diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/__init__.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/__init__.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..0dd313de7ba150878ecba85334c30e1a27ea3ae8 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/__init__.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/__main__.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/__main__.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..33797c0c32044e80da686433fd36a16d67ef358a Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/__main__.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/cmdline.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/cmdline.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..07fc9e1a9ebc21d3c15f360c0f988f64f9be8487 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/cmdline.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/console.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/console.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..edec33d8353958765f82c5ded36f47abc8186528 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/console.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/plugin.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/plugin.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..496d0d376ac80b08054e1993d872a763ce44c1af Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/plugin.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/scanner.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/scanner.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..4bc6e01b01ddeb80e9a67e9b02200e61e4c4043d Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/scanner.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/style.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/style.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..7980ade11f85c7f5a210b4545b1e4c95dea370ee Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/style.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/token.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/token.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..b6535883d42fb2aead5b2748f3468d9d651353e4 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/token.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/util.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/util.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..0a24fe1402967ce3b33b0e35953cb19c84a4a007 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/__pycache__/util.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/filters/__pycache__/__init__.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/filters/__pycache__/__init__.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..08b3b6c6ab9997ebb2afd21ddaa952d75210b6e3 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/filters/__pycache__/__init__.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__init__.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__init__.py new file mode 100644 index 0000000000000000000000000000000000000000..34f2bec59816c82f15bc875267d6de4c0cc7d7e4 --- /dev/null +++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__init__.py @@ -0,0 +1,153 @@ +""" + pygments.formatters + ~~~~~~~~~~~~~~~~~~~ + + Pygments formatters. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re +import sys +import types +import fnmatch +from os.path import basename + +from pip._vendor.pygments.formatters._mapping import FORMATTERS +from pip._vendor.pygments.plugin import find_plugin_formatters +from pip._vendor.pygments.util import ClassNotFound + +__all__ = ['get_formatter_by_name', 'get_formatter_for_filename', + 'get_all_formatters', 'load_formatter_from_file'] + list(FORMATTERS) + +_formatter_cache = {} # classes by name +_pattern_cache = {} + + +def _fn_matches(fn, glob): + """Return whether the supplied file name fn matches pattern filename.""" + if glob not in _pattern_cache: + pattern = _pattern_cache[glob] = re.compile(fnmatch.translate(glob)) + return pattern.match(fn) + return _pattern_cache[glob].match(fn) + + +def _load_formatters(module_name): + """Load a formatter (and all others in the module too).""" + mod = __import__(module_name, None, None, ['__all__']) + for formatter_name in mod.__all__: + cls = getattr(mod, formatter_name) + _formatter_cache[cls.name] = cls + + +def get_all_formatters(): + """Return a generator for all formatter classes.""" + # NB: this returns formatter classes, not info like get_all_lexers(). + for info in FORMATTERS.values(): + if info[1] not in _formatter_cache: + _load_formatters(info[0]) + yield _formatter_cache[info[1]] + for _, formatter in find_plugin_formatters(): + yield formatter + + +def find_formatter_class(alias): + """Lookup a formatter by alias. + + Returns None if not found. + """ + for module_name, name, aliases, _, _ in FORMATTERS.values(): + if alias in aliases: + if name not in _formatter_cache: + _load_formatters(module_name) + return _formatter_cache[name] + for _, cls in find_plugin_formatters(): + if alias in cls.aliases: + return cls + + +def get_formatter_by_name(_alias, **options): + """Lookup and instantiate a formatter by alias. + + Raises ClassNotFound if not found. + """ + cls = find_formatter_class(_alias) + if cls is None: + raise ClassNotFound("no formatter found for name %r" % _alias) + return cls(**options) + + +def load_formatter_from_file(filename, formattername="CustomFormatter", + **options): + """Load a formatter from a file. + + This method expects a file located relative to the current working + directory, which contains a class named CustomFormatter. By default, + it expects the Formatter to be named CustomFormatter; you can specify + your own class name as the second argument to this function. + + Users should be very careful with the input, because this method + is equivalent to running eval on the input file. + + Raises ClassNotFound if there are any problems importing the Formatter. + + .. versionadded:: 2.2 + """ + try: + # This empty dict will contain the namespace for the exec'd file + custom_namespace = {} + with open(filename, 'rb') as f: + exec(f.read(), custom_namespace) + # Retrieve the class `formattername` from that namespace + if formattername not in custom_namespace: + raise ClassNotFound('no valid %s class found in %s' % + (formattername, filename)) + formatter_class = custom_namespace[formattername] + # And finally instantiate it with the options + return formatter_class(**options) + except OSError as err: + raise ClassNotFound('cannot read %s: %s' % (filename, err)) + except ClassNotFound: + raise + except Exception as err: + raise ClassNotFound('error when loading custom formatter: %s' % err) + + +def get_formatter_for_filename(fn, **options): + """Lookup and instantiate a formatter by filename pattern. + + Raises ClassNotFound if not found. + """ + fn = basename(fn) + for modname, name, _, filenames, _ in FORMATTERS.values(): + for filename in filenames: + if _fn_matches(fn, filename): + if name not in _formatter_cache: + _load_formatters(modname) + return _formatter_cache[name](**options) + for cls in find_plugin_formatters(): + for filename in cls.filenames: + if _fn_matches(fn, filename): + return cls(**options) + raise ClassNotFound("no formatter found for file name %r" % fn) + + +class _automodule(types.ModuleType): + """Automatically import formatters.""" + + def __getattr__(self, name): + info = FORMATTERS.get(name) + if info: + _load_formatters(info[0]) + cls = _formatter_cache[info[1]] + setattr(self, name, cls) + return cls + raise AttributeError(name) + + +oldmod = sys.modules[__name__] +newmod = _automodule(__name__) +newmod.__dict__.update(oldmod.__dict__) +sys.modules[__name__] = newmod +del newmod.newmod, newmod.oldmod, newmod.sys, newmod.types diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/__init__.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/__init__.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..513fb8be3f944c63357b57fd95b70195a8f3da54 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/__init__.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/_mapping.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/_mapping.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..9e2575e0a51a3c50904a53ea58c534370fd881b8 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/_mapping.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/bbcode.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/bbcode.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..723f5946fc7c21340b192789be5edc7ddaeeb80e Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/bbcode.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/groff.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/groff.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..340455882d9e5076c352021ba90d3577237f2be9 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/groff.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/html.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/html.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..d3d966091cf58c509d479d727a2142dae4e2adcf Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/html.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/img.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/img.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..5ecc69d4c04695eb538fd7bfa1b63ddae7f9789d Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/img.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/irc.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/irc.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..6bad7bca0f9b97f2cd8627face143424ac14c566 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/irc.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/latex.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/latex.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..17b8ae0c9a29a44980e83418a8297b8be8abd86f Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/latex.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/other.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/other.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..cbe0bac594c3cc1205ef9edfb41fb0afe2a77a34 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/other.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/pangomarkup.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/pangomarkup.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..e6c6982212804df6919d80363e79316c69f73fb5 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/pangomarkup.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/rtf.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/rtf.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..f89adacf199b79ecbd20ffdfbbed4ea695631c22 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/rtf.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/svg.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/svg.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..d04a5570e4e68ca1f14e15eb64af46897d3490a3 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/svg.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/terminal.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/terminal.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..85f23e4b4fc26bd778e515f3d71b59056929f80c Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/terminal.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/terminal256.cpython-310.pyc b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/terminal256.cpython-310.pyc new file mode 100644 index 0000000000000000000000000000000000000000..ff357d9106e2f25b8e13df419eaed1d7a16b4521 Binary files /dev/null and b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/__pycache__/terminal256.cpython-310.pyc differ diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/_mapping.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/_mapping.py new file mode 100644 index 0000000000000000000000000000000000000000..57445dc98edd1a03f6c6c6e9bb1f96510d10d94a --- /dev/null +++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/_mapping.py @@ -0,0 +1,84 @@ +""" + pygments.formatters._mapping + ~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter mapping definitions. This file is generated by itself. Everytime + you change something on a builtin formatter definition, run this script from + the formatters folder to update it. + + Do not alter the FORMATTERS dictionary by hand. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +FORMATTERS = { + 'BBCodeFormatter': ('pygments.formatters.bbcode', 'BBCode', ('bbcode', 'bb'), (), 'Format tokens with BBcodes. These formatting codes are used by many bulletin boards, so you can highlight your sourcecode with pygments before posting it there.'), + 'BmpImageFormatter': ('pygments.formatters.img', 'img_bmp', ('bmp', 'bitmap'), ('*.bmp',), 'Create a bitmap image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'), + 'GifImageFormatter': ('pygments.formatters.img', 'img_gif', ('gif',), ('*.gif',), 'Create a GIF image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'), + 'GroffFormatter': ('pygments.formatters.groff', 'groff', ('groff', 'troff', 'roff'), (), 'Format tokens with groff escapes to change their color and font style.'), + 'HtmlFormatter': ('pygments.formatters.html', 'HTML', ('html',), ('*.html', '*.htm'), "Format tokens as HTML 4 ```` tags within a ``
`` tag, wrapped in a ``
`` tag. The ``
``'s CSS class can be set by the `cssclass` option."),
+    'IRCFormatter': ('pygments.formatters.irc', 'IRC', ('irc', 'IRC'), (), 'Format tokens with IRC color sequences'),
+    'ImageFormatter': ('pygments.formatters.img', 'img', ('img', 'IMG', 'png'), ('*.png',), 'Create a PNG image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'),
+    'JpgImageFormatter': ('pygments.formatters.img', 'img_jpg', ('jpg', 'jpeg'), ('*.jpg',), 'Create a JPEG image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'),
+    'LatexFormatter': ('pygments.formatters.latex', 'LaTeX', ('latex', 'tex'), ('*.tex',), 'Format tokens as LaTeX code. This needs the `fancyvrb` and `color` standard packages.'),
+    'NullFormatter': ('pygments.formatters.other', 'Text only', ('text', 'null'), ('*.txt',), 'Output the text unchanged without any formatting.'),
+    'PangoMarkupFormatter': ('pygments.formatters.pangomarkup', 'Pango Markup', ('pango', 'pangomarkup'), (), 'Format tokens as Pango Markup code. It can then be rendered to an SVG.'),
+    'RawTokenFormatter': ('pygments.formatters.other', 'Raw tokens', ('raw', 'tokens'), ('*.raw',), 'Format tokens as a raw representation for storing token streams.'),
+    'RtfFormatter': ('pygments.formatters.rtf', 'RTF', ('rtf',), ('*.rtf',), 'Format tokens as RTF markup. This formatter automatically outputs full RTF documents with color information and other useful stuff. Perfect for Copy and Paste into Microsoft(R) Word(R) documents.'),
+    'SvgFormatter': ('pygments.formatters.svg', 'SVG', ('svg',), ('*.svg',), 'Format tokens as an SVG graphics file.  This formatter is still experimental. Each line of code is a ```` element with explicit ``x`` and ``y`` coordinates containing ```` elements with the individual token styles.'),
+    'Terminal256Formatter': ('pygments.formatters.terminal256', 'Terminal256', ('terminal256', 'console256', '256'), (), 'Format tokens with ANSI color sequences, for output in a 256-color terminal or console.  Like in `TerminalFormatter` color sequences are terminated at newlines, so that paging the output works correctly.'),
+    'TerminalFormatter': ('pygments.formatters.terminal', 'Terminal', ('terminal', 'console'), (), 'Format tokens with ANSI color sequences, for output in a text console. Color sequences are terminated at newlines, so that paging the output works correctly.'),
+    'TerminalTrueColorFormatter': ('pygments.formatters.terminal256', 'TerminalTrueColor', ('terminal16m', 'console16m', '16m'), (), 'Format tokens with ANSI color sequences, for output in a true-color terminal or console.  Like in `TerminalFormatter` color sequences are terminated at newlines, so that paging the output works correctly.'),
+    'TestcaseFormatter': ('pygments.formatters.other', 'Testcase', ('testcase',), (), 'Format tokens as appropriate for a new testcase.')
+}
+
+if __name__ == '__main__':  # pragma: no cover
+    import sys
+    import os
+
+    # lookup formatters
+    found_formatters = []
+    imports = []
+    sys.path.insert(0, os.path.join(os.path.dirname(__file__), '..', '..'))
+    from pip._vendor.pygments.util import docstring_headline
+
+    for root, dirs, files in os.walk('.'):
+        for filename in files:
+            if filename.endswith('.py') and not filename.startswith('_'):
+                module_name = 'pygments.formatters%s.%s' % (
+                    root[1:].replace('/', '.'), filename[:-3])
+                print(module_name)
+                module = __import__(module_name, None, None, [''])
+                for formatter_name in module.__all__:
+                    formatter = getattr(module, formatter_name)
+                    found_formatters.append(
+                        '%r: %r' % (formatter_name,
+                                    (module_name,
+                                     formatter.name,
+                                     tuple(formatter.aliases),
+                                     tuple(formatter.filenames),
+                                     docstring_headline(formatter))))
+    # sort them to make the diff minimal
+    found_formatters.sort()
+
+    # extract useful sourcecode from this file
+    with open(__file__) as fp:
+        content = fp.read()
+        # replace crnl to nl for Windows.
+        #
+        # Note that, originally, contributers should keep nl of master
+        # repository, for example by using some kind of automatic
+        # management EOL, like `EolExtension
+        #  `.
+        content = content.replace("\r\n", "\n")
+    header = content[:content.find('FORMATTERS = {')]
+    footer = content[content.find("if __name__ == '__main__':"):]
+
+    # write new file
+    with open(__file__, 'w') as fp:
+        fp.write(header)
+        fp.write('FORMATTERS = {\n    %s\n}\n\n' % ',\n    '.join(found_formatters))
+        fp.write(footer)
+
+    print ('=== %d formatters processed.' % len(found_formatters))
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/bbcode.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/bbcode.py
new file mode 100644
index 0000000000000000000000000000000000000000..35a37328ec7d835ae510a7a9b0127bb9b790b3c1
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/bbcode.py
@@ -0,0 +1,108 @@
+"""
+    pygments.formatters.bbcode
+    ~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+    BBcode formatter.
+
+    :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS.
+    :license: BSD, see LICENSE for details.
+"""
+
+
+from pip._vendor.pygments.formatter import Formatter
+from pip._vendor.pygments.util import get_bool_opt
+
+__all__ = ['BBCodeFormatter']
+
+
+class BBCodeFormatter(Formatter):
+    """
+    Format tokens with BBcodes. These formatting codes are used by many
+    bulletin boards, so you can highlight your sourcecode with pygments before
+    posting it there.
+
+    This formatter has no support for background colors and borders, as there
+    are no common BBcode tags for that.
+
+    Some board systems (e.g. phpBB) don't support colors in their [code] tag,
+    so you can't use the highlighting together with that tag.
+    Text in a [code] tag usually is shown with a monospace font (which this
+    formatter can do with the ``monofont`` option) and no spaces (which you
+    need for indentation) are removed.
+
+    Additional options accepted:
+
+    `style`
+        The style to use, can be a string or a Style subclass (default:
+        ``'default'``).
+
+    `codetag`
+        If set to true, put the output into ``[code]`` tags (default:
+        ``false``)
+
+    `monofont`
+        If set to true, add a tag to show the code with a monospace font
+        (default: ``false``).
+    """
+    name = 'BBCode'
+    aliases = ['bbcode', 'bb']
+    filenames = []
+
+    def __init__(self, **options):
+        Formatter.__init__(self, **options)
+        self._code = get_bool_opt(options, 'codetag', False)
+        self._mono = get_bool_opt(options, 'monofont', False)
+
+        self.styles = {}
+        self._make_styles()
+
+    def _make_styles(self):
+        for ttype, ndef in self.style:
+            start = end = ''
+            if ndef['color']:
+                start += '[color=#%s]' % ndef['color']
+                end = '[/color]' + end
+            if ndef['bold']:
+                start += '[b]'
+                end = '[/b]' + end
+            if ndef['italic']:
+                start += '[i]'
+                end = '[/i]' + end
+            if ndef['underline']:
+                start += '[u]'
+                end = '[/u]' + end
+            # there are no common BBcodes for background-color and border
+
+            self.styles[ttype] = start, end
+
+    def format_unencoded(self, tokensource, outfile):
+        if self._code:
+            outfile.write('[code]')
+        if self._mono:
+            outfile.write('[font=monospace]')
+
+        lastval = ''
+        lasttype = None
+
+        for ttype, value in tokensource:
+            while ttype not in self.styles:
+                ttype = ttype.parent
+            if ttype == lasttype:
+                lastval += value
+            else:
+                if lastval:
+                    start, end = self.styles[lasttype]
+                    outfile.write(''.join((start, lastval, end)))
+                lastval = value
+                lasttype = ttype
+
+        if lastval:
+            start, end = self.styles[lasttype]
+            outfile.write(''.join((start, lastval, end)))
+
+        if self._mono:
+            outfile.write('[/font]')
+        if self._code:
+            outfile.write('[/code]')
+        if self._code or self._mono:
+            outfile.write('\n')
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/groff.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/groff.py
new file mode 100644
index 0000000000000000000000000000000000000000..da9d7fca06966507815c1eb4cd54b44a46825f83
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/groff.py
@@ -0,0 +1,168 @@
+"""
+    pygments.formatters.groff
+    ~~~~~~~~~~~~~~~~~~~~~~~~~
+
+    Formatter for groff output.
