Add files using upload-large-folder tool

env-llmeval/lib/python3.10/site-packages/pip/_vendor/distlib/locators.py

@@ -0,0 +1,1300 @@
+# -*- coding: utf-8 -*-
+#
+# Copyright (C) 2012-2015 Vinay Sajip.
+# Licensed to the Python Software Foundation under a contributor agreement.
+# See LICENSE.txt and CONTRIBUTORS.txt.
+#
+
+import gzip
+from io import BytesIO
+import json
+import logging
+import os
+import posixpath
+import re
+try:
+    import threading
+except ImportError:  # pragma: no cover
+    import dummy_threading as threading
+import zlib
+
+from . import DistlibException
+from .compat import (urljoin, urlparse, urlunparse, url2pathname, pathname2url,
+                     queue, quote, unescape, build_opener,
+                     HTTPRedirectHandler as BaseRedirectHandler, text_type,
+                     Request, HTTPError, URLError)
+from .database import Distribution, DistributionPath, make_dist
+from .metadata import Metadata, MetadataInvalidError
+from .util import (cached_property, ensure_slash, split_filename, get_project_data,
+                   parse_requirement, parse_name_and_version, ServerProxy,
+                   normalize_name)
+from .version import get_scheme, UnsupportedVersionError
+from .wheel import Wheel, is_compatible
+
+logger = logging.getLogger(__name__)
+
+HASHER_HASH = re.compile(r'^(\w+)=([a-f0-9]+)')
+CHARSET = re.compile(r';\s*charset\s*=\s*(.*)\s*$', re.I)
+HTML_CONTENT_TYPE = re.compile('text/html|application/x(ht)?ml')
+DEFAULT_INDEX = 'https://pypi.org/pypi'
+
+def get_all_distribution_names(url=None):
+    """
+    Return all distribution names known by an index.
+    :param url: The URL of the index.
+    :return: A list of all known distribution names.
+    """
+    if url is None:
+        url = DEFAULT_INDEX
+    client = ServerProxy(url, timeout=3.0)
+    try:
+        return client.list_packages()
+    finally:
+        client('close')()
+
+class RedirectHandler(BaseRedirectHandler):
+    """
+    A class to work around a bug in some Python 3.2.x releases.
+    """
+    # There's a bug in the base version for some 3.2.x
+    # (e.g. 3.2.2 on Ubuntu Oneiric). If a Location header
+    # returns e.g. /abc, it bails because it says the scheme ''
+    # is bogus, when actually it should use the request's
+    # URL for the scheme. See Python issue #13696.
+    def http_error_302(self, req, fp, code, msg, headers):
+        # Some servers (incorrectly) return multiple Location headers
+        # (so probably same goes for URI).  Use first header.
+        newurl = None
+        for key in ('location', 'uri'):
+            if key in headers:
+                newurl = headers[key]
+                break
+        if newurl is None:  # pragma: no cover
+            return
+        urlparts = urlparse(newurl)
+        if urlparts.scheme == '':
+            newurl = urljoin(req.get_full_url(), newurl)
+            if hasattr(headers, 'replace_header'):
+                headers.replace_header(key, newurl)
+            else:
+                headers[key] = newurl
+        return BaseRedirectHandler.http_error_302(self, req, fp, code, msg,
+                                                  headers)
+
+    http_error_301 = http_error_303 = http_error_307 = http_error_302
+
+class Locator(object):
+    """
+    A base class for locators - things that locate distributions.
+    """
+    source_extensions = ('.tar.gz', '.tar.bz2', '.tar', '.zip', '.tgz', '.tbz')
+    binary_extensions = ('.egg', '.exe', '.whl')
+    excluded_extensions = ('.pdf',)
+
+    # A list of tags indicating which wheels you want to match. The default
+    # value of None matches against the tags compatible with the running
+    # Python. If you want to match other values, set wheel_tags on a locator
+    # instance to a list of tuples (pyver, abi, arch) which you want to match.
+    wheel_tags = None
+
+    downloadable_extensions = source_extensions + ('.whl',)
+
+    def __init__(self, scheme='default'):
+        """
+        Initialise an instance.
+        :param scheme: Because locators look for most recent versions, they
+                       need to know the version scheme to use. This specifies
+                       the current PEP-recommended scheme - use ``'legacy'``
+                       if you need to support existing distributions on PyPI.
+        """
+        self._cache = {}
+        self.scheme = scheme
+        # Because of bugs in some of the handlers on some of the platforms,
+        # we use our own opener rather than just using urlopen.
+        self.opener = build_opener(RedirectHandler())
+        # If get_project() is called from locate(), the matcher instance
+        # is set from the requirement passed to locate(). See issue #18 for
+        # why this can be useful to know.
+        self.matcher = None
+        self.errors = queue.Queue()
+
+    def get_errors(self):
+        """
+        Return any errors which have occurred.
+        """
+        result = []
+        while not self.errors.empty():  # pragma: no cover
+            try:
+                e = self.errors.get(False)
+                result.append(e)
+            except self.errors.Empty:
+                continue
+            self.errors.task_done()
+        return result
+
+    def clear_errors(self):
+        """
+        Clear any errors which may have been logged.
+        """
+        # Just get the errors and throw them away
+        self.get_errors()
+
+    def clear_cache(self):
+        self._cache.clear()
+
+    def _get_scheme(self):
+        return self._scheme
+
+    def _set_scheme(self, value):
+        self._scheme = value
+
+    scheme = property(_get_scheme, _set_scheme)
+
+    def _get_project(self, name):
+        """
+        For a given project, get a dictionary mapping available versions to Distribution
+        instances.
+
+        This should be implemented in subclasses.
+
+        If called from a locate() request, self.matcher will be set to a
+        matcher for the requirement to satisfy, otherwise it will be None.
+        """
+        raise NotImplementedError('Please implement in the subclass')
+
+    def get_distribution_names(self):
+        """
+        Return all the distribution names known to this locator.
+        """
+        raise NotImplementedError('Please implement in the subclass')
+
+    def get_project(self, name):
+        """
+        For a given project, get a dictionary mapping available versions to Distribution
+        instances.
+
+        This calls _get_project to do all the work, and just implements a caching layer on top.
+        """
+        if self._cache is None:  # pragma: no cover
+            result = self._get_project(name)
+        elif name in self._cache:
+            result = self._cache[name]
+        else:
+            self.clear_errors()
+            result = self._get_project(name)
+            self._cache[name] = result
+        return result
+
+    def score_url(self, url):
+        """
+        Give an url a score which can be used to choose preferred URLs
+        for a given project release.
+        """
+        t = urlparse(url)
+        basename = posixpath.basename(t.path)
+        compatible = True
+        is_wheel = basename.endswith('.whl')
+        is_downloadable = basename.endswith(self.downloadable_extensions)
+        if is_wheel:
+            compatible = is_compatible(Wheel(basename), self.wheel_tags)
+        return (t.scheme == 'https', 'pypi.org' in t.netloc,
+                is_downloadable, is_wheel, compatible, basename)
+
+    def prefer_url(self, url1, url2):
+        """
+        Choose one of two URLs where both are candidates for distribution
+        archives for the same version of a distribution (for example,
+        .tar.gz vs. zip).
+
+        The current implementation favours https:// URLs over http://, archives
+        from PyPI over those from other locations, wheel compatibility (if a
+        wheel) and then the archive name.
+        """
+        result = url2
+        if url1:
+            s1 = self.score_url(url1)
+            s2 = self.score_url(url2)
+            if s1 > s2:
+                result = url1
+            if result != url2:
+                logger.debug('Not replacing %r with %r', url1, url2)
+            else:
+                logger.debug('Replacing %r with %r', url1, url2)
+        return result
+
+    def split_filename(self, filename, project_name):
+        """
+        Attempt to split a filename in project name, version and Python version.
+        """
+        return split_filename(filename, project_name)
+
+    def convert_url_to_download_info(self, url, project_name):
+        """
+        See if a URL is a candidate for a download URL for a project (the URL
+        has typically been scraped from an HTML page).
+
+        If it is, a dictionary is returned with keys "name", "version",
+        "filename" and "url"; otherwise, None is returned.
+        """
+        def same_project(name1, name2):
+            return normalize_name(name1) == normalize_name(name2)
+
+        result = None
+        scheme, netloc, path, params, query, frag = urlparse(url)
+        if frag.lower().startswith('egg='):  # pragma: no cover
+            logger.debug('%s: version hint in fragment: %r',
+                         project_name, frag)
+        m = HASHER_HASH.match(frag)
+        if m:
+            algo, digest = m.groups()
+        else:
+            algo, digest = None, None
+        origpath = path
+        if path and path[-1] == '/':  # pragma: no cover
+            path = path[:-1]
+        if path.endswith('.whl'):
+            try:
+                wheel = Wheel(path)
+                if not is_compatible(wheel, self.wheel_tags):
+                    logger.debug('Wheel not compatible: %s', path)
+                else:
+                    if project_name is None:
+                        include = True
+                    else:
+                        include = same_project(wheel.name, project_name)
+                    if include:
+                        result = {
+                            'name': wheel.name,
+                            'version': wheel.version,
+                            'filename': wheel.filename,
+                            'url': urlunparse((scheme, netloc, origpath,
+                                               params, query, '')),
+                            'python-version': ', '.join(
+                                ['.'.join(list(v[2:])) for v in wheel.pyver]),
+                        }
+            except Exception as e:  # pragma: no cover
+                logger.warning('invalid path for wheel: %s', path)
+        elif not path.endswith(self.downloadable_extensions):  # pragma: no cover
+            logger.debug('Not downloadable: %s', path)
+        else:  # downloadable extension
+            path = filename = posixpath.basename(path)
+            for ext in self.downloadable_extensions:
+                if path.endswith(ext):
+                    path = path[:-len(ext)]
+                    t = self.split_filename(path, project_name)
+                    if not t:  # pragma: no cover
+                        logger.debug('No match for project/version: %s', path)
+                    else:
+                        name, version, pyver = t
+                        if not project_name or same_project(project_name, name):
+                            result = {
+                                'name': name,
+                                'version': version,
+                                'filename': filename,
+                                'url': urlunparse((scheme, netloc, origpath,
+                                                   params, query, '')),
+                                #'packagetype': 'sdist',
+                            }
+                            if pyver:  # pragma: no cover
+                                result['python-version'] = pyver
+                    break
+        if result and algo:
+            result['%s_digest' % algo] = digest
+        return result
+
+    def _get_digest(self, info):
+        """
+        Get a digest from a dictionary by looking at a "digests" dictionary
+        or keys of the form 'algo_digest'.
+
+        Returns a 2-tuple (algo, digest) if found, else None. Currently
+        looks only for SHA256, then MD5.
+        """
+        result = None
+        if 'digests' in info:
+            digests = info['digests']
+            for algo in ('sha256', 'md5'):
+                if algo in digests:
+                    result = (algo, digests[algo])
+                    break
+        if not result:
+            for algo in ('sha256', 'md5'):
+                key = '%s_digest' % algo
+                if key in info:
+                    result = (algo, info[key])
+                    break
+        return result
+
+    def _update_version_data(self, result, info):
+        """
+        Update a result dictionary (the final result from _get_project) with a
+        dictionary for a specific version, which typically holds information
+        gleaned from a filename or URL for an archive for the distribution.
+        """
+        name = info.pop('name')
+        version = info.pop('version')
+        if version in result:
+            dist = result[version]
+            md = dist.metadata
+        else:
+            dist = make_dist(name, version, scheme=self.scheme)
+            md = dist.metadata
+        dist.digest = digest = self._get_digest(info)
+        url = info['url']
+        result['digests'][url] = digest
+        if md.source_url != info['url']:
+            md.source_url = self.prefer_url(md.source_url, url)
+            result['urls'].setdefault(version, set()).add(url)
+        dist.locator = self
+        result[version] = dist
+
+    def locate(self, requirement, prereleases=False):
+        """
+        Find the most recent distribution which matches the given
+        requirement.
+
+        :param requirement: A requirement of the form 'foo (1.0)' or perhaps
+                            'foo (>= 1.0, < 2.0, != 1.3)'
+        :param prereleases: If ``True``, allow pre-release versions
+                            to be located. Otherwise, pre-release versions
+                            are not returned.
+        :return: A :class:`Distribution` instance, or ``None`` if no such
+                 distribution could be located.
+        """
+        result = None
+        r = parse_requirement(requirement)
+        if r is None:  # pragma: no cover
+            raise DistlibException('Not a valid requirement: %r' % requirement)
+        scheme = get_scheme(self.scheme)
+        self.matcher = matcher = scheme.matcher(r.requirement)
+        logger.debug('matcher: %s (%s)', matcher, type(matcher).__name__)
+        versions = self.get_project(r.name)
+        if len(versions) > 2:   # urls and digests keys are present
+            # sometimes, versions are invalid
+            slist = []
+            vcls = matcher.version_class
+            for k in versions:
+                if k in ('urls', 'digests'):
+                    continue
+                try:
+                    if not matcher.match(k):
+                        pass  # logger.debug('%s did not match %r', matcher, k)
+                    else:
+                        if prereleases or not vcls(k).is_prerelease:
+                            slist.append(k)
+                        # else:
+                            # logger.debug('skipping pre-release '
+                                         # 'version %s of %s', k, matcher.name)
+                except Exception:  # pragma: no cover
+                    logger.warning('error matching %s with %r', matcher, k)
+                    pass # slist.append(k)
+            if len(slist) > 1:
+                slist = sorted(slist, key=scheme.key)
+            if slist:
+                logger.debug('sorted list: %s', slist)
+                version = slist[-1]
+                result = versions[version]
+        if result:
+            if r.extras:
+                result.extras = r.extras
+            result.download_urls = versions.get('urls', {}).get(version, set())
+            d = {}
+            sd = versions.get('digests', {})
+            for url in result.download_urls:
+                if url in sd:  # pragma: no cover
+                    d[url] = sd[url]
+            result.digests = d
+        self.matcher = None
+        return result
+
+
+class PyPIRPCLocator(Locator):
+    """
+    This locator uses XML-RPC to locate distributions. It therefore
+    cannot be used with simple mirrors (that only mirror file content).
+    """
+    def __init__(self, url, **kwargs):
+        """
+        Initialise an instance.
+
+        :param url: The URL to use for XML-RPC.
+        :param kwargs: Passed to the superclass constructor.
+        """
+        super(PyPIRPCLocator, self).__init__(**kwargs)
+        self.base_url = url
+        self.client = ServerProxy(url, timeout=3.0)
+
+    def get_distribution_names(self):
+        """
+        Return all the distribution names known to this locator.
+        """
+        return set(self.client.list_packages())
+
+    def _get_project(self, name):
+        result = {'urls': {}, 'digests': {}}
+        versions = self.client.package_releases(name, True)
+        for v in versions:
+            urls = self.client.release_urls(name, v)
+            data = self.client.release_data(name, v)
+            metadata = Metadata(scheme=self.scheme)
+            metadata.name = data['name']
+            metadata.version = data['version']
+            metadata.license = data.get('license')
+            metadata.keywords = data.get('keywords', [])
+            metadata.summary = data.get('summary')
+            dist = Distribution(metadata)
+            if urls:
+                info = urls[0]
+                metadata.source_url = info['url']
+                dist.digest = self._get_digest(info)
+                dist.locator = self
+                result[v] = dist
+                for info in urls:
+                    url = info['url']
+                    digest = self._get_digest(info)
+                    result['urls'].setdefault(v, set()).add(url)
+                    result['digests'][url] = digest
+        return result
+
+class PyPIJSONLocator(Locator):
+    """
+    This locator uses PyPI's JSON interface. It's very limited in functionality
+    and probably not worth using.
+    """
+    def __init__(self, url, **kwargs):
+        super(PyPIJSONLocator, self).__init__(**kwargs)
+        self.base_url = ensure_slash(url)
+
+    def get_distribution_names(self):
+        """
+        Return all the distribution names known to this locator.
+        """
+        raise NotImplementedError('Not available from this locator')
+
+    def _get_project(self, name):
+        result = {'urls': {}, 'digests': {}}
+        url = urljoin(self.base_url, '%s/json' % quote(name))
+        try:
+            resp = self.opener.open(url)
+            data = resp.read().decode() # for now
+            d = json.loads(data)
+            md = Metadata(scheme=self.scheme)
+            data = d['info']
+            md.name = data['name']
+            md.version = data['version']
+            md.license = data.get('license')
+            md.keywords = data.get('keywords', [])
+            md.summary = data.get('summary')
+            dist = Distribution(md)
+            dist.locator = self
+            urls = d['urls']
+            result[md.version] = dist
+            for info in d['urls']:
+                url = info['url']
+                dist.download_urls.add(url)
+                dist.digests[url] = self._get_digest(info)
+                result['urls'].setdefault(md.version, set()).add(url)
+                result['digests'][url] = self._get_digest(info)
+            # Now get other releases
+            for version, infos in d['releases'].items():
+                if version == md.version:
+                    continue    # already done
+                omd = Metadata(scheme=self.scheme)
+                omd.name = md.name
+                omd.version = version
+                odist = Distribution(omd)
+                odist.locator = self
+                result[version] = odist
+                for info in infos:
+                    url = info['url']
+                    odist.download_urls.add(url)
+                    odist.digests[url] = self._get_digest(info)
+                    result['urls'].setdefault(version, set()).add(url)
+                    result['digests'][url] = self._get_digest(info)
+#            for info in urls:
+#                md.source_url = info['url']
+#                dist.digest = self._get_digest(info)
+#                dist.locator = self
+#                for info in urls:
+#                    url = info['url']
+#                    result['urls'].setdefault(md.version, set()).add(url)
+#                    result['digests'][url] = self._get_digest(info)
+        except Exception as e:
+            self.errors.put(text_type(e))
+            logger.exception('JSON fetch failed: %s', e)
+        return result
+
+
+class Page(object):
+    """
+    This class represents a scraped HTML page.
+    """
+    # The following slightly hairy-looking regex just looks for the contents of
+    # an anchor link, which has an attribute "href" either immediately preceded
+    # or immediately followed by a "rel" attribute. The attribute values can be
+    # declared with double quotes, single quotes or no quotes - which leads to
+    # the length of the expression.
+    _href = re.compile("""
+(rel\\s*=\\s*(?:"(?P<rel1>[^"]*)"|'(?P<rel2>[^']*)'|(?P<rel3>[^>\\s\n]*))\\s+)?
+href\\s*=\\s*(?:"(?P<url1>[^"]*)"|'(?P<url2>[^']*)'|(?P<url3>[^>\\s\n]*))
+(\\s+rel\\s*=\\s*(?:"(?P<rel4>[^"]*)"|'(?P<rel5>[^']*)'|(?P<rel6>[^>\\s\n]*)))?
+""", re.I | re.S | re.X)
+    _base = re.compile(r"""<base\s+href\s*=\s*['"]?([^'">]+)""", re.I | re.S)
+
+    def __init__(self, data, url):
+        """
+        Initialise an instance with the Unicode page contents and the URL they
+        came from.
+        """
+        self.data = data
+        self.base_url = self.url = url
+        m = self._base.search(self.data)
+        if m:
+            self.base_url = m.group(1)
+
+    _clean_re = re.compile(r'[^a-z0-9$&+,/:;=?@.#%_\\|-]', re.I)
+
+    @cached_property
+    def links(self):
+        """
+        Return the URLs of all the links on a page together with information
+        about their "rel" attribute, for determining which ones to treat as
+        downloads and which ones to queue for further scraping.
+        """
+        def clean(url):
+            "Tidy up an URL."
+            scheme, netloc, path, params, query, frag = urlparse(url)
+            return urlunparse((scheme, netloc, quote(path),
+                               params, query, frag))
+
+        result = set()
+        for match in self._href.finditer(self.data):
+            d = match.groupdict('')
+            rel = (d['rel1'] or d['rel2'] or d['rel3'] or
+                   d['rel4'] or d['rel5'] or d['rel6'])
+            url = d['url1'] or d['url2'] or d['url3']
+            url = urljoin(self.base_url, url)
+            url = unescape(url)
+            url = self._clean_re.sub(lambda m: '%%%2x' % ord(m.group(0)), url)
+            result.add((url, rel))
+        # We sort the result, hoping to bring the most recent versions
+        # to the front
+        result = sorted(result, key=lambda t: t[0], reverse=True)
+        return result
+
+
+class SimpleScrapingLocator(Locator):
+    """
+    A locator which scrapes HTML pages to locate downloads for a distribution.
+    This runs multiple threads to do the I/O; performance is at least as good
+    as pip's PackageFinder, which works in an analogous fashion.
+    """
+
+    # These are used to deal with various Content-Encoding schemes.
+    decoders = {
+        'deflate': zlib.decompress,
+        'gzip': lambda b: gzip.GzipFile(fileobj=BytesIO(b)).read(),
+        'none': lambda b: b,
+    }
+
+    def __init__(self, url, timeout=None, num_workers=10, **kwargs):
+        """
+        Initialise an instance.
+        :param url: The root URL to use for scraping.
+        :param timeout: The timeout, in seconds, to be applied to requests.
+                        This defaults to ``None`` (no timeout specified).
+        :param num_workers: The number of worker threads you want to do I/O,
+                            This defaults to 10.
+        :param kwargs: Passed to the superclass.
+        """
+        super(SimpleScrapingLocator, self).__init__(**kwargs)
+        self.base_url = ensure_slash(url)
+        self.timeout = timeout
+        self._page_cache = {}
+        self._seen = set()
+        self._to_fetch = queue.Queue()
+        self._bad_hosts = set()
+        self.skip_externals = False
+        self.num_workers = num_workers
+        self._lock = threading.RLock()
+        # See issue #45: we need to be resilient when the locator is used
+        # in a thread, e.g. with concurrent.futures. We can't use self._lock
+        # as it is for coordinating our internal threads - the ones created
+        # in _prepare_threads.
+        self._gplock = threading.RLock()
+        self.platform_check = False  # See issue #112
+
+    def _prepare_threads(self):
+        """
+        Threads are created only when get_project is called, and terminate
+        before it returns. They are there primarily to parallelise I/O (i.e.
+        fetching web pages).
+        """
+        self._threads = []
+        for i in range(self.num_workers):
+            t = threading.Thread(target=self._fetch)
+            t.daemon = True
+            t.start()
+            self._threads.append(t)
+
+    def _wait_threads(self):
+        """
+        Tell all the threads to terminate (by sending a sentinel value) and
+        wait for them to do so.
+        """
+        # Note that you need two loops, since you can't say which
+        # thread will get each sentinel
+        for t in self._threads:
+            self._to_fetch.put(None)    # sentinel
+        for t in self._threads:
+            t.join()
+        self._threads = []
+
+    def _get_project(self, name):
+        result = {'urls': {}, 'digests': {}}
+        with self._gplock:
+            self.result = result
+            self.project_name = name
+            url = urljoin(self.base_url, '%s/' % quote(name))
+            self._seen.clear()
+            self._page_cache.clear()
+            self._prepare_threads()
+            try:
+                logger.debug('Queueing %s', url)
+                self._to_fetch.put(url)
+                self._to_fetch.join()
+            finally:
+                self._wait_threads()
+            del self.result
+        return result
+
+    platform_dependent = re.compile(r'\b(linux_(i\d86|x86_64|arm\w+)|'
+                                    r'win(32|_amd64)|macosx_?\d+)\b', re.I)
+
+    def _is_platform_dependent(self, url):
+        """
+        Does an URL refer to a platform-specific download?
+        """
+        return self.platform_dependent.search(url)
+
+    def _process_download(self, url):
+        """
+        See if an URL is a suitable download for a project.
+
+        If it is, register information in the result dictionary (for
+        _get_project) about the specific version it's for.
+
+        Note that the return value isn't actually used other than as a boolean
+        value.
+        """
+        if self.platform_check and self._is_platform_dependent(url):
+            info = None
+        else:
+            info = self.convert_url_to_download_info(url, self.project_name)
+        logger.debug('process_download: %s -> %s', url, info)
+        if info:
+            with self._lock:    # needed because self.result is shared
+                self._update_version_data(self.result, info)
+        return info
+
+    def _should_queue(self, link, referrer, rel):
+        """
+        Determine whether a link URL from a referring page and with a
+        particular "rel" attribute should be queued for scraping.
+        """
+        scheme, netloc, path, _, _, _ = urlparse(link)
+        if path.endswith(self.source_extensions + self.binary_extensions +
+                         self.excluded_extensions):
+            result = False
+        elif self.skip_externals and not link.startswith(self.base_url):
+            result = False
+        elif not referrer.startswith(self.base_url):
+            result = False
+        elif rel not in ('homepage', 'download'):
+            result = False
+        elif scheme not in ('http', 'https', 'ftp'):
+            result = False
+        elif self._is_platform_dependent(link):
+            result = False
+        else:
+            host = netloc.split(':', 1)[0]
+            if host.lower() == 'localhost':
+                result = False
+            else:
+                result = True
+        logger.debug('should_queue: %s (%s) from %s -> %s', link, rel,
+                     referrer, result)
+        return result
+
+    def _fetch(self):
+        """
+        Get a URL to fetch from the work queue, get the HTML page, examine its
+        links for download candidates and candidates for further scraping.
+
+        This is a handy method to run in a thread.
+        """
+        while True:
+            url = self._to_fetch.get()
+            try:
+                if url:
+                    page = self.get_page(url)
+                    if page is None:    # e.g. after an error
+                        continue
+                    for link, rel in page.links:
+                        if link not in self._seen:
+                            try:
+                                self._seen.add(link)
+                                if (not self._process_download(link) and
+                                    self._should_queue(link, url, rel)):
+                                    logger.debug('Queueing %s from %s', link, url)
+                                    self._to_fetch.put(link)
+                            except MetadataInvalidError:  # e.g. invalid versions
+                                pass
+            except Exception as e:  # pragma: no cover
+                self.errors.put(text_type(e))
+            finally:
+                # always do this, to avoid hangs :-)
+                self._to_fetch.task_done()
+            if not url:
+                #logger.debug('Sentinel seen, quitting.')
+                break
+
+    def get_page(self, url):
+        """
+        Get the HTML for an URL, possibly from an in-memory cache.
+
+        XXX TODO Note: this cache is never actually cleared. It's assumed that
+        the data won't get stale over the lifetime of a locator instance (not
+        necessarily true for the default_locator).
+        """
+        # http://peak.telecommunity.com/DevCenter/EasyInstall#package-index-api
+        scheme, netloc, path, _, _, _ = urlparse(url)
+        if scheme == 'file' and os.path.isdir(url2pathname(path)):
+            url = urljoin(ensure_slash(url), 'index.html')
+
+        if url in self._page_cache:
+            result = self._page_cache[url]
+            logger.debug('Returning %s from cache: %s', url, result)
+        else:
+            host = netloc.split(':', 1)[0]
+            result = None
+            if host in self._bad_hosts:
+                logger.debug('Skipping %s due to bad host %s', url, host)
+            else:
+                req = Request(url, headers={'Accept-encoding': 'identity'})
+                try:
+                    logger.debug('Fetching %s', url)
+                    resp = self.opener.open(req, timeout=self.timeout)
+                    logger.debug('Fetched %s', url)
+                    headers = resp.info()
+                    content_type = headers.get('Content-Type', '')
+                    if HTML_CONTENT_TYPE.match(content_type):
+                        final_url = resp.geturl()
+                        data = resp.read()
+                        encoding = headers.get('Content-Encoding')
+                        if encoding:
+                            decoder = self.decoders[encoding]   # fail if not found
+                            data = decoder(data)
+                        encoding = 'utf-8'
+                        m = CHARSET.search(content_type)
+                        if m:
+                            encoding = m.group(1)
+                        try:
+                            data = data.decode(encoding)
+                        except UnicodeError:  # pragma: no cover
+                            data = data.decode('latin-1')    # fallback
+                        result = Page(data, final_url)
+                        self._page_cache[final_url] = result
+                except HTTPError as e:
+                    if e.code != 404:
+                        logger.exception('Fetch failed: %s: %s', url, e)
+                except URLError as e:  # pragma: no cover
+                    logger.exception('Fetch failed: %s: %s', url, e)
+                    with self._lock:
+                        self._bad_hosts.add(host)
+                except Exception as e:  # pragma: no cover
+                    logger.exception('Fetch failed: %s: %s', url, e)
+                finally:
+                    self._page_cache[url] = result   # even if None (failure)
+        return result
+
+    _distname_re = re.compile('<a href=[^>]*>([^<]+)<')
+
+    def get_distribution_names(self):
+        """
+        Return all the distribution names known to this locator.
+        """
+        result = set()
+        page = self.get_page(self.base_url)
+        if not page:
+            raise DistlibException('Unable to get %s' % self.base_url)
+        for match in self._distname_re.finditer(page.data):
+            result.add(match.group(1))
+        return result
+
+class DirectoryLocator(Locator):
+    """
+    This class locates distributions in a directory tree.
+    """
+
+    def __init__(self, path, **kwargs):
+        """
+        Initialise an instance.
+        :param path: The root of the directory tree to search.
+        :param kwargs: Passed to the superclass constructor,
+                       except for:
+                       * recursive - if True (the default), subdirectories are
+                         recursed into. If False, only the top-level directory
+                         is searched,
+        """
+        self.recursive = kwargs.pop('recursive', True)
+        super(DirectoryLocator, self).__init__(**kwargs)
+        path = os.path.abspath(path)
+        if not os.path.isdir(path):  # pragma: no cover
+            raise DistlibException('Not a directory: %r' % path)
+        self.base_dir = path
+
+    def should_include(self, filename, parent):
+        """
+        Should a filename be considered as a candidate for a distribution
+        archive? As well as the filename, the directory which contains it
+        is provided, though not used by the current implementation.
+        """
+        return filename.endswith(self.downloadable_extensions)
+
+    def _get_project(self, name):
+        result = {'urls': {}, 'digests': {}}
+        for root, dirs, files in os.walk(self.base_dir):
+            for fn in files:
+                if self.should_include(fn, root):
+                    fn = os.path.join(root, fn)
+                    url = urlunparse(('file', '',
+                                      pathname2url(os.path.abspath(fn)),
+                                      '', '', ''))
+                    info = self.convert_url_to_download_info(url, name)
+                    if info:
+                        self._update_version_data(result, info)
+            if not self.recursive:
+                break
+        return result
+
+    def get_distribution_names(self):
+        """
+        Return all the distribution names known to this locator.
+        """
+        result = set()
+        for root, dirs, files in os.walk(self.base_dir):
+            for fn in files:
+                if self.should_include(fn, root):
+                    fn = os.path.join(root, fn)
+                    url = urlunparse(('file', '',
+                                      pathname2url(os.path.abspath(fn)),
+                                      '', '', ''))
+                    info = self.convert_url_to_download_info(url, None)
+                    if info:
+                        result.add(info['name'])
+            if not self.recursive:
+                break
+        return result
+
+class JSONLocator(Locator):
+    """
+    This locator uses special extended metadata (not available on PyPI) and is
+    the basis of performant dependency resolution in distlib. Other locators
+    require archive downloads before dependencies can be determined! As you
+    might imagine, that can be slow.
+    """
+    def get_distribution_names(self):
+        """
+        Return all the distribution names known to this locator.
+        """
+        raise NotImplementedError('Not available from this locator')
+
+    def _get_project(self, name):
+        result = {'urls': {}, 'digests': {}}
+        data = get_project_data(name)
+        if data:
+            for info in data.get('files', []):
+                if info['ptype'] != 'sdist' or info['pyversion'] != 'source':
+                    continue
+                # We don't store summary in project metadata as it makes
+                # the data bigger for no benefit during dependency
+                # resolution
+                dist = make_dist(data['name'], info['version'],
+                                 summary=data.get('summary',
+                                                  'Placeholder for summary'),
+                                 scheme=self.scheme)
+                md = dist.metadata
+                md.source_url = info['url']
+                # TODO SHA256 digest
+                if 'digest' in info and info['digest']:
+                    dist.digest = ('md5', info['digest'])
+                md.dependencies = info.get('requirements', {})
+                dist.exports = info.get('exports', {})
+                result[dist.version] = dist
+                result['urls'].setdefault(dist.version, set()).add(info['url'])
+        return result
+
+class DistPathLocator(Locator):
+    """
+    This locator finds installed distributions in a path. It can be useful for
+    adding to an :class:`AggregatingLocator`.
+    """
+    def __init__(self, distpath, **kwargs):
+        """
+        Initialise an instance.
+
+        :param distpath: A :class:`DistributionPath` instance to search.
+        """
+        super(DistPathLocator, self).__init__(**kwargs)
+        assert isinstance(distpath, DistributionPath)
+        self.distpath = distpath
+
+    def _get_project(self, name):
+        dist = self.distpath.get_distribution(name)
+        if dist is None:
+            result = {'urls': {}, 'digests': {}}
+        else:
+            result = {
+                dist.version: dist,
+                'urls': {dist.version: set([dist.source_url])},
+                'digests': {dist.version: set([None])}
+            }
+        return result
+
+
+class AggregatingLocator(Locator):
+    """
+    This class allows you to chain and/or merge a list of locators.
+    """
+    def __init__(self, *locators, **kwargs):
+        """
+        Initialise an instance.
+
+        :param locators: The list of locators to search.
+        :param kwargs: Passed to the superclass constructor,
+                       except for:
+                       * merge - if False (the default), the first successful
+                         search from any of the locators is returned. If True,
+                         the results from all locators are merged (this can be
+                         slow).
+        """
+        self.merge = kwargs.pop('merge', False)
+        self.locators = locators
+        super(AggregatingLocator, self).__init__(**kwargs)
+
+    def clear_cache(self):
+        super(AggregatingLocator, self).clear_cache()
+        for locator in self.locators:
+            locator.clear_cache()
+
+    def _set_scheme(self, value):
+        self._scheme = value
+        for locator in self.locators:
+            locator.scheme = value
+
+    scheme = property(Locator.scheme.fget, _set_scheme)
+
+    def _get_project(self, name):
+        result = {}
+        for locator in self.locators:
+            d = locator.get_project(name)
+            if d:
+                if self.merge:
+                    files = result.get('urls', {})
+                    digests = result.get('digests', {})
+                    # next line could overwrite result['urls'], result['digests']
+                    result.update(d)
+                    df = result.get('urls')
+                    if files and df:
+                        for k, v in files.items():
+                            if k in df:
+                                df[k] |= v
+                            else:
+                                df[k] = v
+                    dd = result.get('digests')
+                    if digests and dd:
+                        dd.update(digests)
+                else:
+                    # See issue #18. If any dists are found and we're looking
+                    # for specific constraints, we only return something if
+                    # a match is found. For example, if a DirectoryLocator
+                    # returns just foo (1.0) while we're looking for
+                    # foo (>= 2.0), we'll pretend there was nothing there so
+                    # that subsequent locators can be queried. Otherwise we
+                    # would just return foo (1.0) which would then lead to a
+                    # failure to find foo (>= 2.0), because other locators
+                    # weren't searched. Note that this only matters when
+                    # merge=False.
+                    if self.matcher is None:
+                        found = True
+                    else:
+                        found = False
+                        for k in d:
+                            if self.matcher.match(k):
+                                found = True
+                                break
+                    if found:
+                        result = d
+                        break
+        return result
+
+    def get_distribution_names(self):
+        """
+        Return all the distribution names known to this locator.
+        """
+        result = set()
+        for locator in self.locators:
+            try:
+                result |= locator.get_distribution_names()
+            except NotImplementedError:
+                pass
+        return result
+
+
+# We use a legacy scheme simply because most of the dists on PyPI use legacy
+# versions which don't conform to PEP 426 / PEP 440.
+default_locator = AggregatingLocator(
+                    JSONLocator(),
+                    SimpleScrapingLocator('https://pypi.org/simple/',
+                                          timeout=3.0),
+                    scheme='legacy')
+
+locate = default_locator.locate
+
+
+class DependencyFinder(object):
+    """
+    Locate dependencies for distributions.
+    """
+
+    def __init__(self, locator=None):
+        """
+        Initialise an instance, using the specified locator
+        to locate distributions.
+        """
+        self.locator = locator or default_locator
+        self.scheme = get_scheme(self.locator.scheme)
+
+    def add_distribution(self, dist):
+        """
+        Add a distribution to the finder. This will update internal information
+        about who provides what.
+        :param dist: The distribution to add.
+        """
+        logger.debug('adding distribution %s', dist)
+        name = dist.key
+        self.dists_by_name[name] = dist
+        self.dists[(name, dist.version)] = dist
+        for p in dist.provides:
+            name, version = parse_name_and_version(p)
+            logger.debug('Add to provided: %s, %s, %s', name, version, dist)
+            self.provided.setdefault(name, set()).add((version, dist))
+
+    def remove_distribution(self, dist):
+        """
+        Remove a distribution from the finder. This will update internal
+        information about who provides what.
+        :param dist: The distribution to remove.
+        """
+        logger.debug('removing distribution %s', dist)
+        name = dist.key
+        del self.dists_by_name[name]
+        del self.dists[(name, dist.version)]
+        for p in dist.provides:
+            name, version = parse_name_and_version(p)
+            logger.debug('Remove from provided: %s, %s, %s', name, version, dist)
+            s = self.provided[name]
+            s.remove((version, dist))
+            if not s:
+                del self.provided[name]
+
+    def get_matcher(self, reqt):
+        """
+        Get a version matcher for a requirement.
+        :param reqt: The requirement
+        :type reqt: str
+        :return: A version matcher (an instance of
+                 :class:`distlib.version.Matcher`).
+        """
+        try:
+            matcher = self.scheme.matcher(reqt)
+        except UnsupportedVersionError:  # pragma: no cover
+            # XXX compat-mode if cannot read the version
+            name = reqt.split()[0]
+            matcher = self.scheme.matcher(name)
+        return matcher
+
+    def find_providers(self, reqt):
+        """
+        Find the distributions which can fulfill a requirement.
+
+        :param reqt: The requirement.
+         :type reqt: str
+        :return: A set of distribution which can fulfill the requirement.
+        """
+        matcher = self.get_matcher(reqt)
+        name = matcher.key   # case-insensitive
+        result = set()
+        provided = self.provided
+        if name in provided:
+            for version, provider in provided[name]:
+                try:
+                    match = matcher.match(version)
+                except UnsupportedVersionError:
+                    match = False
+
+                if match:
+                    result.add(provider)
+                    break
+        return result
+
+    def try_to_replace(self, provider, other, problems):
+        """
+        Attempt to replace one provider with another. This is typically used
+        when resolving dependencies from multiple sources, e.g. A requires
+        (B >= 1.0) while C requires (B >= 1.1).
+
+        For successful replacement, ``provider`` must meet all the requirements
+        which ``other`` fulfills.
+
+        :param provider: The provider we are trying to replace with.
+        :param other: The provider we're trying to replace.
+        :param problems: If False is returned, this will contain what
+                         problems prevented replacement. This is currently
+                         a tuple of the literal string 'cantreplace',
+                         ``provider``, ``other``  and the set of requirements
+                         that ``provider`` couldn't fulfill.
+        :return: True if we can replace ``other`` with ``provider``, else
+                 False.
+        """
+        rlist = self.reqts[other]
+        unmatched = set()
+        for s in rlist:
+            matcher = self.get_matcher(s)
+            if not matcher.match(provider.version):
+                unmatched.add(s)
+        if unmatched:
+            # can't replace other with provider
+            problems.add(('cantreplace', provider, other,
+                          frozenset(unmatched)))
+            result = False
+        else:
+            # can replace other with provider
+            self.remove_distribution(other)
+            del self.reqts[other]
+            for s in rlist:
+                self.reqts.setdefault(provider, set()).add(s)
+            self.add_distribution(provider)
+            result = True
+        return result
+
+    def find(self, requirement, meta_extras=None, prereleases=False):
+        """
+        Find a distribution and all distributions it depends on.
+
+        :param requirement: The requirement specifying the distribution to
+                            find, or a Distribution instance.
+        :param meta_extras: A list of meta extras such as :test:, :build: and
+                            so on.
+        :param prereleases: If ``True``, allow pre-release versions to be
+                            returned - otherwise, don't return prereleases
+                            unless they're all that's available.
+
+        Return a set of :class:`Distribution` instances and a set of
+        problems.
+
+        The distributions returned should be such that they have the
+        :attr:`required` attribute set to ``True`` if they were
+        from the ``requirement`` passed to ``find()``, and they have the
+        :attr:`build_time_dependency` attribute set to ``True`` unless they
+        are post-installation dependencies of the ``requirement``.
+
+        The problems should be a tuple consisting of the string
+        ``'unsatisfied'`` and the requirement which couldn't be satisfied
+        by any distribution known to the locator.
+        """
+
+        self.provided = {}
+        self.dists = {}
+        self.dists_by_name = {}
+        self.reqts = {}
+
+        meta_extras = set(meta_extras or [])
+        if ':*:' in meta_extras:
+            meta_extras.remove(':*:')
+            # :meta: and :run: are implicitly included
+            meta_extras |= set([':test:', ':build:', ':dev:'])
+
+        if isinstance(requirement, Distribution):
+            dist = odist = requirement
+            logger.debug('passed %s as requirement', odist)
+        else:
+            dist = odist = self.locator.locate(requirement,
+                                               prereleases=prereleases)
+            if dist is None:
+                raise DistlibException('Unable to locate %r' % requirement)
+            logger.debug('located %s', odist)
+        dist.requested = True
+        problems = set()
+        todo = set([dist])
+        install_dists = set([odist])
+        while todo:
+            dist = todo.pop()
+            name = dist.key     # case-insensitive
+            if name not in self.dists_by_name:
+                self.add_distribution(dist)
+            else:
+                #import pdb; pdb.set_trace()
+                other = self.dists_by_name[name]
+                if other != dist:
+                    self.try_to_replace(dist, other, problems)
+
+            ireqts = dist.run_requires | dist.meta_requires
+            sreqts = dist.build_requires
+            ereqts = set()
+            if meta_extras and dist in install_dists:
+                for key in ('test', 'build', 'dev'):
+                    e = ':%s:' % key
+                    if e in meta_extras:
+                        ereqts |= getattr(dist, '%s_requires' % key)
+            all_reqts = ireqts | sreqts | ereqts
+            for r in all_reqts:
+                providers = self.find_providers(r)
+                if not providers:
+                    logger.debug('No providers found for %r', r)
+                    provider = self.locator.locate(r, prereleases=prereleases)
+                    # If no provider is found and we didn't consider
+                    # prereleases, consider them now.
+                    if provider is None and not prereleases:
+                        provider = self.locator.locate(r, prereleases=True)
+                    if provider is None:
+                        logger.debug('Cannot satisfy %r', r)
+                        problems.add(('unsatisfied', r))
+                    else:
+                        n, v = provider.key, provider.version
+                        if (n, v) not in self.dists:
+                            todo.add(provider)
+                        providers.add(provider)
+                        if r in ireqts and dist in install_dists:
+                            install_dists.add(provider)
+                            logger.debug('Adding %s to install_dists',
+                                         provider.name_and_version)
+                for p in providers:
+                    name = p.key
+                    if name not in self.dists_by_name:
+                        self.reqts.setdefault(p, set()).add(r)
+                    else:
+                        other = self.dists_by_name[name]
+                        if other != p:
+                            # see if other can be replaced by p
+                            self.try_to_replace(p, other, problems)
+
+        dists = set(self.dists.values())
+        for dist in dists:
+            dist.build_time_dependency = dist not in install_dists
+            if dist.build_time_dependency:
+                logger.debug('%s is a build-time dependency only.',
+                             dist.name_and_version)
+        logger.debug('find done for %s', odist)
+        return dists, problems

