int *incx) nogil
+cdef s scnrm2(int *n, c *x, int *incx) noexcept nogil:
+    
+    return _fortran_scnrm2(n, <npy_complex64*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_scopy "BLAS_FUNC(scopy)"(int *n, s *sx, int *incx, s *sy, int *incy) nogil
+cdef void scopy(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil:
+    
+    _fortran_scopy(n, sx, incx, sy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    s _fortran_sdot "BLAS_FUNC(sdot)"(int *n, s *sx, int *incx, s *sy, int *incy) nogil
+cdef s sdot(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil:
+    
+    return _fortran_sdot(n, sx, incx, sy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    s _fortran_sdsdot "BLAS_FUNC(sdsdot)"(int *n, s *sb, s *sx, int *incx, s *sy, int *incy) nogil
+cdef s sdsdot(int *n, s *sb, s *sx, int *incx, s *sy, int *incy) noexcept nogil:
+    
+    return _fortran_sdsdot(n, sb, sx, incx, sy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sgbmv "BLAS_FUNC(sgbmv)"(char *trans, int *m, int *n, int *kl, int *ku, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) nogil
+cdef void sgbmv(char *trans, int *m, int *n, int *kl, int *ku, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil:
+    
+    _fortran_sgbmv(trans, m, n, kl, ku, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sgemm "BLAS_FUNC(sgemm)"(char *transa, char *transb, int *m, int *n, int *k, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) nogil
+cdef void sgemm(char *transa, char *transb, int *m, int *n, int *k, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) noexcept nogil:
+    
+    _fortran_sgemm(transa, transb, m, n, k, alpha, a, lda, b, ldb, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sgemv "BLAS_FUNC(sgemv)"(char *trans, int *m, int *n, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) nogil
+cdef void sgemv(char *trans, int *m, int *n, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil:
+    
+    _fortran_sgemv(trans, m, n, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sger "BLAS_FUNC(sger)"(int *m, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *a, int *lda) nogil
+cdef void sger(int *m, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *a, int *lda) noexcept nogil:
+    
+    _fortran_sger(m, n, alpha, x, incx, y, incy, a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    s _fortran_snrm2 "BLAS_FUNC(snrm2)"(int *n, s *x, int *incx) nogil
+cdef s snrm2(int *n, s *x, int *incx) noexcept nogil:
+    
+    return _fortran_snrm2(n, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_srot "BLAS_FUNC(srot)"(int *n, s *sx, int *incx, s *sy, int *incy, s *c, s *s) nogil
+cdef void srot(int *n, s *sx, int *incx, s *sy, int *incy, s *c, s *s) noexcept nogil:
+    
+    _fortran_srot(n, sx, incx, sy, incy, c, s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_srotg "BLAS_FUNC(srotg)"(s *sa, s *sb, s *c, s *s) nogil
+cdef void srotg(s *sa, s *sb, s *c, s *s) noexcept nogil:
+    
+    _fortran_srotg(sa, sb, c, s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_srotm "BLAS_FUNC(srotm)"(int *n, s *sx, int *incx, s *sy, int *incy, s *sparam) nogil
+cdef void srotm(int *n, s *sx, int *incx, s *sy, int *incy, s *sparam) noexcept nogil:
+    
+    _fortran_srotm(n, sx, incx, sy, incy, sparam)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_srotmg "BLAS_FUNC(srotmg)"(s *sd1, s *sd2, s *sx1, s *sy1, s *sparam) nogil
+cdef void srotmg(s *sd1, s *sd2, s *sx1, s *sy1, s *sparam) noexcept nogil:
+    
+    _fortran_srotmg(sd1, sd2, sx1, sy1, sparam)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ssbmv "BLAS_FUNC(ssbmv)"(char *uplo, int *n, int *k, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) nogil
+cdef void ssbmv(char *uplo, int *n, int *k, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil:
+    
+    _fortran_ssbmv(uplo, n, k, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sscal "BLAS_FUNC(sscal)"(int *n, s *sa, s *sx, int *incx) nogil
+cdef void sscal(int *n, s *sa, s *sx, int *incx) noexcept nogil:
+    
+    _fortran_sscal(n, sa, sx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sspmv "BLAS_FUNC(sspmv)"(char *uplo, int *n, s *alpha, s *ap, s *x, int *incx, s *beta, s *y, int *incy) nogil
+cdef void sspmv(char *uplo, int *n, s *alpha, s *ap, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil:
+    
+    _fortran_sspmv(uplo, n, alpha, ap, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sspr "BLAS_FUNC(sspr)"(char *uplo, int *n, s *alpha, s *x, int *incx, s *ap) nogil
+cdef void sspr(char *uplo, int *n, s *alpha, s *x, int *incx, s *ap) noexcept nogil:
+    
+    _fortran_sspr(uplo, n, alpha, x, incx, ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sspr2 "BLAS_FUNC(sspr2)"(char *uplo, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *ap) nogil
+cdef void sspr2(char *uplo, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *ap) noexcept nogil:
+    
+    _fortran_sspr2(uplo, n, alpha, x, incx, y, incy, ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_sswap "BLAS_FUNC(sswap)"(int *n, s *sx, int *incx, s *sy, int *incy) nogil
+cdef void sswap(int *n, s *sx, int *incx, s *sy, int *incy) noexcept nogil:
+    
+    _fortran_sswap(n, sx, incx, sy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ssymm "BLAS_FUNC(ssymm)"(char *side, char *uplo, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) nogil
+cdef void ssymm(char *side, char *uplo, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) noexcept nogil:
+    
+    _fortran_ssymm(side, uplo, m, n, alpha, a, lda, b, ldb, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ssymv "BLAS_FUNC(ssymv)"(char *uplo, int *n, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) nogil
+cdef void ssymv(char *uplo, int *n, s *alpha, s *a, int *lda, s *x, int *incx, s *beta, s *y, int *incy) noexcept nogil:
+    
+    _fortran_ssymv(uplo, n, alpha, a, lda, x, incx, beta, y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ssyr "BLAS_FUNC(ssyr)"(char *uplo, int *n, s *alpha, s *x, int *incx, s *a, int *lda) nogil
+cdef void ssyr(char *uplo, int *n, s *alpha, s *x, int *incx, s *a, int *lda) noexcept nogil:
+    
+    _fortran_ssyr(uplo, n, alpha, x, incx, a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ssyr2 "BLAS_FUNC(ssyr2)"(char *uplo, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *a, int *lda) nogil
+cdef void ssyr2(char *uplo, int *n, s *alpha, s *x, int *incx, s *y, int *incy, s *a, int *lda) noexcept nogil:
+    
+    _fortran_ssyr2(uplo, n, alpha, x, incx, y, incy, a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ssyr2k "BLAS_FUNC(ssyr2k)"(char *uplo, char *trans, int *n, int *k, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) nogil
+cdef void ssyr2k(char *uplo, char *trans, int *n, int *k, s *alpha, s *a, int *lda, s *b, int *ldb, s *beta, s *c, int *ldc) noexcept nogil:
+    
+    _fortran_ssyr2k(uplo, trans, n, k, alpha, a, lda, b, ldb, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ssyrk "BLAS_FUNC(ssyrk)"(char *uplo, char *trans, int *n, int *k, s *alpha, s *a, int *lda, s *beta, s *c, int *ldc) nogil
+cdef void ssyrk(char *uplo, char *trans, int *n, int *k, s *alpha, s *a, int *lda, s *beta, s *c, int *ldc) noexcept nogil:
+    
+    _fortran_ssyrk(uplo, trans, n, k, alpha, a, lda, beta, c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_stbmv "BLAS_FUNC(stbmv)"(char *uplo, char *trans, char *diag, int *n, int *k, s *a, int *lda, s *x, int *incx) nogil
+cdef void stbmv(char *uplo, char *trans, char *diag, int *n, int *k, s *a, int *lda, s *x, int *incx) noexcept nogil:
+    
+    _fortran_stbmv(uplo, trans, diag, n, k, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_stbsv "BLAS_FUNC(stbsv)"(char *uplo, char *trans, char *diag, int *n, int *k, s *a, int *lda, s *x, int *incx) nogil
+cdef void stbsv(char *uplo, char *trans, char *diag, int *n, int *k, s *a, int *lda, s *x, int *incx) noexcept nogil:
+    
+    _fortran_stbsv(uplo, trans, diag, n, k, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_stpmv "BLAS_FUNC(stpmv)"(char *uplo, char *trans, char *diag, int *n, s *ap, s *x, int *incx) nogil
+cdef void stpmv(char *uplo, char *trans, char *diag, int *n, s *ap, s *x, int *incx) noexcept nogil:
+    
+    _fortran_stpmv(uplo, trans, diag, n, ap, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_stpsv "BLAS_FUNC(stpsv)"(char *uplo, char *trans, char *diag, int *n, s *ap, s *x, int *incx) nogil
+cdef void stpsv(char *uplo, char *trans, char *diag, int *n, s *ap, s *x, int *incx) noexcept nogil:
+    