+
+    :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS.
+    :license: BSD, see LICENSE for details.
+"""
+
+import math
+from pip._vendor.pygments.formatter import Formatter
+from pip._vendor.pygments.util import get_bool_opt, get_int_opt
+
+__all__ = ['GroffFormatter']
+
+
+class GroffFormatter(Formatter):
+    """
+    Format tokens with groff escapes to change their color and font style.
+
+    .. versionadded:: 2.11
+
+    Additional options accepted:
+
+    `style`
+        The style to use, can be a string or a Style subclass (default:
+        ``'default'``).
+
+    `monospaced`
+        If set to true, monospace font will be used (default: ``true``).
+
+    `linenos`
+        If set to true, print the line numbers (default: ``false``).
+
+    `wrap`
+        Wrap lines to the specified number of characters. Disabled if set to 0
+        (default: ``0``).
+    """
+
+    name = 'groff'
+    aliases = ['groff','troff','roff']
+    filenames = []
+
+    def __init__(self, **options):
+        Formatter.__init__(self, **options)
+
+        self.monospaced = get_bool_opt(options, 'monospaced', True)
+        self.linenos = get_bool_opt(options, 'linenos', False)
+        self._lineno = 0
+        self.wrap = get_int_opt(options, 'wrap', 0)
+        self._linelen = 0
+
+        self.styles = {}
+        self._make_styles()
+
+
+    def _make_styles(self):
+        regular = '\\f[CR]' if self.monospaced else '\\f[R]'
+        bold = '\\f[CB]' if self.monospaced else '\\f[B]'
+        italic = '\\f[CI]' if self.monospaced else '\\f[I]'
+
+        for ttype, ndef in self.style:
+            start = end = ''
+            if ndef['color']:
+                start += '\\m[%s]' % ndef['color']
+                end = '\\m[]' + end
+            if ndef['bold']:
+                start += bold
+                end = regular + end
+            if ndef['italic']:
+                start += italic
+                end = regular + end
+            if ndef['bgcolor']:
+                start += '\\M[%s]' % ndef['bgcolor']
+                end = '\\M[]' + end
+
+            self.styles[ttype] = start, end
+
+
+    def _define_colors(self, outfile):
+        colors = set()
+        for _, ndef in self.style:
+            if ndef['color'] is not None:
+                colors.add(ndef['color'])
+
+        for color in colors:
+            outfile.write('.defcolor ' + color + ' rgb #' + color + '\n')
+
+
+    def _write_lineno(self, outfile):
+        self._lineno += 1
+        outfile.write("%s% 4d " % (self._lineno != 1 and '\n' or '', self._lineno))
+
+
+    def _wrap_line(self, line):
+        length = len(line.rstrip('\n'))
+        space = '     ' if self.linenos else ''
+        newline = ''
+
+        if length > self.wrap:
+            for i in range(0, math.floor(length / self.wrap)):
+                chunk = line[i*self.wrap:i*self.wrap+self.wrap]
+                newline += (chunk + '\n' + space)
+            remainder = length % self.wrap
+            if remainder > 0:
+                newline += line[-remainder-1:]
+                self._linelen = remainder
+        elif self._linelen + length > self.wrap:
+            newline = ('\n' + space) + line
+            self._linelen = length
+        else:
+            newline = line
+            self._linelen += length
+
+        return newline
+
+
+    def _escape_chars(self, text):
+        text = text.replace('\\', '\\[u005C]'). \
+                    replace('.', '\\[char46]'). \
+                    replace('\'', '\\[u0027]'). \
+                    replace('`', '\\[u0060]'). \
+                    replace('~', '\\[u007E]')
+        copy = text
+
+        for char in copy:
+            if len(char) != len(char.encode()):
+                uni = char.encode('unicode_escape') \
+                    .decode()[1:] \
+                    .replace('x', 'u00') \
+                    .upper()
+                text = text.replace(char, '\\[u' + uni[1:] + ']')
+
+        return text
+
+
+    def format_unencoded(self, tokensource, outfile):
+        self._define_colors(outfile)
+
+        outfile.write('.nf\n\\f[CR]\n')
+
+        if self.linenos:
+            self._write_lineno(outfile)
+
+        for ttype, value in tokensource:
+            start, end = self.styles[ttype]
+
+            for line in value.splitlines(True):
+                if self.wrap > 0:
+                    line = self._wrap_line(line)
+
+                if start and end:
+                    text = self._escape_chars(line.rstrip('\n'))
+                    if text != '':
+                        outfile.write(''.join((start, text, end)))
+                else:
+                    outfile.write(self._escape_chars(line.rstrip('\n')))
+
+                if line.endswith('\n'):
+                    if self.linenos:
+                        self._write_lineno(outfile)
+                        self._linelen = 0
+                    else:
+                        outfile.write('\n')
+                        self._linelen = 0
+
+        outfile.write('\n.fi')
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/html.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/html.py
new file mode 100644
index 0000000000000000000000000000000000000000..47f5d9c17fbfed747f57cedb697c07f43f451604
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/pygments/formatters/html.py
@@ -0,0 +1,983 @@
+"""
+    pygments.formatters.html
+    ~~~~~~~~~~~~~~~~~~~~~~~~
+
+    Formatter for HTML output.
+
+    :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS.
+    :license: BSD, see LICENSE for details.
+"""
+
+import functools
+import os
+import sys
+import os.path
+from io import StringIO
+
+from pip._vendor.pygments.formatter import Formatter
+from pip._vendor.pygments.token import Token, Text, STANDARD_TYPES
+from pip._vendor.pygments.util import get_bool_opt, get_int_opt, get_list_opt
+
+try:
+    import ctags
+except ImportError:
+    ctags = None
+
+__all__ = ['HtmlFormatter']
+
+
+_escape_html_table = {
+    ord('&'): '&',
+    ord('<'): '<',
+    ord('>'): '>',
+    ord('"'): '"',
+    ord("'"): ''',
+}
+
+
+def escape_html(text, table=_escape_html_table):
+    """Escape &, <, > as well as single and double quotes for HTML."""
+    return text.translate(table)
+
+
+def webify(color):
+    if color.startswith('calc') or color.startswith('var'):
+        return color
+    else:
+        return '#' + color
+
+
+def _get_ttype_class(ttype):
+    fname = STANDARD_TYPES.get(ttype)
+    if fname:
+        return fname
+    aname = ''
+    while fname is None:
+        aname = '-' + ttype[-1] + aname
+        ttype = ttype.parent
+        fname = STANDARD_TYPES.get(ttype)
+    return fname + aname
+
+
+CSSFILE_TEMPLATE = '''\
+/*
+generated by Pygments 
+Copyright 2006-2021 by the Pygments team.
+Licensed under the BSD license, see LICENSE for details.
+*/
+%(styledefs)s
+'''
+
+DOC_HEADER = '''\
+
+
+
+
+  %(title)s
+  
+  
+
+
+
%(title)s

+
+'''
+
+DOC_HEADER_EXTERNALCSS = '''\
+
+
+
+
+  %(title)s
+  
+  
+
+
+
%(title)s

+
+'''
+
+DOC_FOOTER = '''\
+
+
+'''
+
+
+class HtmlFormatter(Formatter):
+    r"""
+    Format tokens as HTML 4 ```` tags within a ``
`` tag, wrapped
+    in a ``
`` tag. The ``
``'s CSS class can be set by the `cssclass`
+    option.
+
+    If the `linenos` option is set to ``"table"``, the ``
`` is
+    additionally wrapped inside a ```` which has one row and two
+    cells: one containing the line numbers and one containing the code.
+    Example:
+
+    .. sourcecode:: html
+
+        

+        

+          
+          
+        

+            
1
+            2

+          		
+            
def foo(bar):
+              pass
+            

+          

+
+    (whitespace added to improve clarity).
+
+    Wrapping can be disabled using the `nowrap` option.
+
+    A list of lines can be specified using the `hl_lines` option to make these
+    lines highlighted (as of Pygments 0.11).
+
+    With the `full` option, a complete HTML 4 document is output, including
+    the style definitions inside a ``
+
+
+
+    
+        
{code}

+    
+
+
+"""
+
+_TERM_COLORS = {"256color": ColorSystem.EIGHT_BIT, "16color": ColorSystem.STANDARD}
+
+
+class ConsoleDimensions(NamedTuple):
+    """Size of the terminal."""
+
+    width: int
+    """The width of the console in 'cells'."""
+    height: int
+    """The height of the console in lines."""
+
+
+@dataclass
+class ConsoleOptions:
+    """Options for __rich_console__ method."""
+
+    size: ConsoleDimensions
+    """Size of console."""
+    legacy_windows: bool
+    """legacy_windows: flag for legacy windows."""
+    min_width: int
+    """Minimum width of renderable."""
+    max_width: int
+    """Maximum width of renderable."""
+    is_terminal: bool
+    """True if the target is a terminal, otherwise False."""
+    encoding: str
+    """Encoding of terminal."""
+    max_height: int
+    """Height of container (starts as terminal)"""
+    justify: Optional[JustifyMethod] = None
+    """Justify value override for renderable."""
+    overflow: Optional[OverflowMethod] = None
+    """Overflow value override for renderable."""
+    no_wrap: Optional[bool] = False
+    """Disable wrapping for text."""
+    highlight: Optional[bool] = None
+    """Highlight override for render_str."""
+    markup: Optional[bool] = None
+    """Enable markup when rendering strings."""
+    height: Optional[int] = None
+
+    @property
+    def ascii_only(self) -> bool:
+        """Check if renderables should use ascii only."""
+        return not self.encoding.startswith("utf")
+
+    def copy(self) -> "ConsoleOptions":
+        """Return a copy of the options.
+
+        Returns:
+            ConsoleOptions: a copy of self.
+        """
+        options: ConsoleOptions = ConsoleOptions.__new__(ConsoleOptions)
+        options.__dict__ = self.__dict__.copy()
+        return options
+
+    def update(
+        self,
+        *,
+        width: Union[int, NoChange] = NO_CHANGE,
+        min_width: Union[int, NoChange] = NO_CHANGE,
+        max_width: Union[int, NoChange] = NO_CHANGE,
+        justify: Union[Optional[JustifyMethod], NoChange] = NO_CHANGE,
+        overflow: Union[Optional[OverflowMethod], NoChange] = NO_CHANGE,
+        no_wrap: Union[Optional[bool], NoChange] = NO_CHANGE,
+        highlight: Union[Optional[bool], NoChange] = NO_CHANGE,
+        markup: Union[Optional[bool], NoChange] = NO_CHANGE,
+        height: Union[Optional[int], NoChange] = NO_CHANGE,
+    ) -> "ConsoleOptions":
+        """Update values, return a copy."""
+        options = self.copy()
+        if not isinstance(width, NoChange):
+            options.min_width = options.max_width = max(0, width)
+        if not isinstance(min_width, NoChange):
+            options.min_width = min_width
+        if not isinstance(max_width, NoChange):
+            options.max_width = max_width
+        if not isinstance(justify, NoChange):
+            options.justify = justify
+        if not isinstance(overflow, NoChange):
+            options.overflow = overflow
+        if not isinstance(no_wrap, NoChange):
+            options.no_wrap = no_wrap
+        if not isinstance(highlight, NoChange):
+            options.highlight = highlight
+        if not isinstance(markup, NoChange):
+            options.markup = markup
+        if not isinstance(height, NoChange):
+            if height is not None:
+                options.max_height = height
+            options.height = None if height is None else max(0, height)
+        return options
+
+    def update_width(self, width: int) -> "ConsoleOptions":
+        """Update just the width, return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width)
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        return options
+
+    def update_height(self, height: int) -> "ConsoleOptions":
+        """Update the height, and return a copy.
+
+        Args:
+            height (int): New height
+
+        Returns:
+            ~ConsoleOptions: New Console options instance.
+        """
+        options = self.copy()
+        options.max_height = options.height = height
+        return options
+
+    def update_dimensions(self, width: int, height: int) -> "ConsoleOptions":
+        """Update the width and height, and return a copy.
+
+        Args:
+            width (int): New width (sets both min_width and max_width).
+            height (int): New height.
+
+        Returns:
+            ~ConsoleOptions: New console options instance.
+        """
+        options = self.copy()
+        options.min_width = options.max_width = max(0, width)
+        options.height = options.max_height = height
+        return options
+
+
+@runtime_checkable
+class RichCast(Protocol):
+    """An object that may be 'cast' to a console renderable."""
+
+    def __rich__(self) -> Union["ConsoleRenderable", str]:  # pragma: no cover
+        ...
+
+
+@runtime_checkable
+class ConsoleRenderable(Protocol):
+    """An object that supports the console protocol."""
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":  # pragma: no cover
+        ...
+
+
+# A type that may be rendered by Console.
+RenderableType = Union[ConsoleRenderable, RichCast, str]
+
+
+# The result of calling a __rich_console__ method.
+RenderResult = Iterable[Union[RenderableType, Segment]]
+
+
+_null_highlighter = NullHighlighter()
+
+
+class CaptureError(Exception):
+    """An error in the Capture context manager."""
+
+
+class NewLine:
+    """A renderable to generate new line(s)"""
+
+    def __init__(self, count: int = 1) -> None:
+        self.count = count
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Iterable[Segment]:
+        yield Segment("\n" * self.count)
+
+
+class ScreenUpdate:
+    """Render a list of lines at a given offset."""
+
+    def __init__(self, lines: List[List[Segment]], x: int, y: int) -> None:
+        self._lines = lines
+        self.x = x
+        self.y = y
+
+    def __rich_console__(
+        self, console: "Console", options: ConsoleOptions
+    ) -> RenderResult:
+        x = self.x
+        move_to = Control.move_to
+        for offset, line in enumerate(self._lines, self.y):
+            yield move_to(x, offset)
+            yield from line
+
+
+class Capture:
+    """Context manager to capture the result of printing to the console.
+    See :meth:`~rich.console.Console.capture` for how to use.
+
+    Args:
+        console (Console): A console instance to capture output.
+    """
+
+    def __init__(self, console: "Console") -> None:
+        self._console = console
+        self._result: Optional[str] = None
+
+    def __enter__(self) -> "Capture":
+        self._console.begin_capture()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self._result = self._console.end_capture()
+
+    def get(self) -> str:
+        """Get the result of the capture."""
+        if self._result is None:
+            raise CaptureError(
+                "Capture result is not available until context manager exits."
+            )
+        return self._result
+
+
+class ThemeContext:
+    """A context manager to use a temporary theme. See :meth:`~rich.console.Console.use_theme` for usage."""
+
+    def __init__(self, console: "Console", theme: Theme, inherit: bool = True) -> None:
+        self.console = console
+        self.theme = theme
+        self.inherit = inherit
+
+    def __enter__(self) -> "ThemeContext":
+        self.console.push_theme(self.theme)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.console.pop_theme()
+
+
+class PagerContext:
+    """A context manager that 'pages' content. See :meth:`~rich.console.Console.pager` for usage."""
+
+    def __init__(
+        self,
+        console: "Console",
+        pager: Optional[Pager] = None,
+        styles: bool = False,
+        links: bool = False,
+    ) -> None:
+        self._console = console
+        self.pager = SystemPager() if pager is None else pager
+        self.styles = styles
+        self.links = links
+
+    def __enter__(self) -> "PagerContext":
+        self._console._enter_buffer()
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if exc_type is None:
+            with self._console._lock:
+                buffer: List[Segment] = self._console._buffer[:]
+                del self._console._buffer[:]
+                segments: Iterable[Segment] = buffer
+                if not self.styles:
+                    segments = Segment.strip_styles(segments)
+                elif not self.links:
+                    segments = Segment.strip_links(segments)
+                content = self._console._render_buffer(segments)
+            self.pager.show(content)
+        self._console._exit_buffer()
+
+
+class ScreenContext:
+    """A context manager that enables an alternative screen. See :meth:`~rich.console.Console.screen` for usage."""
+
+    def __init__(
+        self, console: "Console", hide_cursor: bool, style: StyleType = ""
+    ) -> None:
+        self.console = console
+        self.hide_cursor = hide_cursor
+        self.screen = Screen(style=style)
+        self._changed = False
+
+    def update(
+        self, *renderables: RenderableType, style: Optional[StyleType] = None
+    ) -> None:
+        """Update the screen.
+
+        Args:
+            renderable (RenderableType, optional): Optional renderable to replace current renderable,
+                or None for no change. Defaults to None.
+            style: (Style, optional): Replacement style, or None for no change. Defaults to None.