env-llmeval/lib/python3.10/site-packages/pip/_vendor/distlib/wheel.py

@@ -0,0 +1,1053 @@
+# -*- coding: utf-8 -*-
+#
+# Copyright (C) 2013-2020 Vinay Sajip.
+# Licensed to the Python Software Foundation under a contributor agreement.
+# See LICENSE.txt and CONTRIBUTORS.txt.
+#
+from __future__ import unicode_literals
+
+import base64
+import codecs
+import datetime
+from email import message_from_file
+import hashlib
+import imp
+import json
+import logging
+import os
+import posixpath
+import re
+import shutil
+import sys
+import tempfile
+import zipfile
+
+from . import __version__, DistlibException
+from .compat import sysconfig, ZipFile, fsdecode, text_type, filter
+from .database import InstalledDistribution
+from .metadata import (Metadata, METADATA_FILENAME, WHEEL_METADATA_FILENAME,
+                       LEGACY_METADATA_FILENAME)
+from .util import (FileOperator, convert_path, CSVReader, CSVWriter, Cache,
+                   cached_property, get_cache_base, read_exports, tempdir,
+                   get_platform)
+from .version import NormalizedVersion, UnsupportedVersionError
+
+logger = logging.getLogger(__name__)
+
+cache = None    # created when needed
+
+if hasattr(sys, 'pypy_version_info'):  # pragma: no cover
+    IMP_PREFIX = 'pp'
+elif sys.platform.startswith('java'):  # pragma: no cover
+    IMP_PREFIX = 'jy'
+elif sys.platform == 'cli':  # pragma: no cover
+    IMP_PREFIX = 'ip'
+else:
+    IMP_PREFIX = 'cp'
+
+VER_SUFFIX = sysconfig.get_config_var('py_version_nodot')
+if not VER_SUFFIX:   # pragma: no cover
+    VER_SUFFIX = '%s%s' % sys.version_info[:2]
+PYVER = 'py' + VER_SUFFIX
+IMPVER = IMP_PREFIX + VER_SUFFIX
+
+ARCH = get_platform().replace('-', '_').replace('.', '_')
+
+ABI = sysconfig.get_config_var('SOABI')
+if ABI and ABI.startswith('cpython-'):
+    ABI = ABI.replace('cpython-', 'cp').split('-')[0]
+else:
+    def _derive_abi():
+        parts = ['cp', VER_SUFFIX]
+        if sysconfig.get_config_var('Py_DEBUG'):
+            parts.append('d')
+        if sysconfig.get_config_var('WITH_PYMALLOC'):
+            parts.append('m')
+        if sysconfig.get_config_var('Py_UNICODE_SIZE') == 4:
+            parts.append('u')
+        return ''.join(parts)
+    ABI = _derive_abi()
+    del _derive_abi
+
+FILENAME_RE = re.compile(r'''
+(?P<nm>[^-]+)
+-(?P<vn>\d+[^-]*)
+(-(?P<bn>\d+[^-]*))?
+-(?P<py>\w+\d+(\.\w+\d+)*)
+-(?P<bi>\w+)
+-(?P<ar>\w+(\.\w+)*)
+\.whl$
+''', re.IGNORECASE | re.VERBOSE)
+
+NAME_VERSION_RE = re.compile(r'''
+(?P<nm>[^-]+)
+-(?P<vn>\d+[^-]*)
+(-(?P<bn>\d+[^-]*))?$
+''', re.IGNORECASE | re.VERBOSE)
+
+SHEBANG_RE = re.compile(br'\s*#![^\r\n]*')
+SHEBANG_DETAIL_RE = re.compile(br'^(\s*#!("[^"]+"|\S+))\s+(.*)$')
+SHEBANG_PYTHON = b'#!python'
+SHEBANG_PYTHONW = b'#!pythonw'
+
+if os.sep == '/':
+    to_posix = lambda o: o
+else:
+    to_posix = lambda o: o.replace(os.sep, '/')
+
+
+class Mounter(object):
+    def __init__(self):
+        self.impure_wheels = {}
+        self.libs = {}
+
+    def add(self, pathname, extensions):
+        self.impure_wheels[pathname] = extensions
+        self.libs.update(extensions)
+
+    def remove(self, pathname):
+        extensions = self.impure_wheels.pop(pathname)
+        for k, v in extensions:
+            if k in self.libs:
+                del self.libs[k]
+
+    def find_module(self, fullname, path=None):
+        if fullname in self.libs:
+            result = self
+        else:
+            result = None
+        return result
+
+    def load_module(self, fullname):
+        if fullname in sys.modules:
+            result = sys.modules[fullname]
+        else:
+            if fullname not in self.libs:
+                raise ImportError('unable to find extension for %s' % fullname)
+            result = imp.load_dynamic(fullname, self.libs[fullname])
+            result.__loader__ = self
+            parts = fullname.rsplit('.', 1)
+            if len(parts) > 1:
+                result.__package__ = parts[0]
+        return result
+
+_hook = Mounter()
+
+
+class Wheel(object):
+    """
+    Class to build and install from Wheel files (PEP 427).
+    """
+
+    wheel_version = (1, 1)
+    hash_kind = 'sha256'
+
+    def __init__(self, filename=None, sign=False, verify=False):
+        """
+        Initialise an instance using a (valid) filename.
+        """
+        self.sign = sign
+        self.should_verify = verify
+        self.buildver = ''
+        self.pyver = [PYVER]
+        self.abi = ['none']
+        self.arch = ['any']
+        self.dirname = os.getcwd()
+        if filename is None:
+            self.name = 'dummy'
+            self.version = '0.1'
+            self._filename = self.filename
+        else:
+            m = NAME_VERSION_RE.match(filename)
+            if m:
+                info = m.groupdict('')
+                self.name = info['nm']
+                # Reinstate the local version separator
+                self.version = info['vn'].replace('_', '-')
+                self.buildver = info['bn']
+                self._filename = self.filename
+            else:
+                dirname, filename = os.path.split(filename)
+                m = FILENAME_RE.match(filename)
+                if not m:
+                    raise DistlibException('Invalid name or '
+                                           'filename: %r' % filename)
+                if dirname:
+                    self.dirname = os.path.abspath(dirname)
+                self._filename = filename
+                info = m.groupdict('')
+                self.name = info['nm']
+                self.version = info['vn']
+                self.buildver = info['bn']
+                self.pyver = info['py'].split('.')
+                self.abi = info['bi'].split('.')
+                self.arch = info['ar'].split('.')
+
+    @property
+    def filename(self):
+        """
+        Build and return a filename from the various components.
+        """
+        if self.buildver:
+            buildver = '-' + self.buildver
+        else:
+            buildver = ''
+        pyver = '.'.join(self.pyver)
+        abi = '.'.join(self.abi)
+        arch = '.'.join(self.arch)
+        # replace - with _ as a local version separator
+        version = self.version.replace('-', '_')
+        return '%s-%s%s-%s-%s-%s.whl' % (self.name, version, buildver,
+                                         pyver, abi, arch)
+
+    @property
+    def exists(self):
+        path = os.path.join(self.dirname, self.filename)
+        return os.path.isfile(path)
+
+    @property
+    def tags(self):
+        for pyver in self.pyver:
+            for abi in self.abi:
+                for arch in self.arch:
+                    yield pyver, abi, arch
+
+    @cached_property
+    def metadata(self):
+        pathname = os.path.join(self.dirname, self.filename)
+        name_ver = '%s-%s' % (self.name, self.version)
+        info_dir = '%s.dist-info' % name_ver
+        wrapper = codecs.getreader('utf-8')
+        with ZipFile(pathname, 'r') as zf:
+            wheel_metadata = self.get_wheel_metadata(zf)
+            wv = wheel_metadata['Wheel-Version'].split('.', 1)
+            file_version = tuple([int(i) for i in wv])
+            # if file_version < (1, 1):
+                # fns = [WHEEL_METADATA_FILENAME, METADATA_FILENAME,
+                       # LEGACY_METADATA_FILENAME]
+            # else:
+                # fns = [WHEEL_METADATA_FILENAME, METADATA_FILENAME]
+            fns = [WHEEL_METADATA_FILENAME, LEGACY_METADATA_FILENAME]
+            result = None
+            for fn in fns:
+                try:
+                    metadata_filename = posixpath.join(info_dir, fn)
+                    with zf.open(metadata_filename) as bf:
+                        wf = wrapper(bf)
+                        result = Metadata(fileobj=wf)
+                        if result:
+                            break
+                except KeyError:
+                    pass
+            if not result:
+                raise ValueError('Invalid wheel, because metadata is '
+                                 'missing: looked in %s' % ', '.join(fns))
+        return result
+
+    def get_wheel_metadata(self, zf):
+        name_ver = '%s-%s' % (self.name, self.version)
+        info_dir = '%s.dist-info' % name_ver
+        metadata_filename = posixpath.join(info_dir, 'WHEEL')
+        with zf.open(metadata_filename) as bf:
+            wf = codecs.getreader('utf-8')(bf)
+            message = message_from_file(wf)
+        return dict(message)
+
+    @cached_property
+    def info(self):
+        pathname = os.path.join(self.dirname, self.filename)
+        with ZipFile(pathname, 'r') as zf:
+            result = self.get_wheel_metadata(zf)
+        return result
+
+    def process_shebang(self, data):
+        m = SHEBANG_RE.match(data)
+        if m:
+            end = m.end()
+            shebang, data_after_shebang = data[:end], data[end:]
+            # Preserve any arguments after the interpreter
+            if b'pythonw' in shebang.lower():
+                shebang_python = SHEBANG_PYTHONW
+            else:
+                shebang_python = SHEBANG_PYTHON
+            m = SHEBANG_DETAIL_RE.match(shebang)
+            if m:
+                args = b' ' + m.groups()[-1]
+            else:
+                args = b''
+            shebang = shebang_python + args
+            data = shebang + data_after_shebang
+        else:
+            cr = data.find(b'\r')
+            lf = data.find(b'\n')
+            if cr < 0 or cr > lf:
+                term = b'\n'
+            else:
+                if data[cr:cr + 2] == b'\r\n':
+                    term = b'\r\n'
+                else:
+                    term = b'\r'
+            data = SHEBANG_PYTHON + term + data
+        return data
+
+    def get_hash(self, data, hash_kind=None):
+        if hash_kind is None:
+            hash_kind = self.hash_kind
+        try:
+            hasher = getattr(hashlib, hash_kind)
+        except AttributeError:
+            raise DistlibException('Unsupported hash algorithm: %r' % hash_kind)
+        result = hasher(data).digest()
+        result = base64.urlsafe_b64encode(result).rstrip(b'=').decode('ascii')
+        return hash_kind, result
+
+    def write_record(self, records, record_path, base):
+        records = list(records) # make a copy, as mutated
+        p = to_posix(os.path.relpath(record_path, base))
+        records.append((p, '', ''))
+        with CSVWriter(record_path) as writer:
+            for row in records:
+                writer.writerow(row)
+
+    def write_records(self, info, libdir, archive_paths):
+        records = []
+        distinfo, info_dir = info
+        hasher = getattr(hashlib, self.hash_kind)
+        for ap, p in archive_paths:
+            with open(p, 'rb') as f:
+                data = f.read()
+            digest = '%s=%s' % self.get_hash(data)
+            size = os.path.getsize(p)
+            records.append((ap, digest, size))
+
+        p = os.path.join(distinfo, 'RECORD')
+        self.write_record(records, p, libdir)
+        ap = to_posix(os.path.join(info_dir, 'RECORD'))
+        archive_paths.append((ap, p))
+
+    def build_zip(self, pathname, archive_paths):
+        with ZipFile(pathname, 'w', zipfile.ZIP_DEFLATED) as zf:
+            for ap, p in archive_paths:
+                logger.debug('Wrote %s to %s in wheel', p, ap)
+                zf.write(p, ap)
+
+    def build(self, paths, tags=None, wheel_version=None):
+        """
+        Build a wheel from files in specified paths, and use any specified tags
+        when determining the name of the wheel.
+        """
+        if tags is None:
+            tags = {}
+
+        libkey = list(filter(lambda o: o in paths, ('purelib', 'platlib')))[0]
+        if libkey == 'platlib':
+            is_pure = 'false'
+            default_pyver = [IMPVER]
+            default_abi = [ABI]
+            default_arch = [ARCH]
+        else:
+            is_pure = 'true'
+            default_pyver = [PYVER]
+            default_abi = ['none']
+            default_arch = ['any']
+
+        self.pyver = tags.get('pyver', default_pyver)
+        self.abi = tags.get('abi', default_abi)
+        self.arch = tags.get('arch', default_arch)
+
+        libdir = paths[libkey]
+
+        name_ver = '%s-%s' % (self.name, self.version)
+        data_dir = '%s.data' % name_ver
+        info_dir = '%s.dist-info' % name_ver
+
+        archive_paths = []
+
+        # First, stuff which is not in site-packages
+        for key in ('data', 'headers', 'scripts'):
+            if key not in paths:
+                continue
+            path = paths[key]
+            if os.path.isdir(path):
+                for root, dirs, files in os.walk(path):
+                    for fn in files:
+                        p = fsdecode(os.path.join(root, fn))
+                        rp = os.path.relpath(p, path)
+                        ap = to_posix(os.path.join(data_dir, key, rp))
+                        archive_paths.append((ap, p))
+                        if key == 'scripts' and not p.endswith('.exe'):
+                            with open(p, 'rb') as f:
+                                data = f.read()
+                            data = self.process_shebang(data)
+                            with open(p, 'wb') as f:
+                                f.write(data)
+
+        # Now, stuff which is in site-packages, other than the
+        # distinfo stuff.
+        path = libdir
+        distinfo = None
+        for root, dirs, files in os.walk(path):
+            if root == path:
+                # At the top level only, save distinfo for later
+                # and skip it for now
+                for i, dn in enumerate(dirs):
+                    dn = fsdecode(dn)
+                    if dn.endswith('.dist-info'):
+                        distinfo = os.path.join(root, dn)
+                        del dirs[i]
+                        break
+                assert distinfo, '.dist-info directory expected, not found'
+
+            for fn in files:
+                # comment out next suite to leave .pyc files in
+                if fsdecode(fn).endswith(('.pyc', '.pyo')):
+                    continue
+                p = os.path.join(root, fn)
+                rp = to_posix(os.path.relpath(p, path))
+                archive_paths.append((rp, p))
+
+        # Now distinfo. Assumed to be flat, i.e. os.listdir is enough.
+        files = os.listdir(distinfo)
+        for fn in files:
+            if fn not in ('RECORD', 'INSTALLER', 'SHARED', 'WHEEL'):
+                p = fsdecode(os.path.join(distinfo, fn))
+                ap = to_posix(os.path.join(info_dir, fn))
+                archive_paths.append((ap, p))
+
+        wheel_metadata = [
+            'Wheel-Version: %d.%d' % (wheel_version or self.wheel_version),
+            'Generator: distlib %s' % __version__,
+            'Root-Is-Purelib: %s' % is_pure,
+        ]
+        for pyver, abi, arch in self.tags:
+            wheel_metadata.append('Tag: %s-%s-%s' % (pyver, abi, arch))
+        p = os.path.join(distinfo, 'WHEEL')
+        with open(p, 'w') as f:
+            f.write('\n'.join(wheel_metadata))
+        ap = to_posix(os.path.join(info_dir, 'WHEEL'))
+        archive_paths.append((ap, p))
+
+        # sort the entries by archive path. Not needed by any spec, but it
+        # keeps the archive listing and RECORD tidier than they would otherwise
+        # be. Use the number of path segments to keep directory entries together,
+        # and keep the dist-info stuff at the end.
+        def sorter(t):
+            ap = t[0]
+            n = ap.count('/')
+            if '.dist-info' in ap:
+                n += 10000
+            return (n, ap)
+        archive_paths = sorted(archive_paths, key=sorter)
+
+        # Now, at last, RECORD.
+        # Paths in here are archive paths - nothing else makes sense.
+        self.write_records((distinfo, info_dir), libdir, archive_paths)
+        # Now, ready to build the zip file
+        pathname = os.path.join(self.dirname, self.filename)
+        self.build_zip(pathname, archive_paths)
+        return pathname
+
+    def skip_entry(self, arcname):
+        """
+        Determine whether an archive entry should be skipped when verifying
+        or installing.
+        """
+        # The signature file won't be in RECORD,
+        # and we  don't currently don't do anything with it
+        # We also skip directories, as they won't be in RECORD
+        # either. See:
+        #
+        # https://github.com/pypa/wheel/issues/294
+        # https://github.com/pypa/wheel/issues/287
+        # https://github.com/pypa/wheel/pull/289
+        #
+        return arcname.endswith(('/', '/RECORD.jws'))
+
+    def install(self, paths, maker, **kwargs):
+        """
+        Install a wheel to the specified paths. If kwarg ``warner`` is
+        specified, it should be a callable, which will be called with two
+        tuples indicating the wheel version of this software and the wheel
+        version in the file, if there is a discrepancy in the versions.
+        This can be used to issue any warnings to raise any exceptions.
+        If kwarg ``lib_only`` is True, only the purelib/platlib files are
+        installed, and the headers, scripts, data and dist-info metadata are
+        not written. If kwarg ``bytecode_hashed_invalidation`` is True, written
+        bytecode will try to use file-hash based invalidation (PEP-552) on
+        supported interpreter versions (CPython 2.7+).
+
+        The return value is a :class:`InstalledDistribution` instance unless
+        ``options.lib_only`` is True, in which case the return value is ``None``.
+        """
+
+        dry_run = maker.dry_run
+        warner = kwargs.get('warner')
+        lib_only = kwargs.get('lib_only', False)
+        bc_hashed_invalidation = kwargs.get('bytecode_hashed_invalidation', False)
+
+        pathname = os.path.join(self.dirname, self.filename)
+        name_ver = '%s-%s' % (self.name, self.version)
+        data_dir = '%s.data' % name_ver
+        info_dir = '%s.dist-info' % name_ver
+
+        metadata_name = posixpath.join(info_dir, LEGACY_METADATA_FILENAME)
+        wheel_metadata_name = posixpath.join(info_dir, 'WHEEL')
+        record_name = posixpath.join(info_dir, 'RECORD')
+
+        wrapper = codecs.getreader('utf-8')
+
+        with ZipFile(pathname, 'r') as zf:
+            with zf.open(wheel_metadata_name) as bwf:
+                wf = wrapper(bwf)
+                message = message_from_file(wf)
+            wv = message['Wheel-Version'].split('.', 1)
+            file_version = tuple([int(i) for i in wv])
+            if (file_version != self.wheel_version) and warner:
+                warner(self.wheel_version, file_version)
+
+            if message['Root-Is-Purelib'] == 'true':
+                libdir = paths['purelib']
+            else:
+                libdir = paths['platlib']
+
+            records = {}
+            with zf.open(record_name) as bf:
+                with CSVReader(stream=bf) as reader:
+                    for row in reader:
+                        p = row[0]
+                        records[p] = row
+
+            data_pfx = posixpath.join(data_dir, '')
+            info_pfx = posixpath.join(info_dir, '')
+            script_pfx = posixpath.join(data_dir, 'scripts', '')
+
+            # make a new instance rather than a copy of maker's,
+            # as we mutate it
+            fileop = FileOperator(dry_run=dry_run)
+            fileop.record = True    # so we can rollback if needed
+
+            bc = not sys.dont_write_bytecode    # Double negatives. Lovely!
+
+            outfiles = []   # for RECORD writing
+
+            # for script copying/shebang processing
+            workdir = tempfile.mkdtemp()
+            # set target dir later
+            # we default add_launchers to False, as the
+            # Python Launcher should be used instead
+            maker.source_dir = workdir
+            maker.target_dir = None
+            try:
+                for zinfo in zf.infolist():
+                    arcname = zinfo.filename
+                    if isinstance(arcname, text_type):
+                        u_arcname = arcname
+                    else:
+                        u_arcname = arcname.decode('utf-8')
+                    if self.skip_entry(u_arcname):
+                        continue
+                    row = records[u_arcname]
+                    if row[2] and str(zinfo.file_size) != row[2]:
+                        raise DistlibException('size mismatch for '
+                                               '%s' % u_arcname)
+                    if row[1]:
+                        kind, value = row[1].split('=', 1)
+                        with zf.open(arcname) as bf:
+                            data = bf.read()
+                        _, digest = self.get_hash(data, kind)
+                        if digest != value:
+                            raise DistlibException('digest mismatch for '
+                                                   '%s' % arcname)
+
+                    if lib_only and u_arcname.startswith((info_pfx, data_pfx)):
+                        logger.debug('lib_only: skipping %s', u_arcname)
+                        continue
+                    is_script = (u_arcname.startswith(script_pfx)
+                                 and not u_arcname.endswith('.exe'))
+
+                    if u_arcname.startswith(data_pfx):
+                        _, where, rp = u_arcname.split('/', 2)
+                        outfile = os.path.join(paths[where], convert_path(rp))
+                    else:
+                        # meant for site-packages.
+                        if u_arcname in (wheel_metadata_name, record_name):
+                            continue
+                        outfile = os.path.join(libdir, convert_path(u_arcname))
+                    if not is_script:
+                        with zf.open(arcname) as bf:
+                            fileop.copy_stream(bf, outfile)
+                        # Issue #147: permission bits aren't preserved. Using
+                        # zf.extract(zinfo, libdir) should have worked, but didn't,
+                        # see https://www.thetopsites.net/article/53834422.shtml
+                        # So ... manually preserve permission bits as given in zinfo
+                        if os.name == 'posix':
+                            # just set the normal permission bits
+                            os.chmod(outfile, (zinfo.external_attr >> 16) & 0x1FF)
+                        outfiles.append(outfile)
+                        # Double check the digest of the written file
+                        if not dry_run and row[1]:
+                            with open(outfile, 'rb') as bf:
+                                data = bf.read()
+                                _, newdigest = self.get_hash(data, kind)
+                                if newdigest != digest:
+                                    raise DistlibException('digest mismatch '
+                                                           'on write for '
+                                                           '%s' % outfile)
+                        if bc and outfile.endswith('.py'):
+                            try:
+                                pyc = fileop.byte_compile(outfile,
+                                                          hashed_invalidation=bc_hashed_invalidation)
+                                outfiles.append(pyc)
+                            except Exception:
+                                # Don't give up if byte-compilation fails,
+                                # but log it and perhaps warn the user
+                                logger.warning('Byte-compilation failed',
+                                               exc_info=True)
+                    else:
+                        fn = os.path.basename(convert_path(arcname))
+                        workname = os.path.join(workdir, fn)
+                        with zf.open(arcname) as bf:
+                            fileop.copy_stream(bf, workname)
+
+                        dn, fn = os.path.split(outfile)
+                        maker.target_dir = dn
+                        filenames = maker.make(fn)
+                        fileop.set_executable_mode(filenames)
+                        outfiles.extend(filenames)
+
+                if lib_only:
+                    logger.debug('lib_only: returning None')
+                    dist = None
+                else:
+                    # Generate scripts
+
+                    # Try to get pydist.json so we can see if there are
+                    # any commands to generate. If this fails (e.g. because
+                    # of a legacy wheel), log a warning but don't give up.
+                    commands = None
+                    file_version = self.info['Wheel-Version']
+                    if file_version == '1.0':
+                        # Use legacy info
+                        ep = posixpath.join(info_dir, 'entry_points.txt')
+                        try:
+                            with zf.open(ep) as bwf:
+                                epdata = read_exports(bwf)
+                            commands = {}
+                            for key in ('console', 'gui'):
+                                k = '%s_scripts' % key
+                                if k in epdata:
+                                    commands['wrap_%s' % key] = d = {}
+                                    for v in epdata[k].values():
+                                        s = '%s:%s' % (v.prefix, v.suffix)
+                                        if v.flags:
+                                            s += ' [%s]' % ','.join(v.flags)
+                                        d[v.name] = s
+                        except Exception:
+                            logger.warning('Unable to read legacy script '
+                                           'metadata, so cannot generate '
+                                           'scripts')
+                    else:
+                        try:
+                            with zf.open(metadata_name) as bwf:
+                                wf = wrapper(bwf)
+                                commands = json.load(wf).get('extensions')
+                                if commands:
+                                    commands = commands.get('python.commands')
+                        except Exception:
+                            logger.warning('Unable to read JSON metadata, so '
+                                           'cannot generate scripts')
+                    if commands:
+                        console_scripts = commands.get('wrap_console', {})
+                        gui_scripts = commands.get('wrap_gui', {})
+                        if console_scripts or gui_scripts:
+                            script_dir = paths.get('scripts', '')
+                            if not os.path.isdir(script_dir):
+                                raise ValueError('Valid script path not '
+                                                 'specified')
+                            maker.target_dir = script_dir
+                            for k, v in console_scripts.items():
+                                script = '%s = %s' % (k, v)
+                                filenames = maker.make(script)
+                                fileop.set_executable_mode(filenames)
+
+                            if gui_scripts:
+                                options = {'gui': True }
+                                for k, v in gui_scripts.items():
+                                    script = '%s = %s' % (k, v)
+                                    filenames = maker.make(script, options)
+                                    fileop.set_executable_mode(filenames)
+
+                    p = os.path.join(libdir, info_dir)
+                    dist = InstalledDistribution(p)
+
+                    # Write SHARED
+                    paths = dict(paths)     # don't change passed in dict
+                    del paths['purelib']
+                    del paths['platlib']
+                    paths['lib'] = libdir
+                    p = dist.write_shared_locations(paths, dry_run)
+                    if p:
+                        outfiles.append(p)
+
+                    # Write RECORD
+                    dist.write_installed_files(outfiles, paths['prefix'],
+                                               dry_run)
+                return dist
+            except Exception:  # pragma: no cover
+                logger.exception('installation failed.')
+                fileop.rollback()
+                raise
+            finally:
+                shutil.rmtree(workdir)
+
+    def _get_dylib_cache(self):
+        global cache
+        if cache is None:
+            # Use native string to avoid issues on 2.x: see Python #20140.
+            base = os.path.join(get_cache_base(), str('dylib-cache'),
+                                '%s.%s' % sys.version_info[:2])
+            cache = Cache(base)
+        return cache
+
+    def _get_extensions(self):
+        pathname = os.path.join(self.dirname, self.filename)
+        name_ver = '%s-%s' % (self.name, self.version)
+        info_dir = '%s.dist-info' % name_ver
+        arcname = posixpath.join(info_dir, 'EXTENSIONS')
+        wrapper = codecs.getreader('utf-8')
+        result = []
+        with ZipFile(pathname, 'r') as zf:
+            try:
+                with zf.open(arcname) as bf:
+                    wf = wrapper(bf)
+                    extensions = json.load(wf)
+                    cache = self._get_dylib_cache()
+                    prefix = cache.prefix_to_dir(pathname)
+                    cache_base = os.path.join(cache.base, prefix)
+                    if not os.path.isdir(cache_base):
+                        os.makedirs(cache_base)
+                    for name, relpath in extensions.items():
+                        dest = os.path.join(cache_base, convert_path(relpath))
+                        if not os.path.exists(dest):
+                            extract = True
+                        else:
+                            file_time = os.stat(dest).st_mtime
+                            file_time = datetime.datetime.fromtimestamp(file_time)
+                            info = zf.getinfo(relpath)
+                            wheel_time = datetime.datetime(*info.date_time)
+                            extract = wheel_time > file_time
+                        if extract:
+                            zf.extract(relpath, cache_base)
+                        result.append((name, dest))
+            except KeyError:
+                pass
+        return result
+
+    def is_compatible(self):
+        """
+        Determine if a wheel is compatible with the running system.
+        """
+        return is_compatible(self)
+
+    def is_mountable(self):
+        """
+        Determine if a wheel is asserted as mountable by its metadata.
+        """
+        return True # for now - metadata details TBD
+
+    def mount(self, append=False):
+        pathname = os.path.abspath(os.path.join(self.dirname, self.filename))
+        if not self.is_compatible():
+            msg = 'Wheel %s not compatible with this Python.' % pathname
+            raise DistlibException(msg)
+        if not self.is_mountable():
+            msg = 'Wheel %s is marked as not mountable.' % pathname
+            raise DistlibException(msg)
+        if pathname in sys.path:
+            logger.debug('%s already in path', pathname)
+        else:
+            if append:
+                sys.path.append(pathname)
+            else:
+                sys.path.insert(0, pathname)
+            extensions = self._get_extensions()
+            if extensions:
+                if _hook not in sys.meta_path:
+                    sys.meta_path.append(_hook)
+                _hook.add(pathname, extensions)
+
+    def unmount(self):
+        pathname = os.path.abspath(os.path.join(self.dirname, self.filename))
+        if pathname not in sys.path:
+            logger.debug('%s not in path', pathname)
+        else:
+            sys.path.remove(pathname)
+            if pathname in _hook.impure_wheels:
+                _hook.remove(pathname)
+            if not _hook.impure_wheels:
+                if _hook in sys.meta_path:
+                    sys.meta_path.remove(_hook)
+
+    def verify(self):
+        pathname = os.path.join(self.dirname, self.filename)
+        name_ver = '%s-%s' % (self.name, self.version)
+        data_dir = '%s.data' % name_ver
+        info_dir = '%s.dist-info' % name_ver
+
+        metadata_name = posixpath.join(info_dir, LEGACY_METADATA_FILENAME)
+        wheel_metadata_name = posixpath.join(info_dir, 'WHEEL')
+        record_name = posixpath.join(info_dir, 'RECORD')
+
+        wrapper = codecs.getreader('utf-8')
+
+        with ZipFile(pathname, 'r') as zf:
+            with zf.open(wheel_metadata_name) as bwf:
+                wf = wrapper(bwf)
+                message = message_from_file(wf)
+            wv = message['Wheel-Version'].split('.', 1)
+            file_version = tuple([int(i) for i in wv])
+            # TODO version verification
+
+            records = {}
+            with zf.open(record_name) as bf:
+                with CSVReader(stream=bf) as reader:
+                    for row in reader:
+                        p = row[0]
+                        records[p] = row
+
+            for zinfo in zf.infolist():
+                arcname = zinfo.filename
+                if isinstance(arcname, text_type):
+                    u_arcname = arcname
+                else:
+                    u_arcname = arcname.decode('utf-8')
+                # See issue #115: some wheels have .. in their entries, but
+                # in the filename ... e.g. __main__..py ! So the check is
+                # updated to look for .. in the directory portions
+                p = u_arcname.split('/')
+                if '..' in p:
+                    raise DistlibException('invalid entry in '
+                                           'wheel: %r' % u_arcname)
+
+                if self.skip_entry(u_arcname):
+                    continue
+                row = records[u_arcname]
+                if row[2] and str(zinfo.file_size) != row[2]:
+                    raise DistlibException('size mismatch for '
+                                           '%s' % u_arcname)
+                if row[1]:
+                    kind, value = row[1].split('=', 1)
+                    with zf.open(arcname) as bf:
+                        data = bf.read()
+                    _, digest = self.get_hash(data, kind)
+                    if digest != value:
+                        raise DistlibException('digest mismatch for '
+                                               '%s' % arcname)
+
+    def update(self, modifier, dest_dir=None, **kwargs):
+        """
+        Update the contents of a wheel in a generic way. The modifier should
+        be a callable which expects a dictionary argument: its keys are
+        archive-entry paths, and its values are absolute filesystem paths
+        where the contents the corresponding archive entries can be found. The
+        modifier is free to change the contents of the files pointed to, add
+        new entries and remove entries, before returning. This method will
+        extract the entire contents of the wheel to a temporary location, call
+        the modifier, and then use the passed (and possibly updated)
+        dictionary to write a new wheel. If ``dest_dir`` is specified, the new
+        wheel is written there -- otherwise, the original wheel is overwritten.
+
+        The modifier should return True if it updated the wheel, else False.
+        This method returns the same value the modifier returns.
+        """
+
+        def get_version(path_map, info_dir):
+            version = path = None
+            key = '%s/%s' % (info_dir, LEGACY_METADATA_FILENAME)
+            if key not in path_map:
+                key = '%s/PKG-INFO' % info_dir
+            if key in path_map:
+                path = path_map[key]
+                version = Metadata(path=path).version
+            return version, path
+
+        def update_version(version, path):
+            updated = None
+            try:
+                v = NormalizedVersion(version)
+                i = version.find('-')
+                if i < 0:
+                    updated = '%s+1' % version
+                else:
+                    parts = [int(s) for s in version[i + 1:].split('.')]
+                    parts[-1] += 1
+                    updated = '%s+%s' % (version[:i],
+                                         '.'.join(str(i) for i in parts))
+            except UnsupportedVersionError:
+                logger.debug('Cannot update non-compliant (PEP-440) '
+                             'version %r', version)
+            if updated:
+                md = Metadata(path=path)
+                md.version = updated
+                legacy = path.endswith(LEGACY_METADATA_FILENAME)
+                md.write(path=path, legacy=legacy)
+                logger.debug('Version updated from %r to %r', version,
+                             updated)
+
+        pathname = os.path.join(self.dirname, self.filename)
+        name_ver = '%s-%s' % (self.name, self.version)
+        info_dir = '%s.dist-info' % name_ver
+        record_name = posixpath.join(info_dir, 'RECORD')
+        with tempdir() as workdir:
+            with ZipFile(pathname, 'r') as zf:
+                path_map = {}
+                for zinfo in zf.infolist():
+                    arcname = zinfo.filename
+                    if isinstance(arcname, text_type):
+                        u_arcname = arcname
+                    else:
+                        u_arcname = arcname.decode('utf-8')
+                    if u_arcname == record_name:
+                        continue
+                    if '..' in u_arcname:
+                        raise DistlibException('invalid entry in '
+                                               'wheel: %r' % u_arcname)
+                    zf.extract(zinfo, workdir)
+                    path = os.path.join(workdir, convert_path(u_arcname))
+                    path_map[u_arcname] = path
+
+            # Remember the version.
+            original_version, _ = get_version(path_map, info_dir)
+            # Files extracted. Call the modifier.
+            modified = modifier(path_map, **kwargs)
+            if modified:
+                # Something changed - need to build a new wheel.
+                current_version, path = get_version(path_map, info_dir)
+                if current_version and (current_version == original_version):
+                    # Add or update local version to signify changes.
+                    update_version(current_version, path)
+                # Decide where the new wheel goes.
+                if dest_dir is None:
+                    fd, newpath = tempfile.mkstemp(suffix='.whl',
+                                                   prefix='wheel-update-',
+                                                   dir=workdir)
+                    os.close(fd)
+                else:
+                    if not os.path.isdir(dest_dir):
+                        raise DistlibException('Not a directory: %r' % dest_dir)
+                    newpath = os.path.join(dest_dir, self.filename)
+                archive_paths = list(path_map.items())
+                distinfo = os.path.join(workdir, info_dir)
+                info = distinfo, info_dir
+                self.write_records(info, workdir, archive_paths)
+                self.build_zip(newpath, archive_paths)
+                if dest_dir is None:
+                    shutil.copyfile(newpath, pathname)
+        return modified
+
+def _get_glibc_version():
+    import platform
+    ver = platform.libc_ver()
+    result = []
+    if ver[0] == 'glibc':
+        for s in ver[1].split('.'):
+            result.append(int(s) if s.isdigit() else 0)
+        result = tuple(result)
+    return result
+
+def compatible_tags():
+    """
+    Return (pyver, abi, arch) tuples compatible with this Python.
+    """
+    versions = [VER_SUFFIX]
+    major = VER_SUFFIX[0]
+    for minor in range(sys.version_info[1] - 1, - 1, -1):
+        versions.append(''.join([major, str(minor)]))
+
+    abis = []
+    for suffix, _, _ in imp.get_suffixes():
+        if suffix.startswith('.abi'):
+            abis.append(suffix.split('.', 2)[1])
+    abis.sort()
+    if ABI != 'none':
+        abis.insert(0, ABI)
+    abis.append('none')
+    result = []
+
+    arches = [ARCH]
+    if sys.platform == 'darwin':
+        m = re.match(r'(\w+)_(\d+)_(\d+)_(\w+)$', ARCH)
+        if m:
+            name, major, minor, arch = m.groups()
+            minor = int(minor)
+            matches = [arch]
+            if arch in ('i386', 'ppc'):
+                matches.append('fat')
+            if arch in ('i386', 'ppc', 'x86_64'):
+                matches.append('fat3')
+            if arch in ('ppc64', 'x86_64'):
+                matches.append('fat64')
+            if arch in ('i386', 'x86_64'):
+                matches.append('intel')
+            if arch in ('i386', 'x86_64', 'intel', 'ppc', 'ppc64'):
+                matches.append('universal')
+            while minor >= 0:
+                for match in matches:
+                    s = '%s_%s_%s_%s' % (name, major, minor, match)
+                    if s != ARCH:   # already there
+                        arches.append(s)
+                minor -= 1
+
+    # Most specific - our Python version, ABI and arch
+    for abi in abis:
+        for arch in arches:
+            result.append((''.join((IMP_PREFIX, versions[0])), abi, arch))
+            # manylinux
+            if abi != 'none' and sys.platform.startswith('linux'):
+                arch = arch.replace('linux_', '')
+                parts = _get_glibc_version()
+                if len(parts) == 2:
+                    if parts >= (2, 5):
+                        result.append((''.join((IMP_PREFIX, versions[0])), abi,
+                                       'manylinux1_%s' % arch))
+                    if parts >= (2, 12):
+                        result.append((''.join((IMP_PREFIX, versions[0])), abi,
+                                       'manylinux2010_%s' % arch))
+                    if parts >= (2, 17):
+                        result.append((''.join((IMP_PREFIX, versions[0])), abi,
+                                       'manylinux2014_%s' % arch))
+                    result.append((''.join((IMP_PREFIX, versions[0])), abi,
+                                   'manylinux_%s_%s_%s' % (parts[0], parts[1],
+                                                           arch)))
+
+    # where no ABI / arch dependency, but IMP_PREFIX dependency
+    for i, version in enumerate(versions):
+        result.append((''.join((IMP_PREFIX, version)), 'none', 'any'))
+        if i == 0:
+            result.append((''.join((IMP_PREFIX, version[0])), 'none', 'any'))
+
+    # no IMP_PREFIX, ABI or arch dependency
+    for i, version in enumerate(versions):
+        result.append((''.join(('py', version)), 'none', 'any'))
+        if i == 0:
+            result.append((''.join(('py', version[0])), 'none', 'any'))
+
+    return set(result)
+
+
+COMPATIBLE_TAGS = compatible_tags()
+
+del compatible_tags
+
+
+def is_compatible(wheel, tags=None):
+    if not isinstance(wheel, Wheel):
+        wheel = Wheel(wheel)    # assume it's a filename
+    result = False
+    if tags is None:
+        tags = COMPATIBLE_TAGS
+    for ver, abi, arch in tags:
+        if ver in wheel.pyver and abi in wheel.abi and arch in wheel.arch:
+            result = True
+            break
+    return result