+    _fortran_stpsv(uplo, trans, diag, n, ap, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_strmm "BLAS_FUNC(strmm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb) nogil
+cdef void strmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb) noexcept nogil:
+    
+    _fortran_strmm(side, uplo, transa, diag, m, n, alpha, a, lda, b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_strmv "BLAS_FUNC(strmv)"(char *uplo, char *trans, char *diag, int *n, s *a, int *lda, s *x, int *incx) nogil
+cdef void strmv(char *uplo, char *trans, char *diag, int *n, s *a, int *lda, s *x, int *incx) noexcept nogil:
+    
+    _fortran_strmv(uplo, trans, diag, n, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_strsm "BLAS_FUNC(strsm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb) nogil
+cdef void strsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, s *alpha, s *a, int *lda, s *b, int *ldb) noexcept nogil:
+    
+    _fortran_strsm(side, uplo, transa, diag, m, n, alpha, a, lda, b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_strsv "BLAS_FUNC(strsv)"(char *uplo, char *trans, char *diag, int *n, s *a, int *lda, s *x, int *incx) nogil
+cdef void strsv(char *uplo, char *trans, char *diag, int *n, s *a, int *lda, s *x, int *incx) noexcept nogil:
+    
+    _fortran_strsv(uplo, trans, diag, n, a, lda, x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zaxpy "BLAS_FUNC(zaxpy)"(int *n, npy_complex128 *za, npy_complex128 *zx, int *incx, npy_complex128 *zy, int *incy) nogil
+cdef void zaxpy(int *n, z *za, z *zx, int *incx, z *zy, int *incy) noexcept nogil:
+    
+    _fortran_zaxpy(n, <npy_complex128*>za, <npy_complex128*>zx, incx, <npy_complex128*>zy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zcopy "BLAS_FUNC(zcopy)"(int *n, npy_complex128 *zx, int *incx, npy_complex128 *zy, int *incy) nogil
+cdef void zcopy(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil:
+    
+    _fortran_zcopy(n, <npy_complex128*>zx, incx, <npy_complex128*>zy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zdotc "(zdotcwrp_)"(npy_complex128 *out, int *n, npy_complex128 *zx, int *incx, npy_complex128 *zy, int *incy) nogil
+cdef z zdotc(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil:
+    cdef z out
+    _fortran_zdotc(<npy_complex128*>&out, n, <npy_complex128*>zx, incx, <npy_complex128*>zy, incy)
+    return out
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zdotu "(zdotuwrp_)"(npy_complex128 *out, int *n, npy_complex128 *zx, int *incx, npy_complex128 *zy, int *incy) nogil
+cdef z zdotu(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil:
+    cdef z out
+    _fortran_zdotu(<npy_complex128*>&out, n, <npy_complex128*>zx, incx, <npy_complex128*>zy, incy)
+    return out
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zdrot "BLAS_FUNC(zdrot)"(int *n, npy_complex128 *cx, int *incx, npy_complex128 *cy, int *incy, d *c, d *s) nogil
+cdef void zdrot(int *n, z *cx, int *incx, z *cy, int *incy, d *c, d *s) noexcept nogil:
+    
+    _fortran_zdrot(n, <npy_complex128*>cx, incx, <npy_complex128*>cy, incy, c, s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zdscal "BLAS_FUNC(zdscal)"(int *n, d *da, npy_complex128 *zx, int *incx) nogil
+cdef void zdscal(int *n, d *da, z *zx, int *incx) noexcept nogil:
+    
+    _fortran_zdscal(n, da, <npy_complex128*>zx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zgbmv "BLAS_FUNC(zgbmv)"(char *trans, int *m, int *n, int *kl, int *ku, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx, npy_complex128 *beta, npy_complex128 *y, int *incy) nogil
+cdef void zgbmv(char *trans, int *m, int *n, int *kl, int *ku, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil:
+    
+    _fortran_zgbmv(trans, m, n, kl, ku, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>x, incx, <npy_complex128*>beta, <npy_complex128*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zgemm "BLAS_FUNC(zgemm)"(char *transa, char *transb, int *m, int *n, int *k, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *b, int *ldb, npy_complex128 *beta, npy_complex128 *c, int *ldc) nogil
+cdef void zgemm(char *transa, char *transb, int *m, int *n, int *k, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil:
+    
+    _fortran_zgemm(transa, transb, m, n, k, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>b, ldb, <npy_complex128*>beta, <npy_complex128*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zgemv "BLAS_FUNC(zgemv)"(char *trans, int *m, int *n, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx, npy_complex128 *beta, npy_complex128 *y, int *incy) nogil
+cdef void zgemv(char *trans, int *m, int *n, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil:
+    
+    _fortran_zgemv(trans, m, n, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>x, incx, <npy_complex128*>beta, <npy_complex128*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zgerc "BLAS_FUNC(zgerc)"(int *m, int *n, npy_complex128 *alpha, npy_complex128 *x, int *incx, npy_complex128 *y, int *incy, npy_complex128 *a, int *lda) nogil
+cdef void zgerc(int *m, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *a, int *lda) noexcept nogil:
+    
+    _fortran_zgerc(m, n, <npy_complex128*>alpha, <npy_complex128*>x, incx, <npy_complex128*>y, incy, <npy_complex128*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zgeru "BLAS_FUNC(zgeru)"(int *m, int *n, npy_complex128 *alpha, npy_complex128 *x, int *incx, npy_complex128 *y, int *incy, npy_complex128 *a, int *lda) nogil
+cdef void zgeru(int *m, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *a, int *lda) noexcept nogil:
+    
+    _fortran_zgeru(m, n, <npy_complex128*>alpha, <npy_complex128*>x, incx, <npy_complex128*>y, incy, <npy_complex128*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zhbmv "BLAS_FUNC(zhbmv)"(char *uplo, int *n, int *k, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx, npy_complex128 *beta, npy_complex128 *y, int *incy) nogil
+cdef void zhbmv(char *uplo, int *n, int *k, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil:
+    
+    _fortran_zhbmv(uplo, n, k, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>x, incx, <npy_complex128*>beta, <npy_complex128*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zhemm "BLAS_FUNC(zhemm)"(char *side, char *uplo, int *m, int *n, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *b, int *ldb, npy_complex128 *beta, npy_complex128 *c, int *ldc) nogil
+cdef void zhemm(char *side, char *uplo, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil:
+    
+    _fortran_zhemm(side, uplo, m, n, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>b, ldb, <npy_complex128*>beta, <npy_complex128*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zhemv "BLAS_FUNC(zhemv)"(char *uplo, int *n, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx, npy_complex128 *beta, npy_complex128 *y, int *incy) nogil
+cdef void zhemv(char *uplo, int *n, z *alpha, z *a, int *lda, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil:
+    
+    _fortran_zhemv(uplo, n, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>x, incx, <npy_complex128*>beta, <npy_complex128*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zher "BLAS_FUNC(zher)"(char *uplo, int *n, d *alpha, npy_complex128 *x, int *incx, npy_complex128 *a, int *lda) nogil
+cdef void zher(char *uplo, int *n, d *alpha, z *x, int *incx, z *a, int *lda) noexcept nogil:
+    
+    _fortran_zher(uplo, n, alpha, <npy_complex128*>x, incx, <npy_complex128*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zher2 "BLAS_FUNC(zher2)"(char *uplo, int *n, npy_complex128 *alpha, npy_complex128 *x, int *incx, npy_complex128 *y, int *incy, npy_complex128 *a, int *lda) nogil
+cdef void zher2(char *uplo, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *a, int *lda) noexcept nogil:
+    
+    _fortran_zher2(uplo, n, <npy_complex128*>alpha, <npy_complex128*>x, incx, <npy_complex128*>y, incy, <npy_complex128*>a, lda)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zher2k "BLAS_FUNC(zher2k)"(char *uplo, char *trans, int *n, int *k, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *b, int *ldb, d *beta, npy_complex128 *c, int *ldc) nogil
+cdef void zher2k(char *uplo, char *trans, int *n, int *k, z *alpha, z *a, int *lda, z *b, int *ldb, d *beta, z *c, int *ldc) noexcept nogil:
+    
+    _fortran_zher2k(uplo, trans, n, k, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>b, ldb, beta, <npy_complex128*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zherk "BLAS_FUNC(zherk)"(char *uplo, char *trans, int *n, int *k, d *alpha, npy_complex128 *a, int *lda, d *beta, npy_complex128 *c, int *ldc) nogil