+        """
+        if renderables:
+            self.screen.renderable = (
+                Group(*renderables) if len(renderables) > 1 else renderables[0]
+            )
+        if style is not None:
+            self.screen.style = style
+        self.console.print(self.screen, end="")
+
+    def __enter__(self) -> "ScreenContext":
+        self._changed = self.console.set_alt_screen(True)
+        if self._changed and self.hide_cursor:
+            self.console.show_cursor(False)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        if self._changed:
+            self.console.set_alt_screen(False)
+            if self.hide_cursor:
+                self.console.show_cursor(True)
+
+
+class Group:
+    """Takes a group of renderables and returns a renderable object that renders the group.
+
+    Args:
+        renderables (Iterable[RenderableType]): An iterable of renderable objects.
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def __init__(self, *renderables: "RenderableType", fit: bool = True) -> None:
+        self._renderables = renderables
+        self.fit = fit
+        self._render: Optional[List[RenderableType]] = None
+
+    @property
+    def renderables(self) -> List["RenderableType"]:
+        if self._render is None:
+            self._render = list(self._renderables)
+        return self._render
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.fit:
+            return measure_renderables(console, options, self.renderables)
+        else:
+            return Measurement(options.max_width, options.max_width)
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> RenderResult:
+        yield from self.renderables
+
+
+def group(fit: bool = True) -> Callable[..., Callable[..., Group]]:
+    """A decorator that turns an iterable of renderables in to a group.
+
+    Args:
+        fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True.
+    """
+
+    def decorator(
+        method: Callable[..., Iterable[RenderableType]]
+    ) -> Callable[..., Group]:
+        """Convert a method that returns an iterable of renderables in to a Group."""
+
+        @wraps(method)
+        def _replace(*args: Any, **kwargs: Any) -> Group:
+            renderables = method(*args, **kwargs)
+            return Group(*renderables, fit=fit)
+
+        return _replace
+
+    return decorator
+
+
+def _is_jupyter() -> bool:  # pragma: no cover
+    """Check if we're running in a Jupyter notebook."""
+    try:
+        get_ipython  # type: ignore
+    except NameError:
+        return False
+    ipython = get_ipython()  # type: ignore
+    shell = ipython.__class__.__name__
+    if "google.colab" in str(ipython.__class__) or shell == "ZMQInteractiveShell":
+        return True  # Jupyter notebook or qtconsole
+    elif shell == "TerminalInteractiveShell":
+        return False  # Terminal running IPython
+    else:
+        return False  # Other type (?)
+
+
+COLOR_SYSTEMS = {
+    "standard": ColorSystem.STANDARD,
+    "256": ColorSystem.EIGHT_BIT,
+    "truecolor": ColorSystem.TRUECOLOR,
+    "windows": ColorSystem.WINDOWS,
+}
+
+
+_COLOR_SYSTEMS_NAMES = {system: name for name, system in COLOR_SYSTEMS.items()}
+
+
+@dataclass
+class ConsoleThreadLocals(threading.local):
+    """Thread local values for Console context."""
+
+    theme_stack: ThemeStack
+    buffer: List[Segment] = field(default_factory=list)
+    buffer_index: int = 0
+
+
+class RenderHook(ABC):
+    """Provides hooks in to the render process."""
+
+    @abstractmethod
+    def process_renderables(
+        self, renderables: List[ConsoleRenderable]
+    ) -> List[ConsoleRenderable]:
+        """Called with a list of objects to render.
+
+        This method can return a new list of renderables, or modify and return the same list.
+
+        Args:
+            renderables (List[ConsoleRenderable]): A number of renderable objects.
+
+        Returns:
+            List[ConsoleRenderable]: A replacement list of renderables.
+        """
+
+
+_windows_console_features: Optional["WindowsConsoleFeatures"] = None
+
+
+def get_windows_console_features() -> "WindowsConsoleFeatures":  # pragma: no cover
+    global _windows_console_features
+    if _windows_console_features is not None:
+        return _windows_console_features
+    from ._windows import get_windows_console_features
+
+    _windows_console_features = get_windows_console_features()
+    return _windows_console_features
+
+
+def detect_legacy_windows() -> bool:
+    """Detect legacy Windows."""
+    return WINDOWS and not get_windows_console_features().vt
+
+
+if detect_legacy_windows():  # pragma: no cover
+    from pip._vendor.colorama import init
+
+    init(strip=False)
+
+
+class Console:
+    """A high level console interface.
+
+    Args:
+        color_system (str, optional): The color system supported by your terminal,
+            either ``"standard"``, ``"256"`` or ``"truecolor"``. Leave as ``"auto"`` to autodetect.
+        force_terminal (Optional[bool], optional): Enable/disable terminal control codes, or None to auto-detect terminal. Defaults to None.
+        force_jupyter (Optional[bool], optional): Enable/disable Jupyter rendering, or None to auto-detect Jupyter. Defaults to None.
+        force_interactive (Optional[bool], optional): Enable/disable interactive mode, or None to auto detect. Defaults to None.
+        soft_wrap (Optional[bool], optional): Set soft wrap default on print method. Defaults to False.
+        theme (Theme, optional): An optional style theme object, or ``None`` for default theme.
+        stderr (bool, optional): Use stderr rather than stdout if ``file`` is not specified. Defaults to False.
+        file (IO, optional): A file object where the console should write to. Defaults to stdout.
+        quiet (bool, Optional): Boolean to suppress all output. Defaults to False.
+        width (int, optional): The width of the terminal. Leave as default to auto-detect width.
+        height (int, optional): The height of the terminal. Leave as default to auto-detect height.
+        style (StyleType, optional): Style to apply to all output, or None for no style. Defaults to None.
+        no_color (Optional[bool], optional): Enabled no color mode, or None to auto detect. Defaults to None.
+        tab_size (int, optional): Number of spaces used to replace a tab character. Defaults to 8.
+        record (bool, optional): Boolean to enable recording of terminal output,
+            required to call :meth:`export_html` and :meth:`export_text`. Defaults to False.
+        markup (bool, optional): Boolean to enable :ref:`console_markup`. Defaults to True.
+        emoji (bool, optional): Enable emoji code. Defaults to True.
+        emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None.
+        highlight (bool, optional): Enable automatic highlighting. Defaults to True.
+        log_time (bool, optional): Boolean to enable logging of time by :meth:`log` methods. Defaults to True.
+        log_path (bool, optional): Boolean to enable the logging of the caller by :meth:`log`. Defaults to True.
+        log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%X] ".
+        highlighter (HighlighterType, optional): Default highlighter.
+        legacy_windows (bool, optional): Enable legacy Windows mode, or ``None`` to auto detect. Defaults to ``None``.
+        safe_box (bool, optional): Restrict box options that don't render on legacy Windows.
+        get_datetime (Callable[[], datetime], optional): Callable that gets the current time as a datetime.datetime object (used by Console.log),
+            or None for datetime.now.
+        get_time (Callable[[], time], optional): Callable that gets the current time in seconds, default uses time.monotonic.
+    """
+
+    _environ: Mapping[str, str] = os.environ
+
+    def __init__(
+        self,
+        *,
+        color_system: Optional[
+            Literal["auto", "standard", "256", "truecolor", "windows"]
+        ] = "auto",
+        force_terminal: Optional[bool] = None,
+        force_jupyter: Optional[bool] = None,
+        force_interactive: Optional[bool] = None,
+        soft_wrap: bool = False,
+        theme: Optional[Theme] = None,
+        stderr: bool = False,
+        file: Optional[IO[str]] = None,
+        quiet: bool = False,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        style: Optional[StyleType] = None,
+        no_color: Optional[bool] = None,
+        tab_size: int = 8,
+        record: bool = False,
+        markup: bool = True,
+        emoji: bool = True,
+        emoji_variant: Optional[EmojiVariant] = None,
+        highlight: bool = True,
+        log_time: bool = True,
+        log_path: bool = True,
+        log_time_format: Union[str, FormatTimeCallable] = "[%X]",
+        highlighter: Optional["HighlighterType"] = ReprHighlighter(),
+        legacy_windows: Optional[bool] = None,
+        safe_box: bool = True,
+        get_datetime: Optional[Callable[[], datetime]] = None,
+        get_time: Optional[Callable[[], float]] = None,
+        _environ: Optional[Mapping[str, str]] = None,
+    ):
+        # Copy of os.environ allows us to replace it for testing
+        if _environ is not None:
+            self._environ = _environ
+
+        self.is_jupyter = _is_jupyter() if force_jupyter is None else force_jupyter
+        if self.is_jupyter:
+            width = width or 93
+            height = height or 100
+
+        self.soft_wrap = soft_wrap
+        self._width = width
+        self._height = height
+        self.tab_size = tab_size
+        self.record = record
+        self._markup = markup
+        self._emoji = emoji
+        self._emoji_variant: Optional[EmojiVariant] = emoji_variant
+        self._highlight = highlight
+        self.legacy_windows: bool = (
+            (detect_legacy_windows() and not self.is_jupyter)
+            if legacy_windows is None
+            else legacy_windows
+        )
+        if width is None:
+            columns = self._environ.get("COLUMNS")
+            if columns is not None and columns.isdigit():
+                width = int(columns) - self.legacy_windows
+        if height is None:
+            lines = self._environ.get("LINES")
+            if lines is not None and lines.isdigit():
+                height = int(lines)
+
+        self.soft_wrap = soft_wrap
+        self._width = width
+        self._height = height
+
+        self._color_system: Optional[ColorSystem]
+        self._force_terminal = force_terminal
+        self._file = file
+        self.quiet = quiet
+        self.stderr = stderr
+
+        if color_system is None:
+            self._color_system = None
+        elif color_system == "auto":
+            self._color_system = self._detect_color_system()
+        else:
+            self._color_system = COLOR_SYSTEMS[color_system]
+
+        self._lock = threading.RLock()
+        self._log_render = LogRender(
+            show_time=log_time,
+            show_path=log_path,
+            time_format=log_time_format,
+        )
+        self.highlighter: HighlighterType = highlighter or _null_highlighter
+        self.safe_box = safe_box
+        self.get_datetime = get_datetime or datetime.now
+        self.get_time = get_time or monotonic
+        self.style = style
+        self.no_color = (
+            no_color if no_color is not None else "NO_COLOR" in self._environ
+        )
+        self.is_interactive = (
+            (self.is_terminal and not self.is_dumb_terminal)
+            if force_interactive is None
+            else force_interactive
+        )
+
+        self._record_buffer_lock = threading.RLock()
+        self._thread_locals = ConsoleThreadLocals(
+            theme_stack=ThemeStack(themes.DEFAULT if theme is None else theme)
+        )
+        self._record_buffer: List[Segment] = []
+        self._render_hooks: List[RenderHook] = []
+        self._live: Optional["Live"] = None
+        self._is_alt_screen = False
+
+    def __repr__(self) -> str:
+        return f""
+
+    @property
+    def file(self) -> IO[str]:
+        """Get the file object to write to."""
+        file = self._file or (sys.stderr if self.stderr else sys.stdout)
+        file = getattr(file, "rich_proxied_file", file)
+        return file
+
+    @file.setter
+    def file(self, new_file: IO[str]) -> None:
+        """Set a new file object."""
+        self._file = new_file
+
+    @property
+    def _buffer(self) -> List[Segment]:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer
+
+    @property
+    def _buffer_index(self) -> int:
+        """Get a thread local buffer."""
+        return self._thread_locals.buffer_index
+
+    @_buffer_index.setter
+    def _buffer_index(self, value: int) -> None:
+        self._thread_locals.buffer_index = value
+
+    @property
+    def _theme_stack(self) -> ThemeStack:
+        """Get the thread local theme stack."""
+        return self._thread_locals.theme_stack
+
+    def _detect_color_system(self) -> Optional[ColorSystem]:
+        """Detect color system from env vars."""
+        if self.is_jupyter:
+            return ColorSystem.TRUECOLOR
+        if not self.is_terminal or self.is_dumb_terminal:
+            return None
+        if WINDOWS:  # pragma: no cover
+            if self.legacy_windows:  # pragma: no cover
+                return ColorSystem.WINDOWS
+            windows_console_features = get_windows_console_features()
+            return (
+                ColorSystem.TRUECOLOR
+                if windows_console_features.truecolor
+                else ColorSystem.EIGHT_BIT
+            )
+        else:
+            color_term = self._environ.get("COLORTERM", "").strip().lower()
+            if color_term in ("truecolor", "24bit"):
+                return ColorSystem.TRUECOLOR
+            term = self._environ.get("TERM", "").strip().lower()
+            _term_name, _hyphen, colors = term.rpartition("-")
+            color_system = _TERM_COLORS.get(colors, ColorSystem.STANDARD)
+            return color_system
+
+    def _enter_buffer(self) -> None:
+        """Enter in to a buffer context, and buffer all output."""
+        self._buffer_index += 1
+
+    def _exit_buffer(self) -> None:
+        """Leave buffer context, and render content if required."""
+        self._buffer_index -= 1
+        self._check_buffer()
+
+    def set_live(self, live: "Live") -> None:
+        """Set Live instance. Used by Live context manager.
+
+        Args:
+            live (Live): Live instance using this Console.
+
+        Raises:
+            errors.LiveError: If this Console has a Live context currently active.
+        """
+        with self._lock:
+            if self._live is not None:
+                raise errors.LiveError("Only one live display may be active at once")
+            self._live = live
+
+    def clear_live(self) -> None:
+        """Clear the Live instance."""
+        with self._lock:
+            self._live = None
+
+    def push_render_hook(self, hook: RenderHook) -> None:
+        """Add a new render hook to the stack.
+
+        Args:
+            hook (RenderHook): Render hook instance.
+        """
+        with self._lock:
+            self._render_hooks.append(hook)
+
+    def pop_render_hook(self) -> None:
+        """Pop the last renderhook from the stack."""
+        with self._lock:
+            self._render_hooks.pop()
+
+    def __enter__(self) -> "Console":
+        """Own context manager to enter buffer context."""
+        self._enter_buffer()
+        return self
+
+    def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None:
+        """Exit buffer context."""
+        self._exit_buffer()
+
+    def begin_capture(self) -> None:
+        """Begin capturing console output. Call :meth:`end_capture` to exit capture mode and return output."""
+        self._enter_buffer()
+
+    def end_capture(self) -> str:
+        """End capture mode and return captured string.
+
+        Returns:
+            str: Console output.
+        """
+        render_result = self._render_buffer(self._buffer)
+        del self._buffer[:]
+        self._exit_buffer()
+        return render_result
+
+    def push_theme(self, theme: Theme, *, inherit: bool = True) -> None:
+        """Push a new theme on to the top of the stack, replacing the styles from the previous theme.
+        Generally speaking, you should call :meth:`~rich.console.Console.use_theme` to get a context manager, rather
+        than calling this method directly.
+
+        Args:
+            theme (Theme): A theme instance.
+            inherit (bool, optional): Inherit existing styles. Defaults to True.
+        """
+        self._theme_stack.push_theme(theme, inherit=inherit)
+
+    def pop_theme(self) -> None:
+        """Remove theme from top of stack, restoring previous theme."""
+        self._theme_stack.pop_theme()
+
+    def use_theme(self, theme: Theme, *, inherit: bool = True) -> ThemeContext:
+        """Use a different theme for the duration of the context manager.
+
+        Args:
+            theme (Theme): Theme instance to user.
+            inherit (bool, optional): Inherit existing console styles. Defaults to True.
+
+        Returns:
+            ThemeContext: [description]
+        """
+        return ThemeContext(self, theme, inherit)
+
+    @property
+    def color_system(self) -> Optional[str]:
+        """Get color system string.
+
+        Returns:
+            Optional[str]: "standard", "256" or "truecolor".
+        """
+
+        if self._color_system is not None:
+            return _COLOR_SYSTEMS_NAMES[self._color_system]
+        else:
+            return None
+
+    @property
+    def encoding(self) -> str:
+        """Get the encoding of the console file, e.g. ``"utf-8"``.
+
+        Returns:
+            str: A standard encoding string.
+        """
+        return (getattr(self.file, "encoding", "utf-8") or "utf-8").lower()
+
+    @property
+    def is_terminal(self) -> bool:
+        """Check if the console is writing to a terminal.
+
+        Returns:
+            bool: True if the console writing to a device capable of
+            understanding terminal codes, otherwise False.
+        """
+        if self._force_terminal is not None:
+            return self._force_terminal
+        isatty: Optional[Callable[[], bool]] = getattr(self.file, "isatty", None)
+        try:
+            return False if isatty is None else isatty()
+        except ValueError:
+            # in some situation (at the end of a pytest run for example) isatty() can raise
+            # ValueError: I/O operation on closed file
+            # return False because we aren't in a terminal anymore
+            return False
+
+    @property
+    def is_dumb_terminal(self) -> bool:
+        """Detect dumb terminal.
+
+        Returns:
+            bool: True if writing to a dumb terminal, otherwise False.
+
+        """
+        _term = self._environ.get("TERM", "")
+        is_dumb = _term.lower() in ("dumb", "unknown")
+        return self.is_terminal and is_dumb
+
+    @property
+    def options(self) -> ConsoleOptions:
+        """Get default console options."""