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_cell_widths.py

@@ -0,0 +1,451 @@
+# Auto generated by make_terminal_widths.py
+
+CELL_WIDTHS = [
+    (0, 0, 0),
+    (1, 31, -1),
+    (127, 159, -1),
+    (768, 879, 0),
+    (1155, 1161, 0),
+    (1425, 1469, 0),
+    (1471, 1471, 0),
+    (1473, 1474, 0),
+    (1476, 1477, 0),
+    (1479, 1479, 0),
+    (1552, 1562, 0),
+    (1611, 1631, 0),
+    (1648, 1648, 0),
+    (1750, 1756, 0),
+    (1759, 1764, 0),
+    (1767, 1768, 0),
+    (1770, 1773, 0),
+    (1809, 1809, 0),
+    (1840, 1866, 0),
+    (1958, 1968, 0),
+    (2027, 2035, 0),
+    (2045, 2045, 0),
+    (2070, 2073, 0),
+    (2075, 2083, 0),
+    (2085, 2087, 0),
+    (2089, 2093, 0),
+    (2137, 2139, 0),
+    (2259, 2273, 0),
+    (2275, 2306, 0),
+    (2362, 2362, 0),
+    (2364, 2364, 0),
+    (2369, 2376, 0),
+    (2381, 2381, 0),
+    (2385, 2391, 0),
+    (2402, 2403, 0),
+    (2433, 2433, 0),
+    (2492, 2492, 0),
+    (2497, 2500, 0),
+    (2509, 2509, 0),
+    (2530, 2531, 0),
+    (2558, 2558, 0),
+    (2561, 2562, 0),
+    (2620, 2620, 0),
+    (2625, 2626, 0),
+    (2631, 2632, 0),
+    (2635, 2637, 0),
+    (2641, 2641, 0),
+    (2672, 2673, 0),
+    (2677, 2677, 0),
+    (2689, 2690, 0),
+    (2748, 2748, 0),
+    (2753, 2757, 0),
+    (2759, 2760, 0),
+    (2765, 2765, 0),
+    (2786, 2787, 0),
+    (2810, 2815, 0),
+    (2817, 2817, 0),
+    (2876, 2876, 0),
+    (2879, 2879, 0),
+    (2881, 2884, 0),
+    (2893, 2893, 0),
+    (2901, 2902, 0),
+    (2914, 2915, 0),
+    (2946, 2946, 0),
+    (3008, 3008, 0),
+    (3021, 3021, 0),
+    (3072, 3072, 0),
+    (3076, 3076, 0),
+    (3134, 3136, 0),
+    (3142, 3144, 0),
+    (3146, 3149, 0),
+    (3157, 3158, 0),
+    (3170, 3171, 0),
+    (3201, 3201, 0),
+    (3260, 3260, 0),
+    (3263, 3263, 0),
+    (3270, 3270, 0),
+    (3276, 3277, 0),
+    (3298, 3299, 0),
+    (3328, 3329, 0),
+    (3387, 3388, 0),
+    (3393, 3396, 0),
+    (3405, 3405, 0),
+    (3426, 3427, 0),
+    (3457, 3457, 0),
+    (3530, 3530, 0),
+    (3538, 3540, 0),
+    (3542, 3542, 0),
+    (3633, 3633, 0),
+    (3636, 3642, 0),
+    (3655, 3662, 0),
+    (3761, 3761, 0),
+    (3764, 3772, 0),
+    (3784, 3789, 0),
+    (3864, 3865, 0),
+    (3893, 3893, 0),
+    (3895, 3895, 0),
+    (3897, 3897, 0),
+    (3953, 3966, 0),
+    (3968, 3972, 0),
+    (3974, 3975, 0),
+    (3981, 3991, 0),
+    (3993, 4028, 0),
+    (4038, 4038, 0),
+    (4141, 4144, 0),
+    (4146, 4151, 0),
+    (4153, 4154, 0),
+    (4157, 4158, 0),
+    (4184, 4185, 0),
+    (4190, 4192, 0),
+    (4209, 4212, 0),
+    (4226, 4226, 0),
+    (4229, 4230, 0),
+    (4237, 4237, 0),
+    (4253, 4253, 0),
+    (4352, 4447, 2),
+    (4957, 4959, 0),
+    (5906, 5908, 0),
+    (5938, 5940, 0),
+    (5970, 5971, 0),
+    (6002, 6003, 0),
+    (6068, 6069, 0),
+    (6071, 6077, 0),
+    (6086, 6086, 0),
+    (6089, 6099, 0),
+    (6109, 6109, 0),
+    (6155, 6157, 0),
+    (6277, 6278, 0),
+    (6313, 6313, 0),
+    (6432, 6434, 0),
+    (6439, 6440, 0),
+    (6450, 6450, 0),
+    (6457, 6459, 0),
+    (6679, 6680, 0),
+    (6683, 6683, 0),
+    (6742, 6742, 0),
+    (6744, 6750, 0),
+    (6752, 6752, 0),
+    (6754, 6754, 0),
+    (6757, 6764, 0),
+    (6771, 6780, 0),
+    (6783, 6783, 0),
+    (6832, 6848, 0),
+    (6912, 6915, 0),
+    (6964, 6964, 0),
+    (6966, 6970, 0),
+    (6972, 6972, 0),
+    (6978, 6978, 0),
+    (7019, 7027, 0),
+    (7040, 7041, 0),
+    (7074, 7077, 0),
+    (7080, 7081, 0),
+    (7083, 7085, 0),
+    (7142, 7142, 0),
+    (7144, 7145, 0),
+    (7149, 7149, 0),
+    (7151, 7153, 0),
+    (7212, 7219, 0),
+    (7222, 7223, 0),
+    (7376, 7378, 0),
+    (7380, 7392, 0),
+    (7394, 7400, 0),
+    (7405, 7405, 0),
+    (7412, 7412, 0),
+    (7416, 7417, 0),
+    (7616, 7673, 0),
+    (7675, 7679, 0),
+    (8203, 8207, 0),
+    (8232, 8238, 0),
+    (8288, 8291, 0),
+    (8400, 8432, 0),
+    (8986, 8987, 2),
+    (9001, 9002, 2),
+    (9193, 9196, 2),
+    (9200, 9200, 2),
+    (9203, 9203, 2),
+    (9725, 9726, 2),
+    (9748, 9749, 2),
+    (9800, 9811, 2),
+    (9855, 9855, 2),
+    (9875, 9875, 2),
+    (9889, 9889, 2),
+    (9898, 9899, 2),
+    (9917, 9918, 2),
+    (9924, 9925, 2),
+    (9934, 9934, 2),
+    (9940, 9940, 2),
+    (9962, 9962, 2),
+    (9970, 9971, 2),
+    (9973, 9973, 2),
+    (9978, 9978, 2),
+    (9981, 9981, 2),
+    (9989, 9989, 2),
+    (9994, 9995, 2),
+    (10024, 10024, 2),
+    (10060, 10060, 2),
+    (10062, 10062, 2),
+    (10067, 10069, 2),
+    (10071, 10071, 2),
+    (10133, 10135, 2),
+    (10160, 10160, 2),
+    (10175, 10175, 2),
+    (11035, 11036, 2),
+    (11088, 11088, 2),
+    (11093, 11093, 2),
+    (11503, 11505, 0),
+    (11647, 11647, 0),
+    (11744, 11775, 0),
+    (11904, 11929, 2),
+    (11931, 12019, 2),
+    (12032, 12245, 2),
+    (12272, 12283, 2),
+    (12288, 12329, 2),
+    (12330, 12333, 0),
+    (12334, 12350, 2),
+    (12353, 12438, 2),
+    (12441, 12442, 0),
+    (12443, 12543, 2),
+    (12549, 12591, 2),
+    (12593, 12686, 2),
+    (12688, 12771, 2),
+    (12784, 12830, 2),
+    (12832, 12871, 2),
+    (12880, 19903, 2),
+    (19968, 42124, 2),
+    (42128, 42182, 2),
+    (42607, 42610, 0),
+    (42612, 42621, 0),
+    (42654, 42655, 0),
+    (42736, 42737, 0),
+    (43010, 43010, 0),
+    (43014, 43014, 0),
+    (43019, 43019, 0),
+    (43045, 43046, 0),
+    (43052, 43052, 0),
+    (43204, 43205, 0),
+    (43232, 43249, 0),
+    (43263, 43263, 0),
+    (43302, 43309, 0),
+    (43335, 43345, 0),
+    (43360, 43388, 2),
+    (43392, 43394, 0),
+    (43443, 43443, 0),
+    (43446, 43449, 0),
+    (43452, 43453, 0),
+    (43493, 43493, 0),
+    (43561, 43566, 0),
+    (43569, 43570, 0),
+    (43573, 43574, 0),
+    (43587, 43587, 0),
+    (43596, 43596, 0),
+    (43644, 43644, 0),
+    (43696, 43696, 0),
+    (43698, 43700, 0),
+    (43703, 43704, 0),
+    (43710, 43711, 0),
+    (43713, 43713, 0),
+    (43756, 43757, 0),
+    (43766, 43766, 0),
+    (44005, 44005, 0),
+    (44008, 44008, 0),
+    (44013, 44013, 0),
+    (44032, 55203, 2),
+    (63744, 64255, 2),
+    (64286, 64286, 0),
+    (65024, 65039, 0),
+    (65040, 65049, 2),
+    (65056, 65071, 0),
+    (65072, 65106, 2),
+    (65108, 65126, 2),
+    (65128, 65131, 2),
+    (65281, 65376, 2),
+    (65504, 65510, 2),
+    (66045, 66045, 0),
+    (66272, 66272, 0),
+    (66422, 66426, 0),
+    (68097, 68099, 0),
+    (68101, 68102, 0),
+    (68108, 68111, 0),
+    (68152, 68154, 0),
+    (68159, 68159, 0),
+    (68325, 68326, 0),
+    (68900, 68903, 0),
+    (69291, 69292, 0),
+    (69446, 69456, 0),
+    (69633, 69633, 0),
+    (69688, 69702, 0),
+    (69759, 69761, 0),
+    (69811, 69814, 0),
+    (69817, 69818, 0),
+    (69888, 69890, 0),
+    (69927, 69931, 0),
+    (69933, 69940, 0),
+    (70003, 70003, 0),
+    (70016, 70017, 0),
+    (70070, 70078, 0),
+    (70089, 70092, 0),
+    (70095, 70095, 0),
+    (70191, 70193, 0),
+    (70196, 70196, 0),
+    (70198, 70199, 0),
+    (70206, 70206, 0),
+    (70367, 70367, 0),
+    (70371, 70378, 0),
+    (70400, 70401, 0),
+    (70459, 70460, 0),
+    (70464, 70464, 0),
+    (70502, 70508, 0),
+    (70512, 70516, 0),
+    (70712, 70719, 0),
+    (70722, 70724, 0),
+    (70726, 70726, 0),
+    (70750, 70750, 0),
+    (70835, 70840, 0),
+    (70842, 70842, 0),
+    (70847, 70848, 0),
+    (70850, 70851, 0),
+    (71090, 71093, 0),
+    (71100, 71101, 0),
+    (71103, 71104, 0),
+    (71132, 71133, 0),
+    (71219, 71226, 0),
+    (71229, 71229, 0),
+    (71231, 71232, 0),
+    (71339, 71339, 0),
+    (71341, 71341, 0),
+    (71344, 71349, 0),
+    (71351, 71351, 0),
+    (71453, 71455, 0),
+    (71458, 71461, 0),
+    (71463, 71467, 0),
+    (71727, 71735, 0),
+    (71737, 71738, 0),
+    (71995, 71996, 0),
+    (71998, 71998, 0),
+    (72003, 72003, 0),
+    (72148, 72151, 0),
+    (72154, 72155, 0),
+    (72160, 72160, 0),
+    (72193, 72202, 0),
+    (72243, 72248, 0),
+    (72251, 72254, 0),
+    (72263, 72263, 0),
+    (72273, 72278, 0),
+    (72281, 72283, 0),
+    (72330, 72342, 0),
+    (72344, 72345, 0),
+    (72752, 72758, 0),
+    (72760, 72765, 0),
+    (72767, 72767, 0),
+    (72850, 72871, 0),
+    (72874, 72880, 0),
+    (72882, 72883, 0),
+    (72885, 72886, 0),
+    (73009, 73014, 0),
+    (73018, 73018, 0),
+    (73020, 73021, 0),
+    (73023, 73029, 0),
+    (73031, 73031, 0),
+    (73104, 73105, 0),
+    (73109, 73109, 0),
+    (73111, 73111, 0),
+    (73459, 73460, 0),
+    (92912, 92916, 0),
+    (92976, 92982, 0),
+    (94031, 94031, 0),
+    (94095, 94098, 0),
+    (94176, 94179, 2),
+    (94180, 94180, 0),
+    (94192, 94193, 2),
+    (94208, 100343, 2),
+    (100352, 101589, 2),
+    (101632, 101640, 2),
+    (110592, 110878, 2),
+    (110928, 110930, 2),
+    (110948, 110951, 2),
+    (110960, 111355, 2),
+    (113821, 113822, 0),
+    (119143, 119145, 0),
+    (119163, 119170, 0),
+    (119173, 119179, 0),
+    (119210, 119213, 0),
+    (119362, 119364, 0),
+    (121344, 121398, 0),
+    (121403, 121452, 0),
+    (121461, 121461, 0),
+    (121476, 121476, 0),
+    (121499, 121503, 0),
+    (121505, 121519, 0),
+    (122880, 122886, 0),
+    (122888, 122904, 0),
+    (122907, 122913, 0),
+    (122915, 122916, 0),
+    (122918, 122922, 0),
+    (123184, 123190, 0),
+    (123628, 123631, 0),
+    (125136, 125142, 0),
+    (125252, 125258, 0),
+    (126980, 126980, 2),
+    (127183, 127183, 2),
+    (127374, 127374, 2),
+    (127377, 127386, 2),
+    (127488, 127490, 2),
+    (127504, 127547, 2),
+    (127552, 127560, 2),
+    (127568, 127569, 2),
+    (127584, 127589, 2),
+    (127744, 127776, 2),
+    (127789, 127797, 2),
+    (127799, 127868, 2),
+    (127870, 127891, 2),
+    (127904, 127946, 2),
+    (127951, 127955, 2),
+    (127968, 127984, 2),
+    (127988, 127988, 2),
+    (127992, 128062, 2),
+    (128064, 128064, 2),
+    (128066, 128252, 2),
+    (128255, 128317, 2),
+    (128331, 128334, 2),
+    (128336, 128359, 2),
+    (128378, 128378, 2),
+    (128405, 128406, 2),
+    (128420, 128420, 2),
+    (128507, 128591, 2),
+    (128640, 128709, 2),
+    (128716, 128716, 2),
+    (128720, 128722, 2),
+    (128725, 128727, 2),
+    (128747, 128748, 2),
+    (128756, 128764, 2),
+    (128992, 129003, 2),
+    (129292, 129338, 2),
+    (129340, 129349, 2),
+    (129351, 129400, 2),
+    (129402, 129483, 2),
+    (129485, 129535, 2),
+    (129648, 129652, 2),
+    (129656, 129658, 2),
+    (129664, 129670, 2),
+    (129680, 129704, 2),
+    (129712, 129718, 2),
+    (129728, 129730, 2),
+    (129744, 129750, 2),
+    (131072, 196605, 2),
+    (196608, 262141, 2),
+    (917760, 917999, 0),
+]

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_emoji_replace.py

@@ -0,0 +1,32 @@
+from typing import Callable, Match, Optional
+import re
+
+from ._emoji_codes import EMOJI
+
+
+_ReStringMatch = Match[str]  # regex match object
+_ReSubCallable = Callable[[_ReStringMatch], str]  # Callable invoked by re.sub
+_EmojiSubMethod = Callable[[_ReSubCallable, str], str]  # Sub method of a compiled re
+
+
+def _emoji_replace(
+    text: str,
+    default_variant: Optional[str] = None,
+    _emoji_sub: _EmojiSubMethod = re.compile(r"(:(\S*?)(?:(?:\-)(emoji|text))?:)").sub,
+) -> str:
+    """Replace emoji code in text."""
+    get_emoji = EMOJI.__getitem__
+    variants = {"text": "\uFE0E", "emoji": "\uFE0F"}
+    get_variant = variants.get
+    default_variant_code = variants.get(default_variant, "") if default_variant else ""
+
+    def do_replace(match: Match[str]) -> str:
+        emoji_code, emoji_name, variant = match.groups()
+        try:
+            return get_emoji(emoji_name.lower()) + get_variant(
+                variant, default_variant_code
+            )
+        except KeyError:
+            return emoji_code
+
+    return _emoji_sub(do_replace, text)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_inspect.py

@@ -0,0 +1,210 @@
+from __future__ import absolute_import
+
+from inspect import cleandoc, getdoc, getfile, isclass, ismodule, signature
+from typing import Any, Iterable, Optional, Tuple
+
+from .console import RenderableType, Group
+from .highlighter import ReprHighlighter
+from .jupyter import JupyterMixin
+from .panel import Panel
+from .pretty import Pretty
+from .table import Table
+from .text import Text, TextType
+
+
+def _first_paragraph(doc: str) -> str:
+    """Get the first paragraph from a docstring."""
+    paragraph, _, _ = doc.partition("\n\n")
+    return paragraph
+
+
+def _reformat_doc(doc: str) -> str:
+    """Reformat docstring."""
+    doc = cleandoc(doc).strip()
+    return doc
+
+
+class Inspect(JupyterMixin):
+    """A renderable to inspect any Python Object.
+
+    Args:
+        obj (Any): An object to inspect.
+        title (str, optional): Title to display over inspect result, or None use type. Defaults to None.
+        help (bool, optional): Show full help text rather than just first paragraph. Defaults to False.
+        methods (bool, optional): Enable inspection of callables. Defaults to False.
+        docs (bool, optional): Also render doc strings. Defaults to True.
+        private (bool, optional): Show private attributes (beginning with underscore). Defaults to False.
+        dunder (bool, optional): Show attributes starting with double underscore. Defaults to False.
+        sort (bool, optional): Sort attributes alphabetically. Defaults to True.
+        all (bool, optional): Show all attributes. Defaults to False.
+        value (bool, optional): Pretty print value of object. Defaults to True.
+    """
+
+    def __init__(
+        self,
+        obj: Any,
+        *,
+        title: Optional[TextType] = None,
+        help: bool = False,
+        methods: bool = False,
+        docs: bool = True,
+        private: bool = False,
+        dunder: bool = False,
+        sort: bool = True,
+        all: bool = True,
+        value: bool = True,
+    ) -> None:
+        self.highlighter = ReprHighlighter()
+        self.obj = obj
+        self.title = title or self._make_title(obj)
+        if all:
+            methods = private = dunder = True
+        self.help = help
+        self.methods = methods
+        self.docs = docs or help
+        self.private = private or dunder
+        self.dunder = dunder
+        self.sort = sort
+        self.value = value
+
+    def _make_title(self, obj: Any) -> Text:
+        """Make a default title."""
+        title_str = (
+            str(obj)
+            if (isclass(obj) or callable(obj) or ismodule(obj))
+            else str(type(obj))
+        )
+        title_text = self.highlighter(title_str)
+        return title_text
+
+    def __rich__(self) -> Panel:
+        return Panel.fit(
+            Group(*self._render()),
+            title=self.title,
+            border_style="scope.border",
+            padding=(0, 1),
+        )
+
+    def _get_signature(self, name: str, obj: Any) -> Optional[Text]:
+        """Get a signature for a callable."""
+        try:
+            _signature = str(signature(obj)) + ":"
+        except ValueError:
+            _signature = "(...)"
+        except TypeError:
+            return None
+
+        source_filename: Optional[str] = None
+        try:
+            source_filename = getfile(obj)
+        except TypeError:
+            pass
+
+        callable_name = Text(name, style="inspect.callable")
+        if source_filename:
+            callable_name.stylize(f"link file://{source_filename}")
+        signature_text = self.highlighter(_signature)
+
+        qualname = name or getattr(obj, "__qualname__", name)
+        qual_signature = Text.assemble(
+            ("def ", "inspect.def"), (qualname, "inspect.callable"), signature_text
+        )
+
+        return qual_signature
+
+    def _render(self) -> Iterable[RenderableType]:
+        """Render object."""
+
+        def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]:
+            key, (_error, value) = item
+            return (callable(value), key.strip("_").lower())
+
+        def safe_getattr(attr_name: str) -> Tuple[Any, Any]:
+            """Get attribute or any exception."""
+            try:
+                return (None, getattr(obj, attr_name))
+            except Exception as error:
+                return (error, None)
+
+        obj = self.obj
+        keys = dir(obj)
+        total_items = len(keys)
+        if not self.dunder:
+            keys = [key for key in keys if not key.startswith("__")]
+        if not self.private:
+            keys = [key for key in keys if not key.startswith("_")]
+        not_shown_count = total_items - len(keys)
+        items = [(key, safe_getattr(key)) for key in keys]
+        if self.sort:
+            items.sort(key=sort_items)
+
+        items_table = Table.grid(padding=(0, 1), expand=False)
+        items_table.add_column(justify="right")
+        add_row = items_table.add_row
+        highlighter = self.highlighter
+
+        if callable(obj):
+            signature = self._get_signature("", obj)
+            if signature is not None:
+                yield signature
+                yield ""
+
+        if self.docs:
+            _doc = getdoc(obj)
+            if _doc is not None:
+                if not self.help:
+                    _doc = _first_paragraph(_doc)
+                doc_text = Text(_reformat_doc(_doc), style="inspect.help")
+                doc_text = highlighter(doc_text)
+                yield doc_text
+                yield ""
+
+        if self.value and not (isclass(obj) or callable(obj) or ismodule(obj)):
+            yield Panel(
+                Pretty(obj, indent_guides=True, max_length=10, max_string=60),
+                border_style="inspect.value.border",
+            )
+            yield ""
+
+        for key, (error, value) in items:
+            key_text = Text.assemble(
+                (
+                    key,
+                    "inspect.attr.dunder" if key.startswith("__") else "inspect.attr",
+                ),
+                (" =", "inspect.equals"),
+            )
+            if error is not None:
+                warning = key_text.copy()
+                warning.stylize("inspect.error")
+                add_row(warning, highlighter(repr(error)))
+                continue
+
+            if callable(value):
+                if not self.methods:
+                    continue
+
+                _signature_text = self._get_signature(key, value)
+                if _signature_text is None:
+                    add_row(key_text, Pretty(value, highlighter=highlighter))
+                else:
+                    if self.docs:
+                        docs = getdoc(value)
+                        if docs is not None:
+                            _doc = _reformat_doc(str(docs))
+                            if not self.help:
+                                _doc = _first_paragraph(_doc)
+                            _signature_text.append("\n" if "\n" in _doc else " ")
+                            doc = highlighter(_doc)
+                            doc.stylize("inspect.doc")
+                            _signature_text.append(doc)
+
+                    add_row(key_text, _signature_text)
+            else:
+                add_row(key_text, Pretty(value, highlighter=highlighter))
+        if items_table.row_count:
+            yield items_table
+        else:
+            yield Text.from_markup(
+                f"[b cyan]{not_shown_count}[/][i] attribute(s) not shown.[/i] Run [b][magenta]inspect[/]([not b]inspect[/])[/b] for options."
+            )

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_log_render.py

@@ -0,0 +1,94 @@
+from datetime import datetime
+from typing import Iterable, List, Optional, TYPE_CHECKING, Union, Callable
+
+
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleRenderable, RenderableType
+    from .table import Table
+
+FormatTimeCallable = Callable[[datetime], Text]
+
+
+class LogRender:
+    def __init__(
+        self,
+        show_time: bool = True,
+        show_level: bool = False,
+        show_path: bool = True,
+        time_format: Union[str, FormatTimeCallable] = "[%x %X]",
+        omit_repeated_times: bool = True,
+        level_width: Optional[int] = 8,
+    ) -> None:
+        self.show_time = show_time
+        self.show_level = show_level
+        self.show_path = show_path
+        self.time_format = time_format
+        self.omit_repeated_times = omit_repeated_times
+        self.level_width = level_width
+        self._last_time: Optional[Text] = None
+
+    def __call__(
+        self,
+        console: "Console",
+        renderables: Iterable["ConsoleRenderable"],
+        log_time: Optional[datetime] = None,
+        time_format: Optional[Union[str, FormatTimeCallable]] = None,
+        level: TextType = "",
+        path: Optional[str] = None,
+        line_no: Optional[int] = None,
+        link_path: Optional[str] = None,
+    ) -> "Table":
+        from .containers import Renderables
+        from .table import Table
+
+        output = Table.grid(padding=(0, 1))
+        output.expand = True
+        if self.show_time:
+            output.add_column(style="log.time")
+        if self.show_level:
+            output.add_column(style="log.level", width=self.level_width)
+        output.add_column(ratio=1, style="log.message", overflow="fold")
+        if self.show_path and path:
+            output.add_column(style="log.path")
+        row: List["RenderableType"] = []
+        if self.show_time:
+            log_time = log_time or console.get_datetime()
+            time_format = time_format or self.time_format
+            if callable(time_format):
+                log_time_display = time_format(log_time)
+            else:
+                log_time_display = Text(log_time.strftime(time_format))
+            if log_time_display == self._last_time and self.omit_repeated_times:
+                row.append(Text(" " * len(log_time_display)))
+            else:
+                row.append(log_time_display)
+                self._last_time = log_time_display
+        if self.show_level:
+            row.append(level)
+
+        row.append(Renderables(renderables))
+        if self.show_path and path:
+            path_text = Text()
+            path_text.append(
+                path, style=f"link file://{link_path}" if link_path else ""
+            )
+            if line_no:
+                path_text.append(":")
+                path_text.append(
+                    f"{line_no}",
+                    style=f"link file://{link_path}#{line_no}" if link_path else "",
+                )
+            row.append(path_text)
+
+        output.add_row(*row)
+        return output
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+
+    c = Console()
+    c.print("[on blue]Hello", justify="right")
+    c.log("[on blue]hello", justify="right")

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_loop.py

@@ -0,0 +1,43 @@
+from typing import Iterable, Tuple, TypeVar
+
+T = TypeVar("T")
+
+
+def loop_first(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:
+    """Iterate and generate a tuple with a flag for first value."""
+    iter_values = iter(values)
+    try:
+        value = next(iter_values)
+    except StopIteration:
+        return
+    yield True, value
+    for value in iter_values:
+        yield False, value
+
+
+def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:
+    """Iterate and generate a tuple with a flag for last value."""
+    iter_values = iter(values)
+    try:
+        previous_value = next(iter_values)
+    except StopIteration:
+        return
+    for value in iter_values:
+        yield False, previous_value
+        previous_value = value
+    yield True, previous_value
+
+
+def loop_first_last(values: Iterable[T]) -> Iterable[Tuple[bool, bool, T]]:
+    """Iterate and generate a tuple with a flag for first and last value."""
+    iter_values = iter(values)
+    try:
+        previous_value = next(iter_values)
+    except StopIteration:
+        return
+    first = True
+    for value in iter_values:
+        yield first, False, previous_value
+        first = False
+        previous_value = value
+    yield first, True, previous_value

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_palettes.py

@@ -0,0 +1,309 @@
+from .palette import Palette
+
+
+# Taken from https://en.wikipedia.org/wiki/ANSI_escape_code (Windows 10 column)
+WINDOWS_PALETTE = Palette(
+    [
+        (12, 12, 12),
+        (197, 15, 31),
+        (19, 161, 14),
+        (193, 156, 0),
+        (0, 55, 218),
+        (136, 23, 152),
+        (58, 150, 221),
+        (204, 204, 204),
+        (118, 118, 118),
+        (231, 72, 86),
+        (22, 198, 12),
+        (249, 241, 165),
+        (59, 120, 255),
+        (180, 0, 158),
+        (97, 214, 214),
+        (242, 242, 242),
+    ]
+)
+
+# # The standard ansi colors (including bright variants)
+STANDARD_PALETTE = Palette(
+    [
+        (0, 0, 0),
+        (170, 0, 0),
+        (0, 170, 0),
+        (170, 85, 0),
+        (0, 0, 170),
+        (170, 0, 170),
+        (0, 170, 170),
+        (170, 170, 170),
+        (85, 85, 85),
+        (255, 85, 85),
+        (85, 255, 85),
+        (255, 255, 85),
+        (85, 85, 255),
+        (255, 85, 255),
+        (85, 255, 255),
+        (255, 255, 255),
+    ]
+)
+
+
+# The 256 color palette
+EIGHT_BIT_PALETTE = Palette(
+    [
+        (0, 0, 0),
+        (128, 0, 0),
+        (0, 128, 0),
+        (128, 128, 0),
+        (0, 0, 128),
+        (128, 0, 128),
+        (0, 128, 128),
+        (192, 192, 192),
+        (128, 128, 128),
+        (255, 0, 0),
+        (0, 255, 0),
+        (255, 255, 0),
+        (0, 0, 255),
+        (255, 0, 255),
+        (0, 255, 255),
+        (255, 255, 255),
+        (0, 0, 0),
+        (0, 0, 95),
+        (0, 0, 135),
+        (0, 0, 175),
+        (0, 0, 215),
+        (0, 0, 255),
+        (0, 95, 0),
+        (0, 95, 95),
+        (0, 95, 135),
+        (0, 95, 175),
+        (0, 95, 215),
+        (0, 95, 255),
+        (0, 135, 0),
+        (0, 135, 95),
+        (0, 135, 135),
+        (0, 135, 175),
+        (0, 135, 215),
+        (0, 135, 255),
+        (0, 175, 0),
+        (0, 175, 95),
+        (0, 175, 135),
+        (0, 175, 175),
+        (0, 175, 215),
+        (0, 175, 255),
+        (0, 215, 0),
+        (0, 215, 95),
+        (0, 215, 135),
+        (0, 215, 175),
+        (0, 215, 215),
+        (0, 215, 255),
+        (0, 255, 0),
+        (0, 255, 95),
+        (0, 255, 135),
+        (0, 255, 175),
+        (0, 255, 215),
+        (0, 255, 255),
+        (95, 0, 0),
+        (95, 0, 95),
+        (95, 0, 135),
+        (95, 0, 175),
+        (95, 0, 215),
+        (95, 0, 255),
+        (95, 95, 0),
+        (95, 95, 95),
+        (95, 95, 135),
+        (95, 95, 175),
+        (95, 95, 215),
+        (95, 95, 255),
+        (95, 135, 0),
+        (95, 135, 95),
+        (95, 135, 135),
+        (95, 135, 175),
+        (95, 135, 215),
+        (95, 135, 255),
+        (95, 175, 0),
+        (95, 175, 95),
+        (95, 175, 135),
+        (95, 175, 175),
+        (95, 175, 215),
+        (95, 175, 255),
+        (95, 215, 0),
+        (95, 215, 95),
+        (95, 215, 135),
+        (95, 215, 175),
+        (95, 215, 215),
+        (95, 215, 255),
+        (95, 255, 0),
+        (95, 255, 95),
+        (95, 255, 135),
+        (95, 255, 175),
+        (95, 255, 215),
+        (95, 255, 255),
+        (135, 0, 0),
+        (135, 0, 95),
+        (135, 0, 135),
+        (135, 0, 175),
+        (135, 0, 215),
+        (135, 0, 255),
+        (135, 95, 0),
+        (135, 95, 95),
+        (135, 95, 135),
+        (135, 95, 175),
+        (135, 95, 215),
+        (135, 95, 255),
+        (135, 135, 0),
+        (135, 135, 95),
+        (135, 135, 135),
+        (135, 135, 175),
+        (135, 135, 215),
+        (135, 135, 255),
+        (135, 175, 0),
+        (135, 175, 95),
+        (135, 175, 135),
+        (135, 175, 175),
+        (135, 175, 215),
+        (135, 175, 255),
+        (135, 215, 0),
+        (135, 215, 95),
+        (135, 215, 135),
+        (135, 215, 175),
+        (135, 215, 215),
+        (135, 215, 255),
+        (135, 255, 0),
+        (135, 255, 95),
+        (135, 255, 135),
+        (135, 255, 175),
+        (135, 255, 215),
+        (135, 255, 255),
+        (175, 0, 0),
+        (175, 0, 95),
+        (175, 0, 135),
+        (175, 0, 175),
+        (175, 0, 215),
+        (175, 0, 255),
+        (175, 95, 0),
+        (175, 95, 95),
+        (175, 95, 135),
+        (175, 95, 175),
+        (175, 95, 215),
+        (175, 95, 255),
+        (175, 135, 0),
+        (175, 135, 95),
+        (175, 135, 135),
+        (175, 135, 175),
+        (175, 135, 215),
+        (175, 135, 255),
+        (175, 175, 0),
+        (175, 175, 95),
+        (175, 175, 135),
+        (175, 175, 175),
+        (175, 175, 215),
+        (175, 175, 255),
+        (175, 215, 0),
+        (175, 215, 95),
+        (175, 215, 135),
+        (175, 215, 175),
+        (175, 215, 215),
+        (175, 215, 255),
+        (175, 255, 0),
+        (175, 255, 95),
+        (175, 255, 135),
+        (175, 255, 175),
+        (175, 255, 215),
+        (175, 255, 255),
+        (215, 0, 0),
+        (215, 0, 95),
+        (215, 0, 135),
+        (215, 0, 175),
+        (215, 0, 215),
+        (215, 0, 255),
+        (215, 95, 0),
+        (215, 95, 95),
+        (215, 95, 135),
+        (215, 95, 175),
+        (215, 95, 215),
+        (215, 95, 255),
+        (215, 135, 0),
+        (215, 135, 95),
+        (215, 135, 135),
+        (215, 135, 175),
+        (215, 135, 215),
+        (215, 135, 255),
+        (215, 175, 0),
+        (215, 175, 95),
+        (215, 175, 135),
+        (215, 175, 175),
+        (215, 175, 215),
+        (215, 175, 255),
+        (215, 215, 0),
+        (215, 215, 95),
+        (215, 215, 135),
+        (215, 215, 175),
+        (215, 215, 215),
+        (215, 215, 255),
+        (215, 255, 0),
+        (215, 255, 95),
+        (215, 255, 135),
+        (215, 255, 175),
+        (215, 255, 215),
+        (215, 255, 255),
+        (255, 0, 0),
+        (255, 0, 95),
+        (255, 0, 135),
+        (255, 0, 175),
+        (255, 0, 215),
+        (255, 0, 255),
+        (255, 95, 0),
+        (255, 95, 95),
+        (255, 95, 135),
+        (255, 95, 175),
+        (255, 95, 215),
+        (255, 95, 255),
+        (255, 135, 0),
+        (255, 135, 95),
+        (255, 135, 135),
+        (255, 135, 175),
+        (255, 135, 215),
+        (255, 135, 255),
+        (255, 175, 0),
+        (255, 175, 95),
+        (255, 175, 135),
+        (255, 175, 175),
+        (255, 175, 215),
+        (255, 175, 255),
+        (255, 215, 0),
+        (255, 215, 95),
+        (255, 215, 135),
+        (255, 215, 175),
+        (255, 215, 215),
+        (255, 215, 255),
+        (255, 255, 0),
+        (255, 255, 95),
+        (255, 255, 135),
+        (255, 255, 175),
+        (255, 255, 215),
+        (255, 255, 255),
+        (8, 8, 8),
+        (18, 18, 18),
+        (28, 28, 28),
+        (38, 38, 38),
+        (48, 48, 48),
+        (58, 58, 58),
+        (68, 68, 68),
+        (78, 78, 78),
+        (88, 88, 88),
+        (98, 98, 98),
+        (108, 108, 108),
+        (118, 118, 118),
+        (128, 128, 128),
+        (138, 138, 138),
+        (148, 148, 148),
+        (158, 158, 158),
+        (168, 168, 168),
+        (178, 178, 178),
+        (188, 188, 188),
+        (198, 198, 198),
+        (208, 208, 208),
+        (218, 218, 218),
+        (228, 228, 228),
+        (238, 238, 238),
+    ]
+)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_pick.py