+cdef void zherk(char *uplo, char *trans, int *n, int *k, d *alpha, z *a, int *lda, d *beta, z *c, int *ldc) noexcept nogil:
+    
+    _fortran_zherk(uplo, trans, n, k, alpha, <npy_complex128*>a, lda, beta, <npy_complex128*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zhpmv "BLAS_FUNC(zhpmv)"(char *uplo, int *n, npy_complex128 *alpha, npy_complex128 *ap, npy_complex128 *x, int *incx, npy_complex128 *beta, npy_complex128 *y, int *incy) nogil
+cdef void zhpmv(char *uplo, int *n, z *alpha, z *ap, z *x, int *incx, z *beta, z *y, int *incy) noexcept nogil:
+    
+    _fortran_zhpmv(uplo, n, <npy_complex128*>alpha, <npy_complex128*>ap, <npy_complex128*>x, incx, <npy_complex128*>beta, <npy_complex128*>y, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zhpr "BLAS_FUNC(zhpr)"(char *uplo, int *n, d *alpha, npy_complex128 *x, int *incx, npy_complex128 *ap) nogil
+cdef void zhpr(char *uplo, int *n, d *alpha, z *x, int *incx, z *ap) noexcept nogil:
+    
+    _fortran_zhpr(uplo, n, alpha, <npy_complex128*>x, incx, <npy_complex128*>ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zhpr2 "BLAS_FUNC(zhpr2)"(char *uplo, int *n, npy_complex128 *alpha, npy_complex128 *x, int *incx, npy_complex128 *y, int *incy, npy_complex128 *ap) nogil
+cdef void zhpr2(char *uplo, int *n, z *alpha, z *x, int *incx, z *y, int *incy, z *ap) noexcept nogil:
+    
+    _fortran_zhpr2(uplo, n, <npy_complex128*>alpha, <npy_complex128*>x, incx, <npy_complex128*>y, incy, <npy_complex128*>ap)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zrotg "BLAS_FUNC(zrotg)"(npy_complex128 *ca, npy_complex128 *cb, d *c, npy_complex128 *s) nogil
+cdef void zrotg(z *ca, z *cb, d *c, z *s) noexcept nogil:
+    
+    _fortran_zrotg(<npy_complex128*>ca, <npy_complex128*>cb, c, <npy_complex128*>s)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zscal "BLAS_FUNC(zscal)"(int *n, npy_complex128 *za, npy_complex128 *zx, int *incx) nogil
+cdef void zscal(int *n, z *za, z *zx, int *incx) noexcept nogil:
+    
+    _fortran_zscal(n, <npy_complex128*>za, <npy_complex128*>zx, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zswap "BLAS_FUNC(zswap)"(int *n, npy_complex128 *zx, int *incx, npy_complex128 *zy, int *incy) nogil
+cdef void zswap(int *n, z *zx, int *incx, z *zy, int *incy) noexcept nogil:
+    
+    _fortran_zswap(n, <npy_complex128*>zx, incx, <npy_complex128*>zy, incy)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zsymm "BLAS_FUNC(zsymm)"(char *side, char *uplo, int *m, int *n, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *b, int *ldb, npy_complex128 *beta, npy_complex128 *c, int *ldc) nogil
+cdef void zsymm(char *side, char *uplo, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil:
+    
+    _fortran_zsymm(side, uplo, m, n, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>b, ldb, <npy_complex128*>beta, <npy_complex128*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zsyr2k "BLAS_FUNC(zsyr2k)"(char *uplo, char *trans, int *n, int *k, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *b, int *ldb, npy_complex128 *beta, npy_complex128 *c, int *ldc) nogil
+cdef void zsyr2k(char *uplo, char *trans, int *n, int *k, z *alpha, z *a, int *lda, z *b, int *ldb, z *beta, z *c, int *ldc) noexcept nogil:
+    
+    _fortran_zsyr2k(uplo, trans, n, k, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>b, ldb, <npy_complex128*>beta, <npy_complex128*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_zsyrk "BLAS_FUNC(zsyrk)"(char *uplo, char *trans, int *n, int *k, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *beta, npy_complex128 *c, int *ldc) nogil
+cdef void zsyrk(char *uplo, char *trans, int *n, int *k, z *alpha, z *a, int *lda, z *beta, z *c, int *ldc) noexcept nogil:
+    
+    _fortran_zsyrk(uplo, trans, n, k, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>beta, <npy_complex128*>c, ldc)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztbmv "BLAS_FUNC(ztbmv)"(char *uplo, char *trans, char *diag, int *n, int *k, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx) nogil
+cdef void ztbmv(char *uplo, char *trans, char *diag, int *n, int *k, z *a, int *lda, z *x, int *incx) noexcept nogil:
+    
+    _fortran_ztbmv(uplo, trans, diag, n, k, <npy_complex128*>a, lda, <npy_complex128*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztbsv "BLAS_FUNC(ztbsv)"(char *uplo, char *trans, char *diag, int *n, int *k, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx) nogil
+cdef void ztbsv(char *uplo, char *trans, char *diag, int *n, int *k, z *a, int *lda, z *x, int *incx) noexcept nogil:
+    
+    _fortran_ztbsv(uplo, trans, diag, n, k, <npy_complex128*>a, lda, <npy_complex128*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztpmv "BLAS_FUNC(ztpmv)"(char *uplo, char *trans, char *diag, int *n, npy_complex128 *ap, npy_complex128 *x, int *incx) nogil
+cdef void ztpmv(char *uplo, char *trans, char *diag, int *n, z *ap, z *x, int *incx) noexcept nogil:
+    
+    _fortran_ztpmv(uplo, trans, diag, n, <npy_complex128*>ap, <npy_complex128*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztpsv "BLAS_FUNC(ztpsv)"(char *uplo, char *trans, char *diag, int *n, npy_complex128 *ap, npy_complex128 *x, int *incx) nogil
+cdef void ztpsv(char *uplo, char *trans, char *diag, int *n, z *ap, z *x, int *incx) noexcept nogil:
+    
+    _fortran_ztpsv(uplo, trans, diag, n, <npy_complex128*>ap, <npy_complex128*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztrmm "BLAS_FUNC(ztrmm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *b, int *ldb) nogil
+cdef void ztrmm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb) noexcept nogil:
+    
+    _fortran_ztrmm(side, uplo, transa, diag, m, n, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztrmv "BLAS_FUNC(ztrmv)"(char *uplo, char *trans, char *diag, int *n, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx) nogil
+cdef void ztrmv(char *uplo, char *trans, char *diag, int *n, z *a, int *lda, z *x, int *incx) noexcept nogil:
+    
+    _fortran_ztrmv(uplo, trans, diag, n, <npy_complex128*>a, lda, <npy_complex128*>x, incx)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztrsm "BLAS_FUNC(ztrsm)"(char *side, char *uplo, char *transa, char *diag, int *m, int *n, npy_complex128 *alpha, npy_complex128 *a, int *lda, npy_complex128 *b, int *ldb) nogil
+cdef void ztrsm(char *side, char *uplo, char *transa, char *diag, int *m, int *n, z *alpha, z *a, int *lda, z *b, int *ldb) noexcept nogil:
+    
+    _fortran_ztrsm(side, uplo, transa, diag, m, n, <npy_complex128*>alpha, <npy_complex128*>a, lda, <npy_complex128*>b, ldb)
+    
+
+cdef extern from "_blas_subroutines.h":
+    void _fortran_ztrsv "BLAS_FUNC(ztrsv)"(char *uplo, char *trans, char *diag, int *n, npy_complex128 *a, int *lda, npy_complex128 *x, int *incx) nogil
+cdef void ztrsv(char *uplo, char *trans, char *diag, int *n, z *a, int *lda, z *x, int *incx) noexcept nogil:
+    
+    _fortran_ztrsv(uplo, trans, diag, n, <npy_complex128*>a, lda, <npy_complex128*>x, incx)
+    
+
+
+# Python-accessible wrappers for testing:
+
+cdef inline bint _is_contiguous(double[:,:] a, int axis) noexcept nogil:
+    return (a.strides[axis] == sizeof(a[0,0]) or a.shape[axis] == 1)
+
+cpdef float complex _test_cdotc(float complex[:] cx, float complex[:] cy) noexcept nogil:
+    cdef:
+        int n = cx.shape[0]
+        int incx = cx.strides[0] // sizeof(cx[0])
+        int incy = cy.strides[0] // sizeof(cy[0])
+    return cdotc(&n, &cx[0], &incx, &cy[0], &incy)
+
+cpdef float complex _test_cdotu(float complex[:] cx, float complex[:] cy) noexcept nogil:
+    cdef:
+        int n = cx.shape[0]
+        int incx = cx.strides[0] // sizeof(cx[0])
+        int incy = cy.strides[0] // sizeof(cy[0])
+    return cdotu(&n, &cx[0], &incx, &cy[0], &incy)
+
+cpdef double _test_dasum(double[:] dx) noexcept nogil:
+    cdef:
+        int n = dx.shape[0]
+        int incx = dx.strides[0] // sizeof(dx[0])
+    return dasum(&n, &dx[0], &incx)
+
+cpdef double _test_ddot(double[:] dx, double[:] dy) noexcept nogil:
+    cdef:
+        int n = dx.shape[0]
+        int incx = dx.strides[0] // sizeof(dx[0])
+        int incy = dy.strides[0] // sizeof(dy[0])
+    return ddot(&n, &dx[0], &incx, &dy[0], &incy)
+
+cpdef int _test_dgemm(double alpha, double[:,:] a, double[:,:] b, double beta,
+                double[:,:] c) except -1 nogil:
+    cdef:
+        char *transa
+        char *transb
+        int m, n, k, lda, ldb, ldc
+        double *a0=&a[0,0]
+        double *b0=&b[0,0]
+        double *c0=&c[0,0]
+    # In the case that c is C contiguous, swap a and b and
+    # swap whether or not each of them is transposed.
