diff --git "a/env-llmeval/lib/python3.10/site-packages/scipy/special/_add_newdocs.py" "b/env-llmeval/lib/python3.10/site-packages/scipy/special/_add_newdocs.py" new file mode 100644--- /dev/null +++ "b/env-llmeval/lib/python3.10/site-packages/scipy/special/_add_newdocs.py" @@ -0,0 +1,14580 @@ +# Docstrings for generated ufuncs +# +# The syntax is designed to look like the function add_newdoc is being +# called from numpy.lib, but in this file add_newdoc puts the +# docstrings in a dictionary. This dictionary is used in +# _generate_pyx.py to generate the docstrings for the ufuncs in +# scipy.special at the C level when the ufuncs are created at compile +# time. + +docdict: dict[str, str] = {} + + +def get(name): + return docdict.get(name) + + +def add_newdoc(name, doc): + docdict[name] = doc + + +add_newdoc("_sf_error_test_function", + """ + Private function; do not use. + """) + + +add_newdoc("_cosine_cdf", + """ + _cosine_cdf(x) + + Cumulative distribution function (CDF) of the cosine distribution:: + + { 0, x < -pi + cdf(x) = { (pi + x + sin(x))/(2*pi), -pi <= x <= pi + { 1, x > pi + + Parameters + ---------- + x : array_like + `x` must contain real numbers. + + Returns + ------- + scalar or ndarray + The cosine distribution CDF evaluated at `x`. + + """) + +add_newdoc("_cosine_invcdf", + """ + _cosine_invcdf(p) + + Inverse of the cumulative distribution function (CDF) of the cosine + distribution. + + The CDF of the cosine distribution is:: + + cdf(x) = (pi + x + sin(x))/(2*pi) + + This function computes the inverse of cdf(x). + + Parameters + ---------- + p : array_like + `p` must contain real numbers in the interval ``0 <= p <= 1``. + `nan` is returned for values of `p` outside the interval [0, 1]. + + Returns + ------- + scalar or ndarray + The inverse of the cosine distribution CDF evaluated at `p`. + + """) + +add_newdoc("sph_harm", + r""" + sph_harm(m, n, theta, phi, out=None) + + Compute spherical harmonics. + + The spherical harmonics are defined as + + .. math:: + + Y^m_n(\theta,\phi) = \sqrt{\frac{2n+1}{4\pi} \frac{(n-m)!}{(n+m)!}} + e^{i m \theta} P^m_n(\cos(\phi)) + + where :math:`P_n^m` are the associated Legendre functions; see `lpmv`. + + Parameters + ---------- + m : array_like + Order of the harmonic (int); must have ``|m| <= n``. + n : array_like + Degree of the harmonic (int); must have ``n >= 0``. This is + often denoted by ``l`` (lower case L) in descriptions of + spherical harmonics. + theta : array_like + Azimuthal (longitudinal) coordinate; must be in ``[0, 2*pi]``. + phi : array_like + Polar (colatitudinal) coordinate; must be in ``[0, pi]``. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y_mn : complex scalar or ndarray + The harmonic :math:`Y^m_n` sampled at ``theta`` and ``phi``. + + Notes + ----- + There are different conventions for the meanings of the input + arguments ``theta`` and ``phi``. In SciPy ``theta`` is the + azimuthal angle and ``phi`` is the polar angle. It is common to + see the opposite convention, that is, ``theta`` as the polar angle + and ``phi`` as the azimuthal angle. + + Note that SciPy's spherical harmonics include the Condon-Shortley + phase [2]_ because it is part of `lpmv`. + + With SciPy's conventions, the first several spherical harmonics + are + + .. math:: + + Y_0^0(\theta, \phi) &= \frac{1}{2} \sqrt{\frac{1}{\pi}} \\ + Y_1^{-1}(\theta, \phi) &= \frac{1}{2} \sqrt{\frac{3}{2\pi}} + e^{-i\theta} \sin(\phi) \\ + Y_1^0(\theta, \phi) &= \frac{1}{2} \sqrt{\frac{3}{\pi}} + \cos(\phi) \\ + Y_1^1(\theta, \phi) &= -\frac{1}{2} \sqrt{\frac{3}{2\pi}} + e^{i\theta} \sin(\phi). + + References + ---------- + .. [1] Digital Library of Mathematical Functions, 14.30. + https://dlmf.nist.gov/14.30 + .. [2] https://en.wikipedia.org/wiki/Spherical_harmonics#Condon.E2.80.93Shortley_phase + """) + +add_newdoc("_ellip_harm", + """ + Internal function, use `ellip_harm` instead. + """) + +add_newdoc("_ellip_norm", + """ + Internal function, use `ellip_norm` instead. + """) + +add_newdoc("_lambertw", + """ + Internal function, use `lambertw` instead. + """) + +add_newdoc("voigt_profile", + r""" + voigt_profile(x, sigma, gamma, out=None) + + Voigt profile. + + The Voigt profile is a convolution of a 1-D Normal distribution with + standard deviation ``sigma`` and a 1-D Cauchy distribution with half-width at + half-maximum ``gamma``. + + If ``sigma = 0``, PDF of Cauchy distribution is returned. + Conversely, if ``gamma = 0``, PDF of Normal distribution is returned. + If ``sigma = gamma = 0``, the return value is ``Inf`` for ``x = 0``, + and ``0`` for all other ``x``. + + Parameters + ---------- + x : array_like + Real argument + sigma : array_like + The standard deviation of the Normal distribution part + gamma : array_like + The half-width at half-maximum of the Cauchy distribution part + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + The Voigt profile at the given arguments + + See Also + -------- + wofz : Faddeeva function + + Notes + ----- + It can be expressed in terms of Faddeeva function + + .. math:: V(x; \sigma, \gamma) = \frac{Re[w(z)]}{\sigma\sqrt{2\pi}}, + .. math:: z = \frac{x + i\gamma}{\sqrt{2}\sigma} + + where :math:`w(z)` is the Faddeeva function. + + References + ---------- + .. [1] https://en.wikipedia.org/wiki/Voigt_profile + + Examples + -------- + Calculate the function at point 2 for ``sigma=1`` and ``gamma=1``. + + >>> from scipy.special import voigt_profile + >>> import numpy as np + >>> import matplotlib.pyplot as plt + >>> voigt_profile(2, 1., 1.) + 0.09071519942627544 + + Calculate the function at several points by providing a NumPy array + for `x`. + + >>> values = np.array([-2., 0., 5]) + >>> voigt_profile(values, 1., 1.) + array([0.0907152 , 0.20870928, 0.01388492]) + + Plot the function for different parameter sets. + + >>> fig, ax = plt.subplots(figsize=(8, 8)) + >>> x = np.linspace(-10, 10, 500) + >>> parameters_list = [(1.5, 0., "solid"), (1.3, 0.5, "dashed"), + ... (0., 1.8, "dotted"), (1., 1., "dashdot")] + >>> for params in parameters_list: + ... sigma, gamma, linestyle = params + ... voigt = voigt_profile(x, sigma, gamma) + ... ax.plot(x, voigt, label=rf"$\sigma={sigma},\, \gamma={gamma}$", + ... ls=linestyle) + >>> ax.legend() + >>> plt.show() + + Verify visually that the Voigt profile indeed arises as the convolution + of a normal and a Cauchy distribution. + + >>> from scipy.signal import convolve + >>> x, dx = np.linspace(-10, 10, 500, retstep=True) + >>> def gaussian(x, sigma): + ... return np.exp(-0.5 * x**2/sigma**2)/(sigma * np.sqrt(2*np.pi)) + >>> def cauchy(x, gamma): + ... return gamma/(np.pi * (np.square(x)+gamma**2)) + >>> sigma = 2 + >>> gamma = 1 + >>> gauss_profile = gaussian(x, sigma) + >>> cauchy_profile = cauchy(x, gamma) + >>> convolved = dx * convolve(cauchy_profile, gauss_profile, mode="same") + >>> voigt = voigt_profile(x, sigma, gamma) + >>> fig, ax = plt.subplots(figsize=(8, 8)) + >>> ax.plot(x, gauss_profile, label="Gauss: $G$", c='b') + >>> ax.plot(x, cauchy_profile, label="Cauchy: $C$", c='y', ls="dashed") + >>> xx = 0.5*(x[1:] + x[:-1]) # midpoints + >>> ax.plot(xx, convolved[1:], label="Convolution: $G * C$", ls='dashdot', + ... c='k') + >>> ax.plot(x, voigt, label="Voigt", ls='dotted', c='r') + >>> ax.legend() + >>> plt.show() + """) + +add_newdoc("wrightomega", + r""" + wrightomega(z, out=None) + + Wright Omega function. + + Defined as the solution to + + .. math:: + + \omega + \log(\omega) = z + + where :math:`\log` is the principal branch of the complex logarithm. + + Parameters + ---------- + z : array_like + Points at which to evaluate the Wright Omega function + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + omega : scalar or ndarray + Values of the Wright Omega function + + See Also + -------- + lambertw : The Lambert W function + + Notes + ----- + .. versionadded:: 0.19.0 + + The function can also be defined as + + .. math:: + + \omega(z) = W_{K(z)}(e^z) + + where :math:`K(z) = \lceil (\Im(z) - \pi)/(2\pi) \rceil` is the + unwinding number and :math:`W` is the Lambert W function. + + The implementation here is taken from [1]_. + + References + ---------- + .. [1] Lawrence, Corless, and Jeffrey, "Algorithm 917: Complex + Double-Precision Evaluation of the Wright :math:`\omega` + Function." ACM Transactions on Mathematical Software, + 2012. :doi:`10.1145/2168773.2168779`. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import wrightomega, lambertw + + >>> wrightomega([-2, -1, 0, 1, 2]) + array([0.12002824, 0.27846454, 0.56714329, 1. , 1.5571456 ]) + + Complex input: + + >>> wrightomega(3 + 5j) + (1.5804428632097158+3.8213626783287937j) + + Verify that ``wrightomega(z)`` satisfies ``w + log(w) = z``: + + >>> w = -5 + 4j + >>> wrightomega(w + np.log(w)) + (-5+4j) + + Verify the connection to ``lambertw``: + + >>> z = 0.5 + 3j + >>> wrightomega(z) + (0.0966015889280649+1.4937828458191993j) + >>> lambertw(np.exp(z)) + (0.09660158892806493+1.4937828458191993j) + + >>> z = 0.5 + 4j + >>> wrightomega(z) + (-0.3362123489037213+2.282986001579032j) + >>> lambertw(np.exp(z), k=1) + (-0.33621234890372115+2.282986001579032j) + """) + + +add_newdoc("agm", + """ + agm(a, b, out=None) + + Compute the arithmetic-geometric mean of `a` and `b`. + + Start with a_0 = a and b_0 = b and iteratively compute:: + + a_{n+1} = (a_n + b_n)/2 + b_{n+1} = sqrt(a_n*b_n) + + a_n and b_n converge to the same limit as n increases; their common + limit is agm(a, b). + + Parameters + ---------- + a, b : array_like + Real values only. If the values are both negative, the result + is negative. If one value is negative and the other is positive, + `nan` is returned. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + The arithmetic-geometric mean of `a` and `b`. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import agm + >>> a, b = 24.0, 6.0 + >>> agm(a, b) + 13.458171481725614 + + Compare that result to the iteration: + + >>> while a != b: + ... a, b = (a + b)/2, np.sqrt(a*b) + ... print("a = %19.16f b=%19.16f" % (a, b)) + ... + a = 15.0000000000000000 b=12.0000000000000000 + a = 13.5000000000000000 b=13.4164078649987388 + a = 13.4582039324993694 b=13.4581390309909850 + a = 13.4581714817451772 b=13.4581714817060547 + a = 13.4581714817256159 b=13.4581714817256159 + + When array-like arguments are given, broadcasting applies: + + >>> a = np.array([[1.5], [3], [6]]) # a has shape (3, 1). + >>> b = np.array([6, 12, 24, 48]) # b has shape (4,). + >>> agm(a, b) + array([[ 3.36454287, 5.42363427, 9.05798751, 15.53650756], + [ 4.37037309, 6.72908574, 10.84726853, 18.11597502], + [ 6. , 8.74074619, 13.45817148, 21.69453707]]) + """) + +add_newdoc("airy", + r""" + airy(z, out=None) + + Airy functions and their derivatives. + + Parameters + ---------- + z : array_like + Real or complex argument. + out : tuple of ndarray, optional + Optional output arrays for the function values + + Returns + ------- + Ai, Aip, Bi, Bip : 4-tuple of scalar or ndarray + Airy functions Ai and Bi, and their derivatives Aip and Bip. + + See Also + -------- + airye : exponentially scaled Airy functions. + + Notes + ----- + The Airy functions Ai and Bi are two independent solutions of + + .. math:: y''(x) = x y(x). + + For real `z` in [-10, 10], the computation is carried out by calling + the Cephes [1]_ `airy` routine, which uses power series summation + for small `z` and rational minimax approximations for large `z`. + + Outside this range, the AMOS [2]_ `zairy` and `zbiry` routines are + employed. They are computed using power series for :math:`|z| < 1` and + the following relations to modified Bessel functions for larger `z` + (where :math:`t \equiv 2 z^{3/2}/3`): + + .. math:: + + Ai(z) = \frac{1}{\pi \sqrt{3}} K_{1/3}(t) + + Ai'(z) = -\frac{z}{\pi \sqrt{3}} K_{2/3}(t) + + Bi(z) = \sqrt{\frac{z}{3}} \left(I_{-1/3}(t) + I_{1/3}(t) \right) + + Bi'(z) = \frac{z}{\sqrt{3}} \left(I_{-2/3}(t) + I_{2/3}(t)\right) + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + .. [2] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + Compute the Airy functions on the interval [-15, 5]. + + >>> import numpy as np + >>> from scipy import special + >>> x = np.linspace(-15, 5, 201) + >>> ai, aip, bi, bip = special.airy(x) + + Plot Ai(x) and Bi(x). + + >>> import matplotlib.pyplot as plt + >>> plt.plot(x, ai, 'r', label='Ai(x)') + >>> plt.plot(x, bi, 'b--', label='Bi(x)') + >>> plt.ylim(-0.5, 1.0) + >>> plt.grid() + >>> plt.legend(loc='upper left') + >>> plt.show() + + """) + +add_newdoc("airye", + """ + airye(z, out=None) + + Exponentially scaled Airy functions and their derivatives. + + Scaling:: + + eAi = Ai * exp(2.0/3.0*z*sqrt(z)) + eAip = Aip * exp(2.0/3.0*z*sqrt(z)) + eBi = Bi * exp(-abs(2.0/3.0*(z*sqrt(z)).real)) + eBip = Bip * exp(-abs(2.0/3.0*(z*sqrt(z)).real)) + + Parameters + ---------- + z : array_like + Real or complex argument. + out : tuple of ndarray, optional + Optional output arrays for the function values + + Returns + ------- + eAi, eAip, eBi, eBip : 4-tuple of scalar or ndarray + Exponentially scaled Airy functions eAi and eBi, and their derivatives + eAip and eBip + + See Also + -------- + airy + + Notes + ----- + Wrapper for the AMOS [1]_ routines `zairy` and `zbiry`. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + We can compute exponentially scaled Airy functions and their derivatives: + + >>> import numpy as np + >>> from scipy.special import airye + >>> import matplotlib.pyplot as plt + >>> z = np.linspace(0, 50, 500) + >>> eAi, eAip, eBi, eBip = airye(z) + >>> f, ax = plt.subplots(2, 1, sharex=True) + >>> for ind, data in enumerate([[eAi, eAip, ["eAi", "eAip"]], + ... [eBi, eBip, ["eBi", "eBip"]]]): + ... ax[ind].plot(z, data[0], "-r", z, data[1], "-b") + ... ax[ind].legend(data[2]) + ... ax[ind].grid(True) + >>> plt.show() + + We can compute these using usual non-scaled Airy functions by: + + >>> from scipy.special import airy + >>> Ai, Aip, Bi, Bip = airy(z) + >>> np.allclose(eAi, Ai * np.exp(2.0 / 3.0 * z * np.sqrt(z))) + True + >>> np.allclose(eAip, Aip * np.exp(2.0 / 3.0 * z * np.sqrt(z))) + True + >>> np.allclose(eBi, Bi * np.exp(-abs(np.real(2.0 / 3.0 * z * np.sqrt(z))))) + True + >>> np.allclose(eBip, Bip * np.exp(-abs(np.real(2.0 / 3.0 * z * np.sqrt(z))))) + True + + Comparing non-scaled and exponentially scaled ones, the usual non-scaled + function quickly underflows for large values, whereas the exponentially + scaled function does not. + + >>> airy(200) + (0.0, 0.0, nan, nan) + >>> airye(200) + (0.07501041684381093, -1.0609012305109042, 0.15003188417418148, 2.1215836725571093) + + """) + +add_newdoc("bdtr", + r""" + bdtr(k, n, p, out=None) + + Binomial distribution cumulative distribution function. + + Sum of the terms 0 through `floor(k)` of the Binomial probability density. + + .. math:: + \mathrm{bdtr}(k, n, p) = + \sum_{j=0}^{\lfloor k \rfloor} {{n}\choose{j}} p^j (1-p)^{n-j} + + Parameters + ---------- + k : array_like + Number of successes (double), rounded down to the nearest integer. + n : array_like + Number of events (int). + p : array_like + Probability of success in a single event (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y : scalar or ndarray + Probability of `floor(k)` or fewer successes in `n` independent events with + success probabilities of `p`. + + Notes + ----- + The terms are not summed directly; instead the regularized incomplete beta + function is employed, according to the formula, + + .. math:: + \mathrm{bdtr}(k, n, p) = + I_{1 - p}(n - \lfloor k \rfloor, \lfloor k \rfloor + 1). + + Wrapper for the Cephes [1]_ routine `bdtr`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + """) + +add_newdoc("bdtrc", + r""" + bdtrc(k, n, p, out=None) + + Binomial distribution survival function. + + Sum of the terms `floor(k) + 1` through `n` of the binomial probability + density, + + .. math:: + \mathrm{bdtrc}(k, n, p) = + \sum_{j=\lfloor k \rfloor +1}^n {{n}\choose{j}} p^j (1-p)^{n-j} + + Parameters + ---------- + k : array_like + Number of successes (double), rounded down to nearest integer. + n : array_like + Number of events (int) + p : array_like + Probability of success in a single event. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y : scalar or ndarray + Probability of `floor(k) + 1` or more successes in `n` independent + events with success probabilities of `p`. + + See Also + -------- + bdtr + betainc + + Notes + ----- + The terms are not summed directly; instead the regularized incomplete beta + function is employed, according to the formula, + + .. math:: + \mathrm{bdtrc}(k, n, p) = I_{p}(\lfloor k \rfloor + 1, n - \lfloor k \rfloor). + + Wrapper for the Cephes [1]_ routine `bdtrc`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + """) + +add_newdoc("bdtri", + r""" + bdtri(k, n, y, out=None) + + Inverse function to `bdtr` with respect to `p`. + + Finds the event probability `p` such that the sum of the terms 0 through + `k` of the binomial probability density is equal to the given cumulative + probability `y`. + + Parameters + ---------- + k : array_like + Number of successes (float), rounded down to the nearest integer. + n : array_like + Number of events (float) + y : array_like + Cumulative probability (probability of `k` or fewer successes in `n` + events). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + p : scalar or ndarray + The event probability such that `bdtr(\lfloor k \rfloor, n, p) = y`. + + See Also + -------- + bdtr + betaincinv + + Notes + ----- + The computation is carried out using the inverse beta integral function + and the relation,:: + + 1 - p = betaincinv(n - k, k + 1, y). + + Wrapper for the Cephes [1]_ routine `bdtri`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + """) + +add_newdoc("bdtrik", + """ + bdtrik(y, n, p, out=None) + + Inverse function to `bdtr` with respect to `k`. + + Finds the number of successes `k` such that the sum of the terms 0 through + `k` of the Binomial probability density for `n` events with probability + `p` is equal to the given cumulative probability `y`. + + Parameters + ---------- + y : array_like + Cumulative probability (probability of `k` or fewer successes in `n` + events). + n : array_like + Number of events (float). + p : array_like + Success probability (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + k : scalar or ndarray + The number of successes `k` such that `bdtr(k, n, p) = y`. + + See Also + -------- + bdtr + + Notes + ----- + Formula 26.5.24 of [1]_ is used to reduce the binomial distribution to the + cumulative incomplete beta distribution. + + Computation of `k` involves a search for a value that produces the desired + value of `y`. The search relies on the monotonicity of `y` with `k`. + + Wrapper for the CDFLIB [2]_ Fortran routine `cdfbin`. + + References + ---------- + .. [1] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + .. [2] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + + """) + +add_newdoc("bdtrin", + """ + bdtrin(k, y, p, out=None) + + Inverse function to `bdtr` with respect to `n`. + + Finds the number of events `n` such that the sum of the terms 0 through + `k` of the Binomial probability density for events with probability `p` is + equal to the given cumulative probability `y`. + + Parameters + ---------- + k : array_like + Number of successes (float). + y : array_like + Cumulative probability (probability of `k` or fewer successes in `n` + events). + p : array_like + Success probability (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + n : scalar or ndarray + The number of events `n` such that `bdtr(k, n, p) = y`. + + See Also + -------- + bdtr + + Notes + ----- + Formula 26.5.24 of [1]_ is used to reduce the binomial distribution to the + cumulative incomplete beta distribution. + + Computation of `n` involves a search for a value that produces the desired + value of `y`. The search relies on the monotonicity of `y` with `n`. + + Wrapper for the CDFLIB [2]_ Fortran routine `cdfbin`. + + References + ---------- + .. [1] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + .. [2] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + """) + +add_newdoc( + "binom", + r""" + binom(x, y, out=None) + + Binomial coefficient considered as a function of two real variables. + + For real arguments, the binomial coefficient is defined as + + .. math:: + + \binom{x}{y} = \frac{\Gamma(x + 1)}{\Gamma(y + 1)\Gamma(x - y + 1)} = + \frac{1}{(x + 1)\mathrm{B}(x - y + 1, y + 1)} + + Where :math:`\Gamma` is the Gamma function (`gamma`) and :math:`\mathrm{B}` + is the Beta function (`beta`) [1]_. + + Parameters + ---------- + x, y: array_like + Real arguments to :math:`\binom{x}{y}`. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Value of binomial coefficient. + + See Also + -------- + comb : The number of combinations of N things taken k at a time. + + Notes + ----- + The Gamma function has poles at non-positive integers and tends to either + positive or negative infinity depending on the direction on the real line + from which a pole is approached. When considered as a function of two real + variables, :math:`\binom{x}{y}` is thus undefined when `x` is a negative + integer. `binom` returns ``nan`` when ``x`` is a negative integer. This + is the case even when ``x`` is a negative integer and ``y`` an integer, + contrary to the usual convention for defining :math:`\binom{n}{k}` when it + is considered as a function of two integer variables. + + References + ---------- + .. [1] https://en.wikipedia.org/wiki/Binomial_coefficient + + Examples + -------- + The following examples illustrate the ways in which `binom` differs from + the function `comb`. + + >>> from scipy.special import binom, comb + + When ``exact=False`` and ``x`` and ``y`` are both positive, `comb` calls + `binom` internally. + + >>> x, y = 3, 2 + >>> (binom(x, y), comb(x, y), comb(x, y, exact=True)) + (3.0, 3.0, 3) + + For larger values, `comb` with ``exact=True`` no longer agrees + with `binom`. + + >>> x, y = 43, 23 + >>> (binom(x, y), comb(x, y), comb(x, y, exact=True)) + (960566918219.9999, 960566918219.9999, 960566918220) + + `binom` returns ``nan`` when ``x`` is a negative integer, but is otherwise + defined for negative arguments. `comb` returns 0 whenever one of ``x`` or + ``y`` is negative or ``x`` is less than ``y``. + + >>> x, y = -3, 2 + >>> (binom(x, y), comb(x, y), comb(x, y, exact=True)) + (nan, 0.0, 0) + + >>> x, y = -3.1, 2.2 + >>> (binom(x, y), comb(x, y), comb(x, y, exact=True)) + (18.714147876804432, 0.0, 0) + + >>> x, y = 2.2, 3.1 + >>> (binom(x, y), comb(x, y), comb(x, y, exact=True)) + (0.037399983365134115, 0.0, 0) + """ +) + +add_newdoc("btdtria", + r""" + btdtria(p, b, x, out=None) + + Inverse of `btdtr` with respect to `a`. + + This is the inverse of the beta cumulative distribution function, `btdtr`, + considered as a function of `a`, returning the value of `a` for which + `btdtr(a, b, x) = p`, or + + .. math:: + p = \int_0^x \frac{\Gamma(a + b)}{\Gamma(a)\Gamma(b)} t^{a-1} (1-t)^{b-1}\,dt + + Parameters + ---------- + p : array_like + Cumulative probability, in [0, 1]. + b : array_like + Shape parameter (`b` > 0). + x : array_like + The quantile, in [0, 1]. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + a : scalar or ndarray + The value of the shape parameter `a` such that `btdtr(a, b, x) = p`. + + See Also + -------- + btdtr : Cumulative distribution function of the beta distribution. + btdtri : Inverse with respect to `x`. + btdtrib : Inverse with respect to `b`. + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdfbet`. + + The cumulative distribution function `p` is computed using a routine by + DiDinato and Morris [2]_. Computation of `a` involves a search for a value + that produces the desired value of `p`. The search relies on the + monotonicity of `p` with `a`. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] DiDinato, A. R. and Morris, A. H., + Algorithm 708: Significant Digit Computation of the Incomplete Beta + Function Ratios. ACM Trans. Math. Softw. 18 (1993), 360-373. + + """) + +add_newdoc("btdtrib", + r""" + btdtria(a, p, x, out=None) + + Inverse of `btdtr` with respect to `b`. + + This is the inverse of the beta cumulative distribution function, `btdtr`, + considered as a function of `b`, returning the value of `b` for which + `btdtr(a, b, x) = p`, or + + .. math:: + p = \int_0^x \frac{\Gamma(a + b)}{\Gamma(a)\Gamma(b)} t^{a-1} (1-t)^{b-1}\,dt + + Parameters + ---------- + a : array_like + Shape parameter (`a` > 0). + p : array_like + Cumulative probability, in [0, 1]. + x : array_like + The quantile, in [0, 1]. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + b : scalar or ndarray + The value of the shape parameter `b` such that `btdtr(a, b, x) = p`. + + See Also + -------- + btdtr : Cumulative distribution function of the beta distribution. + btdtri : Inverse with respect to `x`. + btdtria : Inverse with respect to `a`. + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdfbet`. + + The cumulative distribution function `p` is computed using a routine by + DiDinato and Morris [2]_. Computation of `b` involves a search for a value + that produces the desired value of `p`. The search relies on the + monotonicity of `p` with `b`. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] DiDinato, A. R. and Morris, A. H., + Algorithm 708: Significant Digit Computation of the Incomplete Beta + Function Ratios. ACM Trans. Math. Softw. 18 (1993), 360-373. + + + """) + +add_newdoc("bei", + r""" + bei(x, out=None) + + Kelvin function bei. + + Defined as + + .. math:: + + \mathrm{bei}(x) = \Im[J_0(x e^{3 \pi i / 4})] + + where :math:`J_0` is the Bessel function of the first kind of + order zero (see `jv`). See [dlmf]_ for more details. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the Kelvin function. + + See Also + -------- + ber : the corresponding real part + beip : the derivative of bei + jv : Bessel function of the first kind + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10.61 + + Examples + -------- + It can be expressed using Bessel functions. + + >>> import numpy as np + >>> import scipy.special as sc + >>> x = np.array([1.0, 2.0, 3.0, 4.0]) + >>> sc.jv(0, x * np.exp(3 * np.pi * 1j / 4)).imag + array([0.24956604, 0.97229163, 1.93758679, 2.29269032]) + >>> sc.bei(x) + array([0.24956604, 0.97229163, 1.93758679, 2.29269032]) + + """) + +add_newdoc("beip", + r""" + beip(x, out=None) + + Derivative of the Kelvin function bei. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + The values of the derivative of bei. + + See Also + -------- + bei + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10#PT5 + + """) + +add_newdoc("ber", + r""" + ber(x, out=None) + + Kelvin function ber. + + Defined as + + .. math:: + + \mathrm{ber}(x) = \Re[J_0(x e^{3 \pi i / 4})] + + where :math:`J_0` is the Bessel function of the first kind of + order zero (see `jv`). See [dlmf]_ for more details. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the Kelvin function. + + See Also + -------- + bei : the corresponding real part + berp : the derivative of bei + jv : Bessel function of the first kind + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10.61 + + Examples + -------- + It can be expressed using Bessel functions. + + >>> import numpy as np + >>> import scipy.special as sc + >>> x = np.array([1.0, 2.0, 3.0, 4.0]) + >>> sc.jv(0, x * np.exp(3 * np.pi * 1j / 4)).real + array([ 0.98438178, 0.75173418, -0.22138025, -2.56341656]) + >>> sc.ber(x) + array([ 0.98438178, 0.75173418, -0.22138025, -2.56341656]) + + """) + +add_newdoc("berp", + r""" + berp(x, out=None) + + Derivative of the Kelvin function ber. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + The values of the derivative of ber. + + See Also + -------- + ber + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10#PT5 + + """) + +add_newdoc("besselpoly", + r""" + besselpoly(a, lmb, nu, out=None) + + Weighted integral of the Bessel function of the first kind. + + Computes + + .. math:: + + \int_0^1 x^\lambda J_\nu(2 a x) \, dx + + where :math:`J_\nu` is a Bessel function and :math:`\lambda=lmb`, + :math:`\nu=nu`. + + Parameters + ---------- + a : array_like + Scale factor inside the Bessel function. + lmb : array_like + Power of `x` + nu : array_like + Order of the Bessel function. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Value of the integral. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Evaluate the function for one parameter set. + + >>> from scipy.special import besselpoly + >>> besselpoly(1, 1, 1) + 0.24449718372863877 + + Evaluate the function for different scale factors. + + >>> import numpy as np + >>> factors = np.array([0., 3., 6.]) + >>> besselpoly(factors, 1, 1) + array([ 0. , -0.00549029, 0.00140174]) + + Plot the function for varying powers, orders and scales. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> powers = np.linspace(0, 10, 100) + >>> orders = [1, 2, 3] + >>> scales = [1, 2] + >>> all_combinations = [(order, scale) for order in orders + ... for scale in scales] + >>> for order, scale in all_combinations: + ... ax.plot(powers, besselpoly(scale, powers, order), + ... label=rf"$\nu={order}, a={scale}$") + >>> ax.legend() + >>> ax.set_xlabel(r"$\lambda$") + >>> ax.set_ylabel(r"$\int_0^1 x^{\lambda} J_{\nu}(2ax)\,dx$") + >>> plt.show() + """) + +add_newdoc("beta", + r""" + beta(a, b, out=None) + + Beta function. + + This function is defined in [1]_ as + + .. math:: + + B(a, b) = \int_0^1 t^{a-1}(1-t)^{b-1}dt + = \frac{\Gamma(a)\Gamma(b)}{\Gamma(a+b)}, + + where :math:`\Gamma` is the gamma function. + + Parameters + ---------- + a, b : array_like + Real-valued arguments + out : ndarray, optional + Optional output array for the function result + + Returns + ------- + scalar or ndarray + Value of the beta function + + See Also + -------- + gamma : the gamma function + betainc : the regularized incomplete beta function + betaln : the natural logarithm of the absolute + value of the beta function + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions, + Eq. 5.12.1. https://dlmf.nist.gov/5.12 + + Examples + -------- + >>> import scipy.special as sc + + The beta function relates to the gamma function by the + definition given above: + + >>> sc.beta(2, 3) + 0.08333333333333333 + >>> sc.gamma(2)*sc.gamma(3)/sc.gamma(2 + 3) + 0.08333333333333333 + + As this relationship demonstrates, the beta function + is symmetric: + + >>> sc.beta(1.7, 2.4) + 0.16567527689031739 + >>> sc.beta(2.4, 1.7) + 0.16567527689031739 + + This function satisfies :math:`B(1, b) = 1/b`: + + >>> sc.beta(1, 4) + 0.25 + + """) + +add_newdoc( + "betainc", + r""" + betainc(a, b, x, out=None) + + Regularized incomplete beta function. + + Computes the regularized incomplete beta function, defined as [1]_: + + .. math:: + + I_x(a, b) = \frac{\Gamma(a+b)}{\Gamma(a)\Gamma(b)} \int_0^x + t^{a-1}(1-t)^{b-1}dt, + + for :math:`0 \leq x \leq 1`. + + This function is the cumulative distribution function for the beta + distribution; its range is [0, 1]. + + Parameters + ---------- + a, b : array_like + Positive, real-valued parameters + x : array_like + Real-valued such that :math:`0 \leq x \leq 1`, + the upper limit of integration + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Value of the regularized incomplete beta function + + See Also + -------- + beta : beta function + betaincinv : inverse of the regularized incomplete beta function + betaincc : complement of the regularized incomplete beta function + scipy.stats.beta : beta distribution + + Notes + ----- + The term *regularized* in the name of this function refers to the + scaling of the function by the gamma function terms shown in the + formula. When not qualified as *regularized*, the name *incomplete + beta function* often refers to just the integral expression, + without the gamma terms. One can use the function `beta` from + `scipy.special` to get this "nonregularized" incomplete beta + function by multiplying the result of ``betainc(a, b, x)`` by + ``beta(a, b)``. + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/8.17 + + Examples + -------- + + Let :math:`B(a, b)` be the `beta` function. + + >>> import scipy.special as sc + + The coefficient in terms of `gamma` is equal to + :math:`1/B(a, b)`. Also, when :math:`x=1` + the integral is equal to :math:`B(a, b)`. + Therefore, :math:`I_{x=1}(a, b) = 1` for any :math:`a, b`. + + >>> sc.betainc(0.2, 3.5, 1.0) + 1.0 + + It satisfies + :math:`I_x(a, b) = x^a F(a, 1-b, a+1, x)/ (aB(a, b))`, + where :math:`F` is the hypergeometric function `hyp2f1`: + + >>> a, b, x = 1.4, 3.1, 0.5 + >>> x**a * sc.hyp2f1(a, 1 - b, a + 1, x)/(a * sc.beta(a, b)) + 0.8148904036225295 + >>> sc.betainc(a, b, x) + 0.8148904036225296 + + This functions satisfies the relationship + :math:`I_x(a, b) = 1 - I_{1-x}(b, a)`: + + >>> sc.betainc(2.2, 3.1, 0.4) + 0.49339638807619446 + >>> 1 - sc.betainc(3.1, 2.2, 1 - 0.4) + 0.49339638807619446 + + """) + + +add_newdoc( + "betaincc", + r""" + betaincc(a, b, x, out=None) + + Complement of the regularized incomplete beta function. + + Computes the complement of the regularized incomplete beta function, + defined as [1]_: + + .. math:: + + \bar{I}_x(a, b) = 1 - I_x(a, b) + = 1 - \frac{\Gamma(a+b)}{\Gamma(a)\Gamma(b)} \int_0^x + t^{a-1}(1-t)^{b-1}dt, + + for :math:`0 \leq x \leq 1`. + + Parameters + ---------- + a, b : array_like + Positive, real-valued parameters + x : array_like + Real-valued such that :math:`0 \leq x \leq 1`, + the upper limit of integration + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Value of the regularized incomplete beta function + + See Also + -------- + betainc : regularized incomplete beta function + betaincinv : inverse of the regularized incomplete beta function + betainccinv : + inverse of the complement of the regularized incomplete beta function + beta : beta function + scipy.stats.beta : beta distribution + + Notes + ----- + .. versionadded:: 1.11.0 + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/8.17 + + Examples + -------- + >>> from scipy.special import betaincc, betainc + + The naive calculation ``1 - betainc(a, b, x)`` loses precision when + the values of ``betainc(a, b, x)`` are close to 1: + + >>> 1 - betainc(0.5, 8, [0.9, 0.99, 0.999]) + array([2.0574632e-09, 0.0000000e+00, 0.0000000e+00]) + + By using ``betaincc``, we get the correct values: + + >>> betaincc(0.5, 8, [0.9, 0.99, 0.999]) + array([2.05746321e-09, 1.97259354e-17, 1.96467954e-25]) + + """) + +add_newdoc( + "betaincinv", + r""" + betaincinv(a, b, y, out=None) + + Inverse of the regularized incomplete beta function. + + Computes :math:`x` such that: + + .. math:: + + y = I_x(a, b) = \frac{\Gamma(a+b)}{\Gamma(a)\Gamma(b)} + \int_0^x t^{a-1}(1-t)^{b-1}dt, + + where :math:`I_x` is the normalized incomplete beta function `betainc` + and :math:`\Gamma` is the `gamma` function [1]_. + + Parameters + ---------- + a, b : array_like + Positive, real-valued parameters + y : array_like + Real-valued input + out : ndarray, optional + Optional output array for function values + + Returns + ------- + scalar or ndarray + Value of the inverse of the regularized incomplete beta function + + See Also + -------- + betainc : regularized incomplete beta function + gamma : gamma function + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/8.17 + + Examples + -------- + >>> import scipy.special as sc + + This function is the inverse of `betainc` for fixed + values of :math:`a` and :math:`b`. + + >>> a, b = 1.2, 3.1 + >>> y = sc.betainc(a, b, 0.2) + >>> sc.betaincinv(a, b, y) + 0.2 + >>> + >>> a, b = 7.5, 0.4 + >>> x = sc.betaincinv(a, b, 0.5) + >>> sc.betainc(a, b, x) + 0.5 + + """) + + +add_newdoc( + "betainccinv", + r""" + betainccinv(a, b, y, out=None) + + Inverse of the complemented regularized incomplete beta function. + + Computes :math:`x` such that: + + .. math:: + + y = 1 - I_x(a, b) = 1 - \frac{\Gamma(a+b)}{\Gamma(a)\Gamma(b)} + \int_0^x t^{a-1}(1-t)^{b-1}dt, + + where :math:`I_x` is the normalized incomplete beta function `betainc` + and :math:`\Gamma` is the `gamma` function [1]_. + + Parameters + ---------- + a, b : array_like + Positive, real-valued parameters + y : array_like + Real-valued input + out : ndarray, optional + Optional output array for function values + + Returns + ------- + scalar or ndarray + Value of the inverse of the regularized incomplete beta function + + See Also + -------- + betainc : regularized incomplete beta function + betaincc : complement of the regularized incomplete beta function + + Notes + ----- + .. versionadded:: 1.11.0 + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/8.17 + + Examples + -------- + >>> from scipy.special import betainccinv, betaincc + + This function is the inverse of `betaincc` for fixed + values of :math:`a` and :math:`b`. + + >>> a, b = 1.2, 3.1 + >>> y = betaincc(a, b, 0.2) + >>> betainccinv(a, b, y) + 0.2 + + >>> a, b = 7, 2.5 + >>> x = betainccinv(a, b, 0.875) + >>> betaincc(a, b, x) + 0.875 + + """) + +add_newdoc("betaln", + """ + betaln(a, b, out=None) + + Natural logarithm of absolute value of beta function. + + Computes ``ln(abs(beta(a, b)))``. + + Parameters + ---------- + a, b : array_like + Positive, real-valued parameters + out : ndarray, optional + Optional output array for function values + + Returns + ------- + scalar or ndarray + Value of the betaln function + + See Also + -------- + gamma : the gamma function + betainc : the regularized incomplete beta function + beta : the beta function + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import betaln, beta + + Verify that, for moderate values of ``a`` and ``b``, ``betaln(a, b)`` + is the same as ``log(beta(a, b))``: + + >>> betaln(3, 4) + -4.0943445622221 + + >>> np.log(beta(3, 4)) + -4.0943445622221 + + In the following ``beta(a, b)`` underflows to 0, so we can't compute + the logarithm of the actual value. + + >>> a = 400 + >>> b = 900 + >>> beta(a, b) + 0.0 + + We can compute the logarithm of ``beta(a, b)`` by using `betaln`: + + >>> betaln(a, b) + -804.3069951764146 + + """) + +add_newdoc("boxcox", + """ + boxcox(x, lmbda, out=None) + + Compute the Box-Cox transformation. + + The Box-Cox transformation is:: + + y = (x**lmbda - 1) / lmbda if lmbda != 0 + log(x) if lmbda == 0 + + Returns `nan` if ``x < 0``. + Returns `-inf` if ``x == 0`` and ``lmbda < 0``. + + Parameters + ---------- + x : array_like + Data to be transformed. + lmbda : array_like + Power parameter of the Box-Cox transform. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y : scalar or ndarray + Transformed data. + + Notes + ----- + + .. versionadded:: 0.14.0 + + Examples + -------- + >>> from scipy.special import boxcox + >>> boxcox([1, 4, 10], 2.5) + array([ 0. , 12.4 , 126.09110641]) + >>> boxcox(2, [0, 1, 2]) + array([ 0.69314718, 1. , 1.5 ]) + """) + +add_newdoc("boxcox1p", + """ + boxcox1p(x, lmbda, out=None) + + Compute the Box-Cox transformation of 1 + `x`. + + The Box-Cox transformation computed by `boxcox1p` is:: + + y = ((1+x)**lmbda - 1) / lmbda if lmbda != 0 + log(1+x) if lmbda == 0 + + Returns `nan` if ``x < -1``. + Returns `-inf` if ``x == -1`` and ``lmbda < 0``. + + Parameters + ---------- + x : array_like + Data to be transformed. + lmbda : array_like + Power parameter of the Box-Cox transform. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y : scalar or ndarray + Transformed data. + + Notes + ----- + + .. versionadded:: 0.14.0 + + Examples + -------- + >>> from scipy.special import boxcox1p + >>> boxcox1p(1e-4, [0, 0.5, 1]) + array([ 9.99950003e-05, 9.99975001e-05, 1.00000000e-04]) + >>> boxcox1p([0.01, 0.1], 0.25) + array([ 0.00996272, 0.09645476]) + """) + +add_newdoc("inv_boxcox", + """ + inv_boxcox(y, lmbda, out=None) + + Compute the inverse of the Box-Cox transformation. + + Find ``x`` such that:: + + y = (x**lmbda - 1) / lmbda if lmbda != 0 + log(x) if lmbda == 0 + + Parameters + ---------- + y : array_like + Data to be transformed. + lmbda : array_like + Power parameter of the Box-Cox transform. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + x : scalar or ndarray + Transformed data. + + Notes + ----- + + .. versionadded:: 0.16.0 + + Examples + -------- + >>> from scipy.special import boxcox, inv_boxcox + >>> y = boxcox([1, 4, 10], 2.5) + >>> inv_boxcox(y, 2.5) + array([1., 4., 10.]) + """) + +add_newdoc("inv_boxcox1p", + """ + inv_boxcox1p(y, lmbda, out=None) + + Compute the inverse of the Box-Cox transformation. + + Find ``x`` such that:: + + y = ((1+x)**lmbda - 1) / lmbda if lmbda != 0 + log(1+x) if lmbda == 0 + + Parameters + ---------- + y : array_like + Data to be transformed. + lmbda : array_like + Power parameter of the Box-Cox transform. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + x : scalar or ndarray + Transformed data. + + Notes + ----- + + .. versionadded:: 0.16.0 + + Examples + -------- + >>> from scipy.special import boxcox1p, inv_boxcox1p + >>> y = boxcox1p([1, 4, 10], 2.5) + >>> inv_boxcox1p(y, 2.5) + array([1., 4., 10.]) + """) + +add_newdoc("btdtr", + r""" + btdtr(a, b, x, out=None) + + Cumulative distribution function of the beta distribution. + + Returns the integral from zero to `x` of the beta probability density + function, + + .. math:: + I = \int_0^x \frac{\Gamma(a + b)}{\Gamma(a)\Gamma(b)} t^{a-1} (1-t)^{b-1}\,dt + + where :math:`\Gamma` is the gamma function. + + .. deprecated:: 1.12.0 + This function is deprecated and will be removed from SciPy 1.14.0. + Use `scipy.special.betainc` instead. + + Parameters + ---------- + a : array_like + Shape parameter (a > 0). + b : array_like + Shape parameter (b > 0). + x : array_like + Upper limit of integration, in [0, 1]. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + Cumulative distribution function of the beta distribution with + parameters `a` and `b` at `x`. + + See Also + -------- + betainc + + Notes + ----- + This function is identical to the incomplete beta integral function + `betainc`. + + Wrapper for the Cephes [1]_ routine `btdtr`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + """) + +add_newdoc("btdtri", + r""" + btdtri(a, b, p, out=None) + + The `p`-th quantile of the beta distribution. + + This function is the inverse of the beta cumulative distribution function, + `btdtr`, returning the value of `x` for which `btdtr(a, b, x) = p`, or + + .. math:: + p = \int_0^x \frac{\Gamma(a + b)}{\Gamma(a)\Gamma(b)} t^{a-1} (1-t)^{b-1}\,dt + + .. deprecated:: 1.12.0 + This function is deprecated and will be removed from SciPy 1.14.0. + Use `scipy.special.betaincinv` instead. + + Parameters + ---------- + a : array_like + Shape parameter (`a` > 0). + b : array_like + Shape parameter (`b` > 0). + p : array_like + Cumulative probability, in [0, 1]. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + x : scalar or ndarray + The quantile corresponding to `p`. + + See Also + -------- + betaincinv + btdtr + + Notes + ----- + The value of `x` is found by interval halving or Newton iterations. + + Wrapper for the Cephes [1]_ routine `incbi`, which solves the equivalent + problem of finding the inverse of the incomplete beta integral. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + """) + +add_newdoc("cbrt", + """ + cbrt(x, out=None) + + Element-wise cube root of `x`. + + Parameters + ---------- + x : array_like + `x` must contain real numbers. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + The cube root of each value in `x`. + + Examples + -------- + >>> from scipy.special import cbrt + + >>> cbrt(8) + 2.0 + >>> cbrt([-8, -3, 0.125, 1.331]) + array([-2. , -1.44224957, 0.5 , 1.1 ]) + + """) + +add_newdoc("chdtr", + r""" + chdtr(v, x, out=None) + + Chi square cumulative distribution function. + + Returns the area under the left tail (from 0 to `x`) of the Chi + square probability density function with `v` degrees of freedom: + + .. math:: + + \frac{1}{2^{v/2} \Gamma(v/2)} \int_0^x t^{v/2 - 1} e^{-t/2} dt + + Here :math:`\Gamma` is the Gamma function; see `gamma`. This + integral can be expressed in terms of the regularized lower + incomplete gamma function `gammainc` as + ``gammainc(v / 2, x / 2)``. [1]_ + + Parameters + ---------- + v : array_like + Degrees of freedom. + x : array_like + Upper bound of the integral. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the cumulative distribution function. + + See Also + -------- + chdtrc, chdtri, chdtriv, gammainc + + References + ---------- + .. [1] Chi-Square distribution, + https://www.itl.nist.gov/div898/handbook/eda/section3/eda3666.htm + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It can be expressed in terms of the regularized lower incomplete + gamma function. + + >>> v = 1 + >>> x = np.arange(4) + >>> sc.chdtr(v, x) + array([0. , 0.68268949, 0.84270079, 0.91673548]) + >>> sc.gammainc(v / 2, x / 2) + array([0. , 0.68268949, 0.84270079, 0.91673548]) + + """) + +add_newdoc("chdtrc", + r""" + chdtrc(v, x, out=None) + + Chi square survival function. + + Returns the area under the right hand tail (from `x` to infinity) + of the Chi square probability density function with `v` degrees of + freedom: + + .. math:: + + \frac{1}{2^{v/2} \Gamma(v/2)} \int_x^\infty t^{v/2 - 1} e^{-t/2} dt + + Here :math:`\Gamma` is the Gamma function; see `gamma`. This + integral can be expressed in terms of the regularized upper + incomplete gamma function `gammaincc` as + ``gammaincc(v / 2, x / 2)``. [1]_ + + Parameters + ---------- + v : array_like + Degrees of freedom. + x : array_like + Lower bound of the integral. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the survival function. + + See Also + -------- + chdtr, chdtri, chdtriv, gammaincc + + References + ---------- + .. [1] Chi-Square distribution, + https://www.itl.nist.gov/div898/handbook/eda/section3/eda3666.htm + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It can be expressed in terms of the regularized upper incomplete + gamma function. + + >>> v = 1 + >>> x = np.arange(4) + >>> sc.chdtrc(v, x) + array([1. , 0.31731051, 0.15729921, 0.08326452]) + >>> sc.gammaincc(v / 2, x / 2) + array([1. , 0.31731051, 0.15729921, 0.08326452]) + + """) + +add_newdoc("chdtri", + """ + chdtri(v, p, out=None) + + Inverse to `chdtrc` with respect to `x`. + + Returns `x` such that ``chdtrc(v, x) == p``. + + Parameters + ---------- + v : array_like + Degrees of freedom. + p : array_like + Probability. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + x : scalar or ndarray + Value so that the probability a Chi square random variable + with `v` degrees of freedom is greater than `x` equals `p`. + + See Also + -------- + chdtrc, chdtr, chdtriv + + References + ---------- + .. [1] Chi-Square distribution, + https://www.itl.nist.gov/div898/handbook/eda/section3/eda3666.htm + + Examples + -------- + >>> import scipy.special as sc + + It inverts `chdtrc`. + + >>> v, p = 1, 0.3 + >>> sc.chdtrc(v, sc.chdtri(v, p)) + 0.3 + >>> x = 1 + >>> sc.chdtri(v, sc.chdtrc(v, x)) + 1.0 + + """) + +add_newdoc("chdtriv", + """ + chdtriv(p, x, out=None) + + Inverse to `chdtr` with respect to `v`. + + Returns `v` such that ``chdtr(v, x) == p``. + + Parameters + ---------- + p : array_like + Probability that the Chi square random variable is less than + or equal to `x`. + x : array_like + Nonnegative input. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Degrees of freedom. + + See Also + -------- + chdtr, chdtrc, chdtri + + References + ---------- + .. [1] Chi-Square distribution, + https://www.itl.nist.gov/div898/handbook/eda/section3/eda3666.htm + + Examples + -------- + >>> import scipy.special as sc + + It inverts `chdtr`. + + >>> p, x = 0.5, 1 + >>> sc.chdtr(sc.chdtriv(p, x), x) + 0.5000000000202172 + >>> v = 1 + >>> sc.chdtriv(sc.chdtr(v, x), v) + 1.0000000000000013 + + """) + +add_newdoc("chndtr", + r""" + chndtr(x, df, nc, out=None) + + Non-central chi square cumulative distribution function + + The cumulative distribution function is given by: + + .. math:: + + P(\chi^{\prime 2} \vert \nu, \lambda) =\sum_{j=0}^{\infty} + e^{-\lambda /2} + \frac{(\lambda /2)^j}{j!} P(\chi^{\prime 2} \vert \nu + 2j), + + where :math:`\nu > 0` is the degrees of freedom (``df``) and + :math:`\lambda \geq 0` is the non-centrality parameter (``nc``). + + Parameters + ---------- + x : array_like + Upper bound of the integral; must satisfy ``x >= 0`` + df : array_like + Degrees of freedom; must satisfy ``df > 0`` + nc : array_like + Non-centrality parameter; must satisfy ``nc >= 0`` + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + x : scalar or ndarray + Value of the non-central chi square cumulative distribution function. + + See Also + -------- + chndtrix, chndtridf, chndtrinc + + """) + +add_newdoc("chndtrix", + """ + chndtrix(p, df, nc, out=None) + + Inverse to `chndtr` vs `x` + + Calculated using a search to find a value for `x` that produces the + desired value of `p`. + + Parameters + ---------- + p : array_like + Probability; must satisfy ``0 <= p < 1`` + df : array_like + Degrees of freedom; must satisfy ``df > 0`` + nc : array_like + Non-centrality parameter; must satisfy ``nc >= 0`` + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + x : scalar or ndarray + Value so that the probability a non-central Chi square random variable + with `df` degrees of freedom and non-centrality, `nc`, is greater than + `x` equals `p`. + + See Also + -------- + chndtr, chndtridf, chndtrinc + + """) + +add_newdoc("chndtridf", + """ + chndtridf(x, p, nc, out=None) + + Inverse to `chndtr` vs `df` + + Calculated using a search to find a value for `df` that produces the + desired value of `p`. + + Parameters + ---------- + x : array_like + Upper bound of the integral; must satisfy ``x >= 0`` + p : array_like + Probability; must satisfy ``0 <= p < 1`` + nc : array_like + Non-centrality parameter; must satisfy ``nc >= 0`` + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + df : scalar or ndarray + Degrees of freedom + + See Also + -------- + chndtr, chndtrix, chndtrinc + + """) + +add_newdoc("chndtrinc", + """ + chndtrinc(x, df, p, out=None) + + Inverse to `chndtr` vs `nc` + + Calculated using a search to find a value for `df` that produces the + desired value of `p`. + + Parameters + ---------- + x : array_like + Upper bound of the integral; must satisfy ``x >= 0`` + df : array_like + Degrees of freedom; must satisfy ``df > 0`` + p : array_like + Probability; must satisfy ``0 <= p < 1`` + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + nc : scalar or ndarray + Non-centrality + + See Also + -------- + chndtr, chndtrix, chndtrinc + + """) + +add_newdoc("cosdg", + """ + cosdg(x, out=None) + + Cosine of the angle `x` given in degrees. + + Parameters + ---------- + x : array_like + Angle, given in degrees. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Cosine of the input. + + See Also + -------- + sindg, tandg, cotdg + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is more accurate than using cosine directly. + + >>> x = 90 + 180 * np.arange(3) + >>> sc.cosdg(x) + array([-0., 0., -0.]) + >>> np.cos(x * np.pi / 180) + array([ 6.1232340e-17, -1.8369702e-16, 3.0616170e-16]) + + """) + +add_newdoc("cosm1", + """ + cosm1(x, out=None) + + cos(x) - 1 for use when `x` is near zero. + + Parameters + ---------- + x : array_like + Real valued argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of ``cos(x) - 1``. + + See Also + -------- + expm1, log1p + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is more accurate than computing ``cos(x) - 1`` directly for + ``x`` around 0. + + >>> x = 1e-30 + >>> np.cos(x) - 1 + 0.0 + >>> sc.cosm1(x) + -5.0000000000000005e-61 + + """) + +add_newdoc("cotdg", + """ + cotdg(x, out=None) + + Cotangent of the angle `x` given in degrees. + + Parameters + ---------- + x : array_like + Angle, given in degrees. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Cotangent at the input. + + See Also + -------- + sindg, cosdg, tandg + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is more accurate than using cotangent directly. + + >>> x = 90 + 180 * np.arange(3) + >>> sc.cotdg(x) + array([0., 0., 0.]) + >>> 1 / np.tan(x * np.pi / 180) + array([6.1232340e-17, 1.8369702e-16, 3.0616170e-16]) + + """) + +add_newdoc("dawsn", + """ + dawsn(x, out=None) + + Dawson's integral. + + Computes:: + + exp(-x**2) * integral(exp(t**2), t=0..x). + + Parameters + ---------- + x : array_like + Function parameter. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y : scalar or ndarray + Value of the integral. + + See Also + -------- + wofz, erf, erfc, erfcx, erfi + + References + ---------- + .. [1] Steven G. Johnson, Faddeeva W function implementation. + http://ab-initio.mit.edu/Faddeeva + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-15, 15, num=1000) + >>> plt.plot(x, special.dawsn(x)) + >>> plt.xlabel('$x$') + >>> plt.ylabel('$dawsn(x)$') + >>> plt.show() + + """) + +add_newdoc("ellipe", + r""" + ellipe(m, out=None) + + Complete elliptic integral of the second kind + + This function is defined as + + .. math:: E(m) = \int_0^{\pi/2} [1 - m \sin(t)^2]^{1/2} dt + + Parameters + ---------- + m : array_like + Defines the parameter of the elliptic integral. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + E : scalar or ndarray + Value of the elliptic integral. + + See Also + -------- + ellipkm1 : Complete elliptic integral of the first kind, near `m` = 1 + ellipk : Complete elliptic integral of the first kind + ellipkinc : Incomplete elliptic integral of the first kind + ellipeinc : Incomplete elliptic integral of the second kind + elliprd : Symmetric elliptic integral of the second kind. + elliprg : Completely-symmetric elliptic integral of the second kind. + + Notes + ----- + Wrapper for the Cephes [1]_ routine `ellpe`. + + For `m > 0` the computation uses the approximation, + + .. math:: E(m) \approx P(1-m) - (1-m) \log(1-m) Q(1-m), + + where :math:`P` and :math:`Q` are tenth-order polynomials. For + `m < 0`, the relation + + .. math:: E(m) = E(m/(m - 1)) \sqrt(1-m) + + is used. + + The parameterization in terms of :math:`m` follows that of section + 17.2 in [2]_. Other parameterizations in terms of the + complementary parameter :math:`1 - m`, modular angle + :math:`\sin^2(\alpha) = m`, or modulus :math:`k^2 = m` are also + used, so be careful that you choose the correct parameter. + + The Legendre E integral is related to Carlson's symmetric R_D or R_G + functions in multiple ways [3]_. For example, + + .. math:: E(m) = 2 R_G(0, 1-k^2, 1) . + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + .. [2] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + .. [3] NIST Digital Library of Mathematical + Functions. http://dlmf.nist.gov/, Release 1.0.28 of + 2020-09-15. See Sec. 19.25(i) https://dlmf.nist.gov/19.25#i + + Examples + -------- + This function is used in finding the circumference of an + ellipse with semi-major axis `a` and semi-minor axis `b`. + + >>> import numpy as np + >>> from scipy import special + + >>> a = 3.5 + >>> b = 2.1 + >>> e_sq = 1.0 - b**2/a**2 # eccentricity squared + + Then the circumference is found using the following: + + >>> C = 4*a*special.ellipe(e_sq) # circumference formula + >>> C + 17.868899204378693 + + When `a` and `b` are the same (meaning eccentricity is 0), + this reduces to the circumference of a circle. + + >>> 4*a*special.ellipe(0.0) # formula for ellipse with a = b + 21.991148575128552 + >>> 2*np.pi*a # formula for circle of radius a + 21.991148575128552 + + """) + +add_newdoc("ellipeinc", + r""" + ellipeinc(phi, m, out=None) + + Incomplete elliptic integral of the second kind + + This function is defined as + + .. math:: E(\phi, m) = \int_0^{\phi} [1 - m \sin(t)^2]^{1/2} dt + + Parameters + ---------- + phi : array_like + amplitude of the elliptic integral. + m : array_like + parameter of the elliptic integral. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + E : scalar or ndarray + Value of the elliptic integral. + + See Also + -------- + ellipkm1 : Complete elliptic integral of the first kind, near `m` = 1 + ellipk : Complete elliptic integral of the first kind + ellipkinc : Incomplete elliptic integral of the first kind + ellipe : Complete elliptic integral of the second kind + elliprd : Symmetric elliptic integral of the second kind. + elliprf : Completely-symmetric elliptic integral of the first kind. + elliprg : Completely-symmetric elliptic integral of the second kind. + + Notes + ----- + Wrapper for the Cephes [1]_ routine `ellie`. + + Computation uses arithmetic-geometric means algorithm. + + The parameterization in terms of :math:`m` follows that of section + 17.2 in [2]_. Other parameterizations in terms of the + complementary parameter :math:`1 - m`, modular angle + :math:`\sin^2(\alpha) = m`, or modulus :math:`k^2 = m` are also + used, so be careful that you choose the correct parameter. + + The Legendre E incomplete integral can be related to combinations + of Carlson's symmetric integrals R_D, R_F, and R_G in multiple + ways [3]_. For example, with :math:`c = \csc^2\phi`, + + .. math:: + E(\phi, m) = R_F(c-1, c-k^2, c) + - \frac{1}{3} k^2 R_D(c-1, c-k^2, c) . + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + .. [2] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + .. [3] NIST Digital Library of Mathematical + Functions. http://dlmf.nist.gov/, Release 1.0.28 of + 2020-09-15. See Sec. 19.25(i) https://dlmf.nist.gov/19.25#i + """) + +add_newdoc("ellipj", + """ + ellipj(u, m, out=None) + + Jacobian elliptic functions + + Calculates the Jacobian elliptic functions of parameter `m` between + 0 and 1, and real argument `u`. + + Parameters + ---------- + m : array_like + Parameter. + u : array_like + Argument. + out : tuple of ndarray, optional + Optional output arrays for the function values + + Returns + ------- + sn, cn, dn, ph : 4-tuple of scalar or ndarray + The returned functions:: + + sn(u|m), cn(u|m), dn(u|m) + + The value `ph` is such that if `u = ellipkinc(ph, m)`, + then `sn(u|m) = sin(ph)` and `cn(u|m) = cos(ph)`. + + See Also + -------- + ellipk : Complete elliptic integral of the first kind + ellipkinc : Incomplete elliptic integral of the first kind + + Notes + ----- + Wrapper for the Cephes [1]_ routine `ellpj`. + + These functions are periodic, with quarter-period on the real axis + equal to the complete elliptic integral `ellipk(m)`. + + Relation to incomplete elliptic integral: If `u = ellipkinc(phi,m)`, then + `sn(u|m) = sin(phi)`, and `cn(u|m) = cos(phi)`. The `phi` is called + the amplitude of `u`. + + Computation is by means of the arithmetic-geometric mean algorithm, + except when `m` is within 1e-9 of 0 or 1. In the latter case with `m` + close to 1, the approximation applies only for `phi < pi/2`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + """) + +add_newdoc("ellipkm1", + """ + ellipkm1(p, out=None) + + Complete elliptic integral of the first kind around `m` = 1 + + This function is defined as + + .. math:: K(p) = \\int_0^{\\pi/2} [1 - m \\sin(t)^2]^{-1/2} dt + + where `m = 1 - p`. + + Parameters + ---------- + p : array_like + Defines the parameter of the elliptic integral as `m = 1 - p`. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + K : scalar or ndarray + Value of the elliptic integral. + + See Also + -------- + ellipk : Complete elliptic integral of the first kind + ellipkinc : Incomplete elliptic integral of the first kind + ellipe : Complete elliptic integral of the second kind + ellipeinc : Incomplete elliptic integral of the second kind + elliprf : Completely-symmetric elliptic integral of the first kind. + + Notes + ----- + Wrapper for the Cephes [1]_ routine `ellpk`. + + For `p <= 1`, computation uses the approximation, + + .. math:: K(p) \\approx P(p) - \\log(p) Q(p), + + where :math:`P` and :math:`Q` are tenth-order polynomials. The + argument `p` is used internally rather than `m` so that the logarithmic + singularity at `m = 1` will be shifted to the origin; this preserves + maximum accuracy. For `p > 1`, the identity + + .. math:: K(p) = K(1/p)/\\sqrt(p) + + is used. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + """) + +add_newdoc("ellipk", + r""" + ellipk(m, out=None) + + Complete elliptic integral of the first kind. + + This function is defined as + + .. math:: K(m) = \int_0^{\pi/2} [1 - m \sin(t)^2]^{-1/2} dt + + Parameters + ---------- + m : array_like + The parameter of the elliptic integral. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + K : scalar or ndarray + Value of the elliptic integral. + + See Also + -------- + ellipkm1 : Complete elliptic integral of the first kind around m = 1 + ellipkinc : Incomplete elliptic integral of the first kind + ellipe : Complete elliptic integral of the second kind + ellipeinc : Incomplete elliptic integral of the second kind + elliprf : Completely-symmetric elliptic integral of the first kind. + + Notes + ----- + For more precision around point m = 1, use `ellipkm1`, which this + function calls. + + The parameterization in terms of :math:`m` follows that of section + 17.2 in [1]_. Other parameterizations in terms of the + complementary parameter :math:`1 - m`, modular angle + :math:`\sin^2(\alpha) = m`, or modulus :math:`k^2 = m` are also + used, so be careful that you choose the correct parameter. + + The Legendre K integral is related to Carlson's symmetric R_F + function by [2]_: + + .. math:: K(m) = R_F(0, 1-k^2, 1) . + + References + ---------- + .. [1] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + .. [2] NIST Digital Library of Mathematical + Functions. http://dlmf.nist.gov/, Release 1.0.28 of + 2020-09-15. See Sec. 19.25(i) https://dlmf.nist.gov/19.25#i + + """) + +add_newdoc("ellipkinc", + r""" + ellipkinc(phi, m, out=None) + + Incomplete elliptic integral of the first kind + + This function is defined as + + .. math:: K(\phi, m) = \int_0^{\phi} [1 - m \sin(t)^2]^{-1/2} dt + + This function is also called :math:`F(\phi, m)`. + + Parameters + ---------- + phi : array_like + amplitude of the elliptic integral + m : array_like + parameter of the elliptic integral + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + K : scalar or ndarray + Value of the elliptic integral + + See Also + -------- + ellipkm1 : Complete elliptic integral of the first kind, near `m` = 1 + ellipk : Complete elliptic integral of the first kind + ellipe : Complete elliptic integral of the second kind + ellipeinc : Incomplete elliptic integral of the second kind + elliprf : Completely-symmetric elliptic integral of the first kind. + + Notes + ----- + Wrapper for the Cephes [1]_ routine `ellik`. The computation is + carried out using the arithmetic-geometric mean algorithm. + + The parameterization in terms of :math:`m` follows that of section + 17.2 in [2]_. Other parameterizations in terms of the + complementary parameter :math:`1 - m`, modular angle + :math:`\sin^2(\alpha) = m`, or modulus :math:`k^2 = m` are also + used, so be careful that you choose the correct parameter. + + The Legendre K incomplete integral (or F integral) is related to + Carlson's symmetric R_F function [3]_. + Setting :math:`c = \csc^2\phi`, + + .. math:: F(\phi, m) = R_F(c-1, c-k^2, c) . + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + .. [2] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + .. [3] NIST Digital Library of Mathematical + Functions. http://dlmf.nist.gov/, Release 1.0.28 of + 2020-09-15. See Sec. 19.25(i) https://dlmf.nist.gov/19.25#i + """) + +add_newdoc( + "elliprc", + r""" + elliprc(x, y, out=None) + + Degenerate symmetric elliptic integral. + + The function RC is defined as [1]_ + + .. math:: + + R_{\mathrm{C}}(x, y) = + \frac{1}{2} \int_0^{+\infty} (t + x)^{-1/2} (t + y)^{-1} dt + = R_{\mathrm{F}}(x, y, y) + + Parameters + ---------- + x, y : array_like + Real or complex input parameters. `x` can be any number in the + complex plane cut along the negative real axis. `y` must be non-zero. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + R : scalar or ndarray + Value of the integral. If `y` is real and negative, the Cauchy + principal value is returned. If both of `x` and `y` are real, the + return value is real. Otherwise, the return value is complex. + + See Also + -------- + elliprf : Completely-symmetric elliptic integral of the first kind. + elliprd : Symmetric elliptic integral of the second kind. + elliprg : Completely-symmetric elliptic integral of the second kind. + elliprj : Symmetric elliptic integral of the third kind. + + Notes + ----- + RC is a degenerate case of the symmetric integral RF: ``elliprc(x, y) == + elliprf(x, y, y)``. It is an elementary function rather than an elliptic + integral. + + The code implements Carlson's algorithm based on the duplication theorems + and series expansion up to the 7th order. [2]_ + + .. versionadded:: 1.8.0 + + References + ---------- + .. [1] B. C. Carlson, ed., Chapter 19 in "Digital Library of Mathematical + Functions," NIST, US Dept. of Commerce. + https://dlmf.nist.gov/19.16.E6 + .. [2] B. C. Carlson, "Numerical computation of real or complex elliptic + integrals," Numer. Algorithm, vol. 10, no. 1, pp. 13-26, 1995. + https://arxiv.org/abs/math/9409227 + https://doi.org/10.1007/BF02198293 + + Examples + -------- + Basic homogeneity property: + + >>> import numpy as np + >>> from scipy.special import elliprc + + >>> x = 1.2 + 3.4j + >>> y = 5. + >>> scale = 0.3 + 0.4j + >>> elliprc(scale*x, scale*y) + (0.5484493976710874-0.4169557678995833j) + + >>> elliprc(x, y)/np.sqrt(scale) + (0.5484493976710874-0.41695576789958333j) + + When the two arguments coincide, the integral is particularly + simple: + + >>> x = 1.2 + 3.4j + >>> elliprc(x, x) + (0.4299173120614631-0.3041729818745595j) + + >>> 1/np.sqrt(x) + (0.4299173120614631-0.30417298187455954j) + + Another simple case: the first argument vanishes: + + >>> y = 1.2 + 3.4j + >>> elliprc(0, y) + (0.6753125346116815-0.47779380263880866j) + + >>> np.pi/2/np.sqrt(y) + (0.6753125346116815-0.4777938026388088j) + + When `x` and `y` are both positive, we can express + :math:`R_C(x,y)` in terms of more elementary functions. For the + case :math:`0 \le x < y`, + + >>> x = 3.2 + >>> y = 6. + >>> elliprc(x, y) + 0.44942991498453444 + + >>> np.arctan(np.sqrt((y-x)/x))/np.sqrt(y-x) + 0.44942991498453433 + + And for the case :math:`0 \le y < x`, + + >>> x = 6. + >>> y = 3.2 + >>> elliprc(x,y) + 0.4989837501576147 + + >>> np.log((np.sqrt(x)+np.sqrt(x-y))/np.sqrt(y))/np.sqrt(x-y) + 0.49898375015761476 + + """) + +add_newdoc( + "elliprd", + r""" + elliprd(x, y, z, out=None) + + Symmetric elliptic integral of the second kind. + + The function RD is defined as [1]_ + + .. math:: + + R_{\mathrm{D}}(x, y, z) = + \frac{3}{2} \int_0^{+\infty} [(t + x) (t + y)]^{-1/2} (t + z)^{-3/2} + dt + + Parameters + ---------- + x, y, z : array_like + Real or complex input parameters. `x` or `y` can be any number in the + complex plane cut along the negative real axis, but at most one of them + can be zero, while `z` must be non-zero. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + R : scalar or ndarray + Value of the integral. If all of `x`, `y`, and `z` are real, the + return value is real. Otherwise, the return value is complex. + + See Also + -------- + elliprc : Degenerate symmetric elliptic integral. + elliprf : Completely-symmetric elliptic integral of the first kind. + elliprg : Completely-symmetric elliptic integral of the second kind. + elliprj : Symmetric elliptic integral of the third kind. + + Notes + ----- + RD is a degenerate case of the elliptic integral RJ: ``elliprd(x, y, z) == + elliprj(x, y, z, z)``. + + The code implements Carlson's algorithm based on the duplication theorems + and series expansion up to the 7th order. [2]_ + + .. versionadded:: 1.8.0 + + References + ---------- + .. [1] B. C. Carlson, ed., Chapter 19 in "Digital Library of Mathematical + Functions," NIST, US Dept. of Commerce. + https://dlmf.nist.gov/19.16.E5 + .. [2] B. C. Carlson, "Numerical computation of real or complex elliptic + integrals," Numer. Algorithm, vol. 10, no. 1, pp. 13-26, 1995. + https://arxiv.org/abs/math/9409227 + https://doi.org/10.1007/BF02198293 + + Examples + -------- + Basic homogeneity property: + + >>> import numpy as np + >>> from scipy.special import elliprd + + >>> x = 1.2 + 3.4j + >>> y = 5. + >>> z = 6. + >>> scale = 0.3 + 0.4j + >>> elliprd(scale*x, scale*y, scale*z) + (-0.03703043835680379-0.24500934665683802j) + + >>> elliprd(x, y, z)*np.power(scale, -1.5) + (-0.0370304383568038-0.24500934665683805j) + + All three arguments coincide: + + >>> x = 1.2 + 3.4j + >>> elliprd(x, x, x) + (-0.03986825876151896-0.14051741840449586j) + + >>> np.power(x, -1.5) + (-0.03986825876151894-0.14051741840449583j) + + The so-called "second lemniscate constant": + + >>> elliprd(0, 2, 1)/3 + 0.5990701173677961 + + >>> from scipy.special import gamma + >>> gamma(0.75)**2/np.sqrt(2*np.pi) + 0.5990701173677959 + + """) + +add_newdoc( + "elliprf", + r""" + elliprf(x, y, z, out=None) + + Completely-symmetric elliptic integral of the first kind. + + The function RF is defined as [1]_ + + .. math:: + + R_{\mathrm{F}}(x, y, z) = + \frac{1}{2} \int_0^{+\infty} [(t + x) (t + y) (t + z)]^{-1/2} dt + + Parameters + ---------- + x, y, z : array_like + Real or complex input parameters. `x`, `y`, or `z` can be any number in + the complex plane cut along the negative real axis, but at most one of + them can be zero. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + R : scalar or ndarray + Value of the integral. If all of `x`, `y`, and `z` are real, the return + value is real. Otherwise, the return value is complex. + + See Also + -------- + elliprc : Degenerate symmetric integral. + elliprd : Symmetric elliptic integral of the second kind. + elliprg : Completely-symmetric elliptic integral of the second kind. + elliprj : Symmetric elliptic integral of the third kind. + + Notes + ----- + The code implements Carlson's algorithm based on the duplication theorems + and series expansion up to the 7th order (cf.: + https://dlmf.nist.gov/19.36.i) and the AGM algorithm for the complete + integral. [2]_ + + .. versionadded:: 1.8.0 + + References + ---------- + .. [1] B. C. Carlson, ed., Chapter 19 in "Digital Library of Mathematical + Functions," NIST, US Dept. of Commerce. + https://dlmf.nist.gov/19.16.E1 + .. [2] B. C. Carlson, "Numerical computation of real or complex elliptic + integrals," Numer. Algorithm, vol. 10, no. 1, pp. 13-26, 1995. + https://arxiv.org/abs/math/9409227 + https://doi.org/10.1007/BF02198293 + + Examples + -------- + Basic homogeneity property: + + >>> import numpy as np + >>> from scipy.special import elliprf + + >>> x = 1.2 + 3.4j + >>> y = 5. + >>> z = 6. + >>> scale = 0.3 + 0.4j + >>> elliprf(scale*x, scale*y, scale*z) + (0.5328051227278146-0.4008623567957094j) + + >>> elliprf(x, y, z)/np.sqrt(scale) + (0.5328051227278147-0.4008623567957095j) + + All three arguments coincide: + + >>> x = 1.2 + 3.4j + >>> elliprf(x, x, x) + (0.42991731206146316-0.30417298187455954j) + + >>> 1/np.sqrt(x) + (0.4299173120614631-0.30417298187455954j) + + The so-called "first lemniscate constant": + + >>> elliprf(0, 1, 2) + 1.3110287771460598 + + >>> from scipy.special import gamma + >>> gamma(0.25)**2/(4*np.sqrt(2*np.pi)) + 1.3110287771460598 + + """) + +add_newdoc( + "elliprg", + r""" + elliprg(x, y, z, out=None) + + Completely-symmetric elliptic integral of the second kind. + + The function RG is defined as [1]_ + + .. math:: + + R_{\mathrm{G}}(x, y, z) = + \frac{1}{4} \int_0^{+\infty} [(t + x) (t + y) (t + z)]^{-1/2} + \left(\frac{x}{t + x} + \frac{y}{t + y} + \frac{z}{t + z}\right) t + dt + + Parameters + ---------- + x, y, z : array_like + Real or complex input parameters. `x`, `y`, or `z` can be any number in + the complex plane cut along the negative real axis. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + R : scalar or ndarray + Value of the integral. If all of `x`, `y`, and `z` are real, the return + value is real. Otherwise, the return value is complex. + + See Also + -------- + elliprc : Degenerate symmetric integral. + elliprd : Symmetric elliptic integral of the second kind. + elliprf : Completely-symmetric elliptic integral of the first kind. + elliprj : Symmetric elliptic integral of the third kind. + + Notes + ----- + The implementation uses the relation [1]_ + + .. math:: + + 2 R_{\mathrm{G}}(x, y, z) = + z R_{\mathrm{F}}(x, y, z) - + \frac{1}{3} (x - z) (y - z) R_{\mathrm{D}}(x, y, z) + + \sqrt{\frac{x y}{z}} + + and the symmetry of `x`, `y`, `z` when at least one non-zero parameter can + be chosen as the pivot. When one of the arguments is close to zero, the AGM + method is applied instead. Other special cases are computed following Ref. + [2]_ + + .. versionadded:: 1.8.0 + + References + ---------- + .. [1] B. C. Carlson, "Numerical computation of real or complex elliptic + integrals," Numer. Algorithm, vol. 10, no. 1, pp. 13-26, 1995. + https://arxiv.org/abs/math/9409227 + https://doi.org/10.1007/BF02198293 + .. [2] B. C. Carlson, ed., Chapter 19 in "Digital Library of Mathematical + Functions," NIST, US Dept. of Commerce. + https://dlmf.nist.gov/19.16.E1 + https://dlmf.nist.gov/19.20.ii + + Examples + -------- + Basic homogeneity property: + + >>> import numpy as np + >>> from scipy.special import elliprg + + >>> x = 1.2 + 3.4j + >>> y = 5. + >>> z = 6. + >>> scale = 0.3 + 0.4j + >>> elliprg(scale*x, scale*y, scale*z) + (1.195936862005246+0.8470988320464167j) + + >>> elliprg(x, y, z)*np.sqrt(scale) + (1.195936862005246+0.8470988320464165j) + + Simplifications: + + >>> elliprg(0, y, y) + 1.756203682760182 + + >>> 0.25*np.pi*np.sqrt(y) + 1.7562036827601817 + + >>> elliprg(0, 0, z) + 1.224744871391589 + + >>> 0.5*np.sqrt(z) + 1.224744871391589 + + The surface area of a triaxial ellipsoid with semiaxes ``a``, ``b``, and + ``c`` is given by + + .. math:: + + S = 4 \pi a b c R_{\mathrm{G}}(1 / a^2, 1 / b^2, 1 / c^2). + + >>> def ellipsoid_area(a, b, c): + ... r = 4.0 * np.pi * a * b * c + ... return r * elliprg(1.0 / (a * a), 1.0 / (b * b), 1.0 / (c * c)) + >>> print(ellipsoid_area(1, 3, 5)) + 108.62688289491807 + """) + +add_newdoc( + "elliprj", + r""" + elliprj(x, y, z, p, out=None) + + Symmetric elliptic integral of the third kind. + + The function RJ is defined as [1]_ + + .. math:: + + R_{\mathrm{J}}(x, y, z, p) = + \frac{3}{2} \int_0^{+\infty} [(t + x) (t + y) (t + z)]^{-1/2} + (t + p)^{-1} dt + + .. warning:: + This function should be considered experimental when the inputs are + unbalanced. Check correctness with another independent implementation. + + Parameters + ---------- + x, y, z, p : array_like + Real or complex input parameters. `x`, `y`, or `z` are numbers in + the complex plane cut along the negative real axis (subject to further + constraints, see Notes), and at most one of them can be zero. `p` must + be non-zero. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + R : scalar or ndarray + Value of the integral. If all of `x`, `y`, `z`, and `p` are real, the + return value is real. Otherwise, the return value is complex. + + If `p` is real and negative, while `x`, `y`, and `z` are real, + non-negative, and at most one of them is zero, the Cauchy principal + value is returned. [1]_ [2]_ + + See Also + -------- + elliprc : Degenerate symmetric integral. + elliprd : Symmetric elliptic integral of the second kind. + elliprf : Completely-symmetric elliptic integral of the first kind. + elliprg : Completely-symmetric elliptic integral of the second kind. + + Notes + ----- + The code implements Carlson's algorithm based on the duplication theorems + and series expansion up to the 7th order. [3]_ The algorithm is slightly + different from its earlier incarnation as it appears in [1]_, in that the + call to `elliprc` (or ``atan``/``atanh``, see [4]_) is no longer needed in + the inner loop. Asymptotic approximations are used where arguments differ + widely in the order of magnitude. [5]_ + + The input values are subject to certain sufficient but not necessary + constraints when input arguments are complex. Notably, ``x``, ``y``, and + ``z`` must have non-negative real parts, unless two of them are + non-negative and complex-conjugates to each other while the other is a real + non-negative number. [1]_ If the inputs do not satisfy the sufficient + condition described in Ref. [1]_ they are rejected outright with the output + set to NaN. + + In the case where one of ``x``, ``y``, and ``z`` is equal to ``p``, the + function ``elliprd`` should be preferred because of its less restrictive + domain. + + .. versionadded:: 1.8.0 + + References + ---------- + .. [1] B. C. Carlson, "Numerical computation of real or complex elliptic + integrals," Numer. Algorithm, vol. 10, no. 1, pp. 13-26, 1995. + https://arxiv.org/abs/math/9409227 + https://doi.org/10.1007/BF02198293 + .. [2] B. C. Carlson, ed., Chapter 19 in "Digital Library of Mathematical + Functions," NIST, US Dept. of Commerce. + https://dlmf.nist.gov/19.20.iii + .. [3] B. C. Carlson, J. FitzSimmons, "Reduction Theorems for Elliptic + Integrands with the Square Root of Two Quadratic Factors," J. + Comput. Appl. Math., vol. 118, nos. 1-2, pp. 71-85, 2000. + https://doi.org/10.1016/S0377-0427(00)00282-X + .. [4] F. Johansson, "Numerical Evaluation of Elliptic Functions, Elliptic + Integrals and Modular Forms," in J. Blumlein, C. Schneider, P. + Paule, eds., "Elliptic Integrals, Elliptic Functions and Modular + Forms in Quantum Field Theory," pp. 269-293, 2019 (Cham, + Switzerland: Springer Nature Switzerland) + https://arxiv.org/abs/1806.06725 + https://doi.org/10.1007/978-3-030-04480-0 + .. [5] B. C. Carlson, J. L. Gustafson, "Asymptotic Approximations for + Symmetric Elliptic Integrals," SIAM J. Math. Anls., vol. 25, no. 2, + pp. 288-303, 1994. + https://arxiv.org/abs/math/9310223 + https://doi.org/10.1137/S0036141092228477 + + Examples + -------- + Basic homogeneity property: + + >>> import numpy as np + >>> from scipy.special import elliprj + + >>> x = 1.2 + 3.4j + >>> y = 5. + >>> z = 6. + >>> p = 7. + >>> scale = 0.3 - 0.4j + >>> elliprj(scale*x, scale*y, scale*z, scale*p) + (0.10834905565679157+0.19694950747103812j) + + >>> elliprj(x, y, z, p)*np.power(scale, -1.5) + (0.10834905565679556+0.19694950747103854j) + + Reduction to simpler elliptic integral: + + >>> elliprj(x, y, z, z) + (0.08288462362195129-0.028376809745123258j) + + >>> from scipy.special import elliprd + >>> elliprd(x, y, z) + (0.08288462362195136-0.028376809745123296j) + + All arguments coincide: + + >>> elliprj(x, x, x, x) + (-0.03986825876151896-0.14051741840449586j) + + >>> np.power(x, -1.5) + (-0.03986825876151894-0.14051741840449583j) + + """) + +add_newdoc("entr", + r""" + entr(x, out=None) + + Elementwise function for computing entropy. + + .. math:: \text{entr}(x) = \begin{cases} - x \log(x) & x > 0 \\ 0 & x = 0 + \\ -\infty & \text{otherwise} \end{cases} + + Parameters + ---------- + x : ndarray + Input array. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + res : scalar or ndarray + The value of the elementwise entropy function at the given points `x`. + + See Also + -------- + kl_div, rel_entr, scipy.stats.entropy + + Notes + ----- + .. versionadded:: 0.15.0 + + This function is concave. + + The origin of this function is in convex programming; see [1]_. + Given a probability distribution :math:`p_1, \ldots, p_n`, + the definition of entropy in the context of *information theory* is + + .. math:: + + \sum_{i = 1}^n \mathrm{entr}(p_i). + + To compute the latter quantity, use `scipy.stats.entropy`. + + References + ---------- + .. [1] Boyd, Stephen and Lieven Vandenberghe. *Convex optimization*. + Cambridge University Press, 2004. + :doi:`https://doi.org/10.1017/CBO9780511804441` + + """) + +add_newdoc("erf", + """ + erf(z, out=None) + + Returns the error function of complex argument. + + It is defined as ``2/sqrt(pi)*integral(exp(-t**2), t=0..z)``. + + Parameters + ---------- + x : ndarray + Input array. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + res : scalar or ndarray + The values of the error function at the given points `x`. + + See Also + -------- + erfc, erfinv, erfcinv, wofz, erfcx, erfi + + Notes + ----- + The cumulative of the unit normal distribution is given by + ``Phi(z) = 1/2[1 + erf(z/sqrt(2))]``. + + References + ---------- + .. [1] https://en.wikipedia.org/wiki/Error_function + .. [2] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, + 1972. http://www.math.sfu.ca/~cbm/aands/page_297.htm + .. [3] Steven G. Johnson, Faddeeva W function implementation. + http://ab-initio.mit.edu/Faddeeva + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-3, 3) + >>> plt.plot(x, special.erf(x)) + >>> plt.xlabel('$x$') + >>> plt.ylabel('$erf(x)$') + >>> plt.show() + + """) + +add_newdoc("erfc", + """ + erfc(x, out=None) + + Complementary error function, ``1 - erf(x)``. + + Parameters + ---------- + x : array_like + Real or complex valued argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the complementary error function + + See Also + -------- + erf, erfi, erfcx, dawsn, wofz + + References + ---------- + .. [1] Steven G. Johnson, Faddeeva W function implementation. + http://ab-initio.mit.edu/Faddeeva + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-3, 3) + >>> plt.plot(x, special.erfc(x)) + >>> plt.xlabel('$x$') + >>> plt.ylabel('$erfc(x)$') + >>> plt.show() + + """) + +add_newdoc("erfi", + """ + erfi(z, out=None) + + Imaginary error function, ``-i erf(i z)``. + + Parameters + ---------- + z : array_like + Real or complex valued argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the imaginary error function + + See Also + -------- + erf, erfc, erfcx, dawsn, wofz + + Notes + ----- + + .. versionadded:: 0.12.0 + + References + ---------- + .. [1] Steven G. Johnson, Faddeeva W function implementation. + http://ab-initio.mit.edu/Faddeeva + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-3, 3) + >>> plt.plot(x, special.erfi(x)) + >>> plt.xlabel('$x$') + >>> plt.ylabel('$erfi(x)$') + >>> plt.show() + + """) + +add_newdoc("erfcx", + """ + erfcx(x, out=None) + + Scaled complementary error function, ``exp(x**2) * erfc(x)``. + + Parameters + ---------- + x : array_like + Real or complex valued argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the scaled complementary error function + + + See Also + -------- + erf, erfc, erfi, dawsn, wofz + + Notes + ----- + + .. versionadded:: 0.12.0 + + References + ---------- + .. [1] Steven G. Johnson, Faddeeva W function implementation. + http://ab-initio.mit.edu/Faddeeva + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-3, 3) + >>> plt.plot(x, special.erfcx(x)) + >>> plt.xlabel('$x$') + >>> plt.ylabel('$erfcx(x)$') + >>> plt.show() + + """) + +add_newdoc( + "erfinv", + """ + erfinv(y, out=None) + + Inverse of the error function. + + Computes the inverse of the error function. + + In the complex domain, there is no unique complex number w satisfying + erf(w)=z. This indicates a true inverse function would be multivalued. + When the domain restricts to the real, -1 < x < 1, there is a unique real + number satisfying erf(erfinv(x)) = x. + + Parameters + ---------- + y : ndarray + Argument at which to evaluate. Domain: [-1, 1] + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + erfinv : scalar or ndarray + The inverse of erf of y, element-wise + + See Also + -------- + erf : Error function of a complex argument + erfc : Complementary error function, ``1 - erf(x)`` + erfcinv : Inverse of the complementary error function + + Examples + -------- + >>> import numpy as np + >>> import matplotlib.pyplot as plt + >>> from scipy.special import erfinv, erf + + >>> erfinv(0.5) + 0.4769362762044699 + + >>> y = np.linspace(-1.0, 1.0, num=9) + >>> x = erfinv(y) + >>> x + array([ -inf, -0.81341985, -0.47693628, -0.22531206, 0. , + 0.22531206, 0.47693628, 0.81341985, inf]) + + Verify that ``erf(erfinv(y))`` is ``y``. + + >>> erf(x) + array([-1. , -0.75, -0.5 , -0.25, 0. , 0.25, 0.5 , 0.75, 1. ]) + + Plot the function: + + >>> y = np.linspace(-1, 1, 200) + >>> fig, ax = plt.subplots() + >>> ax.plot(y, erfinv(y)) + >>> ax.grid(True) + >>> ax.set_xlabel('y') + >>> ax.set_title('erfinv(y)') + >>> plt.show() + + """) + +add_newdoc( + "erfcinv", + """ + erfcinv(y, out=None) + + Inverse of the complementary error function. + + Computes the inverse of the complementary error function. + + In the complex domain, there is no unique complex number w satisfying + erfc(w)=z. This indicates a true inverse function would be multivalued. + When the domain restricts to the real, 0 < x < 2, there is a unique real + number satisfying erfc(erfcinv(x)) = erfcinv(erfc(x)). + + It is related to inverse of the error function by erfcinv(1-x) = erfinv(x) + + Parameters + ---------- + y : ndarray + Argument at which to evaluate. Domain: [0, 2] + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + erfcinv : scalar or ndarray + The inverse of erfc of y, element-wise + + See Also + -------- + erf : Error function of a complex argument + erfc : Complementary error function, ``1 - erf(x)`` + erfinv : Inverse of the error function + + Examples + -------- + >>> import numpy as np + >>> import matplotlib.pyplot as plt + >>> from scipy.special import erfcinv + + >>> erfcinv(0.5) + 0.4769362762044699 + + >>> y = np.linspace(0.0, 2.0, num=11) + >>> erfcinv(y) + array([ inf, 0.9061938 , 0.59511608, 0.37080716, 0.17914345, + -0. , -0.17914345, -0.37080716, -0.59511608, -0.9061938 , + -inf]) + + Plot the function: + + >>> y = np.linspace(0, 2, 200) + >>> fig, ax = plt.subplots() + >>> ax.plot(y, erfcinv(y)) + >>> ax.grid(True) + >>> ax.set_xlabel('y') + >>> ax.set_title('erfcinv(y)') + >>> plt.show() + + """) + +add_newdoc("eval_jacobi", + r""" + eval_jacobi(n, alpha, beta, x, out=None) + + Evaluate Jacobi polynomial at a point. + + The Jacobi polynomials can be defined via the Gauss hypergeometric + function :math:`{}_2F_1` as + + .. math:: + + P_n^{(\alpha, \beta)}(x) = \frac{(\alpha + 1)_n}{\Gamma(n + 1)} + {}_2F_1(-n, 1 + \alpha + \beta + n; \alpha + 1; (1 - z)/2) + + where :math:`(\cdot)_n` is the Pochhammer symbol; see `poch`. When + :math:`n` is an integer the result is a polynomial of degree + :math:`n`. See 22.5.42 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer the result is + determined via the relation to the Gauss hypergeometric + function. + alpha : array_like + Parameter + beta : array_like + Parameter + x : array_like + Points at which to evaluate the polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + P : scalar or ndarray + Values of the Jacobi polynomial + + See Also + -------- + roots_jacobi : roots and quadrature weights of Jacobi polynomials + jacobi : Jacobi polynomial object + hyp2f1 : Gauss hypergeometric function + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_sh_jacobi", + r""" + eval_sh_jacobi(n, p, q, x, out=None) + + Evaluate shifted Jacobi polynomial at a point. + + Defined by + + .. math:: + + G_n^{(p, q)}(x) + = \binom{2n + p - 1}{n}^{-1} P_n^{(p - q, q - 1)}(2x - 1), + + where :math:`P_n^{(\cdot, \cdot)}` is the n-th Jacobi + polynomial. See 22.5.2 in [AS]_ for details. + + Parameters + ---------- + n : int + Degree of the polynomial. If not an integer, the result is + determined via the relation to `binom` and `eval_jacobi`. + p : float + Parameter + q : float + Parameter + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + G : scalar or ndarray + Values of the shifted Jacobi polynomial. + + See Also + -------- + roots_sh_jacobi : roots and quadrature weights of shifted Jacobi + polynomials + sh_jacobi : shifted Jacobi polynomial object + eval_jacobi : evaluate Jacobi polynomials + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_gegenbauer", + r""" + eval_gegenbauer(n, alpha, x, out=None) + + Evaluate Gegenbauer polynomial at a point. + + The Gegenbauer polynomials can be defined via the Gauss + hypergeometric function :math:`{}_2F_1` as + + .. math:: + + C_n^{(\alpha)} = \frac{(2\alpha)_n}{\Gamma(n + 1)} + {}_2F_1(-n, 2\alpha + n; \alpha + 1/2; (1 - z)/2). + + When :math:`n` is an integer the result is a polynomial of degree + :math:`n`. See 22.5.46 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to the Gauss hypergeometric + function. + alpha : array_like + Parameter + x : array_like + Points at which to evaluate the Gegenbauer polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + C : scalar or ndarray + Values of the Gegenbauer polynomial + + See Also + -------- + roots_gegenbauer : roots and quadrature weights of Gegenbauer + polynomials + gegenbauer : Gegenbauer polynomial object + hyp2f1 : Gauss hypergeometric function + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_chebyt", + r""" + eval_chebyt(n, x, out=None) + + Evaluate Chebyshev polynomial of the first kind at a point. + + The Chebyshev polynomials of the first kind can be defined via the + Gauss hypergeometric function :math:`{}_2F_1` as + + .. math:: + + T_n(x) = {}_2F_1(n, -n; 1/2; (1 - x)/2). + + When :math:`n` is an integer the result is a polynomial of degree + :math:`n`. See 22.5.47 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to the Gauss hypergeometric + function. + x : array_like + Points at which to evaluate the Chebyshev polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + T : scalar or ndarray + Values of the Chebyshev polynomial + + See Also + -------- + roots_chebyt : roots and quadrature weights of Chebyshev + polynomials of the first kind + chebyu : Chebychev polynomial object + eval_chebyu : evaluate Chebyshev polynomials of the second kind + hyp2f1 : Gauss hypergeometric function + numpy.polynomial.chebyshev.Chebyshev : Chebyshev series + + Notes + ----- + This routine is numerically stable for `x` in ``[-1, 1]`` at least + up to order ``10000``. + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_chebyu", + r""" + eval_chebyu(n, x, out=None) + + Evaluate Chebyshev polynomial of the second kind at a point. + + The Chebyshev polynomials of the second kind can be defined via + the Gauss hypergeometric function :math:`{}_2F_1` as + + .. math:: + + U_n(x) = (n + 1) {}_2F_1(-n, n + 2; 3/2; (1 - x)/2). + + When :math:`n` is an integer the result is a polynomial of degree + :math:`n`. See 22.5.48 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to the Gauss hypergeometric + function. + x : array_like + Points at which to evaluate the Chebyshev polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + U : scalar or ndarray + Values of the Chebyshev polynomial + + See Also + -------- + roots_chebyu : roots and quadrature weights of Chebyshev + polynomials of the second kind + chebyu : Chebyshev polynomial object + eval_chebyt : evaluate Chebyshev polynomials of the first kind + hyp2f1 : Gauss hypergeometric function + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_chebys", + r""" + eval_chebys(n, x, out=None) + + Evaluate Chebyshev polynomial of the second kind on [-2, 2] at a + point. + + These polynomials are defined as + + .. math:: + + S_n(x) = U_n(x/2) + + where :math:`U_n` is a Chebyshev polynomial of the second + kind. See 22.5.13 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to `eval_chebyu`. + x : array_like + Points at which to evaluate the Chebyshev polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + S : scalar or ndarray + Values of the Chebyshev polynomial + + See Also + -------- + roots_chebys : roots and quadrature weights of Chebyshev + polynomials of the second kind on [-2, 2] + chebys : Chebyshev polynomial object + eval_chebyu : evaluate Chebyshev polynomials of the second kind + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + They are a scaled version of the Chebyshev polynomials of the + second kind. + + >>> x = np.linspace(-2, 2, 6) + >>> sc.eval_chebys(3, x) + array([-4. , 0.672, 0.736, -0.736, -0.672, 4. ]) + >>> sc.eval_chebyu(3, x / 2) + array([-4. , 0.672, 0.736, -0.736, -0.672, 4. ]) + + """) + +add_newdoc("eval_chebyc", + r""" + eval_chebyc(n, x, out=None) + + Evaluate Chebyshev polynomial of the first kind on [-2, 2] at a + point. + + These polynomials are defined as + + .. math:: + + C_n(x) = 2 T_n(x/2) + + where :math:`T_n` is a Chebyshev polynomial of the first kind. See + 22.5.11 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to `eval_chebyt`. + x : array_like + Points at which to evaluate the Chebyshev polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + C : scalar or ndarray + Values of the Chebyshev polynomial + + See Also + -------- + roots_chebyc : roots and quadrature weights of Chebyshev + polynomials of the first kind on [-2, 2] + chebyc : Chebyshev polynomial object + numpy.polynomial.chebyshev.Chebyshev : Chebyshev series + eval_chebyt : evaluate Chebycshev polynomials of the first kind + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + They are a scaled version of the Chebyshev polynomials of the + first kind. + + >>> x = np.linspace(-2, 2, 6) + >>> sc.eval_chebyc(3, x) + array([-2. , 1.872, 1.136, -1.136, -1.872, 2. ]) + >>> 2 * sc.eval_chebyt(3, x / 2) + array([-2. , 1.872, 1.136, -1.136, -1.872, 2. ]) + + """) + +add_newdoc("eval_sh_chebyt", + r""" + eval_sh_chebyt(n, x, out=None) + + Evaluate shifted Chebyshev polynomial of the first kind at a + point. + + These polynomials are defined as + + .. math:: + + T_n^*(x) = T_n(2x - 1) + + where :math:`T_n` is a Chebyshev polynomial of the first kind. See + 22.5.14 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to `eval_chebyt`. + x : array_like + Points at which to evaluate the shifted Chebyshev polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + T : scalar or ndarray + Values of the shifted Chebyshev polynomial + + See Also + -------- + roots_sh_chebyt : roots and quadrature weights of shifted + Chebyshev polynomials of the first kind + sh_chebyt : shifted Chebyshev polynomial object + eval_chebyt : evaluate Chebyshev polynomials of the first kind + numpy.polynomial.chebyshev.Chebyshev : Chebyshev series + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_sh_chebyu", + r""" + eval_sh_chebyu(n, x, out=None) + + Evaluate shifted Chebyshev polynomial of the second kind at a + point. + + These polynomials are defined as + + .. math:: + + U_n^*(x) = U_n(2x - 1) + + where :math:`U_n` is a Chebyshev polynomial of the first kind. See + 22.5.15 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to `eval_chebyu`. + x : array_like + Points at which to evaluate the shifted Chebyshev polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + U : scalar or ndarray + Values of the shifted Chebyshev polynomial + + See Also + -------- + roots_sh_chebyu : roots and quadrature weights of shifted + Chebychev polynomials of the second kind + sh_chebyu : shifted Chebyshev polynomial object + eval_chebyu : evaluate Chebyshev polynomials of the second kind + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_legendre", + r""" + eval_legendre(n, x, out=None) + + Evaluate Legendre polynomial at a point. + + The Legendre polynomials can be defined via the Gauss + hypergeometric function :math:`{}_2F_1` as + + .. math:: + + P_n(x) = {}_2F_1(-n, n + 1; 1; (1 - x)/2). + + When :math:`n` is an integer the result is a polynomial of degree + :math:`n`. See 22.5.49 in [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to the Gauss hypergeometric + function. + x : array_like + Points at which to evaluate the Legendre polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + P : scalar or ndarray + Values of the Legendre polynomial + + See Also + -------- + roots_legendre : roots and quadrature weights of Legendre + polynomials + legendre : Legendre polynomial object + hyp2f1 : Gauss hypergeometric function + numpy.polynomial.legendre.Legendre : Legendre series + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import eval_legendre + + Evaluate the zero-order Legendre polynomial at x = 0 + + >>> eval_legendre(0, 0) + 1.0 + + Evaluate the first-order Legendre polynomial between -1 and 1 + + >>> X = np.linspace(-1, 1, 5) # Domain of Legendre polynomials + >>> eval_legendre(1, X) + array([-1. , -0.5, 0. , 0.5, 1. ]) + + Evaluate Legendre polynomials of order 0 through 4 at x = 0 + + >>> N = range(0, 5) + >>> eval_legendre(N, 0) + array([ 1. , 0. , -0.5 , 0. , 0.375]) + + Plot Legendre polynomials of order 0 through 4 + + >>> X = np.linspace(-1, 1) + + >>> import matplotlib.pyplot as plt + >>> for n in range(0, 5): + ... y = eval_legendre(n, X) + ... plt.plot(X, y, label=r'$P_{}(x)$'.format(n)) + + >>> plt.title("Legendre Polynomials") + >>> plt.xlabel("x") + >>> plt.ylabel(r'$P_n(x)$') + >>> plt.legend(loc='lower right') + >>> plt.show() + + """) + +add_newdoc("eval_sh_legendre", + r""" + eval_sh_legendre(n, x, out=None) + + Evaluate shifted Legendre polynomial at a point. + + These polynomials are defined as + + .. math:: + + P_n^*(x) = P_n(2x - 1) + + where :math:`P_n` is a Legendre polynomial. See 2.2.11 in [AS]_ + for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the value is + determined via the relation to `eval_legendre`. + x : array_like + Points at which to evaluate the shifted Legendre polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + P : scalar or ndarray + Values of the shifted Legendre polynomial + + See Also + -------- + roots_sh_legendre : roots and quadrature weights of shifted + Legendre polynomials + sh_legendre : shifted Legendre polynomial object + eval_legendre : evaluate Legendre polynomials + numpy.polynomial.legendre.Legendre : Legendre series + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_genlaguerre", + r""" + eval_genlaguerre(n, alpha, x, out=None) + + Evaluate generalized Laguerre polynomial at a point. + + The generalized Laguerre polynomials can be defined via the + confluent hypergeometric function :math:`{}_1F_1` as + + .. math:: + + L_n^{(\alpha)}(x) = \binom{n + \alpha}{n} + {}_1F_1(-n, \alpha + 1, x). + + When :math:`n` is an integer the result is a polynomial of degree + :math:`n`. See 22.5.54 in [AS]_ for details. The Laguerre + polynomials are the special case where :math:`\alpha = 0`. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer, the result is + determined via the relation to the confluent hypergeometric + function. + alpha : array_like + Parameter; must have ``alpha > -1`` + x : array_like + Points at which to evaluate the generalized Laguerre + polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + L : scalar or ndarray + Values of the generalized Laguerre polynomial + + See Also + -------- + roots_genlaguerre : roots and quadrature weights of generalized + Laguerre polynomials + genlaguerre : generalized Laguerre polynomial object + hyp1f1 : confluent hypergeometric function + eval_laguerre : evaluate Laguerre polynomials + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_laguerre", + r""" + eval_laguerre(n, x, out=None) + + Evaluate Laguerre polynomial at a point. + + The Laguerre polynomials can be defined via the confluent + hypergeometric function :math:`{}_1F_1` as + + .. math:: + + L_n(x) = {}_1F_1(-n, 1, x). + + See 22.5.16 and 22.5.54 in [AS]_ for details. When :math:`n` is an + integer the result is a polynomial of degree :math:`n`. + + Parameters + ---------- + n : array_like + Degree of the polynomial. If not an integer the result is + determined via the relation to the confluent hypergeometric + function. + x : array_like + Points at which to evaluate the Laguerre polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + L : scalar or ndarray + Values of the Laguerre polynomial + + See Also + -------- + roots_laguerre : roots and quadrature weights of Laguerre + polynomials + laguerre : Laguerre polynomial object + numpy.polynomial.laguerre.Laguerre : Laguerre series + eval_genlaguerre : evaluate generalized Laguerre polynomials + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_hermite", + r""" + eval_hermite(n, x, out=None) + + Evaluate physicist's Hermite polynomial at a point. + + Defined by + + .. math:: + + H_n(x) = (-1)^n e^{x^2} \frac{d^n}{dx^n} e^{-x^2}; + + :math:`H_n` is a polynomial of degree :math:`n`. See 22.11.7 in + [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial + x : array_like + Points at which to evaluate the Hermite polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + H : scalar or ndarray + Values of the Hermite polynomial + + See Also + -------- + roots_hermite : roots and quadrature weights of physicist's + Hermite polynomials + hermite : physicist's Hermite polynomial object + numpy.polynomial.hermite.Hermite : Physicist's Hermite series + eval_hermitenorm : evaluate Probabilist's Hermite polynomials + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("eval_hermitenorm", + r""" + eval_hermitenorm(n, x, out=None) + + Evaluate probabilist's (normalized) Hermite polynomial at a + point. + + Defined by + + .. math:: + + He_n(x) = (-1)^n e^{x^2/2} \frac{d^n}{dx^n} e^{-x^2/2}; + + :math:`He_n` is a polynomial of degree :math:`n`. See 22.11.8 in + [AS]_ for details. + + Parameters + ---------- + n : array_like + Degree of the polynomial + x : array_like + Points at which to evaluate the Hermite polynomial + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + He : scalar or ndarray + Values of the Hermite polynomial + + See Also + -------- + roots_hermitenorm : roots and quadrature weights of probabilist's + Hermite polynomials + hermitenorm : probabilist's Hermite polynomial object + numpy.polynomial.hermite_e.HermiteE : Probabilist's Hermite series + eval_hermite : evaluate physicist's Hermite polynomials + + References + ---------- + .. [AS] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + """) + +add_newdoc("exp1", + r""" + exp1(z, out=None) + + Exponential integral E1. + + For complex :math:`z \ne 0` the exponential integral can be defined as + [1]_ + + .. math:: + + E_1(z) = \int_z^\infty \frac{e^{-t}}{t} dt, + + where the path of the integral does not cross the negative real + axis or pass through the origin. + + Parameters + ---------- + z: array_like + Real or complex argument. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the exponential integral E1 + + See Also + -------- + expi : exponential integral :math:`Ei` + expn : generalization of :math:`E_1` + + Notes + ----- + For :math:`x > 0` it is related to the exponential integral + :math:`Ei` (see `expi`) via the relation + + .. math:: + + E_1(x) = -Ei(-x). + + References + ---------- + .. [1] Digital Library of Mathematical Functions, 6.2.1 + https://dlmf.nist.gov/6.2#E1 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It has a pole at 0. + + >>> sc.exp1(0) + inf + + It has a branch cut on the negative real axis. + + >>> sc.exp1(-1) + nan + >>> sc.exp1(complex(-1, 0)) + (-1.8951178163559368-3.141592653589793j) + >>> sc.exp1(complex(-1, -0.0)) + (-1.8951178163559368+3.141592653589793j) + + It approaches 0 along the positive real axis. + + >>> sc.exp1([1, 10, 100, 1000]) + array([2.19383934e-01, 4.15696893e-06, 3.68359776e-46, 0.00000000e+00]) + + It is related to `expi`. + + >>> x = np.array([1, 2, 3, 4]) + >>> sc.exp1(x) + array([0.21938393, 0.04890051, 0.01304838, 0.00377935]) + >>> -sc.expi(-x) + array([0.21938393, 0.04890051, 0.01304838, 0.00377935]) + + """) + + +add_newdoc( + "_scaled_exp1", + """ + _scaled_exp1(x, out=None): + + Compute the scaled exponential integral. + + This is a private function, subject to change or removal with no + deprecation. + + This function computes F(x), where F is the factor remaining in E_1(x) + when exp(-x)/x is factored out. That is,:: + + E_1(x) = exp(-x)/x * F(x) + + or + + F(x) = x * exp(x) * E_1(x) + + The function is defined for real x >= 0. For x < 0, nan is returned. + + F has the properties: + + * F(0) = 0 + * F(x) is increasing on [0, inf). + * The limit as x goes to infinity of F(x) is 1. + + Parameters + ---------- + x: array_like + The input values. Must be real. The implementation is limited to + double precision floating point, so other types will be cast to + to double precision. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the scaled exponential integral. + + See Also + -------- + exp1 : exponential integral E_1 + + Examples + -------- + >>> from scipy.special import _scaled_exp1 + >>> _scaled_exp1([0, 0.1, 1, 10, 100]) + + """ +) + + +add_newdoc("exp10", + """ + exp10(x, out=None) + + Compute ``10**x`` element-wise. + + Parameters + ---------- + x : array_like + `x` must contain real numbers. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + ``10**x``, computed element-wise. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import exp10 + + >>> exp10(3) + 1000.0 + >>> x = np.array([[-1, -0.5, 0], [0.5, 1, 1.5]]) + >>> exp10(x) + array([[ 0.1 , 0.31622777, 1. ], + [ 3.16227766, 10. , 31.6227766 ]]) + + """) + +add_newdoc("exp2", + """ + exp2(x, out=None) + + Compute ``2**x`` element-wise. + + Parameters + ---------- + x : array_like + `x` must contain real numbers. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + ``2**x``, computed element-wise. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import exp2 + + >>> exp2(3) + 8.0 + >>> x = np.array([[-1, -0.5, 0], [0.5, 1, 1.5]]) + >>> exp2(x) + array([[ 0.5 , 0.70710678, 1. ], + [ 1.41421356, 2. , 2.82842712]]) + """) + +add_newdoc("expi", + r""" + expi(x, out=None) + + Exponential integral Ei. + + For real :math:`x`, the exponential integral is defined as [1]_ + + .. math:: + + Ei(x) = \int_{-\infty}^x \frac{e^t}{t} dt. + + For :math:`x > 0` the integral is understood as a Cauchy principal + value. + + It is extended to the complex plane by analytic continuation of + the function on the interval :math:`(0, \infty)`. The complex + variant has a branch cut on the negative real axis. + + Parameters + ---------- + x : array_like + Real or complex valued argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the exponential integral + + See Also + -------- + exp1 : Exponential integral :math:`E_1` + expn : Generalized exponential integral :math:`E_n` + + Notes + ----- + The exponential integrals :math:`E_1` and :math:`Ei` satisfy the + relation + + .. math:: + + E_1(x) = -Ei(-x) + + for :math:`x > 0`. + + References + ---------- + .. [1] Digital Library of Mathematical Functions, 6.2.5 + https://dlmf.nist.gov/6.2#E5 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is related to `exp1`. + + >>> x = np.array([1, 2, 3, 4]) + >>> -sc.expi(-x) + array([0.21938393, 0.04890051, 0.01304838, 0.00377935]) + >>> sc.exp1(x) + array([0.21938393, 0.04890051, 0.01304838, 0.00377935]) + + The complex variant has a branch cut on the negative real axis. + + >>> sc.expi(-1 + 1e-12j) + (-0.21938393439552062+3.1415926535894254j) + >>> sc.expi(-1 - 1e-12j) + (-0.21938393439552062-3.1415926535894254j) + + As the complex variant approaches the branch cut, the real parts + approach the value of the real variant. + + >>> sc.expi(-1) + -0.21938393439552062 + + The SciPy implementation returns the real variant for complex + values on the branch cut. + + >>> sc.expi(complex(-1, 0.0)) + (-0.21938393439552062-0j) + >>> sc.expi(complex(-1, -0.0)) + (-0.21938393439552062-0j) + + """) + +add_newdoc('expit', + """ + expit(x, out=None) + + Expit (a.k.a. logistic sigmoid) ufunc for ndarrays. + + The expit function, also known as the logistic sigmoid function, is + defined as ``expit(x) = 1/(1+exp(-x))``. It is the inverse of the + logit function. + + Parameters + ---------- + x : ndarray + The ndarray to apply expit to element-wise. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + An ndarray of the same shape as x. Its entries + are `expit` of the corresponding entry of x. + + See Also + -------- + logit + + Notes + ----- + As a ufunc expit takes a number of optional + keyword arguments. For more information + see `ufuncs `_ + + .. versionadded:: 0.10.0 + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import expit, logit + + >>> expit([-np.inf, -1.5, 0, 1.5, np.inf]) + array([ 0. , 0.18242552, 0.5 , 0.81757448, 1. ]) + + `logit` is the inverse of `expit`: + + >>> logit(expit([-2.5, 0, 3.1, 5.0])) + array([-2.5, 0. , 3.1, 5. ]) + + Plot expit(x) for x in [-6, 6]: + + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-6, 6, 121) + >>> y = expit(x) + >>> plt.plot(x, y) + >>> plt.grid() + >>> plt.xlim(-6, 6) + >>> plt.xlabel('x') + >>> plt.title('expit(x)') + >>> plt.show() + + """) + +add_newdoc("expm1", + """ + expm1(x, out=None) + + Compute ``exp(x) - 1``. + + When `x` is near zero, ``exp(x)`` is near 1, so the numerical calculation + of ``exp(x) - 1`` can suffer from catastrophic loss of precision. + ``expm1(x)`` is implemented to avoid the loss of precision that occurs when + `x` is near zero. + + Parameters + ---------- + x : array_like + `x` must contain real numbers. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + ``exp(x) - 1`` computed element-wise. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import expm1 + + >>> expm1(1.0) + 1.7182818284590451 + >>> expm1([-0.2, -0.1, 0, 0.1, 0.2]) + array([-0.18126925, -0.09516258, 0. , 0.10517092, 0.22140276]) + + The exact value of ``exp(7.5e-13) - 1`` is:: + + 7.5000000000028125000000007031250000001318...*10**-13. + + Here is what ``expm1(7.5e-13)`` gives: + + >>> expm1(7.5e-13) + 7.5000000000028135e-13 + + Compare that to ``exp(7.5e-13) - 1``, where the subtraction results in + a "catastrophic" loss of precision: + + >>> np.exp(7.5e-13) - 1 + 7.5006667543675576e-13 + + """) + +add_newdoc("expn", + r""" + expn(n, x, out=None) + + Generalized exponential integral En. + + For integer :math:`n \geq 0` and real :math:`x \geq 0` the + generalized exponential integral is defined as [dlmf]_ + + .. math:: + + E_n(x) = x^{n - 1} \int_x^\infty \frac{e^{-t}}{t^n} dt. + + Parameters + ---------- + n : array_like + Non-negative integers + x : array_like + Real argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the generalized exponential integral + + See Also + -------- + exp1 : special case of :math:`E_n` for :math:`n = 1` + expi : related to :math:`E_n` when :math:`n = 1` + + References + ---------- + .. [dlmf] Digital Library of Mathematical Functions, 8.19.2 + https://dlmf.nist.gov/8.19#E2 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + Its domain is nonnegative n and x. + + >>> sc.expn(-1, 1.0), sc.expn(1, -1.0) + (nan, nan) + + It has a pole at ``x = 0`` for ``n = 1, 2``; for larger ``n`` it + is equal to ``1 / (n - 1)``. + + >>> sc.expn([0, 1, 2, 3, 4], 0) + array([ inf, inf, 1. , 0.5 , 0.33333333]) + + For n equal to 0 it reduces to ``exp(-x) / x``. + + >>> x = np.array([1, 2, 3, 4]) + >>> sc.expn(0, x) + array([0.36787944, 0.06766764, 0.01659569, 0.00457891]) + >>> np.exp(-x) / x + array([0.36787944, 0.06766764, 0.01659569, 0.00457891]) + + For n equal to 1 it reduces to `exp1`. + + >>> sc.expn(1, x) + array([0.21938393, 0.04890051, 0.01304838, 0.00377935]) + >>> sc.exp1(x) + array([0.21938393, 0.04890051, 0.01304838, 0.00377935]) + + """) + +add_newdoc("exprel", + r""" + exprel(x, out=None) + + Relative error exponential, ``(exp(x) - 1)/x``. + + When `x` is near zero, ``exp(x)`` is near 1, so the numerical calculation + of ``exp(x) - 1`` can suffer from catastrophic loss of precision. + ``exprel(x)`` is implemented to avoid the loss of precision that occurs when + `x` is near zero. + + Parameters + ---------- + x : ndarray + Input array. `x` must contain real numbers. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + ``(exp(x) - 1)/x``, computed element-wise. + + See Also + -------- + expm1 + + Notes + ----- + .. versionadded:: 0.17.0 + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import exprel + + >>> exprel(0.01) + 1.0050167084168056 + >>> exprel([-0.25, -0.1, 0, 0.1, 0.25]) + array([ 0.88479687, 0.95162582, 1. , 1.05170918, 1.13610167]) + + Compare ``exprel(5e-9)`` to the naive calculation. The exact value + is ``1.00000000250000000416...``. + + >>> exprel(5e-9) + 1.0000000025 + + >>> (np.exp(5e-9) - 1)/5e-9 + 0.99999999392252903 + """) + +add_newdoc("fdtr", + r""" + fdtr(dfn, dfd, x, out=None) + + F cumulative distribution function. + + Returns the value of the cumulative distribution function of the + F-distribution, also known as Snedecor's F-distribution or the + Fisher-Snedecor distribution. + + The F-distribution with parameters :math:`d_n` and :math:`d_d` is the + distribution of the random variable, + + .. math:: + X = \frac{U_n/d_n}{U_d/d_d}, + + where :math:`U_n` and :math:`U_d` are random variables distributed + :math:`\chi^2`, with :math:`d_n` and :math:`d_d` degrees of freedom, + respectively. + + Parameters + ---------- + dfn : array_like + First parameter (positive float). + dfd : array_like + Second parameter (positive float). + x : array_like + Argument (nonnegative float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y : scalar or ndarray + The CDF of the F-distribution with parameters `dfn` and `dfd` at `x`. + + See Also + -------- + fdtrc : F distribution survival function + fdtri : F distribution inverse cumulative distribution + scipy.stats.f : F distribution + + Notes + ----- + The regularized incomplete beta function is used, according to the + formula, + + .. math:: + F(d_n, d_d; x) = I_{xd_n/(d_d + xd_n)}(d_n/2, d_d/2). + + Wrapper for the Cephes [1]_ routine `fdtr`. The F distribution is also + available as `scipy.stats.f`. Calling `fdtr` directly can improve + performance compared to the ``cdf`` method of `scipy.stats.f` (see last + example below). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function for ``dfn=1`` and ``dfd=2`` at ``x=1``. + + >>> import numpy as np + >>> from scipy.special import fdtr + >>> fdtr(1, 2, 1) + 0.5773502691896258 + + Calculate the function at several points by providing a NumPy array for + `x`. + + >>> x = np.array([0.5, 2., 3.]) + >>> fdtr(1, 2, x) + array([0.4472136 , 0.70710678, 0.77459667]) + + Plot the function for several parameter sets. + + >>> import matplotlib.pyplot as plt + >>> dfn_parameters = [1, 5, 10, 50] + >>> dfd_parameters = [1, 1, 2, 3] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(dfn_parameters, dfd_parameters, + ... linestyles)) + >>> x = np.linspace(0, 30, 1000) + >>> fig, ax = plt.subplots() + >>> for parameter_set in parameters_list: + ... dfn, dfd, style = parameter_set + ... fdtr_vals = fdtr(dfn, dfd, x) + ... ax.plot(x, fdtr_vals, label=rf"$d_n={dfn},\, d_d={dfd}$", + ... ls=style) + >>> ax.legend() + >>> ax.set_xlabel("$x$") + >>> ax.set_title("F distribution cumulative distribution function") + >>> plt.show() + + The F distribution is also available as `scipy.stats.f`. Using `fdtr` + directly can be much faster than calling the ``cdf`` method of + `scipy.stats.f`, especially for small arrays or individual values. + To get the same results one must use the following parametrization: + ``stats.f(dfn, dfd).cdf(x)=fdtr(dfn, dfd, x)``. + + >>> from scipy.stats import f + >>> dfn, dfd = 1, 2 + >>> x = 1 + >>> fdtr_res = fdtr(dfn, dfd, x) # this will often be faster than below + >>> f_dist_res = f(dfn, dfd).cdf(x) + >>> fdtr_res == f_dist_res # test that results are equal + True + """) + +add_newdoc("fdtrc", + r""" + fdtrc(dfn, dfd, x, out=None) + + F survival function. + + Returns the complemented F-distribution function (the integral of the + density from `x` to infinity). + + Parameters + ---------- + dfn : array_like + First parameter (positive float). + dfd : array_like + Second parameter (positive float). + x : array_like + Argument (nonnegative float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + y : scalar or ndarray + The complemented F-distribution function with parameters `dfn` and + `dfd` at `x`. + + See Also + -------- + fdtr : F distribution cumulative distribution function + fdtri : F distribution inverse cumulative distribution function + scipy.stats.f : F distribution + + Notes + ----- + The regularized incomplete beta function is used, according to the + formula, + + .. math:: + F(d_n, d_d; x) = I_{d_d/(d_d + xd_n)}(d_d/2, d_n/2). + + Wrapper for the Cephes [1]_ routine `fdtrc`. The F distribution is also + available as `scipy.stats.f`. Calling `fdtrc` directly can improve + performance compared to the ``sf`` method of `scipy.stats.f` (see last + example below). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function for ``dfn=1`` and ``dfd=2`` at ``x=1``. + + >>> import numpy as np + >>> from scipy.special import fdtrc + >>> fdtrc(1, 2, 1) + 0.42264973081037427 + + Calculate the function at several points by providing a NumPy array for + `x`. + + >>> x = np.array([0.5, 2., 3.]) + >>> fdtrc(1, 2, x) + array([0.5527864 , 0.29289322, 0.22540333]) + + Plot the function for several parameter sets. + + >>> import matplotlib.pyplot as plt + >>> dfn_parameters = [1, 5, 10, 50] + >>> dfd_parameters = [1, 1, 2, 3] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(dfn_parameters, dfd_parameters, + ... linestyles)) + >>> x = np.linspace(0, 30, 1000) + >>> fig, ax = plt.subplots() + >>> for parameter_set in parameters_list: + ... dfn, dfd, style = parameter_set + ... fdtrc_vals = fdtrc(dfn, dfd, x) + ... ax.plot(x, fdtrc_vals, label=rf"$d_n={dfn},\, d_d={dfd}$", + ... ls=style) + >>> ax.legend() + >>> ax.set_xlabel("$x$") + >>> ax.set_title("F distribution survival function") + >>> plt.show() + + The F distribution is also available as `scipy.stats.f`. Using `fdtrc` + directly can be much faster than calling the ``sf`` method of + `scipy.stats.f`, especially for small arrays or individual values. + To get the same results one must use the following parametrization: + ``stats.f(dfn, dfd).sf(x)=fdtrc(dfn, dfd, x)``. + + >>> from scipy.stats import f + >>> dfn, dfd = 1, 2 + >>> x = 1 + >>> fdtrc_res = fdtrc(dfn, dfd, x) # this will often be faster than below + >>> f_dist_res = f(dfn, dfd).sf(x) + >>> f_dist_res == fdtrc_res # test that results are equal + True + """) + +add_newdoc("fdtri", + r""" + fdtri(dfn, dfd, p, out=None) + + The `p`-th quantile of the F-distribution. + + This function is the inverse of the F-distribution CDF, `fdtr`, returning + the `x` such that `fdtr(dfn, dfd, x) = p`. + + Parameters + ---------- + dfn : array_like + First parameter (positive float). + dfd : array_like + Second parameter (positive float). + p : array_like + Cumulative probability, in [0, 1]. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + x : scalar or ndarray + The quantile corresponding to `p`. + + See Also + -------- + fdtr : F distribution cumulative distribution function + fdtrc : F distribution survival function + scipy.stats.f : F distribution + + Notes + ----- + The computation is carried out using the relation to the inverse + regularized beta function, :math:`I^{-1}_x(a, b)`. Let + :math:`z = I^{-1}_p(d_d/2, d_n/2).` Then, + + .. math:: + x = \frac{d_d (1 - z)}{d_n z}. + + If `p` is such that :math:`x < 0.5`, the following relation is used + instead for improved stability: let + :math:`z' = I^{-1}_{1 - p}(d_n/2, d_d/2).` Then, + + .. math:: + x = \frac{d_d z'}{d_n (1 - z')}. + + Wrapper for the Cephes [1]_ routine `fdtri`. + + The F distribution is also available as `scipy.stats.f`. Calling + `fdtri` directly can improve performance compared to the ``ppf`` + method of `scipy.stats.f` (see last example below). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + `fdtri` represents the inverse of the F distribution CDF which is + available as `fdtr`. Here, we calculate the CDF for ``df1=1``, ``df2=2`` + at ``x=3``. `fdtri` then returns ``3`` given the same values for `df1`, + `df2` and the computed CDF value. + + >>> import numpy as np + >>> from scipy.special import fdtri, fdtr + >>> df1, df2 = 1, 2 + >>> x = 3 + >>> cdf_value = fdtr(df1, df2, x) + >>> fdtri(df1, df2, cdf_value) + 3.000000000000006 + + Calculate the function at several points by providing a NumPy array for + `x`. + + >>> x = np.array([0.1, 0.4, 0.7]) + >>> fdtri(1, 2, x) + array([0.02020202, 0.38095238, 1.92156863]) + + Plot the function for several parameter sets. + + >>> import matplotlib.pyplot as plt + >>> dfn_parameters = [50, 10, 1, 50] + >>> dfd_parameters = [0.5, 1, 1, 5] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(dfn_parameters, dfd_parameters, + ... linestyles)) + >>> x = np.linspace(0, 1, 1000) + >>> fig, ax = plt.subplots() + >>> for parameter_set in parameters_list: + ... dfn, dfd, style = parameter_set + ... fdtri_vals = fdtri(dfn, dfd, x) + ... ax.plot(x, fdtri_vals, label=rf"$d_n={dfn},\, d_d={dfd}$", + ... ls=style) + >>> ax.legend() + >>> ax.set_xlabel("$x$") + >>> title = "F distribution inverse cumulative distribution function" + >>> ax.set_title(title) + >>> ax.set_ylim(0, 30) + >>> plt.show() + + The F distribution is also available as `scipy.stats.f`. Using `fdtri` + directly can be much faster than calling the ``ppf`` method of + `scipy.stats.f`, especially for small arrays or individual values. + To get the same results one must use the following parametrization: + ``stats.f(dfn, dfd).ppf(x)=fdtri(dfn, dfd, x)``. + + >>> from scipy.stats import f + >>> dfn, dfd = 1, 2 + >>> x = 0.7 + >>> fdtri_res = fdtri(dfn, dfd, x) # this will often be faster than below + >>> f_dist_res = f(dfn, dfd).ppf(x) + >>> f_dist_res == fdtri_res # test that results are equal + True + """) + +add_newdoc("fdtridfd", + """ + fdtridfd(dfn, p, x, out=None) + + Inverse to `fdtr` vs dfd + + Finds the F density argument dfd such that ``fdtr(dfn, dfd, x) == p``. + + Parameters + ---------- + dfn : array_like + First parameter (positive float). + p : array_like + Cumulative probability, in [0, 1]. + x : array_like + Argument (nonnegative float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + dfd : scalar or ndarray + `dfd` such that ``fdtr(dfn, dfd, x) == p``. + + See Also + -------- + fdtr : F distribution cumulative distribution function + fdtrc : F distribution survival function + fdtri : F distribution quantile function + scipy.stats.f : F distribution + + Examples + -------- + Compute the F distribution cumulative distribution function for one + parameter set. + + >>> from scipy.special import fdtridfd, fdtr + >>> dfn, dfd, x = 10, 5, 2 + >>> cdf_value = fdtr(dfn, dfd, x) + >>> cdf_value + 0.7700248806501017 + + Verify that `fdtridfd` recovers the original value for `dfd`: + + >>> fdtridfd(dfn, cdf_value, x) + 5.0 + """) + +''' +commented out as fdtridfn seems to have bugs and is not in functions.json +see: https://github.com/scipy/scipy/pull/15622#discussion_r811440983 + +add_newdoc( + "fdtridfn", + """ + fdtridfn(p, dfd, x, out=None) + + Inverse to `fdtr` vs dfn + + finds the F density argument dfn such that ``fdtr(dfn, dfd, x) == p``. + + + Parameters + ---------- + p : array_like + Cumulative probability, in [0, 1]. + dfd : array_like + Second parameter (positive float). + x : array_like + Argument (nonnegative float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + dfn : scalar or ndarray + `dfn` such that ``fdtr(dfn, dfd, x) == p``. + + See Also + -------- + fdtr, fdtrc, fdtri, fdtridfd + + + """) +''' + +add_newdoc("fresnel", + r""" + fresnel(z, out=None) + + Fresnel integrals. + + The Fresnel integrals are defined as + + .. math:: + + S(z) &= \int_0^z \sin(\pi t^2 /2) dt \\ + C(z) &= \int_0^z \cos(\pi t^2 /2) dt. + + See [dlmf]_ for details. + + Parameters + ---------- + z : array_like + Real or complex valued argument + out : 2-tuple of ndarrays, optional + Optional output arrays for the function results + + Returns + ------- + S, C : 2-tuple of scalar or ndarray + Values of the Fresnel integrals + + See Also + -------- + fresnel_zeros : zeros of the Fresnel integrals + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/7.2#iii + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + As z goes to infinity along the real axis, S and C converge to 0.5. + + >>> S, C = sc.fresnel([0.1, 1, 10, 100, np.inf]) + >>> S + array([0.00052359, 0.43825915, 0.46816998, 0.4968169 , 0.5 ]) + >>> C + array([0.09999753, 0.7798934 , 0.49989869, 0.4999999 , 0.5 ]) + + They are related to the error function `erf`. + + >>> z = np.array([1, 2, 3, 4]) + >>> zeta = 0.5 * np.sqrt(np.pi) * (1 - 1j) * z + >>> S, C = sc.fresnel(z) + >>> C + 1j*S + array([0.7798934 +0.43825915j, 0.48825341+0.34341568j, + 0.60572079+0.496313j , 0.49842603+0.42051575j]) + >>> 0.5 * (1 + 1j) * sc.erf(zeta) + array([0.7798934 +0.43825915j, 0.48825341+0.34341568j, + 0.60572079+0.496313j , 0.49842603+0.42051575j]) + + """) + +add_newdoc("gamma", + r""" + gamma(z, out=None) + + gamma function. + + The gamma function is defined as + + .. math:: + + \Gamma(z) = \int_0^\infty t^{z-1} e^{-t} dt + + for :math:`\Re(z) > 0` and is extended to the rest of the complex + plane by analytic continuation. See [dlmf]_ for more details. + + Parameters + ---------- + z : array_like + Real or complex valued argument + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the gamma function + + Notes + ----- + The gamma function is often referred to as the generalized + factorial since :math:`\Gamma(n + 1) = n!