@@ -0,0 +1,17 @@
+from typing import Optional
+
+
+def pick_bool(*values: Optional[bool]) -> bool:
+    """Pick the first non-none bool or return the last value.
+
+    Args:
+        *values (bool): Any number of boolean or None values.
+
+    Returns:
+        bool: First non-none boolean.
+    """
+    assert values, "1 or more values required"
+    for value in values:
+        if value is not None:
+            return value
+    return bool(value)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_ratio.py

@@ -0,0 +1,160 @@
+import sys
+from fractions import Fraction
+from math import ceil
+from typing import cast, List, Optional, Sequence
+
+if sys.version_info >= (3, 8):
+    from typing import Protocol
+else:
+    from pip._vendor.typing_extensions import Protocol  # pragma: no cover
+
+
+class Edge(Protocol):
+    """Any object that defines an edge (such as Layout)."""
+
+    size: Optional[int] = None
+    ratio: int = 1
+    minimum_size: int = 1
+
+
+def ratio_resolve(total: int, edges: Sequence[Edge]) -> List[int]:
+    """Divide total space to satisfy size, ratio, and minimum_size, constraints.
+
+    The returned list of integers should add up to total in most cases, unless it is
+    impossible to satisfy all the constraints. For instance, if there are two edges
+    with a minimum size of 20 each and `total` is 30 then the returned list will be
+    greater than total. In practice, this would mean that a Layout object would
+    clip the rows that would overflow the screen height.
+
+    Args:
+        total (int): Total number of characters.
+        edges (List[Edge]): Edges within total space.
+
+    Returns:
+        List[int]: Number of characters for each edge.
+    """
+    # Size of edge or None for yet to be determined
+    sizes = [(edge.size or None) for edge in edges]
+
+    _Fraction = Fraction
+
+    # While any edges haven't been calculated
+    while None in sizes:
+        # Get flexible edges and index to map these back on to sizes list
+        flexible_edges = [
+            (index, edge)
+            for index, (size, edge) in enumerate(zip(sizes, edges))
+            if size is None
+        ]
+        # Remaining space in total
+        remaining = total - sum(size or 0 for size in sizes)
+        if remaining <= 0:
+            # No room for flexible edges
+            return [
+                ((edge.minimum_size or 1) if size is None else size)
+                for size, edge in zip(sizes, edges)
+            ]
+        # Calculate number of characters in a ratio portion
+        portion = _Fraction(
+            remaining, sum((edge.ratio or 1) for _, edge in flexible_edges)
+        )
+
+        # If any edges will be less than their minimum, replace size with the minimum
+        for index, edge in flexible_edges:
+            if portion * edge.ratio <= edge.minimum_size:
+                sizes[index] = edge.minimum_size
+                # New fixed size will invalidate calculations, so we need to repeat the process
+                break
+        else:
+            # Distribute flexible space and compensate for rounding error
+            # Since edge sizes can only be integers we need to add the remainder
+            # to the following line
+            remainder = _Fraction(0)
+            for index, edge in flexible_edges:
+                size, remainder = divmod(portion * edge.ratio + remainder, 1)
+                sizes[index] = size
+            break
+    # Sizes now contains integers only
+    return cast(List[int], sizes)
+
+
+def ratio_reduce(
+    total: int, ratios: List[int], maximums: List[int], values: List[int]
+) -> List[int]:
+    """Divide an integer total in to parts based on ratios.
+
+    Args:
+        total (int): The total to divide.
+        ratios (List[int]): A list of integer ratios.
+        maximums (List[int]): List of maximums values for each slot.
+        values (List[int]): List of values
+
+    Returns:
+        List[int]: A list of integers guaranteed to sum to total.
+    """
+    ratios = [ratio if _max else 0 for ratio, _max in zip(ratios, maximums)]
+    total_ratio = sum(ratios)
+    if not total_ratio:
+        return values[:]
+    total_remaining = total
+    result: List[int] = []
+    append = result.append
+    for ratio, maximum, value in zip(ratios, maximums, values):
+        if ratio and total_ratio > 0:
+            distributed = min(maximum, round(ratio * total_remaining / total_ratio))
+            append(value - distributed)
+            total_remaining -= distributed
+            total_ratio -= ratio
+        else:
+            append(value)
+    return result
+
+
+def ratio_distribute(
+    total: int, ratios: List[int], minimums: Optional[List[int]] = None
+) -> List[int]:
+    """Distribute an integer total in to parts based on ratios.
+
+    Args:
+        total (int): The total to divide.
+        ratios (List[int]): A list of integer ratios.
+        minimums (List[int]): List of minimum values for each slot.
+
+    Returns:
+        List[int]: A list of integers guaranteed to sum to total.
+    """
+    if minimums:
+        ratios = [ratio if _min else 0 for ratio, _min in zip(ratios, minimums)]
+    total_ratio = sum(ratios)
+    assert total_ratio > 0, "Sum of ratios must be > 0"
+
+    total_remaining = total
+    distributed_total: List[int] = []
+    append = distributed_total.append
+    if minimums is None:
+        _minimums = [0] * len(ratios)
+    else:
+        _minimums = minimums
+    for ratio, minimum in zip(ratios, _minimums):
+        if total_ratio > 0:
+            distributed = max(minimum, ceil(ratio * total_remaining / total_ratio))
+        else:
+            distributed = total_remaining
+        append(distributed)
+        total_ratio -= ratio
+        total_remaining -= distributed
+    return distributed_total
+
+
+if __name__ == "__main__":
+    from dataclasses import dataclass
+
+    @dataclass
+    class E:
+
+        size: Optional[int] = None
+        ratio: int = 1
+        minimum_size: int = 1
+
+    resolved = ratio_resolve(110, [E(None, 1, 1), E(None, 1, 1), E(None, 1, 1)])
+    print(sum(resolved))

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_stack.py

@@ -0,0 +1,16 @@
+from typing import List, TypeVar
+
+T = TypeVar("T")
+
+
+class Stack(List[T]):
+    """A small shim over builtin list."""
+
+    @property
+    def top(self) -> T:
+        """Get top of stack."""
+        return self[-1]
+
+    def push(self, item: T) -> None:
+        """Push an item on to the stack (append in stack nomenclature)."""
+        self.append(item)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_timer.py

@@ -0,0 +1,19 @@
+"""
+Timer context manager, only used in debug.
+
+"""
+
+from time import time
+
+import contextlib
+from typing import Generator
+
+
+@contextlib.contextmanager
+def timer(subject: str = "time") -> Generator[None, None, None]:
+    """print the elapsed time. (only used in debugging)"""
+    start = time()
+    yield
+    elapsed = time() - start
+    elapsed_ms = elapsed * 1000
+    print(f"{subject} elapsed {elapsed_ms:.1f}ms")

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/_wrap.py

@@ -0,0 +1,55 @@
+import re
+from typing import Iterable, List, Tuple
+
+from .cells import cell_len, chop_cells
+from ._loop import loop_last
+
+re_word = re.compile(r"\s*\S+\s*")
+
+
+def words(text: str) -> Iterable[Tuple[int, int, str]]:
+    position = 0
+    word_match = re_word.match(text, position)
+    while word_match is not None:
+        start, end = word_match.span()
+        word = word_match.group(0)
+        yield start, end, word
+        word_match = re_word.match(text, end)
+
+
+def divide_line(text: str, width: int, fold: bool = True) -> List[int]:
+    divides: List[int] = []
+    append = divides.append
+    line_position = 0
+    _cell_len = cell_len
+    for start, _end, word in words(text):
+        word_length = _cell_len(word.rstrip())
+        if line_position + word_length > width:
+            if word_length > width:
+                if fold:
+                    for last, line in loop_last(
+                        chop_cells(word, width, position=line_position)
+                    ):
+                        if last:
+                            line_position = _cell_len(line)
+                        else:
+                            start += len(line)
+                            append(start)
+                else:
+                    if start:
+                        append(start)
+                    line_position = _cell_len(word)
+            elif line_position and start:
+                append(start)
+                line_position = _cell_len(word)
+        else:
+            line_position += _cell_len(word)
+    return divides
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    console = Console(width=10)
+    console.print("12345 abcdefghijklmnopqrstuvwyxzABCDEFGHIJKLMNOPQRSTUVWXYZ 12345")
+    print(chop_cells("abcdefghijklmnopqrstuvwxyz", 10, position=2))

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/abc.py

@@ -0,0 +1,33 @@
+from abc import ABC
+
+
+class RichRenderable(ABC):
+    """An abstract base class for Rich renderables.
+
+    Note that there is no need to extend this class, the intended use is to check if an
+    object supports the Rich renderable protocol. For example::
+
+        if isinstance(my_object, RichRenderable):
+            console.print(my_object)
+
+    """
+
+    @classmethod
+    def __subclasshook__(cls, other: type) -> bool:
+        """Check if this class supports the rich render protocol."""
+        return hasattr(other, "__rich_console__") or hasattr(other, "__rich__")
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.text import Text
+
+    t = Text()
+    print(isinstance(Text, RichRenderable))
+    print(isinstance(t, RichRenderable))
+
+    class Foo:
+        pass
+
+    f = Foo()
+    print(isinstance(f, RichRenderable))
+    print(isinstance("", RichRenderable))

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/align.py

@@ -0,0 +1,312 @@
+import sys
+from itertools import chain
+from typing import TYPE_CHECKING, Iterable, Optional
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+from .constrain import Constrain
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import StyleType
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+AlignMethod = Literal["left", "center", "right"]
+VerticalAlignMethod = Literal["top", "middle", "bottom"]
+AlignValues = AlignMethod  # TODO: deprecate AlignValues
+
+
+class Align(JupyterMixin):
+    """Align a renderable by adding spaces if necessary.
+
+    Args:
+        renderable (RenderableType): A console renderable.
+        align (AlignMethod): One of "left", "center", or "right""
+        style (StyleType, optional): An optional style to apply to the background.
+        vertical (Optional[VerticalAlginMethod], optional): Optional vertical align, one of "top", "middle", or "bottom". Defaults to None.
+        pad (bool, optional): Pad the right with spaces. Defaults to True.
+        width (int, optional): Restrict contents to given width, or None to use default width. Defaults to None.
+        height (int, optional): Set height of align renderable, or None to fit to contents. Defaults to None.
+
+    Raises:
+        ValueError: if ``align`` is not one of the expected values.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        align: AlignMethod = "left",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> None:
+        if align not in ("left", "center", "right"):
+            raise ValueError(
+                f'invalid value for align, expected "left", "center", or "right" (not {align!r})'
+            )
+        if vertical is not None and vertical not in ("top", "middle", "bottom"):
+            raise ValueError(
+                f'invalid value for vertical, expected "top", "middle", or "bottom" (not {vertical!r})'
+            )
+        self.renderable = renderable
+        self.align = align
+        self.style = style
+        self.vertical = vertical
+        self.pad = pad
+        self.width = width
+        self.height = height
+
+    def __repr__(self) -> str:
+        return f"Align({self.renderable!r}, {self.align!r})"
+
+    @classmethod
+    def left(
+        cls,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> "Align":
+        """Align a renderable to the left."""
+        return cls(
+            renderable,
+            "left",
+            style=style,
+            vertical=vertical,
+            pad=pad,
+            width=width,
+            height=height,
+        )
+
+    @classmethod
+    def center(
+        cls,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> "Align":
+        """Align a renderable to the center."""
+        return cls(
+            renderable,
+            "center",
+            style=style,
+            vertical=vertical,
+            pad=pad,
+            width=width,
+            height=height,
+        )
+
+    @classmethod
+    def right(
+        cls,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+        *,
+        vertical: Optional[VerticalAlignMethod] = None,
+        pad: bool = True,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+    ) -> "Align":
+        """Align a renderable to the right."""
+        return cls(
+            renderable,
+            "right",
+            style=style,
+            vertical=vertical,
+            pad=pad,
+            width=width,
+            height=height,
+        )
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        align = self.align
+        width = console.measure(self.renderable, options=options).maximum
+        rendered = console.render(
+            Constrain(
+                self.renderable, width if self.width is None else min(width, self.width)
+            ),
+            options.update(height=None),
+        )
+        lines = list(Segment.split_lines(rendered))
+        width, height = Segment.get_shape(lines)
+        lines = Segment.set_shape(lines, width, height)
+        new_line = Segment.line()
+        excess_space = options.max_width - width
+        style = console.get_style(self.style) if self.style is not None else None
+
+        def generate_segments() -> Iterable[Segment]:
+            if excess_space <= 0:
+                # Exact fit
+                for line in lines:
+                    yield from line
+                    yield new_line
+
+            elif align == "left":
+                # Pad on the right
+                pad = Segment(" " * excess_space, style) if self.pad else None
+                for line in lines:
+                    yield from line
+                    if pad:
+                        yield pad
+                    yield new_line
+
+            elif align == "center":
+                # Pad left and right
+                left = excess_space // 2
+                pad = Segment(" " * left, style)
+                pad_right = (
+                    Segment(" " * (excess_space - left), style) if self.pad else None
+                )
+                for line in lines:
+                    if left:
+                        yield pad
+                    yield from line
+                    if pad_right:
+                        yield pad_right
+                    yield new_line
+
+            elif align == "right":
+                # Padding on left
+                pad = Segment(" " * excess_space, style)
+                for line in lines:
+                    yield pad
+                    yield from line
+                    yield new_line
+
+        blank_line = (
+            Segment(f"{' ' * (self.width or options.max_width)}\n", style)
+            if self.pad
+            else Segment("\n")
+        )
+
+        def blank_lines(count: int) -> Iterable[Segment]:
+            if count > 0:
+                for _ in range(count):
+                    yield blank_line
+
+        vertical_height = self.height or options.height
+        iter_segments: Iterable[Segment]
+        if self.vertical and vertical_height is not None:
+            if self.vertical == "top":
+                bottom_space = vertical_height - height
+                iter_segments = chain(generate_segments(), blank_lines(bottom_space))
+            elif self.vertical == "middle":
+                top_space = (vertical_height - height) // 2
+                bottom_space = vertical_height - top_space - height
+                iter_segments = chain(
+                    blank_lines(top_space),
+                    generate_segments(),
+                    blank_lines(bottom_space),
+                )
+            else:  #  self.vertical == "bottom":
+                top_space = vertical_height - height
+                iter_segments = chain(blank_lines(top_space), generate_segments())
+        else:
+            iter_segments = generate_segments()
+        if self.style:
+            style = console.get_style(self.style)
+            iter_segments = Segment.apply_style(iter_segments, style)
+        yield from iter_segments
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        measurement = Measurement.get(console, options, self.renderable)
+        return measurement
+
+
+class VerticalCenter(JupyterMixin):
+    """Vertically aligns a renderable.
+
+    Warn:
+        This class is deprecated and may be removed in a future version. Use Align class with
+        `vertical="middle"`.
+
+    Args:
+        renderable (RenderableType): A renderable object.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        style: Optional[StyleType] = None,
+    ) -> None:
+        self.renderable = renderable
+        self.style = style
+
+    def __repr__(self) -> str:
+        return f"VerticalCenter({self.renderable!r})"
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        style = console.get_style(self.style) if self.style is not None else None
+        lines = console.render_lines(
+            self.renderable, options.update(height=None), pad=False
+        )
+        width, _height = Segment.get_shape(lines)
+        new_line = Segment.line()
+        height = options.height or options.size.height
+        top_space = (height - len(lines)) // 2
+        bottom_space = height - top_space - len(lines)
+        blank_line = Segment(f"{' ' * width}", style)
+
+        def blank_lines(count: int) -> Iterable[Segment]:
+            for _ in range(count):
+                yield blank_line
+                yield new_line
+
+        if top_space > 0:
+            yield from blank_lines(top_space)
+        for line in lines:
+            yield from line
+            yield new_line
+        if bottom_space > 0:
+            yield from blank_lines(bottom_space)
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        measurement = Measurement.get(console, options, self.renderable)
+        return measurement
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console, Group
+    from pip._vendor.rich.highlighter import ReprHighlighter
+    from pip._vendor.rich.panel import Panel
+
+    highlighter = ReprHighlighter()
+    console = Console()
+
+    panel = Panel(
+        Group(
+            Align.left(highlighter("align='left'")),
+            Align.center(highlighter("align='center'")),
+            Align.right(highlighter("align='right'")),
+        ),
+        width=60,
+        style="on dark_blue",
+        title="Algin",
+    )
+
+    console.print(
+        Align.center(panel, vertical="middle", style="on red", height=console.height)
+    )

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/ansi.py

@@ -0,0 +1,228 @@
+from contextlib import suppress
+import re
+from typing import Iterable, NamedTuple
+
+from .color import Color
+from .style import Style
+from .text import Text
+
+re_ansi = re.compile(r"(?:\x1b\[(.*?)m)|(?:\x1b\](.*?)\x1b\\)")
+re_csi = re.compile(r"\x1B(?:[@-Z\\-_]|\[[0-?]*[ -/]*[@-~])")
+
+
+class _AnsiToken(NamedTuple):
+    """Result of ansi tokenized string."""
+
+    plain: str = ""
+    sgr: str = ""
+    osc: str = ""
+
+
+def _ansi_tokenize(ansi_text: str) -> Iterable[_AnsiToken]:
+    """Tokenize a string in to plain text and ANSI codes.
+
+    Args:
+        ansi_text (str): A String containing ANSI codes.
+
+    Yields:
+        AnsiToken: A named tuple of (plain, sgr, osc)
+    """
+
+    def remove_csi(ansi_text: str) -> str:
+        """Remove unknown CSI sequences."""
+        return re_csi.sub("", ansi_text)
+
+    position = 0
+    for match in re_ansi.finditer(ansi_text):
+        start, end = match.span(0)
+        sgr, osc = match.groups()
+        if start > position:
+            yield _AnsiToken(remove_csi(ansi_text[position:start]))
+        yield _AnsiToken("", sgr, osc)
+        position = end
+    if position < len(ansi_text):
+        yield _AnsiToken(remove_csi(ansi_text[position:]))
+
+
+SGR_STYLE_MAP = {
+    1: "bold",
+    2: "dim",
+    3: "italic",
+    4: "underline",
+    5: "blink",
+    6: "blink2",
+    7: "reverse",
+    8: "conceal",
+    9: "strike",
+    21: "underline2",
+    22: "not dim not bold",
+    23: "not italic",
+    24: "not underline",
+    25: "not blink",
+    26: "not blink2",
+    27: "not reverse",
+    28: "not conceal",
+    29: "not strike",
+    30: "color(0)",
+    31: "color(1)",
+    32: "color(2)",
+    33: "color(3)",
+    34: "color(4)",
+    35: "color(5)",
+    36: "color(6)",
+    37: "color(7)",
+    39: "default",
+    40: "on color(0)",
+    41: "on color(1)",
+    42: "on color(2)",
+    43: "on color(3)",
+    44: "on color(4)",
+    45: "on color(5)",
+    46: "on color(6)",
+    47: "on color(7)",
+    49: "on default",
+    51: "frame",
+    52: "encircle",
+    53: "overline",
+    54: "not frame not encircle",
+    55: "not overline",
+    90: "color(8)",
+    91: "color(9)",
+    92: "color(10)",
+    93: "color(11)",
+    94: "color(12)",
+    95: "color(13)",
+    96: "color(14)",
+    97: "color(15)",
+    100: "on color(8)",
+    101: "on color(9)",
+    102: "on color(10)",
+    103: "on color(11)",
+    104: "on color(12)",
+    105: "on color(13)",
+    106: "on color(14)",
+    107: "on color(15)",
+}
+
+
+class AnsiDecoder:
+    """Translate ANSI code in to styled Text."""
+
+    def __init__(self) -> None:
+        self.style = Style.null()
+
+    def decode(self, terminal_text: str) -> Iterable[Text]:
+        """Decode ANSI codes in an interable of lines.
+
+        Args:
+            lines (Iterable[str]): An iterable of lines of terminal output.
+
+        Yields:
+            Text: Marked up Text.
+        """
+        for line in terminal_text.splitlines():
+            yield self.decode_line(line)
+
+    def decode_line(self, line: str) -> Text:
+        """Decode a line containing ansi codes.
+
+        Args:
+            line (str): A line of terminal output.
+
+        Returns:
+            Text: A Text instance marked up according to ansi codes.
+        """
+        from_ansi = Color.from_ansi
+        from_rgb = Color.from_rgb
+        _Style = Style
+        text = Text()
+        append = text.append
+        line = line.rsplit("\r", 1)[-1]
+        for token in _ansi_tokenize(line):
+            plain_text, sgr, osc = token
+            if plain_text:
+                append(plain_text, self.style or None)
+            elif osc:
+                if osc.startswith("8;"):
+                    _params, semicolon, link = osc[2:].partition(";")
+                    if semicolon:
+                        self.style = self.style.update_link(link or None)
+            elif sgr:
+                # Translate in to semi-colon separated codes
+                # Ignore invalid codes, because we want to be lenient
+                codes = [
+                    min(255, int(_code)) for _code in sgr.split(";") if _code.isdigit()
+                ]
+                iter_codes = iter(codes)
+                for code in iter_codes:
+                    if code == 0:
+                        # reset
+                        self.style = _Style.null()
+                    elif code in SGR_STYLE_MAP:
+                        # styles
+                        self.style += _Style.parse(SGR_STYLE_MAP[code])
+                    elif code == 38:
+                        #  Foreground
+                        with suppress(StopIteration):
+                            color_type = next(iter_codes)
+                            if color_type == 5:
+                                self.style += _Style.from_color(
+                                    from_ansi(next(iter_codes))
+                                )
+                            elif color_type == 2:
+                                self.style += _Style.from_color(
+                                    from_rgb(
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                    )
+                                )
+                    elif code == 48:
+                        # Background
+                        with suppress(StopIteration):
+                            color_type = next(iter_codes)
+                            if color_type == 5:
+                                self.style += _Style.from_color(
+                                    None, from_ansi(next(iter_codes))
+                                )
+                            elif color_type == 2:
+                                self.style += _Style.from_color(
+                                    None,
+                                    from_rgb(
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                        next(iter_codes),
+                                    ),
+                                )
+
+        return text
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import pty
+    import io
+    import os
+    import sys
+
+    decoder = AnsiDecoder()
+
+    stdout = io.BytesIO()
+
+    def read(fd: int) -> bytes:
+        data = os.read(fd, 1024)
+        stdout.write(data)
+        return data
+
+    pty.spawn(sys.argv[1:], read)
+
+    from .console import Console
+
+    console = Console(record=True)
+
+    stdout_result = stdout.getvalue().decode("utf-8")
+    print(stdout_result)
+
+    for line in decoder.decode(stdout_result):
+        console.print(line)
+
+    console.save_html("stdout.html")

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/box.py

@@ -0,0 +1,483 @@
+import sys
+from typing import TYPE_CHECKING, Iterable, List
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+
+from ._loop import loop_last
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.console import ConsoleOptions
+
+
+class Box:
+    """Defines characters to render boxes.
+
+    ┌─┬┐ top
+    │ ││ head
+    ├─┼┤ head_row
+    │ ││ mid
+    ├─┼┤ row
+    ├─┼┤ foot_row
+    │ ││ foot
+    └─┴┘ bottom
+
+    Args:
+        box (str): Characters making up box.
+        ascii (bool, optional): True if this box uses ascii characters only. Default is False.
+    """
+
+    def __init__(self, box: str, *, ascii: bool = False) -> None:
+        self._box = box
+        self.ascii = ascii
+        line1, line2, line3, line4, line5, line6, line7, line8 = box.splitlines()
+        # top
+        self.top_left, self.top, self.top_divider, self.top_right = iter(line1)
+        # head
+        self.head_left, _, self.head_vertical, self.head_right = iter(line2)
+        # head_row
+        (
+            self.head_row_left,
+            self.head_row_horizontal,
+            self.head_row_cross,
+            self.head_row_right,
+        ) = iter(line3)
+
+        # mid
+        self.mid_left, _, self.mid_vertical, self.mid_right = iter(line4)
+        # row
+        self.row_left, self.row_horizontal, self.row_cross, self.row_right = iter(line5)
+        # foot_row
+        (
+            self.foot_row_left,
+            self.foot_row_horizontal,
+            self.foot_row_cross,
+            self.foot_row_right,
+        ) = iter(line6)
+        # foot
+        self.foot_left, _, self.foot_vertical, self.foot_right = iter(line7)
+        # bottom
+        self.bottom_left, self.bottom, self.bottom_divider, self.bottom_right = iter(
+            line8
+        )
+
+    def __repr__(self) -> str:
+        return "Box(...)"
+
+    def __str__(self) -> str:
+        return self._box
+
+    def substitute(self, options: "ConsoleOptions", safe: bool = True) -> "Box":
+        """Substitute this box for another if it won't render due to platform issues.
+
+        Args:
+            options (ConsoleOptions): Console options used in rendering.
+            safe (bool, optional): Substitute this for another Box if there are known problems
+                displaying on the platform (currently only relevant on Windows). Default is True.
+
+        Returns:
+            Box: A different Box or the same Box.
+        """
+        box = self
+        if options.legacy_windows and safe:
+            box = LEGACY_WINDOWS_SUBSTITUTIONS.get(box, box)
+        if options.ascii_only and not box.ascii:
+            box = ASCII
+        return box
+
+    def get_top(self, widths: Iterable[int]) -> str:
+        """Get the top of a simple box.
+
+        Args:
+            widths (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+
+        parts: List[str] = []
+        append = parts.append
+        append(self.top_left)
+        for last, width in loop_last(widths):
+            append(self.top * width)
+            if not last:
+                append(self.top_divider)
+        append(self.top_right)
+        return "".join(parts)
+
+    def get_row(
+        self,
+        widths: Iterable[int],
+        level: Literal["head", "row", "foot", "mid"] = "row",
+        edge: bool = True,
+    ) -> str:
+        """Get the top of a simple box.
+
+        Args:
+            width (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+        if level == "head":
+            left = self.head_row_left
+            horizontal = self.head_row_horizontal
+            cross = self.head_row_cross
+            right = self.head_row_right
+        elif level == "row":
+            left = self.row_left
+            horizontal = self.row_horizontal
+            cross = self.row_cross
+            right = self.row_right
+        elif level == "mid":
+            left = self.mid_left
+            horizontal = " "
+            cross = self.mid_vertical
+            right = self.mid_right
+        elif level == "foot":
+            left = self.foot_row_left
+            horizontal = self.foot_row_horizontal
+            cross = self.foot_row_cross
+            right = self.foot_row_right
+        else:
+            raise ValueError("level must be 'head', 'row' or 'foot'")
+
+        parts: List[str] = []
+        append = parts.append
+        if edge:
+            append(left)
+        for last, width in loop_last(widths):
+            append(horizontal * width)
+            if not last:
+                append(cross)
+        if edge:
+            append(right)
+        return "".join(parts)
+
+    def get_bottom(self, widths: Iterable[int]) -> str:
+        """Get the bottom of a simple box.
+
+        Args:
+            widths (List[int]): Widths of columns.
+
+        Returns:
+            str: A string of box characters.
+        """
+
+        parts: List[str] = []
+        append = parts.append
+        append(self.bottom_left)
+        for last, width in loop_last(widths):
+            append(self.bottom * width)
+            if not last:
+                append(self.bottom_divider)
+        append(self.bottom_right)
+        return "".join(parts)
+
+
+ASCII: Box = Box(
+    """\
++--+
+| ||
+|-+|
+| ||
+|-+|
+|-+|
+| ||
++--+
+""",
+    ascii=True,
+)
+
+ASCII2: Box = Box(
+    """\
++-++
+| ||
++-++
+| ||
++-++
++-++
+| ||
++-++
+""",
+    ascii=True,
+)
+
+ASCII_DOUBLE_HEAD: Box = Box(
+    """\
++-++
+| ||
++=++
+| ||
++-++
++-++
+| ||
++-++
+""",
+    ascii=True,
+)
+
+SQUARE: Box = Box(
+    """\
+┌─┬┐
+│ ││
+├─┼┤
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+└─┴┘
+"""
+)
+
+SQUARE_DOUBLE_HEAD: Box = Box(
+    """\
+┌─┬┐
+│ ││
+╞═╪╡
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+└─┴┘
+"""
+)
+
+MINIMAL: Box = Box(
+    """\
+  ╷ 
+  │ 
+╶─┼╴
+  │ 
+╶─┼╴
+╶─┼╴
+  │ 
+  ╵ 
+"""
+)
+
+
+MINIMAL_HEAVY_HEAD: Box = Box(
+    """\
+  ╷ 
+  │ 
+╺━┿╸
+  │ 
+╶─┼╴
+╶─┼╴
+  │ 
+  ╵ 
+"""
+)
+
+MINIMAL_DOUBLE_HEAD: Box = Box(
+    """\
+  ╷ 
+  │ 
+ ═╪ 
+  │ 
+ ─┼ 
+ ─┼ 
+  │ 
+  ╵ 
+"""
+)
+
+
+SIMPLE: Box = Box(
+    """\
+    
+    
+ ── 
+    
+    
+ ── 
+    
+    
+"""
+)
+
+SIMPLE_HEAD: Box = Box(
+    """\
+    
+    
+ ── 
+    
+    
+    
+    
+    
+"""
+)
+
+
+SIMPLE_HEAVY: Box = Box(
+    """\
+    
+    
+ ━━ 
+    
+    
+ ━━ 
+    
+    
+"""
+)
+
+
+HORIZONTALS: Box = Box(
+    """\
+ ── 
+    
+ ── 
+    
+ ── 
+ ── 
+    
+ ── 
+"""
+)
+
+ROUNDED: Box = Box(
+    """\
+╭─┬╮
+│ ││
+├─┼┤
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+╰─┴╯
+"""
+)
+
+HEAVY: Box = Box(
+    """\
+┏━┳┓
+┃ ┃┃
+┣━╋┫
+┃ ┃┃
+┣━╋┫
+┣━╋┫
+┃ ┃┃
+┗━┻┛
+"""
+)
+
+HEAVY_EDGE: Box = Box(
+    """\
+┏━┯┓
+┃ │┃
+┠─┼┨
+┃ │┃
+┠─┼┨
+┠─┼┨
+┃ │┃
+┗━┷┛
+"""
+)
+
+HEAVY_HEAD: Box = Box(
+    """\
+┏━┳┓
+┃ ┃┃
+┡━╇┩
+│ ││
+├─┼┤
+├─┼┤
+│ ││
+└─┴┘
+"""
+)
+
+DOUBLE: Box = Box(
+    """\
+╔═╦╗
+║ ║║
+╠═╬╣
+║ ║║
+╠═╬╣
+╠═╬╣
+║ ║║
+╚═╩╝
+"""
+)
+
+DOUBLE_EDGE: Box = Box(
+    """\
+╔═╤╗
+║ │║
+╟─┼╢
+║ │║
+╟─┼╢
+╟─┼╢
+║ │║
+╚═╧╝
+"""
+)
+
+# Map Boxes that don't render with raster fonts on to equivalent that do
+LEGACY_WINDOWS_SUBSTITUTIONS = {
+    ROUNDED: SQUARE,
+    MINIMAL_HEAVY_HEAD: MINIMAL,
+    SIMPLE_HEAVY: SIMPLE,
+    HEAVY: SQUARE,
+    HEAVY_EDGE: SQUARE,
+    HEAVY_HEAD: SQUARE,
+}
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from pip._vendor.rich.columns import Columns
+    from pip._vendor.rich.panel import Panel
+
+    from . import box as box
+    from .console import Console
+    from .table import Table
+    from .text import Text
+
+    console = Console(record=True)
+
+    BOXES = [
+        "ASCII",
+        "ASCII2",
+        "ASCII_DOUBLE_HEAD",
+        "SQUARE",
+        "SQUARE_DOUBLE_HEAD",
+        "MINIMAL",
+        "MINIMAL_HEAVY_HEAD",
+        "MINIMAL_DOUBLE_HEAD",
+        "SIMPLE",
+        "SIMPLE_HEAD",
+        "SIMPLE_HEAVY",
+        "HORIZONTALS",
+        "ROUNDED",
+        "HEAVY",
+        "HEAVY_EDGE",
+        "HEAVY_HEAD",
+        "DOUBLE",
+        "DOUBLE_EDGE",
+    ]
+
+    console.print(Panel("[bold green]Box Constants", style="green"), justify="center")
+    console.print()
+
+    columns = Columns(expand=True, padding=2)
+    for box_name in sorted(BOXES):
+        table = Table(
+            show_footer=True, style="dim", border_style="not dim", expand=True
+        )
+        table.add_column("Header 1", "Footer 1")
+        table.add_column("Header 2", "Footer 2")
+        table.add_row("Cell", "Cell")
+        table.add_row("Cell", "Cell")
+        table.box = getattr(box, box_name)
+        table.title = Text(f"box.{box_name}", style="magenta")
+        columns.add_renderable(table)
+    console.print(columns)
+
+    # console.save_html("box.html", inline_styles=True)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/color.py