+    # This can be done because a.dot(b) = b.T.dot(a.T).T.
+    if _is_contiguous(c, 1):
+        if _is_contiguous(a, 1):
+            transb = 'n'
+            ldb = (&a[1,0]) - a0 if a.shape[0] > 1 else 1
+        elif _is_contiguous(a, 0):
+            transb = 't'
+            ldb = (&a[0,1]) - a0 if a.shape[1] > 1 else 1
+        else:
+            with gil:
+                raise ValueError("Input 'a' is neither C nor Fortran contiguous.")
+        if _is_contiguous(b, 1):
+            transa = 'n'
+            lda = (&b[1,0]) - b0 if b.shape[0] > 1 else 1
+        elif _is_contiguous(b, 0):
+            transa = 't'
+            lda = (&b[0,1]) - b0 if b.shape[1] > 1 else 1
+        else:
+            with gil:
+                raise ValueError("Input 'b' is neither C nor Fortran contiguous.")
+        k = b.shape[0]
+        if k != a.shape[1]:
+            with gil:
+                raise ValueError("Shape mismatch in input arrays.")
+        m = b.shape[1]
+        n = a.shape[0]
+        if n != c.shape[0] or m != c.shape[1]:
+            with gil:
+                raise ValueError("Output array does not have the correct shape.")
+        ldc = (&c[1,0]) - c0 if c.shape[0] > 1 else 1
+        dgemm(transa, transb, &m, &n, &k, &alpha, b0, &lda, a0,
+                   &ldb, &beta, c0, &ldc)
+    elif _is_contiguous(c, 0):
+        if _is_contiguous(a, 1):
+            transa = 't'
+            lda = (&a[1,0]) - a0 if a.shape[0] > 1 else 1
+        elif _is_contiguous(a, 0):
+            transa = 'n'
+            lda = (&a[0,1]) - a0 if a.shape[1] > 1 else 1
+        else:
+            with gil:
+                raise ValueError("Input 'a' is neither C nor Fortran contiguous.")
+        if _is_contiguous(b, 1):
+            transb = 't'
+            ldb = (&b[1,0]) - b0 if b.shape[0] > 1 else 1
+        elif _is_contiguous(b, 0):
+            transb = 'n'
+            ldb = (&b[0,1]) - b0 if b.shape[1] > 1 else 1
+        else:
+            with gil:
+                raise ValueError("Input 'b' is neither C nor Fortran contiguous.")
+        m = a.shape[0]
+        k = a.shape[1]
+        if k != b.shape[0]:
+            with gil:
+                raise ValueError("Shape mismatch in input arrays.")
+        n = b.shape[1]
+        if m != c.shape[0] or n != c.shape[1]:
+            with gil:
+                raise ValueError("Output array does not have the correct shape.")
+        ldc = (&c[0,1]) - c0 if c.shape[1] > 1 else 1
+        dgemm(transa, transb, &m, &n, &k, &alpha, a0, &lda, b0,
+                   &ldb, &beta, c0, &ldc)
+    else:
+        with gil:
+            raise ValueError("Input 'c' is neither C nor Fortran contiguous.")
+    return 0
+
+cpdef double _test_dnrm2(double[:] x) noexcept nogil:
+    cdef:
+        int n = x.shape[0]
+        int incx = x.strides[0] // sizeof(x[0])
+    return dnrm2(&n, &x[0], &incx)
+
+cpdef double _test_dzasum(double complex[:] zx) noexcept nogil:
+    cdef:
+        int n = zx.shape[0]
+        int incx = zx.strides[0] // sizeof(zx[0])
+    return dzasum(&n, &zx[0], &incx)
+
+cpdef double _test_dznrm2(double complex[:] x) noexcept nogil:
+    cdef:
+        int n = x.shape[0]
+        int incx = x.strides[0] // sizeof(x[0])
+    return dznrm2(&n, &x[0], &incx)
+
+cpdef int _test_icamax(float complex[:] cx) noexcept nogil:
+    cdef:
+        int n = cx.shape[0]
+        int incx = cx.strides[0] // sizeof(cx[0])
+    return icamax(&n, &cx[0], &incx)
+
+cpdef int _test_idamax(double[:] dx) noexcept nogil:
+    cdef:
+        int n = dx.shape[0]
+        int incx = dx.strides[0] // sizeof(dx[0])
+    return idamax(&n, &dx[0], &incx)
+
+cpdef int _test_isamax(float[:] sx) noexcept nogil:
+    cdef:
+        int n = sx.shape[0]
+        int incx = sx.strides[0] // sizeof(sx[0])
+    return isamax(&n, &sx[0], &incx)
+
+cpdef int _test_izamax(double complex[:] zx) noexcept nogil:
+    cdef:
+        int n = zx.shape[0]
+        int incx = zx.strides[0] // sizeof(zx[0])
+    return izamax(&n, &zx[0], &incx)
+
+cpdef float _test_sasum(float[:] sx) noexcept nogil:
+    cdef:
+        int n = sx.shape[0]
+        int incx = sx.strides[0] // sizeof(sx[0])
+    return sasum(&n, &sx[0], &incx)
+
+cpdef float _test_scasum(float complex[:] cx) noexcept nogil:
+    cdef:
+        int n = cx.shape[0]
+        int incx = cx.strides[0] // sizeof(cx[0])
+    return scasum(&n, &cx[0], &incx)
+
+cpdef float _test_scnrm2(float complex[:] x) noexcept nogil:
+    cdef:
+        int n = x.shape[0]
+        int incx = x.strides[0] // sizeof(x[0])
+    return scnrm2(&n, &x[0], &incx)
+
+cpdef float _test_sdot(float[:] sx, float[:] sy) noexcept nogil:
+    cdef:
+        int n = sx.shape[0]
+        int incx = sx.strides[0] // sizeof(sx[0])
+        int incy = sy.strides[0] // sizeof(sy[0])
+    return sdot(&n, &sx[0], &incx, &sy[0], &incy)
+
+cpdef float _test_snrm2(float[:] x) noexcept nogil:
+    cdef:
+        int n = x.shape[0]
+        int incx = x.strides[0] // sizeof(x[0])
+    return snrm2(&n, &x[0], &incx)
+
+cpdef double complex _test_zdotc(double complex[:] zx, double complex[:] zy) noexcept nogil:
+    cdef:
+        int n = zx.shape[0]
+        int incx = zx.strides[0] // sizeof(zx[0])
+        int incy = zy.strides[0] // sizeof(zy[0])
+    return zdotc(&n, &zx[0], &incx, &zy[0], &incy)
+
+cpdef double complex _test_zdotu(double complex[:] zx, double complex[:] zy) noexcept nogil:
+    cdef:
+        int n = zx.shape[0]
+        int incx = zx.strides[0] // sizeof(zx[0])
+        int incy = zy.strides[0] // sizeof(zy[0])
+    return zdotu(&n, &zx[0], &incx, &zy[0], &incy)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/decomp.py

@@ -0,0 +1,25 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.linalg` namespace for importing the functions
+# included below.
+
+from scipy._lib.deprecation import _sub_module_deprecation
+
+
+__all__ = [  # noqa: F822
+    'eig', 'eigvals', 'eigh', 'eigvalsh',
+    'eig_banded', 'eigvals_banded',
+    'eigh_tridiagonal', 'eigvalsh_tridiagonal', 'hessenberg', 'cdf2rdf',
+    'array', 'isfinite', 'inexact', 'nonzero', 'iscomplexobj',
+    'flatnonzero', 'argsort', 'iscomplex', 'einsum', 'eye', 'inf',
+    'LinAlgError', 'norm', 'get_lapack_funcs'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    return _sub_module_deprecation(sub_package="linalg", module="decomp",
+                                   private_modules=["_decomp"], all=__all__,
+                                   attribute=name)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/decomp_cholesky.py

@@ -0,0 +1,22 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.linalg` namespace for importing the functions
+# included below.
+
+from scipy._lib.deprecation import _sub_module_deprecation
+
+
+__all__ = [  # noqa: F822
+    'cholesky', 'cho_factor', 'cho_solve', 'cholesky_banded',
+    'cho_solve_banded', 'asarray_chkfinite', 'atleast_2d',
+    'LinAlgError', 'get_lapack_funcs'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    return _sub_module_deprecation(sub_package="linalg", module="decomp_cholesky",
+                                   private_modules=["_decomp_cholesky"], all=__all__,
+                                   attribute=name)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/decomp_qr.py

@@ -0,0 +1,20 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.linalg` namespace for importing the functions
+# included below.