` for natural numbers + :math:`n`. More generally it satisfies the recurrence relation + :math:`\Gamma(z + 1) = z \cdot \Gamma(z)` for complex :math:`z`, + which, combined with the fact that :math:`\Gamma(1) = 1`, implies + the above identity for :math:`z = n`. + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/5.2#E1 + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import gamma, factorial + + >>> gamma([0, 0.5, 1, 5]) + array([ inf, 1.77245385, 1. , 24. ]) + + >>> z = 2.5 + 1j + >>> gamma(z) + (0.77476210455108352+0.70763120437959293j) + >>> gamma(z+1), z*gamma(z) # Recurrence property + ((1.2292740569981171+2.5438401155000685j), + (1.2292740569981158+2.5438401155000658j)) + + >>> gamma(0.5)**2 # gamma(0.5) = sqrt(pi) + 3.1415926535897927 + + Plot gamma(x) for real x + + >>> x = np.linspace(-3.5, 5.5, 2251) + >>> y = gamma(x) + + >>> import matplotlib.pyplot as plt + >>> plt.plot(x, y, 'b', alpha=0.6, label='gamma(x)') + >>> k = np.arange(1, 7) + >>> plt.plot(k, factorial(k-1), 'k*', alpha=0.6, + ... label='(x-1)!, x = 1, 2, ...') + >>> plt.xlim(-3.5, 5.5) + >>> plt.ylim(-10, 25) + >>> plt.grid() + >>> plt.xlabel('x') + >>> plt.legend(loc='lower right') + >>> plt.show() + + """) + +add_newdoc("gammainc", + r""" + gammainc(a, x, out=None) + + Regularized lower incomplete gamma function. + + It is defined as + + .. math:: + + P(a, x) = \frac{1}{\Gamma(a)} \int_0^x t^{a - 1}e^{-t} dt + + for :math:`a > 0` and :math:`x \geq 0`. See [dlmf]_ for details. + + Parameters + ---------- + a : array_like + Positive parameter + x : array_like + Nonnegative argument + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the lower incomplete gamma function + + See Also + -------- + gammaincc : regularized upper incomplete gamma function + gammaincinv : inverse of the regularized lower incomplete gamma function + gammainccinv : inverse of the regularized upper incomplete gamma function + + Notes + ----- + The function satisfies the relation ``gammainc(a, x) + + gammaincc(a, x) = 1`` where `gammaincc` is the regularized upper + incomplete gamma function. + + The implementation largely follows that of [boost]_. + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical functions + https://dlmf.nist.gov/8.2#E4 + .. [boost] Maddock et. al., "Incomplete Gamma Functions", + https://www.boost.org/doc/libs/1_61_0/libs/math/doc/html/math_toolkit/sf_gamma/igamma.html + + Examples + -------- + >>> import scipy.special as sc + + It is the CDF of the gamma distribution, so it starts at 0 and + monotonically increases to 1. + + >>> sc.gammainc(0.5, [0, 1, 10, 100]) + array([0. , 0.84270079, 0.99999226, 1. ]) + + It is equal to one minus the upper incomplete gamma function. + + >>> a, x = 0.5, 0.4 + >>> sc.gammainc(a, x) + 0.6289066304773024 + >>> 1 - sc.gammaincc(a, x) + 0.6289066304773024 + + """) + +add_newdoc("gammaincc", + r""" + gammaincc(a, x, out=None) + + Regularized upper incomplete gamma function. + + It is defined as + + .. math:: + + Q(a, x) = \frac{1}{\Gamma(a)} \int_x^\infty t^{a - 1}e^{-t} dt + + for :math:`a > 0` and :math:`x \geq 0`. See [dlmf]_ for details. + + Parameters + ---------- + a : array_like + Positive parameter + x : array_like + Nonnegative argument + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the upper incomplete gamma function + + See Also + -------- + gammainc : regularized lower incomplete gamma function + gammaincinv : inverse of the regularized lower incomplete gamma function + gammainccinv : inverse of the regularized upper incomplete gamma function + + Notes + ----- + The function satisfies the relation ``gammainc(a, x) + + gammaincc(a, x) = 1`` where `gammainc` is the regularized lower + incomplete gamma function. + + The implementation largely follows that of [boost]_. + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical functions + https://dlmf.nist.gov/8.2#E4 + .. [boost] Maddock et. al., "Incomplete Gamma Functions", + https://www.boost.org/doc/libs/1_61_0/libs/math/doc/html/math_toolkit/sf_gamma/igamma.html + + Examples + -------- + >>> import scipy.special as sc + + It is the survival function of the gamma distribution, so it + starts at 1 and monotonically decreases to 0. + + >>> sc.gammaincc(0.5, [0, 1, 10, 100, 1000]) + array([1.00000000e+00, 1.57299207e-01, 7.74421643e-06, 2.08848758e-45, + 0.00000000e+00]) + + It is equal to one minus the lower incomplete gamma function. + + >>> a, x = 0.5, 0.4 + >>> sc.gammaincc(a, x) + 0.37109336952269756 + >>> 1 - sc.gammainc(a, x) + 0.37109336952269756 + + """) + +add_newdoc("gammainccinv", + """ + gammainccinv(a, y, out=None) + + Inverse of the regularized upper incomplete gamma function. + + Given an input :math:`y` between 0 and 1, returns :math:`x` such + that :math:`y = Q(a, x)`. Here :math:`Q` is the regularized upper + incomplete gamma function; see `gammaincc`. This is well-defined + because the upper incomplete gamma function is monotonic as can + be seen from its definition in [dlmf]_. + + Parameters + ---------- + a : array_like + Positive parameter + y : array_like + Argument between 0 and 1, inclusive + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the inverse of the upper incomplete gamma function + + See Also + -------- + gammaincc : regularized upper incomplete gamma function + gammainc : regularized lower incomplete gamma function + gammaincinv : inverse of the regularized lower incomplete gamma function + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/8.2#E4 + + Examples + -------- + >>> import scipy.special as sc + + It starts at infinity and monotonically decreases to 0. + + >>> sc.gammainccinv(0.5, [0, 0.1, 0.5, 1]) + array([ inf, 1.35277173, 0.22746821, 0. ]) + + It inverts the upper incomplete gamma function. + + >>> a, x = 0.5, [0, 0.1, 0.5, 1] + >>> sc.gammaincc(a, sc.gammainccinv(a, x)) + array([0. , 0.1, 0.5, 1. ]) + + >>> a, x = 0.5, [0, 10, 50] + >>> sc.gammainccinv(a, sc.gammaincc(a, x)) + array([ 0., 10., 50.]) + + """) + +add_newdoc("gammaincinv", + """ + gammaincinv(a, y, out=None) + + Inverse to the regularized lower incomplete gamma function. + + Given an input :math:`y` between 0 and 1, returns :math:`x` such + that :math:`y = P(a, x)`. Here :math:`P` is the regularized lower + incomplete gamma function; see `gammainc`. This is well-defined + because the lower incomplete gamma function is monotonic as can be + seen from its definition in [dlmf]_. + + Parameters + ---------- + a : array_like + Positive parameter + y : array_like + Parameter between 0 and 1, inclusive + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the inverse of the lower incomplete gamma function + + See Also + -------- + gammainc : regularized lower incomplete gamma function + gammaincc : regularized upper incomplete gamma function + gammainccinv : inverse of the regularized upper incomplete gamma function + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/8.2#E4 + + Examples + -------- + >>> import scipy.special as sc + + It starts at 0 and monotonically increases to infinity. + + >>> sc.gammaincinv(0.5, [0, 0.1 ,0.5, 1]) + array([0. , 0.00789539, 0.22746821, inf]) + + It inverts the lower incomplete gamma function. + + >>> a, x = 0.5, [0, 0.1, 0.5, 1] + >>> sc.gammainc(a, sc.gammaincinv(a, x)) + array([0. , 0.1, 0.5, 1. ]) + + >>> a, x = 0.5, [0, 10, 25] + >>> sc.gammaincinv(a, sc.gammainc(a, x)) + array([ 0. , 10. , 25.00001465]) + + """) + +add_newdoc("gammaln", + r""" + gammaln(x, out=None) + + Logarithm of the absolute value of the gamma function. + + Defined as + + .. math:: + + \ln(\lvert\Gamma(x)\rvert) + + where :math:`\Gamma` is the gamma function. For more details on + the gamma function, see [dlmf]_. + + Parameters + ---------- + x : array_like + Real argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the log of the absolute value of gamma + + See Also + -------- + gammasgn : sign of the gamma function + loggamma : principal branch of the logarithm of the gamma function + + Notes + ----- + It is the same function as the Python standard library function + :func:`math.lgamma`. + + When used in conjunction with `gammasgn`, this function is useful + for working in logspace on the real axis without having to deal + with complex numbers via the relation ``exp(gammaln(x)) = + gammasgn(x) * gamma(x)``. + + For complex-valued log-gamma, use `loggamma` instead of `gammaln`. + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/5 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It has two positive zeros. + + >>> sc.gammaln([1, 2]) + array([0., 0.]) + + It has poles at nonpositive integers. + + >>> sc.gammaln([0, -1, -2, -3, -4]) + array([inf, inf, inf, inf, inf]) + + It asymptotically approaches ``x * log(x)`` (Stirling's formula). + + >>> x = np.array([1e10, 1e20, 1e40, 1e80]) + >>> sc.gammaln(x) + array([2.20258509e+11, 4.50517019e+21, 9.11034037e+41, 1.83206807e+82]) + >>> x * np.log(x) + array([2.30258509e+11, 4.60517019e+21, 9.21034037e+41, 1.84206807e+82]) + + """) + +add_newdoc("gammasgn", + r""" + gammasgn(x, out=None) + + Sign of the gamma function. + + It is defined as + + .. math:: + + \text{gammasgn}(x) = + \begin{cases} + +1 & \Gamma(x) > 0 \\ + -1 & \Gamma(x) < 0 + \end{cases} + + where :math:`\Gamma` is the gamma function; see `gamma`. This + definition is complete since the gamma function is never zero; + see the discussion after [dlmf]_. + + Parameters + ---------- + x : array_like + Real argument + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Sign of the gamma function + + See Also + -------- + gamma : the gamma function + gammaln : log of the absolute value of the gamma function + loggamma : analytic continuation of the log of the gamma function + + Notes + ----- + The gamma function can be computed as ``gammasgn(x) * + np.exp(gammaln(x))``. + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/5.2#E1 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is 1 for `x > 0`. + + >>> sc.gammasgn([1, 2, 3, 4]) + array([1., 1., 1., 1.]) + + It alternates between -1 and 1 for negative integers. + + >>> sc.gammasgn([-0.5, -1.5, -2.5, -3.5]) + array([-1., 1., -1., 1.]) + + It can be used to compute the gamma function. + + >>> x = [1.5, 0.5, -0.5, -1.5] + >>> sc.gammasgn(x) * np.exp(sc.gammaln(x)) + array([ 0.88622693, 1.77245385, -3.5449077 , 2.3632718 ]) + >>> sc.gamma(x) + array([ 0.88622693, 1.77245385, -3.5449077 , 2.3632718 ]) + + """) + +add_newdoc("gdtr", + r""" + gdtr(a, b, x, out=None) + + Gamma distribution cumulative distribution function. + + Returns the integral from zero to `x` of the gamma probability density + function, + + .. math:: + + F = \int_0^x \frac{a^b}{\Gamma(b)} t^{b-1} e^{-at}\,dt, + + where :math:`\Gamma` is the gamma function. + + Parameters + ---------- + a : array_like + The rate parameter of the gamma distribution, sometimes denoted + :math:`\beta` (float). It is also the reciprocal of the scale + parameter :math:`\theta`. + b : array_like + The shape parameter of the gamma distribution, sometimes denoted + :math:`\alpha` (float). + x : array_like + The quantile (upper limit of integration; float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + F : scalar or ndarray + The CDF of the gamma distribution with parameters `a` and `b` + evaluated at `x`. + + See Also + -------- + gdtrc : 1 - CDF of the gamma distribution. + scipy.stats.gamma: Gamma distribution + + Notes + ----- + The evaluation is carried out using the relation to the incomplete gamma + integral (regularized gamma function). + + Wrapper for the Cephes [1]_ routine `gdtr`. Calling `gdtr` directly can + improve performance compared to the ``cdf`` method of `scipy.stats.gamma` + (see last example below). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Compute the function for ``a=1``, ``b=2`` at ``x=5``. + + >>> import numpy as np + >>> from scipy.special import gdtr + >>> import matplotlib.pyplot as plt + >>> gdtr(1., 2., 5.) + 0.9595723180054873 + + Compute the function for ``a=1`` and ``b=2`` at several points by + providing a NumPy array for `x`. + + >>> xvalues = np.array([1., 2., 3., 4]) + >>> gdtr(1., 1., xvalues) + array([0.63212056, 0.86466472, 0.95021293, 0.98168436]) + + `gdtr` can evaluate different parameter sets by providing arrays with + broadcasting compatible shapes for `a`, `b` and `x`. Here we compute the + function for three different `a` at four positions `x` and ``b=3``, + resulting in a 3x4 array. + + >>> a = np.array([[0.5], [1.5], [2.5]]) + >>> x = np.array([1., 2., 3., 4]) + >>> a.shape, x.shape + ((3, 1), (4,)) + + >>> gdtr(a, 3., x) + array([[0.01438768, 0.0803014 , 0.19115317, 0.32332358], + [0.19115317, 0.57680992, 0.82642193, 0.9380312 ], + [0.45618688, 0.87534798, 0.97974328, 0.9972306 ]]) + + Plot the function for four different parameter sets. + + >>> a_parameters = [0.3, 1, 2, 6] + >>> b_parameters = [2, 10, 15, 20] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(a_parameters, b_parameters, linestyles)) + >>> x = np.linspace(0, 30, 1000) + >>> fig, ax = plt.subplots() + >>> for parameter_set in parameters_list: + ... a, b, style = parameter_set + ... gdtr_vals = gdtr(a, b, x) + ... ax.plot(x, gdtr_vals, label=fr"$a= {a},\, b={b}$", ls=style) + >>> ax.legend() + >>> ax.set_xlabel("$x$") + >>> ax.set_title("Gamma distribution cumulative distribution function") + >>> plt.show() + + The gamma distribution is also available as `scipy.stats.gamma`. Using + `gdtr` directly can be much faster than calling the ``cdf`` method of + `scipy.stats.gamma`, especially for small arrays or individual values. + To get the same results one must use the following parametrization: + ``stats.gamma(b, scale=1/a).cdf(x)=gdtr(a, b, x)``. + + >>> from scipy.stats import gamma + >>> a = 2. + >>> b = 3 + >>> x = 1. + >>> gdtr_result = gdtr(a, b, x) # this will often be faster than below + >>> gamma_dist_result = gamma(b, scale=1/a).cdf(x) + >>> gdtr_result == gamma_dist_result # test that results are equal + True + """) + +add_newdoc("gdtrc", + r""" + gdtrc(a, b, x, out=None) + + Gamma distribution survival function. + + Integral from `x` to infinity of the gamma probability density function, + + .. math:: + + F = \int_x^\infty \frac{a^b}{\Gamma(b)} t^{b-1} e^{-at}\,dt, + + where :math:`\Gamma` is the gamma function. + + Parameters + ---------- + a : array_like + The rate parameter of the gamma distribution, sometimes denoted + :math:`\beta` (float). It is also the reciprocal of the scale + parameter :math:`\theta`. + b : array_like + The shape parameter of the gamma distribution, sometimes denoted + :math:`\alpha` (float). + x : array_like + The quantile (lower limit of integration; float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + F : scalar or ndarray + The survival function of the gamma distribution with parameters `a` + and `b` evaluated at `x`. + + See Also + -------- + gdtr: Gamma distribution cumulative distribution function + scipy.stats.gamma: Gamma distribution + gdtrix + + Notes + ----- + The evaluation is carried out using the relation to the incomplete gamma + integral (regularized gamma function). + + Wrapper for the Cephes [1]_ routine `gdtrc`. Calling `gdtrc` directly can + improve performance compared to the ``sf`` method of `scipy.stats.gamma` + (see last example below). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Compute the function for ``a=1`` and ``b=2`` at ``x=5``. + + >>> import numpy as np + >>> from scipy.special import gdtrc + >>> import matplotlib.pyplot as plt + >>> gdtrc(1., 2., 5.) + 0.04042768199451279 + + Compute the function for ``a=1``, ``b=2`` at several points by providing + a NumPy array for `x`. + + >>> xvalues = np.array([1., 2., 3., 4]) + >>> gdtrc(1., 1., xvalues) + array([0.36787944, 0.13533528, 0.04978707, 0.01831564]) + + `gdtrc` can evaluate different parameter sets by providing arrays with + broadcasting compatible shapes for `a`, `b` and `x`. Here we compute the + function for three different `a` at four positions `x` and ``b=3``, + resulting in a 3x4 array. + + >>> a = np.array([[0.5], [1.5], [2.5]]) + >>> x = np.array([1., 2., 3., 4]) + >>> a.shape, x.shape + ((3, 1), (4,)) + + >>> gdtrc(a, 3., x) + array([[0.98561232, 0.9196986 , 0.80884683, 0.67667642], + [0.80884683, 0.42319008, 0.17357807, 0.0619688 ], + [0.54381312, 0.12465202, 0.02025672, 0.0027694 ]]) + + Plot the function for four different parameter sets. + + >>> a_parameters = [0.3, 1, 2, 6] + >>> b_parameters = [2, 10, 15, 20] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(a_parameters, b_parameters, linestyles)) + >>> x = np.linspace(0, 30, 1000) + >>> fig, ax = plt.subplots() + >>> for parameter_set in parameters_list: + ... a, b, style = parameter_set + ... gdtrc_vals = gdtrc(a, b, x) + ... ax.plot(x, gdtrc_vals, label=fr"$a= {a},\, b={b}$", ls=style) + >>> ax.legend() + >>> ax.set_xlabel("$x$") + >>> ax.set_title("Gamma distribution survival function") + >>> plt.show() + + The gamma distribution is also available as `scipy.stats.gamma`. + Using `gdtrc` directly can be much faster than calling the ``sf`` method + of `scipy.stats.gamma`, especially for small arrays or individual + values. To get the same results one must use the following parametrization: + ``stats.gamma(b, scale=1/a).sf(x)=gdtrc(a, b, x)``. + + >>> from scipy.stats import gamma + >>> a = 2 + >>> b = 3 + >>> x = 1. + >>> gdtrc_result = gdtrc(a, b, x) # this will often be faster than below + >>> gamma_dist_result = gamma(b, scale=1/a).sf(x) + >>> gdtrc_result == gamma_dist_result # test that results are equal + True + """) + +add_newdoc("gdtria", + """ + gdtria(p, b, x, out=None) + + Inverse of `gdtr` vs a. + + Returns the inverse with respect to the parameter `a` of ``p = + gdtr(a, b, x)``, the cumulative distribution function of the gamma + distribution. + + Parameters + ---------- + p : array_like + Probability values. + b : array_like + `b` parameter values of `gdtr(a, b, x)`. `b` is the "shape" parameter + of the gamma distribution. + x : array_like + Nonnegative real values, from the domain of the gamma distribution. + out : ndarray, optional + If a fourth argument is given, it must be a numpy.ndarray whose size + matches the broadcast result of `a`, `b` and `x`. `out` is then the + array returned by the function. + + Returns + ------- + a : scalar or ndarray + Values of the `a` parameter such that `p = gdtr(a, b, x)`. `1/a` + is the "scale" parameter of the gamma distribution. + + See Also + -------- + gdtr : CDF of the gamma distribution. + gdtrib : Inverse with respect to `b` of `gdtr(a, b, x)`. + gdtrix : Inverse with respect to `x` of `gdtr(a, b, x)`. + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdfgam`. + + The cumulative distribution function `p` is computed using a routine by + DiDinato and Morris [2]_. Computation of `a` involves a search for a value + that produces the desired value of `p`. The search relies on the + monotonicity of `p` with `a`. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] DiDinato, A. R. and Morris, A. H., + Computation of the incomplete gamma function ratios and their + inverse. ACM Trans. Math. Softw. 12 (1986), 377-393. + + Examples + -------- + First evaluate `gdtr`. + + >>> from scipy.special import gdtr, gdtria + >>> p = gdtr(1.2, 3.4, 5.6) + >>> print(p) + 0.94378087442 + + Verify the inverse. + + >>> gdtria(p, 3.4, 5.6) + 1.2 + """) + +add_newdoc("gdtrib", + """ + gdtrib(a, p, x, out=None) + + Inverse of `gdtr` vs b. + + Returns the inverse with respect to the parameter `b` of ``p = + gdtr(a, b, x)``, the cumulative distribution function of the gamma + distribution. + + Parameters + ---------- + a : array_like + `a` parameter values of `gdtr(a, b, x)`. `1/a` is the "scale" + parameter of the gamma distribution. + p : array_like + Probability values. + x : array_like + Nonnegative real values, from the domain of the gamma distribution. + out : ndarray, optional + If a fourth argument is given, it must be a numpy.ndarray whose size + matches the broadcast result of `a`, `b` and `x`. `out` is then the + array returned by the function. + + Returns + ------- + b : scalar or ndarray + Values of the `b` parameter such that `p = gdtr(a, b, x)`. `b` is + the "shape" parameter of the gamma distribution. + + See Also + -------- + gdtr : CDF of the gamma distribution. + gdtria : Inverse with respect to `a` of `gdtr(a, b, x)`. + gdtrix : Inverse with respect to `x` of `gdtr(a, b, x)`. + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdfgam`. + + The cumulative distribution function `p` is computed using a routine by + DiDinato and Morris [2]_. Computation of `b` involves a search for a value + that produces the desired value of `p`. The search relies on the + monotonicity of `p` with `b`. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] DiDinato, A. R. and Morris, A. H., + Computation of the incomplete gamma function ratios and their + inverse. ACM Trans. Math. Softw. 12 (1986), 377-393. + + Examples + -------- + First evaluate `gdtr`. + + >>> from scipy.special import gdtr, gdtrib + >>> p = gdtr(1.2, 3.4, 5.6) + >>> print(p) + 0.94378087442 + + Verify the inverse. + + >>> gdtrib(1.2, p, 5.6) + 3.3999999999723882 + """) + +add_newdoc("gdtrix", + """ + gdtrix(a, b, p, out=None) + + Inverse of `gdtr` vs x. + + Returns the inverse with respect to the parameter `x` of ``p = + gdtr(a, b, x)``, the cumulative distribution function of the gamma + distribution. This is also known as the pth quantile of the + distribution. + + Parameters + ---------- + a : array_like + `a` parameter values of `gdtr(a, b, x)`. `1/a` is the "scale" + parameter of the gamma distribution. + b : array_like + `b` parameter values of `gdtr(a, b, x)`. `b` is the "shape" parameter + of the gamma distribution. + p : array_like + Probability values. + out : ndarray, optional + If a fourth argument is given, it must be a numpy.ndarray whose size + matches the broadcast result of `a`, `b` and `x`. `out` is then the + array returned by the function. + + Returns + ------- + x : scalar or ndarray + Values of the `x` parameter such that `p = gdtr(a, b, x)`. + + See Also + -------- + gdtr : CDF of the gamma distribution. + gdtria : Inverse with respect to `a` of `gdtr(a, b, x)`. + gdtrib : Inverse with respect to `b` of `gdtr(a, b, x)`. + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdfgam`. + + The cumulative distribution function `p` is computed using a routine by + DiDinato and Morris [2]_. Computation of `x` involves a search for a value + that produces the desired value of `p`. The search relies on the + monotonicity of `p` with `x`. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] DiDinato, A. R. and Morris, A. H., + Computation of the incomplete gamma function ratios and their + inverse. ACM Trans. Math. Softw. 12 (1986), 377-393. + + Examples + -------- + First evaluate `gdtr`. + + >>> from scipy.special import gdtr, gdtrix + >>> p = gdtr(1.2, 3.4, 5.6) + >>> print(p) + 0.94378087442 + + Verify the inverse. + + >>> gdtrix(1.2, 3.4, p) + 5.5999999999999996 + """) + +add_newdoc("hankel1", + r""" + hankel1(v, z, out=None) + + Hankel function of the first kind + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the Hankel function of the first kind. + + See Also + -------- + hankel1e : ndarray + This function with leading exponential behavior stripped off. + + Notes + ----- + A wrapper for the AMOS [1]_ routine `zbesh`, which carries out the + computation using the relation, + + .. math:: H^{(1)}_v(z) = + \frac{2}{\imath\pi} \exp(-\imath \pi v/2) K_v(z \exp(-\imath\pi/2)) + + where :math:`K_v` is the modified Bessel function of the second kind. + For negative orders, the relation + + .. math:: H^{(1)}_{-v}(z) = H^{(1)}_v(z) \exp(\imath\pi v) + + is used. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + """) + +add_newdoc("hankel1e", + r""" + hankel1e(v, z, out=None) + + Exponentially scaled Hankel function of the first kind + + Defined as:: + + hankel1e(v, z) = hankel1(v, z) * exp(-1j * z) + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the exponentially scaled Hankel function. + + Notes + ----- + A wrapper for the AMOS [1]_ routine `zbesh`, which carries out the + computation using the relation, + + .. math:: H^{(1)}_v(z) = + \frac{2}{\imath\pi} \exp(-\imath \pi v/2) K_v(z \exp(-\imath\pi/2)) + + where :math:`K_v` is the modified Bessel function of the second kind. + For negative orders, the relation + + .. math:: H^{(1)}_{-v}(z) = H^{(1)}_v(z) \exp(\imath\pi v) + + is used. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + """) + +add_newdoc("hankel2", + r""" + hankel2(v, z, out=None) + + Hankel function of the second kind + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the Hankel function of the second kind. + + See Also + -------- + hankel2e : this function with leading exponential behavior stripped off. + + Notes + ----- + A wrapper for the AMOS [1]_ routine `zbesh`, which carries out the + computation using the relation, + + .. math:: H^{(2)}_v(z) = + -\frac{2}{\imath\pi} \exp(\imath \pi v/2) K_v(z \exp(\imath\pi/2)) + + where :math:`K_v` is the modified Bessel function of the second kind. + For negative orders, the relation + + .. math:: H^{(2)}_{-v}(z) = H^{(2)}_v(z) \exp(-\imath\pi v) + + is used. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + """) + +add_newdoc("hankel2e", + r""" + hankel2e(v, z, out=None) + + Exponentially scaled Hankel function of the second kind + + Defined as:: + + hankel2e(v, z) = hankel2(v, z) * exp(1j * z) + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the exponentially scaled Hankel function of the second kind. + + Notes + ----- + A wrapper for the AMOS [1]_ routine `zbesh`, which carries out the + computation using the relation, + + .. math:: H^{(2)}_v(z) = -\frac{2}{\imath\pi} + \exp(\frac{\imath \pi v}{2}) K_v(z exp(\frac{\imath\pi}{2})) + + where :math:`K_v` is the modified Bessel function of the second kind. + For negative orders, the relation + + .. math:: H^{(2)}_{-v}(z) = H^{(2)}_v(z) \exp(-\imath\pi v) + + is used. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + """) + +add_newdoc("huber", + r""" + huber(delta, r, out=None) + + Huber loss function. + + .. math:: \text{huber}(\delta, r) = \begin{cases} \infty & \delta < 0 \\ + \frac{1}{2}r^2 & 0 \le \delta, | r | \le \delta \\ + \delta ( |r| - \frac{1}{2}\delta ) & \text{otherwise} \end{cases} + + Parameters + ---------- + delta : ndarray + Input array, indicating the quadratic vs. linear loss changepoint. + r : ndarray + Input array, possibly representing residuals. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + The computed Huber loss function values. + + See Also + -------- + pseudo_huber : smooth approximation of this function + + Notes + ----- + `huber` is useful as a loss function in robust statistics or machine + learning to reduce the influence of outliers as compared to the common + squared error loss, residuals with a magnitude higher than `delta` are + not squared [1]_. + + Typically, `r` represents residuals, the difference + between a model prediction and data. Then, for :math:`|r|\leq\delta`, + `huber` resembles the squared error and for :math:`|r|>\delta` the + absolute error. This way, the Huber loss often achieves + a fast convergence in model fitting for small residuals like the squared + error loss function and still reduces the influence of outliers + (:math:`|r|>\delta`) like the absolute error loss. As :math:`\delta` is + the cutoff between squared and absolute error regimes, it has + to be tuned carefully for each problem. `huber` is also + convex, making it suitable for gradient based optimization. + + .. versionadded:: 0.15.0 + + References + ---------- + .. [1] Peter Huber. "Robust Estimation of a Location Parameter", + 1964. Annals of Statistics. 53 (1): 73 - 101. + + Examples + -------- + Import all necessary modules. + + >>> import numpy as np + >>> from scipy.special import huber + >>> import matplotlib.pyplot as plt + + Compute the function for ``delta=1`` at ``r=2`` + + >>> huber(1., 2.) + 1.5 + + Compute the function for different `delta` by providing a NumPy array or + list for `delta`. + + >>> huber([1., 3., 5.], 4.) + array([3.5, 7.5, 8. ]) + + Compute the function at different points by providing a NumPy array or + list for `r`. + + >>> huber(2., np.array([1., 1.5, 3.])) + array([0.5 , 1.125, 4. ]) + + The function can be calculated for different `delta` and `r` by + providing arrays for both with compatible shapes for broadcasting. + + >>> r = np.array([1., 2.5, 8., 10.]) + >>> deltas = np.array([[1.], [5.], [9.]]) + >>> print(r.shape, deltas.shape) + (4,) (3, 1) + + >>> huber(deltas, r) + array([[ 0.5 , 2. , 7.5 , 9.5 ], + [ 0.5 , 3.125, 27.5 , 37.5 ], + [ 0.5 , 3.125, 32. , 49.5 ]]) + + Plot the function for different `delta`. + + >>> x = np.linspace(-4, 4, 500) + >>> deltas = [1, 2, 3] + >>> linestyles = ["dashed", "dotted", "dashdot"] + >>> fig, ax = plt.subplots() + >>> combined_plot_parameters = list(zip(deltas, linestyles)) + >>> for delta, style in combined_plot_parameters: + ... ax.plot(x, huber(delta, x), label=fr"$\delta={delta}$", ls=style) + >>> ax.legend(loc="upper center") + >>> ax.set_xlabel("$x$") + >>> ax.set_title(r"Huber loss function $h_{\delta}(x)$") + >>> ax.set_xlim(-4, 4) + >>> ax.set_ylim(0, 8) + >>> plt.show() + """) + +add_newdoc("hyp0f1", + r""" + hyp0f1(v, z, out=None) + + Confluent hypergeometric limit function 0F1. + + Parameters + ---------- + v : array_like + Real-valued parameter + z : array_like + Real- or complex-valued argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The confluent hypergeometric limit function + + Notes + ----- + This function is defined as: + + .. math:: _0F_1(v, z) = \sum_{k=0}^{\infty}\frac{z^k}{(v)_k k!}. + + It's also the limit as :math:`q \to \infty` of :math:`_1F_1(q; v; z/q)`, + and satisfies the differential equation :math:`f''(z) + vf'(z) = + f(z)`. See [1]_ for more information. + + References + ---------- + .. [1] Wolfram MathWorld, "Confluent Hypergeometric Limit Function", + http://mathworld.wolfram.com/ConfluentHypergeometricLimitFunction.html + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is one when `z` is zero. + + >>> sc.hyp0f1(1, 0) + 1.0 + + It is the limit of the confluent hypergeometric function as `q` + goes to infinity. + + >>> q = np.array([1, 10, 100, 1000]) + >>> v = 1 + >>> z = 1 + >>> sc.hyp1f1(q, v, z / q) + array([2.71828183, 2.31481985, 2.28303778, 2.27992985]) + >>> sc.hyp0f1(v, z) + 2.2795853023360673 + + It is related to Bessel functions. + + >>> n = 1 + >>> x = np.linspace(0, 1, 5) + >>> sc.jv(n, x) + array([0. , 0.12402598, 0.24226846, 0.3492436 , 0.44005059]) + >>> (0.5 * x)**n / sc.factorial(n) * sc.hyp0f1(n + 1, -0.25 * x**2) + array([0. , 0.12402598, 0.24226846, 0.3492436 , 0.44005059]) + + """) + +add_newdoc("hyp1f1", + r""" + hyp1f1(a, b, x, out=None) + + Confluent hypergeometric function 1F1. + + The confluent hypergeometric function is defined by the series + + .. math:: + + {}_1F_1(a; b; x) = \sum_{k = 0}^\infty \frac{(a)_k}{(b)_k k!} x^k. + + See [dlmf]_ for more details. Here :math:`(\cdot)_k` is the + Pochhammer symbol; see `poch`. + + Parameters + ---------- + a, b : array_like + Real parameters + x : array_like + Real or complex argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the confluent hypergeometric function + + See Also + -------- + hyperu : another confluent hypergeometric function + hyp0f1 : confluent hypergeometric limit function + hyp2f1 : Gaussian hypergeometric function + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/13.2#E2 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is one when `x` is zero: + + >>> sc.hyp1f1(0.5, 0.5, 0) + 1.0 + + It is singular when `b` is a nonpositive integer. + + >>> sc.hyp1f1(0.5, -1, 0) + inf + + It is a polynomial when `a` is a nonpositive integer. + + >>> a, b, x = -1, 0.5, np.array([1.0, 2.0, 3.0, 4.0]) + >>> sc.hyp1f1(a, b, x) + array([-1., -3., -5., -7.]) + >>> 1 + (a / b) * x + array([-1., -3., -5., -7.]) + + It reduces to the exponential function when `a = b`. + + >>> sc.hyp1f1(2, 2, [1, 2, 3, 4]) + array([ 2.71828183, 7.3890561 , 20.08553692, 54.59815003]) + >>> np.exp([1, 2, 3, 4]) + array([ 2.71828183, 7.3890561 , 20.08553692, 54.59815003]) + + """) + +add_newdoc("hyp2f1", + r""" + hyp2f1(a, b, c, z, out=None) + + Gauss hypergeometric function 2F1(a, b; c; z) + + Parameters + ---------- + a, b, c : array_like + Arguments, should be real-valued. + z : array_like + Argument, real or complex. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + hyp2f1 : scalar or ndarray + The values of the gaussian hypergeometric function. + + See Also + -------- + hyp0f1 : confluent hypergeometric limit function. + hyp1f1 : Kummer's (confluent hypergeometric) function. + + Notes + ----- + This function is defined for :math:`|z| < 1` as + + .. math:: + + \mathrm{hyp2f1}(a, b, c, z) = \sum_{n=0}^\infty + \frac{(a)_n (b)_n}{(c)_n}\frac{z^n}{n!}, + + and defined on the rest of the complex z-plane by analytic + continuation [1]_. + Here :math:`(\cdot)_n` is the Pochhammer symbol; see `poch`. When + :math:`n` is an integer the result is a polynomial of degree :math:`n`. + + The implementation for complex values of ``z`` is described in [2]_, + except for ``z`` in the region defined by + + .. math:: + + 0.9 <= \left|z\right| < 1.1, + \left|1 - z\right| >= 0.9, + \mathrm{real}(z) >= 0 + + in which the implementation follows [4]_. + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/15.2 + .. [2] S. Zhang and J.M. Jin, "Computation of Special Functions", Wiley 1996 + .. [3] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + .. [4] J.L. Lopez and N.M. Temme, "New series expansions of the Gauss + hypergeometric function", Adv Comput Math 39, 349-365 (2013). + https://doi.org/10.1007/s10444-012-9283-y + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It has poles when `c` is a negative integer. + + >>> sc.hyp2f1(1, 1, -2, 1) + inf + + It is a polynomial when `a` or `b` is a negative integer. + + >>> a, b, c = -1, 1, 1.5 + >>> z = np.linspace(0, 1, 5) + >>> sc.hyp2f1(a, b, c, z) + array([1. , 0.83333333, 0.66666667, 0.5 , 0.33333333]) + >>> 1 + a * b * z / c + array([1. , 0.83333333, 0.66666667, 0.5 , 0.33333333]) + + It is symmetric in `a` and `b`. + + >>> a = np.linspace(0, 1, 5) + >>> b = np.linspace(0, 1, 5) + >>> sc.hyp2f1(a, b, 1, 0.5) + array([1. , 1.03997334, 1.1803406 , 1.47074441, 2. ]) + >>> sc.hyp2f1(b, a, 1, 0.5) + array([1. , 1.03997334, 1.1803406 , 1.47074441, 2. ]) + + It contains many other functions as special cases. + + >>> z = 0.5 + >>> sc.hyp2f1(1, 1, 2, z) + 1.3862943611198901 + >>> -np.log(1 - z) / z + 1.3862943611198906 + + >>> sc.hyp2f1(0.5, 1, 1.5, z**2) + 1.098612288668109 + >>> np.log((1 + z) / (1 - z)) / (2 * z) + 1.0986122886681098 + + >>> sc.hyp2f1(0.5, 1, 1.5, -z**2) + 0.9272952180016117 + >>> np.arctan(z) / z + 0.9272952180016122 + + """) + +add_newdoc("hyperu", + r""" + hyperu(a, b, x, out=None) + + Confluent hypergeometric function U + + It is defined as the solution to the equation + + .. math:: + + x \frac{d^2w}{dx^2} + (b - x) \frac{dw}{dx} - aw = 0 + + which satisfies the property + + .. math:: + + U(a, b, x) \sim x^{-a} + + as :math:`x \to \infty`. See [dlmf]_ for more details. + + Parameters + ---------- + a, b : array_like + Real-valued parameters + x : array_like + Real-valued argument + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of `U` + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematics Functions + https://dlmf.nist.gov/13.2#E6 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It has a branch cut along the negative `x` axis. + + >>> x = np.linspace(-0.1, -10, 5) + >>> sc.hyperu(1, 1, x) + array([nan, nan, nan, nan, nan]) + + It approaches zero as `x` goes to infinity. + + >>> x = np.array([1, 10, 100]) + >>> sc.hyperu(1, 1, x) + array([0.59634736, 0.09156333, 0.00990194]) + + It satisfies Kummer's transformation. + + >>> a, b, x = 2, 1, 1 + >>> sc.hyperu(a, b, x) + 0.1926947246463881 + >>> x**(1 - b) * sc.hyperu(a - b + 1, 2 - b, x) + 0.1926947246463881 + + """) + +add_newdoc("i0", + r""" + i0(x, out=None) + + Modified Bessel function of order 0. + + Defined as, + + .. math:: + I_0(x) = \sum_{k=0}^\infty \frac{(x^2/4)^k}{(k!)^2} = J_0(\imath x), + + where :math:`J_0` is the Bessel function of the first kind of order 0. + + Parameters + ---------- + x : array_like + Argument (float) + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + Value of the modified Bessel function of order 0 at `x`. + + See Also + -------- + iv: Modified Bessel function of any order + i0e: Exponentially scaled modified Bessel function of order 0 + + Notes + ----- + The range is partitioned into the two intervals [0, 8] and (8, infinity). + Chebyshev polynomial expansions are employed in each interval. + + This function is a wrapper for the Cephes [1]_ routine `i0`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import i0 + >>> i0(1.) + 1.2660658777520082 + + Calculate at several points: + + >>> import numpy as np + >>> i0(np.array([-2., 0., 3.5])) + array([2.2795853 , 1. , 7.37820343]) + + Plot the function from -10 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-10., 10., 1000) + >>> y = i0(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("i0e", + """ + i0e(x, out=None) + + Exponentially scaled modified Bessel function of order 0. + + Defined as:: + + i0e(x) = exp(-abs(x)) * i0(x). + + Parameters + ---------- + x : array_like + Argument (float) + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + Value of the exponentially scaled modified Bessel function of order 0 + at `x`. + + See Also + -------- + iv: Modified Bessel function of the first kind + i0: Modified Bessel function of order 0 + + Notes + ----- + The range is partitioned into the two intervals [0, 8] and (8, infinity). + Chebyshev polynomial expansions are employed in each interval. The + polynomial expansions used are the same as those in `i0`, but + they are not multiplied by the dominant exponential factor. + + This function is a wrapper for the Cephes [1]_ routine `i0e`. `i0e` + is useful for large arguments `x`: for these, `i0` quickly overflows. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + In the following example `i0` returns infinity whereas `i0e` still returns + a finite number. + + >>> from scipy.special import i0, i0e + >>> i0(1000.), i0e(1000.) + (inf, 0.012617240455891257) + + Calculate the function at several points by providing a NumPy array or + list for `x`: + + >>> import numpy as np + >>> i0e(np.array([-2., 0., 3.])) + array([0.30850832, 1. , 0.24300035]) + + Plot the function from -10 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-10., 10., 1000) + >>> y = i0e(x) + >>> ax.plot(x, y) + >>> plt.show() + """) + +add_newdoc("i1", + r""" + i1(x, out=None) + + Modified Bessel function of order 1. + + Defined as, + + .. math:: + I_1(x) = \frac{1}{2}x \sum_{k=0}^\infty \frac{(x^2/4)^k}{k! (k + 1)!} + = -\imath J_1(\imath x), + + where :math:`J_1` is the Bessel function of the first kind of order 1. + + Parameters + ---------- + x : array_like + Argument (float) + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + Value of the modified Bessel function of order 1 at `x`. + + See Also + -------- + iv: Modified Bessel function of the first kind + i1e: Exponentially scaled modified Bessel function of order 1 + + Notes + ----- + The range is partitioned into the two intervals [0, 8] and (8, infinity). + Chebyshev polynomial expansions are employed in each interval. + + This function is a wrapper for the Cephes [1]_ routine `i1`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import i1 + >>> i1(1.) + 0.5651591039924851 + + Calculate the function at several points: + + >>> import numpy as np + >>> i1(np.array([-2., 0., 6.])) + array([-1.59063685, 0. , 61.34193678]) + + Plot the function between -10 and 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-10., 10., 1000) + >>> y = i1(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("i1e", + """ + i1e(x, out=None) + + Exponentially scaled modified Bessel function of order 1. + + Defined as:: + + i1e(x) = exp(-abs(x)) * i1(x) + + Parameters + ---------- + x : array_like + Argument (float) + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + Value of the exponentially scaled modified Bessel function of order 1 + at `x`. + + See Also + -------- + iv: Modified Bessel function of the first kind + i1: Modified Bessel function of order 1 + + Notes + ----- + The range is partitioned into the two intervals [0, 8] and (8, infinity). + Chebyshev polynomial expansions are employed in each interval. The + polynomial expansions used are the same as those in `i1`, but + they are not multiplied by the dominant exponential factor. + + This function is a wrapper for the Cephes [1]_ routine `i1e`. `i1e` + is useful for large arguments `x`: for these, `i1` quickly overflows. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + In the following example `i1` returns infinity whereas `i1e` still returns + a finite number. + + >>> from scipy.special import i1, i1e + >>> i1(1000.), i1e(1000.) + (inf, 0.01261093025692863) + + Calculate the function at several points by providing a NumPy array or + list for `x`: + + >>> import numpy as np + >>> i1e(np.array([-2., 0., 6.])) + array([-0.21526929, 0. , 0.15205146]) + + Plot the function between -10 and 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-10., 10., 1000) + >>> y = i1e(x) + >>> ax.plot(x, y) + >>> plt.show() + """) + +add_newdoc("_igam_fac", + """ + Internal function, do not use. + """) + +add_newdoc("it2i0k0", + r""" + it2i0k0(x, out=None) + + Integrals related to modified Bessel functions of order 0. + + Computes the integrals + + .. math:: + + \int_0^x \frac{I_0(t) - 1}{t} dt \\ + \int_x^\infty \frac{K_0(t)}{t} dt. + + Parameters + ---------- + x : array_like + Values at which to evaluate the integrals. + out : tuple of ndarrays, optional + Optional output arrays for the function results. + + Returns + ------- + ii0 : scalar or ndarray + The integral for `i0` + ik0 : scalar or ndarray + The integral for `k0` + + References + ---------- + .. [1] S. Zhang and J.M. Jin, "Computation of Special Functions", + Wiley 1996 + + Examples + -------- + Evaluate the functions at one point. + + >>> from scipy.special import it2i0k0 + >>> int_i, int_k = it2i0k0(1.) + >>> int_i, int_k + (0.12897944249456852, 0.2085182909001295) + + Evaluate the functions at several points. + + >>> import numpy as np + >>> points = np.array([0.5, 1.5, 3.]) + >>> int_i, int_k = it2i0k0(points) + >>> int_i, int_k + (array([0.03149527, 0.30187149, 1.50012461]), + array([0.66575102, 0.0823715 , 0.00823631])) + + Plot the functions from 0 to 5. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 5., 1000) + >>> int_i, int_k = it2i0k0(x) + >>> ax.plot(x, int_i, label=r"$\int_0^x \frac{I_0(t)-1}{t}\,dt$") + >>> ax.plot(x, int_k, label=r"$\int_x^{\infty} \frac{K_0(t)}{t}\,dt$") + >>> ax.legend() + >>> ax.set_ylim(0, 10) + >>> plt.show() + """) + +add_newdoc("it2j0y0", + r""" + it2j0y0(x, out=None) + + Integrals related to Bessel functions of the first kind of order 0. + + Computes the integrals + + .. math:: + + \int_0^x \frac{1 - J_0(t)}{t} dt \\ + \int_x^\infty \frac{Y_0(t)}{t} dt. + + For more on :math:`J_0` and :math:`Y_0` see `j0` and `y0`. + + Parameters + ---------- + x : array_like + Values at which to evaluate the integrals. + out : tuple of ndarrays, optional + Optional output arrays for the function results. + + Returns + ------- + ij0 : scalar or ndarray + The integral for `j0` + iy0 : scalar or ndarray + The integral for `y0` + + References + ---------- + .. [1] S. Zhang and J.M. Jin, "Computation of Special Functions", + Wiley 1996 + + Examples + -------- + Evaluate the functions at one point. + + >>> from scipy.special import it2j0y0 + >>> int_j, int_y = it2j0y0(1.) + >>> int_j, int_y + (0.12116524699506871, 0.39527290169929336) + + Evaluate the functions at several points. + + >>> import numpy as np + >>> points = np.array([0.5, 1.5, 3.]) + >>> int_j, int_y = it2j0y0(points) + >>> int_j, int_y + (array([0.03100699, 0.26227724, 0.85614669]), + array([ 0.26968854, 0.29769696, -0.02987272])) + + Plot the functions from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> int_j, int_y = it2j0y0(x) + >>> ax.plot(x, int_j, label=r"$\int_0^x \frac{1-J_0(t)}{t}\,dt$") + >>> ax.plot(x, int_y, label=r"$\int_x^{\infty} \frac{Y_0(t)}{t}\,dt$") + >>> ax.legend() + >>> ax.set_ylim(-2.5, 2.5) + >>> plt.show() + """) + +add_newdoc("it2struve0", + r""" + it2struve0(x, out=None) + + Integral related to the Struve function of order 0. + + Returns the integral, + + .. math:: + \int_x^\infty \frac{H_0(t)}{t}\,dt + + where :math:`H_0` is the Struve function of order 0. + + Parameters + ---------- + x : array_like + Lower limit of integration. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + The value of the integral. + + See Also + -------- + struve + + Notes + ----- + Wrapper for a Fortran routine created by Shanjie Zhang and Jianming + Jin [1]_. + + References + ---------- + .. [1] Zhang, Shanjie and Jin, Jianming. "Computation of Special + Functions", John Wiley and Sons, 1996. + https://people.sc.fsu.edu/~jburkardt/f_src/special_functions/special_functions.html + + Examples + -------- + Evaluate the function at one point. + + >>> import numpy as np + >>> from scipy.special import it2struve0 + >>> it2struve0(1.) + 0.9571973506383524 + + Evaluate the function at several points by supplying + an array for `x`. + + >>> points = np.array([1., 2., 3.5]) + >>> it2struve0(points) + array([0.95719735, 0.46909296, 0.10366042]) + + Plot the function from -10 to 10. + + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-10., 10., 1000) + >>> it2struve0_values = it2struve0(x) + >>> fig, ax = plt.subplots() + >>> ax.plot(x, it2struve0_values) + >>> ax.set_xlabel(r'$x$') + >>> ax.set_ylabel(r'$\int_x^{\infty}\frac{H_0(t)}{t}\,dt$') + >>> plt.show() + """) + +add_newdoc( + "itairy", + r""" + itairy(x, out=None) + + Integrals of Airy functions + + Calculates the integrals of Airy functions from 0 to `x`. + + Parameters + ---------- + + x : array_like + Upper limit of integration (float). + out : tuple of ndarray, optional + Optional output arrays for the function values + + Returns + ------- + Apt : scalar or ndarray + Integral of Ai(t) from 0 to x. + Bpt : scalar or ndarray + Integral of Bi(t) from 0 to x. + Ant : scalar or ndarray + Integral of Ai(-t) from 0 to x. + Bnt : scalar or ndarray + Integral of Bi(-t) from 0 to x. + + Notes + ----- + + Wrapper for a Fortran routine created by Shanjie Zhang and Jianming + Jin [1]_. + + References + ---------- + + .. [1] Zhang, Shanjie and Jin, Jianming. "Computation of Special + Functions", John Wiley and Sons, 1996. + https://people.sc.fsu.edu/~jburkardt/f_src/special_functions/special_functions.html + + Examples + -------- + Compute the functions at ``x=1.``. + + >>> import numpy as np + >>> from scipy.special import itairy + >>> import matplotlib.pyplot as plt + >>> apt, bpt, ant, bnt = itairy(1.) + >>> apt, bpt, ant, bnt + (0.23631734191710949, + 0.8727691167380077, + 0.46567398346706845, + 0.3730050096342943) + + Compute the functions at several points by providing a NumPy array for `x`. + + >>> x = np.array([1., 1.5, 2.5, 5]) + >>> apt, bpt, ant, bnt = itairy(x) + >>> apt, bpt, ant, bnt + (array([0.23631734, 0.28678675, 0.324638 , 0.33328759]), + array([ 0.87276912, 1.62470809, 5.20906691, 321.47831857]), + array([0.46567398, 0.72232876, 0.93187776, 0.7178822 ]), + array([ 0.37300501, 0.35038814, -0.02812939, 0.15873094])) + + Plot the functions from -10 to 10. + + >>> x = np.linspace(-10, 10, 500) + >>> apt, bpt, ant, bnt = itairy(x) + >>> fig, ax = plt.subplots(figsize=(6, 5)) + >>> ax.plot(x, apt, label=r"$\int_0^x\, Ai(t)\, dt$") + >>> ax.plot(x, bpt, ls="dashed", label=r"$\int_0^x\, Bi(t)\, dt$") + >>> ax.plot(x, ant, ls="dashdot", label=r"$\int_0^x\, Ai(-t)\, dt$") + >>> ax.plot(x, bnt, ls="dotted", label=r"$\int_0^x\, Bi(-t)\, dt$") + >>> ax.set_ylim(-2, 1.5) + >>> ax.legend(loc="lower right") + >>> plt.show() + """) + +add_newdoc("iti0k0", + r""" + iti0k0(x, out=None) + + Integrals of modified Bessel functions of order 0. + + Computes the integrals + + .. math:: + + \int_0^x I_0(t) dt \\ + \int_0^x K_0(t) dt. + + For more on :math:`I_0` and :math:`K_0` see `i0` and `k0`. + + Parameters + ---------- + x : array_like + Values at which to evaluate the integrals. + out : tuple of ndarrays, optional + Optional output arrays for the function results. + + Returns + ------- + ii0 : scalar or ndarray + The integral for `i0` + ik0 : scalar or ndarray + The integral for `k0` + + References + ---------- + .. [1] S. Zhang and J.M. Jin, "Computation of Special Functions", + Wiley 1996 + + Examples + -------- + Evaluate the functions at one point. + + >>> from scipy.special import iti0k0 + >>> int_i, int_k = iti0k0(1.) + >>> int_i, int_k + (1.0865210970235892, 1.2425098486237771) + + Evaluate the functions at several points. + + >>> import numpy as np + >>> points = np.array([0., 1.5, 3.]) + >>> int_i, int_k = iti0k0(points) + >>> int_i, int_k + (array([0. , 1.80606937, 6.16096149]), + array([0. , 1.39458246, 1.53994809])) + + Plot the functions from 0 to 5. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 5., 1000) + >>> int_i, int_k = iti0k0(x) + >>> ax.plot(x, int_i, label=r"$\int_0^x I_0(t)\,dt$") + >>> ax.plot(x, int_k, label=r"$\int_0^x K_0(t)\,dt$") + >>> ax.legend() + >>> plt.show() + """) + +add_newdoc("itj0y0", + r""" + itj0y0(x, out=None) + + Integrals of Bessel functions of the first kind of order 0. + + Computes the integrals + + .. math:: + + \int_0^x J_0(t) dt \\ + \int_0^x Y_0(t) dt. + + For more on :math:`J_0` and :math:`Y_0` see `j0` and `y0`. + + Parameters + ---------- + x : array_like + Values at which to evaluate the integrals. + out : tuple of ndarrays, optional + Optional output arrays for the function results. + + Returns + ------- + ij0 : scalar or ndarray + The integral of `j0` + iy0 : scalar or ndarray + The integral of `y0` + + References + ---------- + .. [1] S. Zhang and J.M. Jin, "Computation of Special Functions", + Wiley 1996 + + Examples + -------- + Evaluate the functions at one point. + + >>> from scipy.special import itj0y0 + >>> int_j, int_y = itj0y0(1.) + >>> int_j, int_y + (0.9197304100897596, -0.637069376607422) + + Evaluate the functions at several points. + + >>> import numpy as np + >>> points = np.array([0., 1.5, 3.]) + >>> int_j, int_y = itj0y0(points) + >>> int_j, int_y + (array([0. , 1.24144951, 1.38756725]), + array([ 0. , -0.51175903, 0.19765826])) + + Plot the functions from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> int_j, int_y = itj0y0(x) + >>> ax.plot(x, int_j, label=r"$\int_0^x J_0(t)\,dt$") + >>> ax.plot(x, int_y, label=r"$\int_0^x Y_0(t)\,dt$") + >>> ax.legend() + >>> plt.show() + + """) + +add_newdoc("itmodstruve0", + r""" + itmodstruve0(x, out=None) + + Integral of the modified Struve function of order 0. + + .. math:: + I = \int_0^x L_0(t)\,dt + + Parameters + ---------- + x : array_like + Upper limit of integration (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + The integral of :math:`L_0` from 0 to `x`. + + See Also + -------- + modstruve: Modified Struve function which is integrated by this function + + Notes + ----- + Wrapper for a Fortran routine created by Shanjie Zhang and Jianming + Jin [1]_. + + References + ---------- + .. [1] Zhang, Shanjie and Jin, Jianming. "Computation of Special + Functions", John Wiley and Sons, 1996. + https://people.sc.fsu.edu/~jburkardt/f_src/special_functions/special_functions.html + + Examples + -------- + Evaluate the function at one point. + + >>> import numpy as np + >>> from scipy.special import itmodstruve0 + >>> itmodstruve0(1.) + 0.3364726286440384 + + Evaluate the function at several points by supplying + an array for `x`. + + >>> points = np.array([1., 2., 3.5]) + >>> itmodstruve0(points) + array([0.33647263, 1.588285 , 7.60382578]) + + Plot the function from -10 to 10. + + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-10., 10., 1000) + >>> itmodstruve0_values = itmodstruve0(x) + >>> fig, ax = plt.subplots() + >>> ax.plot(x, itmodstruve0_values) + >>> ax.set_xlabel(r'$x$') + >>> ax.set_ylabel(r'$\int_0^xL_0(t)\,dt$') + >>> plt.show() + """) + +add_newdoc("itstruve0", + r""" + itstruve0(x, out=None) + + Integral of the Struve function of order 0. + + .. math:: + I = \int_0^x H_0(t)\,dt + + Parameters + ---------- + x : array_like + Upper limit of integration (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + I : scalar or ndarray + The integral of :math:`H_0` from 0 to `x`. + + See Also + -------- + struve: Function which is integrated by this function + + Notes + ----- + Wrapper for a Fortran routine created by Shanjie Zhang and Jianming + Jin [1]_. + + References + ---------- + .. [1] Zhang, Shanjie and Jin, Jianming. "Computation of Special + Functions", John Wiley and Sons, 1996. + https://people.sc.fsu.edu/~jburkardt/f_src/special_functions/special_functions.html + + Examples + -------- + Evaluate the function at one point. + + >>> import numpy as np + >>> from scipy.special import itstruve0 + >>> itstruve0(1.) + 0.30109042670805547 + + Evaluate the function at several points by supplying + an array for `x`. + + >>> points = np.array([1., 2., 3.5]) + >>> itstruve0(points) + array([0.30109043, 1.01870116, 1.96804581]) + + Plot the function from -20 to 20. + + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-20., 20., 1000) + >>> istruve0_values = itstruve0(x) + >>> fig, ax = plt.subplots() + >>> ax.plot(x, istruve0_values) + >>> ax.set_xlabel(r'$x$') + >>> ax.set_ylabel(r'$\int_0^{x}H_0(t)\,dt$') + >>> plt.show() + """) + +add_newdoc("iv", + r""" + iv(v, z, out=None) + + Modified Bessel function of the first kind of real order. + + Parameters + ---------- + v : array_like + Order. If `z` is of real type and negative, `v` must be integer + valued. + z : array_like of float or complex + Argument. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the modified Bessel function. + + See Also + -------- + ive : This function with leading exponential behavior stripped off. + i0 : Faster version of this function for order 0. + i1 : Faster version of this function for order 1. + + Notes + ----- + For real `z` and :math:`v \in [-50, 50]`, the evaluation is carried out + using Temme's method [1]_. For larger orders, uniform asymptotic + expansions are applied. + + For complex `z` and positive `v`, the AMOS [2]_ `zbesi` routine is + called. It uses a power series for small `z`, the asymptotic expansion + for large `abs(z)`, the Miller algorithm normalized by the Wronskian + and a Neumann series for intermediate magnitudes, and the uniform + asymptotic expansions for :math:`I_v(z)` and :math:`J_v(z)` for large + orders. Backward recurrence is used to generate sequences or reduce + orders when necessary. + + The calculations above are done in the right half plane and continued + into the left half plane by the formula, + + .. math:: I_v(z \exp(\pm\imath\pi)) = \exp(\pm\pi v) I_v(z) + + (valid when the real part of `z` is positive). For negative `v`, the + formula + + .. math:: I_{-v}(z) = I_v(z) + \frac{2}{\pi} \sin(\pi v) K_v(z) + + is used, where :math:`K_v(z)` is the modified Bessel function of the + second kind, evaluated using the AMOS routine `zbesk`. + + References + ---------- + .. [1] Temme, Journal of Computational Physics, vol 21, 343 (1976) + .. [2] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + Evaluate the function of order 0 at one point. + + >>> from scipy.special import iv + >>> iv(0, 1.) + 1.2660658777520084 + + Evaluate the function at one point for different orders. + + >>> iv(0, 1.), iv(1, 1.), iv(1.5, 1.) + (1.2660658777520084, 0.565159103992485, 0.2935253263474798) + + The evaluation for different orders can be carried out in one call by + providing a list or NumPy array as argument for the `v` parameter: + + >>> iv([0, 1, 1.5], 1.) + array([1.26606588, 0.5651591 , 0.29352533]) + + Evaluate the function at several points for order 0 by providing an + array for `z`. + + >>> import numpy as np + >>> points = np.array([-2., 0., 3.]) + >>> iv(0, points) + array([2.2795853 , 1. , 4.88079259]) + + If `z` is an array, the order parameter `v` must be broadcastable to + the correct shape if different orders shall be computed in one call. + To calculate the orders 0 and 1 for an 1D array: + + >>> orders = np.array([[0], [1]]) + >>> orders.shape + (2, 1) + + >>> iv(orders, points) + array([[ 2.2795853 , 1. , 4.88079259], + [-1.59063685, 0. , 3.95337022]]) + + Plot the functions of order 0 to 3 from -5 to 5. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-5., 5., 1000) + >>> for i in range(4): + ... ax.plot(x, iv(i, x), label=f'$I_{i!r}$') + >>> ax.legend() + >>> plt.show() + + """) + +add_newdoc("ive", + r""" + ive(v, z, out=None) + + Exponentially scaled modified Bessel function of the first kind. + + Defined as:: + + ive(v, z) = iv(v, z) * exp(-abs(z.real)) + + For imaginary numbers without a real part, returns the unscaled + Bessel function of the first kind `iv`. + + Parameters + ---------- + v : array_like of float + Order. + z : array_like of float or complex + Argument. + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + Values of the exponentially scaled modified Bessel function. + + See Also + -------- + iv: Modified Bessel function of the first kind + i0e: Faster implementation of this function for order 0 + i1e: Faster implementation of this function for order 1 + + Notes + ----- + For positive `v`, the AMOS [1]_ `zbesi` routine is called. It uses a + power series for small `z`, the asymptotic expansion for large + `abs(z)`, the Miller algorithm normalized by the Wronskian and a + Neumann series for intermediate magnitudes, and the uniform asymptotic + expansions for :math:`I_v(z)` and :math:`J_v(z)` for large orders. + Backward recurrence is used to generate sequences or reduce orders when + necessary. + + The calculations above are done in the right half plane and continued + into the left half plane by the formula, + + .. math:: I_v(z \exp(\pm\imath\pi)) = \exp(\pm\pi v) I_v(z) + + (valid when the real part of `z` is positive). For negative `v`, the + formula + + .. math:: I_{-v}(z) = I_v(z) + \frac{2}{\pi} \sin(\pi v) K_v(z) + + is used, where :math:`K_v(z)` is the modified Bessel function of the + second kind, evaluated using the AMOS routine `zbesk`. + + `ive` is useful for large arguments `z`: for these, `iv` easily overflows, + while `ive` does not due to the exponential scaling. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + In the following example `iv` returns infinity whereas `ive` still returns + a finite number. + + >>> from scipy.special import iv, ive + >>> import numpy as np + >>> import matplotlib.pyplot as plt + >>> iv(3, 1000.), ive(3, 1000.) + (inf, 0.01256056218254712) + + Evaluate the function at one point for different orders by + providing a list or NumPy array as argument for the `v` parameter: + + >>> ive([0, 1, 1.5], 1.) + array([0.46575961, 0.20791042, 0.10798193]) + + Evaluate the function at several points for order 0 by providing an + array for `z`. + + >>> points = np.array([-2., 0., 3.]) + >>> ive(0, points) + array([0.30850832, 1. , 0.24300035]) + + Evaluate the function at several points for different orders by + providing arrays for both `v` for `z`. Both arrays have to be + broadcastable to the correct shape. To calculate the orders 0, 1 + and 2 for a 1D array of points: + + >>> ive([[0], [1], [2]], points) + array([[ 0.30850832, 1. , 0.24300035], + [-0.21526929, 0. , 0.19682671], + [ 0.09323903, 0. , 0.11178255]]) + + Plot the functions of order 0 to 3 from -5 to 5. + + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-5., 5., 1000) + >>> for i in range(4): + ... ax.plot(x, ive(i, x), label=fr'$I_{i!r}(z)\cdot e^{{-|z|}}$') + >>> ax.legend() + >>> ax.set_xlabel(r"$z$") + >>> plt.show() + """) + +add_newdoc("j0", + r""" + j0(x, out=None) + + Bessel function of the first kind of order 0. + + Parameters + ---------- + x : array_like + Argument (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + J : scalar or ndarray + Value of the Bessel function of the first kind of order 0 at `x`. + + See Also + -------- + jv : Bessel function of real order and complex argument. + spherical_jn : spherical Bessel functions. + + Notes + ----- + The domain is divided into the intervals [0, 5] and (5, infinity). In the + first interval the following rational approximation is used: + + .. math:: + + J_0(x) \approx (w - r_1^2)(w - r_2^2) \frac{P_3(w)}{Q_8(w)}, + + where :math:`w = x^2` and :math:`r_1`, :math:`r_2` are the zeros of + :math:`J_0`, and :math:`P_3` and :math:`Q_8` are polynomials of degrees 3 + and 8, respectively. + + In the second interval, the Hankel asymptotic expansion is employed with + two rational functions of degree 6/6 and 7/7. + + This function is a wrapper for the Cephes [1]_ routine `j0`. + It should not be confused with the spherical Bessel functions (see + `spherical_jn`). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import j0 + >>> j0(1.) + 0.7651976865579665 + + Calculate the function at several points: + + >>> import numpy as np + >>> j0(np.array([-2., 0., 4.])) + array([ 0.22389078, 1. , -0.39714981]) + + Plot the function from -20 to 20. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-20., 20., 1000) + >>> y = j0(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("j1", + """ + j1(x, out=None) + + Bessel function of the first kind of order 1. + + Parameters + ---------- + x : array_like + Argument (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + J : scalar or ndarray + Value of the Bessel function of the first kind of order 1 at `x`. + + See Also + -------- + jv: Bessel function of the first kind + spherical_jn: spherical Bessel functions. + + Notes + ----- + The domain is divided into the intervals [0, 8] and (8, infinity). In the + first interval a 24 term Chebyshev expansion is used. In the second, the + asymptotic trigonometric representation is employed using two rational + functions of degree 5/5. + + This function is a wrapper for the Cephes [1]_ routine `j1`. + It should not be confused with the spherical Bessel functions (see + `spherical_jn`). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import j1 + >>> j1(1.) + 0.44005058574493355 + + Calculate the function at several points: + + >>> import numpy as np + >>> j1(np.array([-2., 0., 4.])) + array([-0.57672481, 0. , -0.06604333]) + + Plot the function from -20 to 20. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-20., 20., 1000) + >>> y = j1(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("jn", + """ + jn(n, x, out=None) + + Bessel function of the first kind of integer order and real argument. + + Parameters + ---------- + n : array_like + order of the Bessel function + x : array_like + argument of the Bessel function + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + scalar or ndarray + The value of the bessel function + + See Also + -------- + jv + spherical_jn : spherical Bessel functions. + + Notes + ----- + `jn` is an alias of `jv`. + Not to be confused with the spherical Bessel functions (see + `spherical_jn`). + + """) + +add_newdoc("jv", + r""" + jv(v, z, out=None) + + Bessel function of the first kind of real order and complex argument. + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + J : scalar or ndarray + Value of the Bessel function, :math:`J_v(z)`. + + See Also + -------- + jve : :math:`J_v` with leading exponential behavior stripped off. + spherical_jn : spherical Bessel functions. + j0 : faster version of this function for order 0. + j1 : faster version of this function for order 1. + + Notes + ----- + For positive `v` values, the computation is carried out using the AMOS + [1]_ `zbesj` routine, which exploits the connection to the modified + Bessel function :math:`I_v`, + + .. math:: + J_v(z) = \exp(v\pi\imath/2) I_v(-\imath z)\qquad (\Im z > 0) + + J_v(z) = \exp(-v\pi\imath/2) I_v(\imath z)\qquad (\Im z < 0) + + For negative `v` values the formula, + + .. math:: J_{-v}(z) = J_v(z) \cos(\pi v) - Y_v(z) \sin(\pi v) + + is used, where :math:`Y_v(z)` is the Bessel function of the second + kind, computed using the AMOS routine `zbesy`. Note that the second + term is exactly zero for integer `v`; to improve accuracy the second + term is explicitly omitted for `v` values such that `v = floor(v)`. + + Not to be confused with the spherical Bessel functions (see `spherical_jn`). + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + Evaluate the function of order 0 at one point. + + >>> from scipy.special import jv + >>> jv(0, 1.) + 0.7651976865579666 + + Evaluate the function at one point for different orders. + + >>> jv(0, 1.), jv(1, 1.), jv(1.5, 1.) + (0.7651976865579666, 0.44005058574493355, 0.24029783912342725) + + The evaluation for different orders can be carried out in one call by + providing a list or NumPy array as argument for the `v` parameter: + + >>> jv([0, 1, 1.5], 1.) + array([0.76519769, 0.44005059, 0.24029784]) + + Evaluate the function at several points for order 0 by providing an + array for `z`. + + >>> import numpy as np + >>> points = np.array([-2., 0., 3.]) + >>> jv(0, points) + array([ 0.22389078, 1. , -0.26005195]) + + If `z` is an array, the order parameter `v` must be broadcastable to + the correct shape if different orders shall be computed in one call. + To calculate the orders 0 and 1 for an 1D array: + + >>> orders = np.array([[0], [1]]) + >>> orders.shape + (2, 1) + + >>> jv(orders, points) + array([[ 0.22389078, 1. , -0.26005195], + [-0.57672481, 0. , 0.33905896]]) + + Plot the functions of order 0 to 3 from -10 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-10., 10., 1000) + >>> for i in range(4): + ... ax.plot(x, jv(i, x), label=f'$J_{i!r}$') + >>> ax.legend() + >>> plt.show() + + """) + +add_newdoc("jve", + r""" + jve(v, z, out=None) + + Exponentially scaled Bessel function of the first kind of order `v`. + + Defined as:: + + jve(v, z) = jv(v, z) * exp(-abs(z.imag)) + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + J : scalar or ndarray + Value of the exponentially scaled Bessel function. + + See Also + -------- + jv: Unscaled Bessel function of the first kind + + Notes + ----- + For positive `v` values, the computation is carried out using the AMOS + [1]_ `zbesj` routine, which exploits the connection to the modified + Bessel function :math:`I_v`, + + .. math:: + J_v(z) = \exp(v\pi\imath/2) I_v(-\imath z)\qquad (\Im z > 0) + + J_v(z) = \exp(-v\pi\imath/2) I_v(\imath z)\qquad (\Im z < 0) + + For negative `v` values the formula, + + .. math:: J_{-v}(z) = J_v(z) \cos(\pi v) - Y_v(z) \sin(\pi v) + + is used, where :math:`Y_v(z)` is the Bessel function of the second + kind, computed using the AMOS routine `zbesy`. Note that the second + term is exactly zero for integer `v`; to improve accuracy the second + term is explicitly omitted for `v` values such that `v = floor(v)`. + + Exponentially scaled Bessel functions are useful for large arguments `z`: + for these, the unscaled Bessel functions can easily under-or overflow. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + Compare the output of `jv` and `jve` for large complex arguments for `z` + by computing their values for order ``v=1`` at ``z=1000j``. We see that + `jv` overflows but `jve` returns a finite number: + + >>> import numpy as np + >>> from scipy.special import jv, jve + >>> v = 1 + >>> z = 1000j + >>> jv(v, z), jve(v, z) + ((inf+infj), (7.721967686709077e-19+0.012610930256928629j)) + + For real arguments for `z`, `jve` returns the same as `jv`. + + >>> v, z = 1, 1000 + >>> jv(v, z), jve(v, z) + (0.004728311907089523, 0.004728311907089523) + + The function can be evaluated for several orders at the same time by + providing a list or NumPy array for `v`: + + >>> jve([1, 3, 5], 1j) + array([1.27304208e-17+2.07910415e-01j, -4.99352086e-19-8.15530777e-03j, + 6.11480940e-21+9.98657141e-05j]) + + In the same way, the function can be evaluated at several points in one + call by providing a list or NumPy array for `z`: + + >>> jve(1, np.array([1j, 2j, 3j])) + array([1.27308412e-17+0.20791042j, 1.31814423e-17+0.21526929j, + 1.20521602e-17+0.19682671j]) + + It is also possible to evaluate several orders at several points + at the same time by providing arrays for `v` and `z` with + compatible shapes for broadcasting. Compute `jve` for two different orders + `v` and three points `z` resulting in a 2x3 array. + + >>> v = np.array([[1], [3]]) + >>> z = np.array([1j, 2j, 3j]) + >>> v.shape, z.shape + ((2, 1), (3,)) + + >>> jve(v, z) + array([[1.27304208e-17+0.20791042j, 1.31810070e-17+0.21526929j, + 1.20517622e-17+0.19682671j], + [-4.99352086e-19-0.00815531j, -1.76289571e-18-0.02879122j, + -2.92578784e-18-0.04778332j]]) + """) + +add_newdoc("k0", + r""" + k0(x, out=None) + + Modified Bessel function of the second kind of order 0, :math:`K_0`. + + This function is also sometimes referred to as the modified Bessel + function of the third kind of order 0. + + Parameters + ---------- + x : array_like + Argument (float). + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + K : scalar or ndarray + Value of the modified Bessel function :math:`K_0` at `x`. + + See Also + -------- + kv: Modified Bessel function of the second kind of any order + k0e: Exponentially scaled modified Bessel function of the second kind + + Notes + ----- + The range is partitioned into the two intervals [0, 2] and (2, infinity). + Chebyshev polynomial expansions are employed in each interval. + + This function is a wrapper for the Cephes [1]_ routine `k0`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import k0 + >>> k0(1.) + 0.42102443824070823 + + Calculate the function at several points: + + >>> import numpy as np + >>> k0(np.array([0.5, 2., 3.])) + array([0.92441907, 0.11389387, 0.0347395 ]) + + Plot the function from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> y = k0(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("k0e", + """ + k0e(x, out=None) + + Exponentially scaled modified Bessel function K of order 0 + + Defined as:: + + k0e(x) = exp(x) * k0(x). + + Parameters + ---------- + x : array_like + Argument (float) + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + K : scalar or ndarray + Value of the exponentially scaled modified Bessel function K of order + 0 at `x`. + + See Also + -------- + kv: Modified Bessel function of the second kind of any order + k0: Modified Bessel function of the second kind + + Notes + ----- + The range is partitioned into the two intervals [0, 2] and (2, infinity). + Chebyshev polynomial expansions are employed in each interval. + + This function is a wrapper for the Cephes [1]_ routine `k0e`. `k0e` is + useful for large arguments: for these, `k0` easily underflows. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + In the following example `k0` returns 0 whereas `k0e` still returns a + useful finite number: + + >>> from scipy.special import k0, k0e + >>> k0(1000.), k0e(1000) + (0., 0.03962832160075422) + + Calculate the function at several points by providing a NumPy array or + list for `x`: + + >>> import numpy as np + >>> k0e(np.array([0.5, 2., 3.])) + array([1.52410939, 0.84156822, 0.6977616 ]) + + Plot the function from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> y = k0e(x) + >>> ax.plot(x, y) + >>> plt.show() + """) + +add_newdoc("k1", + """ + k1(x, out=None) + + Modified Bessel function of the second kind of order 1, :math:`K_1(x)`. + + Parameters + ---------- + x : array_like + Argument (float) + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + K : scalar or ndarray + Value of the modified Bessel function K of order 1 at `x`. + + See Also + -------- + kv: Modified Bessel function of the second kind of any order + k1e: Exponentially scaled modified Bessel function K of order 1 + + Notes + ----- + The range is partitioned into the two intervals [0, 2] and (2, infinity). + Chebyshev polynomial expansions are employed in each interval. + + This function is a wrapper for the Cephes [1]_ routine `k1`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import k1 + >>> k1(1.) + 0.6019072301972346 + + Calculate the function at several points: + + >>> import numpy as np + >>> k1(np.array([0.5, 2., 3.])) + array([1.65644112, 0.13986588, 0.04015643]) + + Plot the function from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> y = k1(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("k1e", + """ + k1e(x, out=None) + + Exponentially scaled modified Bessel function K of order 1 + + Defined as:: + + k1e(x) = exp(x) * k1(x) + + Parameters + ---------- + x : array_like + Argument (float) + out : ndarray, optional + Optional output array for the function values + + Returns + ------- + K : scalar or ndarray + Value of the exponentially scaled modified Bessel function K of order + 1 at `x`. + + See Also + -------- + kv: Modified Bessel function of the second kind of any order + k1: Modified Bessel function of the second kind of order 1 + + Notes + ----- + The range is partitioned into the two intervals [0, 2] and (2, infinity). + Chebyshev polynomial expansions are employed in each interval. + + This function is a wrapper for the Cephes [1]_ routine `k1e`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + In the following example `k1` returns 0 whereas `k1e` still returns a + useful floating point number. + + >>> from scipy.special import k1, k1e + >>> k1(1000.), k1e(1000.) + (0., 0.03964813081296021) + + Calculate the function at several points by providing a NumPy array or + list for `x`: + + >>> import numpy as np + >>> k1e(np.array([0.5, 2., 3.])) + array([2.73100971, 1.03347685, 0.80656348]) + + Plot the function from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> y = k1e(x) + >>> ax.plot(x, y) + >>> plt.show() + """) + +add_newdoc("kei", + r""" + kei(x, out=None) + + Kelvin function kei. + + Defined as + + .. math:: + + \mathrm{kei}(x) = \Im[K_0(x e^{\pi i / 4})] + + where :math:`K_0` is the modified Bessel function of the second + kind (see `kv`). See [dlmf]_ for more details. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the Kelvin function. + + See Also + -------- + ker : the corresponding real part + keip : the derivative of kei + kv : modified Bessel function of the second kind + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10.61 + + Examples + -------- + It can be expressed using the modified Bessel function of the + second kind. + + >>> import numpy as np + >>> import scipy.special as sc + >>> x = np.array([1.0, 2.0, 3.0, 4.0]) + >>> sc.kv(0, x * np.exp(np.pi * 1j / 4)).imag + array([-0.49499464, -0.20240007, -0.05112188, 0.0021984 ]) + >>> sc.kei(x) + array([-0.49499464, -0.20240007, -0.05112188, 0.0021984 ]) + + """) + +add_newdoc("keip", + r""" + keip(x, out=None) + + Derivative of the Kelvin function kei. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + The values of the derivative of kei. + + See Also + -------- + kei + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10#PT5 + + """) + +add_newdoc("kelvin", + """ + kelvin(x, out=None) + + Kelvin functions as complex numbers + + Parameters + ---------- + x : array_like + Argument + out : tuple of ndarray, optional + Optional output arrays for the function values + + Returns + ------- + Be, Ke, Bep, Kep : 4-tuple of scalar or ndarray + The tuple (Be, Ke, Bep, Kep) contains complex numbers + representing the real and imaginary Kelvin functions and their + derivatives evaluated at `x`. For example, kelvin(x)[0].real = + ber x and kelvin(x)[0].imag = bei x with similar relationships + for ker and kei. + """) + +add_newdoc("ker", + r""" + ker(x, out=None) + + Kelvin function ker. + + Defined as + + .. math:: + + \mathrm{ker}(x) = \Re[K_0(x e^{\pi i / 4})] + + Where :math:`K_0` is the modified Bessel function of the second + kind (see `kv`). See [dlmf]_ for more details. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the Kelvin function. + + See Also + -------- + kei : the corresponding imaginary part + kerp : the derivative of ker + kv : modified Bessel function of the second kind + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10.61 + + Examples + -------- + It can be expressed using the modified Bessel function of the + second kind. + + >>> import numpy as np + >>> import scipy.special as sc + >>> x = np.array([1.0, 2.0, 3.0, 4.0]) + >>> sc.kv(0, x * np.exp(np.pi * 1j / 4)).real + array([ 0.28670621, -0.04166451, -0.06702923, -0.03617885]) + >>> sc.ker(x) + array([ 0.28670621, -0.04166451, -0.06702923, -0.03617885]) + + """) + +add_newdoc("kerp", + r""" + kerp(x, out=None) + + Derivative of the Kelvin function ker. + + Parameters + ---------- + x : array_like + Real argument. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the derivative of ker. + + See Also + -------- + ker + + References + ---------- + .. [dlmf] NIST, Digital Library of Mathematical Functions, + https://dlmf.nist.gov/10#PT5 + + """) + +add_newdoc("kl_div", + r""" + kl_div(x, y, out=None) + + Elementwise function for computing Kullback-Leibler divergence. + + .. math:: + + \mathrm{kl\_div}(x, y) = + \begin{cases} + x \log(x / y) - x + y & x > 0, y > 0 \\ + y & x = 0, y \ge 0 \\ + \infty & \text{otherwise} + \end{cases} + + Parameters + ---------- + x, y : array_like + Real arguments + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the Kullback-Liebler divergence. + + See Also + -------- + entr, rel_entr, scipy.stats.entropy + + Notes + ----- + .. versionadded:: 0.15.0 + + This function is non-negative and is jointly convex in `x` and `y`. + + The origin of this function is in convex programming; see [1]_ for + details. This is why the function contains the extra :math:`-x + + y` terms over what might be expected from the Kullback-Leibler + divergence. For a version of the function without the extra terms, + see `rel_entr`. + + References + ---------- + .. [1] Boyd, Stephen and Lieven Vandenberghe. *Convex optimization*. + Cambridge University Press, 2004. + :doi:`https://doi.org/10.1017/CBO9780511804441` + + """) + +add_newdoc("kn", + r""" + kn(n, x, out=None) + + Modified Bessel function of the second kind of integer order `n` + + Returns the modified Bessel function of the second kind for integer order + `n` at real `z`. + + These are also sometimes called functions of the third kind, Basset + functions, or Macdonald functions. + + Parameters + ---------- + n : array_like of int + Order of Bessel functions (floats will truncate with a warning) + x : array_like of float + Argument at which to evaluate the Bessel functions + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Value of the Modified Bessel function of the second kind, + :math:`K_n(x)`. + + See Also + -------- + kv : Same function, but accepts real order and complex argument + kvp : Derivative of this function + + Notes + ----- + Wrapper for AMOS [1]_ routine `zbesk`. For a discussion of the + algorithm used, see [2]_ and the references therein. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + .. [2] Donald E. Amos, "Algorithm 644: A portable package for Bessel + functions of a complex argument and nonnegative order", ACM + TOMS Vol. 12 Issue 3, Sept. 1986, p. 265 + + Examples + -------- + Plot the function of several orders for real input: + + >>> import numpy as np + >>> from scipy.special import kn + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(0, 5, 1000) + >>> for N in range(6): + ... plt.plot(x, kn(N, x), label='$K_{}(x)$'.format(N)) + >>> plt.ylim(0, 10) + >>> plt.legend() + >>> plt.title(r'Modified Bessel function of the second kind $K_n(x)$') + >>> plt.show() + + Calculate for a single value at multiple orders: + + >>> kn([4, 5, 6], 1) + array([ 44.23241585, 360.9605896 , 3653.83831186]) + """) + +add_newdoc("kolmogi", + """ + kolmogi(p, out=None) + + Inverse Survival Function of Kolmogorov distribution + + It is the inverse function to `kolmogorov`. + Returns y such that ``kolmogorov(y) == p``. + + Parameters + ---------- + p : float array_like + Probability + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The value(s) of kolmogi(p) + + See Also + -------- + kolmogorov : The Survival Function for the distribution + scipy.stats.kstwobign : Provides the functionality as a continuous distribution + smirnov, smirnovi : Functions for the one-sided distribution + + Notes + ----- + `kolmogorov` is used by `stats.kstest` in the application of the + Kolmogorov-Smirnov Goodness of Fit test. For historical reasons this + function is exposed in `scpy.special`, but the recommended way to achieve + the most accurate CDF/SF/PDF/PPF/ISF computations is to use the + `stats.kstwobign` distribution. + + Examples + -------- + >>> from scipy.special import kolmogi + >>> kolmogi([0, 0.1, 0.25, 0.5, 0.75, 0.9, 1.0]) + array([ inf, 1.22384787, 1.01918472, 0.82757356, 0.67644769, + 0.57117327, 0. ]) + + """) + +add_newdoc("kolmogorov", + r""" + kolmogorov(y, out=None) + + Complementary cumulative distribution (Survival Function) function of + Kolmogorov distribution. + + Returns the complementary cumulative distribution function of + Kolmogorov's limiting distribution (``D_n*\sqrt(n)`` as n goes to infinity) + of a two-sided test for equality between an empirical and a theoretical + distribution. It is equal to the (limit as n->infinity of the) + probability that ``sqrt(n) * max absolute deviation > y``. + + Parameters + ---------- + y : float array_like + Absolute deviation between the Empirical CDF (ECDF) and the target CDF, + multiplied by sqrt(n). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The value(s) of kolmogorov(y) + + See Also + -------- + kolmogi : The Inverse Survival Function for the distribution + scipy.stats.kstwobign : Provides the functionality as a continuous distribution + smirnov, smirnovi : Functions for the one-sided distribution + + Notes + ----- + `kolmogorov` is used by `stats.kstest` in the application of the + Kolmogorov-Smirnov Goodness of Fit test. For historical reasons this + function is exposed in `scpy.special`, but the recommended way to achieve + the most accurate CDF/SF/PDF/PPF/ISF computations is to use the + `stats.kstwobign` distribution. + + Examples + -------- + Show the probability of a gap at least as big as 0, 0.5 and 1.0. + + >>> import numpy as np + >>> from scipy.special import kolmogorov + >>> from scipy.stats import kstwobign + >>> kolmogorov([0, 0.5, 1.0]) + array([ 1. , 0.96394524, 0.26999967]) + + Compare a sample of size 1000 drawn from a Laplace(0, 1) distribution against + the target distribution, a Normal(0, 1) distribution. + + >>> from scipy.stats import norm, laplace + >>> rng = np.random.default_rng() + >>> n = 1000 + >>> lap01 = laplace(0, 1) + >>> x = np.sort(lap01.rvs(n, random_state=rng)) + >>> np.mean(x), np.std(x) + (-0.05841730131499543, 1.3968109101997568) + + Construct the Empirical CDF and the K-S statistic Dn. + + >>> target = norm(0,1) # Normal mean 0, stddev 1 + >>> cdfs = target.cdf(x) + >>> ecdfs = np.arange(n+1, dtype=float)/n + >>> gaps = np.column_stack([cdfs - ecdfs[:n], ecdfs[1:] - cdfs]) + >>> Dn = np.max(gaps) + >>> Kn = np.sqrt(n) * Dn + >>> print('Dn=%f, sqrt(n)*Dn=%f' % (Dn, Kn)) + Dn=0.043363, sqrt(n)*Dn=1.371265 + >>> print(chr(10).join(['For a sample of size n drawn from a N(0, 1) distribution:', + ... ' the approximate Kolmogorov probability that sqrt(n)*Dn>=%f is %f' % + ... (Kn, kolmogorov(Kn)), + ... ' the approximate Kolmogorov probability that sqrt(n)*Dn<=%f is %f' % + ... (Kn, kstwobign.cdf(Kn))])) + For a sample of size n drawn from a N(0, 1) distribution: + the approximate Kolmogorov probability that sqrt(n)*Dn>=1.371265 is 0.046533 + the approximate Kolmogorov probability that sqrt(n)*Dn<=1.371265 is 0.953467 + + Plot the Empirical CDF against the target N(0, 1) CDF. + + >>> import matplotlib.pyplot as plt + >>> plt.step(np.concatenate([[-3], x]), ecdfs, where='post', label='Empirical CDF') + >>> x3 = np.linspace(-3, 3, 100) + >>> plt.plot(x3, target.cdf(x3), label='CDF for N(0, 1)') + >>> plt.ylim([0, 1]); plt.grid(True); plt.legend(); + >>> # Add vertical lines marking Dn+ and Dn- + >>> iminus, iplus = np.argmax(gaps, axis=0) + >>> plt.vlines([x[iminus]], ecdfs[iminus], cdfs[iminus], + ... color='r', linestyle='dashed', lw=4) + >>> plt.vlines([x[iplus]], cdfs[iplus], ecdfs[iplus+1], + ... color='r', linestyle='dashed', lw=4) + >>> plt.show() + """) + +add_newdoc("_kolmogc", + r""" + Internal function, do not use. + """) + +add_newdoc("_kolmogci", + r""" + Internal function, do not use. + """) + +add_newdoc("_kolmogp", + r""" + Internal function, do not use. + """) + +add_newdoc("kv", + r""" + kv(v, z, out=None) + + Modified Bessel function of the second kind of real order `v` + + Returns the modified Bessel function of the second kind for real order + `v` at complex `z`. + + These are also sometimes called functions of the third kind, Basset + functions, or Macdonald functions. They are defined as those solutions + of the modified Bessel equation for which, + + .. math:: + K_v(x) \sim \sqrt{\pi/(2x)} \exp(-x) + + as :math:`x \to \infty` [3]_. + + Parameters + ---------- + v : array_like of float + Order of Bessel functions + z : array_like of complex + Argument at which to evaluate the Bessel functions + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The results. Note that input must be of complex type to get complex + output, e.g. ``kv(3, -2+0j)`` instead of ``kv(3, -2)``. + + See Also + -------- + kve : This function with leading exponential behavior stripped off. + kvp : Derivative of this function + + Notes + ----- + Wrapper for AMOS [1]_ routine `zbesk`. For a discussion of the + algorithm used, see [2]_ and the references therein. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + .. [2] Donald E. Amos, "Algorithm 644: A portable package for Bessel + functions of a complex argument and nonnegative order", ACM + TOMS Vol. 12 Issue 3, Sept. 1986, p. 265 + .. [3] NIST Digital Library of Mathematical Functions, + Eq. 10.25.E3. https://dlmf.nist.gov/10.25.E3 + + Examples + -------- + Plot the function of several orders for real input: + + >>> import numpy as np + >>> from scipy.special import kv + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(0, 5, 1000) + >>> for N in np.linspace(0, 6, 5): + ... plt.plot(x, kv(N, x), label='$K_{{{}}}(x)$'.format(N)) + >>> plt.ylim(0, 10) + >>> plt.legend() + >>> plt.title(r'Modified Bessel function of the second kind $K_\nu(x)$') + >>> plt.show() + + Calculate for a single value at multiple orders: + + >>> kv([4, 4.5, 5], 1+2j) + array([ 0.1992+2.3892j, 2.3493+3.6j , 7.2827+3.8104j]) + + """) + +add_newdoc("kve", + r""" + kve(v, z, out=None) + + Exponentially scaled modified Bessel function of the second kind. + + Returns the exponentially scaled, modified Bessel function of the + second kind (sometimes called the third kind) for real order `v` at + complex `z`:: + + kve(v, z) = kv(v, z) * exp(z) + + Parameters + ---------- + v : array_like of float + Order of Bessel functions + z : array_like of complex + Argument at which to evaluate the Bessel functions + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The exponentially scaled modified Bessel function of the second kind. + + See Also + -------- + kv : This function without exponential scaling. + k0e : Faster version of this function for order 0. + k1e : Faster version of this function for order 1. + + Notes + ----- + Wrapper for AMOS [1]_ routine `zbesk`. For a discussion of the + algorithm used, see [2]_ and the references therein. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + .. [2] Donald E. Amos, "Algorithm 644: A portable package for Bessel + functions of a complex argument and nonnegative order", ACM + TOMS Vol. 12 Issue 3, Sept. 1986, p. 265 + + Examples + -------- + In the following example `kv` returns 0 whereas `kve` still returns + a useful finite number. + + >>> import numpy as np + >>> from scipy.special import kv, kve + >>> import matplotlib.pyplot as plt + >>> kv(3, 1000.), kve(3, 1000.) + (0.0, 0.03980696128440973) + + Evaluate the function at one point for different orders by + providing a list or NumPy array as argument for the `v` parameter: + + >>> kve([0, 1, 1.5], 1.) + array([1.14446308, 1.63615349, 2.50662827]) + + Evaluate the function at several points for order 0 by providing an + array for `z`. + + >>> points = np.array([1., 3., 10.]) + >>> kve(0, points) + array([1.14446308, 0.6977616 , 0.39163193]) + + Evaluate the function at several points for different orders by + providing arrays for both `v` for `z`. Both arrays have to be + broadcastable to the correct shape. To calculate the orders 0, 1 + and 2 for a 1D array of points: + + >>> kve([[0], [1], [2]], points) + array([[1.14446308, 0.6977616 , 0.39163193], + [1.63615349, 0.80656348, 0.41076657], + [4.41677005, 1.23547058, 0.47378525]]) + + Plot the functions of order 0 to 3 from 0 to 5. + + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 5., 1000) + >>> for i in range(4): + ... ax.plot(x, kve(i, x), label=fr'$K_{i!r}(z)\cdot e^z$') + >>> ax.legend() + >>> ax.set_xlabel(r"$z$") + >>> ax.set_ylim(0, 4) + >>> ax.set_xlim(0, 5) + >>> plt.show() + """) + +add_newdoc("_lanczos_sum_expg_scaled", + """ + Internal function, do not use. + """) + +add_newdoc("_lgam1p", + """ + Internal function, do not use. + """) + +add_newdoc("log1p", + """ + log1p(x, out=None) + + Calculates log(1 + x) for use when `x` is near zero. + + Parameters + ---------- + x : array_like + Real or complex valued input. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of ``log(1 + x)``. + + See Also + -------- + expm1, cosm1 + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is more accurate than using ``log(1 + x)`` directly for ``x`` + near 0. Note that in the below example ``1 + 1e-17 == 1`` to + double precision. + + >>> sc.log1p(1e-17) + 1e-17 + >>> np.log(1 + 1e-17) + 0.0 + + """) + +add_newdoc("_log1pmx", + """ + Internal function, do not use. + """) + +add_newdoc('log_expit', + """ + log_expit(x, out=None) + + Logarithm of the logistic sigmoid function. + + The SciPy implementation of the logistic sigmoid function is + `scipy.special.expit`, so this function is called ``log_expit``. + + The function is mathematically equivalent to ``log(expit(x))``, but + is formulated to avoid loss of precision for inputs with large + (positive or negative) magnitude. + + Parameters + ---------- + x : array_like + The values to apply ``log_expit`` to element-wise. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + out : scalar or ndarray + The computed values, an ndarray of the same shape as ``x``. + + See Also + -------- + expit + + Notes + ----- + As a ufunc, ``log_expit`` takes a number of optional keyword arguments. + For more information see + `ufuncs `_ + + .. versionadded:: 1.8.0 + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import log_expit, expit + + >>> log_expit([-3.0, 0.25, 2.5, 5.0]) + array([-3.04858735, -0.57593942, -0.07888973, -0.00671535]) + + Large negative values: + + >>> log_expit([-100, -500, -1000]) + array([ -100., -500., -1000.]) + + Note that ``expit(-1000)`` returns 0, so the naive implementation + ``log(expit(-1000))`` return ``-inf``. + + Large positive values: + + >>> log_expit([29, 120, 400]) + array([-2.54366565e-013, -7.66764807e-053, -1.91516960e-174]) + + Compare that to the naive implementation: + + >>> np.log(expit([29, 120, 400])) + array([-2.54463117e-13, 0.00000000e+00, 0.00000000e+00]) + + The first value is accurate to only 3 digits, and the larger inputs + lose all precision and return 0. + """) + +add_newdoc('logit', + """ + logit(x, out=None) + + Logit ufunc for ndarrays. + + The logit function is defined as logit(p) = log(p/(1-p)). + Note that logit(0) = -inf, logit(1) = inf, and logit(p) + for p<0 or p>1 yields nan. + + Parameters + ---------- + x : ndarray + The ndarray to apply logit to element-wise. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + An ndarray of the same shape as x. Its entries + are logit of the corresponding entry of x. + + See Also + -------- + expit + + Notes + ----- + As a ufunc logit takes a number of optional + keyword arguments. For more information + see `ufuncs `_ + + .. versionadded:: 0.10.0 + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import logit, expit + + >>> logit([0, 0.25, 0.5, 0.75, 1]) + array([ -inf, -1.09861229, 0. , 1.09861229, inf]) + + `expit` is the inverse of `logit`: + + >>> expit(logit([0.1, 0.75, 0.999])) + array([ 0.1 , 0.75 , 0.999]) + + Plot logit(x) for x in [0, 1]: + + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(0, 1, 501) + >>> y = logit(x) + >>> plt.plot(x, y) + >>> plt.grid() + >>> plt.ylim(-6, 6) + >>> plt.xlabel('x') + >>> plt.title('logit(x)') + >>> plt.show() + + """) + +add_newdoc("lpmv", + r""" + lpmv(m, v, x, out=None) + + Associated Legendre function of integer order and real degree. + + Defined as + + .. math:: + + P_v^m = (-1)^m (1 - x^2)^{m/2} \frac{d^m}{dx^m} P_v(x) + + where + + .. math:: + + P_v = \sum_{k = 0}^\infty \frac{(-v)_k (v + 1)_k}{(k!)^2} + \left(\frac{1 - x}{2}\right)^k + + is the Legendre function of the first kind. Here :math:`(\cdot)_k` + is the Pochhammer symbol; see `poch`. + + Parameters + ---------- + m : array_like + Order (int or float). If passed a float not equal to an + integer the function returns NaN. + v : array_like + Degree (float). + x : array_like + Argument (float). Must have ``|x| <= 1``. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + pmv : scalar or ndarray + Value of the associated Legendre function. + + See Also + -------- + lpmn : Compute the associated Legendre function for all orders + ``0, ..., m`` and degrees ``0, ..., n``. + clpmn : Compute the associated Legendre function at complex + arguments. + + Notes + ----- + Note that this implementation includes the Condon-Shortley phase. + + References + ---------- + .. [1] Zhang, Jin, "Computation of Special Functions", John Wiley + and Sons, Inc, 1996. + + """) + +add_newdoc("mathieu_a", + """ + mathieu_a(m, q, out=None) + + Characteristic value of even Mathieu functions + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Characteristic value for the even solution, ``ce_m(z, q)``, of + Mathieu's equation. + + See Also + -------- + mathieu_b, mathieu_cem, mathieu_sem + + """) + +add_newdoc("mathieu_b", + """ + mathieu_b(m, q, out=None) + + Characteristic value of odd Mathieu functions + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Characteristic value for the odd solution, ``se_m(z, q)``, of Mathieu's + equation. + + See Also + -------- + mathieu_a, mathieu_cem, mathieu_sem + + """) + +add_newdoc("mathieu_cem", + """ + mathieu_cem(m, q, x, out=None) + + Even Mathieu function and its derivative + + Returns the even Mathieu function, ``ce_m(x, q)``, of order `m` and + parameter `q` evaluated at `x` (given in degrees). Also returns the + derivative with respect to `x` of ce_m(x, q) + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + x : array_like + Argument of the function, *given in degrees, not radians* + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + y : scalar or ndarray + Value of the function + yp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + mathieu_a, mathieu_b, mathieu_sem + + """) + +add_newdoc("mathieu_modcem1", + """ + mathieu_modcem1(m, q, x, out=None) + + Even modified Mathieu function of the first kind and its derivative + + Evaluates the even modified Mathieu function of the first kind, + ``Mc1m(x, q)``, and its derivative at `x` for order `m` and parameter + `q`. + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + x : array_like + Argument of the function, *given in degrees, not radians* + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + y : scalar or ndarray + Value of the function + yp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + mathieu_modsem1 + + """) + +add_newdoc("mathieu_modcem2", + """ + mathieu_modcem2(m, q, x, out=None) + + Even modified Mathieu function of the second kind and its derivative + + Evaluates the even modified Mathieu function of the second kind, + Mc2m(x, q), and its derivative at `x` (given in degrees) for order `m` + and parameter `q`. + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + x : array_like + Argument of the function, *given in degrees, not radians* + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + y : scalar or ndarray + Value of the function + yp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + mathieu_modsem2 + + """) + +add_newdoc("mathieu_modsem1", + """ + mathieu_modsem1(m, q, x, out=None) + + Odd modified Mathieu function of the first kind and its derivative + + Evaluates the odd modified Mathieu function of the first kind, + Ms1m(x, q), and its derivative at `x` (given in degrees) for order `m` + and parameter `q`. + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + x : array_like + Argument of the function, *given in degrees, not radians* + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + y : scalar or ndarray + Value of the function + yp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + mathieu_modcem1 + + """) + +add_newdoc("mathieu_modsem2", + """ + mathieu_modsem2(m, q, x, out=None) + + Odd modified Mathieu function of the second kind and its derivative + + Evaluates the odd modified Mathieu function of the second kind, + Ms2m(x, q), and its derivative at `x` (given in degrees) for order `m` + and parameter q. + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + x : array_like + Argument of the function, *given in degrees, not radians* + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + y : scalar or ndarray + Value of the function + yp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + mathieu_modcem2 + + """) + +add_newdoc( + "mathieu_sem", + """ + mathieu_sem(m, q, x, out=None) + + Odd Mathieu function and its derivative + + Returns the odd Mathieu function, se_m(x, q), of order `m` and + parameter `q` evaluated at `x` (given in degrees). Also returns the + derivative with respect to `x` of se_m(x, q). + + Parameters + ---------- + m : array_like + Order of the function + q : array_like + Parameter of the function + x : array_like + Argument of the function, *given in degrees, not radians*. + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + y : scalar or ndarray + Value of the function + yp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + mathieu_a, mathieu_b, mathieu_cem + + """) + +add_newdoc("modfresnelm", + """ + modfresnelm(x, out=None) + + Modified Fresnel negative integrals + + Parameters + ---------- + x : array_like + Function argument + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + fm : scalar or ndarray + Integral ``F_-(x)``: ``integral(exp(-1j*t*t), t=x..inf)`` + km : scalar or ndarray + Integral ``K_-(x)``: ``1/sqrt(pi)*exp(1j*(x*x+pi/4))*fp`` + + See Also + -------- + modfresnelp + + """) + +add_newdoc("modfresnelp", + """ + modfresnelp(x, out=None) + + Modified Fresnel positive integrals + + Parameters + ---------- + x : array_like + Function argument + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + fp : scalar or ndarray + Integral ``F_+(x)``: ``integral(exp(1j*t*t), t=x..inf)`` + kp : scalar or ndarray + Integral ``K_+(x)``: ``1/sqrt(pi)*exp(-1j*(x*x+pi/4))*fp`` + + See Also + -------- + modfresnelm + + """) + +add_newdoc("modstruve", + r""" + modstruve(v, x, out=None) + + Modified Struve function. + + Return the value of the modified Struve function of order `v` at `x`. The + modified Struve function is defined as, + + .. math:: + L_v(x) = -\imath \exp(-\pi\imath v/2) H_v(\imath x), + + where :math:`H_v` is the Struve function. + + Parameters + ---------- + v : array_like + Order of the modified Struve function (float). + x : array_like + Argument of the Struve function (float; must be positive unless `v` is + an integer). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + L : scalar or ndarray + Value of the modified Struve function of order `v` at `x`. + + See Also + -------- + struve + + Notes + ----- + Three methods discussed in [1]_ are used to evaluate the function: + + - power series + - expansion in Bessel functions (if :math:`|x| < |v| + 20`) + - asymptotic large-x expansion (if :math:`x \geq 0.7v + 12`) + + Rounding errors are estimated based on the largest terms in the sums, and + the result associated with the smallest error is returned. + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/11 + + Examples + -------- + Calculate the modified Struve function of order 1 at 2. + + >>> import numpy as np + >>> from scipy.special import modstruve + >>> import matplotlib.pyplot as plt + >>> modstruve(1, 2.) + 1.102759787367716 + + Calculate the modified Struve function at 2 for orders 1, 2 and 3 by + providing a list for the order parameter `v`. + + >>> modstruve([1, 2, 3], 2.) + array([1.10275979, 0.41026079, 0.11247294]) + + Calculate the modified Struve function of order 1 for several points + by providing an array for `x`. + + >>> points = np.array([2., 5., 8.]) + >>> modstruve(1, points) + array([ 1.10275979, 23.72821578, 399.24709139]) + + Compute the modified Struve function for several orders at several + points by providing arrays for `v` and `z`. The arrays have to be + broadcastable to the correct shapes. + + >>> orders = np.array([[1], [2], [3]]) + >>> points.shape, orders.shape + ((3,), (3, 1)) + + >>> modstruve(orders, points) + array([[1.10275979e+00, 2.37282158e+01, 3.99247091e+02], + [4.10260789e-01, 1.65535979e+01, 3.25973609e+02], + [1.12472937e-01, 9.42430454e+00, 2.33544042e+02]]) + + Plot the modified Struve functions of order 0 to 3 from -5 to 5. + + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-5., 5., 1000) + >>> for i in range(4): + ... ax.plot(x, modstruve(i, x), label=f'$L_{i!r}$') + >>> ax.legend(ncol=2) + >>> ax.set_xlim(-5, 5) + >>> ax.set_title(r"Modified Struve functions $L_{\nu}$") + >>> plt.show() + """) + +add_newdoc("nbdtr", + r""" + nbdtr(k, n, p, out=None) + + Negative binomial cumulative distribution function. + + Returns the sum of the terms 0 through `k` of the negative binomial + distribution probability mass function, + + .. math:: + + F = \sum_{j=0}^k {{n + j - 1}\choose{j}} p^n (1 - p)^j. + + In a sequence of Bernoulli trials with individual success probabilities + `p`, this is the probability that `k` or fewer failures precede the nth + success. + + Parameters + ---------- + k : array_like + The maximum number of allowed failures (nonnegative int). + n : array_like + The target number of successes (positive int). + p : array_like + Probability of success in a single event (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + F : scalar or ndarray + The probability of `k` or fewer failures before `n` successes in a + sequence of events with individual success probability `p`. + + See Also + -------- + nbdtrc : Negative binomial survival function + nbdtrik : Negative binomial quantile function + scipy.stats.nbinom : Negative binomial distribution + + Notes + ----- + If floating point values are passed for `k` or `n`, they will be truncated + to integers. + + The terms are not summed directly; instead the regularized incomplete beta + function is employed, according to the formula, + + .. math:: + \mathrm{nbdtr}(k, n, p) = I_{p}(n, k + 1). + + Wrapper for the Cephes [1]_ routine `nbdtr`. + + The negative binomial distribution is also available as + `scipy.stats.nbinom`. Using `nbdtr` directly can improve performance + compared to the ``cdf`` method of `scipy.stats.nbinom` (see last example). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Compute the function for ``k=10`` and ``n=5`` at ``p=0.5``. + + >>> import numpy as np + >>> from scipy.special import nbdtr + >>> nbdtr(10, 5, 0.5) + 0.940765380859375 + + Compute the function for ``n=10`` and ``p=0.5`` at several points by + providing a NumPy array or list for `k`. + + >>> nbdtr([5, 10, 15], 10, 0.5) + array([0.15087891, 0.58809853, 0.88523853]) + + Plot the function for four different parameter sets. + + >>> import matplotlib.pyplot as plt + >>> k = np.arange(130) + >>> n_parameters = [20, 20, 20, 80] + >>> p_parameters = [0.2, 0.5, 0.8, 0.5] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(p_parameters, n_parameters, + ... linestyles)) + >>> fig, ax = plt.subplots(figsize=(8, 8)) + >>> for parameter_set in parameters_list: + ... p, n, style = parameter_set + ... nbdtr_vals = nbdtr(k, n, p) + ... ax.plot(k, nbdtr_vals, label=rf"$n={n},\, p={p}$", + ... ls=style) + >>> ax.legend() + >>> ax.set_xlabel("$k$") + >>> ax.set_title("Negative binomial cumulative distribution function") + >>> plt.show() + + The negative binomial distribution is also available as + `scipy.stats.nbinom`. Using `nbdtr` directly can be much faster than + calling the ``cdf`` method of `scipy.stats.nbinom`, especially for small + arrays or individual values. To get the same results one must use the + following parametrization: ``nbinom(n, p).cdf(k)=nbdtr(k, n, p)``. + + >>> from scipy.stats import nbinom + >>> k, n, p = 5, 3, 0.5 + >>> nbdtr_res = nbdtr(k, n, p) # this will often be faster than below + >>> stats_res = nbinom(n, p).cdf(k) + >>> stats_res, nbdtr_res # test that results are equal + (0.85546875, 0.85546875) + + `nbdtr` can evaluate different parameter sets by providing arrays with + shapes compatible for broadcasting for `k`, `n` and `p`. Here we compute + the function for three different `k` at four locations `p`, resulting in + a 3x4 array. + + >>> k = np.array([[5], [10], [15]]) + >>> p = np.array([0.3, 0.5, 0.7, 0.9]) + >>> k.shape, p.shape + ((3, 1), (4,)) + + >>> nbdtr(k, 5, p) + array([[0.15026833, 0.62304687, 0.95265101, 0.9998531 ], + [0.48450894, 0.94076538, 0.99932777, 0.99999999], + [0.76249222, 0.99409103, 0.99999445, 1. ]]) + """) + +add_newdoc("nbdtrc", + r""" + nbdtrc(k, n, p, out=None) + + Negative binomial survival function. + + Returns the sum of the terms `k + 1` to infinity of the negative binomial + distribution probability mass function, + + .. math:: + + F = \sum_{j=k + 1}^\infty {{n + j - 1}\choose{j}} p^n (1 - p)^j. + + In a sequence of Bernoulli trials with individual success probabilities + `p`, this is the probability that more than `k` failures precede the nth + success. + + Parameters + ---------- + k : array_like + The maximum number of allowed failures (nonnegative int). + n : array_like + The target number of successes (positive int). + p : array_like + Probability of success in a single event (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + F : scalar or ndarray + The probability of `k + 1` or more failures before `n` successes in a + sequence of events with individual success probability `p`. + + See Also + -------- + nbdtr : Negative binomial cumulative distribution function + nbdtrik : Negative binomial percentile function + scipy.stats.nbinom : Negative binomial distribution + + Notes + ----- + If floating point values are passed for `k` or `n`, they will be truncated + to integers. + + The terms are not summed directly; instead the regularized incomplete beta + function is employed, according to the formula, + + .. math:: + \mathrm{nbdtrc}(k, n, p) = I_{1 - p}(k + 1, n). + + Wrapper for the Cephes [1]_ routine `nbdtrc`. + + The negative binomial distribution is also available as + `scipy.stats.nbinom`. Using `nbdtrc` directly can improve performance + compared to the ``sf`` method of `scipy.stats.nbinom` (see last example). + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Compute the function for ``k=10`` and ``n=5`` at ``p=0.5``. + + >>> import numpy as np + >>> from scipy.special import nbdtrc + >>> nbdtrc(10, 5, 0.5) + 0.059234619140624986 + + Compute the function for ``n=10`` and ``p=0.5`` at several points by + providing a NumPy array or list for `k`. + + >>> nbdtrc([5, 10, 15], 10, 0.5) + array([0.84912109, 0.41190147, 0.11476147]) + + Plot the function for four different parameter sets. + + >>> import matplotlib.pyplot as plt + >>> k = np.arange(130) + >>> n_parameters = [20, 20, 20, 80] + >>> p_parameters = [0.2, 0.5, 0.8, 0.5] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(p_parameters, n_parameters, + ... linestyles)) + >>> fig, ax = plt.subplots(figsize=(8, 8)) + >>> for parameter_set in parameters_list: + ... p, n, style = parameter_set + ... nbdtrc_vals = nbdtrc(k, n, p) + ... ax.plot(k, nbdtrc_vals, label=rf"$n={n},\, p={p}$", + ... ls=style) + >>> ax.legend() + >>> ax.set_xlabel("$k$") + >>> ax.set_title("Negative binomial distribution survival function") + >>> plt.show() + + The negative binomial distribution is also available as + `scipy.stats.nbinom`. Using `nbdtrc` directly can be much faster than + calling the ``sf`` method of `scipy.stats.nbinom`, especially for small + arrays or individual values. To get the same results one must use the + following parametrization: ``nbinom(n, p).sf(k)=nbdtrc(k, n, p)``. + + >>> from scipy.stats import nbinom + >>> k, n, p = 3, 5, 0.5 + >>> nbdtr_res = nbdtrc(k, n, p) # this will often be faster than below + >>> stats_res = nbinom(n, p).sf(k) + >>> stats_res, nbdtr_res # test that results are equal + (0.6367187499999999, 0.6367187499999999) + + `nbdtrc` can evaluate different parameter sets by providing arrays with + shapes compatible for broadcasting for `k`, `n` and `p`. Here we compute + the function for three different `k` at four locations `p`, resulting in + a 3x4 array. + + >>> k = np.array([[5], [10], [15]]) + >>> p = np.array([0.3, 0.5, 0.7, 0.9]) + >>> k.shape, p.shape + ((3, 1), (4,)) + + >>> nbdtrc(k, 5, p) + array([[8.49731667e-01, 3.76953125e-01, 4.73489874e-02, 1.46902600e-04], + [5.15491059e-01, 5.92346191e-02, 6.72234070e-04, 9.29610100e-09], + [2.37507779e-01, 5.90896606e-03, 5.55025308e-06, 3.26346760e-13]]) + """) + +add_newdoc( + "nbdtri", + r""" + nbdtri(k, n, y, out=None) + + Returns the inverse with respect to the parameter `p` of + `y = nbdtr(k, n, p)`, the negative binomial cumulative distribution + function. + + Parameters + ---------- + k : array_like + The maximum number of allowed failures (nonnegative int). + n : array_like + The target number of successes (positive int). + y : array_like + The probability of `k` or fewer failures before `n` successes (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + p : scalar or ndarray + Probability of success in a single event (float) such that + `nbdtr(k, n, p) = y`. + + See Also + -------- + nbdtr : Cumulative distribution function of the negative binomial. + nbdtrc : Negative binomial survival function. + scipy.stats.nbinom : negative binomial distribution. + nbdtrik : Inverse with respect to `k` of `nbdtr(k, n, p)`. + nbdtrin : Inverse with respect to `n` of `nbdtr(k, n, p)`. + scipy.stats.nbinom : Negative binomial distribution + + Notes + ----- + Wrapper for the Cephes [1]_ routine `nbdtri`. + + The negative binomial distribution is also available as + `scipy.stats.nbinom`. Using `nbdtri` directly can improve performance + compared to the ``ppf`` method of `scipy.stats.nbinom`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + `nbdtri` is the inverse of `nbdtr` with respect to `p`. + Up to floating point errors the following holds: + ``nbdtri(k, n, nbdtr(k, n, p))=p``. + + >>> import numpy as np + >>> from scipy.special import nbdtri, nbdtr + >>> k, n, y = 5, 10, 0.2 + >>> cdf_val = nbdtr(k, n, y) + >>> nbdtri(k, n, cdf_val) + 0.20000000000000004 + + Compute the function for ``k=10`` and ``n=5`` at several points by + providing a NumPy array or list for `y`. + + >>> y = np.array([0.1, 0.4, 0.8]) + >>> nbdtri(3, 5, y) + array([0.34462319, 0.51653095, 0.69677416]) + + Plot the function for three different parameter sets. + + >>> import matplotlib.pyplot as plt + >>> n_parameters = [5, 20, 30, 30] + >>> k_parameters = [20, 20, 60, 80] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(n_parameters, k_parameters, linestyles)) + >>> cdf_vals = np.linspace(0, 1, 1000) + >>> fig, ax = plt.subplots(figsize=(8, 8)) + >>> for parameter_set in parameters_list: + ... n, k, style = parameter_set + ... nbdtri_vals = nbdtri(k, n, cdf_vals) + ... ax.plot(cdf_vals, nbdtri_vals, label=rf"$k={k},\ n={n}$", + ... ls=style) + >>> ax.legend() + >>> ax.set_ylabel("$p$") + >>> ax.set_xlabel("$CDF$") + >>> title = "nbdtri: inverse of negative binomial CDF with respect to $p$" + >>> ax.set_title(title) + >>> plt.show() + + `nbdtri` can evaluate different parameter sets by providing arrays with + shapes compatible for broadcasting for `k`, `n` and `p`. Here we compute + the function for three different `k` at four locations `p`, resulting in + a 3x4 array. + + >>> k = np.array([[5], [10], [15]]) + >>> y = np.array([0.3, 0.5, 0.7, 0.9]) + >>> k.shape, y.shape + ((3, 1), (4,)) + + >>> nbdtri(k, 5, y) + array([[0.37258157, 0.45169416, 0.53249956, 0.64578407], + [0.24588501, 0.30451981, 0.36778453, 0.46397088], + [0.18362101, 0.22966758, 0.28054743, 0.36066188]]) + """) + +add_newdoc("nbdtrik", + r""" + nbdtrik(y, n, p, out=None) + + Negative binomial percentile function. + + Returns the inverse with respect to the parameter `k` of + `y = nbdtr(k, n, p)`, the negative binomial cumulative distribution + function. + + Parameters + ---------- + y : array_like + The probability of `k` or fewer failures before `n` successes (float). + n : array_like + The target number of successes (positive int). + p : array_like + Probability of success in a single event (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + k : scalar or ndarray + The maximum number of allowed failures such that `nbdtr(k, n, p) = y`. + + See Also + -------- + nbdtr : Cumulative distribution function of the negative binomial. + nbdtrc : Survival function of the negative binomial. + nbdtri : Inverse with respect to `p` of `nbdtr(k, n, p)`. + nbdtrin : Inverse with respect to `n` of `nbdtr(k, n, p)`. + scipy.stats.nbinom : Negative binomial distribution + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdfnbn`. + + Formula 26.5.26 of [2]_, + + .. math:: + \sum_{j=k + 1}^\infty {{n + j - 1} + \choose{j}} p^n (1 - p)^j = I_{1 - p}(k + 1, n), + + is used to reduce calculation of the cumulative distribution function to + that of a regularized incomplete beta :math:`I`. + + Computation of `k` involves a search for a value that produces the desired + value of `y`. The search relies on the monotonicity of `y` with `k`. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + Examples + -------- + Compute the negative binomial cumulative distribution function for an + exemplary parameter set. + + >>> import numpy as np + >>> from scipy.special import nbdtr, nbdtrik + >>> k, n, p = 5, 2, 0.5 + >>> cdf_value = nbdtr(k, n, p) + >>> cdf_value + 0.9375 + + Verify that `nbdtrik` recovers the original value for `k`. + + >>> nbdtrik(cdf_value, n, p) + 5.0 + + Plot the function for different parameter sets. + + >>> import matplotlib.pyplot as plt + >>> p_parameters = [0.2, 0.5, 0.7, 0.5] + >>> n_parameters = [30, 30, 30, 80] + >>> linestyles = ['solid', 'dashed', 'dotted', 'dashdot'] + >>> parameters_list = list(zip(p_parameters, n_parameters, linestyles)) + >>> cdf_vals = np.linspace(0, 1, 1000) + >>> fig, ax = plt.subplots(figsize=(8, 8)) + >>> for parameter_set in parameters_list: + ... p, n, style = parameter_set + ... nbdtrik_vals = nbdtrik(cdf_vals, n, p) + ... ax.plot(cdf_vals, nbdtrik_vals, label=rf"$n={n},\ p={p}$", + ... ls=style) + >>> ax.legend() + >>> ax.set_ylabel("$k$") + >>> ax.set_xlabel("$CDF$") + >>> ax.set_title("Negative binomial percentile function") + >>> plt.show() + + The negative binomial distribution is also available as + `scipy.stats.nbinom`. The percentile function method ``ppf`` + returns the result of `nbdtrik` rounded up to integers: + + >>> from scipy.stats import nbinom + >>> q, n, p = 0.6, 5, 0.5 + >>> nbinom.ppf(q, n, p), nbdtrik(q, n, p) + (5.0, 4.800428460273882) + + """) + +add_newdoc("nbdtrin", + r""" + nbdtrin(k, y, p, out=None) + + Inverse of `nbdtr` vs `n`. + + Returns the inverse with respect to the parameter `n` of + `y = nbdtr(k, n, p)`, the negative binomial cumulative distribution + function. + + Parameters + ---------- + k : array_like + The maximum number of allowed failures (nonnegative int). + y : array_like + The probability of `k` or fewer failures before `n` successes (float). + p : array_like + Probability of success in a single event (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + n : scalar or ndarray + The number of successes `n` such that `nbdtr(k, n, p) = y`. + + See Also + -------- + nbdtr : Cumulative distribution function of the negative binomial. + nbdtri : Inverse with respect to `p` of `nbdtr(k, n, p)`. + nbdtrik : Inverse with respect to `k` of `nbdtr(k, n, p)`. + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdfnbn`. + + Formula 26.5.26 of [2]_, + + .. math:: + \sum_{j=k + 1}^\infty {{n + j - 1} + \choose{j}} p^n (1 - p)^j = I_{1 - p}(k + 1, n), + + is used to reduce calculation of the cumulative distribution function to + that of a regularized incomplete beta :math:`I`. + + Computation of `n` involves a search for a value that produces the desired + value of `y`. The search relies on the monotonicity of `y` with `n`. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + Examples + -------- + Compute the negative binomial cumulative distribution function for an + exemplary parameter set. + + >>> from scipy.special import nbdtr, nbdtrin + >>> k, n, p = 5, 2, 0.5 + >>> cdf_value = nbdtr(k, n, p) + >>> cdf_value + 0.9375 + + Verify that `nbdtrin` recovers the original value for `n` up to floating + point accuracy. + + >>> nbdtrin(k, cdf_value, p) + 1.999999999998137 + """) + +add_newdoc("ncfdtr", + r""" + ncfdtr(dfn, dfd, nc, f, out=None) + + Cumulative distribution function of the non-central F distribution. + + The non-central F describes the distribution of, + + .. math:: + Z = \frac{X/d_n}{Y/d_d} + + where :math:`X` and :math:`Y` are independently distributed, with + :math:`X` distributed non-central :math:`\chi^2` with noncentrality + parameter `nc` and :math:`d_n` degrees of freedom, and :math:`Y` + distributed :math:`\chi^2` with :math:`d_d` degrees of freedom. + + Parameters + ---------- + dfn : array_like + Degrees of freedom of the numerator sum of squares. Range (0, inf). + dfd : array_like + Degrees of freedom of the denominator sum of squares. Range (0, inf). + nc : array_like + Noncentrality parameter. Should be in range (0, 1e4). + f : array_like + Quantiles, i.e. the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + cdf : scalar or ndarray + The calculated CDF. If all inputs are scalar, the return will be a + float. Otherwise it will be an array. + + See Also + -------- + ncfdtri : Quantile function; inverse of `ncfdtr` with respect to `f`. + ncfdtridfd : Inverse of `ncfdtr` with respect to `dfd`. + ncfdtridfn : Inverse of `ncfdtr` with respect to `dfn`. + ncfdtrinc : Inverse of `ncfdtr` with respect to `nc`. + + Notes + ----- + Wrapper for the CDFLIB [1]_ Fortran routine `cdffnc`. + + The cumulative distribution function is computed using Formula 26.6.20 of + [2]_: + + .. math:: + F(d_n, d_d, n_c, f) = \sum_{j=0}^\infty e^{-n_c/2} + \frac{(n_c/2)^j}{j!} I_{x}(\frac{d_n}{2} + j, \frac{d_d}{2}), + + where :math:`I` is the regularized incomplete beta function, and + :math:`x = f d_n/(f d_n + d_d)`. + + The computation time required for this routine is proportional to the + noncentrality parameter `nc`. Very large values of this parameter can + consume immense computer resources. This is why the search range is + bounded by 10,000. + + References + ---------- + .. [1] Barry Brown, James Lovato, and Kathy Russell, + CDFLIB: Library of Fortran Routines for Cumulative Distribution + Functions, Inverses, and Other Parameters. + .. [2] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> from scipy import stats + >>> import matplotlib.pyplot as plt + + Plot the CDF of the non-central F distribution, for nc=0. Compare with the + F-distribution from scipy.stats: + + >>> x = np.linspace(-1, 8, num=500) + >>> dfn = 3 + >>> dfd = 2 + >>> ncf_stats = stats.f.cdf(x, dfn, dfd) + >>> ncf_special = special.ncfdtr(dfn, dfd, 0, x) + + >>> fig = plt.figure() + >>> ax = fig.add_subplot(111) + >>> ax.plot(x, ncf_stats, 'b-', lw=3) + >>> ax.plot(x, ncf_special, 'r-') + >>> plt.show() + + """) + +add_newdoc("ncfdtri", + """ + ncfdtri(dfn, dfd, nc, p, out=None) + + Inverse with respect to `f` of the CDF of the non-central F distribution. + + See `ncfdtr` for more details. + + Parameters + ---------- + dfn : array_like + Degrees of freedom of the numerator sum of squares. Range (0, inf). + dfd : array_like + Degrees of freedom of the denominator sum of squares. Range (0, inf). + nc : array_like + Noncentrality parameter. Should be in range (0, 1e4). + p : array_like + Value of the cumulative distribution function. Must be in the + range [0, 1]. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + f : scalar or ndarray + Quantiles, i.e., the upper limit of integration. + + See Also + -------- + ncfdtr : CDF of the non-central F distribution. + ncfdtridfd : Inverse of `ncfdtr` with respect to `dfd`. + ncfdtridfn : Inverse of `ncfdtr` with respect to `dfn`. + ncfdtrinc : Inverse of `ncfdtr` with respect to `nc`. + + Examples + -------- + >>> from scipy.special import ncfdtr, ncfdtri + + Compute the CDF for several values of `f`: + + >>> f = [0.5, 1, 1.5] + >>> p = ncfdtr(2, 3, 1.5, f) + >>> p + array([ 0.20782291, 0.36107392, 0.47345752]) + + Compute the inverse. We recover the values of `f`, as expected: + + >>> ncfdtri(2, 3, 1.5, p) + array([ 0.5, 1. , 1.5]) + + """) + +add_newdoc("ncfdtridfd", + """ + ncfdtridfd(dfn, p, nc, f, out=None) + + Calculate degrees of freedom (denominator) for the noncentral F-distribution. + + This is the inverse with respect to `dfd` of `ncfdtr`. + See `ncfdtr` for more details. + + Parameters + ---------- + dfn : array_like + Degrees of freedom of the numerator sum of squares. Range (0, inf). + p : array_like + Value of the cumulative distribution function. Must be in the + range [0, 1]. + nc : array_like + Noncentrality parameter. Should be in range (0, 1e4). + f : array_like + Quantiles, i.e., the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + dfd : scalar or ndarray + Degrees of freedom of the denominator sum of squares. + + See Also + -------- + ncfdtr : CDF of the non-central F distribution. + ncfdtri : Quantile function; inverse of `ncfdtr` with respect to `f`. + ncfdtridfn : Inverse of `ncfdtr` with respect to `dfn`. + ncfdtrinc : Inverse of `ncfdtr` with respect to `nc`. + + Notes + ----- + The value of the cumulative noncentral F distribution is not necessarily + monotone in either degrees of freedom. There thus may be two values that + provide a given CDF value. This routine assumes monotonicity and will + find an arbitrary one of the two values. + + Examples + -------- + >>> from scipy.special import ncfdtr, ncfdtridfd + + Compute the CDF for several values of `dfd`: + + >>> dfd = [1, 2, 3] + >>> p = ncfdtr(2, dfd, 0.25, 15) + >>> p + array([ 0.8097138 , 0.93020416, 0.96787852]) + + Compute the inverse. We recover the values of `dfd`, as expected: + + >>> ncfdtridfd(2, p, 0.25, 15) + array([ 1., 2., 3.]) + + """) + +add_newdoc("ncfdtridfn", + """ + ncfdtridfn(p, dfd, nc, f, out=None) + + Calculate degrees of freedom (numerator) for the noncentral F-distribution. + + This is the inverse with respect to `dfn` of `ncfdtr`. + See `ncfdtr` for more details. + + Parameters + ---------- + p : array_like + Value of the cumulative distribution function. Must be in the + range [0, 1]. + dfd : array_like + Degrees of freedom of the denominator sum of squares. Range (0, inf). + nc : array_like + Noncentrality parameter. Should be in range (0, 1e4). + f : float + Quantiles, i.e., the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + dfn : scalar or ndarray + Degrees of freedom of the numerator sum of squares. + + See Also + -------- + ncfdtr : CDF of the non-central F distribution. + ncfdtri : Quantile function; inverse of `ncfdtr` with respect to `f`. + ncfdtridfd : Inverse of `ncfdtr` with respect to `dfd`. + ncfdtrinc : Inverse of `ncfdtr` with respect to `nc`. + + Notes + ----- + The value of the cumulative noncentral F distribution is not necessarily + monotone in either degrees of freedom. There thus may be two values that + provide a given CDF value. This routine assumes monotonicity and will + find an arbitrary one of the two values. + + Examples + -------- + >>> from scipy.special import ncfdtr, ncfdtridfn + + Compute the CDF for several values of `dfn`: + + >>> dfn = [1, 2, 3] + >>> p = ncfdtr(dfn, 2, 0.25, 15) + >>> p + array([ 0.92562363, 0.93020416, 0.93188394]) + + Compute the inverse. We recover the values of `dfn`, as expected: + + >>> ncfdtridfn(p, 2, 0.25, 15) + array([ 1., 2., 3.]) + + """) + +add_newdoc("ncfdtrinc", + """ + ncfdtrinc(dfn, dfd, p, f, out=None) + + Calculate non-centrality parameter for non-central F distribution. + + This is the inverse with respect to `nc` of `ncfdtr`. + See `ncfdtr` for more details. + + Parameters + ---------- + dfn : array_like + Degrees of freedom of the numerator sum of squares. Range (0, inf). + dfd : array_like + Degrees of freedom of the denominator sum of squares. Range (0, inf). + p : array_like + Value of the cumulative distribution function. Must be in the + range [0, 1]. + f : array_like + Quantiles, i.e., the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + nc : scalar or ndarray + Noncentrality parameter. + + See Also + -------- + ncfdtr : CDF of the non-central F distribution. + ncfdtri : Quantile function; inverse of `ncfdtr` with respect to `f`. + ncfdtridfd : Inverse of `ncfdtr` with respect to `dfd`. + ncfdtridfn : Inverse of `ncfdtr` with respect to `dfn`. + + Examples + -------- + >>> from scipy.special import ncfdtr, ncfdtrinc + + Compute the CDF for several values of `nc`: + + >>> nc = [0.5, 1.5, 2.0] + >>> p = ncfdtr(2, 3, nc, 15) + >>> p + array([ 0.96309246, 0.94327955, 0.93304098]) + + Compute the inverse. We recover the values of `nc`, as expected: + + >>> ncfdtrinc(2, 3, p, 15) + array([ 0.5, 1.5, 2. ]) + + """) + +add_newdoc("nctdtr", + """ + nctdtr(df, nc, t, out=None) + + Cumulative distribution function of the non-central `t` distribution. + + Parameters + ---------- + df : array_like + Degrees of freedom of the distribution. Should be in range (0, inf). + nc : array_like + Noncentrality parameter. Should be in range (-1e6, 1e6). + t : array_like + Quantiles, i.e., the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + cdf : scalar or ndarray + The calculated CDF. If all inputs are scalar, the return will be a + float. Otherwise, it will be an array. + + See Also + -------- + nctdtrit : Inverse CDF (iCDF) of the non-central t distribution. + nctdtridf : Calculate degrees of freedom, given CDF and iCDF values. + nctdtrinc : Calculate non-centrality parameter, given CDF iCDF values. + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> from scipy import stats + >>> import matplotlib.pyplot as plt + + Plot the CDF of the non-central t distribution, for nc=0. Compare with the + t-distribution from scipy.stats: + + >>> x = np.linspace(-5, 5, num=500) + >>> df = 3 + >>> nct_stats = stats.t.cdf(x, df) + >>> nct_special = special.nctdtr(df, 0, x) + + >>> fig = plt.figure() + >>> ax = fig.add_subplot(111) + >>> ax.plot(x, nct_stats, 'b-', lw=3) + >>> ax.plot(x, nct_special, 'r-') + >>> plt.show() + + """) + +add_newdoc("nctdtridf", + """ + nctdtridf(p, nc, t, out=None) + + Calculate degrees of freedom for non-central t distribution. + + See `nctdtr` for more details. + + Parameters + ---------- + p : array_like + CDF values, in range (0, 1]. + nc : array_like + Noncentrality parameter. Should be in range (-1e6, 1e6). + t : array_like + Quantiles, i.e., the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + df : scalar or ndarray + The degrees of freedom. If all inputs are scalar, the return will be a + float. Otherwise, it will be an array. + + See Also + -------- + nctdtr : CDF of the non-central `t` distribution. + nctdtrit : Inverse CDF (iCDF) of the non-central t distribution. + nctdtrinc : Calculate non-centrality parameter, given CDF iCDF values. + + Examples + -------- + >>> from scipy.special import nctdtr, nctdtridf + + Compute the CDF for several values of `df`: + + >>> df = [1, 2, 3] + >>> p = nctdtr(df, 0.25, 1) + >>> p + array([0.67491974, 0.716464 , 0.73349456]) + + Compute the inverse. We recover the values of `df`, as expected: + + >>> nctdtridf(p, 0.25, 1) + array([1., 2., 3.]) + + """) + +add_newdoc("nctdtrinc", + """ + nctdtrinc(df, p, t, out=None) + + Calculate non-centrality parameter for non-central t distribution. + + See `nctdtr` for more details. + + Parameters + ---------- + df : array_like + Degrees of freedom of the distribution. Should be in range (0, inf). + p : array_like + CDF values, in range (0, 1]. + t : array_like + Quantiles, i.e., the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + nc : scalar or ndarray + Noncentrality parameter + + See Also + -------- + nctdtr : CDF of the non-central `t` distribution. + nctdtrit : Inverse CDF (iCDF) of the non-central t distribution. + nctdtridf : Calculate degrees of freedom, given CDF and iCDF values. + + Examples + -------- + >>> from scipy.special import nctdtr, nctdtrinc + + Compute the CDF for several values of `nc`: + + >>> nc = [0.5, 1.5, 2.5] + >>> p = nctdtr(3, nc, 1.5) + >>> p + array([0.77569497, 0.45524533, 0.1668691 ]) + + Compute the inverse. We recover the values of `nc`, as expected: + + >>> nctdtrinc(3, p, 1.5) + array([0.5, 1.5, 2.5]) + + """) + +add_newdoc("nctdtrit", + """ + nctdtrit(df, nc, p, out=None) + + Inverse cumulative distribution function of the non-central t distribution. + + See `nctdtr` for more details. + + Parameters + ---------- + df : array_like + Degrees of freedom of the distribution. Should be in range (0, inf). + nc : array_like + Noncentrality parameter. Should be in range (-1e6, 1e6). + p : array_like + CDF values, in range (0, 1]. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + t : scalar or ndarray + Quantiles + + See Also + -------- + nctdtr : CDF of the non-central `t` distribution. + nctdtridf : Calculate degrees of freedom, given CDF and iCDF values. + nctdtrinc : Calculate non-centrality parameter, given CDF iCDF values. + + Examples + -------- + >>> from scipy.special import nctdtr, nctdtrit + + Compute the CDF for several values of `t`: + + >>> t = [0.5, 1, 1.5] + >>> p = nctdtr(3, 1, t) + >>> p + array([0.29811049, 0.46922687, 0.6257559 ]) + + Compute the inverse. We recover the values of `t`, as expected: + + >>> nctdtrit(3, 1, p) + array([0.5, 1. , 1.5]) + + """) + +add_newdoc("ndtr", + r""" + ndtr(x, out=None) + + Cumulative distribution of the standard normal distribution. + + Returns the area under the standard Gaussian probability + density function, integrated from minus infinity to `x` + + .. math:: + + \frac{1}{\sqrt{2\pi}} \int_{-\infty}^x \exp(-t^2/2) dt + + Parameters + ---------- + x : array_like, real or complex + Argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The value of the normal CDF evaluated at `x` + + See Also + -------- + log_ndtr : Logarithm of ndtr + ndtri : Inverse of ndtr, standard normal percentile function + erf : Error function + erfc : 1 - erf + scipy.stats.norm : Normal distribution + + Examples + -------- + Evaluate `ndtr` at one point. + + >>> import numpy as np + >>> from scipy.special import ndtr + >>> ndtr(0.5) + 0.6914624612740131 + + Evaluate the function at several points by providing a NumPy array + or list for `x`. + + >>> ndtr([0, 0.5, 2]) + array([0.5 , 0.69146246, 0.97724987]) + + Plot the function. + + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(-5, 5, 100) + >>> fig, ax = plt.subplots() + >>> ax.plot(x, ndtr(x)) + >>> ax.set_title(r"Standard normal cumulative distribution function $\Phi$") + >>> plt.show() + """) + + +add_newdoc("nrdtrimn", + """ + nrdtrimn(p, std, x, out=None) + + Calculate mean of normal distribution given other params. + + Parameters + ---------- + p : array_like + CDF values, in range (0, 1]. + std : array_like + Standard deviation. + x : array_like + Quantiles, i.e. the upper limit of integration. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + mn : scalar or ndarray + The mean of the normal distribution. + + See Also + -------- + scipy.stats.norm : Normal distribution + ndtr : Standard normal cumulative probability distribution + ndtri : Inverse of standard normal CDF with respect to quantile + nrdtrisd : Inverse of normal distribution CDF with respect to + standard deviation + + Examples + -------- + `nrdtrimn` can be used to recover the mean of a normal distribution + if we know the CDF value `p` for a given quantile `x` and the + standard deviation `std`. First, we calculate + the normal distribution CDF for an exemplary parameter set. + + >>> from scipy.stats import norm + >>> mean = 3. + >>> std = 2. + >>> x = 6. + >>> p = norm.cdf(x, loc=mean, scale=std) + >>> p + 0.9331927987311419 + + Verify that `nrdtrimn` returns the original value for `mean`. + + >>> from scipy.special import nrdtrimn + >>> nrdtrimn(p, std, x) + 3.0000000000000004 + + """) + +add_newdoc("nrdtrisd", + """ + nrdtrisd(mn, p, x, out=None) + + Calculate standard deviation of normal distribution given other params. + + Parameters + ---------- + mn : scalar or ndarray + The mean of the normal distribution. + p : array_like + CDF values, in range (0, 1]. + x : array_like + Quantiles, i.e. the upper limit of integration. + + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + std : scalar or ndarray + Standard deviation. + + See Also + -------- + scipy.stats.norm : Normal distribution + ndtr : Standard normal cumulative probability distribution + ndtri : Inverse of standard normal CDF with respect to quantile + nrdtrimn : Inverse of normal distribution CDF with respect to + mean + + Examples + -------- + `nrdtrisd` can be used to recover the standard deviation of a normal + distribution if we know the CDF value `p` for a given quantile `x` and + the mean `mn`. First, we calculate the normal distribution CDF for an + exemplary parameter set. + + >>> from scipy.stats import norm + >>> mean = 3. + >>> std = 2. + >>> x = 6. + >>> p = norm.cdf(x, loc=mean, scale=std) + >>> p + 0.9331927987311419 + + Verify that `nrdtrisd` returns the original value for `std`. + + >>> from scipy.special import nrdtrisd + >>> nrdtrisd(mean, p, x) + 2.0000000000000004 + + """) + +add_newdoc("log_ndtr", + """ + log_ndtr(x, out=None) + + Logarithm of Gaussian cumulative distribution function. + + Returns the log of the area under the standard Gaussian probability + density function, integrated from minus infinity to `x`:: + + log(1/sqrt(2*pi) * integral(exp(-t**2 / 2), t=-inf..x)) + + Parameters + ---------- + x : array_like, real or complex + Argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The value of the log of the normal CDF evaluated at `x` + + See Also + -------- + erf + erfc + scipy.stats.norm + ndtr + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import log_ndtr, ndtr + + The benefit of ``log_ndtr(x)`` over the naive implementation + ``np.log(ndtr(x))`` is most evident with moderate to large positive + values of ``x``: + + >>> x = np.array([6, 7, 9, 12, 15, 25]) + >>> log_ndtr(x) + array([-9.86587646e-010, -1.27981254e-012, -1.12858841e-019, + -1.77648211e-033, -3.67096620e-051, -3.05669671e-138]) + + The results of the naive calculation for the moderate ``x`` values + have only 5 or 6 correct significant digits. For values of ``x`` + greater than approximately 8.3, the naive expression returns 0: + + >>> np.log(ndtr(x)) + array([-9.86587701e-10, -1.27986510e-12, 0.00000000e+00, + 0.00000000e+00, 0.00000000e+00, 0.00000000e+00]) + """) + +add_newdoc("ndtri", + """ + ndtri(y, out=None) + + Inverse of `ndtr` vs x + + Returns the argument x for which the area under the standard normal + probability density function (integrated from minus infinity to `x`) + is equal to y. + + Parameters + ---------- + p : array_like + Probability + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + x : scalar or ndarray + Value of x such that ``ndtr(x) == p``. + + See Also + -------- + ndtr : Standard normal cumulative probability distribution + ndtri_exp : Inverse of log_ndtr + + Examples + -------- + `ndtri` is the percentile function of the standard normal distribution. + This means it returns the inverse of the cumulative density `ndtr`. First, + let us compute a cumulative density value. + + >>> import numpy as np + >>> from scipy.special import ndtri, ndtr + >>> cdf_val = ndtr(2) + >>> cdf_val + 0.9772498680518208 + + Verify that `ndtri` yields the original value for `x` up to floating point + errors. + + >>> ndtri(cdf_val) + 2.0000000000000004 + + Plot the function. For that purpose, we provide a NumPy array as argument. + + >>> import matplotlib.pyplot as plt + >>> x = np.linspace(0.01, 1, 200) + >>> fig, ax = plt.subplots() + >>> ax.plot(x, ndtri(x)) + >>> ax.set_title("Standard normal percentile function") + >>> plt.show() + """) + +add_newdoc("obl_ang1", + """ + obl_ang1(m, n, c, x, out=None) + + Oblate spheroidal angular function of the first kind and its derivative + + Computes the oblate spheroidal angular function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. + + Parameters + ---------- + m : array_like + Mode parameter m (nonnegative) + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + x : array_like + Parameter x (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + obl_ang1_cv + + """) + +add_newdoc("obl_ang1_cv", + """ + obl_ang1_cv(m, n, c, cv, x, out=None) + + Oblate spheroidal angular function obl_ang1 for precomputed characteristic value + + Computes the oblate spheroidal angular function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. Requires + pre-computed characteristic value. + + Parameters + ---------- + m : array_like + Mode parameter m (nonnegative) + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + cv : array_like + Characteristic value + x : array_like + Parameter x (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + obl_ang1 + + """) + +add_newdoc("obl_cv", + """ + obl_cv(m, n, c, out=None) + + Characteristic value of oblate spheroidal function + + Computes the characteristic value of oblate spheroidal wave + functions of order `m`, `n` (n>=m) and spheroidal parameter `c`. + + Parameters + ---------- + m : array_like + Mode parameter m (nonnegative) + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + cv : scalar or ndarray + Characteristic value + + """) + +add_newdoc("obl_rad1", + """ + obl_rad1(m, n, c, x, out=None) + + Oblate spheroidal radial function of the first kind and its derivative + + Computes the oblate spheroidal radial function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. + + Parameters + ---------- + m : array_like + Mode parameter m (nonnegative) + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + x : array_like + Parameter x (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + obl_rad1_cv + + """) + +add_newdoc("obl_rad1_cv", + """ + obl_rad1_cv(m, n, c, cv, x, out=None) + + Oblate spheroidal radial function obl_rad1 for precomputed characteristic value + + Computes the oblate spheroidal radial function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. Requires + pre-computed characteristic value. + + Parameters + ---------- + m : array_like + Mode parameter m (nonnegative) + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + cv : array_like + Characteristic value + x : array_like + Parameter x (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + obl_rad1 + + """) + +add_newdoc("obl_rad2", + """ + obl_rad2(m, n, c, x, out=None) + + Oblate spheroidal radial function of the second kind and its derivative. + + Computes the oblate spheroidal radial function of the second kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. + + Parameters + ---------- + m : array_like + Mode parameter m (nonnegative) + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + x : array_like + Parameter x (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + obl_rad2_cv + + """) + +add_newdoc("obl_rad2_cv", + """ + obl_rad2_cv(m, n, c, cv, x, out=None) + + Oblate spheroidal radial function obl_rad2 for precomputed characteristic value + + Computes the oblate spheroidal radial function of the second kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. Requires + pre-computed characteristic value. + + Parameters + ---------- + m : array_like + Mode parameter m (nonnegative) + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + cv : array_like + Characteristic value + x : array_like + Parameter x (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + + See Also + -------- + obl_rad2 + """) + +add_newdoc("pbdv", + """ + pbdv(v, x, out=None) + + Parabolic cylinder function D + + Returns (d, dp) the parabolic cylinder function Dv(x) in d and the + derivative, Dv'(x) in dp. + + Parameters + ---------- + v : array_like + Real parameter + x : array_like + Real argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + d : scalar or ndarray + Value of the function + dp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pbvv", + """ + pbvv(v, x, out=None) + + Parabolic cylinder function V + + Returns the parabolic cylinder function Vv(x) in v and the + derivative, Vv'(x) in vp. + + Parameters + ---------- + v : array_like + Real parameter + x : array_like + Real argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + v : scalar or ndarray + Value of the function + vp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pbwa", + r""" + pbwa(a, x, out=None) + + Parabolic cylinder function W. + + The function is a particular solution to the differential equation + + .. math:: + + y'' + \left(\frac{1}{4}x^2 - a\right)y = 0, + + for a full definition see section 12.14 in [1]_. + + Parameters + ---------- + a : array_like + Real parameter + x : array_like + Real argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + w : scalar or ndarray + Value of the function + wp : scalar or ndarray + Value of the derivative in x + + Notes + ----- + The function is a wrapper for a Fortran routine by Zhang and Jin + [2]_. The implementation is accurate only for ``|a|, |x| < 5`` and + returns NaN outside that range. + + References + ---------- + .. [1] Digital Library of Mathematical Functions, 14.30. + https://dlmf.nist.gov/14.30 + .. [2] Zhang, Shanjie and Jin, Jianming. "Computation of Special + Functions", John Wiley and Sons, 1996. + https://people.sc.fsu.edu/~jburkardt/f_src/special_functions/special_functions.html + """) + +add_newdoc("pdtr", + r""" + pdtr(k, m, out=None) + + Poisson cumulative distribution function. + + Defined as the probability that a Poisson-distributed random + variable with event rate :math:`m` is less than or equal to + :math:`k`. More concretely, this works out to be [1]_ + + .. math:: + + \exp(-m) \sum_{j = 0}^{\lfloor{k}\rfloor} \frac{m^j}{j!}. + + Parameters + ---------- + k : array_like + Number of occurrences (nonnegative, real) + m : array_like + Shape parameter (nonnegative, real) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the Poisson cumulative distribution function + + See Also + -------- + pdtrc : Poisson survival function + pdtrik : inverse of `pdtr` with respect to `k` + pdtri : inverse of `pdtr` with respect to `m` + + References + ---------- + .. [1] https://en.wikipedia.org/wiki/Poisson_distribution + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is a cumulative distribution function, so it converges to 1 + monotonically as `k` goes to infinity. + + >>> sc.pdtr([1, 10, 100, np.inf], 1) + array([0.73575888, 0.99999999, 1. , 1. ]) + + It is discontinuous at integers and constant between integers. + + >>> sc.pdtr([1, 1.5, 1.9, 2], 1) + array([0.73575888, 0.73575888, 0.73575888, 0.9196986 ]) + + """) + +add_newdoc("pdtrc", + """ + pdtrc(k, m, out=None) + + Poisson survival function + + Returns the sum of the terms from k+1 to infinity of the Poisson + distribution: sum(exp(-m) * m**j / j!, j=k+1..inf) = gammainc( + k+1, m). Arguments must both be non-negative doubles. + + Parameters + ---------- + k : array_like + Number of occurrences (nonnegative, real) + m : array_like + Shape parameter (nonnegative, real) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the Poisson survival function + + See Also + -------- + pdtr : Poisson cumulative distribution function + pdtrik : inverse of `pdtr` with respect to `k` + pdtri : inverse of `pdtr` with respect to `m` + + """) + +add_newdoc("pdtri", + """ + pdtri(k, y, out=None) + + Inverse to `pdtr` vs m + + Returns the Poisson variable `m` such that the sum from 0 to `k` of + the Poisson density is equal to the given probability `y`: + calculated by ``gammaincinv(k + 1, y)``. `k` must be a nonnegative + integer and `y` between 0 and 1. + + Parameters + ---------- + k : array_like + Number of occurrences (nonnegative, real) + y : array_like + Probability + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of the shape parameter `m` such that ``pdtr(k, m) = p`` + + See Also + -------- + pdtr : Poisson cumulative distribution function + pdtrc : Poisson survival function + pdtrik : inverse of `pdtr` with respect to `k` + + """) + +add_newdoc("pdtrik", + """ + pdtrik(p, m, out=None) + + Inverse to `pdtr` vs `m`. + + Parameters + ---------- + m : array_like + Shape parameter (nonnegative, real) + p : array_like + Probability + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The number of occurrences `k` such that ``pdtr(k, m) = p`` + + See Also + -------- + pdtr : Poisson cumulative distribution function + pdtrc : Poisson survival function + pdtri : inverse of `pdtr` with respect to `m` + + """) + +add_newdoc("poch", + r""" + poch(z, m, out=None) + + Pochhammer symbol. + + The Pochhammer symbol (rising factorial) is defined as + + .. math:: + + (z)_m = \frac{\Gamma(z + m)}{\Gamma(z)} + + For positive integer `m` it reads + + .. math:: + + (z)_m = z (z + 1) ... (z + m - 1) + + See [dlmf]_ for more details. + + Parameters + ---------- + z, m : array_like + Real-valued arguments. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The value of the function. + + References + ---------- + .. [dlmf] Nist, Digital Library of Mathematical Functions + https://dlmf.nist.gov/5.2#iii + + Examples + -------- + >>> import scipy.special as sc + + It is 1 when m is 0. + + >>> sc.poch([1, 2, 3, 4], 0) + array([1., 1., 1., 1.]) + + For z equal to 1 it reduces to the factorial function. + + >>> sc.poch(1, 5) + 120.0 + >>> 1 * 2 * 3 * 4 * 5 + 120 + + It can be expressed in terms of the gamma function. + + >>> z, m = 3.7, 2.1 + >>> sc.poch(z, m) + 20.529581933776953 + >>> sc.gamma(z + m) / sc.gamma(z) + 20.52958193377696 + + """) + +add_newdoc("powm1", """ + powm1(x, y, out=None) + + Computes ``x**y - 1``. + + This function is useful when `y` is near 0, or when `x` is near 1. + + The function is implemented for real types only (unlike ``numpy.power``, + which accepts complex inputs). + + Parameters + ---------- + x : array_like + The base. Must be a real type (i.e. integer or float, not complex). + y : array_like + The exponent. Must be a real type (i.e. integer or float, not complex). + + Returns + ------- + array_like + Result of the calculation + + Notes + ----- + .. versionadded:: 1.10.0 + + The underlying code is implemented for single precision and double + precision floats only. Unlike `numpy.power`, integer inputs to + `powm1` are converted to floating point, and complex inputs are + not accepted. + + Note the following edge cases: + + * ``powm1(x, 0)`` returns 0 for any ``x``, including 0, ``inf`` + and ``nan``. + * ``powm1(1, y)`` returns 0 for any ``y``, including ``nan`` + and ``inf``. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import powm1 + + >>> x = np.array([1.2, 10.0, 0.9999999975]) + >>> y = np.array([1e-9, 1e-11, 0.1875]) + >>> powm1(x, y) + array([ 1.82321557e-10, 2.30258509e-11, -4.68749998e-10]) + + It can be verified that the relative errors in those results + are less than 2.5e-16. + + Compare that to the result of ``x**y - 1``, where the + relative errors are all larger than 8e-8: + + >>> x**y - 1 + array([ 1.82321491e-10, 2.30258035e-11, -4.68750039e-10]) + + """) + + +add_newdoc("pro_ang1", + """ + pro_ang1(m, n, c, x, out=None) + + Prolate spheroidal angular function of the first kind and its derivative + + Computes the prolate spheroidal angular function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. + + Parameters + ---------- + m : array_like + Nonnegative mode parameter m + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + x : array_like + Real parameter (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pro_ang1_cv", + """ + pro_ang1_cv(m, n, c, cv, x, out=None) + + Prolate spheroidal angular function pro_ang1 for precomputed characteristic value + + Computes the prolate spheroidal angular function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. Requires + pre-computed characteristic value. + + Parameters + ---------- + m : array_like + Nonnegative mode parameter m + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + cv : array_like + Characteristic value + x : array_like + Real parameter (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pro_cv", + """ + pro_cv(m, n, c, out=None) + + Characteristic value of prolate spheroidal function + + Computes the characteristic value of prolate spheroidal wave + functions of order `m`, `n` (n>=m) and spheroidal parameter `c`. + + Parameters + ---------- + m : array_like + Nonnegative mode parameter m + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + cv : scalar or ndarray + Characteristic value + """) + +add_newdoc("pro_rad1", + """ + pro_rad1(m, n, c, x, out=None) + + Prolate spheroidal radial function of the first kind and its derivative + + Computes the prolate spheroidal radial function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. + + Parameters + ---------- + m : array_like + Nonnegative mode parameter m + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + x : array_like + Real parameter (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pro_rad1_cv", + """ + pro_rad1_cv(m, n, c, cv, x, out=None) + + Prolate spheroidal radial function pro_rad1 for precomputed characteristic value + + Computes the prolate spheroidal radial function of the first kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. Requires + pre-computed characteristic value. + + Parameters + ---------- + m : array_like + Nonnegative mode parameter m + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + cv : array_like + Characteristic value + x : array_like + Real parameter (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pro_rad2", + """ + pro_rad2(m, n, c, x, out=None) + + Prolate spheroidal radial function of the second kind and its derivative + + Computes the prolate spheroidal radial function of the second kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. + + Parameters + ---------- + m : array_like + Nonnegative mode parameter m + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + cv : array_like + Characteristic value + x : array_like + Real parameter (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pro_rad2_cv", + """ + pro_rad2_cv(m, n, c, cv, x, out=None) + + Prolate spheroidal radial function pro_rad2 for precomputed characteristic value + + Computes the prolate spheroidal radial function of the second kind + and its derivative (with respect to `x`) for mode parameters m>=0 + and n>=m, spheroidal parameter `c` and ``|x| < 1.0``. Requires + pre-computed characteristic value. + + Parameters + ---------- + m : array_like + Nonnegative mode parameter m + n : array_like + Mode parameter n (>= m) + c : array_like + Spheroidal parameter + cv : array_like + Characteristic value + x : array_like + Real parameter (``|x| < 1.0``) + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Value of the function + sp : scalar or ndarray + Value of the derivative vs x + """) + +add_newdoc("pseudo_huber", + r""" + pseudo_huber(delta, r, out=None) + + Pseudo-Huber loss function. + + .. math:: \mathrm{pseudo\_huber}(\delta, r) = + \delta^2 \left( \sqrt{ 1 + \left( \frac{r}{\delta} \right)^2 } - 1 \right) + + Parameters + ---------- + delta : array_like + Input array, indicating the soft quadratic vs. linear loss changepoint. + r : array_like + Input array, possibly representing residuals. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + res : scalar or ndarray + The computed Pseudo-Huber loss function values. + + See Also + -------- + huber: Similar function which this function approximates + + Notes + ----- + Like `huber`, `pseudo_huber` often serves as a robust loss function + in statistics or machine learning to reduce the influence of outliers. + Unlike `huber`, `pseudo_huber` is smooth. + + Typically, `r` represents residuals, the difference + between a model prediction and data. Then, for :math:`|r|\leq\delta`, + `pseudo_huber` resembles the squared error and for :math:`|r|>\delta` the + absolute error. This way, the Pseudo-Huber loss often achieves + a fast convergence in model fitting for small residuals like the squared + error loss function and still reduces the influence of outliers + (:math:`|r|>\delta`) like the absolute error loss. As :math:`\delta` is + the cutoff between squared and absolute error regimes, it has + to be tuned carefully for each problem. `pseudo_huber` is also + convex, making it suitable for gradient based optimization. [1]_ [2]_ + + .. versionadded:: 0.15.0 + + References + ---------- + .. [1] Hartley, Zisserman, "Multiple View Geometry in Computer Vision". + 2003. Cambridge University Press. p. 619 + .. [2] Charbonnier et al. "Deterministic edge-preserving regularization + in computed imaging". 1997. IEEE Trans. Image Processing. + 6 (2): 298 - 311. + + Examples + -------- + Import all necessary modules. + + >>> import numpy as np + >>> from scipy.special import pseudo_huber, huber + >>> import matplotlib.pyplot as plt + + Calculate the function for ``delta=1`` at ``r=2``. + + >>> pseudo_huber(1., 2.) + 1.2360679774997898 + + Calculate the function at ``r=2`` for different `delta` by providing + a list or NumPy array for `delta`. + + >>> pseudo_huber([1., 2., 4.], 3.) + array([2.16227766, 3.21110255, 4. ]) + + Calculate the function for ``delta=1`` at several points by providing + a list or NumPy array for `r`. + + >>> pseudo_huber(2., np.array([1., 1.5, 3., 4.])) + array([0.47213595, 1. , 3.21110255, 4.94427191]) + + The function can be calculated for different `delta` and `r` by + providing arrays for both with compatible shapes for broadcasting. + + >>> r = np.array([1., 2.5, 8., 10.]) + >>> deltas = np.array([[1.], [5.], [9.]]) + >>> print(r.shape, deltas.shape) + (4,) (3, 1) + + >>> pseudo_huber(deltas, r) + array([[ 0.41421356, 1.6925824 , 7.06225775, 9.04987562], + [ 0.49509757, 2.95084972, 22.16990566, 30.90169944], + [ 0.49846624, 3.06693762, 27.37435121, 40.08261642]]) + + Plot the function for different `delta`. + + >>> x = np.linspace(-4, 4, 500) + >>> deltas = [1, 2, 3] + >>> linestyles = ["dashed", "dotted", "dashdot"] + >>> fig, ax = plt.subplots() + >>> combined_plot_parameters = list(zip(deltas, linestyles)) + >>> for delta, style in combined_plot_parameters: + ... ax.plot(x, pseudo_huber(delta, x), label=rf"$\delta={delta}$", + ... ls=style) + >>> ax.legend(loc="upper center") + >>> ax.set_xlabel("$x$") + >>> ax.set_title(r"Pseudo-Huber loss function $h_{\delta}(x)$") + >>> ax.set_xlim(-4, 4) + >>> ax.set_ylim(0, 8) + >>> plt.show() + + Finally, illustrate the difference between `huber` and `pseudo_huber` by + plotting them and their gradients with respect to `r`. The plot shows + that `pseudo_huber` is continuously differentiable while `huber` is not + at the points :math:`\pm\delta`. + + >>> def huber_grad(delta, x): + ... grad = np.copy(x) + ... linear_area = np.argwhere(np.abs(x) > delta) + ... grad[linear_area]=delta*np.sign(x[linear_area]) + ... return grad + >>> def pseudo_huber_grad(delta, x): + ... return x* (1+(x/delta)**2)**(-0.5) + >>> x=np.linspace(-3, 3, 500) + >>> delta = 1. + >>> fig, ax = plt.subplots(figsize=(7, 7)) + >>> ax.plot(x, huber(delta, x), label="Huber", ls="dashed") + >>> ax.plot(x, huber_grad(delta, x), label="Huber Gradient", ls="dashdot") + >>> ax.plot(x, pseudo_huber(delta, x), label="Pseudo-Huber", ls="dotted") + >>> ax.plot(x, pseudo_huber_grad(delta, x), label="Pseudo-Huber Gradient", + ... ls="solid") + >>> ax.legend(loc="upper center") + >>> plt.show() + """) + +add_newdoc("psi", + """ + psi(z, out=None) + + The digamma function. + + The logarithmic derivative of the gamma function evaluated at ``z``. + + Parameters + ---------- + z : array_like + Real or complex argument. + out : ndarray, optional + Array for the computed values of ``psi``. + + Returns + ------- + digamma : scalar or ndarray + Computed values of ``psi``. + + Notes + ----- + For large values not close to the negative real axis, ``psi`` is + computed using the asymptotic series (5.11.2) from [1]_. For small + arguments not close to the negative real axis, the recurrence + relation (5.5.2) from [1]_ is used until the argument is large + enough to use the asymptotic series. For values close to the + negative real axis, the reflection formula (5.5.4) from [1]_ is + used first. Note that ``psi`` has a family of zeros on the + negative real axis which occur between the poles at nonpositive + integers. Around the zeros the reflection formula suffers from + cancellation and the implementation loses precision. The sole + positive zero and the first negative zero, however, are handled + separately by precomputing series expansions using [2]_, so the + function should maintain full accuracy around the origin. + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/5 + .. [2] Fredrik Johansson and others. + "mpmath: a Python library for arbitrary-precision floating-point arithmetic" + (Version 0.19) http://mpmath.org/ + + Examples + -------- + >>> from scipy.special import psi + >>> z = 3 + 4j + >>> psi(z) + (1.55035981733341+1.0105022091860445j) + + Verify psi(z) = psi(z + 1) - 1/z: + + >>> psi(z + 1) - 1/z + (1.55035981733341+1.0105022091860445j) + """) + +add_newdoc("radian", + """ + radian(d, m, s, out=None) + + Convert from degrees to radians. + + Returns the angle given in (d)egrees, (m)inutes, and (s)econds in + radians. + + Parameters + ---------- + d : array_like + Degrees, can be real-valued. + m : array_like + Minutes, can be real-valued. + s : array_like + Seconds, can be real-valued. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Values of the inputs in radians. + + Examples + -------- + >>> import scipy.special as sc + + There are many ways to specify an angle. + + >>> sc.radian(90, 0, 0) + 1.5707963267948966 + >>> sc.radian(0, 60 * 90, 0) + 1.5707963267948966 + >>> sc.radian(0, 0, 60**2 * 90) + 1.5707963267948966 + + The inputs can be real-valued. + + >>> sc.radian(1.5, 0, 0) + 0.02617993877991494 + >>> sc.radian(1, 30, 0) + 0.02617993877991494 + + """) + +add_newdoc("rel_entr", + r""" + rel_entr(x, y, out=None) + + Elementwise function for computing relative entropy. + + .. math:: + + \mathrm{rel\_entr}(x, y) = + \begin{cases} + x \log(x / y) & x > 0, y > 0 \\ + 0 & x = 0, y \ge 0 \\ + \infty & \text{otherwise} + \end{cases} + + Parameters + ---------- + x, y : array_like + Input arrays + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Relative entropy of the inputs + + See Also + -------- + entr, kl_div, scipy.stats.entropy + + Notes + ----- + .. versionadded:: 0.15.0 + + This function is jointly convex in x and y. + + The origin of this function is in convex programming; see + [1]_. Given two discrete probability distributions :math:`p_1, + \ldots, p_n` and :math:`q_1, \ldots, q_n`, the definition of relative + entropy in the context of *information theory* is + + .. math:: + + \sum_{i = 1}^n \mathrm{rel\_entr}(p_i, q_i). + + To compute the latter quantity, use `scipy.stats.entropy`. + + See [2]_ for details. + + References + ---------- + .. [1] Boyd, Stephen and Lieven Vandenberghe. *Convex optimization*. + Cambridge University Press, 2004. + :doi:`https://doi.org/10.1017/CBO9780511804441` + .. [2] Kullback-Leibler divergence, + https://en.wikipedia.org/wiki/Kullback%E2%80%93Leibler_divergence + + """) + +add_newdoc("rgamma", + r""" + rgamma(z, out=None) + + Reciprocal of the gamma function. + + Defined as :math:`1 / \Gamma(z)`, where :math:`\Gamma` is the + gamma function. For more on the gamma function see `gamma`. + + Parameters + ---------- + z : array_like + Real or complex valued input + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Function results + + See Also + -------- + gamma, gammaln, loggamma + + Notes + ----- + The gamma function has no zeros and has simple poles at + nonpositive integers, so `rgamma` is an entire function with zeros + at the nonpositive integers. See the discussion in [dlmf]_ for + more details. + + References + ---------- + .. [dlmf] Nist, Digital Library of Mathematical functions, + https://dlmf.nist.gov/5.2#i + + Examples + -------- + >>> import scipy.special as sc + + It is the reciprocal of the gamma function. + + >>> sc.rgamma([1, 2, 3, 4]) + array([1. , 1. , 0.5 , 0.16666667]) + >>> 1 / sc.gamma([1, 2, 3, 4]) + array([1. , 1. , 0.5 , 0.16666667]) + + It is zero at nonpositive integers. + + >>> sc.rgamma([0, -1, -2, -3]) + array([0., 0., 0., 0.]) + + It rapidly underflows to zero along the positive real axis. + + >>> sc.rgamma([10, 100, 179]) + array([2.75573192e-006, 1.07151029e-156, 0.00000000e+000]) + + """) + +add_newdoc("round", + """ + round(x, out=None) + + Round to the nearest integer. + + Returns the nearest integer to `x`. If `x` ends in 0.5 exactly, + the nearest even integer is chosen. + + Parameters + ---------- + x : array_like + Real valued input. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + The nearest integers to the elements of `x`. The result is of + floating type, not integer type. + + Examples + -------- + >>> import scipy.special as sc + + It rounds to even. + + >>> sc.round([0.5, 1.5]) + array([0., 2.]) + + """) + +add_newdoc("shichi", + r""" + shichi(x, out=None) + + Hyperbolic sine and cosine integrals. + + The hyperbolic sine integral is + + .. math:: + + \int_0^x \frac{\sinh{t}}{t}dt + + and the hyperbolic cosine integral is + + .. math:: + + \gamma + \log(x) + \int_0^x \frac{\cosh{t} - 1}{t} dt + + where :math:`\gamma` is Euler's constant and :math:`\log` is the + principal branch of the logarithm [1]_. + + Parameters + ---------- + x : array_like + Real or complex points at which to compute the hyperbolic sine + and cosine integrals. + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + si : scalar or ndarray + Hyperbolic sine integral at ``x`` + ci : scalar or ndarray + Hyperbolic cosine integral at ``x`` + + See Also + -------- + sici : Sine and cosine integrals. + exp1 : Exponential integral E1. + expi : Exponential integral Ei. + + Notes + ----- + For real arguments with ``x < 0``, ``chi`` is the real part of the + hyperbolic cosine integral. For such points ``chi(x)`` and ``chi(x + + 0j)`` differ by a factor of ``1j*pi``. + + For real arguments the function is computed by calling Cephes' + [2]_ *shichi* routine. For complex arguments the algorithm is based + on Mpmath's [3]_ *shi* and *chi* routines. + + References + ---------- + .. [1] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + (See Section 5.2.) + .. [2] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + .. [3] Fredrik Johansson and others. + "mpmath: a Python library for arbitrary-precision floating-point + arithmetic" (Version 0.19) http://mpmath.org/ + + Examples + -------- + >>> import numpy as np + >>> import matplotlib.pyplot as plt + >>> from scipy.special import shichi, sici + + `shichi` accepts real or complex input: + + >>> shichi(0.5) + (0.5069967498196671, -0.05277684495649357) + >>> shichi(0.5 + 2.5j) + ((0.11772029666668238+1.831091777729851j), + (0.29912435887648825+1.7395351121166562j)) + + The hyperbolic sine and cosine integrals Shi(z) and Chi(z) are + related to the sine and cosine integrals Si(z) and Ci(z) by + + * Shi(z) = -i*Si(i*z) + * Chi(z) = Ci(-i*z) + i*pi/2 + + >>> z = 0.25 + 5j + >>> shi, chi = shichi(z) + >>> shi, -1j*sici(1j*z)[0] # Should be the same. + ((-0.04834719325101729+1.5469354086921228j), + (-0.04834719325101729+1.5469354086921228j)) + >>> chi, sici(-1j*z)[1] + 1j*np.pi/2 # Should be the same. + ((-0.19568708973868087+1.556276312103824j), + (-0.19568708973868087+1.556276312103824j)) + + Plot the functions evaluated on the real axis: + + >>> xp = np.geomspace(1e-8, 4.0, 250) + >>> x = np.concatenate((-xp[::-1], xp)) + >>> shi, chi = shichi(x) + + >>> fig, ax = plt.subplots() + >>> ax.plot(x, shi, label='Shi(x)') + >>> ax.plot(x, chi, '--', label='Chi(x)') + >>> ax.set_xlabel('x') + >>> ax.set_title('Hyperbolic Sine and Cosine Integrals') + >>> ax.legend(shadow=True, framealpha=1, loc='lower right') + >>> ax.grid(True) + >>> plt.show() + + """) + +add_newdoc("sici", + r""" + sici(x, out=None) + + Sine and cosine integrals. + + The sine integral is + + .. math:: + + \int_0^x \frac{\sin{t}}{t}dt + + and the cosine integral is + + .. math:: + + \gamma + \log(x) + \int_0^x \frac{\cos{t} - 1}{t}dt + + where :math:`\gamma` is Euler's constant and :math:`\log` is the + principal branch of the logarithm [1]_. + + Parameters + ---------- + x : array_like + Real or complex points at which to compute the sine and cosine + integrals. + out : tuple of ndarray, optional + Optional output arrays for the function results + + Returns + ------- + si : scalar or ndarray + Sine integral at ``x`` + ci : scalar or ndarray + Cosine integral at ``x`` + + See Also + -------- + shichi : Hyperbolic sine and cosine integrals. + exp1 : Exponential integral E1. + expi : Exponential integral Ei. + + Notes + ----- + For real arguments with ``x < 0``, ``ci`` is the real part of the + cosine integral. For such points ``ci(x)`` and ``ci(x + 0j)`` + differ by a factor of ``1j*pi``. + + For real arguments the function is computed by calling Cephes' + [2]_ *sici* routine. For complex arguments the algorithm is based + on Mpmath's [3]_ *si* and *ci* routines. + + References + ---------- + .. [1] Milton Abramowitz and Irene A. Stegun, eds. + Handbook of Mathematical Functions with Formulas, + Graphs, and Mathematical Tables. New York: Dover, 1972. + (See Section 5.2.) + .. [2] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + .. [3] Fredrik Johansson and others. + "mpmath: a Python library for arbitrary-precision floating-point + arithmetic" (Version 0.19) http://mpmath.org/ + + Examples + -------- + >>> import numpy as np + >>> import matplotlib.pyplot as plt + >>> from scipy.special import sici, exp1 + + `sici` accepts real or complex input: + + >>> sici(2.5) + (1.7785201734438267, 0.2858711963653835) + >>> sici(2.5 + 3j) + ((4.505735874563953+0.06863305018999577j), + (0.0793644206906966-2.935510262937543j)) + + For z in the right half plane, the sine and cosine integrals are + related to the exponential integral E1 (implemented in SciPy as + `scipy.special.exp1`) by + + * Si(z) = (E1(i*z) - E1(-i*z))/2i + pi/2 + * Ci(z) = -(E1(i*z) + E1(-i*z))/2 + + See [1]_ (equations 5.2.21 and 5.2.23). + + We can verify these relations: + + >>> z = 2 - 3j + >>> sici(z) + ((4.54751388956229-1.3991965806460565j), + (1.408292501520851+2.9836177420296055j)) + + >>> (exp1(1j*z) - exp1(-1j*z))/2j + np.pi/2 # Same as sine integral + (4.54751388956229-1.3991965806460565j) + + >>> -(exp1(1j*z) + exp1(-1j*z))/2 # Same as cosine integral + (1.408292501520851+2.9836177420296055j) + + Plot the functions evaluated on the real axis; the dotted horizontal + lines are at pi/2 and -pi/2: + + >>> x = np.linspace(-16, 16, 150) + >>> si, ci = sici(x) + + >>> fig, ax = plt.subplots() + >>> ax.plot(x, si, label='Si(x)') + >>> ax.plot(x, ci, '--', label='Ci(x)') + >>> ax.legend(shadow=True, framealpha=1, loc='upper left') + >>> ax.set_xlabel('x') + >>> ax.set_title('Sine and Cosine Integrals') + >>> ax.axhline(np.pi/2, linestyle=':', alpha=0.5, color='k') + >>> ax.axhline(-np.pi/2, linestyle=':', alpha=0.5, color='k') + >>> ax.grid(True) + >>> plt.show() + + """) + +add_newdoc("sindg", + """ + sindg(x, out=None) + + Sine of the angle `x` given in degrees. + + Parameters + ---------- + x : array_like + Angle, given in degrees. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Sine at the input. + + See Also + -------- + cosdg, tandg, cotdg + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is more accurate than using sine directly. + + >>> x = 180 * np.arange(3) + >>> sc.sindg(x) + array([ 0., -0., 0.]) + >>> np.sin(x * np.pi / 180) + array([ 0.0000000e+00, 1.2246468e-16, -2.4492936e-16]) + + """) + +add_newdoc("smirnov", + r""" + smirnov(n, d, out=None) + + Kolmogorov-Smirnov complementary cumulative distribution function + + Returns the exact Kolmogorov-Smirnov complementary cumulative + distribution function,(aka the Survival Function) of Dn+ (or Dn-) + for a one-sided test of equality between an empirical and a + theoretical distribution. It is equal to the probability that the + maximum difference between a theoretical distribution and an empirical + one based on `n` samples is greater than d. + + Parameters + ---------- + n : int + Number of samples + d : float array_like + Deviation between the Empirical CDF (ECDF) and the target CDF. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The value(s) of smirnov(n, d), Prob(Dn+ >= d) (Also Prob(Dn- >= d)) + + See Also + -------- + smirnovi : The Inverse Survival Function for the distribution + scipy.stats.ksone : Provides the functionality as a continuous distribution + kolmogorov, kolmogi : Functions for the two-sided distribution + + Notes + ----- + `smirnov` is used by `stats.kstest` in the application of the + Kolmogorov-Smirnov Goodness of Fit test. For historical reasons this + function is exposed in `scpy.special`, but the recommended way to achieve + the most accurate CDF/SF/PDF/PPF/ISF computations is to use the + `stats.ksone` distribution. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import smirnov + >>> from scipy.stats import norm + + Show the probability of a gap at least as big as 0, 0.5 and 1.0 for a + sample of size 5. + + >>> smirnov(5, [0, 0.5, 1.0]) + array([ 1. , 0.056, 0. ]) + + Compare a sample of size 5 against N(0, 1), the standard normal + distribution with mean 0 and standard deviation 1. + + `x` is the sample. + + >>> x = np.array([-1.392, -0.135, 0.114, 0.190, 1.82]) + + >>> target = norm(0, 1) + >>> cdfs = target.cdf(x) + >>> cdfs + array([0.0819612 , 0.44630594, 0.5453811 , 0.57534543, 0.9656205 ]) + + Construct the empirical CDF and the K-S statistics (Dn+, Dn-, Dn). + + >>> n = len(x) + >>> ecdfs = np.arange(n+1, dtype=float)/n + >>> cols = np.column_stack([x, ecdfs[1:], cdfs, cdfs - ecdfs[:n], + ... ecdfs[1:] - cdfs]) + >>> with np.printoptions(precision=3): + ... print(cols) + [[-1.392 0.2 0.082 0.082 0.118] + [-0.135 0.4 0.446 0.246 -0.046] + [ 0.114 0.6 0.545 0.145 0.055] + [ 0.19 0.8 0.575 -0.025 0.225] + [ 1.82 1. 0.966 0.166 0.034]] + >>> gaps = cols[:, -2:] + >>> Dnpm = np.max(gaps, axis=0) + >>> print(f'Dn-={Dnpm[0]:f}, Dn+={Dnpm[1]:f}') + Dn-=0.246306, Dn+=0.224655 + >>> probs = smirnov(n, Dnpm) + >>> print(f'For a sample of size {n} drawn from N(0, 1):', + ... f' Smirnov n={n}: Prob(Dn- >= {Dnpm[0]:f}) = {probs[0]:.4f}', + ... f' Smirnov n={n}: Prob(Dn+ >= {Dnpm[1]:f}) = {probs[1]:.4f}', + ... sep='\n') + For a sample of size 5 drawn from N(0, 1): + Smirnov n=5: Prob(Dn- >= 0.246306) = 0.4711 + Smirnov n=5: Prob(Dn+ >= 0.224655) = 0.5245 + + Plot the empirical CDF and the standard normal CDF. + + >>> import matplotlib.pyplot as plt + >>> plt.step(np.concatenate(([-2.5], x, [2.5])), + ... np.concatenate((ecdfs, [1])), + ... where='post', label='Empirical CDF') + >>> xx = np.linspace(-2.5, 2.5, 100) + >>> plt.plot(xx, target.cdf(xx), '--', label='CDF for N(0, 1)') + + Add vertical lines marking Dn+ and Dn-. + + >>> iminus, iplus = np.argmax(gaps, axis=0) + >>> plt.vlines([x[iminus]], ecdfs[iminus], cdfs[iminus], color='r', + ... alpha=0.5, lw=4) + >>> plt.vlines([x[iplus]], cdfs[iplus], ecdfs[iplus+1], color='m', + ... alpha=0.5, lw=4) + + >>> plt.grid(True) + >>> plt.legend(framealpha=1, shadow=True) + >>> plt.show() + """) + +add_newdoc("smirnovi", + """ + smirnovi(n, p, out=None) + + Inverse to `smirnov` + + Returns `d` such that ``smirnov(n, d) == p``, the critical value + corresponding to `p`. + + Parameters + ---------- + n : int + Number of samples + p : float array_like + Probability + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + The value(s) of smirnovi(n, p), the critical values. + + See Also + -------- + smirnov : The Survival Function (SF) for the distribution + scipy.stats.ksone : Provides the functionality as a continuous distribution + kolmogorov, kolmogi : Functions for the two-sided distribution + scipy.stats.kstwobign : Two-sided Kolmogorov-Smirnov distribution, large n + + Notes + ----- + `smirnov` is used by `stats.kstest` in the application of the + Kolmogorov-Smirnov Goodness of Fit test. For historical reasons this + function is exposed in `scpy.special`, but the recommended way to achieve + the most accurate CDF/SF/PDF/PPF/ISF computations is to use the + `stats.ksone` distribution. + + Examples + -------- + >>> from scipy.special import smirnovi, smirnov + + >>> n = 24 + >>> deviations = [0.1, 0.2, 0.3] + + Use `smirnov` to compute the complementary CDF of the Smirnov + distribution for the given number of samples and deviations. + + >>> p = smirnov(n, deviations) + >>> p + array([0.58105083, 0.12826832, 0.01032231]) + + The inverse function ``smirnovi(n, p)`` returns ``deviations``. + + >>> smirnovi(n, p) + array([0.1, 0.2, 0.3]) + + """) + +add_newdoc("_smirnovc", + """ + _smirnovc(n, d) + Internal function, do not use. + """) + +add_newdoc("_smirnovci", + """ + Internal function, do not use. + """) + +add_newdoc("_smirnovp", + """ + _smirnovp(n, p) + Internal function, do not use. + """) + +add_newdoc("spence", + r""" + spence(z, out=None) + + Spence's function, also known as the dilogarithm. + + It is defined to be + + .. math:: + \int_1^z \frac{\log(t)}{1 - t}dt + + for complex :math:`z`, where the contour of integration is taken + to avoid the branch cut of the logarithm. Spence's function is + analytic everywhere except the negative real axis where it has a + branch cut. + + Parameters + ---------- + z : array_like + Points at which to evaluate Spence's function + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + s : scalar or ndarray + Computed values of Spence's function + + Notes + ----- + There is a different convention which defines Spence's function by + the integral + + .. math:: + -\int_0^z \frac{\log(1 - t)}{t}dt; + + this is our ``spence(1 - z)``. + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import spence + >>> import matplotlib.pyplot as plt + + The function is defined for complex inputs: + + >>> spence([1-1j, 1.5+2j, 3j, -10-5j]) + array([-0.20561676+0.91596559j, -0.86766909-1.39560134j, + -0.59422064-2.49129918j, -1.14044398+6.80075924j]) + + For complex inputs on the branch cut, which is the negative real axis, + the function returns the limit for ``z`` with positive imaginary part. + For example, in the following, note the sign change of the imaginary + part of the output for ``z = -2`` and ``z = -2 - 1e-8j``: + + >>> spence([-2 + 1e-8j, -2, -2 - 1e-8j]) + array([2.32018041-3.45139229j, 2.32018042-3.4513923j , + 2.32018041+3.45139229j]) + + The function returns ``nan`` for real inputs on the branch cut: + + >>> spence(-1.5) + nan + + Verify some particular values: ``spence(0) = pi**2/6``, + ``spence(1) = 0`` and ``spence(2) = -pi**2/12``. + + >>> spence([0, 1, 2]) + array([ 1.64493407, 0. , -0.82246703]) + >>> np.pi**2/6, -np.pi**2/12 + (1.6449340668482264, -0.8224670334241132) + + Verify the identity:: + + spence(z) + spence(1 - z) = pi**2/6 - log(z)*log(1 - z) + + >>> z = 3 + 4j + >>> spence(z) + spence(1 - z) + (-2.6523186143876067+1.8853470951513935j) + >>> np.pi**2/6 - np.log(z)*np.log(1 - z) + (-2.652318614387606+1.885347095151394j) + + Plot the function for positive real input. + + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0, 6, 400) + >>> ax.plot(x, spence(x)) + >>> ax.grid() + >>> ax.set_xlabel('x') + >>> ax.set_title('spence(x)') + >>> plt.show() + """) + +add_newdoc( + "stdtr", + r""" + stdtr(df, t, out=None) + + Student t distribution cumulative distribution function + + Returns the integral: + + .. math:: + \frac{\Gamma((df+1)/2)}{\sqrt{\pi df} \Gamma(df/2)} + \int_{-\infty}^t (1+x^2/df)^{-(df+1)/2}\, dx + + Parameters + ---------- + df : array_like + Degrees of freedom + t : array_like + Upper bound of the integral + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Value of the Student t CDF at t + + See Also + -------- + stdtridf : inverse of stdtr with respect to `df` + stdtrit : inverse of stdtr with respect to `t` + scipy.stats.t : student t distribution + + Notes + ----- + The student t distribution is also available as `scipy.stats.t`. + Calling `stdtr` directly can improve performance compared to the + ``cdf`` method of `scipy.stats.t` (see last example below). + + Examples + -------- + Calculate the function for ``df=3`` at ``t=1``. + + >>> import numpy as np + >>> from scipy.special import stdtr + >>> import matplotlib.pyplot as plt + >>> stdtr(3, 1) + 0.8044988905221148 + + Plot the function for three different degrees of freedom. + + >>> x = np.linspace(-10, 10, 1000) + >>> fig, ax = plt.subplots() + >>> parameters = [(1, "solid"), (3, "dashed"), (10, "dotted")] + >>> for (df, linestyle) in parameters: + ... ax.plot(x, stdtr(df, x), ls=linestyle, label=f"$df={df}$") + >>> ax.legend() + >>> ax.set_title("Student t distribution cumulative distribution function") + >>> plt.show() + + The function can be computed for several degrees of freedom at the same + time by providing a NumPy array or list for `df`: + + >>> stdtr([1, 2, 3], 1) + array([0.75 , 0.78867513, 0.80449889]) + + It is possible to calculate the function at several points for several + different degrees of freedom simultaneously by providing arrays for `df` + and `t` with shapes compatible for broadcasting. Compute `stdtr` at + 4 points for 3 degrees of freedom resulting in an array of shape 3x4. + + >>> dfs = np.array([[1], [2], [3]]) + >>> t = np.array([2, 4, 6, 8]) + >>> dfs.shape, t.shape + ((3, 1), (4,)) + + >>> stdtr(dfs, t) + array([[0.85241638, 0.92202087, 0.94743154, 0.96041658], + [0.90824829, 0.97140452, 0.98666426, 0.99236596], + [0.93033702, 0.98599577, 0.99536364, 0.99796171]]) + + The t distribution is also available as `scipy.stats.t`. Calling `stdtr` + directly can be much faster than calling the ``cdf`` method of + `scipy.stats.t`. To get the same results, one must use the following + parametrization: ``scipy.stats.t(df).cdf(x) = stdtr(df, x)``. + + >>> from scipy.stats import t + >>> df, x = 3, 1 + >>> stdtr_result = stdtr(df, x) # this can be faster than below + >>> stats_result = t(df).cdf(x) + >>> stats_result == stdtr_result # test that results are equal + True + """) + +add_newdoc("stdtridf", + """ + stdtridf(p, t, out=None) + + Inverse of `stdtr` vs df + + Returns the argument df such that stdtr(df, t) is equal to `p`. + + Parameters + ---------- + p : array_like + Probability + t : array_like + Upper bound of the integral + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + df : scalar or ndarray + Value of `df` such that ``stdtr(df, t) == p`` + + See Also + -------- + stdtr : Student t CDF + stdtrit : inverse of stdtr with respect to `t` + scipy.stats.t : Student t distribution + + Examples + -------- + Compute the student t cumulative distribution function for one + parameter set. + + >>> from scipy.special import stdtr, stdtridf + >>> df, x = 5, 2 + >>> cdf_value = stdtr(df, x) + >>> cdf_value + 0.9490302605850709 + + Verify that `stdtridf` recovers the original value for `df` given + the CDF value and `x`. + + >>> stdtridf(cdf_value, x) + 5.0 + """) + +add_newdoc("stdtrit", + """ + stdtrit(df, p, out=None) + + The `p`-th quantile of the student t distribution. + + This function is the inverse of the student t distribution cumulative + distribution function (CDF), returning `t` such that `stdtr(df, t) = p`. + + Returns the argument `t` such that stdtr(df, t) is equal to `p`. + + Parameters + ---------- + df : array_like + Degrees of freedom + p : array_like + Probability + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + t : scalar or ndarray + Value of `t` such that ``stdtr(df, t) == p`` + + See Also + -------- + stdtr : Student t CDF + stdtridf : inverse of stdtr with respect to `df` + scipy.stats.t : Student t distribution + + Notes + ----- + The student t distribution is also available as `scipy.stats.t`. Calling + `stdtrit` directly can improve performance compared to the ``ppf`` + method of `scipy.stats.t` (see last example below). + + Examples + -------- + `stdtrit` represents the inverse of the student t distribution CDF which + is available as `stdtr`. Here, we calculate the CDF for ``df`` at + ``x=1``. `stdtrit` then returns ``1`` up to floating point errors + given the same value for `df` and the computed CDF value. + + >>> import numpy as np + >>> from scipy.special import stdtr, stdtrit + >>> import matplotlib.pyplot as plt + >>> df = 3 + >>> x = 1 + >>> cdf_value = stdtr(df, x) + >>> stdtrit(df, cdf_value) + 0.9999999994418539 + + Plot the function for three different degrees of freedom. + + >>> x = np.linspace(0, 1, 1000) + >>> parameters = [(1, "solid"), (2, "dashed"), (5, "dotted")] + >>> fig, ax = plt.subplots() + >>> for (df, linestyle) in parameters: + ... ax.plot(x, stdtrit(df, x), ls=linestyle, label=f"$df={df}$") + >>> ax.legend() + >>> ax.set_ylim(-10, 10) + >>> ax.set_title("Student t distribution quantile function") + >>> plt.show() + + The function can be computed for several degrees of freedom at the same + time by providing a NumPy array or list for `df`: + + >>> stdtrit([1, 2, 3], 0.7) + array([0.72654253, 0.6172134 , 0.58438973]) + + It is possible to calculate the function at several points for several + different degrees of freedom simultaneously by providing arrays for `df` + and `p` with shapes compatible for broadcasting. Compute `stdtrit` at + 4 points for 3 degrees of freedom resulting in an array of shape 3x4. + + >>> dfs = np.array([[1], [2], [3]]) + >>> p = np.array([0.2, 0.4, 0.7, 0.8]) + >>> dfs.shape, p.shape + ((3, 1), (4,)) + + >>> stdtrit(dfs, p) + array([[-1.37638192, -0.3249197 , 0.72654253, 1.37638192], + [-1.06066017, -0.28867513, 0.6172134 , 1.06066017], + [-0.97847231, -0.27667066, 0.58438973, 0.97847231]]) + + The t distribution is also available as `scipy.stats.t`. Calling `stdtrit` + directly can be much faster than calling the ``ppf`` method of + `scipy.stats.t`. To get the same results, one must use the following + parametrization: ``scipy.stats.t(df).ppf(x) = stdtrit(df, x)``. + + >>> from scipy.stats import t + >>> df, x = 3, 0.5 + >>> stdtrit_result = stdtrit(df, x) # this can be faster than below + >>> stats_result = t(df).ppf(x) + >>> stats_result == stdtrit_result # test that results are equal + True + """) + +add_newdoc("struve", + r""" + struve(v, x, out=None) + + Struve function. + + Return the value of the Struve function of order `v` at `x`. The Struve + function is defined as, + + .. math:: + H_v(x) = (z/2)^{v + 1} \sum_{n=0}^\infty + \frac{(-1)^n (z/2)^{2n}}{\Gamma(n + \frac{3}{2}) \Gamma(n + v + \frac{3}{2})}, + + where :math:`\Gamma` is the gamma function. + + Parameters + ---------- + v : array_like + Order of the Struve function (float). + x : array_like + Argument of the Struve function (float; must be positive unless `v` is + an integer). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + H : scalar or ndarray + Value of the Struve function of order `v` at `x`. + + See Also + -------- + modstruve: Modified Struve function + + Notes + ----- + Three methods discussed in [1]_ are used to evaluate the Struve function: + + - power series + - expansion in Bessel functions (if :math:`|z| < |v| + 20`) + - asymptotic large-z expansion (if :math:`z \geq 0.7v + 12`) + + Rounding errors are estimated based on the largest terms in the sums, and + the result associated with the smallest error is returned. + + References + ---------- + .. [1] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/11 + + Examples + -------- + Calculate the Struve function of order 1 at 2. + + >>> import numpy as np + >>> from scipy.special import struve + >>> import matplotlib.pyplot as plt + >>> struve(1, 2.) + 0.6467637282835622 + + Calculate the Struve function at 2 for orders 1, 2 and 3 by providing + a list for the order parameter `v`. + + >>> struve([1, 2, 3], 2.) + array([0.64676373, 0.28031806, 0.08363767]) + + Calculate the Struve function of order 1 for several points by providing + an array for `x`. + + >>> points = np.array([2., 5., 8.]) + >>> struve(1, points) + array([0.64676373, 0.80781195, 0.48811605]) + + Compute the Struve function for several orders at several points by + providing arrays for `v` and `z`. The arrays have to be broadcastable + to the correct shapes. + + >>> orders = np.array([[1], [2], [3]]) + >>> points.shape, orders.shape + ((3,), (3, 1)) + + >>> struve(orders, points) + array([[0.64676373, 0.80781195, 0.48811605], + [0.28031806, 1.56937455, 1.51769363], + [0.08363767, 1.50872065, 2.98697513]]) + + Plot the Struve functions of order 0 to 3 from -10 to 10. + + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-10., 10., 1000) + >>> for i in range(4): + ... ax.plot(x, struve(i, x), label=f'$H_{i!r}$') + >>> ax.legend(ncol=2) + >>> ax.set_xlim(-10, 10) + >>> ax.set_title(r"Struve functions $H_{\nu}$") + >>> plt.show() + """) + +add_newdoc("tandg", + """ + tandg(x, out=None) + + Tangent of angle `x` given in degrees. + + Parameters + ---------- + x : array_like + Angle, given in degrees. + out : ndarray, optional + Optional output array for the function results. + + Returns + ------- + scalar or ndarray + Tangent at the input. + + See Also + -------- + sindg, cosdg, cotdg + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + It is more accurate than using tangent directly. + + >>> x = 180 * np.arange(3) + >>> sc.tandg(x) + array([0., 0., 0.]) + >>> np.tan(x * np.pi / 180) + array([ 0.0000000e+00, -1.2246468e-16, -2.4492936e-16]) + + """) + +add_newdoc( + "tklmbda", + r""" + tklmbda(x, lmbda, out=None) + + Cumulative distribution function of the Tukey lambda distribution. + + Parameters + ---------- + x, lmbda : array_like + Parameters + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + cdf : scalar or ndarray + Value of the Tukey lambda CDF + + See Also + -------- + scipy.stats.tukeylambda : Tukey lambda distribution + + Examples + -------- + >>> import numpy as np + >>> import matplotlib.pyplot as plt + >>> from scipy.special import tklmbda, expit + + Compute the cumulative distribution function (CDF) of the Tukey lambda + distribution at several ``x`` values for `lmbda` = -1.5. + + >>> x = np.linspace(-2, 2, 9) + >>> x + array([-2. , -1.5, -1. , -0.5, 0. , 0.5, 1. , 1.5, 2. ]) + >>> tklmbda(x, -1.5) + array([0.34688734, 0.3786554 , 0.41528805, 0.45629737, 0.5 , + 0.54370263, 0.58471195, 0.6213446 , 0.65311266]) + + When `lmbda` is 0, the function is the logistic sigmoid function, + which is implemented in `scipy.special` as `expit`. + + >>> tklmbda(x, 0) + array([0.11920292, 0.18242552, 0.26894142, 0.37754067, 0.5 , + 0.62245933, 0.73105858, 0.81757448, 0.88079708]) + >>> expit(x) + array([0.11920292, 0.18242552, 0.26894142, 0.37754067, 0.5 , + 0.62245933, 0.73105858, 0.81757448, 0.88079708]) + + When `lmbda` is 1, the Tukey lambda distribution is uniform on the + interval [-1, 1], so the CDF increases linearly. + + >>> t = np.linspace(-1, 1, 9) + >>> tklmbda(t, 1) + array([0. , 0.125, 0.25 , 0.375, 0.5 , 0.625, 0.75 , 0.875, 1. ]) + + In the following, we generate plots for several values of `lmbda`. + + The first figure shows graphs for `lmbda` <= 0. + + >>> styles = ['-', '-.', '--', ':'] + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-12, 12, 500) + >>> for k, lmbda in enumerate([-1.0, -0.5, 0.0]): + ... y = tklmbda(x, lmbda) + ... ax.plot(x, y, styles[k], label=rf'$\lambda$ = {lmbda:-4.1f}') + + >>> ax.set_title(r'tklmbda(x, $\lambda$)') + >>> ax.set_label('x') + >>> ax.legend(framealpha=1, shadow=True) + >>> ax.grid(True) + + The second figure shows graphs for `lmbda` > 0. The dots in the + graphs show the bounds of the support of the distribution. + + >>> fig, ax = plt.subplots() + >>> x = np.linspace(-4.2, 4.2, 500) + >>> lmbdas = [0.25, 0.5, 1.0, 1.5] + >>> for k, lmbda in enumerate(lmbdas): + ... y = tklmbda(x, lmbda) + ... ax.plot(x, y, styles[k], label=fr'$\lambda$ = {lmbda}') + + >>> ax.set_prop_cycle(None) + >>> for lmbda in lmbdas: + ... ax.plot([-1/lmbda, 1/lmbda], [0, 1], '.', ms=8) + + >>> ax.set_title(r'tklmbda(x, $\lambda$)') + >>> ax.set_xlabel('x') + >>> ax.legend(framealpha=1, shadow=True) + >>> ax.grid(True) + + >>> plt.tight_layout() + >>> plt.show() + + The CDF of the Tukey lambda distribution is also implemented as the + ``cdf`` method of `scipy.stats.tukeylambda`. In the following, + ``tukeylambda.cdf(x, -0.5)`` and ``tklmbda(x, -0.5)`` compute the + same values: + + >>> from scipy.stats import tukeylambda + >>> x = np.linspace(-2, 2, 9) + + >>> tukeylambda.cdf(x, -0.5) + array([0.21995157, 0.27093858, 0.33541677, 0.41328161, 0.5 , + 0.58671839, 0.66458323, 0.72906142, 0.78004843]) + + >>> tklmbda(x, -0.5) + array([0.21995157, 0.27093858, 0.33541677, 0.41328161, 0.5 , + 0.58671839, 0.66458323, 0.72906142, 0.78004843]) + + The implementation in ``tukeylambda`` also provides location and scale + parameters, and other methods such as ``pdf()`` (the probability + density function) and ``ppf()`` (the inverse of the CDF), so for + working with the Tukey lambda distribution, ``tukeylambda`` is more + generally useful. The primary advantage of ``tklmbda`` is that it is + significantly faster than ``tukeylambda.cdf``. + """) + +add_newdoc("wofz", + """ + wofz(z, out=None) + + Faddeeva function + + Returns the value of the Faddeeva function for complex argument:: + + exp(-z**2) * erfc(-i*z) + + Parameters + ---------- + z : array_like + complex argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Value of the Faddeeva function + + See Also + -------- + dawsn, erf, erfc, erfcx, erfi + + References + ---------- + .. [1] Steven G. Johnson, Faddeeva W function implementation. + http://ab-initio.mit.edu/Faddeeva + + Examples + -------- + >>> import numpy as np + >>> from scipy import special + >>> import matplotlib.pyplot as plt + + >>> x = np.linspace(-3, 3) + >>> z = special.wofz(x) + + >>> plt.plot(x, z.real, label='wofz(x).real') + >>> plt.plot(x, z.imag, label='wofz(x).imag') + >>> plt.xlabel('$x$') + >>> plt.legend(framealpha=1, shadow=True) + >>> plt.grid(alpha=0.25) + >>> plt.show() + + """) + +add_newdoc("xlogy", + """ + xlogy(x, y, out=None) + + Compute ``x*log(y)`` so that the result is 0 if ``x = 0``. + + Parameters + ---------- + x : array_like + Multiplier + y : array_like + Argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + z : scalar or ndarray + Computed x*log(y) + + Notes + ----- + The log function used in the computation is the natural log. + + .. versionadded:: 0.13.0 + + Examples + -------- + We can use this function to calculate the binary logistic loss also + known as the binary cross entropy. This loss function is used for + binary classification problems and is defined as: + + .. math:: + L = 1/n * \\sum_{i=0}^n -(y_i*log(y\\_pred_i) + (1-y_i)*log(1-y\\_pred_i)) + + We can define the parameters `x` and `y` as y and y_pred respectively. + y is the array of the actual labels which over here can be either 0 or 1. + y_pred is the array of the predicted probabilities with respect to + the positive class (1). + + >>> import numpy as np + >>> from scipy.special import xlogy + >>> y = np.array([0, 1, 0, 1, 1, 0]) + >>> y_pred = np.array([0.3, 0.8, 0.4, 0.7, 0.9, 0.2]) + >>> n = len(y) + >>> loss = -(xlogy(y, y_pred) + xlogy(1 - y, 1 - y_pred)).sum() + >>> loss /= n + >>> loss + 0.29597052165495025 + + A lower loss is usually better as it indicates that the predictions are + similar to the actual labels. In this example since our predicted + probabilities are close to the actual labels, we get an overall loss + that is reasonably low and appropriate. + + """) + +add_newdoc("xlog1py", + """ + xlog1py(x, y, out=None) + + Compute ``x*log1p(y)`` so that the result is 0 if ``x = 0``. + + Parameters + ---------- + x : array_like + Multiplier + y : array_like + Argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + z : scalar or ndarray + Computed x*log1p(y) + + Notes + ----- + + .. versionadded:: 0.13.0 + + Examples + -------- + This example shows how the function can be used to calculate the log of + the probability mass function for a geometric discrete random variable. + The probability mass function of the geometric distribution is defined + as follows: + + .. math:: f(k) = (1-p)^{k-1} p + + where :math:`p` is the probability of a single success + and :math:`1-p` is the probability of a single failure + and :math:`k` is the number of trials to get the first success. + + >>> import numpy as np + >>> from scipy.special import xlog1py + >>> p = 0.5 + >>> k = 100 + >>> _pmf = np.power(1 - p, k - 1) * p + >>> _pmf + 7.888609052210118e-31 + + If we take k as a relatively large number the value of the probability + mass function can become very low. In such cases taking the log of the + pmf would be more suitable as the log function can change the values + to a scale that is more appropriate to work with. + + >>> _log_pmf = xlog1py(k - 1, -p) + np.log(p) + >>> _log_pmf + -69.31471805599453 + + We can confirm that we get a value close to the original pmf value by + taking the exponential of the log pmf. + + >>> _orig_pmf = np.exp(_log_pmf) + >>> np.isclose(_pmf, _orig_pmf) + True + + """) + +add_newdoc("y0", + r""" + y0(x, out=None) + + Bessel function of the second kind of order 0. + + Parameters + ---------- + x : array_like + Argument (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + Y : scalar or ndarray + Value of the Bessel function of the second kind of order 0 at `x`. + + See Also + -------- + j0: Bessel function of the first kind of order 0 + yv: Bessel function of the first kind + + Notes + ----- + The domain is divided into the intervals [0, 5] and (5, infinity). In the + first interval a rational approximation :math:`R(x)` is employed to + compute, + + .. math:: + + Y_0(x) = R(x) + \frac{2 \log(x) J_0(x)}{\pi}, + + where :math:`J_0` is the Bessel function of the first kind of order 0. + + In the second interval, the Hankel asymptotic expansion is employed with + two rational functions of degree 6/6 and 7/7. + + This function is a wrapper for the Cephes [1]_ routine `y0`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import y0 + >>> y0(1.) + 0.08825696421567697 + + Calculate at several points: + + >>> import numpy as np + >>> y0(np.array([0.5, 2., 3.])) + array([-0.44451873, 0.51037567, 0.37685001]) + + Plot the function from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> y = y0(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("y1", + """ + y1(x, out=None) + + Bessel function of the second kind of order 1. + + Parameters + ---------- + x : array_like + Argument (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + Y : scalar or ndarray + Value of the Bessel function of the second kind of order 1 at `x`. + + See Also + -------- + j1: Bessel function of the first kind of order 1 + yn: Bessel function of the second kind + yv: Bessel function of the second kind + + Notes + ----- + The domain is divided into the intervals [0, 8] and (8, infinity). In the + first interval a 25 term Chebyshev expansion is used, and computing + :math:`J_1` (the Bessel function of the first kind) is required. In the + second, the asymptotic trigonometric representation is employed using two + rational functions of degree 5/5. + + This function is a wrapper for the Cephes [1]_ routine `y1`. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Calculate the function at one point: + + >>> from scipy.special import y1 + >>> y1(1.) + -0.7812128213002888 + + Calculate at several points: + + >>> import numpy as np + >>> y1(np.array([0.5, 2., 3.])) + array([-1.47147239, -0.10703243, 0.32467442]) + + Plot the function from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> y = y1(x) + >>> ax.plot(x, y) + >>> plt.show() + + """) + +add_newdoc("yn", + r""" + yn(n, x, out=None) + + Bessel function of the second kind of integer order and real argument. + + Parameters + ---------- + n : array_like + Order (integer). + x : array_like + Argument (float). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + Y : scalar or ndarray + Value of the Bessel function, :math:`Y_n(x)`. + + See Also + -------- + yv : For real order and real or complex argument. + y0: faster implementation of this function for order 0 + y1: faster implementation of this function for order 1 + + Notes + ----- + Wrapper for the Cephes [1]_ routine `yn`. + + The function is evaluated by forward recurrence on `n`, starting with + values computed by the Cephes routines `y0` and `y1`. If `n = 0` or 1, + the routine for `y0` or `y1` is called directly. + + References + ---------- + .. [1] Cephes Mathematical Functions Library, + http://www.netlib.org/cephes/ + + Examples + -------- + Evaluate the function of order 0 at one point. + + >>> from scipy.special import yn + >>> yn(0, 1.) + 0.08825696421567697 + + Evaluate the function at one point for different orders. + + >>> yn(0, 1.), yn(1, 1.), yn(2, 1.) + (0.08825696421567697, -0.7812128213002888, -1.6506826068162546) + + The evaluation for different orders can be carried out in one call by + providing a list or NumPy array as argument for the `v` parameter: + + >>> yn([0, 1, 2], 1.) + array([ 0.08825696, -0.78121282, -1.65068261]) + + Evaluate the function at several points for order 0 by providing an + array for `z`. + + >>> import numpy as np + >>> points = np.array([0.5, 3., 8.]) + >>> yn(0, points) + array([-0.44451873, 0.37685001, 0.22352149]) + + If `z` is an array, the order parameter `v` must be broadcastable to + the correct shape if different orders shall be computed in one call. + To calculate the orders 0 and 1 for an 1D array: + + >>> orders = np.array([[0], [1]]) + >>> orders.shape + (2, 1) + + >>> yn(orders, points) + array([[-0.44451873, 0.37685001, 0.22352149], + [-1.47147239, 0.32467442, -0.15806046]]) + + Plot the functions of order 0 to 3 from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> for i in range(4): + ... ax.plot(x, yn(i, x), label=f'$Y_{i!r}$') + >>> ax.set_ylim(-3, 1) + >>> ax.legend() + >>> plt.show() + """) + +add_newdoc("yv", + r""" + yv(v, z, out=None) + + Bessel function of the second kind of real order and complex argument. + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + Y : scalar or ndarray + Value of the Bessel function of the second kind, :math:`Y_v(x)`. + + See Also + -------- + yve : :math:`Y_v` with leading exponential behavior stripped off. + y0: faster implementation of this function for order 0 + y1: faster implementation of this function for order 1 + + Notes + ----- + For positive `v` values, the computation is carried out using the + AMOS [1]_ `zbesy` routine, which exploits the connection to the Hankel + Bessel functions :math:`H_v^{(1)}` and :math:`H_v^{(2)}`, + + .. math:: Y_v(z) = \frac{1}{2\imath} (H_v^{(1)} - H_v^{(2)}). + + For negative `v` values the formula, + + .. math:: Y_{-v}(z) = Y_v(z) \cos(\pi v) + J_v(z) \sin(\pi v) + + is used, where :math:`J_v(z)` is the Bessel function of the first kind, + computed using the AMOS routine `zbesj`. Note that the second term is + exactly zero for integer `v`; to improve accuracy the second term is + explicitly omitted for `v` values such that `v = floor(v)`. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + Evaluate the function of order 0 at one point. + + >>> from scipy.special import yv + >>> yv(0, 1.) + 0.088256964215677 + + Evaluate the function at one point for different orders. + + >>> yv(0, 1.), yv(1, 1.), yv(1.5, 1.) + (0.088256964215677, -0.7812128213002889, -1.102495575160179) + + The evaluation for different orders can be carried out in one call by + providing a list or NumPy array as argument for the `v` parameter: + + >>> yv([0, 1, 1.5], 1.) + array([ 0.08825696, -0.78121282, -1.10249558]) + + Evaluate the function at several points for order 0 by providing an + array for `z`. + + >>> import numpy as np + >>> points = np.array([0.5, 3., 8.]) + >>> yv(0, points) + array([-0.44451873, 0.37685001, 0.22352149]) + + If `z` is an array, the order parameter `v` must be broadcastable to + the correct shape if different orders shall be computed in one call. + To calculate the orders 0 and 1 for an 1D array: + + >>> orders = np.array([[0], [1]]) + >>> orders.shape + (2, 1) + + >>> yv(orders, points) + array([[-0.44451873, 0.37685001, 0.22352149], + [-1.47147239, 0.32467442, -0.15806046]]) + + Plot the functions of order 0 to 3 from 0 to 10. + + >>> import matplotlib.pyplot as plt + >>> fig, ax = plt.subplots() + >>> x = np.linspace(0., 10., 1000) + >>> for i in range(4): + ... ax.plot(x, yv(i, x), label=f'$Y_{i!r}$') + >>> ax.set_ylim(-3, 1) + >>> ax.legend() + >>> plt.show() + + """) + +add_newdoc("yve", + r""" + yve(v, z, out=None) + + Exponentially scaled Bessel function of the second kind of real order. + + Returns the exponentially scaled Bessel function of the second + kind of real order `v` at complex `z`:: + + yve(v, z) = yv(v, z) * exp(-abs(z.imag)) + + Parameters + ---------- + v : array_like + Order (float). + z : array_like + Argument (float or complex). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + Y : scalar or ndarray + Value of the exponentially scaled Bessel function. + + See Also + -------- + yv: Unscaled Bessel function of the second kind of real order. + + Notes + ----- + For positive `v` values, the computation is carried out using the + AMOS [1]_ `zbesy` routine, which exploits the connection to the Hankel + Bessel functions :math:`H_v^{(1)}` and :math:`H_v^{(2)}`, + + .. math:: Y_v(z) = \frac{1}{2\imath} (H_v^{(1)} - H_v^{(2)}). + + For negative `v` values the formula, + + .. math:: Y_{-v}(z) = Y_v(z) \cos(\pi v) + J_v(z) \sin(\pi v) + + is used, where :math:`J_v(z)` is the Bessel function of the first kind, + computed using the AMOS routine `zbesj`. Note that the second term is + exactly zero for integer `v`; to improve accuracy the second term is + explicitly omitted for `v` values such that `v = floor(v)`. + + Exponentially scaled Bessel functions are useful for large `z`: + for these, the unscaled Bessel functions can easily under-or overflow. + + References + ---------- + .. [1] Donald E. Amos, "AMOS, A Portable Package for Bessel Functions + of a Complex Argument and Nonnegative Order", + http://netlib.org/amos/ + + Examples + -------- + Compare the output of `yv` and `yve` for large complex arguments for `z` + by computing their values for order ``v=1`` at ``z=1000j``. We see that + `yv` returns nan but `yve` returns a finite number: + + >>> import numpy as np + >>> from scipy.special import yv, yve + >>> v = 1 + >>> z = 1000j + >>> yv(v, z), yve(v, z) + ((nan+nanj), (-0.012610930256928629+7.721967686709076e-19j)) + + For real arguments for `z`, `yve` returns the same as `yv` up to + floating point errors. + + >>> v, z = 1, 1000 + >>> yv(v, z), yve(v, z) + (-0.02478433129235178, -0.02478433129235179) + + The function can be evaluated for several orders at the same time by + providing a list or NumPy array for `v`: + + >>> yve([1, 2, 3], 1j) + array([-0.20791042+0.14096627j, 0.38053618-0.04993878j, + 0.00815531-1.66311097j]) + + In the same way, the function can be evaluated at several points in one + call by providing a list or NumPy array for `z`: + + >>> yve(1, np.array([1j, 2j, 3j])) + array([-0.20791042+0.14096627j, -0.21526929+0.01205044j, + -0.19682671+0.00127278j]) + + It is also possible to evaluate several orders at several points + at the same time by providing arrays for `v` and `z` with + broadcasting compatible shapes. Compute `yve` for two different orders + `v` and three points `z` resulting in a 2x3 array. + + >>> v = np.array([[1], [2]]) + >>> z = np.array([3j, 4j, 5j]) + >>> v.shape, z.shape + ((2, 1), (3,)) + + >>> yve(v, z) + array([[-1.96826713e-01+1.27277544e-03j, -1.78750840e-01+1.45558819e-04j, + -1.63972267e-01+1.73494110e-05j], + [1.94960056e-03-1.11782545e-01j, 2.02902325e-04-1.17626501e-01j, + 2.27727687e-05-1.17951906e-01j]]) + """) + +add_newdoc("_zeta", + """ + _zeta(x, q) + + Internal function, Hurwitz zeta. + + """) + +add_newdoc("zetac", + """ + zetac(x, out=None) + + Riemann zeta function minus 1. + + This function is defined as + + .. math:: \\zeta(x) = \\sum_{k=2}^{\\infty} 1 / k^x, + + where ``x > 1``. For ``x < 1`` the analytic continuation is + computed. For more information on the Riemann zeta function, see + [dlmf]_. + + Parameters + ---------- + x : array_like of float + Values at which to compute zeta(x) - 1 (must be real). + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Values of zeta(x) - 1. + + See Also + -------- + zeta + + References + ---------- + .. [dlmf] NIST Digital Library of Mathematical Functions + https://dlmf.nist.gov/25 + + Examples + -------- + >>> import numpy as np + >>> from scipy.special import zetac, zeta + + Some special values: + + >>> zetac(2), np.pi**2/6 - 1 + (0.64493406684822641, 0.6449340668482264) + + >>> zetac(-1), -1.0/12 - 1 + (-1.0833333333333333, -1.0833333333333333) + + Compare ``zetac(x)`` to ``zeta(x) - 1`` for large `x`: + + >>> zetac(60), zeta(60) - 1 + (8.673617380119933e-19, 0.0) + """) + +add_newdoc("_riemann_zeta", + """ + Internal function, use `zeta` instead. + """) + +add_newdoc("_struve_asymp_large_z", + """ + _struve_asymp_large_z(v, z, is_h) + + Internal function for testing `struve` & `modstruve` + + Evaluates using asymptotic expansion + + Returns + ------- + v, err + """) + +add_newdoc("_struve_power_series", + """ + _struve_power_series(v, z, is_h) + + Internal function for testing `struve` & `modstruve` + + Evaluates using power series + + Returns + ------- + v, err + """) + +add_newdoc("_struve_bessel_series", + """ + _struve_bessel_series(v, z, is_h) + + Internal function for testing `struve` & `modstruve` + + Evaluates using Bessel function series + + Returns + ------- + v, err + """) + +add_newdoc("_spherical_jn", + """ + Internal function, use `spherical_jn` instead. + """) + +add_newdoc("_spherical_jn_d", + """ + Internal function, use `spherical_jn` instead. + """) + +add_newdoc("_spherical_yn", + """ + Internal function, use `spherical_yn` instead. + """) + +add_newdoc("_spherical_yn_d", + """ + Internal function, use `spherical_yn` instead. + """) + +add_newdoc("_spherical_in", + """ + Internal function, use `spherical_in` instead. + """) + +add_newdoc("_spherical_in_d", + """ + Internal function, use `spherical_in` instead. + """) + +add_newdoc("_spherical_kn", + """ + Internal function, use `spherical_kn` instead. + """) + +add_newdoc("_spherical_kn_d", + """ + Internal function, use `spherical_kn` instead. + """) + +add_newdoc("loggamma", + r""" + loggamma(z, out=None) + + Principal branch of the logarithm of the gamma function. + + Defined to be :math:`\log(\Gamma(x))` for :math:`x > 0` and + extended to the complex plane by analytic continuation. The + function has a single branch cut on the negative real axis. + + .. versionadded:: 0.18.0 + + Parameters + ---------- + z : array_like + Values in the complex plane at which to compute ``loggamma`` + out : ndarray, optional + Output array for computed values of ``loggamma`` + + Returns + ------- + loggamma : scalar or ndarray + Values of ``loggamma`` at z. + + See Also + -------- + gammaln : logarithm of the absolute value of the gamma function + gammasgn : sign of the gamma function + + Notes + ----- + It is not generally true that :math:`\log\Gamma(z) = + \log(\Gamma(z))`, though the real parts of the functions do + agree. The benefit of not defining `loggamma` as + :math:`\log(\Gamma(z))` is that the latter function has a + complicated branch cut structure whereas `loggamma` is analytic + except for on the negative real axis. + + The identities + + .. math:: + \exp(\log\Gamma(z)) &= \Gamma(z) \\ + \log\Gamma(z + 1) &= \log(z) + \log\Gamma(z) + + make `loggamma` useful for working in complex logspace. + + On the real line `loggamma` is related to `gammaln` via + ``exp(loggamma(x + 0j)) = gammasgn(x)*exp(gammaln(x))``, up to + rounding error. + + The implementation here is based on [hare1997]_. + + References + ---------- + .. [hare1997] D.E.G. Hare, + *Computing the Principal Branch of log-Gamma*, + Journal of Algorithms, Volume 25, Issue 2, November 1997, pages 221-236. + """) + +add_newdoc("_sinpi", + """ + Internal function, do not use. + """) + +add_newdoc("_cospi", + """ + Internal function, do not use. + """) + +add_newdoc("owens_t", + """ + owens_t(h, a, out=None) + + Owen's T Function. + + The function T(h, a) gives the probability of the event + (X > h and 0 < Y < a * X) where X and Y are independent + standard normal random variables. + + Parameters + ---------- + h: array_like + Input value. + a: array_like + Input value. + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + t: scalar or ndarray + Probability of the event (X > h and 0 < Y < a * X), + where X and Y are independent standard normal random variables. + + References + ---------- + .. [1] M. Patefield and D. Tandy, "Fast and accurate calculation of + Owen's T Function", Statistical Software vol. 5, pp. 1-25, 2000. + + Examples + -------- + >>> from scipy import special + >>> a = 3.5 + >>> h = 0.78 + >>> special.owens_t(h, a) + 0.10877216734852274 + """) + +add_newdoc("_factorial", + """ + Internal function, do not use. + """) + +add_newdoc("wright_bessel", + r""" + wright_bessel(a, b, x, out=None) + + Wright's generalized Bessel function. + + Wright's generalized Bessel function is an entire function and defined as + + .. math:: \Phi(a, b; x) = \sum_{k=0}^\infty \frac{x^k}{k! \Gamma(a k + b)} + + See Also [1]. + + Parameters + ---------- + a : array_like of float + a >= 0 + b : array_like of float + b >= 0 + x : array_like of float + x >= 0 + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Value of the Wright's generalized Bessel function + + Notes + ----- + Due to the complexity of the function with its three parameters, only + non-negative arguments are implemented. + + References + ---------- + .. [1] Digital Library of Mathematical Functions, 10.46. + https://dlmf.nist.gov/10.46.E1 + + Examples + -------- + >>> from scipy.special import wright_bessel + >>> a, b, x = 1.5, 1.1, 2.5 + >>> wright_bessel(a, b-1, x) + 4.5314465939443025 + + Now, let us verify the relation + + .. math:: \Phi(a, b-1; x) = a x \Phi(a, b+a; x) + (b-1) \Phi(a, b; x) + + >>> a * x * wright_bessel(a, b+a, x) + (b-1) * wright_bessel(a, b, x) + 4.5314465939443025 + + + """) + + +add_newdoc("ndtri_exp", + r""" + ndtri_exp(y, out=None) + + Inverse of `log_ndtr` vs x. Allows for greater precision than + `ndtri` composed with `numpy.exp` for very small values of y and for + y close to 0. + + Parameters + ---------- + y : array_like of float + Function argument + out : ndarray, optional + Optional output array for the function results + + Returns + ------- + scalar or ndarray + Inverse of the log CDF of the standard normal distribution, evaluated + at y. + + See Also + -------- + log_ndtr : log of the standard normal cumulative distribution function + ndtr : standard normal cumulative distribution function + ndtri : standard normal percentile function + + Examples + -------- + >>> import numpy as np + >>> import scipy.special as sc + + `ndtri_exp` agrees with the naive implementation when the latter does + not suffer from underflow. + + >>> sc.ndtri_exp(-1) + -0.33747496376420244 + >>> sc.ndtri(np.exp(-1)) + -0.33747496376420244 + + For extreme values of y, the naive approach fails + + >>> sc.ndtri(np.exp(-800)) + -inf + >>> sc.ndtri(np.exp(-1e-20)) + inf + + whereas `ndtri_exp` is still able to compute the result to high precision. + + >>> sc.ndtri_exp(-800) + -39.88469483825668 + >>> sc.ndtri_exp(-1e-20) + 9.262340089798409 + """) + +add_newdoc("_stirling2_inexact", + r""" + Internal function, do not use. + """)