@@ -0,0 +1,581 @@
+import platform
+import re
+from colorsys import rgb_to_hls
+from enum import IntEnum
+from functools import lru_cache
+from typing import TYPE_CHECKING, NamedTuple, Optional, Tuple
+
+from ._palettes import EIGHT_BIT_PALETTE, STANDARD_PALETTE, WINDOWS_PALETTE
+from .color_triplet import ColorTriplet
+from .repr import rich_repr, Result
+from .terminal_theme import DEFAULT_TERMINAL_THEME
+
+if TYPE_CHECKING:  # pragma: no cover
+    from .terminal_theme import TerminalTheme
+    from .text import Text
+
+
+WINDOWS = platform.system() == "Windows"
+
+
+class ColorSystem(IntEnum):
+    """One of the 3 color system supported by terminals."""
+
+    STANDARD = 1
+    EIGHT_BIT = 2
+    TRUECOLOR = 3
+    WINDOWS = 4
+
+    def __repr__(self) -> str:
+        return f"ColorSystem.{self.name}"
+
+
+class ColorType(IntEnum):
+    """Type of color stored in Color class."""
+
+    DEFAULT = 0
+    STANDARD = 1
+    EIGHT_BIT = 2
+    TRUECOLOR = 3
+    WINDOWS = 4
+
+    def __repr__(self) -> str:
+        return f"ColorType.{self.name}"
+
+
+ANSI_COLOR_NAMES = {
+    "black": 0,
+    "red": 1,
+    "green": 2,
+    "yellow": 3,
+    "blue": 4,
+    "magenta": 5,
+    "cyan": 6,
+    "white": 7,
+    "bright_black": 8,
+    "bright_red": 9,
+    "bright_green": 10,
+    "bright_yellow": 11,
+    "bright_blue": 12,
+    "bright_magenta": 13,
+    "bright_cyan": 14,
+    "bright_white": 15,
+    "grey0": 16,
+    "navy_blue": 17,
+    "dark_blue": 18,
+    "blue3": 20,
+    "blue1": 21,
+    "dark_green": 22,
+    "deep_sky_blue4": 25,
+    "dodger_blue3": 26,
+    "dodger_blue2": 27,
+    "green4": 28,
+    "spring_green4": 29,
+    "turquoise4": 30,
+    "deep_sky_blue3": 32,
+    "dodger_blue1": 33,
+    "green3": 40,
+    "spring_green3": 41,
+    "dark_cyan": 36,
+    "light_sea_green": 37,
+    "deep_sky_blue2": 38,
+    "deep_sky_blue1": 39,
+    "spring_green2": 47,
+    "cyan3": 43,
+    "dark_turquoise": 44,
+    "turquoise2": 45,
+    "green1": 46,
+    "spring_green1": 48,
+    "medium_spring_green": 49,
+    "cyan2": 50,
+    "cyan1": 51,
+    "dark_red": 88,
+    "deep_pink4": 125,
+    "purple4": 55,
+    "purple3": 56,
+    "blue_violet": 57,
+    "orange4": 94,
+    "grey37": 59,
+    "medium_purple4": 60,
+    "slate_blue3": 62,
+    "royal_blue1": 63,
+    "chartreuse4": 64,
+    "dark_sea_green4": 71,
+    "pale_turquoise4": 66,
+    "steel_blue": 67,
+    "steel_blue3": 68,
+    "cornflower_blue": 69,
+    "chartreuse3": 76,
+    "cadet_blue": 73,
+    "sky_blue3": 74,
+    "steel_blue1": 81,
+    "pale_green3": 114,
+    "sea_green3": 78,
+    "aquamarine3": 79,
+    "medium_turquoise": 80,
+    "chartreuse2": 112,
+    "sea_green2": 83,
+    "sea_green1": 85,
+    "aquamarine1": 122,
+    "dark_slate_gray2": 87,
+    "dark_magenta": 91,
+    "dark_violet": 128,
+    "purple": 129,
+    "light_pink4": 95,
+    "plum4": 96,
+    "medium_purple3": 98,
+    "slate_blue1": 99,
+    "yellow4": 106,
+    "wheat4": 101,
+    "grey53": 102,
+    "light_slate_grey": 103,
+    "medium_purple": 104,
+    "light_slate_blue": 105,
+    "dark_olive_green3": 149,
+    "dark_sea_green": 108,
+    "light_sky_blue3": 110,
+    "sky_blue2": 111,
+    "dark_sea_green3": 150,
+    "dark_slate_gray3": 116,
+    "sky_blue1": 117,
+    "chartreuse1": 118,
+    "light_green": 120,
+    "pale_green1": 156,
+    "dark_slate_gray1": 123,
+    "red3": 160,
+    "medium_violet_red": 126,
+    "magenta3": 164,
+    "dark_orange3": 166,
+    "indian_red": 167,
+    "hot_pink3": 168,
+    "medium_orchid3": 133,
+    "medium_orchid": 134,
+    "medium_purple2": 140,
+    "dark_goldenrod": 136,
+    "light_salmon3": 173,
+    "rosy_brown": 138,
+    "grey63": 139,
+    "medium_purple1": 141,
+    "gold3": 178,
+    "dark_khaki": 143,
+    "navajo_white3": 144,
+    "grey69": 145,
+    "light_steel_blue3": 146,
+    "light_steel_blue": 147,
+    "yellow3": 184,
+    "dark_sea_green2": 157,
+    "light_cyan3": 152,
+    "light_sky_blue1": 153,
+    "green_yellow": 154,
+    "dark_olive_green2": 155,
+    "dark_sea_green1": 193,
+    "pale_turquoise1": 159,
+    "deep_pink3": 162,
+    "magenta2": 200,
+    "hot_pink2": 169,
+    "orchid": 170,
+    "medium_orchid1": 207,
+    "orange3": 172,
+    "light_pink3": 174,
+    "pink3": 175,
+    "plum3": 176,
+    "violet": 177,
+    "light_goldenrod3": 179,
+    "tan": 180,
+    "misty_rose3": 181,
+    "thistle3": 182,
+    "plum2": 183,
+    "khaki3": 185,
+    "light_goldenrod2": 222,
+    "light_yellow3": 187,
+    "grey84": 188,
+    "light_steel_blue1": 189,
+    "yellow2": 190,
+    "dark_olive_green1": 192,
+    "honeydew2": 194,
+    "light_cyan1": 195,
+    "red1": 196,
+    "deep_pink2": 197,
+    "deep_pink1": 199,
+    "magenta1": 201,
+    "orange_red1": 202,
+    "indian_red1": 204,
+    "hot_pink": 206,
+    "dark_orange": 208,
+    "salmon1": 209,
+    "light_coral": 210,
+    "pale_violet_red1": 211,
+    "orchid2": 212,
+    "orchid1": 213,
+    "orange1": 214,
+    "sandy_brown": 215,
+    "light_salmon1": 216,
+    "light_pink1": 217,
+    "pink1": 218,
+    "plum1": 219,
+    "gold1": 220,
+    "navajo_white1": 223,
+    "misty_rose1": 224,
+    "thistle1": 225,
+    "yellow1": 226,
+    "light_goldenrod1": 227,
+    "khaki1": 228,
+    "wheat1": 229,
+    "cornsilk1": 230,
+    "grey100": 231,
+    "grey3": 232,
+    "grey7": 233,
+    "grey11": 234,
+    "grey15": 235,
+    "grey19": 236,
+    "grey23": 237,
+    "grey27": 238,
+    "grey30": 239,
+    "grey35": 240,
+    "grey39": 241,
+    "grey42": 242,
+    "grey46": 243,
+    "grey50": 244,
+    "grey54": 245,
+    "grey58": 246,
+    "grey62": 247,
+    "grey66": 248,
+    "grey70": 249,
+    "grey74": 250,
+    "grey78": 251,
+    "grey82": 252,
+    "grey85": 253,
+    "grey89": 254,
+    "grey93": 255,
+}
+
+
+class ColorParseError(Exception):
+    """The color could not be parsed."""
+
+
+RE_COLOR = re.compile(
+    r"""^
+\#([0-9a-f]{6})$|
+color\(([0-9]{1,3})\)$|
+rgb\(([\d\s,]+)\)$
+""",
+    re.VERBOSE,
+)
+
+
+@rich_repr
+class Color(NamedTuple):
+    """Terminal color definition."""
+
+    name: str
+    """The name of the color (typically the input to Color.parse)."""
+    type: ColorType
+    """The type of the color."""
+    number: Optional[int] = None
+    """The color number, if a standard color, or None."""
+    triplet: Optional[ColorTriplet] = None
+    """A triplet of color components, if an RGB color."""
+
+    def __rich__(self) -> "Text":
+        """Dispays the actual color if Rich printed."""
+        from .text import Text
+        from .style import Style
+
+        return Text.assemble(
+            f"<color {self.name!r} ({self.type.name.lower()})",
+            ("⬤", Style(color=self)),
+            " >",
+        )
+
+    def __rich_repr__(self) -> Result:
+        yield self.name
+        yield self.type
+        yield "number", self.number, None
+        yield "triplet", self.triplet, None
+
+    @property
+    def system(self) -> ColorSystem:
+        """Get the native color system for this color."""
+        if self.type == ColorType.DEFAULT:
+            return ColorSystem.STANDARD
+        return ColorSystem(int(self.type))
+
+    @property
+    def is_system_defined(self) -> bool:
+        """Check if the color is ultimately defined by the system."""
+        return self.system not in (ColorSystem.EIGHT_BIT, ColorSystem.TRUECOLOR)
+
+    @property
+    def is_default(self) -> bool:
+        """Check if the color is a default color."""
+        return self.type == ColorType.DEFAULT
+
+    def get_truecolor(
+        self, theme: Optional["TerminalTheme"] = None, foreground: bool = True
+    ) -> ColorTriplet:
+        """Get an equivalent color triplet for this color.
+
+        Args:
+            theme (TerminalTheme, optional): Optional terminal theme, or None to use default. Defaults to None.
+            foreground (bool, optional): True for a foreground color, or False for background. Defaults to True.
+
+        Returns:
+            ColorTriplet: A color triplet containing RGB components.
+        """
+
+        if theme is None:
+            theme = DEFAULT_TERMINAL_THEME
+        if self.type == ColorType.TRUECOLOR:
+            assert self.triplet is not None
+            return self.triplet
+        elif self.type == ColorType.EIGHT_BIT:
+            assert self.number is not None
+            return EIGHT_BIT_PALETTE[self.number]
+        elif self.type == ColorType.STANDARD:
+            assert self.number is not None
+            return theme.ansi_colors[self.number]
+        elif self.type == ColorType.WINDOWS:
+            assert self.number is not None
+            return WINDOWS_PALETTE[self.number]
+        else:  # self.type == ColorType.DEFAULT:
+            assert self.number is None
+            return theme.foreground_color if foreground else theme.background_color
+
+    @classmethod
+    def from_ansi(cls, number: int) -> "Color":
+        """Create a Color number from it's 8-bit ansi number.
+
+        Args:
+            number (int): A number between 0-255 inclusive.
+
+        Returns:
+            Color: A new Color instance.
+        """
+        return cls(
+            name=f"color({number})",
+            type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),
+            number=number,
+        )
+
+    @classmethod
+    def from_triplet(cls, triplet: "ColorTriplet") -> "Color":
+        """Create a truecolor RGB color from a triplet of values.
+
+        Args:
+            triplet (ColorTriplet): A color triplet containing red, green and blue components.
+
+        Returns:
+            Color: A new color object.
+        """
+        return cls(name=triplet.hex, type=ColorType.TRUECOLOR, triplet=triplet)
+
+    @classmethod
+    def from_rgb(cls, red: float, green: float, blue: float) -> "Color":
+        """Create a truecolor from three color components in the range(0->255).
+
+        Args:
+            red (float): Red component in range 0-255.
+            green (float): Green component in range 0-255.
+            blue (float): Blue component in range 0-255.
+
+        Returns:
+            Color: A new color object.
+        """
+        return cls.from_triplet(ColorTriplet(int(red), int(green), int(blue)))
+
+    @classmethod
+    def default(cls) -> "Color":
+        """Get a Color instance representing the default color.
+
+        Returns:
+            Color: Default color.
+        """
+        return cls(name="default", type=ColorType.DEFAULT)
+
+    @classmethod
+    @lru_cache(maxsize=1024)
+    def parse(cls, color: str) -> "Color":
+        """Parse a color definition."""
+        original_color = color
+        color = color.lower().strip()
+
+        if color == "default":
+            return cls(color, type=ColorType.DEFAULT)
+
+        color_number = ANSI_COLOR_NAMES.get(color)
+        if color_number is not None:
+            return cls(
+                color,
+                type=(ColorType.STANDARD if color_number < 16 else ColorType.EIGHT_BIT),
+                number=color_number,
+            )
+
+        color_match = RE_COLOR.match(color)
+        if color_match is None:
+            raise ColorParseError(f"{original_color!r} is not a valid color")
+
+        color_24, color_8, color_rgb = color_match.groups()
+        if color_24:
+            triplet = ColorTriplet(
+                int(color_24[0:2], 16), int(color_24[2:4], 16), int(color_24[4:6], 16)
+            )
+            return cls(color, ColorType.TRUECOLOR, triplet=triplet)
+
+        elif color_8:
+            number = int(color_8)
+            if number > 255:
+                raise ColorParseError(f"color number must be <= 255 in {color!r}")
+            return cls(
+                color,
+                type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT),
+                number=number,
+            )
+
+        else:  #  color_rgb:
+            components = color_rgb.split(",")
+            if len(components) != 3:
+                raise ColorParseError(
+                    f"expected three components in {original_color!r}"
+                )
+            red, green, blue = components
+            triplet = ColorTriplet(int(red), int(green), int(blue))
+            if not all(component <= 255 for component in triplet):
+                raise ColorParseError(
+                    f"color components must be <= 255 in {original_color!r}"
+                )
+            return cls(color, ColorType.TRUECOLOR, triplet=triplet)
+
+    @lru_cache(maxsize=1024)
+    def get_ansi_codes(self, foreground: bool = True) -> Tuple[str, ...]:
+        """Get the ANSI escape codes for this color."""
+        _type = self.type
+        if _type == ColorType.DEFAULT:
+            return ("39" if foreground else "49",)
+
+        elif _type == ColorType.WINDOWS:
+            number = self.number
+            assert number is not None
+            fore, back = (30, 40) if number < 8 else (82, 92)
+            return (str(fore + number if foreground else back + number),)
+
+        elif _type == ColorType.STANDARD:
+            number = self.number
+            assert number is not None
+            fore, back = (30, 40) if number < 8 else (82, 92)
+            return (str(fore + number if foreground else back + number),)
+
+        elif _type == ColorType.EIGHT_BIT:
+            assert self.number is not None
+            return ("38" if foreground else "48", "5", str(self.number))
+
+        else:  # self.standard == ColorStandard.TRUECOLOR:
+            assert self.triplet is not None
+            red, green, blue = self.triplet
+            return ("38" if foreground else "48", "2", str(red), str(green), str(blue))
+
+    @lru_cache(maxsize=1024)
+    def downgrade(self, system: ColorSystem) -> "Color":
+        """Downgrade a color system to a system with fewer colors."""
+
+        if self.type in [ColorType.DEFAULT, system]:
+            return self
+        # Convert to 8-bit color from truecolor color
+        if system == ColorSystem.EIGHT_BIT and self.system == ColorSystem.TRUECOLOR:
+            assert self.triplet is not None
+            red, green, blue = self.triplet.normalized
+            _h, l, s = rgb_to_hls(red, green, blue)
+            # If saturation is under 10% assume it is grayscale
+            if s < 0.1:
+                gray = round(l * 25.0)
+                if gray == 0:
+                    color_number = 16
+                elif gray == 25:
+                    color_number = 231
+                else:
+                    color_number = 231 + gray
+                return Color(self.name, ColorType.EIGHT_BIT, number=color_number)
+
+            color_number = (
+                16 + 36 * round(red * 5.0) + 6 * round(green * 5.0) + round(blue * 5.0)
+            )
+            return Color(self.name, ColorType.EIGHT_BIT, number=color_number)
+
+        # Convert to standard from truecolor or 8-bit
+        elif system == ColorSystem.STANDARD:
+            if self.system == ColorSystem.TRUECOLOR:
+                assert self.triplet is not None
+                triplet = self.triplet
+            else:  # self.system == ColorSystem.EIGHT_BIT
+                assert self.number is not None
+                triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])
+
+            color_number = STANDARD_PALETTE.match(triplet)
+            return Color(self.name, ColorType.STANDARD, number=color_number)
+
+        elif system == ColorSystem.WINDOWS:
+            if self.system == ColorSystem.TRUECOLOR:
+                assert self.triplet is not None
+                triplet = self.triplet
+            else:  # self.system == ColorSystem.EIGHT_BIT
+                assert self.number is not None
+                if self.number < 16:
+                    return Color(self.name, ColorType.WINDOWS, number=self.number)
+                triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number])
+
+            color_number = WINDOWS_PALETTE.match(triplet)
+            return Color(self.name, ColorType.WINDOWS, number=color_number)
+
+        return self
+
+
+def parse_rgb_hex(hex_color: str) -> ColorTriplet:
+    """Parse six hex characters in to RGB triplet."""
+    assert len(hex_color) == 6, "must be 6 characters"
+    color = ColorTriplet(
+        int(hex_color[0:2], 16), int(hex_color[2:4], 16), int(hex_color[4:6], 16)
+    )
+    return color
+
+
+def blend_rgb(
+    color1: ColorTriplet, color2: ColorTriplet, cross_fade: float = 0.5
+) -> ColorTriplet:
+    """Blend one RGB color in to another."""
+    r1, g1, b1 = color1
+    r2, g2, b2 = color2
+    new_color = ColorTriplet(
+        int(r1 + (r2 - r1) * cross_fade),
+        int(g1 + (g2 - g1) * cross_fade),
+        int(b1 + (b2 - b1) * cross_fade),
+    )
+    return new_color
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from .console import Console
+    from .table import Table
+    from .text import Text
+
+    console = Console()
+
+    table = Table(show_footer=False, show_edge=True)
+    table.add_column("Color", width=10, overflow="ellipsis")
+    table.add_column("Number", justify="right", style="yellow")
+    table.add_column("Name", style="green")
+    table.add_column("Hex", style="blue")
+    table.add_column("RGB", style="magenta")
+
+    colors = sorted((v, k) for k, v in ANSI_COLOR_NAMES.items())
+    for color_number, name in colors:
+        color_cell = Text(" " * 10, style=f"on {name}")
+        if color_number < 16:
+            table.add_row(color_cell, f"{color_number}", Text(f'"{name}"'))
+        else:
+            color = EIGHT_BIT_PALETTE[color_number]  # type: ignore
+            table.add_row(
+                color_cell, str(color_number), Text(f'"{name}"'), color.hex, color.rgb
+            )
+
+    console.print(table)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/columns.py

@@ -0,0 +1,187 @@
+from collections import defaultdict
+from itertools import chain
+from operator import itemgetter
+from typing import Dict, Iterable, List, Optional, Tuple
+
+from .align import Align, AlignMethod
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .constrain import Constrain
+from .measure import Measurement
+from .padding import Padding, PaddingDimensions
+from .table import Table
+from .text import TextType
+from .jupyter import JupyterMixin
+
+
+class Columns(JupyterMixin):
+    """Display renderables in neat columns.
+
+    Args:
+        renderables (Iterable[RenderableType]): Any number of Rich renderables (including str).
+        width (int, optional): The desired width of the columns, or None to auto detect. Defaults to None.
+        padding (PaddingDimensions, optional): Optional padding around cells. Defaults to (0, 1).
+        expand (bool, optional): Expand columns to full width. Defaults to False.
+        equal (bool, optional): Arrange in to equal sized columns. Defaults to False.
+        column_first (bool, optional): Align items from top to bottom (rather than left to right). Defaults to False.
+        right_to_left (bool, optional): Start column from right hand side. Defaults to False.
+        align (str, optional): Align value ("left", "right", or "center") or None for default. Defaults to None.
+        title (TextType, optional): Optional title for Columns.
+    """
+
+    def __init__(
+        self,
+        renderables: Optional[Iterable[RenderableType]] = None,
+        padding: PaddingDimensions = (0, 1),
+        *,
+        width: Optional[int] = None,
+        expand: bool = False,
+        equal: bool = False,
+        column_first: bool = False,
+        right_to_left: bool = False,
+        align: Optional[AlignMethod] = None,
+        title: Optional[TextType] = None,
+    ) -> None:
+        self.renderables = list(renderables or [])
+        self.width = width
+        self.padding = padding
+        self.expand = expand
+        self.equal = equal
+        self.column_first = column_first
+        self.right_to_left = right_to_left
+        self.align: Optional[AlignMethod] = align
+        self.title = title
+
+    def add_renderable(self, renderable: RenderableType) -> None:
+        """Add a renderable to the columns.
+
+        Args:
+            renderable (RenderableType): Any renderable object.
+        """
+        self.renderables.append(renderable)
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        render_str = console.render_str
+        renderables = [
+            render_str(renderable) if isinstance(renderable, str) else renderable
+            for renderable in self.renderables
+        ]
+        if not renderables:
+            return
+        _top, right, _bottom, left = Padding.unpack(self.padding)
+        width_padding = max(left, right)
+        max_width = options.max_width
+        widths: Dict[int, int] = defaultdict(int)
+        column_count = len(renderables)
+
+        get_measurement = Measurement.get
+        renderable_widths = [
+            get_measurement(console, options, renderable).maximum
+            for renderable in renderables
+        ]
+        if self.equal:
+            renderable_widths = [max(renderable_widths)] * len(renderable_widths)
+
+        def iter_renderables(
+            column_count: int,
+        ) -> Iterable[Tuple[int, Optional[RenderableType]]]:
+            item_count = len(renderables)
+            if self.column_first:
+                width_renderables = list(zip(renderable_widths, renderables))
+
+                column_lengths: List[int] = [item_count // column_count] * column_count
+                for col_no in range(item_count % column_count):
+                    column_lengths[col_no] += 1
+
+                row_count = (item_count + column_count - 1) // column_count
+                cells = [[-1] * column_count for _ in range(row_count)]
+                row = col = 0
+                for index in range(item_count):
+                    cells[row][col] = index
+                    column_lengths[col] -= 1
+                    if column_lengths[col]:
+                        row += 1
+                    else:
+                        col += 1
+                        row = 0
+                for index in chain.from_iterable(cells):
+                    if index == -1:
+                        break
+                    yield width_renderables[index]
+            else:
+                yield from zip(renderable_widths, renderables)
+            # Pad odd elements with spaces
+            if item_count % column_count:
+                for _ in range(column_count - (item_count % column_count)):
+                    yield 0, None
+
+        table = Table.grid(padding=self.padding, collapse_padding=True, pad_edge=False)
+        table.expand = self.expand
+        table.title = self.title
+
+        if self.width is not None:
+            column_count = (max_width) // (self.width + width_padding)
+            for _ in range(column_count):
+                table.add_column(width=self.width)
+        else:
+            while column_count > 1:
+                widths.clear()
+                column_no = 0
+                for renderable_width, _ in iter_renderables(column_count):
+                    widths[column_no] = max(widths[column_no], renderable_width)
+                    total_width = sum(widths.values()) + width_padding * (
+                        len(widths) - 1
+                    )
+                    if total_width > max_width:
+                        column_count = len(widths) - 1
+                        break
+                    else:
+                        column_no = (column_no + 1) % column_count
+                else:
+                    break
+
+        get_renderable = itemgetter(1)
+        _renderables = [
+            get_renderable(_renderable)
+            for _renderable in iter_renderables(column_count)
+        ]
+        if self.equal:
+            _renderables = [
+                None
+                if renderable is None
+                else Constrain(renderable, renderable_widths[0])
+                for renderable in _renderables
+            ]
+        if self.align:
+            align = self.align
+            _Align = Align
+            _renderables = [
+                None if renderable is None else _Align(renderable, align)
+                for renderable in _renderables
+            ]
+
+        right_to_left = self.right_to_left
+        add_row = table.add_row
+        for start in range(0, len(_renderables), column_count):
+            row = _renderables[start : start + column_count]
+            if right_to_left:
+                row = row[::-1]
+            add_row(*row)
+        yield table
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import os
+
+    console = Console()
+
+    files = [f"{i} {s}" for i, s in enumerate(sorted(os.listdir()))]
+    columns = Columns(files, padding=(0, 1), expand=False, equal=False)
+    console.print(columns)
+    console.rule()
+    columns.column_first = True
+    console.print(columns)
+    columns.right_to_left = True
+    console.rule()
+    console.print(columns)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/console.py