+
+from scipy._lib.deprecation import _sub_module_deprecation
+
+
+__all__ = [  # noqa: F822
+    'qr', 'qr_multiply', 'rq', 'get_lapack_funcs', 'safecall'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    return _sub_module_deprecation(sub_package="linalg", module="decomp_qr",
+                                   private_modules=["_decomp_qr"], all=__all__,
+                                   attribute=name)

env-llmeval/lib/python3.10/site-packages/scipy/linalg/decomp_schur.py

@@ -0,0 +1,22 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.linalg` namespace for importing the functions
+# included below.
+
+from scipy._lib.deprecation import _sub_module_deprecation
+
+
+__all__ = [  # noqa: F822
+    'schur', 'rsf2csf', 'asarray_chkfinite', 'single', 'array', 'norm',
+    'LinAlgError', 'get_lapack_funcs', 'eigvals', 'eps', 'feps'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    return _sub_module_deprecation(sub_package="linalg", module="decomp_schur",
+                                   private_modules=["_decomp_schur"], all=__all__,
+                                   attribute=name)
+

env-llmeval/lib/python3.10/site-packages/scipy/linalg/interpolative.py

@@ -0,0 +1,1015 @@
+#******************************************************************************
+#   Copyright (C) 2013 Kenneth L. Ho
+#
+#   Redistribution and use in source and binary forms, with or without
+#   modification, are permitted provided that the following conditions are met:
+#
+#   Redistributions of source code must retain the above copyright notice, this
+#   list of conditions and the following disclaimer. Redistributions in binary
+#   form must reproduce the above copyright notice, this list of conditions and
+#   the following disclaimer in the documentation and/or other materials
+#   provided with the distribution.
+#
+#   None of the names of the copyright holders may be used to endorse or
+#   promote products derived from this software without specific prior written
+#   permission.
+#
+#   THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+#   AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+#   IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+#   ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE
+#   LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+#   CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+#   SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+#   INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+#   CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+#   ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+#   POSSIBILITY OF SUCH DAMAGE.
+#******************************************************************************
+
+# Python module for interfacing with `id_dist`.
+
+r"""
+======================================================================
+Interpolative matrix decomposition (:mod:`scipy.linalg.interpolative`)
+======================================================================
+
+.. moduleauthor:: Kenneth L. Ho <[email protected]>
+
+.. versionadded:: 0.13
+
+.. currentmodule:: scipy.linalg.interpolative
+
+An interpolative decomposition (ID) of a matrix :math:`A \in
+\mathbb{C}^{m \times n}` of rank :math:`k \leq \min \{ m, n \}` is a
+factorization
+
+.. math::
+  A \Pi =
+  \begin{bmatrix}
+   A \Pi_{1} & A \Pi_{2}
+  \end{bmatrix} =
+  A \Pi_{1}
+  \begin{bmatrix}
+   I & T
+  \end{bmatrix},
+
+where :math:`\Pi = [\Pi_{1}, \Pi_{2}]` is a permutation matrix with
+:math:`\Pi_{1} \in \{ 0, 1 \}^{n \times k}`, i.e., :math:`A \Pi_{2} =
+A \Pi_{1} T`. This can equivalently be written as :math:`A = BP`,
+where :math:`B = A \Pi_{1}` and :math:`P = [I, T] \Pi^{\mathsf{T}}`
+are the *skeleton* and *interpolation matrices*, respectively.
+
+If :math:`A` does not have exact rank :math:`k`, then there exists an
+approximation in the form of an ID such that :math:`A = BP + E`, where
+:math:`\| E \| \sim \sigma_{k + 1}` is on the order of the :math:`(k +
+1)`-th largest singular value of :math:`A`. Note that :math:`\sigma_{k
++ 1}` is the best possible error for a rank-:math:`k` approximation
+and, in fact, is achieved by the singular value decomposition (SVD)
+:math:`A \approx U S V^{*}`, where :math:`U \in \mathbb{C}^{m \times
+k}` and :math:`V \in \mathbb{C}^{n \times k}` have orthonormal columns
+and :math:`S = \mathop{\mathrm{diag}} (\sigma_{i}) \in \mathbb{C}^{k
+\times k}` is diagonal with nonnegative entries. The principal
+advantages of using an ID over an SVD are that:
+
+- it is cheaper to construct;
+- it preserves the structure of :math:`A`; and
+- it is more efficient to compute with in light of the identity submatrix of :math:`P`.
+
+Routines
+========
+
+Main functionality:
+
+.. autosummary::
+   :toctree: generated/
+
+   interp_decomp
+   reconstruct_matrix_from_id
+   reconstruct_interp_matrix
+   reconstruct_skel_matrix
+   id_to_svd
+   svd
+   estimate_spectral_norm
+   estimate_spectral_norm_diff
+   estimate_rank
+
+Support functions:
+
+.. autosummary::
+   :toctree: generated/
+
+   seed
+   rand
+
+
+References
+==========
+
+This module uses the ID software package [1]_ by Martinsson, Rokhlin,
+Shkolnisky, and Tygert, which is a Fortran library for computing IDs
+using various algorithms, including the rank-revealing QR approach of
+[2]_ and the more recent randomized methods described in [3]_, [4]_,
+and [5]_. This module exposes its functionality in a way convenient
+for Python users. Note that this module does not add any functionality
+beyond that of organizing a simpler and more consistent interface.
+
+We advise the user to consult also the `documentation for the ID package
+<http://tygert.com/id_doc.4.pdf>`_.
+
+.. [1] P.G. Martinsson, V. Rokhlin, Y. Shkolnisky, M. Tygert. "ID: a
+    software package for low-rank approximation of matrices via interpolative
+    decompositions, version 0.2." http://tygert.com/id_doc.4.pdf.
+
+.. [2] H. Cheng, Z. Gimbutas, P.G. Martinsson, V. Rokhlin. "On the
+    compression of low rank matrices." *SIAM J. Sci. Comput.* 26 (4): 1389--1404,
+    2005. :doi:`10.1137/030602678`.
+
+.. [3] E. Liberty, F. Woolfe, P.G. Martinsson, V. Rokhlin, M.
+    Tygert. "Randomized algorithms for the low-rank approximation of matrices."
+    *Proc. Natl. Acad. Sci. U.S.A.* 104 (51): 20167--20172, 2007.
+    :doi:`10.1073/pnas.0709640104`.
+
+.. [4] P.G. Martinsson, V. Rokhlin, M. Tygert. "A randomized
+    algorithm for the decomposition of matrices." *Appl. Comput. Harmon. Anal.* 30
+    (1): 47--68,  2011. :doi:`10.1016/j.acha.2010.02.003`.
+
+.. [5] F. Woolfe, E. Liberty, V. Rokhlin, M. Tygert. "A fast
+    randomized algorithm for the approximation of matrices." *Appl. Comput.
+    Harmon. Anal.* 25 (3): 335--366, 2008. :doi:`10.1016/j.acha.2007.12.002`.
+
+
+Tutorial
+========
+
+Initializing
+------------
+
+The first step is to import :mod:`scipy.linalg.interpolative` by issuing the
+command:
+
+>>> import scipy.linalg.interpolative as sli
+
+Now let's build a matrix. For this, we consider a Hilbert matrix, which is well
+know to have low rank:
+
+>>> from scipy.linalg import hilbert
+>>> n = 1000
+>>> A = hilbert(n)
+
+We can also do this explicitly via:
+
+>>> import numpy as np
+>>> n = 1000
+>>> A = np.empty((n, n), order='F')
+>>> for j in range(n):
+...     for i in range(n):
+...         A[i,j] = 1. / (i + j + 1)
+
+Note the use of the flag ``order='F'`` in :func:`numpy.empty`. This
+instantiates the matrix in Fortran-contiguous order and is important for
+avoiding data copying when passing to the backend.
+
+We then define multiplication routines for the matrix by regarding it as a
+:class:`scipy.sparse.linalg.LinearOperator`:
+
+>>> from scipy.sparse.linalg import aslinearoperator
+>>> L = aslinearoperator(A)
+
+This automatically sets up methods describing the action of the matrix and its
+adjoint on a vector.
+
+Computing an ID
+---------------
+
+We have several choices of algorithm to compute an ID. These fall largely
+according to two dichotomies:
+
+1. how the matrix is represented, i.e., via its entries or via its action on a
+   vector; and
+2. whether to approximate it to a fixed relative precision or to a fixed rank.
+
+We step through each choice in turn below.
+
+In all cases, the ID is represented by three parameters:
+
+1. a rank ``k``;
+2. an index array ``idx``; and
+3. interpolation coefficients ``proj``.
+
+The ID is specified by the relation
+``np.dot(A[:,idx[:k]], proj) == A[:,idx[k:]]``.
+
+From matrix entries
+...................
+
+We first consider a matrix given in terms of its entries.
+
+To compute an ID to a fixed precision, type:
+
+>>> eps = 1e-3
+>>> k, idx, proj = sli.interp_decomp(A, eps)
+
+where ``eps < 1`` is the desired precision.
+
+To compute an ID to a fixed rank, use:
+
+>>> idx, proj = sli.interp_decomp(A, k)
+
+where ``k >= 1`` is the desired rank.