+        return ConsoleOptions(
+            max_height=self.size.height,
+            size=self.size,
+            legacy_windows=self.legacy_windows,
+            min_width=1,
+            max_width=self.width,
+            encoding=self.encoding,
+            is_terminal=self.is_terminal,
+        )
+
+    @property
+    def size(self) -> ConsoleDimensions:
+        """Get the size of the console.
+
+        Returns:
+            ConsoleDimensions: A named tuple containing the dimensions.
+        """
+
+        if self._width is not None and self._height is not None:
+            return ConsoleDimensions(self._width - self.legacy_windows, self._height)
+
+        if self.is_dumb_terminal:
+            return ConsoleDimensions(80, 25)
+
+        width: Optional[int] = None
+        height: Optional[int] = None
+
+        if WINDOWS:  # pragma: no cover
+            try:
+                width, height = os.get_terminal_size()
+            except OSError:  # Probably not a terminal
+                pass
+        else:
+            try:
+                width, height = os.get_terminal_size(sys.__stdin__.fileno())
+            except (AttributeError, ValueError, OSError):
+                try:
+                    width, height = os.get_terminal_size(sys.__stdout__.fileno())
+                except (AttributeError, ValueError, OSError):
+                    pass
+
+        columns = self._environ.get("COLUMNS")
+        if columns is not None and columns.isdigit():
+            width = int(columns)
+        lines = self._environ.get("LINES")
+        if lines is not None and lines.isdigit():
+            height = int(lines)
+
+        # get_terminal_size can report 0, 0 if run from pseudo-terminal
+        width = width or 80
+        height = height or 25
+        return ConsoleDimensions(
+            width - self.legacy_windows if self._width is None else self._width,
+            height if self._height is None else self._height,
+        )
+
+    @size.setter
+    def size(self, new_size: Tuple[int, int]) -> None:
+        """Set a new size for the terminal.
+
+        Args:
+            new_size (Tuple[int, int]): New width and height.
+        """
+        width, height = new_size
+        self._width = width
+        self._height = height
+
+    @property
+    def width(self) -> int:
+        """Get the width of the console.
+
+        Returns:
+            int: The width (in characters) of the console.
+        """
+        return self.size.width
+
+    @width.setter
+    def width(self, width: int) -> None:
+        """Set width.
+
+        Args:
+            width (int): New width.
+        """
+        self._width = width
+
+    @property
+    def height(self) -> int:
+        """Get the height of the console.
+
+        Returns:
+            int: The height (in lines) of the console.
+        """
+        return self.size.height
+
+    @height.setter
+    def height(self, height: int) -> None:
+        """Set height.
+
+        Args:
+            height (int): new height.
+        """
+        self._height = height
+
+    def bell(self) -> None:
+        """Play a 'bell' sound (if supported by the terminal)."""
+        self.control(Control.bell())
+
+    def capture(self) -> Capture:
+        """A context manager to *capture* the result of print() or log() in a string,
+        rather than writing it to the console.
+
+        Example:
+            >>> from rich.console import Console
+            >>> console = Console()
+            >>> with console.capture() as capture:
+            ...     console.print("[bold magenta]Hello World[/]")
+            >>> print(capture.get())
+
+        Returns:
+            Capture: Context manager with disables writing to the terminal.
+        """
+        capture = Capture(self)
+        return capture
+
+    def pager(
+        self, pager: Optional[Pager] = None, styles: bool = False, links: bool = False
+    ) -> PagerContext:
+        """A context manager to display anything printed within a "pager". The pager application
+        is defined by the system and will typically support at least pressing a key to scroll.
+
+        Args:
+            pager (Pager, optional): A pager object, or None to use :class:`~rich.pager.SystemPager`. Defaults to None.
+            styles (bool, optional): Show styles in pager. Defaults to False.
+            links (bool, optional): Show links in pager. Defaults to False.
+
+        Example:
+            >>> from rich.console import Console
+            >>> from rich.__main__ import make_test_card
+            >>> console = Console()
+            >>> with console.pager():
+                    console.print(make_test_card())
+
+        Returns:
+            PagerContext: A context manager.
+        """
+        return PagerContext(self, pager=pager, styles=styles, links=links)
+
+    def line(self, count: int = 1) -> None:
+        """Write new line(s).
+
+        Args:
+            count (int, optional): Number of new lines. Defaults to 1.
+        """
+
+        assert count >= 0, "count must be >= 0"
+        self.print(NewLine(count))
+
+    def clear(self, home: bool = True) -> None:
+        """Clear the screen.
+
+        Args:
+            home (bool, optional): Also move the cursor to 'home' position. Defaults to True.
+        """
+        if home:
+            self.control(Control.clear(), Control.home())
+        else:
+            self.control(Control.clear())
+
+    def status(
+        self,
+        status: RenderableType,
+        *,
+        spinner: str = "dots",
+        spinner_style: str = "status.spinner",
+        speed: float = 1.0,
+        refresh_per_second: float = 12.5,
+    ) -> "Status":
+        """Display a status and spinner.
+
+        Args:
+            status (RenderableType): A status renderable (str or Text typically).
+            spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots".
+            spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner".
+            speed (float, optional): Speed factor for spinner animation. Defaults to 1.0.
+            refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5.
+
+        Returns:
+            Status: A Status object that may be used as a context manager.
+        """
+        from .status import Status
+
+        status_renderable = Status(
+            status,
+            console=self,
+            spinner=spinner,
+            spinner_style=spinner_style,
+            speed=speed,
+            refresh_per_second=refresh_per_second,
+        )
+        return status_renderable
+
+    def show_cursor(self, show: bool = True) -> bool:
+        """Show or hide the cursor.
+
+        Args:
+            show (bool, optional): Set visibility of the cursor.
+        """
+        if self.is_terminal and not self.legacy_windows:
+            self.control(Control.show_cursor(show))
+            return True
+        return False
+
+    def set_alt_screen(self, enable: bool = True) -> bool:
+        """Enables alternative screen mode.
+
+        Note, if you enable this mode, you should ensure that is disabled before
+        the application exits. See :meth:`~rich.Console.screen` for a context manager
+        that handles this for you.
+
+        Args:
+            enable (bool, optional): Enable (True) or disable (False) alternate screen. Defaults to True.
+
+        Returns:
+            bool: True if the control codes were written.
+
+        """
+        changed = False
+        if self.is_terminal and not self.legacy_windows:
+            self.control(Control.alt_screen(enable))
+            changed = True
+            self._is_alt_screen = enable
+        return changed
+
+    @property
+    def is_alt_screen(self) -> bool:
+        """Check if the alt screen was enabled.
+
+        Returns:
+            bool: True if the alt screen was enabled, otherwise False.
+        """
+        return self._is_alt_screen
+
+    def screen(
+        self, hide_cursor: bool = True, style: Optional[StyleType] = None
+    ) -> "ScreenContext":
+        """Context manager to enable and disable 'alternative screen' mode.
+
+        Args:
+            hide_cursor (bool, optional): Also hide the cursor. Defaults to False.
+            style (Style, optional): Optional style for screen. Defaults to None.
+
+        Returns:
+            ~ScreenContext: Context which enables alternate screen on enter, and disables it on exit.
+        """
+        return ScreenContext(self, hide_cursor=hide_cursor, style=style or "")
+
+    def measure(
+        self, renderable: RenderableType, *, options: Optional[ConsoleOptions] = None
+    ) -> Measurement:
+        """Measure a renderable. Returns a :class:`~rich.measure.Measurement` object which contains
+        information regarding the number of characters required to print the renderable.
+
+        Args:
+            renderable (RenderableType): Any renderable or string.
+            options (Optional[ConsoleOptions], optional): Options to use when measuring, or None
+                to use default options. Defaults to None.
+
+        Returns:
+            Measurement: A measurement of the renderable.
+        """
+        measurement = Measurement.get(self, options or self.options, renderable)
+        return measurement
+
+    def render(
+        self, renderable: RenderableType, options: Optional[ConsoleOptions] = None
+    ) -> Iterable[Segment]:
+        """Render an object in to an iterable of `Segment` instances.
+
+        This method contains the logic for rendering objects with the console protocol.
+        You are unlikely to need to use it directly, unless you are extending the library.
+
+        Args:
+            renderable (RenderableType): An object supporting the console protocol, or
+                an object that may be converted to a string.
+            options (ConsoleOptions, optional): An options object, or None to use self.options. Defaults to None.
+
+        Returns:
+            Iterable[Segment]: An iterable of segments that may be rendered.
+        """
+
+        _options = options or self.options
+        if _options.max_width < 1:
+            # No space to render anything. This prevents potential recursion errors.
+            return
+        render_iterable: RenderResult
+
+        renderable = rich_cast(renderable)
+        if hasattr(renderable, "__rich_console__") and not isclass(renderable):
+            render_iterable = renderable.__rich_console__(self, _options)  # type: ignore
+        elif isinstance(renderable, str):
+            text_renderable = self.render_str(
+                renderable, highlight=_options.highlight, markup=_options.markup
+            )
+            render_iterable = text_renderable.__rich_console__(self, _options)
+        else:
+            raise errors.NotRenderableError(
+                f"Unable to render {renderable!r}; "
+                "A str, Segment or object with __rich_console__ method is required"
+            )
+
+        try:
+            iter_render = iter(render_iterable)
+        except TypeError:
+            raise errors.NotRenderableError(
+                f"object {render_iterable!r} is not renderable"
+            )
+        _Segment = Segment
+        for render_output in iter_render:
+            if isinstance(render_output, _Segment):
+                yield render_output
+            else:
+                yield from self.render(render_output, _options)
+
+    def render_lines(
+        self,
+        renderable: RenderableType,
+        options: Optional[ConsoleOptions] = None,
+        *,
+        style: Optional[Style] = None,
+        pad: bool = True,
+        new_lines: bool = False,
+    ) -> List[List[Segment]]:
+        """Render objects in to a list of lines.
+
+        The output of render_lines is useful when further formatting of rendered console text
+        is required, such as the Panel class which draws a border around any renderable object.
+
+        Args:
+            renderable (RenderableType): Any object renderable in the console.
+            options (Optional[ConsoleOptions], optional): Console options, or None to use self.options. Default to ``None``.
+            style (Style, optional): Optional style to apply to renderables. Defaults to ``None``.
+            pad (bool, optional): Pad lines shorter than render width. Defaults to ``True``.
+            new_lines (bool, optional): Include "\n" characters at end of lines.
+
+        Returns:
+            List[List[Segment]]: A list of lines, where a line is a list of Segment objects.
+        """
+        with self._lock:
+            render_options = options or self.options
+            _rendered = self.render(renderable, render_options)
+            if style:
+                _rendered = Segment.apply_style(_rendered, style)
+            lines = list(
+                islice(
+                    Segment.split_and_crop_lines(
+                        _rendered,
+                        render_options.max_width,
+                        include_new_lines=new_lines,
+                        pad=pad,
+                    ),
+                    None,
+                    render_options.height,
+                )
+            )
+            if render_options.height is not None:
+                extra_lines = render_options.height - len(lines)
+                if extra_lines > 0:
+                    pad_line = [
+                        [Segment(" " * render_options.max_width, style), Segment("\n")]
+                        if new_lines
+                        else [Segment(" " * render_options.max_width, style)]
+                    ]
+                    lines.extend(pad_line * extra_lines)
+
+            return lines
+
+    def render_str(
+        self,
+        text: str,
+        *,
+        style: Union[str, Style] = "",
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        highlighter: Optional[HighlighterType] = None,
+    ) -> "Text":
+        """Convert a string to a Text instance. This is is called automatically if
+        you print or log a string.
+
+        Args:
+            text (str): Text to render.
+            style (Union[str, Style], optional): Style to apply to rendered text.
+            justify (str, optional): Justify method: "default", "left", "center", "full", or "right". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji, or ``None`` to use Console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use Console default.
+            highlight (Optional[bool], optional): Enable highlighting, or ``None`` to use Console default.
+            highlighter (HighlighterType, optional): Optional highlighter to apply.
+        Returns:
+            ConsoleRenderable: Renderable object.
+
+        """
+        emoji_enabled = emoji or (emoji is None and self._emoji)
+        markup_enabled = markup or (markup is None and self._markup)
+        highlight_enabled = highlight or (highlight is None and self._highlight)
+
+        if markup_enabled:
+            rich_text = render_markup(
+                text,
+                style=style,
+                emoji=emoji_enabled,
+                emoji_variant=self._emoji_variant,
+            )
+            rich_text.justify = justify
+            rich_text.overflow = overflow
+        else:
+            rich_text = Text(
+                _emoji_replace(text, default_variant=self._emoji_variant)
+                if emoji_enabled
+                else text,
+                justify=justify,
+                overflow=overflow,
+                style=style,
+            )
+
+        _highlighter = (highlighter or self.highlighter) if highlight_enabled else None
+        if _highlighter is not None:
+            highlight_text = _highlighter(str(rich_text))
+            highlight_text.copy_styles(rich_text)
+            return highlight_text
+
+        return rich_text
+
+    def get_style(
+        self, name: Union[str, Style], *, default: Optional[Union[Style, str]] = None
+    ) -> Style:
+        """Get a Style instance by it's theme name or parse a definition.
+
+        Args:
+            name (str): The name of a style or a style definition.
+
+        Returns:
+            Style: A Style object.
+
+        Raises:
+            MissingStyle: If no style could be parsed from name.
+
+        """
+        if isinstance(name, Style):
+            return name
+
+        try:
+            style = self._theme_stack.get(name)
+            if style is None:
+                style = Style.parse(name)
+            return style.copy() if style.link else style
+        except errors.StyleSyntaxError as error:
+            if default is not None:
+                return self.get_style(default)
+            raise errors.MissingStyle(
+                f"Failed to get style {name!r}; {error}"
+            ) from None
+
+    def _collect_renderables(
+        self,
+        objects: Iterable[Any],
+        sep: str,
+        end: str,
+        *,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+    ) -> List[ConsoleRenderable]:
+        """Combine a number of renderables and text into one renderable.
+
+        Args:
+            objects (Iterable[Any]): Anything that Rich can render.
+            sep (str): String to write between print data.
+            end (str): String to write at end of print data.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default.
+
+        Returns:
+            List[ConsoleRenderable]: A list of things to render.
+        """
+        renderables: List[ConsoleRenderable] = []
+        _append = renderables.append
+        text: List[Text] = []
+        append_text = text.append
+
+        append = _append
+        if justify in ("left", "center", "right"):
+
+            def align_append(renderable: RenderableType) -> None:
+                _append(Align(renderable, cast(AlignMethod, justify)))
+
+            append = align_append
+
+        _highlighter: HighlighterType = _null_highlighter
+        if highlight or (highlight is None and self._highlight):
+            _highlighter = self.highlighter
+
+        def check_text() -> None:
+            if text:
+                sep_text = Text(sep, justify=justify, end=end)
+                append(sep_text.join(text))
+                del text[:]
+
+        for renderable in objects:
+            renderable = rich_cast(renderable)
+            if isinstance(renderable, str):
+                append_text(
+                    self.render_str(
+                        renderable, emoji=emoji, markup=markup, highlighter=_highlighter
+                    )
+                )
+            elif isinstance(renderable, Text):
+                append_text(renderable)
+            elif isinstance(renderable, ConsoleRenderable):
+                check_text()
+                append(renderable)
+            elif is_expandable(renderable):
+                check_text()
+                append(Pretty(renderable, highlighter=_highlighter))
+            else:
+                append_text(_highlighter(str(renderable)))
+
+        check_text()
+
+        if self.style is not None:
+            style = self.get_style(self.style)
+            renderables = [Styled(renderable, style) for renderable in renderables]
+
+        return renderables
+
+    def rule(
+        self,
+        title: TextType = "",
+        *,
+        characters: str = "─",
+        style: Union[str, Style] = "rule.line",
+        align: AlignMethod = "center",
+    ) -> None:
+        """Draw a line with optional centered title.
+
+        Args:
+            title (str, optional): Text to render over the rule. Defaults to "".
+            characters (str, optional): Character(s) to form the line. Defaults to "─".
+            style (str, optional): Style of line. Defaults to "rule.line".
+            align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center".
+        """
+        from .rule import Rule
+
+        rule = Rule(title=title, characters=characters, style=style, align=align)
+        self.print(rule)
+
+    def control(self, *control: Control) -> None:
+        """Insert non-printing control codes.
+
+        Args:
+            control_codes (str): Control codes, such as those that may move the cursor.
+        """
+        if not self.is_dumb_terminal:
+            with self:
+                self._buffer.extend(_control.segment for _control in control)
+
+    def out(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        highlight: Optional[bool] = None,
+    ) -> None:
+        """Output to the terminal. This is a low-level way of writing to the terminal which unlike
+        :meth:`~rich.console.Console.print` won't pretty print, wrap text, or apply markup, but will
+        optionally apply highlighting and a basic style.
+
+        Args:
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use
+                console default. Defaults to ``None``.