@@ -0,0 +1,2211 @@
+import inspect
+import os
+import platform
+import sys
+import threading
+from abc import ABC, abstractmethod
+from dataclasses import dataclass, field
+from datetime import datetime
+from functools import wraps
+from getpass import getpass
+from html import escape
+from inspect import isclass
+from itertools import islice
+from threading import RLock
+from time import monotonic
+from types import FrameType, ModuleType, TracebackType
+from typing import (
+    IO,
+    TYPE_CHECKING,
+    Any,
+    Callable,
+    Dict,
+    Iterable,
+    List,
+    Mapping,
+    NamedTuple,
+    Optional,
+    TextIO,
+    Tuple,
+    Type,
+    Union,
+    cast,
+)
+
+if sys.version_info >= (3, 8):
+    from typing import Literal, Protocol, runtime_checkable
+else:
+    from pip._vendor.typing_extensions import (
+        Literal,
+        Protocol,
+        runtime_checkable,
+    )  # pragma: no cover
+
+from . import errors, themes
+from ._emoji_replace import _emoji_replace
+from ._log_render import FormatTimeCallable, LogRender
+from .align import Align, AlignMethod
+from .color import ColorSystem
+from .control import Control
+from .emoji import EmojiVariant
+from .highlighter import NullHighlighter, ReprHighlighter
+from .markup import render as render_markup
+from .measure import Measurement, measure_renderables
+from .pager import Pager, SystemPager
+from .pretty import Pretty, is_expandable
+from .protocol import rich_cast
+from .region import Region
+from .scope import render_scope
+from .screen import Screen
+from .segment import Segment
+from .style import Style, StyleType
+from .styled import Styled
+from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme
+from .text import Text, TextType
+from .theme import Theme, ThemeStack
+
+if TYPE_CHECKING:
+    from ._windows import WindowsConsoleFeatures
+    from .live import Live
+    from .status import Status
+
+WINDOWS = platform.system() == "Windows"
+
+HighlighterType = Callable[[Union[str, "Text"]], "Text"]
+JustifyMethod = Literal["default", "left", "center", "right", "full"]
+OverflowMethod = Literal["fold", "crop", "ellipsis", "ignore"]
+
+
+class NoChange:
+    pass
+
+
+NO_CHANGE = NoChange()
+
+
+CONSOLE_HTML_FORMAT = """\
+<!DOCTYPE html>
+<head>
+<meta charset="UTF-8">
+<style>
+{stylesheet}
+body {{
+    color: {foreground};
+    background-color: {background};
+}}
+</style>
+</head>
+<html>
+<body>
+    <code>
+        <pre style="font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre>
+    </code>
+</body>
+</html>
+"""
+
+_TERM_COLORS = {"256color": ColorSystem.EIGHT_BIT, "16color": ColorSystem.STANDARD}
+
+
+class ConsoleDimensions(NamedTuple):
+    """Size of the terminal."""
+
+    width: int
+    """The width of the console in 'cells'."""
+    height: int
+    """The height of the console in lines."""
+
+
+@dataclass
+class ConsoleOptions:
+    """Options for __rich_console__ method."""
+
+    size: ConsoleDimensions
+    """Size of console."""
+    legacy_windows: bool
+    """legacy_windows: flag for legacy windows."""
+    min_width: int
+    """Minimum width of renderable."""
+    max_width: int
+    """Maximum width of renderable."""
+    is_terminal: bool
+    """True if the target is a terminal, otherwise False."""
+    encoding: str
+    """Encoding of terminal."""
+    max_height: int
+    """Height of container (starts as terminal)"""
+    justify: Optional[JustifyMethod] = None
+    """Justify value override for renderable."""
+    overflow: Optional[OverflowMethod] = None
+    """Overflow value override for renderable."""
+    no_wrap: Optional[bool] = False
+    """Disable wrapping for text."""
+    highlight: Optional[bool] = None
+    """Highlight override for render_str."""
+    markup: Optional[bool] = None
+    """Enable markup when rendering strings."""
+    height: Optional[int] = None
+
+    @property
+    def ascii_only(self) -> bool:
+        """Check if renderables should use ascii only."""
+        return not self.encoding.startswith("utf")
+
+    def copy(self) -> "ConsoleOptions":
+        """Return a copy of the options.
+
+        Returns:
+            ConsoleOptions: a copy of self.
+        """
+        options: ConsoleOptions = ConsoleOptions.__new__(ConsoleOptions)
+        options.__dict__ = self.__dict__.copy()
+        return options
+
+    def update(
+        self,
+        *,
+        width: Union[int, NoChange] = NO_CHANGE,
+        min_width: Union[int, NoChange] = NO_CHANGE,
+        max_width: Union[int, NoChange] = NO_CHANGE,
+        justify: Union[Optional[JustifyMethod], NoChange] = NO_CHANGE,
+        overflow: Union[Optional[OverflowMethod], NoChange] = NO_CHANGE,
+        no_wrap: Union[Optional[bool], NoChange] = NO_CHANGE,
+        highlight: Union[Optional[bool], NoChange] = NO_CHANGE,
+        markup: Union[Optional[bool], NoChange] = NO_CHANGE,
+        height: Union[Optional[int], NoChange] = NO_CHANGE,
+    ) -> "ConsoleOptions":
+        """Update values, return a copy."""
+        options = self.copy()
+        if not isinstance(width, NoChange):
+            options.min_width = options.max_width = max(0, width)
+        if not isinstance(min_width, NoChange):
+            options.min_width = min_width
+        if not isinstance(max_width, NoChange):
+            options.max_width = max_width
+        if not isinstance(justify, NoChange):
+            options.justify = justify
+        if not isinstance(overflow, NoChange):
+            options.overflow = overflow
+        if not isinstance(no_wrap, NoChange):
+            options.no_wrap = no_wrap
+        if not isinstance(highlight, NoChange):
+            options.highlight = highlight
+        if not isinstance(markup, NoChange):
+            options.markup = markup
+        if not isinstance(height, NoChange):
+            if height is not None:
+                options.max_height = height
+            options.height = None if height is None else max(0, height)
+        return options
+
+    def update_width(self, width: int) -> "ConsoleOptions":
+        """Update just the width, return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width)
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        return options
+
+    def update_height(self, height: int) -> "ConsoleOptions":
+        """Update the height, and return a copy.
+
+        Args:
+            height (int): New height
+
+        Returns:
+            ~ConsoleOptions: New Console options instance.
+        """
+        options = self.copy()
+        options.max_height = options.height = height
+        return options
+
+    def update_dimensions(self, width: int, height: int) -> "ConsoleOptions":
+        """Update the width and height, and return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width).
+            height (int): New height.
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        options.height = options.max_height = height
+        return options
+
+
+@runtime_checkable
+class RichCast(Protocol):
+    """An object that may be 'cast' to a console renderable."""
+
+    def __rich__(self) -> Union["ConsoleRenderable", str]:  # pragma: no cover
+        ...
+
+
+@runtime_checkable
+class ConsoleRenderable(Protocol):
+    """An object that supports the console protocol."""
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":  # pragma: no cover
+        ...
+
+
+# A type that may be rendered by Console.
+RenderableType = Union[ConsoleRenderable, RichCast, str]
+
+
+# The result of calling a __rich_console__ method.
+RenderResult = Iterable[Union[RenderableType, Segment]]
+
+
+_null_highlighter = NullHighlighter()
+
+
+class CaptureError(Exception):
+    """An error in the Capture context manager."""
+
+
+class NewLine:
+    """A renderable to generate new line(s)"""
+
+    def __init__(self, count: int = 1) -> None:
+        self.count = count
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Iterable[Segment]:
+        yield Segment("\n" * self.count)
+
+
+class ScreenUpdate:
+    """Render a list of lines at a given offset."""
+
+    def __init__(self, lines: List[List[Segment]], x: int, y: int) -> None:
+        self._lines = lines
+        self.x = x
+        self.y = y
+
+    def __rich_console__(
+        self, console: "Console", options: ConsoleOptions
+    ) -> RenderResult:
+        x = self.x
+        move_to = Control.move_to
+        for offset, line in enumerate(self._lines, self.y):
+            yield move_to(x, offset)
+            yield from line
+
+
+class Capture:
+    """Context manager to capture the result of printing to the console.
+    See :meth:`~rich.console.Console.capture` for how to use.
+
+    Args:
+        console (Console): A console instance to capture output.
+    """
+
+    def __init__(self, console: "Console") -> None:
+        self._console = console
+        self._result: Optional[str] = None
+
+    def __enter__(self) -> "Capture":
+        self._console.begin_capture()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self._result = self._console.end_capture()
+
+    def get(self) -> str:
+        """Get the result of the capture."""
+        if self._result is None:
+            raise CaptureError(
+                "Capture result is not available until context manager exits."
+            )
+        return self._result
+
+
+class ThemeContext:
+    """A context manager to use a temporary theme. See :meth:`~rich.console.Console.use_theme` for usage."""
+
+    def __init__(self, console: "Console", theme: Theme, inherit: bool = True) -> None:
+        self.console = console
+        self.theme = theme
+        self.inherit = inherit
+
+    def __enter__(self) -> "ThemeContext":
+        self.console.push_theme(self.theme)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.console.pop_theme()
+
+
+class PagerContext:
+    """A context manager that 'pages' content. See :meth:`~rich.console.Console.pager` for usage."""
+
+    def __init__(
+        self,
+        console: "Console",
+        pager: Optional[Pager] = None,
+        styles: bool = False,
+        links: bool = False,
+    ) -> None:
+        self._console = console
+        self.pager = SystemPager() if pager is None else pager
+        self.styles = styles
+        self.links = links
+
+    def __enter__(self) -> "PagerContext":
+        self._console._enter_buffer()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if exc_type is None:
+            with self._console._lock:
+                buffer: List[Segment] = self._console._buffer[:]
+                del self._console._buffer[:]
+                segments: Iterable[Segment] = buffer
+                if not self.styles:
+                    segments = Segment.strip_styles(segments)
+                elif not self.links:
+                    segments = Segment.strip_links(segments)
+                content = self._console._render_buffer(segments)
+            self.pager.show(content)
+        self._console._exit_buffer()
+
+
+class ScreenContext:
+    """A context manager that enables an alternative screen. See :meth:`~rich.console.Console.screen` for usage."""
+
+    def __init__(
+        self, console: "Console", hide_cursor: bool, style: StyleType = ""
+    ) -> None:
+        self.console = console
+        self.hide_cursor = hide_cursor
+        self.screen = Screen(style=style)
+        self._changed = False
+
+    def update(
+        self, *renderables: RenderableType, style: Optional[StyleType] = None
+    ) -> None:
+        """Update the screen.
+
+        Args:
+            renderable (RenderableType, optional): Optional renderable to replace current renderable,
+                or None for no change. Defaults to None.
+            style: (Style, optional): Replacement style, or None for no change. Defaults to None.
+        """
+        if renderables:
+            self.screen.renderable = (
+                Group(*renderables) if len(renderables) > 1 else renderables[0]
+            )
+        if style is not None:
+            self.screen.style = style
+        self.console.print(self.screen, end="")
+
+    def __enter__(self) -> "ScreenContext":
+        self._changed = self.console.set_alt_screen(True)
+        if self._changed and self.hide_cursor:
+            self.console.show_cursor(False)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if self._changed:
+            self.console.set_alt_screen(False)
+            if self.hide_cursor:
+                self.console.show_cursor(True)
+
+
+class Group:
+    """Takes a group of renderables and returns a renderable object that renders the group.
+
+    Args:
+        renderables (Iterable[RenderableType]): An iterable of renderable objects.
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def __init__(self, *renderables: "RenderableType", fit: bool = True) -> None:
+        self._renderables = renderables
+        self.fit = fit
+        self._render: Optional[List[RenderableType]] = None
+
+    @property
+    def renderables(self) -> List["RenderableType"]:
+        if self._render is None:
+            self._render = list(self._renderables)
+        return self._render
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.fit:
+            return measure_renderables(console, options, self.renderables)
+        else:
+            return Measurement(options.max_width, options.max_width)
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> RenderResult:
+        yield from self.renderables
+
+
+def group(fit: bool = True) -> Callable[..., Callable[..., Group]]:
+    """A decorator that turns an iterable of renderables in to a group.
+
+    Args:
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def decorator(
+        method: Callable[..., Iterable[RenderableType]]
+    ) -> Callable[..., Group]:
+        """Convert a method that returns an iterable of renderables in to a Group."""
+
+        @wraps(method)
+        def _replace(*args: Any, **kwargs: Any) -> Group:
+            renderables = method(*args, **kwargs)
+            return Group(*renderables, fit=fit)
+
+        return _replace
+
+    return decorator
+
+
+def _is_jupyter() -> bool:  # pragma: no cover
+    """Check if we're running in a Jupyter notebook."""
+    try:
+        get_ipython  # type: ignore
+    except NameError:
+        return False
+    ipython = get_ipython()  # type: ignore
+    shell = ipython.__class__.__name__
+    if "google.colab" in str(ipython.__class__) or shell == "ZMQInteractiveShell":
+        return True  # Jupyter notebook or qtconsole
+    elif shell == "TerminalInteractiveShell":
+        return False  # Terminal running IPython
+    else:
+        return False  # Other type (?)
+
+
+COLOR_SYSTEMS = {
+    "standard": ColorSystem.STANDARD,
+    "256": ColorSystem.EIGHT_BIT,
+    "truecolor": ColorSystem.TRUECOLOR,
+    "windows": ColorSystem.WINDOWS,
+}
+
+
+_COLOR_SYSTEMS_NAMES = {system: name for name, system in COLOR_SYSTEMS.items()}
+
+
+@dataclass
+class ConsoleThreadLocals(threading.local):
+    """Thread local values for Console context."""
+
+    theme_stack: ThemeStack
+    buffer: List[Segment] = field(default_factory=list)
+    buffer_index: int = 0
+
+
+class RenderHook(ABC):
+    """Provides hooks in to the render process."""
+
+    @abstractmethod
+    def process_renderables(
+        self, renderables: List[ConsoleRenderable]
+    ) -> List[ConsoleRenderable]:
+        """Called with a list of objects to render.
+
+        This method can return a new list of renderables, or modify and return the same list.
+
+        Args:
+            renderables (List[ConsoleRenderable]): A number of renderable objects.
+
+        Returns:
+            List[ConsoleRenderable]: A replacement list of renderables.
+        """
+
+
+_windows_console_features: Optional["WindowsConsoleFeatures"] = None
+
+
+def get_windows_console_features() -> "WindowsConsoleFeatures":  # pragma: no cover
+    global _windows_console_features
+    if _windows_console_features is not None:
+        return _windows_console_features
+    from ._windows import get_windows_console_features
+
+    _windows_console_features = get_windows_console_features()
+    return _windows_console_features
+
+
+def detect_legacy_windows() -> bool:
+    """Detect legacy Windows."""
+    return WINDOWS and not get_windows_console_features().vt
+
+
+if detect_legacy_windows():  # pragma: no cover
+    from pip._vendor.colorama import init
+
+    init(strip=False)
+
+
+class Console:
+    """A high level console interface.
+
+    Args:
+        color_system (str, optional): The color system supported by your terminal,
+            either ``"standard"``, ``"256"`` or ``"truecolor"``. Leave as ``"auto"`` to autodetect.
+        force_terminal (Optional[bool], optional): Enable/disable terminal control codes, or None to auto-detect terminal. Defaults to None.
+        force_jupyter (Optional[bool], optional): Enable/disable Jupyter rendering, or None to auto-detect Jupyter. Defaults to None.
+        force_interactive (Optional[bool], optional): Enable/disable interactive mode, or None to auto detect. Defaults to None.
+        soft_wrap (Optional[bool], optional): Set soft wrap default on print method. Defaults to False.
+        theme (Theme, optional): An optional style theme object, or ``None`` for default theme.
+        stderr (bool, optional): Use stderr rather than stdout if ``file`` is not specified. Defaults to False.
+        file (IO, optional): A file object where the console should write to. Defaults to stdout.
+        quiet (bool, Optional): Boolean to suppress all output. Defaults to False.
+        width (int, optional): The width of the terminal. Leave as default to auto-detect width.
+        height (int, optional): The height of the terminal. Leave as default to auto-detect height.
+        style (StyleType, optional): Style to apply to all output, or None for no style. Defaults to None.
+        no_color (Optional[bool], optional): Enabled no color mode, or None to auto detect. Defaults to None.
+        tab_size (int, optional): Number of spaces used to replace a tab character. Defaults to 8.
+        record (bool, optional): Boolean to enable recording of terminal output,
+            required to call :meth:`export_html` and :meth:`export_text`. Defaults to False.
+        markup (bool, optional): Boolean to enable :ref:`console_markup`. Defaults to True.
+        emoji (bool, optional): Enable emoji code. Defaults to True.
+        emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None.
+        highlight (bool, optional): Enable automatic highlighting. Defaults to True.
+        log_time (bool, optional): Boolean to enable logging of time by :meth:`log` methods. Defaults to True.
+        log_path (bool, optional): Boolean to enable the logging of the caller by :meth:`log`. Defaults to True.
+        log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%X] ".
+        highlighter (HighlighterType, optional): Default highlighter.
+        legacy_windows (bool, optional): Enable legacy Windows mode, or ``None`` to auto detect. Defaults to ``None``.
+        safe_box (bool, optional): Restrict box options that don't render on legacy Windows.
+        get_datetime (Callable[[], datetime], optional): Callable that gets the current time as a datetime.datetime object (used by Console.log),
+            or None for datetime.now.
+        get_time (Callable[[], time], optional): Callable that gets the current time in seconds, default uses time.monotonic.
+    """
+
+    _environ: Mapping[str, str] = os.environ
+
+    def __init__(
+        self,
+        *,
+        color_system: Optional[
+            Literal["auto", "standard", "256", "truecolor", "windows"]
+        ] = "auto",
+        force_terminal: Optional[bool] = None,
+        force_jupyter: Optional[bool] = None,
+        force_interactive: Optional[bool] = None,
+        soft_wrap: bool = False,
+        theme: Optional[Theme] = None,
+        stderr: bool = False,
+        file: Optional[IO[str]] = None,
+        quiet: bool = False,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        style: Optional[StyleType] = None,
+        no_color: Optional[bool] = None,
+        tab_size: int = 8,
+        record: bool = False,
+        markup: bool = True,
+        emoji: bool = True,
+        emoji_variant: Optional[EmojiVariant] = None,
+        highlight: bool = True,
+        log_time: bool = True,
+        log_path: bool = True,
+        log_time_format: Union[str, FormatTimeCallable] = "[%X]",
+        highlighter: Optional["HighlighterType"] = ReprHighlighter(),
+        legacy_windows: Optional[bool] = None,
+        safe_box: bool = True,
+        get_datetime: Optional[Callable[[], datetime]] = None,
+        get_time: Optional[Callable[[], float]] = None,
+        _environ: Optional[Mapping[str, str]] = None,
+    ):
+        # Copy of os.environ allows us to replace it for testing
+        if _environ is not None:
+            self._environ = _environ
+
+        self.is_jupyter = _is_jupyter() if force_jupyter is None else force_jupyter
+        if self.is_jupyter:
+            width = width or 93
+            height = height or 100
+
+        self.soft_wrap = soft_wrap
+        self._width = width
+        self._height = height
+        self.tab_size = tab_size
+        self.record = record
+        self._markup = markup
+        self._emoji = emoji
+        self._emoji_variant: Optional[EmojiVariant] = emoji_variant
+        self._highlight = highlight
+        self.legacy_windows: bool = (
+            (detect_legacy_windows() and not self.is_jupyter)
+            if legacy_windows is None
+            else legacy_windows
+        )
+        if width is None:
+            columns = self._environ.get("COLUMNS")
+            if columns is not None and columns.isdigit():
+                width = int(columns) - self.legacy_windows
+        if height is None:
+            lines = self._environ.get("LINES")
+            if lines is not None and lines.isdigit():
+                height = int(lines)
+
+        self.soft_wrap = soft_wrap
+        self._width = width
+        self._height = height
+
+        self._color_system: Optional[ColorSystem]
+        self._force_terminal = force_terminal
+        self._file = file
+        self.quiet = quiet
+        self.stderr = stderr
+
+        if color_system is None:
+            self._color_system = None
+        elif color_system == "auto":
+            self._color_system = self._detect_color_system()
+        else:
+            self._color_system = COLOR_SYSTEMS[color_system]
+
+        self._lock = threading.RLock()
+        self._log_render = LogRender(
+            show_time=log_time,
+            show_path=log_path,
+            time_format=log_time_format,
+        )
+        self.highlighter: HighlighterType = highlighter or _null_highlighter
+        self.safe_box = safe_box
+        self.get_datetime = get_datetime or datetime.now
+        self.get_time = get_time or monotonic
+        self.style = style
+        self.no_color = (
+            no_color if no_color is not None else "NO_COLOR" in self._environ
+        )
+        self.is_interactive = (
+            (self.is_terminal and not self.is_dumb_terminal)
+            if force_interactive is None
+            else force_interactive
+        )
+
+        self._record_buffer_lock = threading.RLock()
+        self._thread_locals = ConsoleThreadLocals(
+            theme_stack=ThemeStack(themes.DEFAULT if theme is None else theme)
+        )
+        self._record_buffer: List[Segment] = []
+        self._render_hooks: List[RenderHook] = []
+        self._live: Optional["Live"] = None
+        self._is_alt_screen = False
+
+    def __repr__(self) -> str:
+        return f"<console width={self.width} {str(self._color_system)}>"
+
+    @property
+    def file(self) -> IO[str]:
+        """Get the file object to write to."""
+        file = self._file or (sys.stderr if self.stderr else sys.stdout)
+        file = getattr(file, "rich_proxied_file", file)
+        return file
+
+    @file.setter
+    def file(self, new_file: IO[str]) -> None:
+        """Set a new file object."""
+        self._file = new_file
+
+    @property
+    def _buffer(self) -> List[Segment]:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer
+
+    @property
+    def _buffer_index(self) -> int:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer_index
+
+    @_buffer_index.setter
+    def _buffer_index(self, value: int) -> None:
+        self._thread_locals.buffer_index = value
+
+    @property
+    def _theme_stack(self) -> ThemeStack:
+        """Get the thread local theme stack."""
+        return self._thread_locals.theme_stack
+
+    def _detect_color_system(self) -> Optional[ColorSystem]:
+        """Detect color system from env vars."""
+        if self.is_jupyter:
+            return ColorSystem.TRUECOLOR
+        if not self.is_terminal or self.is_dumb_terminal:
+            return None
+        if WINDOWS:  # pragma: no cover
+            if self.legacy_windows:  # pragma: no cover
+                return ColorSystem.WINDOWS
+            windows_console_features = get_windows_console_features()
+            return (
+                ColorSystem.TRUECOLOR
+                if windows_console_features.truecolor
+                else ColorSystem.EIGHT_BIT
+            )
+        else:
+            color_term = self._environ.get("COLORTERM", "").strip().lower()
+            if color_term in ("truecolor", "24bit"):
+                return ColorSystem.TRUECOLOR
+            term = self._environ.get("TERM", "").strip().lower()
+            _term_name, _hyphen, colors = term.rpartition("-")
+            color_system = _TERM_COLORS.get(colors, ColorSystem.STANDARD)
+            return color_system
+
+    def _enter_buffer(self) -> None:
+        """Enter in to a buffer context, and buffer all output."""
+        self._buffer_index += 1
+
+    def _exit_buffer(self) -> None:
+        """Leave buffer context, and render content if required."""
+        self._buffer_index -= 1
+        self._check_buffer()
+
+    def set_live(self, live: "Live") -> None:
+        """Set Live instance. Used by Live context manager.
+
+        Args:
+            live (Live): Live instance using this Console.
+
+        Raises:
+            errors.LiveError: If this Console has a Live context currently active.
+        """
+        with self._lock:
+            if self._live is not None:
+                raise errors.LiveError("Only one live display may be active at once")
+            self._live = live
+
+    def clear_live(self) -> None:
+        """Clear the Live instance."""
+        with self._lock:
+            self._live = None
+
+    def push_render_hook(self, hook: RenderHook) -> None:
+        """Add a new render hook to the stack.
+
+        Args:
+            hook (RenderHook): Render hook instance.
+        """
+        with self._lock:
+            self._render_hooks.append(hook)
+
+    def pop_render_hook(self) -> None:
+        """Pop the last renderhook from the stack."""
+        with self._lock:
+            self._render_hooks.pop()
+
+    def __enter__(self) -> "Console":
+        """Own context manager to enter buffer context."""
+        self._enter_buffer()
+        return self
+
+    def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None:
+        """Exit buffer context."""
+        self._exit_buffer()
+
+    def begin_capture(self) -> None:
+        """Begin capturing console output. Call :meth:`end_capture` to exit capture mode and return output."""
+        self._enter_buffer()
+
+    def end_capture(self) -> str:
+        """End capture mode and return captured string.
+
+        Returns:
+            str: Console output.
+        """
+        render_result = self._render_buffer(self._buffer)
+        del self._buffer[:]
+        self._exit_buffer()
+        return render_result
+
+    def push_theme(self, theme: Theme, *, inherit: bool = True) -> None:
+        """Push a new theme on to the top of the stack, replacing the styles from the previous theme.
+        Generally speaking, you should call :meth:`~rich.console.Console.use_theme` to get a context manager, rather
+        than calling this method directly.
+
+        Args:
+            theme (Theme): A theme instance.
+            inherit (bool, optional): Inherit existing styles. Defaults to True.
+        """
+        self._theme_stack.push_theme(theme, inherit=inherit)
+
+    def pop_theme(self) -> None:
+        """Remove theme from top of stack, restoring previous theme."""
+        self._theme_stack.pop_theme()
+
+    def use_theme(self, theme: Theme, *, inherit: bool = True) -> ThemeContext:
+        """Use a different theme for the duration of the context manager.
+
+        Args:
+            theme (Theme): Theme instance to user.
+            inherit (bool, optional): Inherit existing console styles. Defaults to True.
+
+        Returns:
+            ThemeContext: [description]
+        """
+        return ThemeContext(self, theme, inherit)
+
+    @property
+    def color_system(self) -> Optional[str]:
+        """Get color system string.
+
+        Returns:
+            Optional[str]: "standard", "256" or "truecolor".
+        """
+
+        if self._color_system is not None:
+            return _COLOR_SYSTEMS_NAMES[self._color_system]
+        else:
+            return None
+
+    @property
+    def encoding(self) -> str:
+        """Get the encoding of the console file, e.g. ``"utf-8"``.
+
+        Returns:
+            str: A standard encoding string.
+        """
+        return (getattr(self.file, "encoding", "utf-8") or "utf-8").lower()
+
+    @property
+    def is_terminal(self) -> bool:
+        """Check if the console is writing to a terminal.
+
+        Returns:
+            bool: True if the console writing to a device capable of
+            understanding terminal codes, otherwise False.
+        """
+        if self._force_terminal is not None:
+            return self._force_terminal
+        isatty: Optional[Callable[[], bool]] = getattr(self.file, "isatty", None)
+        try:
+            return False if isatty is None else isatty()
+        except ValueError:
+            # in some situation (at the end of a pytest run for example) isatty() can raise
+            # ValueError: I/O operation on closed file
+            # return False because we aren't in a terminal anymore
+            return False
+
+    @property
+    def is_dumb_terminal(self) -> bool:
+        """Detect dumb terminal.
+
+        Returns:
+            bool: True if writing to a dumb terminal, otherwise False.
+
+        """
+        _term = self._environ.get("TERM", "")
+        is_dumb = _term.lower() in ("dumb", "unknown")
+        return self.is_terminal and is_dumb
+
+    @property
+    def options(self) -> ConsoleOptions:
+        """Get default console options."""
+        return ConsoleOptions(
+            max_height=self.size.height,
+            size=self.size,
+            legacy_windows=self.legacy_windows,
+            min_width=1,
+            max_width=self.width,
+            encoding=self.encoding,
+            is_terminal=self.is_terminal,
+        )
+
+    @property
+    def size(self) -> ConsoleDimensions:
+        """Get the size of the console.
+
+        Returns:
+            ConsoleDimensions: A named tuple containing the dimensions.
+        """
+
+        if self._width is not None and self._height is not None:
+            return ConsoleDimensions(self._width - self.legacy_windows, self._height)
+
+        if self.is_dumb_terminal:
+            return ConsoleDimensions(80, 25)
+
+        width: Optional[int] = None
+        height: Optional[int] = None
+
+        if WINDOWS:  # pragma: no cover
+            try:
+                width, height = os.get_terminal_size()
+            except OSError:  # Probably not a terminal
+                pass
+        else:
+            try:
+                width, height = os.get_terminal_size(sys.__stdin__.fileno())
+            except (AttributeError, ValueError, OSError):
+                try:
+                    width, height = os.get_terminal_size(sys.__stdout__.fileno())
+                except (AttributeError, ValueError, OSError):
+                    pass
+
+        columns = self._environ.get("COLUMNS")
+        if columns is not None and columns.isdigit():
+            width = int(columns)
+        lines = self._environ.get("LINES")
+        if lines is not None and lines.isdigit():
+            height = int(lines)
+
+        # get_terminal_size can report 0, 0 if run from pseudo-terminal
+        width = width or 80
+        height = height or 25
+        return ConsoleDimensions(
+            width - self.legacy_windows if self._width is None else self._width,
+            height if self._height is None else self._height,
+        )
+
+    @size.setter
+    def size(self, new_size: Tuple[int, int]) -> None:
+        """Set a new size for the terminal.
+
+        Args:
+            new_size (Tuple[int, int]): New width and height.
+        """
+        width, height = new_size
+        self._width = width
+        self._height = height
+
+    @property
+    def width(self) -> int:
+        """Get the width of the console.
+
+        Returns:
+            int: The width (in characters) of the console.
+        """
+        return self.size.width
+
+    @width.setter
+    def width(self, width: int) -> None:
+        """Set width.
+
+        Args:
+            width (int): New width.
+        """
+        self._width = width
+
+    @property
+    def height(self) -> int:
+        """Get the height of the console.
+
+        Returns:
+            int: The height (in lines) of the console.
+        """
+        return self.size.height
+
+    @height.setter
+    def height(self, height: int) -> None:
+        """Set height.
+
+        Args:
+            height (int): new height.
+        """
+        self._height = height
+
+    def bell(self) -> None:
+        """Play a 'bell' sound (if supported by the terminal)."""
+        self.control(Control.bell())
+
+    def capture(self) -> Capture:
+        """A context manager to *capture* the result of print() or log() in a string,
+        rather than writing it to the console.
+
+        Example:
+            >>> from rich.console import Console
+            >>> console = Console()
+            >>> with console.capture() as capture:
+            ...     console.print("[bold magenta]Hello World[/]")
+            >>> print(capture.get())
+
+        Returns:
+            Capture: Context manager with disables writing to the terminal.
+        """
+        capture = Capture(self)
+        return capture
+
+    def pager(
+        self, pager: Optional[Pager] = None, styles: bool = False, links: bool = False
+    ) -> PagerContext:
+        """A context manager to display anything printed within a "pager". The pager application
+        is defined by the system and will typically support at least pressing a key to scroll.
+
+        Args:
+            pager (Pager, optional): A pager object, or None to use :class:`~rich.pager.SystemPager`. Defaults to None.
+            styles (bool, optional): Show styles in pager. Defaults to False.
+            links (bool, optional): Show links in pager. Defaults to False.
+
+        Example:
+            >>> from rich.console import Console
+            >>> from rich.__main__ import make_test_card
+            >>> console = Console()
+            >>> with console.pager():
+                    console.print(make_test_card())
+
+        Returns:
+            PagerContext: A context manager.
+        """
+        return PagerContext(self, pager=pager, styles=styles, links=links)
+
+    def line(self, count: int = 1) -> None:
+        """Write new line(s).
+
+        Args:
+            count (int, optional): Number of new lines. Defaults to 1.
+        """
+
+        assert count >= 0, "count must be >= 0"
+        self.print(NewLine(count))
+
+    def clear(self, home: bool = True) -> None:
+        """Clear the screen.
+
+        Args:
+            home (bool, optional): Also move the cursor to 'home' position. Defaults to True.
+        """
+        if home:
+            self.control(Control.clear(), Control.home())
+        else:
+            self.control(Control.clear())
+
+    def status(
+        self,
+        status: RenderableType,
+        *,
+        spinner: str = "dots",
+        spinner_style: str = "status.spinner",
+        speed: float = 1.0,
+        refresh_per_second: float = 12.5,
+    ) -> "Status":
+        """Display a status and spinner.
+
+        Args:
+            status (RenderableType): A status renderable (str or Text typically).
+            spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots".
+            spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner".
+            speed (float, optional): Speed factor for spinner animation. Defaults to 1.0.
+            refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5.
+
+        Returns:
+            Status: A Status object that may be used as a context manager.
+        """
+        from .status import Status
+
+        status_renderable = Status(
+            status,
+            console=self,
+            spinner=spinner,
+            spinner_style=spinner_style,
+            speed=speed,
+            refresh_per_second=refresh_per_second,
+        )
+        return status_renderable
+
+    def show_cursor(self, show: bool = True) -> bool:
+        """Show or hide the cursor.
+
+        Args:
+            show (bool, optional): Set visibility of the cursor.
+        """
+        if self.is_terminal and not self.legacy_windows:
+            self.control(Control.show_cursor(show))
+            return True
+        return False
+
+    def set_alt_screen(self, enable: bool = True) -> bool:
+        """Enables alternative screen mode.
+
+        Note, if you enable this mode, you should ensure that is disabled before
+        the application exits. See :meth:`~rich.Console.screen` for a context manager
+        that handles this for you.
+
+        Args:
+            enable (bool, optional): Enable (True) or disable (False) alternate screen. Defaults to True.
+
+        Returns:
+            bool: True if the control codes were written.
+
+        """
+        changed = False
+        if self.is_terminal and not self.legacy_windows:
+            self.control(Control.alt_screen(enable))
+            changed = True
+            self._is_alt_screen = enable
+        return changed
+
+    @property
+    def is_alt_screen(self) -> bool:
+        """Check if the alt screen was enabled.
+
+        Returns:
+            bool: True if the alt screen was enabled, otherwise False.
+        """
+        return self._is_alt_screen
+
+    def screen(
+        self, hide_cursor: bool = True, style: Optional[StyleType] = None
+    ) -> "ScreenContext":
+        """Context manager to enable and disable 'alternative screen' mode.
+
+        Args:
+            hide_cursor (bool, optional): Also hide the cursor. Defaults to False.
+            style (Style, optional): Optional style for screen. Defaults to None.
+
+        Returns:
+            ~ScreenContext: Context which enables alternate screen on enter, and disables it on exit.
+        """
+        return ScreenContext(self, hide_cursor=hide_cursor, style=style or "")
+
+    def measure(
+        self, renderable: RenderableType, *, options: Optional[ConsoleOptions] = None
+    ) -> Measurement:
+        """Measure a renderable. Returns a :class:`~rich.measure.Measurement` object which contains
+        information regarding the number of characters required to print the renderable.
+
+        Args:
+            renderable (RenderableType): Any renderable or string.
+            options (Optional[ConsoleOptions], optional): Options to use when measuring, or None
+                to use default options. Defaults to None.
+
+        Returns:
+            Measurement: A measurement of the renderable.
+        """
+        measurement = Measurement.get(self, options or self.options, renderable)
+        return measurement
+
+    def render(
+        self, renderable: RenderableType, options: Optional[ConsoleOptions] = None
+    ) -> Iterable[Segment]:
+        """Render an object in to an iterable of `Segment` instances.
+
+        This method contains the logic for rendering objects with the console protocol.
+        You are unlikely to need to use it directly, unless you are extending the library.
+
+        Args:
+            renderable (RenderableType): An object supporting the console protocol, or
+                an object that may be converted to a string.
+            options (ConsoleOptions, optional): An options object, or None to use self.options. Defaults to None.
+
+        Returns:
+            Iterable[Segment]: An iterable of segments that may be rendered.
+        """
+
+        _options = options or self.options
+        if _options.max_width < 1:
+            # No space to render anything. This prevents potential recursion errors.
+            return
+        render_iterable: RenderResult
+
+        renderable = rich_cast(renderable)
+        if hasattr(renderable, "__rich_console__") and not isclass(renderable):
+            render_iterable = renderable.__rich_console__(self, _options)  # type: ignore
+        elif isinstance(renderable, str):
+            text_renderable = self.render_str(
+                renderable, highlight=_options.highlight, markup=_options.markup
+            )
+            render_iterable = text_renderable.__rich_console__(self, _options)
+        else:
+            raise errors.NotRenderableError(
+                f"Unable to render {renderable!r}; "
+                "A str, Segment or object with __rich_console__ method is required"
+            )
+
+        try:
+            iter_render = iter(render_iterable)
+        except TypeError:
+            raise errors.NotRenderableError(
+                f"object {render_iterable!r} is not renderable"
+            )
+        _Segment = Segment
+        for render_output in iter_render:
+            if isinstance(render_output, _Segment):
+                yield render_output
+            else:
+                yield from self.render(render_output, _options)
+
+    def render_lines(
+        self,
+        renderable: RenderableType,
+        options: Optional[ConsoleOptions] = None,
+        *,
+        style: Optional[Style] = None,
+        pad: bool = True,
+        new_lines: bool = False,
+    ) -> List[List[Segment]]:
+        """Render objects in to a list of lines.
+
+        The output of render_lines is useful when further formatting of rendered console text
+        is required, such as the Panel class which draws a border around any renderable object.
+
+        Args:
+            renderable (RenderableType): Any object renderable in the console.
+            options (Optional[ConsoleOptions], optional): Console options, or None to use self.options. Default to ``None``.
+            style (Style, optional): Optional style to apply to renderables. Defaults to ``None``.
+            pad (bool, optional): Pad lines shorter than render width. Defaults to ``True``.
+            new_lines (bool, optional): Include "\n" characters at end of lines.
+
+        Returns:
+            List[List[Segment]]: A list of lines, where a line is a list of Segment objects.
+        """
+        with self._lock:
+            render_options = options or self.options
+            _rendered = self.render(renderable, render_options)
+            if style:
+                _rendered = Segment.apply_style(_rendered, style)
+            lines = list(
+                islice(
+                    Segment.split_and_crop_lines(
+                        _rendered,
+                        render_options.max_width,
+                        include_new_lines=new_lines,
+                        pad=pad,
+                    ),
+                    None,
+                    render_options.height,
+                )
+            )
+            if render_options.height is not None:
+                extra_lines = render_options.height - len(lines)
+                if extra_lines > 0:
+                    pad_line = [
+                        [Segment(" " * render_options.max_width, style), Segment("\n")]
+                        if new_lines
+                        else [Segment(" " * render_options.max_width, style)]
+                    ]
+                    lines.extend(pad_line * extra_lines)
+
+            return lines
+
+    def render_str(
+        self,
+        text: str,
+        *,
+        style: Union[str, Style] = "",
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        highlighter: Optional[HighlighterType] = None,
+    ) -> "Text":
+        """Convert a string to a Text instance. This is is called automatically if
+        you print or log a string.
+
+        Args:
+            text (str): Text to render.
+            style (Union[str, Style], optional): Style to apply to rendered text.
+            justify (str, optional): Justify method: "default", "left", "center", "full", or "right". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji, or ``None`` to use Console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use Console default.
+            highlight (Optional[bool], optional): Enable highlighting, or ``None`` to use Console default.
+            highlighter (HighlighterType, optional): Optional highlighter to apply.
+        Returns:
+            ConsoleRenderable: Renderable object.
+
+        """
+        emoji_enabled = emoji or (emoji is None and self._emoji)
+        markup_enabled = markup or (markup is None and self._markup)
+        highlight_enabled = highlight or (highlight is None and self._highlight)
+
+        if markup_enabled:
+            rich_text = render_markup(
+                text,
+                style=style,
+                emoji=emoji_enabled,
+                emoji_variant=self._emoji_variant,
+            )
+            rich_text.justify = justify
+            rich_text.overflow = overflow
+        else:
+            rich_text = Text(
+                _emoji_replace(text, default_variant=self._emoji_variant)
+                if emoji_enabled
+                else text,
+                justify=justify,
+                overflow=overflow,
+                style=style,
+            )
+
+        _highlighter = (highlighter or self.highlighter) if highlight_enabled else None
+        if _highlighter is not None:
+            highlight_text = _highlighter(str(rich_text))
+            highlight_text.copy_styles(rich_text)
+            return highlight_text
+
+        return rich_text
+
+    def get_style(
+        self, name: Union[str, Style], *, default: Optional[Union[Style, str]] = None
+    ) -> Style:
+        """Get a Style instance by it's theme name or parse a definition.
+
+        Args:
+            name (str): The name of a style or a style definition.
+
+        Returns:
+            Style: A Style object.
+
+        Raises:
+            MissingStyle: If no style could be parsed from name.
+
+        """
+        if isinstance(name, Style):
+            return name
+
+        try:
+            style = self._theme_stack.get(name)
+            if style is None:
+                style = Style.parse(name)
+            return style.copy() if style.link else style
+        except errors.StyleSyntaxError as error:
+            if default is not None:
+                return self.get_style(default)
+            raise errors.MissingStyle(
+                f"Failed to get style {name!r}; {error}"
+            ) from None
+
+    def _collect_renderables(
+        self,
+        objects: Iterable[Any],
+        sep: str,
+        end: str,
+        *,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+    ) -> List[ConsoleRenderable]:
+        """Combine a number of renderables and text into one renderable.
+
+        Args:
+            objects (Iterable[Any]): Anything that Rich can render.
+            sep (str): String to write between print data.
+            end (str): String to write at end of print data.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default.
+
+        Returns:
+            List[ConsoleRenderable]: A list of things to render.
+        """
+        renderables: List[ConsoleRenderable] = []
+        _append = renderables.append
+        text: List[Text] = []
+        append_text = text.append
+
+        append = _append
+        if justify in ("left", "center", "right"):
+
+            def align_append(renderable: RenderableType) -> None:
+                _append(Align(renderable, cast(AlignMethod, justify)))
+
+            append = align_append
+
+        _highlighter: HighlighterType = _null_highlighter
+        if highlight or (highlight is None and self._highlight):
+            _highlighter = self.highlighter
+
+        def check_text() -> None:
+            if text:
+                sep_text = Text(sep, justify=justify, end=end)
+                append(sep_text.join(text))
+                del text[:]
+
+        for renderable in objects:
+            renderable = rich_cast(renderable)
+            if isinstance(renderable, str):
+                append_text(
+                    self.render_str(
+                        renderable, emoji=emoji, markup=markup, highlighter=_highlighter
+                    )
+                )
+            elif isinstance(renderable, Text):
+                append_text(renderable)
+            elif isinstance(renderable, ConsoleRenderable):
+                check_text()
+                append(renderable)
+            elif is_expandable(renderable):
+                check_text()
+                append(Pretty(renderable, highlighter=_highlighter))
+            else:
+                append_text(_highlighter(str(renderable)))
+
+        check_text()
+
+        if self.style is not None:
+            style = self.get_style(self.style)
+            renderables = [Styled(renderable, style) for renderable in renderables]
+
+        return renderables
+
+    def rule(
+        self,
+        title: TextType = "",
+        *,
+        characters: str = "─",
+        style: Union[str, Style] = "rule.line",
+        align: AlignMethod = "center",
+    ) -> None:
+        """Draw a line with optional centered title.
+
+        Args:
+            title (str, optional): Text to render over the rule. Defaults to "".
+            characters (str, optional): Character(s) to form the line. Defaults to "─".
+            style (str, optional): Style of line. Defaults to "rule.line".
+            align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center".
+        """
+        from .rule import Rule
+
+        rule = Rule(title=title, characters=characters, style=style, align=align)
+        self.print(rule)
+
+    def control(self, *control: Control) -> None:
+        """Insert non-printing control codes.
+
+        Args:
+            control_codes (str): Control codes, such as those that may move the cursor.
+        """
+        if not self.is_dumb_terminal:
+            with self:
+                self._buffer.extend(_control.segment for _control in control)
+
+    def out(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        highlight: Optional[bool] = None,
+    ) -> None:
+        """Output to the terminal. This is a low-level way of writing to the terminal which unlike
+        :meth:`~rich.console.Console.print` won't pretty print, wrap text, or apply markup, but will
+        optionally apply highlighting and a basic style.
+
+        Args:
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use
+                console default. Defaults to ``None``.
+        """
+        raw_output: str = sep.join(str(_object) for _object in objects)
+        self.print(
+            raw_output,
+            style=style,
+            highlight=highlight,
+            emoji=False,
+            markup=False,
+            no_wrap=True,
+            overflow="ignore",
+            crop=False,
+            end=end,
+        )
+
+    def print(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        no_wrap: Optional[bool] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        crop: bool = True,
+        soft_wrap: Optional[bool] = None,
+        new_line_start: bool = False,
+    ) -> None:
+        """Print to the console.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): Justify method: "default", "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "ignore", "crop", "fold", or "ellipsis". Defaults to None.
+            no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to ``None``.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to ``None``.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``.
+            width (Optional[int], optional): Width of output, or ``None`` to auto-detect. Defaults to ``None``.
+            crop (Optional[bool], optional): Crop output to width of terminal. Defaults to True.
+            soft_wrap (bool, optional): Enable soft wrap mode which disables word wrapping and cropping of text or ``None`` for
+                Console default. Defaults to ``None``.
+            new_line_start (bool, False): Insert a new line at the start if the output contains more than one line. Defaults to ``False``.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        if soft_wrap is None:
+            soft_wrap = self.soft_wrap
+        if soft_wrap:
+            if no_wrap is None:
+                no_wrap = True
+            if overflow is None:
+                overflow = "ignore"
+            crop = False
+        render_hooks = self._render_hooks[:]
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            render_options = self.options.update(
+                justify=justify,
+                overflow=overflow,
+                width=min(width, self.width) if width is not None else NO_CHANGE,
+                height=height,
+                no_wrap=no_wrap,
+                markup=markup,
+                highlight=highlight,
+            )
+
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            if style is None:
+                for renderable in renderables:
+                    extend(render(renderable, render_options))
+            else:
+                for renderable in renderables:
+                    extend(
+                        Segment.apply_style(
+                            render(renderable, render_options), self.get_style(style)
+                        )
+                    )
+            if new_line_start:
+                if (
+                    len("".join(segment.text for segment in new_segments).splitlines())
+                    > 1
+                ):
+                    new_segments.insert(0, Segment.line())
+            if crop:
+                buffer_extend = self._buffer.extend
+                for line in Segment.split_and_crop_lines(
+                    new_segments, self.width, pad=False
+                ):
+                    buffer_extend(line)
+            else:
+                self._buffer.extend(new_segments)
+
+    def print_json(
+        self,
+        json: Optional[str] = None,
+        *,
+        data: Any = None,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = True,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> None:
+        """Pretty prints JSON. Output will be valid JSON.
+
+        Args:
+            json (Optional[str]): A string containing JSON.
+            data (Any): If json is not supplied, then encode this data.
+            indent (Union[None, int, str], optional): Number of spaces to indent. Defaults to 2.
+            highlight (bool, optional): Enable highlighting of output: Defaults to True.
+            skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+            ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+            check_circular (bool, optional): Check for circular references. Defaults to True.
+            allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+            default (Callable, optional): A callable that converts values that can not be encoded
+                in to something that can be JSON encoded. Defaults to None.
+            sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+        """
+        from pip._vendor.rich.json import JSON
+
+        if json is None:
+            json_renderable = JSON.from_data(
+                data,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        else:
+            if not isinstance(json, str):
+                raise TypeError(
+                    f"json must be str. Did you mean print_json(data={json!r}) ?"
+                )
+            json_renderable = JSON(
+                json,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        self.print(json_renderable, soft_wrap=True)
+
+    def update_screen(
+        self,
+        renderable: RenderableType,
+        *,
+        region: Optional[Region] = None,
+        options: Optional[ConsoleOptions] = None,
+    ) -> None:
+        """Update the screen at a given offset.
+
+        Args:
+            renderable (RenderableType): A Rich renderable.
+            region (Region, optional): Region of screen to update, or None for entire screen. Defaults to None.
+            x (int, optional): x offset. Defaults to 0.
+            y (int, optional): y offset. Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        render_options = options or self.options
+        if region is None:
+            x = y = 0
+            render_options = render_options.update_dimensions(
+                render_options.max_width, render_options.height or self.height
+            )
+        else:
+            x, y, width, height = region
+            render_options = render_options.update_dimensions(width, height)
+
+        lines = self.render_lines(renderable, options=render_options)
+        self.update_screen_lines(lines, x, y)
+
+    def update_screen_lines(
+        self, lines: List[List[Segment]], x: int = 0, y: int = 0
+    ) -> None:
+        """Update lines of the screen at a given offset.
+
+        Args:
+            lines (List[List[Segment]]): Rendered lines (as produced by :meth:`~rich.Console.render_lines`).
+            x (int, optional): x offset (column no). Defaults to 0.
+            y (int, optional): y offset (column no). Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        screen_update = ScreenUpdate(lines, x, y)
+        segments = self.render(screen_update)
+        self._buffer.extend(segments)
+        self._check_buffer()
+
+    def print_exception(
+        self,
+        *,
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ) -> None:
+        """Prints a rich render of the last exception and traceback.
+
+        Args:
+            width (Optional[int], optional): Number of characters used to render code. Defaults to 88.
+            extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+            theme (str, optional): Override pygments theme used in traceback
+            word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+            max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+        """
+        from .traceback import Traceback
+
+        traceback = Traceback(
+            width=width,
+            extra_lines=extra_lines,
+            theme=theme,
+            word_wrap=word_wrap,
+            show_locals=show_locals,
+            suppress=suppress,
+            max_frames=max_frames,
+        )
+        self.print(traceback)
+
+    @staticmethod
+    def _caller_frame_info(
+        offset: int,
+        currentframe: Callable[[], Optional[FrameType]] = inspect.currentframe,
+    ) -> Tuple[str, int, Dict[str, Any]]:
+        """Get caller frame information.
+
+        Args:
+            offset (int): the caller offset within the current frame stack.
+            currentframe (Callable[[], Optional[FrameType]], optional): the callable to use to
+                retrieve the current frame. Defaults to ``inspect.currentframe``.
+
+        Returns:
+            Tuple[str, int, Dict[str, Any]]: A tuple containing the filename, the line number and
+                the dictionary of local variables associated with the caller frame.
+
+        Raises:
+            RuntimeError: If the stack offset is invalid.
+        """
+        # Ignore the frame of this local helper
+        offset += 1
+
+        frame = currentframe()
+        if frame is not None:
+            # Use the faster currentframe where implemented
+            while offset and frame:
+                frame = frame.f_back
+                offset -= 1
+            assert frame is not None
+            return frame.f_code.co_filename, frame.f_lineno, frame.f_locals
+        else:
+            # Fallback to the slower stack
+            frame_info = inspect.stack()[offset]
+            return frame_info.filename, frame_info.lineno, frame_info.frame.f_locals
+
+    def log(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        log_locals: bool = False,
+        _stack_offset: int = 1,
+    ) -> None:
+        """Log rich content to the terminal.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to None.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to None.
+            log_locals (bool, optional): Boolean to enable logging of locals where ``log()``
+                was called. Defaults to False.
+            _stack_offset (int, optional): Offset of caller from end of call stack. Defaults to 1.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        render_hooks = self._render_hooks[:]
+
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            if style is not None:
+                renderables = [Styled(renderable, style) for renderable in renderables]
+
+            filename, line_no, locals = self._caller_frame_info(_stack_offset)
+            link_path = None if filename.startswith("<") else os.path.abspath(filename)
+            path = filename.rpartition(os.sep)[-1]
+            if log_locals:
+                locals_map = {
+                    key: value
+                    for key, value in locals.items()
+                    if not key.startswith("__")
+                }
+                renderables.append(render_scope(locals_map, title="[i]locals"))
+
+            renderables = [
+                self._log_render(
+                    self,
+                    renderables,
+                    log_time=self.get_datetime(),
+                    path=path,
+                    line_no=line_no,
+                    link_path=link_path,
+                )
+            ]
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            render_options = self.options
+            for renderable in renderables:
+                extend(render(renderable, render_options))
+            buffer_extend = self._buffer.extend
+            for line in Segment.split_and_crop_lines(
+                new_segments, self.width, pad=False
+            ):
+                buffer_extend(line)
+
+    def _check_buffer(self) -> None:
+        """Check if the buffer may be rendered."""
+        if self.quiet:
+            del self._buffer[:]
+            return
+        with self._lock:
+            if self._buffer_index == 0:
+                if self.is_jupyter:  # pragma: no cover
+                    from .jupyter import display
+
+                    display(self._buffer, self._render_buffer(self._buffer[:]))
+                    del self._buffer[:]
+                else:
+                    text = self._render_buffer(self._buffer[:])
+                    del self._buffer[:]
+                    if text:
+                        try:
+                            if WINDOWS:  # pragma: no cover
+                                # https://bugs.python.org/issue37871
+                                write = self.file.write
+                                for line in text.splitlines(True):
+                                    write(line)
+                            else:
+                                self.file.write(text)
+                            self.file.flush()
+                        except UnicodeEncodeError as error:
+                            error.reason = f"{error.reason}\n*** You may need to add PYTHONIOENCODING=utf-8 to your environment ***"
+                            raise
+
+    def _render_buffer(self, buffer: Iterable[Segment]) -> str:
+        """Render buffered output, and clear buffer."""
+        output: List[str] = []
+        append = output.append
+        color_system = self._color_system
+        legacy_windows = self.legacy_windows
+        if self.record:
+            with self._record_buffer_lock:
+                self._record_buffer.extend(buffer)
+        not_terminal = not self.is_terminal
+        if self.no_color and color_system:
+            buffer = Segment.remove_color(buffer)
+        for text, style, control in buffer:
+            if style:
+                append(
+                    style.render(
+                        text,
+                        color_system=color_system,
+                        legacy_windows=legacy_windows,
+                    )
+                )
+            elif not (not_terminal and control):
+                append(text)
+
+        rendered = "".join(output)
+        return rendered
+
+    def input(
+        self,
+        prompt: TextType = "",
+        *,
+        markup: bool = True,
+        emoji: bool = True,
+        password: bool = False,
+        stream: Optional[TextIO] = None,
+    ) -> str:
+        """Displays a prompt and waits for input from the user. The prompt may contain color / style.
+
+        It works in the same way as Python's builtin :func:`input` function and provides elaborate line editing and history features if Python's builtin :mod:`readline` module is previously loaded.
+
+        Args:
+            prompt (Union[str, Text]): Text to render in the prompt.
+            markup (bool, optional): Enable console markup (requires a str prompt). Defaults to True.
+            emoji (bool, optional): Enable emoji (requires a str prompt). Defaults to True.
+            password: (bool, optional): Hide typed text. Defaults to False.
+            stream: (TextIO, optional): Optional file to read input from (rather than stdin). Defaults to None.
+
+        Returns:
+            str: Text read from stdin.
+        """
+        prompt_str = ""
+        if prompt:
+            with self.capture() as capture:
+                self.print(prompt, markup=markup, emoji=emoji, end="")
+            prompt_str = capture.get()
+        if self.legacy_windows:
+            # Legacy windows doesn't like ANSI codes in getpass or input (colorama bug)?
+            self.file.write(prompt_str)
+            prompt_str = ""
+        if password:
+            result = getpass(prompt_str, stream=stream)
+        else:
+            if stream:
+                self.file.write(prompt_str)
+                result = stream.readline()
+            else:
+                result = input(prompt_str)
+        return result
+
+    def export_text(self, *, clear: bool = True, styles: bool = False) -> str:
+        """Generate text from console contents (requires record=True argument in constructor).
+
+        Args:
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi escape codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        Returns:
+            str: String containing console contents.
+
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+
+        with self._record_buffer_lock:
+            if styles:
+                text = "".join(
+                    (style.render(text) if style else text)
+                    for text, style, _ in self._record_buffer
+                )
+            else:
+                text = "".join(
+                    segment.text
+                    for segment in self._record_buffer
+                    if not segment.control
+                )
+            if clear:
+                del self._record_buffer[:]
+        return text
+
+    def save_text(self, path: str, *, clear: bool = True, styles: bool = False) -> None:
+        """Generate text from console and save to a given location (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write text files.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi style codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        """
+        text = self.export_text(clear=clear, styles=styles)
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(text)
+
+    def export_html(
+        self,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: Optional[str] = None,
+        inline_styles: bool = False,
+    ) -> str:
+        """Generate HTML from console contents (requires record=True argument in constructor).
+
+        Args:
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML, should contain {foreground}
+                {background} and {code}.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        Returns:
+            str: String containing console contents as HTML.
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+        fragments: List[str] = []
+        append = fragments.append
+        _theme = theme or DEFAULT_TERMINAL_THEME
+        stylesheet = ""
+
+        render_code_format = CONSOLE_HTML_FORMAT if code_format is None else code_format
+
+        with self._record_buffer_lock:
+            if inline_styles:
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        if style.link:
+                            text = f'<a href="{style.link}">{text}</a>'
+                        text = f'<span style="{rule}">{text}</span>' if rule else text
+                    append(text)
+            else:
+                styles: Dict[str, int] = {}
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        style_number = styles.setdefault(rule, len(styles) + 1)
+                        if style.link:
+                            text = f'<a class="r{style_number}" href="{style.link}">{text}</a>'
+                        else:
+                            text = f'<span class="r{style_number}">{text}</span>'
+                    append(text)
+                stylesheet_rules: List[str] = []
+                stylesheet_append = stylesheet_rules.append
+                for style_rule, style_number in styles.items():
+                    if style_rule:
+                        stylesheet_append(f".r{style_number} {{{style_rule}}}")
+                stylesheet = "\n".join(stylesheet_rules)
+
+            rendered_code = render_code_format.format(
+                code="".join(fragments),
+                stylesheet=stylesheet,
+                foreground=_theme.foreground_color.hex,
+                background=_theme.background_color.hex,
+            )
+            if clear:
+                del self._record_buffer[:]
+        return rendered_code
+
+    def save_html(
+        self,
+        path: str,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: str = CONSOLE_HTML_FORMAT,
+        inline_styles: bool = False,
+    ) -> None:
+        """Generate HTML from console contents and write to a file (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write html file.
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML, should contain {foreground}
+                {background} and {code}.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        """
+        html = self.export_html(
+            theme=theme,
+            clear=clear,
+            code_format=code_format,
+            inline_styles=inline_styles,
+        )
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(html)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console()
+
+    console.log(
+        "JSONRPC [i]request[/i]",
+        5,
+        1.3,
+        True,
+        False,
+        None,
+        {
+            "jsonrpc": "2.0",
+            "method": "subtract",
+            "params": {"minuend": 42, "subtrahend": 23},
+            "id": 3,
+        },
+    )
+
+    console.log("Hello, World!", "{'a': 1}", repr(console))
+
+    console.print(
+        {
+            "name": None,
+            "empty": [],
+            "quiz": {
+                "sport": {
+                    "answered": True,
+                    "q1": {
+                        "question": "Which one is correct team name in NBA?",
+                        "options": [
+                            "New York Bulls",
+                            "Los Angeles Kings",
+                            "Golden State Warriors",
+                            "Huston Rocket",
+                        ],
+                        "answer": "Huston Rocket",
+                    },
+                },
+                "maths": {
+                    "answered": False,
+                    "q1": {
+                        "question": "5 + 7 = ?",
+                        "options": [10, 11, 12, 13],
+                        "answer": 12,
+                    },
+                    "q2": {
+                        "question": "12 - 8 = ?",
+                        "options": [1, 2, 3, 4],
+                        "answer": 4,
+                    },
+                },
+            },
+        }
+    )
+    console.log("foo")