+
+Both algorithms use random sampling and are usually faster than the
+corresponding older, deterministic algorithms, which can be accessed via the
+commands:
+
+>>> k, idx, proj = sli.interp_decomp(A, eps, rand=False)
+
+and:
+
+>>> idx, proj = sli.interp_decomp(A, k, rand=False)
+
+respectively.
+
+From matrix action
+..................
+
+Now consider a matrix given in terms of its action on a vector as a
+:class:`scipy.sparse.linalg.LinearOperator`.
+
+To compute an ID to a fixed precision, type:
+
+>>> k, idx, proj = sli.interp_decomp(L, eps)
+
+To compute an ID to a fixed rank, use:
+
+>>> idx, proj = sli.interp_decomp(L, k)
+
+These algorithms are randomized.
+
+Reconstructing an ID
+--------------------
+
+The ID routines above do not output the skeleton and interpolation matrices
+explicitly but instead return the relevant information in a more compact (and
+sometimes more useful) form. To build these matrices, write:
+
+>>> B = sli.reconstruct_skel_matrix(A, k, idx)
+
+for the skeleton matrix and:
+
+>>> P = sli.reconstruct_interp_matrix(idx, proj)
+
+for the interpolation matrix. The ID approximation can then be computed as:
+
+>>> C = np.dot(B, P)
+
+This can also be constructed directly using:
+
+>>> C = sli.reconstruct_matrix_from_id(B, idx, proj)
+
+without having to first compute ``P``.
+
+Alternatively, this can be done explicitly as well using:
+
+>>> B = A[:,idx[:k]]
+>>> P = np.hstack([np.eye(k), proj])[:,np.argsort(idx)]
+>>> C = np.dot(B, P)
+
+Computing an SVD
+----------------
+
+An ID can be converted to an SVD via the command:
+
+>>> U, S, V = sli.id_to_svd(B, idx, proj)
+
+The SVD approximation is then:
+
+>>> approx = U @ np.diag(S) @ V.conj().T
+
+The SVD can also be computed "fresh" by combining both the ID and conversion
+steps into one command. Following the various ID algorithms above, there are
+correspondingly various SVD algorithms that one can employ.
+
+From matrix entries
+...................
+
+We consider first SVD algorithms for a matrix given in terms of its entries.
+
+To compute an SVD to a fixed precision, type:
+
+>>> U, S, V = sli.svd(A, eps)
+
+To compute an SVD to a fixed rank, use:
+
+>>> U, S, V = sli.svd(A, k)
+
+Both algorithms use random sampling; for the deterministic versions, issue the
+keyword ``rand=False`` as above.
+
+From matrix action
+..................
+
+Now consider a matrix given in terms of its action on a vector.
+
+To compute an SVD to a fixed precision, type:
+
+>>> U, S, V = sli.svd(L, eps)
+
+To compute an SVD to a fixed rank, use:
+
+>>> U, S, V = sli.svd(L, k)
+
+Utility routines
+----------------
+
+Several utility routines are also available.
+
+To estimate the spectral norm of a matrix, use:
+
+>>> snorm = sli.estimate_spectral_norm(A)
+
+This algorithm is based on the randomized power method and thus requires only
+matrix-vector products. The number of iterations to take can be set using the
+keyword ``its`` (default: ``its=20``). The matrix is interpreted as a
+:class:`scipy.sparse.linalg.LinearOperator`, but it is also valid to supply it
+as a :class:`numpy.ndarray`, in which case it is trivially converted using
+:func:`scipy.sparse.linalg.aslinearoperator`.
+
+The same algorithm can also estimate the spectral norm of the difference of two
+matrices ``A1`` and ``A2`` as follows:
+
+>>> A1, A2 = A**2, A
+>>> diff = sli.estimate_spectral_norm_diff(A1, A2)
+
+This is often useful for checking the accuracy of a matrix approximation.
+
+Some routines in :mod:`scipy.linalg.interpolative` require estimating the rank
+of a matrix as well. This can be done with either:
+
+>>> k = sli.estimate_rank(A, eps)
+
+or:
+
+>>> k = sli.estimate_rank(L, eps)
+
+depending on the representation. The parameter ``eps`` controls the definition
+of the numerical rank.
+
+Finally, the random number generation required for all randomized routines can
+be controlled via :func:`scipy.linalg.interpolative.seed`. To reset the seed
+values to their original values, use:
+
+>>> sli.seed('default')
+
+To specify the seed values, use:
+
+>>> s = 42
+>>> sli.seed(s)
+
+where ``s`` must be an integer or array of 55 floats. If an integer, the array
+of floats is obtained by using ``numpy.random.rand`` with the given integer
+seed.
+
+To simply generate some random numbers, type:
+
+>>> arr = sli.rand(n)
+
+where ``n`` is the number of random numbers to generate.
+
+Remarks
+-------
+
+The above functions all automatically detect the appropriate interface and work
+with both real and complex data types, passing input arguments to the proper
+backend routine.
+
+"""
+
+import scipy.linalg._interpolative_backend as _backend
+import numpy as np
+import sys
+
+__all__ = [
+    'estimate_rank',
+    'estimate_spectral_norm',
+    'estimate_spectral_norm_diff',
+    'id_to_svd',
+    'interp_decomp',
+    'rand',
+    'reconstruct_interp_matrix',
+    'reconstruct_matrix_from_id',
+    'reconstruct_skel_matrix',
+    'seed',
+    'svd',
+]
+
+_DTYPE_ERROR = ValueError("invalid input dtype (input must be float64 or complex128)")
+_TYPE_ERROR = TypeError("invalid input type (must be array or LinearOperator)")
+_32BIT_ERROR = ValueError("interpolative decomposition on 32-bit systems "
+                          "with complex128 is buggy")
+_IS_32BIT = (sys.maxsize < 2**32)
+
+
+def _is_real(A):
+    try:
+        if A.dtype == np.complex128:
+            return False
+        elif A.dtype == np.float64:
+            return True
+        else:
+            raise _DTYPE_ERROR
+    except AttributeError as e:
+        raise _TYPE_ERROR from e
+
+
+def seed(seed=None):
+    """
+    Seed the internal random number generator used in this ID package.
+
+    The generator is a lagged Fibonacci method with 55-element internal state.
+
+    Parameters
+    ----------
+    seed : int, sequence, 'default', optional
+        If 'default', the random seed is reset to a default value.
+
+        If `seed` is a sequence containing 55 floating-point numbers
+        in range [0,1], these are used to set the internal state of
+        the generator.
+
+        If the value is an integer, the internal state is obtained
+        from `numpy.random.RandomState` (MT19937) with the integer
+        used as the initial seed.
+
+        If `seed` is omitted (None), ``numpy.random.rand`` is used to
+        initialize the generator.
+
+    """
+    # For details, see :func:`_backend.id_srand`, :func:`_backend.id_srandi`,
+    # and :func:`_backend.id_srando`.
+
+    if isinstance(seed, str) and seed == 'default':
+        _backend.id_srando()
+    elif hasattr(seed, '__len__'):
+        state = np.asfortranarray(seed, dtype=float)
+        if state.shape != (55,):
+            raise ValueError("invalid input size")
+        elif state.min() < 0 or state.max() > 1:
+            raise ValueError("values not in range [0,1]")
+        _backend.id_srandi(state)
+    elif seed is None:
+        _backend.id_srandi(np.random.rand(55))
+    else:
+        rnd = np.random.RandomState(seed)
+        _backend.id_srandi(rnd.rand(55))
+
+
+def rand(*shape):
+    """
+    Generate standard uniform pseudorandom numbers via a very efficient lagged
+    Fibonacci method.
+
+    This routine is used for all random number generation in this package and
+    can affect ID and SVD results.
+
+    Parameters
+    ----------
+    *shape
+        Shape of output array
+
+    """
+    # For details, see :func:`_backend.id_srand`, and :func:`_backend.id_srando`.
+    return _backend.id_srand(np.prod(shape)).reshape(shape)
+
+
+def interp_decomp(A, eps_or_k, rand=True):
+    """
+    Compute ID of a matrix.
+
+    An ID of a matrix `A` is a factorization defined by a rank `k`, a column
+    index array `idx`, and interpolation coefficients `proj` such that::
+
+        numpy.dot(A[:,idx[:k]], proj) = A[:,idx[k:]]
+
+    The original matrix can then be reconstructed as::
+
+        numpy.hstack([A[:,idx[:k]],
+                                    numpy.dot(A[:,idx[:k]], proj)]
+                                )[:,numpy.argsort(idx)]
+
+    or via the routine :func:`reconstruct_matrix_from_id`. This can
+    equivalently be written as::
+
+        numpy.dot(A[:,idx[:k]],
+                            numpy.hstack([numpy.eye(k), proj])
+                          )[:,np.argsort(idx)]
+
+    in terms of the skeleton and interpolation matrices::
+
+        B = A[:,idx[:k]]
+
+    and::
+
+        P = numpy.hstack([numpy.eye(k), proj])[:,np.argsort(idx)]
+
+    respectively. See also :func:`reconstruct_interp_matrix` and
+    :func:`reconstruct_skel_matrix`.