+        """
+        raw_output: str = sep.join(str(_object) for _object in objects)
+        self.print(
+            raw_output,
+            style=style,
+            highlight=highlight,
+            emoji=False,
+            markup=False,
+            no_wrap=True,
+            overflow="ignore",
+            crop=False,
+            end=end,
+        )
+
+    def print(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        overflow: Optional[OverflowMethod] = None,
+        no_wrap: Optional[bool] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        crop: bool = True,
+        soft_wrap: Optional[bool] = None,
+        new_line_start: bool = False,
+    ) -> None:
+        """Print to the console.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): Justify method: "default", "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "ignore", "crop", "fold", or "ellipsis". Defaults to None.
+            no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to ``None``.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to ``None``.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``.
+            width (Optional[int], optional): Width of output, or ``None`` to auto-detect. Defaults to ``None``.
+            crop (Optional[bool], optional): Crop output to width of terminal. Defaults to True.
+            soft_wrap (bool, optional): Enable soft wrap mode which disables word wrapping and cropping of text or ``None`` for
+                Console default. Defaults to ``None``.
+            new_line_start (bool, False): Insert a new line at the start if the output contains more than one line. Defaults to ``False``.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        if soft_wrap is None:
+            soft_wrap = self.soft_wrap
+        if soft_wrap:
+            if no_wrap is None:
+                no_wrap = True
+            if overflow is None:
+                overflow = "ignore"
+            crop = False
+        render_hooks = self._render_hooks[:]
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            render_options = self.options.update(
+                justify=justify,
+                overflow=overflow,
+                width=min(width, self.width) if width is not None else NO_CHANGE,
+                height=height,
+                no_wrap=no_wrap,
+                markup=markup,
+                highlight=highlight,
+            )
+
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            if style is None:
+                for renderable in renderables:
+                    extend(render(renderable, render_options))
+            else:
+                for renderable in renderables:
+                    extend(
+                        Segment.apply_style(
+                            render(renderable, render_options), self.get_style(style)
+                        )
+                    )
+            if new_line_start:
+                if (
+                    len("".join(segment.text for segment in new_segments).splitlines())
+                    > 1
+                ):
+                    new_segments.insert(0, Segment.line())
+            if crop:
+                buffer_extend = self._buffer.extend
+                for line in Segment.split_and_crop_lines(
+                    new_segments, self.width, pad=False
+                ):
+                    buffer_extend(line)
+            else:
+                self._buffer.extend(new_segments)
+
+    def print_json(
+        self,
+        json: Optional[str] = None,
+        *,
+        data: Any = None,
+        indent: Union[None, int, str] = 2,
+        highlight: bool = True,
+        skip_keys: bool = False,
+        ensure_ascii: bool = True,
+        check_circular: bool = True,
+        allow_nan: bool = True,
+        default: Optional[Callable[[Any], Any]] = None,
+        sort_keys: bool = False,
+    ) -> None:
+        """Pretty prints JSON. Output will be valid JSON.
+
+        Args:
+            json (Optional[str]): A string containing JSON.
+            data (Any): If json is not supplied, then encode this data.
+            indent (Union[None, int, str], optional): Number of spaces to indent. Defaults to 2.
+            highlight (bool, optional): Enable highlighting of output: Defaults to True.
+            skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False.
+            ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False.
+            check_circular (bool, optional): Check for circular references. Defaults to True.
+            allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True.
+            default (Callable, optional): A callable that converts values that can not be encoded
+                in to something that can be JSON encoded. Defaults to None.
+            sort_keys (bool, optional): Sort dictionary keys. Defaults to False.
+        """
+        from pip._vendor.rich.json import JSON
+
+        if json is None:
+            json_renderable = JSON.from_data(
+                data,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        else:
+            if not isinstance(json, str):
+                raise TypeError(
+                    f"json must be str. Did you mean print_json(data={json!r}) ?"
+                )
+            json_renderable = JSON(
+                json,
+                indent=indent,
+                highlight=highlight,
+                skip_keys=skip_keys,
+                ensure_ascii=ensure_ascii,
+                check_circular=check_circular,
+                allow_nan=allow_nan,
+                default=default,
+                sort_keys=sort_keys,
+            )
+        self.print(json_renderable, soft_wrap=True)
+
+    def update_screen(
+        self,
+        renderable: RenderableType,
+        *,
+        region: Optional[Region] = None,
+        options: Optional[ConsoleOptions] = None,
+    ) -> None:
+        """Update the screen at a given offset.
+
+        Args:
+            renderable (RenderableType): A Rich renderable.
+            region (Region, optional): Region of screen to update, or None for entire screen. Defaults to None.
+            x (int, optional): x offset. Defaults to 0.
+            y (int, optional): y offset. Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        render_options = options or self.options
+        if region is None:
+            x = y = 0
+            render_options = render_options.update_dimensions(
+                render_options.max_width, render_options.height or self.height
+            )
+        else:
+            x, y, width, height = region
+            render_options = render_options.update_dimensions(width, height)
+
+        lines = self.render_lines(renderable, options=render_options)
+        self.update_screen_lines(lines, x, y)
+
+    def update_screen_lines(
+        self, lines: List[List[Segment]], x: int = 0, y: int = 0
+    ) -> None:
+        """Update lines of the screen at a given offset.
+
+        Args:
+            lines (List[List[Segment]]): Rendered lines (as produced by :meth:`~rich.Console.render_lines`).
+            x (int, optional): x offset (column no). Defaults to 0.
+            y (int, optional): y offset (column no). Defaults to 0.
+
+        Raises:
+            errors.NoAltScreen: If the Console isn't in alt screen mode.
+        """
+        if not self.is_alt_screen:
+            raise errors.NoAltScreen("Alt screen must be enabled to call update_screen")
+        screen_update = ScreenUpdate(lines, x, y)
+        segments = self.render(screen_update)
+        self._buffer.extend(segments)
+        self._check_buffer()
+
+    def print_exception(
+        self,
+        *,
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ) -> None:
+        """Prints a rich render of the last exception and traceback.
+
+        Args:
+            width (Optional[int], optional): Number of characters used to render code. Defaults to 88.
+            extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+            theme (str, optional): Override pygments theme used in traceback
+            word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+            max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+        """
+        from .traceback import Traceback
+
+        traceback = Traceback(
+            width=width,
+            extra_lines=extra_lines,
+            theme=theme,
+            word_wrap=word_wrap,
+            show_locals=show_locals,
+            suppress=suppress,
+            max_frames=max_frames,
+        )
+        self.print(traceback)
+
+    @staticmethod
+    def _caller_frame_info(
+        offset: int,
+        currentframe: Callable[[], Optional[FrameType]] = inspect.currentframe,
+    ) -> Tuple[str, int, Dict[str, Any]]:
+        """Get caller frame information.
+
+        Args:
+            offset (int): the caller offset within the current frame stack.
+            currentframe (Callable[[], Optional[FrameType]], optional): the callable to use to
+                retrieve the current frame. Defaults to ``inspect.currentframe``.
+
+        Returns:
+            Tuple[str, int, Dict[str, Any]]: A tuple containing the filename, the line number and
+                the dictionary of local variables associated with the caller frame.
+
+        Raises:
+            RuntimeError: If the stack offset is invalid.
+        """
+        # Ignore the frame of this local helper
+        offset += 1
+
+        frame = currentframe()
+        if frame is not None:
+            # Use the faster currentframe where implemented
+            while offset and frame:
+                frame = frame.f_back
+                offset -= 1
+            assert frame is not None
+            return frame.f_code.co_filename, frame.f_lineno, frame.f_locals
+        else:
+            # Fallback to the slower stack
+            frame_info = inspect.stack()[offset]
+            return frame_info.filename, frame_info.lineno, frame_info.frame.f_locals
+
+    def log(
+        self,
+        *objects: Any,
+        sep: str = " ",
+        end: str = "\n",
+        style: Optional[Union[str, Style]] = None,
+        justify: Optional[JustifyMethod] = None,
+        emoji: Optional[bool] = None,
+        markup: Optional[bool] = None,
+        highlight: Optional[bool] = None,
+        log_locals: bool = False,
+        _stack_offset: int = 1,
+    ) -> None:
+        """Log rich content to the terminal.
+
+        Args:
+            objects (positional args): Objects to log to the terminal.
+            sep (str, optional): String to write between print data. Defaults to " ".
+            end (str, optional): String to write at end of print data. Defaults to "\\\\n".
+            style (Union[str, Style], optional): A style to apply to output. Defaults to None.
+            justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``.
+            overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None.
+            emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to None.
+            markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to None.
+            highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to None.
+            log_locals (bool, optional): Boolean to enable logging of locals where ``log()``
+                was called. Defaults to False.
+            _stack_offset (int, optional): Offset of caller from end of call stack. Defaults to 1.
+        """
+        if not objects:
+            objects = (NewLine(),)
+
+        render_hooks = self._render_hooks[:]
+
+        with self:
+            renderables = self._collect_renderables(
+                objects,
+                sep,
+                end,
+                justify=justify,
+                emoji=emoji,
+                markup=markup,
+                highlight=highlight,
+            )
+            if style is not None:
+                renderables = [Styled(renderable, style) for renderable in renderables]
+
+            filename, line_no, locals = self._caller_frame_info(_stack_offset)
+            link_path = None if filename.startswith("<") else os.path.abspath(filename)
+            path = filename.rpartition(os.sep)[-1]
+            if log_locals:
+                locals_map = {
+                    key: value
+                    for key, value in locals.items()
+                    if not key.startswith("__")
+                }
+                renderables.append(render_scope(locals_map, title="[i]locals"))
+
+            renderables = [
+                self._log_render(
+                    self,
+                    renderables,
+                    log_time=self.get_datetime(),
+                    path=path,
+                    line_no=line_no,
+                    link_path=link_path,
+                )
+            ]
+            for hook in render_hooks:
+                renderables = hook.process_renderables(renderables)
+            new_segments: List[Segment] = []
+            extend = new_segments.extend
+            render = self.render
+            render_options = self.options
+            for renderable in renderables:
+                extend(render(renderable, render_options))
+            buffer_extend = self._buffer.extend
+            for line in Segment.split_and_crop_lines(
+                new_segments, self.width, pad=False
+            ):
+                buffer_extend(line)
+
+    def _check_buffer(self) -> None:
+        """Check if the buffer may be rendered."""
+        if self.quiet:
+            del self._buffer[:]
+            return
+        with self._lock:
+            if self._buffer_index == 0:
+                if self.is_jupyter:  # pragma: no cover
+                    from .jupyter import display
+
+                    display(self._buffer, self._render_buffer(self._buffer[:]))
+                    del self._buffer[:]
+                else:
+                    text = self._render_buffer(self._buffer[:])
+                    del self._buffer[:]
+                    if text:
+                        try:
+                            if WINDOWS:  # pragma: no cover
+                                # https://bugs.python.org/issue37871
+                                write = self.file.write
+                                for line in text.splitlines(True):
+                                    write(line)
+                            else:
+                                self.file.write(text)
+                            self.file.flush()
+                        except UnicodeEncodeError as error:
+                            error.reason = f"{error.reason}\n*** You may need to add PYTHONIOENCODING=utf-8 to your environment ***"
+                            raise
+
+    def _render_buffer(self, buffer: Iterable[Segment]) -> str:
+        """Render buffered output, and clear buffer."""
+        output: List[str] = []
+        append = output.append
+        color_system = self._color_system
+        legacy_windows = self.legacy_windows
+        if self.record:
+            with self._record_buffer_lock:
+                self._record_buffer.extend(buffer)
+        not_terminal = not self.is_terminal
+        if self.no_color and color_system:
+            buffer = Segment.remove_color(buffer)
+        for text, style, control in buffer:
+            if style:
+                append(
+                    style.render(
+                        text,
+                        color_system=color_system,
+                        legacy_windows=legacy_windows,
+                    )
+                )
+            elif not (not_terminal and control):
+                append(text)
+
+        rendered = "".join(output)
+        return rendered
+
+    def input(
+        self,
+        prompt: TextType = "",
+        *,
+        markup: bool = True,
+        emoji: bool = True,
+        password: bool = False,
+        stream: Optional[TextIO] = None,
+    ) -> str:
+        """Displays a prompt and waits for input from the user. The prompt may contain color / style.
+
+        It works in the same way as Python's builtin :func:`input` function and provides elaborate line editing and history features if Python's builtin :mod:`readline` module is previously loaded.
+
+        Args:
+            prompt (Union[str, Text]): Text to render in the prompt.
+            markup (bool, optional): Enable console markup (requires a str prompt). Defaults to True.
+            emoji (bool, optional): Enable emoji (requires a str prompt). Defaults to True.
+            password: (bool, optional): Hide typed text. Defaults to False.
+            stream: (TextIO, optional): Optional file to read input from (rather than stdin). Defaults to None.
+
+        Returns:
+            str: Text read from stdin.
+        """
+        prompt_str = ""
+        if prompt:
+            with self.capture() as capture:
+                self.print(prompt, markup=markup, emoji=emoji, end="")
+            prompt_str = capture.get()
+        if self.legacy_windows:
+            # Legacy windows doesn't like ANSI codes in getpass or input (colorama bug)?
+            self.file.write(prompt_str)
+            prompt_str = ""
+        if password:
+            result = getpass(prompt_str, stream=stream)
+        else:
+            if stream:
+                self.file.write(prompt_str)
+                result = stream.readline()
+            else:
+                result = input(prompt_str)
+        return result
+
+    def export_text(self, *, clear: bool = True, styles: bool = False) -> str:
+        """Generate text from console contents (requires record=True argument in constructor).
+
+        Args:
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi escape codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        Returns:
+            str: String containing console contents.
+
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+
+        with self._record_buffer_lock:
+            if styles:
+                text = "".join(
+                    (style.render(text) if style else text)
+                    for text, style, _ in self._record_buffer
+                )
+            else:
+                text = "".join(
+                    segment.text
+                    for segment in self._record_buffer
+                    if not segment.control
+                )
+            if clear:
+                del self._record_buffer[:]
+        return text
+
+    def save_text(self, path: str, *, clear: bool = True, styles: bool = False) -> None:
+        """Generate text from console and save to a given location (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write text files.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            styles (bool, optional): If ``True``, ansi style codes will be included. ``False`` for plain text.
+                Defaults to ``False``.
+
+        """
+        text = self.export_text(clear=clear, styles=styles)
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(text)
+
+    def export_html(
+        self,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: Optional[str] = None,
+        inline_styles: bool = False,
+    ) -> str:
+        """Generate HTML from console contents (requires record=True argument in constructor).
+
+        Args:
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML, should contain {foreground}
+                {background} and {code}.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        Returns:
+            str: String containing console contents as HTML.
+        """
+        assert (
+            self.record
+        ), "To export console contents set record=True in the constructor or instance"
+        fragments: List[str] = []
+        append = fragments.append
+        _theme = theme or DEFAULT_TERMINAL_THEME
+        stylesheet = ""
+
+        render_code_format = CONSOLE_HTML_FORMAT if code_format is None else code_format
+
+        with self._record_buffer_lock:
+            if inline_styles:
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        if style.link:
+                            text = f'{text}'
+                        text = f'{text}' if rule else text
+                    append(text)
+            else:
+                styles: Dict[str, int] = {}
+                for text, style, _ in Segment.filter_control(
+                    Segment.simplify(self._record_buffer)
+                ):
+                    text = escape(text)
+                    if style:
+                        rule = style.get_html_style(_theme)
+                        style_number = styles.setdefault(rule, len(styles) + 1)
+                        if style.link:
+                            text = f'{text}'
+                        else:
+                            text = f'{text}'
+                    append(text)
+                stylesheet_rules: List[str] = []
+                stylesheet_append = stylesheet_rules.append
+                for style_rule, style_number in styles.items():
+                    if style_rule:
+                        stylesheet_append(f".r{style_number} {{{style_rule}}}")
+                stylesheet = "\n".join(stylesheet_rules)
+
+            rendered_code = render_code_format.format(
+                code="".join(fragments),
+                stylesheet=stylesheet,
+                foreground=_theme.foreground_color.hex,
+                background=_theme.background_color.hex,
+            )
+            if clear:
+                del self._record_buffer[:]
+        return rendered_code
+
+    def save_html(
+        self,
+        path: str,
+        *,
+        theme: Optional[TerminalTheme] = None,
+        clear: bool = True,
+        code_format: str = CONSOLE_HTML_FORMAT,
+        inline_styles: bool = False,
+    ) -> None:
+        """Generate HTML from console contents and write to a file (requires record=True argument in constructor).
+
+        Args:
+            path (str): Path to write html file.
+            theme (TerminalTheme, optional): TerminalTheme object containing console colors.
+            clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``.
+            code_format (str, optional): Format string to render HTML, should contain {foreground}
+                {background} and {code}.
+            inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files
+                larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag.
+                Defaults to False.