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/containers.py

@@ -0,0 +1,167 @@
+from itertools import zip_longest
+from typing import (
+    Iterator,
+    Iterable,
+    List,
+    Optional,
+    Union,
+    overload,
+    TypeVar,
+    TYPE_CHECKING,
+)
+
+if TYPE_CHECKING:
+    from .console import (
+        Console,
+        ConsoleOptions,
+        JustifyMethod,
+        OverflowMethod,
+        RenderResult,
+        RenderableType,
+    )
+    from .text import Text
+
+from .cells import cell_len
+from .measure import Measurement
+
+T = TypeVar("T")
+
+
+class Renderables:
+    """A list subclass which renders its contents to the console."""
+
+    def __init__(
+        self, renderables: Optional[Iterable["RenderableType"]] = None
+    ) -> None:
+        self._renderables: List["RenderableType"] = (
+            list(renderables) if renderables is not None else []
+        )
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        """Console render method to insert line-breaks."""
+        yield from self._renderables
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        dimensions = [
+            Measurement.get(console, options, renderable)
+            for renderable in self._renderables
+        ]
+        if not dimensions:
+            return Measurement(1, 1)
+        _min = max(dimension.minimum for dimension in dimensions)
+        _max = max(dimension.maximum for dimension in dimensions)
+        return Measurement(_min, _max)
+
+    def append(self, renderable: "RenderableType") -> None:
+        self._renderables.append(renderable)
+
+    def __iter__(self) -> Iterable["RenderableType"]:
+        return iter(self._renderables)
+
+
+class Lines:
+    """A list subclass which can render to the console."""
+
+    def __init__(self, lines: Iterable["Text"] = ()) -> None:
+        self._lines: List["Text"] = list(lines)
+
+    def __repr__(self) -> str:
+        return f"Lines({self._lines!r})"
+
+    def __iter__(self) -> Iterator["Text"]:
+        return iter(self._lines)
+
+    @overload
+    def __getitem__(self, index: int) -> "Text":
+        ...
+
+    @overload
+    def __getitem__(self, index: slice) -> List["Text"]:
+        ...
+
+    def __getitem__(self, index: Union[slice, int]) -> Union["Text", List["Text"]]:
+        return self._lines[index]
+
+    def __setitem__(self, index: int, value: "Text") -> "Lines":
+        self._lines[index] = value
+        return self
+
+    def __len__(self) -> int:
+        return self._lines.__len__()
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        """Console render method to insert line-breaks."""
+        yield from self._lines
+
+    def append(self, line: "Text") -> None:
+        self._lines.append(line)
+
+    def extend(self, lines: Iterable["Text"]) -> None:
+        self._lines.extend(lines)
+
+    def pop(self, index: int = -1) -> "Text":
+        return self._lines.pop(index)
+
+    def justify(
+        self,
+        console: "Console",
+        width: int,
+        justify: "JustifyMethod" = "left",
+        overflow: "OverflowMethod" = "fold",
+    ) -> None:
+        """Justify and overflow text to a given width.
+
+        Args:
+            console (Console): Console instance.
+            width (int): Number of characters per line.
+            justify (str, optional): Default justify method for text: "left", "center", "full" or "right". Defaults to "left".
+            overflow (str, optional): Default overflow for text: "crop", "fold", or "ellipsis". Defaults to "fold".
+
+        """
+        from .text import Text
+
+        if justify == "left":
+            for line in self._lines:
+                line.truncate(width, overflow=overflow, pad=True)
+        elif justify == "center":
+            for line in self._lines:
+                line.rstrip()
+                line.truncate(width, overflow=overflow)
+                line.pad_left((width - cell_len(line.plain)) // 2)
+                line.pad_right(width - cell_len(line.plain))
+        elif justify == "right":
+            for line in self._lines:
+                line.rstrip()
+                line.truncate(width, overflow=overflow)
+                line.pad_left(width - cell_len(line.plain))
+        elif justify == "full":
+            for line_index, line in enumerate(self._lines):
+                if line_index == len(self._lines) - 1:
+                    break
+                words = line.split(" ")
+                words_size = sum(cell_len(word.plain) for word in words)
+                num_spaces = len(words) - 1
+                spaces = [1 for _ in range(num_spaces)]
+                index = 0
+                if spaces:
+                    while words_size + num_spaces < width:
+                        spaces[len(spaces) - index - 1] += 1
+                        num_spaces += 1
+                        index = (index + 1) % len(spaces)
+                tokens: List[Text] = []
+                for index, (word, next_word) in enumerate(
+                    zip_longest(words, words[1:])
+                ):
+                    tokens.append(word)
+                    if index < len(spaces):
+                        style = word.get_style_at_offset(console, -1)
+                        next_style = next_word.get_style_at_offset(console, 0)
+                        space_style = style if style == next_style else line.style
+                        tokens.append(Text(" " * spaces[index], style=space_style))
+                self[line_index] = Text("").join(tokens)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/control.py

@@ -0,0 +1,175 @@
+from typing import Any, Callable, Dict, Iterable, List, TYPE_CHECKING, Union
+
+from .segment import ControlCode, ControlType, Segment
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult
+
+STRIP_CONTROL_CODES = [
+    8,  # Backspace
+    11,  # Vertical tab
+    12,  # Form feed
+    13,  # Carriage return
+]
+_CONTROL_TRANSLATE = {_codepoint: None for _codepoint in STRIP_CONTROL_CODES}
+
+
+CONTROL_CODES_FORMAT: Dict[int, Callable[..., str]] = {
+    ControlType.BELL: lambda: "\x07",
+    ControlType.CARRIAGE_RETURN: lambda: "\r",
+    ControlType.HOME: lambda: "\x1b[H",
+    ControlType.CLEAR: lambda: "\x1b[2J",
+    ControlType.ENABLE_ALT_SCREEN: lambda: "\x1b[?1049h",
+    ControlType.DISABLE_ALT_SCREEN: lambda: "\x1b[?1049l",
+    ControlType.SHOW_CURSOR: lambda: "\x1b[?25h",
+    ControlType.HIDE_CURSOR: lambda: "\x1b[?25l",
+    ControlType.CURSOR_UP: lambda param: f"\x1b[{param}A",
+    ControlType.CURSOR_DOWN: lambda param: f"\x1b[{param}B",
+    ControlType.CURSOR_FORWARD: lambda param: f"\x1b[{param}C",
+    ControlType.CURSOR_BACKWARD: lambda param: f"\x1b[{param}D",
+    ControlType.CURSOR_MOVE_TO_COLUMN: lambda param: f"\x1b[{param+1}G",
+    ControlType.ERASE_IN_LINE: lambda param: f"\x1b[{param}K",
+    ControlType.CURSOR_MOVE_TO: lambda x, y: f"\x1b[{y+1};{x+1}H",
+}
+
+
+class Control:
+    """A renderable that inserts a control code (non printable but may move cursor).
+
+    Args:
+        *codes (str): Positional arguments are either a :class:`~rich.segment.ControlType` enum or a
+            tuple of ControlType and an integer parameter
+    """
+
+    __slots__ = ["segment"]
+
+    def __init__(self, *codes: Union[ControlType, ControlCode]) -> None:
+        control_codes: List[ControlCode] = [
+            (code,) if isinstance(code, ControlType) else code for code in codes
+        ]
+        _format_map = CONTROL_CODES_FORMAT
+        rendered_codes = "".join(
+            _format_map[code](*parameters) for code, *parameters in control_codes
+        )
+        self.segment = Segment(rendered_codes, None, control_codes)
+
+    @classmethod
+    def bell(cls) -> "Control":
+        """Ring the 'bell'."""
+        return cls(ControlType.BELL)
+
+    @classmethod
+    def home(cls) -> "Control":
+        """Move cursor to 'home' position."""
+        return cls(ControlType.HOME)
+
+    @classmethod
+    def move(cls, x: int = 0, y: int = 0) -> "Control":
+        """Move cursor relative to current position.
+
+        Args:
+            x (int): X offset.
+            y (int): Y offset.
+
+        Returns:
+            ~Control: Control object.
+
+        """
+
+        def get_codes() -> Iterable[ControlCode]:
+            control = ControlType
+            if x:
+                yield (
+                    control.CURSOR_FORWARD if x > 0 else control.CURSOR_BACKWARD,
+                    abs(x),
+                )
+            if y:
+                yield (
+                    control.CURSOR_DOWN if y > 0 else control.CURSOR_UP,
+                    abs(y),
+                )
+
+        control = cls(*get_codes())
+        return control
+
+    @classmethod
+    def move_to_column(cls, x: int, y: int = 0) -> "Control":
+        """Move to the given column, optionally add offset to row.
+
+        Returns:
+            x (int): absolute x (column)
+            y (int): optional y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+
+        return (
+            cls(
+                (ControlType.CURSOR_MOVE_TO_COLUMN, x),
+                (
+                    ControlType.CURSOR_DOWN if y > 0 else ControlType.CURSOR_UP,
+                    abs(y),
+                ),
+            )
+            if y
+            else cls((ControlType.CURSOR_MOVE_TO_COLUMN, x))
+        )
+
+    @classmethod
+    def move_to(cls, x: int, y: int) -> "Control":
+        """Move cursor to absolute position.
+
+        Args:
+            x (int): x offset (column)
+            y (int): y offset (row)
+
+        Returns:
+            ~Control: Control object.
+        """
+        return cls((ControlType.CURSOR_MOVE_TO, x, y))
+
+    @classmethod
+    def clear(cls) -> "Control":
+        """Clear the screen."""
+        return cls(ControlType.CLEAR)
+
+    @classmethod
+    def show_cursor(cls, show: bool) -> "Control":
+        """Show or hide the cursor."""
+        return cls(ControlType.SHOW_CURSOR if show else ControlType.HIDE_CURSOR)
+
+    @classmethod
+    def alt_screen(cls, enable: bool) -> "Control":
+        """Enable or disable alt screen."""
+        if enable:
+            return cls(ControlType.ENABLE_ALT_SCREEN, ControlType.HOME)
+        else:
+            return cls(ControlType.DISABLE_ALT_SCREEN)
+
+    def __str__(self) -> str:
+        return self.segment.text
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.segment.text:
+            yield self.segment
+
+
+def strip_control_codes(
+    text: str, _translate_table: Dict[int, None] = _CONTROL_TRANSLATE
+) -> str:
+    """Remove control codes from text.
+
+    Args:
+        text (str): A string possibly contain control codes.
+
+    Returns:
+        str: String with control codes removed.
+    """
+    return text.translate(_translate_table)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    print(strip_control_codes("hello\rWorld"))

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/default_styles.py

@@ -0,0 +1,183 @@
+from typing import Dict
+
+from .style import Style
+
+
+DEFAULT_STYLES: Dict[str, Style] = {
+    "none": Style.null(),
+    "reset": Style(
+        color="default",
+        bgcolor="default",
+        dim=False,
+        bold=False,
+        italic=False,
+        underline=False,
+        blink=False,
+        blink2=False,
+        reverse=False,
+        conceal=False,
+        strike=False,
+    ),
+    "dim": Style(dim=True),
+    "bright": Style(dim=False),
+    "bold": Style(bold=True),
+    "strong": Style(bold=True),
+    "code": Style(reverse=True, bold=True),
+    "italic": Style(italic=True),
+    "emphasize": Style(italic=True),
+    "underline": Style(underline=True),
+    "blink": Style(blink=True),
+    "blink2": Style(blink2=True),
+    "reverse": Style(reverse=True),
+    "strike": Style(strike=True),
+    "black": Style(color="black"),
+    "red": Style(color="red"),
+    "green": Style(color="green"),
+    "yellow": Style(color="yellow"),
+    "magenta": Style(color="magenta"),
+    "cyan": Style(color="cyan"),
+    "white": Style(color="white"),
+    "inspect.attr": Style(color="yellow", italic=True),
+    "inspect.attr.dunder": Style(color="yellow", italic=True, dim=True),
+    "inspect.callable": Style(bold=True, color="red"),
+    "inspect.def": Style(italic=True, color="bright_cyan"),
+    "inspect.error": Style(bold=True, color="red"),
+    "inspect.equals": Style(),
+    "inspect.help": Style(color="cyan"),
+    "inspect.doc": Style(dim=True),
+    "inspect.value.border": Style(color="green"),
+    "live.ellipsis": Style(bold=True, color="red"),
+    "layout.tree.row": Style(dim=False, color="red"),
+    "layout.tree.column": Style(dim=False, color="blue"),
+    "logging.keyword": Style(bold=True, color="yellow"),
+    "logging.level.notset": Style(dim=True),
+    "logging.level.debug": Style(color="green"),
+    "logging.level.info": Style(color="blue"),
+    "logging.level.warning": Style(color="red"),
+    "logging.level.error": Style(color="red", bold=True),
+    "logging.level.critical": Style(color="red", bold=True, reverse=True),
+    "log.level": Style.null(),
+    "log.time": Style(color="cyan", dim=True),
+    "log.message": Style.null(),
+    "log.path": Style(dim=True),
+    "repr.ellipsis": Style(color="yellow"),
+    "repr.indent": Style(color="green", dim=True),
+    "repr.error": Style(color="red", bold=True),
+    "repr.str": Style(color="green", italic=False, bold=False),
+    "repr.brace": Style(bold=True),
+    "repr.comma": Style(bold=True),
+    "repr.ipv4": Style(bold=True, color="bright_green"),
+    "repr.ipv6": Style(bold=True, color="bright_green"),
+    "repr.eui48": Style(bold=True, color="bright_green"),
+    "repr.eui64": Style(bold=True, color="bright_green"),
+    "repr.tag_start": Style(bold=True),
+    "repr.tag_name": Style(color="bright_magenta", bold=True),
+    "repr.tag_contents": Style(color="default"),
+    "repr.tag_end": Style(bold=True),
+    "repr.attrib_name": Style(color="yellow", italic=False),
+    "repr.attrib_equal": Style(bold=True),
+    "repr.attrib_value": Style(color="magenta", italic=False),
+    "repr.number": Style(color="cyan", bold=True, italic=False),
+    "repr.bool_true": Style(color="bright_green", italic=True),
+    "repr.bool_false": Style(color="bright_red", italic=True),
+    "repr.none": Style(color="magenta", italic=True),
+    "repr.url": Style(underline=True, color="bright_blue", italic=False, bold=False),
+    "repr.uuid": Style(color="bright_yellow", bold=False),
+    "repr.call": Style(color="magenta", bold=True),
+    "repr.path": Style(color="magenta"),
+    "repr.filename": Style(color="bright_magenta"),
+    "rule.line": Style(color="bright_green"),
+    "rule.text": Style.null(),
+    "json.brace": Style(bold=True),
+    "json.bool_true": Style(color="bright_green", italic=True),
+    "json.bool_false": Style(color="bright_red", italic=True),
+    "json.null": Style(color="magenta", italic=True),
+    "json.number": Style(color="cyan", bold=True, italic=False),
+    "json.str": Style(color="green", italic=False, bold=False),
+    "json.key": Style(color="blue", bold=True),
+    "prompt": Style.null(),
+    "prompt.choices": Style(color="magenta", bold=True),
+    "prompt.default": Style(color="cyan", bold=True),
+    "prompt.invalid": Style(color="red"),
+    "prompt.invalid.choice": Style(color="red"),
+    "pretty": Style.null(),
+    "scope.border": Style(color="blue"),
+    "scope.key": Style(color="yellow", italic=True),
+    "scope.key.special": Style(color="yellow", italic=True, dim=True),
+    "scope.equals": Style(color="red"),
+    "table.header": Style(bold=True),
+    "table.footer": Style(bold=True),
+    "table.cell": Style.null(),
+    "table.title": Style(italic=True),
+    "table.caption": Style(italic=True, dim=True),
+    "traceback.error": Style(color="red", italic=True),
+    "traceback.border.syntax_error": Style(color="bright_red"),
+    "traceback.border": Style(color="red"),
+    "traceback.text": Style.null(),
+    "traceback.title": Style(color="red", bold=True),
+    "traceback.exc_type": Style(color="bright_red", bold=True),
+    "traceback.exc_value": Style.null(),
+    "traceback.offset": Style(color="bright_red", bold=True),
+    "bar.back": Style(color="grey23"),
+    "bar.complete": Style(color="rgb(249,38,114)"),
+    "bar.finished": Style(color="rgb(114,156,31)"),
+    "bar.pulse": Style(color="rgb(249,38,114)"),
+    "progress.description": Style.null(),
+    "progress.filesize": Style(color="green"),
+    "progress.filesize.total": Style(color="green"),
+    "progress.download": Style(color="green"),
+    "progress.elapsed": Style(color="yellow"),
+    "progress.percentage": Style(color="magenta"),
+    "progress.remaining": Style(color="cyan"),
+    "progress.data.speed": Style(color="red"),
+    "progress.spinner": Style(color="green"),
+    "status.spinner": Style(color="green"),
+    "tree": Style(),
+    "tree.line": Style(),
+    "markdown.paragraph": Style(),
+    "markdown.text": Style(),
+    "markdown.emph": Style(italic=True),
+    "markdown.strong": Style(bold=True),
+    "markdown.code": Style(bgcolor="black", color="bright_white"),
+    "markdown.code_block": Style(dim=True, color="cyan", bgcolor="black"),
+    "markdown.block_quote": Style(color="magenta"),
+    "markdown.list": Style(color="cyan"),
+    "markdown.item": Style(),
+    "markdown.item.bullet": Style(color="yellow", bold=True),
+    "markdown.item.number": Style(color="yellow", bold=True),
+    "markdown.hr": Style(color="yellow"),
+    "markdown.h1.border": Style(),
+    "markdown.h1": Style(bold=True),
+    "markdown.h2": Style(bold=True, underline=True),
+    "markdown.h3": Style(bold=True),
+    "markdown.h4": Style(bold=True, dim=True),
+    "markdown.h5": Style(underline=True),
+    "markdown.h6": Style(italic=True),
+    "markdown.h7": Style(italic=True, dim=True),
+    "markdown.link": Style(color="bright_blue"),
+    "markdown.link_url": Style(color="blue"),
+}
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import argparse
+    import io
+
+    from pip._vendor.rich.console import Console
+    from pip._vendor.rich.table import Table
+    from pip._vendor.rich.text import Text
+
+    parser = argparse.ArgumentParser()
+    parser.add_argument("--html", action="store_true", help="Export as HTML table")
+    args = parser.parse_args()
+    html: bool = args.html
+    console = Console(record=True, width=70, file=io.StringIO()) if html else Console()
+
+    table = Table("Name", "Styling")
+
+    for style_name, style in DEFAULT_STYLES.items():
+        table.add_row(Text(style_name, style=style), str(style))
+
+    console.print(table)
+    if html:
+        print(console.export_html(inline_styles=True))

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/errors.py

@@ -0,0 +1,34 @@
+class ConsoleError(Exception):
+    """An error in console operation."""
+
+
+class StyleError(Exception):
+    """An error in styles."""
+
+
+class StyleSyntaxError(ConsoleError):
+    """Style was badly formatted."""
+
+
+class MissingStyle(StyleError):
+    """No such style."""
+
+
+class StyleStackError(ConsoleError):
+    """Style stack is invalid."""
+
+
+class NotRenderableError(ConsoleError):
+    """Object is not renderable."""
+
+
+class MarkupError(ConsoleError):
+    """Markup was badly formatted."""
+
+
+class LiveError(ConsoleError):
+    """Error related to Live display."""
+
+
+class NoAltScreen(ConsoleError):
+    """Alt screen mode was required."""

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/file_proxy.py

@@ -0,0 +1,54 @@
+import io
+from typing import List, Any, IO, TYPE_CHECKING
+
+from .ansi import AnsiDecoder
+from .text import Text
+
+if TYPE_CHECKING:
+    from .console import Console
+
+
+class FileProxy(io.TextIOBase):
+    """Wraps a file (e.g. sys.stdout) and redirects writes to a console."""
+
+    def __init__(self, console: "Console", file: IO[str]) -> None:
+        self.__console = console
+        self.__file = file
+        self.__buffer: List[str] = []
+        self.__ansi_decoder = AnsiDecoder()
+
+    @property
+    def rich_proxied_file(self) -> IO[str]:
+        """Get proxied file."""
+        return self.__file
+
+    def __getattr__(self, name: str) -> Any:
+        return getattr(self.__file, name)
+
+    def write(self, text: str) -> int:
+        if not isinstance(text, str):
+            raise TypeError(f"write() argument must be str, not {type(text).__name__}")
+        buffer = self.__buffer
+        lines: List[str] = []
+        while text:
+            line, new_line, text = text.partition("\n")
+            if new_line:
+                lines.append("".join(buffer) + line)
+                del buffer[:]
+            else:
+                buffer.append(line)
+                break
+        if lines:
+            console = self.__console
+            with console:
+                output = Text("\n").join(
+                    self.__ansi_decoder.decode_line(line) for line in lines
+                )
+                console.print(output)
+        return len(text)
+
+    def flush(self) -> None:
+        buffer = self.__buffer
+        if buffer:
+            self.__console.print("".join(buffer))
+            del buffer[:]

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/filesize.py

@@ -0,0 +1,89 @@
+# coding: utf-8
+"""Functions for reporting filesizes. Borrowed from https://github.com/PyFilesystem/pyfilesystem2
+
+The functions declared in this module should cover the different
+usecases needed to generate a string representation of a file size
+using several different units. Since there are many standards regarding
+file size units, three different functions have been implemented.
+
+See Also:
+    * `Wikipedia: Binary prefix <https://en.wikipedia.org/wiki/Binary_prefix>`_
+
+"""
+
+__all__ = ["decimal"]
+
+from typing import Iterable, List, Tuple, Optional
+
+
+def _to_str(
+    size: int,
+    suffixes: Iterable[str],
+    base: int,
+    *,
+    precision: Optional[int] = 1,
+    separator: Optional[str] = " ",
+) -> str:
+    if size == 1:
+        return "1 byte"
+    elif size < base:
+        return "{:,} bytes".format(size)
+
+    for i, suffix in enumerate(suffixes, 2):  # noqa: B007
+        unit = base ** i
+        if size < unit:
+            break
+    return "{:,.{precision}f}{separator}{}".format(
+        (base * size / unit),
+        suffix,
+        precision=precision,
+        separator=separator,
+    )
+
+
+def pick_unit_and_suffix(size: int, suffixes: List[str], base: int) -> Tuple[int, str]:
+    """Pick a suffix and base for the given size."""
+    for i, suffix in enumerate(suffixes):
+        unit = base ** i
+        if size < unit * base:
+            break
+    return unit, suffix
+
+
+def decimal(
+    size: int,
+    *,
+    precision: Optional[int] = 1,
+    separator: Optional[str] = " ",
+) -> str:
+    """Convert a filesize in to a string (powers of 1000, SI prefixes).
+
+    In this convention, ``1000 B = 1 kB``.
+
+    This is typically the format used to advertise the storage
+    capacity of USB flash drives and the like (*256 MB* meaning
+    actually a storage capacity of more than *256 000 000 B*),
+    or used by **Mac OS X** since v10.6 to report file sizes.
+
+    Arguments:
+        int (size): A file size.
+        int (precision): The number of decimal places to include (default = 1).
+        str (separator): The string to separate the value from the units (default = " ").
+
+    Returns:
+        `str`: A string containing a abbreviated file size and units.
+
+    Example:
+        >>> filesize.decimal(30000)
+        '30.0 kB'
+        >>> filesize.decimal(30000, precision=2, separator="")
+        '30.00kB'
+
+    """
+    return _to_str(
+        size,
+        ("kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"),
+        1000,
+        precision=precision,
+        separator=separator,
+    )

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py

@@ -0,0 +1,147 @@
+from abc import ABC, abstractmethod
+from typing import List, Union
+
+from .text import Text
+
+
+def _combine_regex(*regexes: str) -> str:
+    """Combine a number of regexes in to a single regex.
+
+    Returns:
+        str: New regex with all regexes ORed together.
+    """
+    return "|".join(regexes)
+
+
+class Highlighter(ABC):
+    """Abstract base class for highlighters."""
+
+    def __call__(self, text: Union[str, Text]) -> Text:
+        """Highlight a str or Text instance.
+
+        Args:
+            text (Union[str, ~Text]): Text to highlight.
+
+        Raises:
+            TypeError: If not called with text or str.
+
+        Returns:
+            Text: A test instance with highlighting applied.
+        """
+        if isinstance(text, str):
+            highlight_text = Text(text)
+        elif isinstance(text, Text):
+            highlight_text = text.copy()
+        else:
+            raise TypeError(f"str or Text instance required, not {text!r}")
+        self.highlight(highlight_text)
+        return highlight_text
+
+    @abstractmethod
+    def highlight(self, text: Text) -> None:
+        """Apply highlighting in place to text.
+
+        Args:
+            text (~Text): A text object highlight.
+        """
+
+
+class NullHighlighter(Highlighter):
+    """A highlighter object that doesn't highlight.
+
+    May be used to disable highlighting entirely.
+
+    """
+
+    def highlight(self, text: Text) -> None:
+        """Nothing to do"""
+
+
+class RegexHighlighter(Highlighter):
+    """Applies highlighting from a list of regular expressions."""
+
+    highlights: List[str] = []
+    base_style: str = ""
+
+    def highlight(self, text: Text) -> None:
+        """Highlight :class:`rich.text.Text` using regular expressions.
+
+        Args:
+            text (~Text): Text to highlighted.
+
+        """
+
+        highlight_regex = text.highlight_regex
+        for re_highlight in self.highlights:
+            highlight_regex(re_highlight, style_prefix=self.base_style)
+
+
+class ReprHighlighter(RegexHighlighter):
+    """Highlights the text typically produced from ``__repr__`` methods."""
+
+    base_style = "repr."
+    highlights = [
+        r"(?P<tag_start>\<)(?P<tag_name>[\w\-\.\:]*)(?P<tag_contents>[\w\W]*?)(?P<tag_end>\>)",
+        r"(?P<attrib_name>[\w_]{1,50})=(?P<attrib_value>\"?[\w_]+\"?)?",
+        r"(?P<brace>[\{\[\(\)\]\}])",
+        _combine_regex(
+            r"(?P<ipv4>[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})",
+            r"(?P<ipv6>([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})",
+            r"(?P<eui64>(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})",
+            r"(?P<eui48>(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})",
+            r"(?P<call>[\w\.]*?)\(",
+            r"\b(?P<bool_true>True)\b|\b(?P<bool_false>False)\b|\b(?P<none>None)\b",
+            r"(?P<ellipsis>\.\.\.)",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            r"(?P<path>\B(\/[\w\.\-\_\+]+)*\/)(?P<filename>[\w\.\-\_\+]*)?",
+            r"(?<![\\\w])(?P<str>b?\'\'\'.*?(?<!\\)\'\'\'|b?\'.*?(?<!\\)\'|b?\"\"\".*?(?<!\\)\"\"\"|b?\".*?(?<!\\)\")",
+            r"(?P<uuid>[a-fA-F0-9]{8}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{12})",
+            r"(?P<url>(file|https|http|ws|wss):\/\/[0-9a-zA-Z\$\-\_\+\!`\(\)\,\.\?\/\;\:\&\=\%\#]*)",
+        ),
+    ]
+
+
+class JSONHighlighter(RegexHighlighter):
+    """Highlights JSON"""
+
+    base_style = "json."
+    highlights = [
+        _combine_regex(
+            r"(?P<brace>[\{\[\(\)\]\}])",
+            r"\b(?P<bool_true>true)\b|\b(?P<bool_false>false)\b|\b(?P<null>null)\b",
+            r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)",
+            r"(?<![\\\w])(?P<str>b?\".*?(?<!\\)\")",
+        ),
+        r"(?<![\\\w])(?P<key>b?\".*?(?<!\\)\")\:",
+    ]
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    console = Console()
+    console.print("[bold green]hello world![/bold green]")
+    console.print("'[bold green]hello world![/bold green]'")
+
+    console.print(" /foo")
+    console.print("/foo/")
+    console.print("/foo/bar")
+    console.print("foo/bar/baz")
+
+    console.print("/foo/bar/baz?foo=bar+egg&egg=baz")
+    console.print("/foo/bar/baz/")
+    console.print("/foo/bar/baz/egg")
+    console.print("/foo/bar/baz/egg.py")
+    console.print("/foo/bar/baz/egg.py word")
+    console.print(" /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/baz/egg.py word")
+    console.print("foo /foo/bar/ba._++z/egg+.py word")
+    console.print("https://example.org?foo=bar#header")
+
+    console.print(1234567.34)
+    console.print(1 / 2)
+    console.print(-1 / 123123123123)
+
+    console.print(
+        "127.0.1.1 bar 192.168.1.4 2001:0db8:85a3:0000:0000:8a2e:0370:7334 foo"
+    )

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/json.py

@@ -0,0 +1,140 @@
+from json import loads, dumps
+from typing import Any, Callable, Optional, Union
+
+from .text import Text
+from .highlighter import JSONHighlighter, NullHighlighter
+
+
+class JSON:
+    """A renderable which pretty prints JSON.
+
+    Args:
+        json (str): JSON encoded data.
+        indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2.
+        highlight (bool, optional): Enable highlighting. Defaults to True.
+        skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+        ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+        check_circular (bool, optional): Check for circular references. Defaults to True.
+        allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+        default (Callable, optional): A callable that converts values that can not be encoded
+            in to something that can be JSON encoded. Defaults to None.
+        sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+    """
+
+    def __init__(
+        self,
+        json: str,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = True,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> None:
+        data = loads(json)
+        json = dumps(
+            data,
+            indent=indent,
+            skipkeys=skip_keys,
+            ensure_ascii=ensure_ascii,
+            check_circular=check_circular,
+            allow_nan=allow_nan,
+            default=default,
+            sort_keys=sort_keys,
+        )
+        highlighter = JSONHighlighter() if highlight else NullHighlighter()
+        self.text = highlighter(json)
+        self.text.no_wrap = True
+        self.text.overflow = None
+
+    @classmethod
+    def from_data(
+        cls,
+        data: Any,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = True,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> "JSON":
+        """Encodes a JSON object from arbitrary data.
+
+        Args:
+            data (Any): An object that may be encoded in to JSON
+            indent (Union[None, int, str], optional): Number of characters to indent by. Defaults to 2.
+            highlight (bool, optional): Enable highlighting. Defaults to True.
+            default (Callable, optional): Optional callable which will be called for objects that cannot be serialized. Defaults to None.
+            skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+            ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+            check_circular (bool, optional): Check for circular references. Defaults to True.
+            allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+            default (Callable, optional): A callable that converts values that can not be encoded
+                in to something that can be JSON encoded. Defaults to None.
+            sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+
+        Returns:
+            JSON: New JSON object from the given data.
+        """
+        json_instance: "JSON" = cls.__new__(cls)
+        json = dumps(
+            data,
+            indent=indent,
+            skipkeys=skip_keys,
+            ensure_ascii=ensure_ascii,
+            check_circular=check_circular,
+            allow_nan=allow_nan,
+            default=default,
+            sort_keys=sort_keys,
+        )
+        highlighter = JSONHighlighter() if highlight else NullHighlighter()
+        json_instance.text = highlighter(json)
+        json_instance.text.no_wrap = True
+        json_instance.text.overflow = None
+        return json_instance
+
+    def __rich__(self) -> Text:
+        return self.text
+
+
+if __name__ == "__main__":
+
+    import argparse
+    import sys
+
+    parser = argparse.ArgumentParser(description="Pretty print json")
+    parser.add_argument(
+        "path",
+        metavar="PATH",
+        help="path to file, or - for stdin",
+    )
+    parser.add_argument(
+        "-i",
+        "--indent",
+        metavar="SPACES",
+        type=int,
+        help="Number of spaces in an indent",
+        default=2,
+    )
+    args = parser.parse_args()
+
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+    error_console = Console(stderr=True)
+
+    try:
+        if args.path == "-":
+            json_data = sys.stdin.read()
+        else:
+            with open(args.path, "rt") as json_file:
+                json_data = json_file.read()
+    except Exception as error:
+        error_console.print(f"Unable to read {args.path!r}; {error}")
+        sys.exit(-1)
+
+    console.print(JSON(json_data, indent=args.indent), soft_wrap=True)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/jupyter.py

@@ -0,0 +1,92 @@
+from typing import Any, Dict, Iterable, List
+
+from . import get_console
+from .segment import Segment
+from .terminal_theme import DEFAULT_TERMINAL_THEME
+
+JUPYTER_HTML_FORMAT = """\
+<pre style="white-space:pre;overflow-x:auto;line-height:normal;font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre>
+"""
+
+
+class JupyterRenderable:
+    """A shim to write html to Jupyter notebook."""
+
+    def __init__(self, html: str, text: str) -> None:
+        self.html = html
+        self.text = text
+
+    def _repr_mimebundle_(
+        self, include: Iterable[str], exclude: Iterable[str], **kwargs: Any
+    ) -> Dict[str, str]:
+        data = {"text/plain": self.text, "text/html": self.html}
+        if include:
+            data = {k: v for (k, v) in data.items() if k in include}
+        if exclude:
+            data = {k: v for (k, v) in data.items() if k not in exclude}
+        return data
+
+
+class JupyterMixin:
+    """Add to an Rich renderable to make it render in Jupyter notebook."""
+
+    __slots__ = ()
+
+    def _repr_mimebundle_(
+        self, include: Iterable[str], exclude: Iterable[str], **kwargs: Any
+    ) -> Dict[str, str]:
+        console = get_console()
+        segments = list(console.render(self, console.options))  # type: ignore
+        html = _render_segments(segments)
+        text = console._render_buffer(segments)
+        data = {"text/plain": text, "text/html": html}
+        if include:
+            data = {k: v for (k, v) in data.items() if k in include}
+        if exclude:
+            data = {k: v for (k, v) in data.items() if k not in exclude}
+        return data
+
+
+def _render_segments(segments: Iterable[Segment]) -> str:
+    def escape(text: str) -> str:
+        """Escape html."""
+        return text.replace("&", "&amp;").replace("<", "&lt;").replace(">", "&gt;")
+
+    fragments: List[str] = []
+    append_fragment = fragments.append
+    theme = DEFAULT_TERMINAL_THEME
+    for text, style, control in Segment.simplify(segments):
+        if control:
+            continue
+        text = escape(text)
+        if style:
+            rule = style.get_html_style(theme)
+            text = f'<span style="{rule}">{text}</span>' if rule else text
+            if style.link:
+                text = f'<a href="{style.link}">{text}</a>'
+        append_fragment(text)
+
+    code = "".join(fragments)
+    html = JUPYTER_HTML_FORMAT.format(code=code)
+
+    return html
+
+
+def display(segments: Iterable[Segment], text: str) -> None:
+    """Render segments to Jupyter."""
+    html = _render_segments(segments)
+    jupyter_renderable = JupyterRenderable(html, text)
+    try:
+        from IPython.display import display as ipython_display
+
+        ipython_display(jupyter_renderable)
+    except ModuleNotFoundError:
+        # Handle the case where the Console has force_jupyter=True,
+        # but IPython is not installed.
+        pass
+
+
+def print(*args: Any, **kwargs: Any) -> None:
+    """Proxy for Console print."""
+    console = get_console()
+    return console.print(*args, **kwargs)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/layout.py