+
+    The ID can be computed to any relative precision or rank (depending on the
+    value of `eps_or_k`). If a precision is specified (`eps_or_k < 1`), then
+    this function has the output signature::
+
+        k, idx, proj = interp_decomp(A, eps_or_k)
+
+    Otherwise, if a rank is specified (`eps_or_k >= 1`), then the output
+    signature is::
+
+        idx, proj = interp_decomp(A, eps_or_k)
+
+    ..  This function automatically detects the form of the input parameters
+        and passes them to the appropriate backend. For details, see
+        :func:`_backend.iddp_id`, :func:`_backend.iddp_aid`,
+        :func:`_backend.iddp_rid`, :func:`_backend.iddr_id`,
+        :func:`_backend.iddr_aid`, :func:`_backend.iddr_rid`,
+        :func:`_backend.idzp_id`, :func:`_backend.idzp_aid`,
+        :func:`_backend.idzp_rid`, :func:`_backend.idzr_id`,
+        :func:`_backend.idzr_aid`, and :func:`_backend.idzr_rid`.
+
+    Parameters
+    ----------
+    A : :class:`numpy.ndarray` or :class:`scipy.sparse.linalg.LinearOperator` with `rmatvec`
+        Matrix to be factored
+    eps_or_k : float or int
+        Relative error (if `eps_or_k < 1`) or rank (if `eps_or_k >= 1`) of
+        approximation.
+    rand : bool, optional
+        Whether to use random sampling if `A` is of type :class:`numpy.ndarray`
+        (randomized algorithms are always used if `A` is of type
+        :class:`scipy.sparse.linalg.LinearOperator`).
+
+    Returns
+    -------
+    k : int
+        Rank required to achieve specified relative precision if
+        `eps_or_k < 1`.
+    idx : :class:`numpy.ndarray`
+        Column index array.
+    proj : :class:`numpy.ndarray`
+        Interpolation coefficients.
+    """  # numpy/numpydoc#87  # noqa: E501
+    from scipy.sparse.linalg import LinearOperator
+
+    real = _is_real(A)
+
+    if isinstance(A, np.ndarray):
+        if eps_or_k < 1:
+            eps = eps_or_k
+            if rand:
+                if real:
+                    k, idx, proj = _backend.iddp_aid(eps, A)
+                else:
+                    if _IS_32BIT:
+                        raise _32BIT_ERROR
+                    k, idx, proj = _backend.idzp_aid(eps, A)
+            else:
+                if real:
+                    k, idx, proj = _backend.iddp_id(eps, A)
+                else:
+                    k, idx, proj = _backend.idzp_id(eps, A)
+            return k, idx - 1, proj
+        else:
+            k = int(eps_or_k)
+            if rand:
+                if real:
+                    idx, proj = _backend.iddr_aid(A, k)
+                else:
+                    if _IS_32BIT:
+                        raise _32BIT_ERROR
+                    idx, proj = _backend.idzr_aid(A, k)
+            else:
+                if real:
+                    idx, proj = _backend.iddr_id(A, k)
+                else:
+                    idx, proj = _backend.idzr_id(A, k)
+            return idx - 1, proj
+    elif isinstance(A, LinearOperator):
+        m, n = A.shape
+        matveca = A.rmatvec
+        if eps_or_k < 1:
+            eps = eps_or_k
+            if real:
+                k, idx, proj = _backend.iddp_rid(eps, m, n, matveca)
+            else:
+                if _IS_32BIT:
+                    raise _32BIT_ERROR
+                k, idx, proj = _backend.idzp_rid(eps, m, n, matveca)
+            return k, idx - 1, proj
+        else:
+            k = int(eps_or_k)
+            if real:
+                idx, proj = _backend.iddr_rid(m, n, matveca, k)
+            else:
+                if _IS_32BIT:
+                    raise _32BIT_ERROR
+                idx, proj = _backend.idzr_rid(m, n, matveca, k)
+            return idx - 1, proj
+    else:
+        raise _TYPE_ERROR
+
+
+def reconstruct_matrix_from_id(B, idx, proj):
+    """
+    Reconstruct matrix from its ID.
+
+    A matrix `A` with skeleton matrix `B` and ID indices and coefficients `idx`
+    and `proj`, respectively, can be reconstructed as::
+
+        numpy.hstack([B, numpy.dot(B, proj)])[:,numpy.argsort(idx)]
+
+    See also :func:`reconstruct_interp_matrix` and
+    :func:`reconstruct_skel_matrix`.
+
+    ..  This function automatically detects the matrix data type and calls the
+        appropriate backend. For details, see :func:`_backend.idd_reconid` and
+        :func:`_backend.idz_reconid`.
+
+    Parameters
+    ----------
+    B : :class:`numpy.ndarray`
+        Skeleton matrix.
+    idx : :class:`numpy.ndarray`
+        Column index array.
+    proj : :class:`numpy.ndarray`
+        Interpolation coefficients.
+
+    Returns
+    -------
+    :class:`numpy.ndarray`
+        Reconstructed matrix.
+    """
+    if _is_real(B):
+        return _backend.idd_reconid(B, idx + 1, proj)
+    else:
+        return _backend.idz_reconid(B, idx + 1, proj)
+
+
+def reconstruct_interp_matrix(idx, proj):
+    """
+    Reconstruct interpolation matrix from ID.
+
+    The interpolation matrix can be reconstructed from the ID indices and
+    coefficients `idx` and `proj`, respectively, as::
+
+        P = numpy.hstack([numpy.eye(proj.shape[0]), proj])[:,numpy.argsort(idx)]
+
+    The original matrix can then be reconstructed from its skeleton matrix `B`
+    via::
+
+        numpy.dot(B, P)
+
+    See also :func:`reconstruct_matrix_from_id` and
+    :func:`reconstruct_skel_matrix`.
+
+    ..  This function automatically detects the matrix data type and calls the
+        appropriate backend. For details, see :func:`_backend.idd_reconint` and
+        :func:`_backend.idz_reconint`.
+
+    Parameters
+    ----------
+    idx : :class:`numpy.ndarray`
+        Column index array.
+    proj : :class:`numpy.ndarray`
+        Interpolation coefficients.
+
+    Returns
+    -------
+    :class:`numpy.ndarray`
+        Interpolation matrix.
+    """
+    if _is_real(proj):
+        return _backend.idd_reconint(idx + 1, proj)
+    else:
+        return _backend.idz_reconint(idx + 1, proj)
+
+
+def reconstruct_skel_matrix(A, k, idx):
+    """
+    Reconstruct skeleton matrix from ID.
+
+    The skeleton matrix can be reconstructed from the original matrix `A` and its
+    ID rank and indices `k` and `idx`, respectively, as::
+
+        B = A[:,idx[:k]]
+
+    The original matrix can then be reconstructed via::
+
+        numpy.hstack([B, numpy.dot(B, proj)])[:,numpy.argsort(idx)]
+
+    See also :func:`reconstruct_matrix_from_id` and
+    :func:`reconstruct_interp_matrix`.
+
+    ..  This function automatically detects the matrix data type and calls the
+        appropriate backend. For details, see :func:`_backend.idd_copycols` and
+        :func:`_backend.idz_copycols`.
+
+    Parameters
+    ----------
+    A : :class:`numpy.ndarray`
+        Original matrix.
+    k : int
+        Rank of ID.
+    idx : :class:`numpy.ndarray`
+        Column index array.
+
+    Returns
+    -------
+    :class:`numpy.ndarray`
+        Skeleton matrix.
+    """
+    if _is_real(A):
+        return _backend.idd_copycols(A, k, idx + 1)
+    else:
+        return _backend.idz_copycols(A, k, idx + 1)
+
+
+def id_to_svd(B, idx, proj):
+    """
+    Convert ID to SVD.
+
+    The SVD reconstruction of a matrix with skeleton matrix `B` and ID indices and
+    coefficients `idx` and `proj`, respectively, is::
+
+        U, S, V = id_to_svd(B, idx, proj)
+        A = numpy.dot(U, numpy.dot(numpy.diag(S), V.conj().T))
+
+    See also :func:`svd`.
+
+    ..  This function automatically detects the matrix data type and calls the
+        appropriate backend. For details, see :func:`_backend.idd_id2svd` and
+        :func:`_backend.idz_id2svd`.
+
+    Parameters
+    ----------
+    B : :class:`numpy.ndarray`
+        Skeleton matrix.
+    idx : :class:`numpy.ndarray`
+        Column index array.
+    proj : :class:`numpy.ndarray`
+        Interpolation coefficients.
+
+    Returns
+    -------
+    U : :class:`numpy.ndarray`
+        Left singular vectors.
+    S : :class:`numpy.ndarray`
+        Singular values.
+    V : :class:`numpy.ndarray`
+        Right singular vectors.
+    """
+    if _is_real(B):
+        U, V, S = _backend.idd_id2svd(B, idx + 1, proj)
+    else:
+        U, V, S = _backend.idz_id2svd(B, idx + 1, proj)
+    return U, S, V
+
+
+def estimate_spectral_norm(A, its=20):
+    """
+    Estimate spectral norm of a matrix by the randomized power method.