+
+        """
+        html = self.export_html(
+            theme=theme,
+            clear=clear,
+            code_format=code_format,
+            inline_styles=inline_styles,
+        )
+        with open(path, "wt", encoding="utf-8") as write_file:
+            write_file.write(html)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console()
+
+    console.log(
+        "JSONRPC [i]request[/i]",
+        5,
+        1.3,
+        True,
+        False,
+        None,
+        {
+            "jsonrpc": "2.0",
+            "method": "subtract",
+            "params": {"minuend": 42, "subtrahend": 23},
+            "id": 3,
+        },
+    )
+
+    console.log("Hello, World!", "{'a': 1}", repr(console))
+
+    console.print(
+        {
+            "name": None,
+            "empty": [],
+            "quiz": {
+                "sport": {
+                    "answered": True,
+                    "q1": {
+                        "question": "Which one is correct team name in NBA?",
+                        "options": [
+                            "New York Bulls",
+                            "Los Angeles Kings",
+                            "Golden State Warriors",
+                            "Huston Rocket",
+                        ],
+                        "answer": "Huston Rocket",
+                    },
+                },
+                "maths": {
+                    "answered": False,
+                    "q1": {
+                        "question": "5 + 7 = ?",
+                        "options": [10, 11, 12, 13],
+                        "answer": 12,
+                    },
+                    "q2": {
+                        "question": "12 - 8 = ?",
+                        "options": [1, 2, 3, 4],
+                        "answer": 4,
+                    },
+                },
+            },
+        }
+    )
+    console.log("foo")
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/constrain.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/constrain.py
new file mode 100644
index 0000000000000000000000000000000000000000..65fdf56342e8b5b8e181914881025231684e1871
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/constrain.py
@@ -0,0 +1,37 @@
+from typing import Optional, TYPE_CHECKING
+
+from .jupyter import JupyterMixin
+from .measure import Measurement
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+
+class Constrain(JupyterMixin):
+    """Constrain the width of a renderable to a given number of characters.
+
+    Args:
+        renderable (RenderableType): A renderable object.
+        width (int, optional): The maximum width (in characters) to render. Defaults to 80.
+    """
+
+    def __init__(self, renderable: "RenderableType", width: Optional[int] = 80) -> None:
+        self.renderable = renderable
+        self.width = width
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.width is None:
+            yield self.renderable
+        else:
+            child_options = options.update_width(min(self.width, options.max_width))
+            yield from console.render(self.renderable, child_options)
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.width is not None:
+            options = options.update_width(self.width)
+        measurement = Measurement.get(console, options, self.renderable)
+        return measurement
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/diagnose.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/diagnose.py
new file mode 100644
index 0000000000000000000000000000000000000000..38728da2ae2b557aa5c1b96a116c5901462fe298
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/diagnose.py
@@ -0,0 +1,6 @@
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+    from pip._vendor.rich import inspect
+
+    console = Console()
+    inspect(console)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/filesize.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/filesize.py
new file mode 100644
index 0000000000000000000000000000000000000000..b3a0996b05ef985e64ce69225e1347c1603dc023
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/filesize.py
@@ -0,0 +1,89 @@
+# coding: utf-8
+"""Functions for reporting filesizes. Borrowed from https://github.com/PyFilesystem/pyfilesystem2
+
+The functions declared in this module should cover the different
+usecases needed to generate a string representation of a file size
+using several different units. Since there are many standards regarding
+file size units, three different functions have been implemented.
+
+See Also:
+    * `Wikipedia: Binary prefix `_
+
+"""
+
+__all__ = ["decimal"]
+
+from typing import Iterable, List, Tuple, Optional
+
+
+def _to_str(
+    size: int,
+    suffixes: Iterable[str],
+    base: int,
+    *,
+    precision: Optional[int] = 1,
+    separator: Optional[str] = " ",
+) -> str:
+    if size == 1:
+        return "1 byte"
+    elif size < base:
+        return "{:,} bytes".format(size)
+
+    for i, suffix in enumerate(suffixes, 2):  # noqa: B007
+        unit = base ** i
+        if size < unit:
+            break
+    return "{:,.{precision}f}{separator}{}".format(
+        (base * size / unit),
+        suffix,
+        precision=precision,
+        separator=separator,
+    )
+
+
+def pick_unit_and_suffix(size: int, suffixes: List[str], base: int) -> Tuple[int, str]:
+    """Pick a suffix and base for the given size."""
+    for i, suffix in enumerate(suffixes):
+        unit = base ** i
+        if size < unit * base:
+            break
+    return unit, suffix
+
+
+def decimal(
+    size: int,
+    *,
+    precision: Optional[int] = 1,
+    separator: Optional[str] = " ",
+) -> str:
+    """Convert a filesize in to a string (powers of 1000, SI prefixes).
+
+    In this convention, ``1000 B = 1 kB``.
+
+    This is typically the format used to advertise the storage
+    capacity of USB flash drives and the like (*256 MB* meaning
+    actually a storage capacity of more than *256 000 000 B*),
+    or used by **Mac OS X** since v10.6 to report file sizes.
+
+    Arguments:
+        int (size): A file size.
+        int (precision): The number of decimal places to include (default = 1).
+        str (separator): The string to separate the value from the units (default = " ").
+
+    Returns:
+        `str`: A string containing a abbreviated file size and units.
+
+    Example:
+        >>> filesize.decimal(30000)
+        '30.0 kB'
+        >>> filesize.decimal(30000, precision=2, separator="")
+        '30.00kB'
+
+    """
+    return _to_str(
+        size,
+        ("kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"),
+        1000,
+        precision=precision,
+        separator=separator,
+    )
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py
new file mode 100644
index 0000000000000000000000000000000000000000..8afdd017b6e5c11458b3dd61af3bbe9c20ba8ea6
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/highlighter.py
@@ -0,0 +1,147 @@
+from abc import ABC, abstractmethod
+from typing import List, Union
+
+from .text import Text
+
+
+def _combine_regex(*regexes: str) -> str:
+    """Combine a number of regexes in to a single regex.
+
+    Returns:
+        str: New regex with all regexes ORed together.
+    """
+    return "|".join(regexes)
+
+
+class Highlighter(ABC):
+    """Abstract base class for highlighters."""
+
+    def __call__(self, text: Union[str, Text]) -> Text:
+        """Highlight a str or Text instance.
+
+        Args:
+            text (Union[str, ~Text]): Text to highlight.
+
+        Raises:
+            TypeError: If not called with text or str.
+
+        Returns:
+            Text: A test instance with highlighting applied.
+        """
+        if isinstance(text, str):
+            highlight_text = Text(text)
+        elif isinstance(text, Text):
+            highlight_text = text.copy()
+        else:
+            raise TypeError(f"str or Text instance required, not {text!r}")
+        self.highlight(highlight_text)
+        return highlight_text
+
+    @abstractmethod
+    def highlight(self, text: Text) -> None:
+        """Apply highlighting in place to text.
+
+        Args:
+            text (~Text): A text object highlight.
+        """
+
+
+class NullHighlighter(Highlighter):
+    """A highlighter object that doesn't highlight.
+
+    May be used to disable highlighting entirely.
+
+    """
+
+    def highlight(self, text: Text) -> None:
+        """Nothing to do"""
+
+
+class RegexHighlighter(Highlighter):
+    """Applies highlighting from a list of regular expressions."""
+
+    highlights: List[str] = []
+    base_style: str = ""
+
+    def highlight(self, text: Text) -> None:
+        """Highlight :class:`rich.text.Text` using regular expressions.
+
+        Args:
+            text (~Text): Text to highlighted.
+
+        """
+
+        highlight_regex = text.highlight_regex
+        for re_highlight in self.highlights:
+            highlight_regex(re_highlight, style_prefix=self.base_style)
+
+
+class ReprHighlighter(RegexHighlighter):
+    """Highlights the text typically produced from ``__repr__`` methods."""
+
+    base_style = "repr."
+    highlights = [
+        r"(?P\<)(?P[\w\-\.\:]*)(?P[\w\W]*?)(?P\>)",
+        r"(?P[\w_]{1,50})=(?P\"?[\w_]+\"?)?",
+        r"(?P[\{\[\(\)\]\}])",
+        _combine_regex(
+            r"(?P[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})",
+            r"(?P([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})",
+            r"(?P(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})",
+            r"(?P(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})",
+            r"(?P[\w\.]*?)\(",
+            r"\b(?PTrue)\b|\b(?PFalse)\b|\b(?PNone)\b",
+            r"(?P\.\.\.)",
+            r"(?P(?\B(\/[\w\.\-\_\+]+)*\/)(?P[\w\.\-\_\+]*)?",
+            r"(?b?\'\'\'.*?(?[a-fA-F0-9]{8}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{12})",
+            r"(?P(file|https|http|ws|wss):\/\/[0-9a-zA-Z\$\-\_\+\!`\(\)\,\.\?\/\;\:\&\=\%\#]*)",
+        ),
+    ]
+
+
+class JSONHighlighter(RegexHighlighter):
+    """Highlights JSON"""
+
+    base_style = "json."
+    highlights = [
+        _combine_regex(
+            r"(?P[\{\[\(\)\]\}])",
+            r"\b(?Ptrue)\b|\b(?Pfalse)\b|\b(?Pnull)\b",
+            r"(?P(?b?\".*?(?b?\".*?(? None:
+        self.live = live
+        self.refresh_per_second = refresh_per_second
+        self.done = Event()
+        super().__init__(daemon=True)
+
+    def stop(self) -> None:
+        self.done.set()
+
+    def run(self) -> None:
+        while not self.done.wait(1 / self.refresh_per_second):
+            with self.live._lock:
+                if not self.done.is_set():
+                    self.live.refresh()
+
+
+class Live(JupyterMixin, RenderHook):
+    """Renders an auto-updating live display of any given renderable.
+
+    Args:
+        renderable (RenderableType, optional): The renderable to live display. Defaults to displaying nothing.
+        console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout.
+        screen (bool, optional): Enable alternate screen mode. Defaults to False.
+        auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()` or `update()` with refresh flag. Defaults to True
+        refresh_per_second (float, optional): Number of times per second to refresh the live display. Defaults to 4.
+        transient (bool, optional): Clear the renderable on exit (has no effect when screen=True). Defaults to False.
+        redirect_stdout (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True.
+        redirect_stderr (bool, optional): Enable redirection of stderr. Defaults to True.
+        vertical_overflow (VerticalOverflowMethod, optional): How to handle renderable when it is too tall for the console. Defaults to "ellipsis".
+        get_renderable (Callable[[], RenderableType], optional): Optional callable to get renderable. Defaults to None.
+    """
+
+    def __init__(
+        self,
+        renderable: Optional[RenderableType] = None,
+        *,
+        console: Optional[Console] = None,
+        screen: bool = False,
+        auto_refresh: bool = True,
+        refresh_per_second: float = 4,
+        transient: bool = False,
+        redirect_stdout: bool = True,
+        redirect_stderr: bool = True,
+        vertical_overflow: VerticalOverflowMethod = "ellipsis",
+        get_renderable: Optional[Callable[[], RenderableType]] = None,
+    ) -> None:
+        assert refresh_per_second > 0, "refresh_per_second must be > 0"
+        self._renderable = renderable
+        self.console = console if console is not None else get_console()
+        self._screen = screen
+        self._alt_screen = False
+
+        self._redirect_stdout = redirect_stdout
+        self._redirect_stderr = redirect_stderr
+        self._restore_stdout: Optional[IO[str]] = None
+        self._restore_stderr: Optional[IO[str]] = None
+
+        self._lock = RLock()
+        self.ipy_widget: Optional[Any] = None
+        self.auto_refresh = auto_refresh
+        self._started: bool = False
+        self.transient = True if screen else transient
+
+        self._refresh_thread: Optional[_RefreshThread] = None
+        self.refresh_per_second = refresh_per_second
+
+        self.vertical_overflow = vertical_overflow
+        self._get_renderable = get_renderable
+        self._live_render = LiveRender(
+            self.get_renderable(), vertical_overflow=vertical_overflow
+        )
+
+    @property
+    def is_started(self) -> bool:
+        """Check if live display has been started."""
+        return self._started
+
+    def get_renderable(self) -> RenderableType:
+        renderable = (
+            self._get_renderable()
+            if self._get_renderable is not None
+            else self._renderable
+        )
+        return renderable or ""
+
+    def start(self, refresh: bool = False) -> None:
+        """Start live rendering display.
+
+        Args:
+            refresh (bool, optional): Also refresh. Defaults to False.
+        """
+        with self._lock:
+            if self._started:
+                return
+            self.console.set_live(self)
+            self._started = True
+            if self._screen:
+                self._alt_screen = self.console.set_alt_screen(True)
+            self.console.show_cursor(False)
+            self._enable_redirect_io()
+            self.console.push_render_hook(self)
+            if refresh:
+                self.refresh()
+            if self.auto_refresh:
+                self._refresh_thread = _RefreshThread(self, self.refresh_per_second)
+                self._refresh_thread.start()
+
+    def stop(self) -> None:
+        """Stop live rendering display."""
+        with self._lock:
+            if not self._started:
+                return
+            self.console.clear_live()
+            self._started = False
+
+            if self.auto_refresh and self._refresh_thread is not None:
+                self._refresh_thread.stop()
+                self._refresh_thread = None
+            # allow it to fully render on the last even if overflow
+            self.vertical_overflow = "visible"
+            with self.console:
+                try:
+                    if not self._alt_screen and not self.console.is_jupyter:
+                        self.refresh()
+                finally:
+                    self._disable_redirect_io()
+                    self.console.pop_render_hook()
+                    if not self._alt_screen and self.console.is_terminal:
+                        self.console.line()
+                    self.console.show_cursor(True)
+                    if self._alt_screen:
+                        self.console.set_alt_screen(False)
+
+                    if self.transient and not self._alt_screen:
+                        self.console.control(self._live_render.restore_cursor())
+                    if self.ipy_widget is not None and self.transient:
+                        self.ipy_widget.close()  # pragma: no cover
+
+    def __enter__(self) -> "Live":
+        self.start(refresh=self._renderable is not None)
+        return self
+
+    def __exit__(
+        self,
+        exc_type: Optional[Type[BaseException]],
+        exc_val: Optional[BaseException],
+        exc_tb: Optional[TracebackType],
+    ) -> None:
+        self.stop()
+
+    def _enable_redirect_io(self) -> None:
+        """Enable redirecting of stdout / stderr."""
+        if self.console.is_terminal or self.console.is_jupyter:
+            if self._redirect_stdout and not isinstance(sys.stdout, FileProxy):
+                self._restore_stdout = sys.stdout
+                sys.stdout = cast("TextIO", FileProxy(self.console, sys.stdout))
+            if self._redirect_stderr and not isinstance(sys.stderr, FileProxy):
+                self._restore_stderr = sys.stderr
+                sys.stderr = cast("TextIO", FileProxy(self.console, sys.stderr))
+
+    def _disable_redirect_io(self) -> None:
+        """Disable redirecting of stdout / stderr."""
+        if self._restore_stdout:
+            sys.stdout = cast("TextIO", self._restore_stdout)
+            self._restore_stdout = None
+        if self._restore_stderr:
+            sys.stderr = cast("TextIO", self._restore_stderr)
+            self._restore_stderr = None
+
+    @property
+    def renderable(self) -> RenderableType:
+        """Get the renderable that is being displayed
+
+        Returns:
+            RenderableType: Displayed renderable.
+        """
+        renderable = self.get_renderable()
+        return Screen(renderable) if self._alt_screen else renderable
+
+    def update(self, renderable: RenderableType, *, refresh: bool = False) -> None:
+        """Update the renderable that is being displayed
+
+        Args:
+            renderable (RenderableType): New renderable to use.
+            refresh (bool, optional): Refresh the display. Defaults to False.
+        """
+        with self._lock:
+            self._renderable = renderable
+            if refresh:
+                self.refresh()
+
+    def refresh(self) -> None:
+        """Update the display of the Live Render."""
+        with self._lock:
+            self._live_render.set_renderable(self.renderable)
+            if self.console.is_jupyter:  # pragma: no cover
+                try:
+                    from IPython.display import display
+                    from ipywidgets import Output
+                except ImportError:
+                    import warnings
+
+                    warnings.warn('install "ipywidgets" for Jupyter support')
+                else:
+                    if self.ipy_widget is None:
+                        self.ipy_widget = Output()
+                        display(self.ipy_widget)
+
+                    with self.ipy_widget:
+                        self.ipy_widget.clear_output(wait=True)
+                        self.console.print(self._live_render.renderable)
+            elif self.console.is_terminal and not self.console.is_dumb_terminal:
+                with self.console:
+                    self.console.print(Control())
+            elif (
+                not self._started and not self.transient
+            ):  # if it is finished allow files or dumb-terminals to see final result
+                with self.console:
+                    self.console.print(Control())
+
+    def process_renderables(
+        self, renderables: List[ConsoleRenderable]
+    ) -> List[ConsoleRenderable]:
+        """Process renderables to restore cursor and display progress."""
+        self._live_render.vertical_overflow = self.vertical_overflow
+        if self.console.is_interactive:
+            # lock needs acquiring as user can modify live_render renderable at any time unlike in Progress.