@@ -0,0 +1,444 @@
+from abc import ABC, abstractmethod
+from itertools import islice
+from operator import itemgetter
+from threading import RLock
+from typing import (
+    TYPE_CHECKING,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Tuple,
+    Union,
+)
+
+from ._ratio import ratio_resolve
+from .align import Align
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .highlighter import ReprHighlighter
+from .panel import Panel
+from .pretty import Pretty
+from .repr import rich_repr, Result
+from .region import Region
+from .segment import Segment
+from .style import StyleType
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.tree import Tree
+
+
+class LayoutRender(NamedTuple):
+    """An individual layout render."""
+
+    region: Region
+    render: List[List[Segment]]
+
+
+RegionMap = Dict["Layout", Region]
+RenderMap = Dict["Layout", LayoutRender]
+
+
+class LayoutError(Exception):
+    """Layout related error."""
+
+
+class NoSplitter(LayoutError):
+    """Requested splitter does not exist."""
+
+
+class _Placeholder:
+    """An internal renderable used as a Layout placeholder."""
+
+    highlighter = ReprHighlighter()
+
+    def __init__(self, layout: "Layout", style: StyleType = "") -> None:
+        self.layout = layout
+        self.style = style
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        width = options.max_width
+        height = options.height or options.size.height
+        layout = self.layout
+        title = (
+            f"{layout.name!r} ({width} x {height})"
+            if layout.name
+            else f"({width} x {height})"
+        )
+        yield Panel(
+            Align.center(Pretty(layout), vertical="middle"),
+            style=self.style,
+            title=self.highlighter(title),
+            border_style="blue",
+        )
+
+
+class Splitter(ABC):
+    """Base class for a splitter."""
+
+    name: str = ""
+
+    @abstractmethod
+    def get_tree_icon(self) -> str:
+        """Get the icon (emoji) used in layout.tree"""
+
+    @abstractmethod
+    def divide(
+        self, children: Sequence["Layout"], region: Region
+    ) -> Iterable[Tuple["Layout", Region]]:
+        """Divide a region amongst several child layouts.
+
+        Args:
+            children (Sequence(Layout)): A number of child layouts.
+            region (Region): A rectangular region to divide.
+        """
+
+
+class RowSplitter(Splitter):
+    """Split a layout region in to rows."""
+
+    name = "row"
+
+    def get_tree_icon(self) -> str:
+        return "[layout.tree.row]⬌"
+
+    def divide(
+        self, children: Sequence["Layout"], region: Region
+    ) -> Iterable[Tuple["Layout", Region]]:
+        x, y, width, height = region
+        render_widths = ratio_resolve(width, children)
+        offset = 0
+        _Region = Region
+        for child, child_width in zip(children, render_widths):
+            yield child, _Region(x + offset, y, child_width, height)
+            offset += child_width
+
+
+class ColumnSplitter(Splitter):
+    """Split a layout region in to columns."""
+
+    name = "column"
+
+    def get_tree_icon(self) -> str:
+        return "[layout.tree.column]⬍"
+
+    def divide(
+        self, children: Sequence["Layout"], region: Region
+    ) -> Iterable[Tuple["Layout", Region]]:
+        x, y, width, height = region
+        render_heights = ratio_resolve(height, children)
+        offset = 0
+        _Region = Region
+        for child, child_height in zip(children, render_heights):
+            yield child, _Region(x, y + offset, width, child_height)
+            offset += child_height
+
+
+@rich_repr
+class Layout:
+    """A renderable to divide a fixed height in to rows or columns.
+
+    Args:
+        renderable (RenderableType, optional): Renderable content, or None for placeholder. Defaults to None.
+        name (str, optional): Optional identifier for Layout. Defaults to None.
+        size (int, optional): Optional fixed size of layout. Defaults to None.
+        minimum_size (int, optional): Minimum size of layout. Defaults to 1.
+        ratio (int, optional): Optional ratio for flexible layout. Defaults to 1.
+        visible (bool, optional): Visibility of layout. Defaults to True.
+    """
+
+    splitters = {"row": RowSplitter, "column": ColumnSplitter}
+
+    def __init__(
+        self,
+        renderable: Optional[RenderableType] = None,
+        *,
+        name: Optional[str] = None,
+        size: Optional[int] = None,
+        minimum_size: int = 1,
+        ratio: int = 1,
+        visible: bool = True,
+        height: Optional[int] = None,
+    ) -> None:
+        self._renderable = renderable or _Placeholder(self)
+        self.size = size
+        self.minimum_size = minimum_size
+        self.ratio = ratio
+        self.name = name
+        self.visible = visible
+        self.height = height
+        self.splitter: Splitter = self.splitters["column"]()
+        self._children: List[Layout] = []
+        self._render_map: RenderMap = {}
+        self._lock = RLock()
+
+    def __rich_repr__(self) -> Result:
+        yield "name", self.name, None
+        yield "size", self.size, None
+        yield "minimum_size", self.minimum_size, 1
+        yield "ratio", self.ratio, 1
+
+    @property
+    def renderable(self) -> RenderableType:
+        """Layout renderable."""
+        return self if self._children else self._renderable
+
+    @property
+    def children(self) -> List["Layout"]:
+        """Gets (visible) layout children."""
+        return [child for child in self._children if child.visible]
+
+    @property
+    def map(self) -> RenderMap:
+        """Get a map of the last render."""
+        return self._render_map
+
+    def get(self, name: str) -> Optional["Layout"]:
+        """Get a named layout, or None if it doesn't exist.
+
+        Args:
+            name (str): Name of layout.
+
+        Returns:
+            Optional[Layout]: Layout instance or None if no layout was found.
+        """
+        if self.name == name:
+            return self
+        else:
+            for child in self._children:
+                named_layout = child.get(name)
+                if named_layout is not None:
+                    return named_layout
+        return None
+
+    def __getitem__(self, name: str) -> "Layout":
+        layout = self.get(name)
+        if layout is None:
+            raise KeyError(f"No layout with name {name!r}")
+        return layout
+
+    @property
+    def tree(self) -> "Tree":
+        """Get a tree renderable to show layout structure."""
+        from pip._vendor.rich.styled import Styled
+        from pip._vendor.rich.table import Table
+        from pip._vendor.rich.tree import Tree
+
+        def summary(layout: "Layout") -> Table:
+
+            icon = layout.splitter.get_tree_icon()
+
+            table = Table.grid(padding=(0, 1, 0, 0))
+
+            text: RenderableType = (
+                Pretty(layout) if layout.visible else Styled(Pretty(layout), "dim")
+            )
+            table.add_row(icon, text)
+            _summary = table
+            return _summary
+
+        layout = self
+        tree = Tree(
+            summary(layout),
+            guide_style=f"layout.tree.{layout.splitter.name}",
+            highlight=True,
+        )
+
+        def recurse(tree: "Tree", layout: "Layout") -> None:
+            for child in layout._children:
+                recurse(
+                    tree.add(
+                        summary(child),
+                        guide_style=f"layout.tree.{child.splitter.name}",
+                    ),
+                    child,
+                )
+
+        recurse(tree, self)
+        return tree
+
+    def split(
+        self,
+        *layouts: Union["Layout", RenderableType],
+        splitter: Union[Splitter, str] = "column",
+    ) -> None:
+        """Split the layout in to multiple sub-layouts.
+
+        Args:
+            *layouts (Layout): Positional arguments should be (sub) Layout instances.
+            splitter (Union[Splitter, str]): Splitter instance or name of splitter.
+        """
+        _layouts = [
+            layout if isinstance(layout, Layout) else Layout(layout)
+            for layout in layouts
+        ]
+        try:
+            self.splitter = (
+                splitter
+                if isinstance(splitter, Splitter)
+                else self.splitters[splitter]()
+            )
+        except KeyError:
+            raise NoSplitter(f"No splitter called {splitter!r}")
+        self._children[:] = _layouts
+
+    def add_split(self, *layouts: Union["Layout", RenderableType]) -> None:
+        """Add a new layout(s) to existing split.
+
+        Args:
+            *layouts (Union[Layout, RenderableType]): Positional arguments should be renderables or (sub) Layout instances.
+
+        """
+        _layouts = (
+            layout if isinstance(layout, Layout) else Layout(layout)
+            for layout in layouts
+        )
+        self._children.extend(_layouts)
+
+    def split_row(self, *layouts: Union["Layout", RenderableType]) -> None:
+        """Split the layout in tow a row (Layouts side by side).
+
+        Args:
+            *layouts (Layout): Positional arguments should be (sub) Layout instances.
+        """
+        self.split(*layouts, splitter="row")
+
+    def split_column(self, *layouts: Union["Layout", RenderableType]) -> None:
+        """Split the layout in to a column (layouts stacked on top of each other).
+
+        Args:
+            *layouts (Layout): Positional arguments should be (sub) Layout instances.
+        """
+        self.split(*layouts, splitter="column")
+
+    def unsplit(self) -> None:
+        """Reset splits to initial state."""
+        del self._children[:]
+
+    def update(self, renderable: RenderableType) -> None:
+        """Update renderable.
+
+        Args:
+            renderable (RenderableType): New renderable object.
+        """
+        with self._lock:
+            self._renderable = renderable
+
+    def refresh_screen(self, console: "Console", layout_name: str) -> None:
+        """Refresh a sub-layout.
+
+        Args:
+            console (Console): Console instance where Layout is to be rendered.
+            layout_name (str): Name of layout.
+        """
+        with self._lock:
+            layout = self[layout_name]
+            region, _lines = self._render_map[layout]
+            (x, y, width, height) = region
+            lines = console.render_lines(
+                layout, console.options.update_dimensions(width, height)
+            )
+            self._render_map[layout] = LayoutRender(region, lines)
+            console.update_screen_lines(lines, x, y)
+
+    def _make_region_map(self, width: int, height: int) -> RegionMap:
+        """Create a dict that maps layout on to Region."""
+        stack: List[Tuple[Layout, Region]] = [(self, Region(0, 0, width, height))]
+        push = stack.append
+        pop = stack.pop
+        layout_regions: List[Tuple[Layout, Region]] = []
+        append_layout_region = layout_regions.append
+        while stack:
+            append_layout_region(pop())
+            layout, region = layout_regions[-1]
+            children = layout.children
+            if children:
+                for child_and_region in layout.splitter.divide(children, region):
+                    push(child_and_region)
+
+        region_map = {
+            layout: region
+            for layout, region in sorted(layout_regions, key=itemgetter(1))
+        }
+        return region_map
+
+    def render(self, console: Console, options: ConsoleOptions) -> RenderMap:
+        """Render the sub_layouts.
+
+        Args:
+            console (Console): Console instance.
+            options (ConsoleOptions): Console options.
+
+        Returns:
+            RenderMap: A dict that maps Layout on to a tuple of Region, lines
+        """
+        render_width = options.max_width
+        render_height = options.height or console.height
+        region_map = self._make_region_map(render_width, render_height)
+        layout_regions = [
+            (layout, region)
+            for layout, region in region_map.items()
+            if not layout.children
+        ]
+        render_map: Dict["Layout", "LayoutRender"] = {}
+        render_lines = console.render_lines
+        update_dimensions = options.update_dimensions
+
+        for layout, region in layout_regions:
+            lines = render_lines(
+                layout.renderable, update_dimensions(region.width, region.height)
+            )
+            render_map[layout] = LayoutRender(region, lines)
+        return render_map
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        with self._lock:
+            width = options.max_width or console.width
+            height = options.height or console.height
+            render_map = self.render(console, options.update_dimensions(width, height))
+            self._render_map = render_map
+            layout_lines: List[List[Segment]] = [[] for _ in range(height)]
+            _islice = islice
+            for (region, lines) in render_map.values():
+                _x, y, _layout_width, layout_height = region
+                for row, line in zip(
+                    _islice(layout_lines, y, y + layout_height), lines
+                ):
+                    row.extend(line)
+
+            new_line = Segment.line()
+            for layout_row in layout_lines:
+                yield from layout_row
+                yield new_line
+
+
+if __name__ == "__main__":
+    from pip._vendor.rich.console import Console
+
+    console = Console()
+    layout = Layout()
+
+    layout.split_column(
+        Layout(name="header", size=3),
+        Layout(ratio=1, name="main"),
+        Layout(size=10, name="footer"),
+    )
+
+    layout["main"].split_row(Layout(name="side"), Layout(name="body", ratio=2))
+
+    layout["body"].split_row(Layout(name="content", ratio=2), Layout(name="s2"))
+
+    layout["s2"].split_column(
+        Layout(name="top"), Layout(name="middle"), Layout(name="bottom")
+    )
+
+    layout["side"].split_column(Layout(layout.tree, name="left1"), Layout(name="left2"))
+
+    layout["content"].update("foo")
+
+    console.print(layout)

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/live_render.py

@@ -0,0 +1,113 @@
+import sys
+from typing import Optional, Tuple
+
+if sys.version_info >= (3, 8):
+    from typing import Literal
+else:
+    from pip._vendor.typing_extensions import Literal  # pragma: no cover
+
+
+from ._loop import loop_last
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .control import Control
+from .segment import ControlType, Segment
+from .style import StyleType
+from .text import Text
+
+VerticalOverflowMethod = Literal["crop", "ellipsis", "visible"]
+
+
+class LiveRender:
+    """Creates a renderable that may be updated.
+
+    Args:
+        renderable (RenderableType): Any renderable object.
+        style (StyleType, optional): An optional style to apply to the renderable. Defaults to "".
+    """
+
+    def __init__(
+        self,
+        renderable: RenderableType,
+        style: StyleType = "",
+        vertical_overflow: VerticalOverflowMethod = "ellipsis",
+    ) -> None:
+        self.renderable = renderable
+        self.style = style
+        self.vertical_overflow = vertical_overflow
+        self._shape: Optional[Tuple[int, int]] = None
+
+    def set_renderable(self, renderable: RenderableType) -> None:
+        """Set a new renderable.
+
+        Args:
+            renderable (RenderableType): Any renderable object, including str.
+        """
+        self.renderable = renderable
+
+    def position_cursor(self) -> Control:
+        """Get control codes to move cursor to beginning of live render.
+
+        Returns:
+            Control: A control instance that may be printed.
+        """
+        if self._shape is not None:
+            _, height = self._shape
+            return Control(
+                ControlType.CARRIAGE_RETURN,
+                (ControlType.ERASE_IN_LINE, 2),
+                *(
+                    (
+                        (ControlType.CURSOR_UP, 1),
+                        (ControlType.ERASE_IN_LINE, 2),
+                    )
+                    * (height - 1)
+                )
+            )
+        return Control()
+
+    def restore_cursor(self) -> Control:
+        """Get control codes to clear the render and restore the cursor to its previous position.
+
+        Returns:
+            Control: A Control instance that may be printed.
+        """
+        if self._shape is not None:
+            _, height = self._shape
+            return Control(
+                ControlType.CARRIAGE_RETURN,
+                *((ControlType.CURSOR_UP, 1), (ControlType.ERASE_IN_LINE, 2)) * height
+            )
+        return Control()
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        renderable = self.renderable
+        style = console.get_style(self.style)
+        lines = console.render_lines(renderable, options, style=style, pad=False)
+        shape = Segment.get_shape(lines)
+
+        _, height = shape
+        if height > options.size.height:
+            if self.vertical_overflow == "crop":
+                lines = lines[: options.size.height]
+                shape = Segment.get_shape(lines)
+            elif self.vertical_overflow == "ellipsis":
+                lines = lines[: (options.size.height - 1)]
+                overflow_text = Text(
+                    "...",
+                    overflow="crop",
+                    justify="center",
+                    end="",
+                    style="live.ellipsis",
+                )
+                lines.append(list(console.render(overflow_text)))
+                shape = Segment.get_shape(lines)
+        self._shape = shape
+
+        new_line = Segment.line()
+        for last, line in loop_last(lines):
+            yield from line
+            if not last:
+                yield new_line

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/logging.py

@@ -0,0 +1,268 @@
+import logging
+from datetime import datetime
+from logging import Handler, LogRecord
+from pathlib import Path
+from typing import ClassVar, List, Optional, Type, Union
+
+from . import get_console
+from ._log_render import LogRender, FormatTimeCallable
+from .console import Console, ConsoleRenderable
+from .highlighter import Highlighter, ReprHighlighter
+from .text import Text
+from .traceback import Traceback
+
+
+class RichHandler(Handler):
+    """A logging handler that renders output with Rich. The time / level / message and file are displayed in columns.
+    The level is color coded, and the message is syntax highlighted.
+
+    Note:
+        Be careful when enabling console markup in log messages if you have configured logging for libraries not
+        under your control. If a dependency writes messages containing square brackets, it may not produce the intended output.
+
+    Args:
+        level (Union[int, str], optional): Log level. Defaults to logging.NOTSET.
+        console (:class:`~rich.console.Console`, optional): Optional console instance to write logs.
+            Default will use a global console instance writing to stdout.
+        show_time (bool, optional): Show a column for the time. Defaults to True.
+        omit_repeated_times (bool, optional): Omit repetition of the same time. Defaults to True.
+        show_level (bool, optional): Show a column for the level. Defaults to True.
+        show_path (bool, optional): Show the path to the original log call. Defaults to True.
+        enable_link_path (bool, optional): Enable terminal link of path column to file. Defaults to True.
+        highlighter (Highlighter, optional): Highlighter to style log messages, or None to use ReprHighlighter. Defaults to None.
+        markup (bool, optional): Enable console markup in log messages. Defaults to False.
+        rich_tracebacks (bool, optional): Enable rich tracebacks with syntax highlighting and formatting. Defaults to False.
+        tracebacks_width (Optional[int], optional): Number of characters used to render tracebacks, or None for full width. Defaults to None.
+        tracebacks_extra_lines (int, optional): Additional lines of code to render tracebacks, or None for full width. Defaults to None.
+        tracebacks_theme (str, optional): Override pygments theme used in traceback.
+        tracebacks_word_wrap (bool, optional): Enable word wrapping of long tracebacks lines. Defaults to True.
+        tracebacks_show_locals (bool, optional): Enable display of locals in tracebacks. Defaults to False.
+        locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to 10.
+        locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+        log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%x %X] ".
+    """
+
+    KEYWORDS: ClassVar[Optional[List[str]]] = [
+        "GET",
+        "POST",
+        "HEAD",
+        "PUT",
+        "DELETE",
+        "OPTIONS",
+        "TRACE",
+        "PATCH",
+    ]
+    HIGHLIGHTER_CLASS: ClassVar[Type[Highlighter]] = ReprHighlighter
+
+    def __init__(
+        self,
+        level: Union[int, str] = logging.NOTSET,
+        console: Optional[Console] = None,
+        *,
+        show_time: bool = True,
+        omit_repeated_times: bool = True,
+        show_level: bool = True,
+        show_path: bool = True,
+        enable_link_path: bool = True,
+        highlighter: Optional[Highlighter] = None,
+        markup: bool = False,
+        rich_tracebacks: bool = False,
+        tracebacks_width: Optional[int] = None,
+        tracebacks_extra_lines: int = 3,
+        tracebacks_theme: Optional[str] = None,
+        tracebacks_word_wrap: bool = True,
+        tracebacks_show_locals: bool = False,
+        locals_max_length: int = 10,
+        locals_max_string: int = 80,
+        log_time_format: Union[str, FormatTimeCallable] = "[%x %X]",
+    ) -> None:
+        super().__init__(level=level)
+        self.console = console or get_console()
+        self.highlighter = highlighter or self.HIGHLIGHTER_CLASS()
+        self._log_render = LogRender(
+            show_time=show_time,
+            show_level=show_level,
+            show_path=show_path,
+            time_format=log_time_format,
+            omit_repeated_times=omit_repeated_times,
+            level_width=None,
+        )
+        self.enable_link_path = enable_link_path
+        self.markup = markup
+        self.rich_tracebacks = rich_tracebacks
+        self.tracebacks_width = tracebacks_width
+        self.tracebacks_extra_lines = tracebacks_extra_lines
+        self.tracebacks_theme = tracebacks_theme
+        self.tracebacks_word_wrap = tracebacks_word_wrap
+        self.tracebacks_show_locals = tracebacks_show_locals
+        self.locals_max_length = locals_max_length
+        self.locals_max_string = locals_max_string
+
+    def get_level_text(self, record: LogRecord) -> Text:
+        """Get the level name from the record.
+
+        Args:
+            record (LogRecord): LogRecord instance.
+
+        Returns:
+            Text: A tuple of the style and level name.
+        """
+        level_name = record.levelname
+        level_text = Text.styled(
+            level_name.ljust(8), f"logging.level.{level_name.lower()}"
+        )
+        return level_text
+
+    def emit(self, record: LogRecord) -> None:
+        """Invoked by logging."""
+        message = self.format(record)
+        traceback = None
+        if (
+            self.rich_tracebacks
+            and record.exc_info
+            and record.exc_info != (None, None, None)
+        ):
+            exc_type, exc_value, exc_traceback = record.exc_info
+            assert exc_type is not None
+            assert exc_value is not None
+            traceback = Traceback.from_exception(
+                exc_type,
+                exc_value,
+                exc_traceback,
+                width=self.tracebacks_width,
+                extra_lines=self.tracebacks_extra_lines,
+                theme=self.tracebacks_theme,
+                word_wrap=self.tracebacks_word_wrap,
+                show_locals=self.tracebacks_show_locals,
+                locals_max_length=self.locals_max_length,
+                locals_max_string=self.locals_max_string,
+            )
+            message = record.getMessage()
+            if self.formatter:
+                record.message = record.getMessage()
+                formatter = self.formatter
+                if hasattr(formatter, "usesTime") and formatter.usesTime():
+                    record.asctime = formatter.formatTime(record, formatter.datefmt)
+                message = formatter.formatMessage(record)
+
+        message_renderable = self.render_message(record, message)
+        log_renderable = self.render(
+            record=record, traceback=traceback, message_renderable=message_renderable
+        )
+        try:
+            self.console.print(log_renderable)
+        except Exception:
+            self.handleError(record)
+
+    def render_message(self, record: LogRecord, message: str) -> "ConsoleRenderable":
+        """Render message text in to Text.
+
+        record (LogRecord): logging Record.
+        message (str): String containing log message.
+
+        Returns:
+            ConsoleRenderable: Renderable to display log message.
+        """
+        use_markup = getattr(record, "markup", self.markup)
+        message_text = Text.from_markup(message) if use_markup else Text(message)
+
+        highlighter = getattr(record, "highlighter", self.highlighter)
+        if highlighter:
+            message_text = highlighter(message_text)
+
+        if self.KEYWORDS:
+            message_text.highlight_words(self.KEYWORDS, "logging.keyword")
+        return message_text
+
+    def render(
+        self,
+        *,
+        record: LogRecord,
+        traceback: Optional[Traceback],
+        message_renderable: "ConsoleRenderable",
+    ) -> "ConsoleRenderable":
+        """Render log for display.
+
+        Args:
+            record (LogRecord): logging Record.
+            traceback (Optional[Traceback]): Traceback instance or None for no Traceback.
+            message_renderable (ConsoleRenderable): Renderable (typically Text) containing log message contents.
+
+        Returns:
+            ConsoleRenderable: Renderable to display log.
+        """
+        path = Path(record.pathname).name
+        level = self.get_level_text(record)
+        time_format = None if self.formatter is None else self.formatter.datefmt
+        log_time = datetime.fromtimestamp(record.created)
+
+        log_renderable = self._log_render(
+            self.console,
+            [message_renderable] if not traceback else [message_renderable, traceback],
+            log_time=log_time,
+            time_format=time_format,
+            level=level,
+            path=path,
+            line_no=record.lineno,
+            link_path=record.pathname if self.enable_link_path else None,
+        )
+        return log_renderable
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from time import sleep
+
+    FORMAT = "%(message)s"
+    # FORMAT = "%(asctime)-15s - %(levelname)s - %(message)s"
+    logging.basicConfig(
+        level="NOTSET",
+        format=FORMAT,
+        datefmt="[%X]",
+        handlers=[RichHandler(rich_tracebacks=True, tracebacks_show_locals=True)],
+    )
+    log = logging.getLogger("rich")
+
+    log.info("Server starting...")
+    log.info("Listening on http://127.0.0.1:8080")
+    sleep(1)
+
+    log.info("GET /index.html 200 1298")
+    log.info("GET /imgs/backgrounds/back1.jpg 200 54386")
+    log.info("GET /css/styles.css 200 54386")
+    log.warning("GET /favicon.ico 404 242")
+    sleep(1)
+
+    log.debug(
+        "JSONRPC request\n--> %r\n<-- %r",
+        {
+            "version": "1.1",
+            "method": "confirmFruitPurchase",
+            "params": [["apple", "orange", "mangoes", "pomelo"], 1.123],
+            "id": "194521489",
+        },
+        {"version": "1.1", "result": True, "error": None, "id": "194521489"},
+    )
+    log.debug(
+        "Loading configuration file /adasd/asdasd/qeqwe/qwrqwrqwr/sdgsdgsdg/werwerwer/dfgerert/ertertert/ertetert/werwerwer"
+    )
+    log.error("Unable to find 'pomelo' in database!")
+    log.info("POST /jsonrpc/ 200 65532")
+    log.info("POST /admin/ 401 42234")
+    log.warning("password was rejected for admin site.")
+
+    def divide() -> None:
+        number = 1
+        divisor = 0
+        foos = ["foo"] * 100
+        log.debug("in divide")
+        try:
+            number / divisor
+        except:
+            log.exception("An error of some kind occurred!")
+
+    divide()
+    sleep(1)
+    log.critical("Out of memory!")
+    log.info("Server exited with code=-1")
+    log.info("[bold]EXITING...[/bold]", extra=dict(markup=True))

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/measure.py

@@ -0,0 +1,149 @@
+from operator import itemgetter
+from typing import Callable, Iterable, NamedTuple, Optional, TYPE_CHECKING
+
+from . import errors
+from .protocol import is_renderable, rich_cast
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType
+
+
+class Measurement(NamedTuple):
+    """Stores the minimum and maximum widths (in characters) required to render an object."""
+
+    minimum: int
+    """Minimum number of cells required to render."""
+    maximum: int
+    """Maximum number of cells required to render."""
+
+    @property
+    def span(self) -> int:
+        """Get difference between maximum and minimum."""
+        return self.maximum - self.minimum
+
+    def normalize(self) -> "Measurement":
+        """Get measurement that ensures that minimum <= maximum and minimum >= 0
+
+        Returns:
+            Measurement: A normalized measurement.
+        """
+        minimum, maximum = self
+        minimum = min(max(0, minimum), maximum)
+        return Measurement(max(0, minimum), max(0, max(minimum, maximum)))
+
+    def with_maximum(self, width: int) -> "Measurement":
+        """Get a RenderableWith where the widths are <= width.
+
+        Args:
+            width (int): Maximum desired width.
+
+        Returns:
+            Measurement: New Measurement object.
+        """
+        minimum, maximum = self
+        return Measurement(min(minimum, width), min(maximum, width))
+
+    def with_minimum(self, width: int) -> "Measurement":
+        """Get a RenderableWith where the widths are >= width.
+
+        Args:
+            width (int): Minimum desired width.
+
+        Returns:
+            Measurement: New Measurement object.
+        """
+        minimum, maximum = self
+        width = max(0, width)
+        return Measurement(max(minimum, width), max(maximum, width))
+
+    def clamp(
+        self, min_width: Optional[int] = None, max_width: Optional[int] = None
+    ) -> "Measurement":
+        """Clamp a measurement within the specified range.
+
+        Args:
+            min_width (int): Minimum desired width, or ``None`` for no minimum. Defaults to None.
+            max_width (int): Maximum desired width, or ``None`` for no maximum. Defaults to None.
+
+        Returns:
+            Measurement: New Measurement object.
+        """
+        measurement = self
+        if min_width is not None:
+            measurement = measurement.with_minimum(min_width)
+        if max_width is not None:
+            measurement = measurement.with_maximum(max_width)
+        return measurement
+
+    @classmethod
+    def get(
+        cls, console: "Console", options: "ConsoleOptions", renderable: "RenderableType"
+    ) -> "Measurement":
+        """Get a measurement for a renderable.
+
+        Args:
+            console (~rich.console.Console): Console instance.
+            options (~rich.console.ConsoleOptions): Console options.
+            renderable (RenderableType): An object that may be rendered with Rich.
+
+        Raises:
+            errors.NotRenderableError: If the object is not renderable.
+
+        Returns:
+            Measurement: Measurement object containing range of character widths required to render the object.
+        """
+        _max_width = options.max_width
+        if _max_width < 1:
+            return Measurement(0, 0)
+        if isinstance(renderable, str):
+            renderable = console.render_str(renderable, markup=options.markup)
+        renderable = rich_cast(renderable)
+        if is_renderable(renderable):
+            get_console_width: Optional[
+                Callable[["Console", "ConsoleOptions"], "Measurement"]
+            ] = getattr(renderable, "__rich_measure__", None)
+            if get_console_width is not None:
+                render_width = (
+                    get_console_width(console, options)
+                    .normalize()
+                    .with_maximum(_max_width)
+                )
+                if render_width.maximum < 1:
+                    return Measurement(0, 0)
+                return render_width.normalize()
+            else:
+                return Measurement(0, _max_width)
+        else:
+            raise errors.NotRenderableError(
+                f"Unable to get render width for {renderable!r}; "
+                "a str, Segment, or object with __rich_console__ method is required"
+            )
+
+
+def measure_renderables(
+    console: "Console",
+    options: "ConsoleOptions",
+    renderables: Iterable["RenderableType"],
+) -> "Measurement":
+    """Get a measurement that would fit a number of renderables.
+
+    Args:
+        console (~rich.console.Console): Console instance.
+        options (~rich.console.ConsoleOptions): Console options.
+        renderables (Iterable[RenderableType]): One or more renderable objects.
+
+    Returns:
+        Measurement: Measurement object containing range of character widths required to
+            contain all given renderables.
+    """
+    if not renderables:
+        return Measurement(0, 0)
+    get_measurement = Measurement.get
+    measurements = [
+        get_measurement(console, options, renderable) for renderable in renderables
+    ]
+    measured_width = Measurement(
+        max(measurements, key=itemgetter(0)).minimum,
+        max(measurements, key=itemgetter(1)).maximum,
+    )
+    return measured_width

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/padding.py

@@ -0,0 +1,141 @@
+from typing import cast, List, Optional, Tuple, TYPE_CHECKING, Union
+
+if TYPE_CHECKING:
+    from .console import (
+        Console,
+        ConsoleOptions,
+        RenderableType,
+        RenderResult,
+    )
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .style import Style
+from .segment import Segment
+
+
+PaddingDimensions = Union[int, Tuple[int], Tuple[int, int], Tuple[int, int, int, int]]
+
+
+class Padding(JupyterMixin):
+    """Draw space around content.
+
+    Example:
+        >>> print(Padding("Hello", (2, 4), style="on blue"))
+
+    Args:
+        renderable (RenderableType): String or other renderable.
+        pad (Union[int, Tuple[int]]): Padding for top, right, bottom, and left borders.
+            May be specified with 1, 2, or 4 integers (CSS style).
+        style (Union[str, Style], optional): Style for padding characters. Defaults to "none".
+        expand (bool, optional): Expand padding to fit available width. Defaults to True.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        pad: "PaddingDimensions" = (0, 0, 0, 0),
+        *,
+        style: Union[str, Style] = "none",
+        expand: bool = True,
+    ):
+        self.renderable = renderable
+        self.top, self.right, self.bottom, self.left = self.unpack(pad)
+        self.style = style
+        self.expand = expand
+
+    @classmethod
+    def indent(cls, renderable: "RenderableType", level: int) -> "Padding":
+        """Make padding instance to render an indent.
+
+        Args:
+            renderable (RenderableType): String or other renderable.
+            level (int): Number of characters to indent.
+
+        Returns:
+            Padding: A Padding instance.
+        """
+
+        return Padding(renderable, pad=(0, 0, 0, level), expand=False)
+
+    @staticmethod
+    def unpack(pad: "PaddingDimensions") -> Tuple[int, int, int, int]:
+        """Unpack padding specified in CSS style."""
+        if isinstance(pad, int):
+            return (pad, pad, pad, pad)
+        if len(pad) == 1:
+            _pad = pad[0]
+            return (_pad, _pad, _pad, _pad)
+        if len(pad) == 2:
+            pad_top, pad_right = cast(Tuple[int, int], pad)
+            return (pad_top, pad_right, pad_top, pad_right)
+        if len(pad) == 4:
+            top, right, bottom, left = cast(Tuple[int, int, int, int], pad)
+            return (top, right, bottom, left)
+        raise ValueError(f"1, 2 or 4 integers required for padding; {len(pad)} given")
+
+    def __repr__(self) -> str:
+        return f"Padding({self.renderable!r}, ({self.top},{self.right},{self.bottom},{self.left}))"
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        style = console.get_style(self.style)
+        if self.expand:
+            width = options.max_width
+        else:
+            width = min(
+                Measurement.get(console, options, self.renderable).maximum
+                + self.left
+                + self.right,
+                options.max_width,
+            )
+        render_options = options.update_width(width - self.left - self.right)
+        if render_options.height is not None:
+            render_options = render_options.update_height(
+                height=render_options.height - self.top - self.bottom
+            )
+        lines = console.render_lines(
+            self.renderable, render_options, style=style, pad=True
+        )
+        _Segment = Segment
+
+        left = _Segment(" " * self.left, style) if self.left else None
+        right = (
+            [_Segment(f'{" " * self.right}', style), _Segment.line()]
+            if self.right
+            else [_Segment.line()]
+        )
+        blank_line: Optional[List[Segment]] = None
+        if self.top:
+            blank_line = [_Segment(f'{" " * width}\n', style)]
+            yield from blank_line * self.top
+        if left:
+            for line in lines:
+                yield left
+                yield from line
+                yield from right
+        else:
+            for line in lines:
+                yield from line
+                yield from right
+        if self.bottom:
+            blank_line = blank_line or [_Segment(f'{" " * width}\n', style)]
+            yield from blank_line * self.bottom
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        max_width = options.max_width
+        extra_width = self.left + self.right
+        if max_width - extra_width < 1:
+            return Measurement(max_width, max_width)
+        measure_min, measure_max = Measurement.get(console, options, self.renderable)
+        measurement = Measurement(measure_min + extra_width, measure_max + extra_width)
+        measurement = measurement.with_maximum(max_width)
+        return measurement
+
+
+if __name__ == "__main__":  #  pragma: no cover
+    from pip._vendor.rich import print
+
+    print(Padding("Hello, World", (2, 4), style="on blue"))

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/pager.py

@@ -0,0 +1,34 @@
+from abc import ABC, abstractmethod
+from typing import Any, Callable
+
+
+class Pager(ABC):
+    """Base class for a pager."""
+
+    @abstractmethod
+    def show(self, content: str) -> None:
+        """Show content in pager.
+
+        Args:
+            content (str): Content to be displayed.
+        """
+
+
+class SystemPager(Pager):
+    """Uses the pager installed on the system."""
+
+    def _pager(self, content: str) -> Any:  #  pragma: no cover
+        return __import__("pydoc").pager(content)
+
+    def show(self, content: str) -> None:
+        """Use the same pager used by pydoc."""
+        self._pager(content)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .__main__ import make_test_card
+    from .console import Console
+
+    console = Console()
+    with console.pager(styles=True):
+        console.print(make_test_card())

env-llmeval/lib/python3.10/site-packages/pip/_vendor/rich/palette.py

@@ -0,0 +1,100 @@
+from math import sqrt
+from functools import lru_cache
+from typing import Sequence, Tuple, TYPE_CHECKING
+
+from .color_triplet import ColorTriplet
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.table import Table
+
+
+class Palette:
+    """A palette of available colors."""
+
+    def __init__(self, colors: Sequence[Tuple[int, int, int]]):
+        self._colors = colors
+
+    def __getitem__(self, number: int) -> ColorTriplet:
+        return ColorTriplet(*self._colors[number])
+
+    def __rich__(self) -> "Table":
+        from pip._vendor.rich.color import Color
+        from pip._vendor.rich.style import Style
+        from pip._vendor.rich.text import Text
+        from pip._vendor.rich.table import Table
+
+        table = Table(
+            "index",
+            "RGB",
+            "Color",
+            title="Palette",
+            caption=f"{len(self._colors)} colors",
+            highlight=True,
+            caption_justify="right",
+        )
+        for index, color in enumerate(self._colors):
+            table.add_row(
+                str(index),
+                repr(color),
+                Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))),
+            )
+        return table
+
+    # This is somewhat inefficient and needs caching
+    @lru_cache(maxsize=1024)
+    def match(self, color: Tuple[int, int, int]) -> int:
+        """Find a color from a palette that most closely matches a given color.
+
+        Args:
+            color (Tuple[int, int, int]): RGB components in range 0 > 255.
+
+        Returns:
+            int: Index of closes matching color.
+        """
+        red1, green1, blue1 = color
+        _sqrt = sqrt
+        get_color = self._colors.__getitem__
+
+        def get_color_distance(index: int) -> float:
+            """Get the distance to a color."""
+            red2, green2, blue2 = get_color(index)
+            red_mean = (red1 + red2) // 2
+            red = red1 - red2
+            green = green1 - green2
+            blue = blue1 - blue2
+            return _sqrt(
+                (((512 + red_mean) * red * red) >> 8)
+                + 4 * green * green
+                + (((767 - red_mean) * blue * blue) >> 8)
+            )
+
+        min_index = min(range(len(self._colors)), key=get_color_distance)
+        return min_index
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import colorsys
+    from typing import Iterable
+    from pip._vendor.rich.color import Color
+    from pip._vendor.rich.console import Console, ConsoleOptions
+    from pip._vendor.rich.segment import Segment
+    from pip._vendor.rich.style import Style
+
+    class ColorBox:
+        def __rich_console__(
+            self, console: Console, options: ConsoleOptions
+        ) -> Iterable[Segment]:
+            height = console.size.height - 3
+            for y in range(0, height):
+                for x in range(options.max_width):
+                    h = x / options.max_width
+                    l = y / (height + 1)
+                    r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0)
+                    r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0)
+                    bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255)
+                    color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255)
+                    yield Segment("▄", Style(color=color, bgcolor=bgcolor))
+                yield Segment.line()
+
+    console = Console()
+    console.print(ColorBox())