+
+    ..  This function automatically detects the matrix data type and calls the
+        appropriate backend. For details, see :func:`_backend.idd_snorm` and
+        :func:`_backend.idz_snorm`.
+
+    Parameters
+    ----------
+    A : :class:`scipy.sparse.linalg.LinearOperator`
+        Matrix given as a :class:`scipy.sparse.linalg.LinearOperator` with the
+        `matvec` and `rmatvec` methods (to apply the matrix and its adjoint).
+    its : int, optional
+        Number of power method iterations.
+
+    Returns
+    -------
+    float
+        Spectral norm estimate.
+    """
+    from scipy.sparse.linalg import aslinearoperator
+    A = aslinearoperator(A)
+    m, n = A.shape
+    def matvec(x):
+        return A.matvec(x)
+    def matveca(x):
+        return A.rmatvec(x)
+    if _is_real(A):
+        return _backend.idd_snorm(m, n, matveca, matvec, its=its)
+    else:
+        return _backend.idz_snorm(m, n, matveca, matvec, its=its)
+
+
+def estimate_spectral_norm_diff(A, B, its=20):
+    """
+    Estimate spectral norm of the difference of two matrices by the randomized
+    power method.
+
+    ..  This function automatically detects the matrix data type and calls the
+        appropriate backend. For details, see :func:`_backend.idd_diffsnorm` and
+        :func:`_backend.idz_diffsnorm`.
+
+    Parameters
+    ----------
+    A : :class:`scipy.sparse.linalg.LinearOperator`
+        First matrix given as a :class:`scipy.sparse.linalg.LinearOperator` with the
+        `matvec` and `rmatvec` methods (to apply the matrix and its adjoint).
+    B : :class:`scipy.sparse.linalg.LinearOperator`
+        Second matrix given as a :class:`scipy.sparse.linalg.LinearOperator` with
+        the `matvec` and `rmatvec` methods (to apply the matrix and its adjoint).
+    its : int, optional
+        Number of power method iterations.
+
+    Returns
+    -------
+    float
+        Spectral norm estimate of matrix difference.
+    """
+    from scipy.sparse.linalg import aslinearoperator
+    A = aslinearoperator(A)
+    B = aslinearoperator(B)
+    m, n = A.shape
+    def matvec1(x):
+        return A.matvec(x)
+    def matveca1(x):
+        return A.rmatvec(x)
+    def matvec2(x):
+        return B.matvec(x)
+    def matveca2(x):
+        return B.rmatvec(x)
+    if _is_real(A):
+        return _backend.idd_diffsnorm(
+            m, n, matveca1, matveca2, matvec1, matvec2, its=its)
+    else:
+        return _backend.idz_diffsnorm(
+            m, n, matveca1, matveca2, matvec1, matvec2, its=its)
+
+
+def svd(A, eps_or_k, rand=True):
+    """
+    Compute SVD of a matrix via an ID.
+
+    An SVD of a matrix `A` is a factorization::
+
+        A = numpy.dot(U, numpy.dot(numpy.diag(S), V.conj().T))
+
+    where `U` and `V` have orthonormal columns and `S` is nonnegative.
+
+    The SVD can be computed to any relative precision or rank (depending on the
+    value of `eps_or_k`).
+
+    See also :func:`interp_decomp` and :func:`id_to_svd`.
+
+    ..  This function automatically detects the form of the input parameters and
+        passes them to the appropriate backend. For details, see
+        :func:`_backend.iddp_svd`, :func:`_backend.iddp_asvd`,
+        :func:`_backend.iddp_rsvd`, :func:`_backend.iddr_svd`,
+        :func:`_backend.iddr_asvd`, :func:`_backend.iddr_rsvd`,
+        :func:`_backend.idzp_svd`, :func:`_backend.idzp_asvd`,
+        :func:`_backend.idzp_rsvd`, :func:`_backend.idzr_svd`,
+        :func:`_backend.idzr_asvd`, and :func:`_backend.idzr_rsvd`.
+
+    Parameters
+    ----------
+    A : :class:`numpy.ndarray` or :class:`scipy.sparse.linalg.LinearOperator`
+        Matrix to be factored, given as either a :class:`numpy.ndarray` or a
+        :class:`scipy.sparse.linalg.LinearOperator` with the `matvec` and
+        `rmatvec` methods (to apply the matrix and its adjoint).
+    eps_or_k : float or int
+        Relative error (if `eps_or_k < 1`) or rank (if `eps_or_k >= 1`) of
+        approximation.
+    rand : bool, optional
+        Whether to use random sampling if `A` is of type :class:`numpy.ndarray`
+        (randomized algorithms are always used if `A` is of type
+        :class:`scipy.sparse.linalg.LinearOperator`).
+
+    Returns
+    -------
+    U : :class:`numpy.ndarray`
+        Left singular vectors.
+    S : :class:`numpy.ndarray`
+        Singular values.
+    V : :class:`numpy.ndarray`
+        Right singular vectors.
+    """
+    from scipy.sparse.linalg import LinearOperator
+
+    real = _is_real(A)
+
+    if isinstance(A, np.ndarray):
+        if eps_or_k < 1:
+            eps = eps_or_k
+            if rand:
+                if real:
+                    U, V, S = _backend.iddp_asvd(eps, A)
+                else:
+                    if _IS_32BIT:
+                        raise _32BIT_ERROR
+                    U, V, S = _backend.idzp_asvd(eps, A)
+            else:
+                if real:
+                    U, V, S = _backend.iddp_svd(eps, A)
+                else:
+                    U, V, S = _backend.idzp_svd(eps, A)
+        else:
+            k = int(eps_or_k)
+            if k > min(A.shape):
+                raise ValueError(f"Approximation rank {k} exceeds min(A.shape) = "
+                                 f" {min(A.shape)} ")
+            if rand:
+                if real:
+                    U, V, S = _backend.iddr_asvd(A, k)
+                else:
+                    if _IS_32BIT:
+                        raise _32BIT_ERROR
+                    U, V, S = _backend.idzr_asvd(A, k)
+            else:
+                if real:
+                    U, V, S = _backend.iddr_svd(A, k)
+                else:
+                    U, V, S = _backend.idzr_svd(A, k)
+    elif isinstance(A, LinearOperator):
+        m, n = A.shape
+        def matvec(x):
+            return A.matvec(x)
+        def matveca(x):
+            return A.rmatvec(x)
+        if eps_or_k < 1:
+            eps = eps_or_k
+            if real:
+                U, V, S = _backend.iddp_rsvd(eps, m, n, matveca, matvec)
+            else:
+                if _IS_32BIT:
+                    raise _32BIT_ERROR
+                U, V, S = _backend.idzp_rsvd(eps, m, n, matveca, matvec)
+        else:
+            k = int(eps_or_k)
+            if real:
+                U, V, S = _backend.iddr_rsvd(m, n, matveca, matvec, k)
+            else:
+                if _IS_32BIT:
+                    raise _32BIT_ERROR
+                U, V, S = _backend.idzr_rsvd(m, n, matveca, matvec, k)
+    else:
+        raise _TYPE_ERROR
+    return U, S, V
+
+
+def estimate_rank(A, eps):
+    """
+    Estimate matrix rank to a specified relative precision using randomized
+    methods.
+
+    The matrix `A` can be given as either a :class:`numpy.ndarray` or a
+    :class:`scipy.sparse.linalg.LinearOperator`, with different algorithms used
+    for each case. If `A` is of type :class:`numpy.ndarray`, then the output
+    rank is typically about 8 higher than the actual numerical rank.
+
+    ..  This function automatically detects the form of the input parameters and
+        passes them to the appropriate backend. For details,
+        see :func:`_backend.idd_estrank`, :func:`_backend.idd_findrank`,
+        :func:`_backend.idz_estrank`, and :func:`_backend.idz_findrank`.
+
+    Parameters
+    ----------
+    A : :class:`numpy.ndarray` or :class:`scipy.sparse.linalg.LinearOperator`
+        Matrix whose rank is to be estimated, given as either a
+        :class:`numpy.ndarray` or a :class:`scipy.sparse.linalg.LinearOperator`
+        with the `rmatvec` method (to apply the matrix adjoint).
+    eps : float
+        Relative error for numerical rank definition.
+
+    Returns
+    -------
+    int
+        Estimated matrix rank.
+    """
+    from scipy.sparse.linalg import LinearOperator
+
+    real = _is_real(A)
+
+    if isinstance(A, np.ndarray):
+        if real:
+            rank = _backend.idd_estrank(eps, A)
+        else:
+            rank = _backend.idz_estrank(eps, A)
+        if rank == 0:
+            # special return value for nearly full rank
+            rank = min(A.shape)
+        return rank
+    elif isinstance(A, LinearOperator):
+        m, n = A.shape
+        matveca = A.rmatvec
+        if real:
+            return _backend.idd_findrank(eps, m, n, matveca)
+        else:
+            return _backend.idz_findrank(eps, m, n, matveca)
+    else:
+        raise _TYPE_ERROR