+            with self._lock:
+                reset = (
+                    Control.home()
+                    if self._alt_screen
+                    else self._live_render.position_cursor()
+                )
+                renderables = [reset, *renderables, self._live_render]
+        elif (
+            not self._started and not self.transient
+        ):  # if it is finished render the final output for files or dumb_terminals
+            renderables = [*renderables, self._live_render]
+
+        return renderables
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import random
+    import time
+    from itertools import cycle
+    from typing import Dict, List, Tuple
+
+    from .align import Align
+    from .console import Console
+    from .live import Live as Live
+    from .panel import Panel
+    from .rule import Rule
+    from .syntax import Syntax
+    from .table import Table
+
+    console = Console()
+
+    syntax = Syntax(
+        '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]:
+    """Iterate and generate a tuple with a flag for last value."""
+    iter_values = iter(values)
+    try:
+        previous_value = next(iter_values)
+    except StopIteration:
+        return
+    for value in iter_values:
+        yield False, previous_value
+        previous_value = value
+    yield True, previous_value''',
+        "python",
+        line_numbers=True,
+    )
+
+    table = Table("foo", "bar", "baz")
+    table.add_row("1", "2", "3")
+
+    progress_renderables = [
+        "You can make the terminal shorter and taller to see the live table hide"
+        "Text may be printed while the progress bars are rendering.",
+        Panel("In fact, [i]any[/i] renderable will work"),
+        "Such as [magenta]tables[/]...",
+        table,
+        "Pretty printed structures...",
+        {"type": "example", "text": "Pretty printed"},
+        "Syntax...",
+        syntax,
+        Rule("Give it a try!"),
+    ]
+
+    examples = cycle(progress_renderables)
+
+    exchanges = [
+        "SGD",
+        "MYR",
+        "EUR",
+        "USD",
+        "AUD",
+        "JPY",
+        "CNH",
+        "HKD",
+        "CAD",
+        "INR",
+        "DKK",
+        "GBP",
+        "RUB",
+        "NZD",
+        "MXN",
+        "IDR",
+        "TWD",
+        "THB",
+        "VND",
+    ]
+    with Live(console=console) as live_table:
+        exchange_rate_dict: Dict[Tuple[str, str], float] = {}
+
+        for index in range(100):
+            select_exchange = exchanges[index % len(exchanges)]
+
+            for exchange in exchanges:
+                if exchange == select_exchange:
+                    continue
+                time.sleep(0.4)
+                if random.randint(0, 10) < 1:
+                    console.log(next(examples))
+                exchange_rate_dict[(select_exchange, exchange)] = 200 / (
+                    (random.random() * 320) + 1
+                )
+                if len(exchange_rate_dict) > len(exchanges) - 1:
+                    exchange_rate_dict.pop(list(exchange_rate_dict.keys())[0])
+                table = Table(title="Exchange Rates")
+
+                table.add_column("Source Currency")
+                table.add_column("Destination Currency")
+                table.add_column("Exchange Rate")
+
+                for ((source, dest), exchange_rate) in exchange_rate_dict.items():
+                    table.add_row(
+                        source,
+                        dest,
+                        Text(
+                            f"{exchange_rate:.4f}",
+                            style="red" if exchange_rate < 1.0 else "green",
+                        ),
+                    )
+
+                live_table.update(Align.center(table))
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/markup.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/markup.py
new file mode 100644
index 0000000000000000000000000000000000000000..619540202cb554f93112b7779c235cf5309d499f
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/markup.py
@@ -0,0 +1,244 @@
+from ast import literal_eval
+from operator import attrgetter
+import re
+from typing import Callable, Iterable, List, Match, NamedTuple, Optional, Tuple, Union
+
+from .errors import MarkupError
+from .style import Style
+from .text import Span, Text
+from .emoji import EmojiVariant
+from ._emoji_replace import _emoji_replace
+
+
+RE_TAGS = re.compile(
+    r"""((\\*)\[([a-z#\/@].*?)\])""",
+    re.VERBOSE,
+)
+
+RE_HANDLER = re.compile(r"^([\w\.]*?)(\(.*?\))?$")
+
+
+class Tag(NamedTuple):
+    """A tag in console markup."""
+
+    name: str
+    """The tag name. e.g. 'bold'."""
+    parameters: Optional[str]
+    """Any additional parameters after the name."""
+
+    def __str__(self) -> str:
+        return (
+            self.name if self.parameters is None else f"{self.name} {self.parameters}"
+        )
+
+    @property
+    def markup(self) -> str:
+        """Get the string representation of this tag."""
+        return (
+            f"[{self.name}]"
+            if self.parameters is None
+            else f"[{self.name}={self.parameters}]"
+        )
+
+
+_ReStringMatch = Match[str]  # regex match object
+_ReSubCallable = Callable[[_ReStringMatch], str]  # Callable invoked by re.sub
+_EscapeSubMethod = Callable[[_ReSubCallable, str], str]  # Sub method of a compiled re
+
+
+def escape(
+    markup: str, _escape: _EscapeSubMethod = re.compile(r"(\\*)(\[[a-z#\/@].*?\])").sub
+) -> str:
+    """Escapes text so that it won't be interpreted as markup.
+
+    Args:
+        markup (str): Content to be inserted in to markup.
+
+    Returns:
+        str: Markup with square brackets escaped.
+    """
+
+    def escape_backslashes(match: Match[str]) -> str:
+        """Called by re.sub replace matches."""
+        backslashes, text = match.groups()
+        return f"{backslashes}{backslashes}\\{text}"
+
+    markup = _escape(escape_backslashes, markup)
+    return markup
+
+
+def _parse(markup: str) -> Iterable[Tuple[int, Optional[str], Optional[Tag]]]:
+    """Parse markup in to an iterable of tuples of (position, text, tag).
+
+    Args:
+        markup (str): A string containing console markup
+
+    """
+    position = 0
+    _divmod = divmod
+    _Tag = Tag
+    for match in RE_TAGS.finditer(markup):
+        full_text, escapes, tag_text = match.groups()
+        start, end = match.span()
+        if start > position:
+            yield start, markup[position:start], None
+        if escapes:
+            backslashes, escaped = _divmod(len(escapes), 2)
+            if backslashes:
+                # Literal backslashes
+                yield start, "\\" * backslashes, None
+                start += backslashes * 2
+            if escaped:
+                # Escape of tag
+                yield start, full_text[len(escapes) :], None
+                position = end
+                continue
+        text, equals, parameters = tag_text.partition("=")
+        yield start, None, _Tag(text, parameters if equals else None)
+        position = end
+    if position < len(markup):
+        yield position, markup[position:], None
+
+
+def render(
+    markup: str,
+    style: Union[str, Style] = "",
+    emoji: bool = True,
+    emoji_variant: Optional[EmojiVariant] = None,
+) -> Text:
+    """Render console markup in to a Text instance.
+
+    Args:
+        markup (str): A string containing console markup.
+        emoji (bool, optional): Also render emoji code. Defaults to True.
+
+    Raises:
+        MarkupError: If there is a syntax error in the markup.
+
+    Returns:
+        Text: A test instance.
+    """
+    emoji_replace = _emoji_replace
+    if "[" not in markup:
+        return Text(
+            emoji_replace(markup, default_variant=emoji_variant) if emoji else markup,
+            style=style,
+        )
+    text = Text(style=style)
+    append = text.append
+    normalize = Style.normalize
+
+    style_stack: List[Tuple[int, Tag]] = []
+    pop = style_stack.pop
+
+    spans: List[Span] = []
+    append_span = spans.append
+
+    _Span = Span
+    _Tag = Tag
+
+    def pop_style(style_name: str) -> Tuple[int, Tag]:
+        """Pop tag matching given style name."""
+        for index, (_, tag) in enumerate(reversed(style_stack), 1):
+            if tag.name == style_name:
+                return pop(-index)
+        raise KeyError(style_name)
+
+    for position, plain_text, tag in _parse(markup):
+        if plain_text is not None:
+            append(emoji_replace(plain_text) if emoji else plain_text)
+        elif tag is not None:
+            if tag.name.startswith("/"):  # Closing tag
+                style_name = tag.name[1:].strip()
+
+                if style_name:  # explicit close
+                    style_name = normalize(style_name)
+                    try:
+                        start, open_tag = pop_style(style_name)
+                    except KeyError:
+                        raise MarkupError(
+                            f"closing tag '{tag.markup}' at position {position} doesn't match any open tag"
+                        ) from None
+                else:  # implicit close
+                    try:
+                        start, open_tag = pop()
+                    except IndexError:
+                        raise MarkupError(
+                            f"closing tag '[/]' at position {position} has nothing to close"
+                        ) from None
+
+                if open_tag.name.startswith("@"):
+                    if open_tag.parameters:
+                        handler_name = ""
+                        parameters = open_tag.parameters.strip()
+                        handler_match = RE_HANDLER.match(parameters)
+                        if handler_match is not None:
+                            handler_name, match_parameters = handler_match.groups()
+                            parameters = (
+                                "()" if match_parameters is None else match_parameters
+                            )
+
+                        try:
+                            meta_params = literal_eval(parameters)
+                        except SyntaxError as error:
+                            raise MarkupError(
+                                f"error parsing {parameters!r} in {open_tag.parameters!r}; {error.msg}"
+                            )
+                        except Exception as error:
+                            raise MarkupError(
+                                f"error parsing {open_tag.parameters!r}; {error}"
+                            ) from None
+
+                        if handler_name:
+                            meta_params = (
+                                handler_name,
+                                meta_params
+                                if isinstance(meta_params, tuple)
+                                else (meta_params,),
+                            )
+
+                    else:
+                        meta_params = ()
+
+                    append_span(
+                        _Span(
+                            start, len(text), Style(meta={open_tag.name: meta_params})
+                        )
+                    )
+                else:
+                    append_span(_Span(start, len(text), str(open_tag)))
+
+            else:  # Opening tag
+                normalized_tag = _Tag(normalize(tag.name), tag.parameters)
+                style_stack.append((len(text), normalized_tag))
+
+    text_length = len(text)
+    while style_stack:
+        start, tag = style_stack.pop()
+        style = str(tag)
+        if style:
+            append_span(_Span(start, text_length, style))
+
+    text.spans = sorted(spans[::-1], key=attrgetter("start"))
+    return text
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    MARKUP = [
+        "[red]Hello World[/red]",
+        "[magenta]Hello [b]World[/b]",
+        "[bold]Bold[italic] bold and italic [/bold]italic[/italic]",
+        "Click [link=https://www.willmcgugan.com]here[/link] to visit my Blog",
+        ":warning-emoji: [bold red blink] DANGER![/]",
+    ]
+
+    from pip._vendor.rich.table import Table
+    from pip._vendor.rich import print
+
+    grid = Table("Markup", "Result", padding=(0, 1))
+
+    for markup in MARKUP:
+        grid.add_row(Text(markup), markup)
+
+    print(grid)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/palette.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/palette.py
new file mode 100644
index 0000000000000000000000000000000000000000..fa0c4dd40381addf5b42fae4228b6d8fef03abd9
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/palette.py
@@ -0,0 +1,100 @@
+from math import sqrt
+from functools import lru_cache
+from typing import Sequence, Tuple, TYPE_CHECKING
+
+from .color_triplet import ColorTriplet
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.table import Table
+
+
+class Palette:
+    """A palette of available colors."""
+
+    def __init__(self, colors: Sequence[Tuple[int, int, int]]):
+        self._colors = colors
+
+    def __getitem__(self, number: int) -> ColorTriplet:
+        return ColorTriplet(*self._colors[number])
+
+    def __rich__(self) -> "Table":
+        from pip._vendor.rich.color import Color
+        from pip._vendor.rich.style import Style
+        from pip._vendor.rich.text import Text
+        from pip._vendor.rich.table import Table
+
+        table = Table(
+            "index",
+            "RGB",
+            "Color",
+            title="Palette",
+            caption=f"{len(self._colors)} colors",
+            highlight=True,
+            caption_justify="right",
+        )
+        for index, color in enumerate(self._colors):
+            table.add_row(
+                str(index),
+                repr(color),
+                Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))),
+            )
+        return table
+
+    # This is somewhat inefficient and needs caching
+    @lru_cache(maxsize=1024)
+    def match(self, color: Tuple[int, int, int]) -> int:
+        """Find a color from a palette that most closely matches a given color.
+
+        Args:
+            color (Tuple[int, int, int]): RGB components in range 0 > 255.
+
+        Returns:
+            int: Index of closes matching color.
+        """
+        red1, green1, blue1 = color
+        _sqrt = sqrt
+        get_color = self._colors.__getitem__
+
+        def get_color_distance(index: int) -> float:
+            """Get the distance to a color."""
+            red2, green2, blue2 = get_color(index)
+            red_mean = (red1 + red2) // 2
+            red = red1 - red2
+            green = green1 - green2
+            blue = blue1 - blue2
+            return _sqrt(
+                (((512 + red_mean) * red * red) >> 8)
+                + 4 * green * green
+                + (((767 - red_mean) * blue * blue) >> 8)
+            )
+
+        min_index = min(range(len(self._colors)), key=get_color_distance)
+        return min_index
+
+
+if __name__ == "__main__":  # pragma: no cover
+    import colorsys
+    from typing import Iterable
+    from pip._vendor.rich.color import Color
+    from pip._vendor.rich.console import Console, ConsoleOptions
+    from pip._vendor.rich.segment import Segment
+    from pip._vendor.rich.style import Style
+
+    class ColorBox:
+        def __rich_console__(
+            self, console: Console, options: ConsoleOptions
+        ) -> Iterable[Segment]:
+            height = console.size.height - 3
+            for y in range(0, height):
+                for x in range(options.max_width):
+                    h = x / options.max_width
+                    l = y / (height + 1)
+                    r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0)
+                    r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0)
+                    bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255)
+                    color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255)
+                    yield Segment("▄", Style(color=color, bgcolor=bgcolor))
+                yield Segment.line()
+
+    console = Console()
+    console.print(ColorBox())
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/panel.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/panel.py
new file mode 100644
index 0000000000000000000000000000000000000000..151fe5f017f855f7df0150508ec0fb53f15abb60
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/panel.py
@@ -0,0 +1,250 @@
+from typing import Optional, TYPE_CHECKING
+
+from .box import Box, ROUNDED
+
+from .align import AlignMethod
+from .jupyter import JupyterMixin
+from .measure import Measurement, measure_renderables
+from .padding import Padding, PaddingDimensions
+from .style import StyleType
+from .text import Text, TextType
+from .segment import Segment
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderableType, RenderResult
+
+
+class Panel(JupyterMixin):
+    """A console renderable that draws a border around its contents.
+
+    Example:
+        >>> console.print(Panel("Hello, World!"))
+
+    Args:
+        renderable (RenderableType): A console renderable object.
+        box (Box, optional): A Box instance that defines the look of the border (see :ref:`appendix_box`.
+            Defaults to box.ROUNDED.
+        safe_box (bool, optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True.
+        expand (bool, optional): If True the panel will stretch to fill the console
+            width, otherwise it will be sized to fit the contents. Defaults to True.
+        style (str, optional): The style of the panel (border and contents). Defaults to "none".
+        border_style (str, optional): The style of the border. Defaults to "none".
+        width (Optional[int], optional): Optional width of panel. Defaults to None to auto-detect.
+        height (Optional[int], optional): Optional height of panel. Defaults to None to auto-detect.
+        padding (Optional[PaddingDimensions]): Optional padding around renderable. Defaults to 0.
+        highlight (bool, optional): Enable automatic highlighting of panel title (if str). Defaults to False.
+    """
+
+    def __init__(
+        self,
+        renderable: "RenderableType",
+        box: Box = ROUNDED,
+        *,
+        title: Optional[TextType] = None,
+        title_align: AlignMethod = "center",
+        subtitle: Optional[TextType] = None,
+        subtitle_align: AlignMethod = "center",
+        safe_box: Optional[bool] = None,
+        expand: bool = True,
+        style: StyleType = "none",
+        border_style: StyleType = "none",
+        width: Optional[int] = None,
+        height: Optional[int] = None,
+        padding: PaddingDimensions = (0, 1),
+        highlight: bool = False,
+    ) -> None:
+        self.renderable = renderable
+        self.box = box
+        self.title = title
+        self.title_align: AlignMethod = title_align
+        self.subtitle = subtitle
+        self.subtitle_align = subtitle_align
+        self.safe_box = safe_box
+        self.expand = expand
+        self.style = style
+        self.border_style = border_style
+        self.width = width
+        self.height = height
+        self.padding = padding
+        self.highlight = highlight
+
+    @classmethod
+    def fit(
+        cls,
+        renderable: "RenderableType",
+        box: Box = ROUNDED,
+        *,
+        title: Optional[TextType] = None,
+        title_align: AlignMethod = "center",
+        subtitle: Optional[TextType] = None,
+        subtitle_align: AlignMethod = "center",
+        safe_box: Optional[bool] = None,
+        style: StyleType = "none",
+        border_style: StyleType = "none",
+        width: Optional[int] = None,
+        padding: PaddingDimensions = (0, 1),
+    ) -> "Panel":
+        """An alternative constructor that sets expand=False."""
+        return cls(
+            renderable,
+            box,
+            title=title,
+            title_align=title_align,
+            subtitle=subtitle,
+            subtitle_align=subtitle_align,
+            safe_box=safe_box,
+            style=style,
+            border_style=border_style,
+            width=width,
+            padding=padding,
+            expand=False,
+        )
+
+    @property
+    def _title(self) -> Optional[Text]:
+        if self.title:
+            title_text = (
+                Text.from_markup(self.title)
+                if isinstance(self.title, str)
+                else self.title.copy()
+            )
+            title_text.end = ""
+            title_text.plain = title_text.plain.replace("\n", " ")
+            title_text.no_wrap = True
+            title_text.expand_tabs()
+            title_text.pad(1)
+            return title_text
+        return None
+
+    @property
+    def _subtitle(self) -> Optional[Text]:
+        if self.subtitle:
+            subtitle_text = (
+                Text.from_markup(self.subtitle)
+                if isinstance(self.subtitle, str)
+                else self.subtitle.copy()
+            )
+            subtitle_text.end = ""
+            subtitle_text.plain = subtitle_text.plain.replace("\n", " ")
+            subtitle_text.no_wrap = True
+            subtitle_text.expand_tabs()
+            subtitle_text.pad(1)
+            return subtitle_text
+        return None
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        _padding = Padding.unpack(self.padding)
+        renderable = (
+            Padding(self.renderable, _padding) if any(_padding) else self.renderable
+        )
+        style = console.get_style(self.style)
+        border_style = style + console.get_style(self.border_style)
+        width = (
+            options.max_width
+            if self.width is None
+            else min(options.max_width, self.width)
+        )
+
+        safe_box: bool = console.safe_box if self.safe_box is None else self.safe_box
+        box = self.box.substitute(options, safe=safe_box)
+
+        title_text = self._title
+        if title_text is not None:
+            title_text.style = border_style
+
+        child_width = (
+            width - 2
+            if self.expand
+            else console.measure(
+                renderable, options=options.update_width(width - 2)
+            ).maximum
+        )
+        child_height = self.height or options.height or None
+        if child_height:
+            child_height -= 2
+        if title_text is not None:
+            child_width = min(
+                options.max_width - 2, max(child_width, title_text.cell_len + 2)
+            )
+
+        width = child_width + 2
+        child_options = options.update(
+            width=child_width, height=child_height, highlight=self.highlight
+        )
+        lines = console.render_lines(renderable, child_options, style=style)
+
+        line_start = Segment(box.mid_left, border_style)
+        line_end = Segment(f"{box.mid_right}", border_style)
+        new_line = Segment.line()
+        if title_text is None or width <= 4:
+            yield Segment(box.get_top([width - 2]), border_style)
+        else:
+            title_text.align(self.title_align, width - 4, character=box.top)
+            yield Segment(box.top_left + box.top, border_style)
+            yield from console.render(title_text)
+            yield Segment(box.top + box.top_right, border_style)
+
+        yield new_line
+        for line in lines:
+            yield line_start
+            yield from line
+            yield line_end
+            yield new_line
+
+        subtitle_text = self._subtitle
+        if subtitle_text is not None:
+            subtitle_text.style = border_style
+
+        if subtitle_text is None or width <= 4:
+            yield Segment(box.get_bottom([width - 2]), border_style)
+        else:
+            subtitle_text.align(self.subtitle_align, width - 4, character=box.bottom)
+            yield Segment(box.bottom_left + box.bottom, border_style)
+            yield from console.render(subtitle_text)
+            yield Segment(box.bottom + box.bottom_right, border_style)
+
+        yield new_line
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        _title = self._title
+        _, right, _, left = Padding.unpack(self.padding)
+        padding = left + right
+        renderables = [self.renderable, _title] if _title else [self.renderable]
+
+        if self.width is None:
+            width = (
+                measure_renderables(
+                    console,
+                    options.update_width(options.max_width - padding - 2),
+                    renderables,
+                ).maximum
+                + padding
+                + 2
+            )
+        else:
+            width = self.width
+        return Measurement(width, width)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from .console import Console
+
+    c = Console()
+
+    from .padding import Padding
+    from .box import ROUNDED, DOUBLE
+
+    p = Panel(
+        "Hello, World!",
+        title="rich.Panel",
+        style="white on blue",
+        box=DOUBLE,
+        padding=1,
+    )
+
+    c.print()
+    c.print(p)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/pretty.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/pretty.py
new file mode 100644
index 0000000000000000000000000000000000000000..606ee33822aff7db27086df4da06d732dcd181b4
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/pretty.py
@@ -0,0 +1,903 @@
+import builtins
+import dataclasses
+import inspect
+import os
+import re
+import sys
+from array import array
+from collections import Counter, UserDict, UserList, defaultdict, deque
+from dataclasses import dataclass, fields, is_dataclass
+from inspect import isclass
+from itertools import islice
+from types import MappingProxyType
+from typing import (
+    TYPE_CHECKING,
+    Any,
+    Callable,
+    DefaultDict,
+    Dict,
+    Iterable,
+    List,
+    Optional,
+    Set,
+    Tuple,
+    Union,
+)
+
+from pip._vendor.rich.repr import RichReprResult
+
+try:
+    import attr as _attr_module
+except ImportError:  # pragma: no cover
+    _attr_module = None  # type: ignore
+
+
+from . import get_console
+from ._loop import loop_last
+from ._pick import pick_bool
+from .abc import RichRenderable
+from .cells import cell_len
+from .highlighter import ReprHighlighter
+from .jupyter import JupyterMixin, JupyterRenderable
+from .measure import Measurement
+from .text import Text
+
+if TYPE_CHECKING:
+    from .console import (
+        Console,
+        ConsoleOptions,
+        HighlighterType,
+        JustifyMethod,
+        OverflowMethod,
+        RenderResult,
+    )
+
+
+def _is_attr_object(obj: Any) -> bool:
+    """Check if an object was created with attrs module."""
+    return _attr_module is not None and _attr_module.has(type(obj))
+
+
+def _get_attr_fields(obj: Any) -> Iterable["_attr_module.Attribute[Any]"]:
+    """Get fields for an attrs object."""
+    return _attr_module.fields(type(obj)) if _attr_module is not None else []
+
+
+def _is_dataclass_repr(obj: object) -> bool:
+    """Check if an instance of a dataclass contains the default repr.
+
+    Args:
+        obj (object): A dataclass instance.
+
+    Returns:
+        bool: True if the default repr is used, False if there is a custom repr.
+    """
+    # Digging in to a lot of internals here
+    # Catching all exceptions in case something is missing on a non CPython implementation
+    try:
+        return obj.__repr__.__code__.co_filename == dataclasses.__file__
+    except Exception:  # pragma: no coverage
+        return False
+
+
+def _ipy_display_hook(
+    value: Any,
+    console: Optional["Console"] = None,
+    overflow: "OverflowMethod" = "ignore",
+    crop: bool = False,
+    indent_guides: bool = False,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+    expand_all: bool = False,
+) -> None:
+    from .console import ConsoleRenderable  # needed here to prevent circular import
+
+    # always skip rich generated jupyter renderables or None values
+    if isinstance(value, JupyterRenderable) or value is None:
+        return
+
+    console = console or get_console()
+    if console.is_jupyter:
+        # Delegate rendering to IPython if the object (and IPython) supports it
+        #  https://ipython.readthedocs.io/en/stable/config/integrating.html#rich-display
+        ipython_repr_methods = [
+            "_repr_html_",
+            "_repr_markdown_",
+            "_repr_json_",
+            "_repr_latex_",
+            "_repr_jpeg_",
+            "_repr_png_",
+            "_repr_svg_",
+            "_repr_mimebundle_",
+        ]
+        for repr_method in ipython_repr_methods:
+            method = getattr(value, repr_method, None)
+            if inspect.ismethod(method):
+                # Calling the method ourselves isn't ideal. The interface for the `_repr_*_` methods
+                #  specifies that if they return None, then they should not be rendered
+                #  by the notebook.
+                try:
+                    repr_result = method()
+                except Exception:
+                    continue  # If the method raises, treat it as if it doesn't exist, try any others
+                if repr_result is not None:
+                    return  # Delegate rendering to IPython
+
+    # certain renderables should start on a new line
+    if isinstance(value, ConsoleRenderable):
+        console.line()
+
+    console.print(
+        value
+        if isinstance(value, RichRenderable)
+        else Pretty(
+            value,
+            overflow=overflow,
+            indent_guides=indent_guides,
+            max_length=max_length,
+            max_string=max_string,
+            expand_all=expand_all,
+            margin=12,
+        ),
+        crop=crop,
+        new_line_start=True,
+    )
+
+
+def install(
+    console: Optional["Console"] = None,
+    overflow: "OverflowMethod" = "ignore",
+    crop: bool = False,
+    indent_guides: bool = False,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+    expand_all: bool = False,
+) -> None:
+    """Install automatic pretty printing in the Python REPL.
+
+    Args:
+        console (Console, optional): Console instance or ``None`` to use global console. Defaults to None.
+        overflow (Optional[OverflowMethod], optional): Overflow method. Defaults to "ignore".
+        crop (Optional[bool], optional): Enable cropping of long lines. Defaults to False.
+        indent_guides (bool, optional): Enable indentation guides. Defaults to False.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None.
+        expand_all (bool, optional): Expand all containers. Defaults to False.
+        max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+    """
+    from pip._vendor.rich import get_console
+
+    console = console or get_console()
+    assert console is not None
+
+    def display_hook(value: Any) -> None:
+        """Replacement sys.displayhook which prettifies objects with Rich."""
+        if value is not None:
+            assert console is not None
+            builtins._ = None  # type: ignore
+            console.print(
+                value
+                if isinstance(value, RichRenderable)
+                else Pretty(
+                    value,
+                    overflow=overflow,
+                    indent_guides=indent_guides,
+                    max_length=max_length,
+                    max_string=max_string,
+                    expand_all=expand_all,
+                ),
+                crop=crop,
+            )
+            builtins._ = value  # type: ignore
+
+    try:  # pragma: no cover
+        ip = get_ipython()  # type: ignore
+        from IPython.core.formatters import BaseFormatter
+
+        class RichFormatter(BaseFormatter):  # type: ignore
+            pprint: bool = True
+
+            def __call__(self, value: Any) -> Any:
+                if self.pprint:
+                    return _ipy_display_hook(
+                        value,
+                        console=get_console(),
+                        overflow=overflow,
+                        indent_guides=indent_guides,
+                        max_length=max_length,
+                        max_string=max_string,
+                        expand_all=expand_all,
+                    )
+                else:
+                    return repr(value)
+
+        # replace plain text formatter with rich formatter
+        rich_formatter = RichFormatter()
+        ip.display_formatter.formatters["text/plain"] = rich_formatter
+    except Exception:
+        sys.displayhook = display_hook
+
+
+class Pretty(JupyterMixin):
+    """A rich renderable that pretty prints an object.
+
+    Args:
+        _object (Any): An object to pretty print.
+        highlighter (HighlighterType, optional): Highlighter object to apply to result, or None for ReprHighlighter. Defaults to None.
+        indent_size (int, optional): Number of spaces in indent. Defaults to 4.
+        justify (JustifyMethod, optional): Justify method, or None for default. Defaults to None.
+        overflow (OverflowMethod, optional): Overflow method, or None for default. Defaults to None.
+        no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to False.
+        indent_guides (bool, optional): Enable indentation guides. Defaults to False.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None.
+        max_depth (int, optional): Maximum depth of nested data structures, or None for no maximum. Defaults to None.
+        expand_all (bool, optional): Expand all containers. Defaults to False.
+        margin (int, optional): Subtrace a margin from width to force containers to expand earlier. Defaults to 0.
+        insert_line (bool, optional): Insert a new line if the output has multiple new lines. Defaults to False.
+    """
+
+    def __init__(
+        self,
+        _object: Any,
+        highlighter: Optional["HighlighterType"] = None,
+        *,
+        indent_size: int = 4,
+        justify: Optional["JustifyMethod"] = None,
+        overflow: Optional["OverflowMethod"] = None,
+        no_wrap: Optional[bool] = False,
+        indent_guides: bool = False,
+        max_length: Optional[int] = None,
+        max_string: Optional[int] = None,
+        max_depth: Optional[int] = None,
+        expand_all: bool = False,
+        margin: int = 0,
+        insert_line: bool = False,
+    ) -> None:
+        self._object = _object
+        self.highlighter = highlighter or ReprHighlighter()
+        self.indent_size = indent_size
+        self.justify: Optional["JustifyMethod"] = justify
+        self.overflow: Optional["OverflowMethod"] = overflow
+        self.no_wrap = no_wrap
+        self.indent_guides = indent_guides
+        self.max_length = max_length
+        self.max_string = max_string
+        self.max_depth = max_depth
+        self.expand_all = expand_all
+        self.margin = margin
+        self.insert_line = insert_line
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        pretty_str = pretty_repr(
+            self._object,
+            max_width=options.max_width - self.margin,
+            indent_size=self.indent_size,
+            max_length=self.max_length,
+            max_string=self.max_string,
+            max_depth=self.max_depth,
+            expand_all=self.expand_all,
+        )
+        pretty_text = Text(
+            pretty_str,
+            justify=self.justify or options.justify,
+            overflow=self.overflow or options.overflow,
+            no_wrap=pick_bool(self.no_wrap, options.no_wrap),
+            style="pretty",
+        )
+        pretty_text = (
+            self.highlighter(pretty_text)
+            if pretty_text
+            else Text(
+                f"{type(self._object)}.__repr__ returned empty string",
+                style="dim italic",
+            )
+        )
+        if self.indent_guides and not options.ascii_only:
+            pretty_text = pretty_text.with_indent_guides(
+                self.indent_size, style="repr.indent"
+            )
+        if self.insert_line and "\n" in pretty_text:
+            yield ""
+        yield pretty_text
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        pretty_str = pretty_repr(
+            self._object,
+            max_width=options.max_width,
+            indent_size=self.indent_size,
+            max_length=self.max_length,
+            max_string=self.max_string,
+        )
+        text_width = (
+            max(cell_len(line) for line in pretty_str.splitlines()) if pretty_str else 0
+        )
+        return Measurement(text_width, text_width)
+
+
+def _get_braces_for_defaultdict(_object: DefaultDict[Any, Any]) -> Tuple[str, str, str]:
+    return (
+        f"defaultdict({_object.default_factory!r}, {{",
+        "})",
+        f"defaultdict({_object.default_factory!r}, {{}})",
+    )
+
+
+def _get_braces_for_array(_object: "array[Any]") -> Tuple[str, str, str]:
+    return (f"array({_object.typecode!r}, [", "])", "array({_object.typecode!r})")
+
+
+_BRACES: Dict[type, Callable[[Any], Tuple[str, str, str]]] = {
+    os._Environ: lambda _object: ("environ({", "})", "environ({})"),
+    array: _get_braces_for_array,
+    defaultdict: _get_braces_for_defaultdict,
+    Counter: lambda _object: ("Counter({", "})", "Counter()"),
+    deque: lambda _object: ("deque([", "])", "deque()"),
+    dict: lambda _object: ("{", "}", "{}"),
+    UserDict: lambda _object: ("{", "}", "{}"),
+    frozenset: lambda _object: ("frozenset({", "})", "frozenset()"),
+    list: lambda _object: ("[", "]", "[]"),
+    UserList: lambda _object: ("[", "]", "[]"),
+    set: lambda _object: ("{", "}", "set()"),
+    tuple: lambda _object: ("(", ")", "()"),
+    MappingProxyType: lambda _object: ("mappingproxy({", "})", "mappingproxy({})"),
+}
+_CONTAINERS = tuple(_BRACES.keys())
+_MAPPING_CONTAINERS = (dict, os._Environ, MappingProxyType, UserDict)
+
+
+def is_expandable(obj: Any) -> bool:
+    """Check if an object may be expanded by pretty print."""
+    return (
+        isinstance(obj, _CONTAINERS)
+        or (is_dataclass(obj))
+        or (hasattr(obj, "__rich_repr__"))
+        or _is_attr_object(obj)
+    ) and not isclass(obj)
+
+
+@dataclass
+class Node:
+    """A node in a repr tree. May be atomic or a container."""
+
+    key_repr: str = ""
+    value_repr: str = ""
+    open_brace: str = ""
+    close_brace: str = ""
+    empty: str = ""
+    last: bool = False
+    is_tuple: bool = False
+    children: Optional[List["Node"]] = None
+    key_separator = ": "
+    separator: str = ", "
+
+    def iter_tokens(self) -> Iterable[str]:
+        """Generate tokens for this node."""
+        if self.key_repr:
+            yield self.key_repr
+            yield self.key_separator
+        if self.value_repr:
+            yield self.value_repr
+        elif self.children is not None:
+            if self.children:
+                yield self.open_brace
+                if self.is_tuple and len(self.children) == 1:
+                    yield from self.children[0].iter_tokens()
+                    yield ","
+                else:
+                    for child in self.children:
+                        yield from child.iter_tokens()
+                        if not child.last:
+                            yield self.separator
+                yield self.close_brace
+            else:
+                yield self.empty
+
+    def check_length(self, start_length: int, max_length: int) -> bool:
+        """Check the length fits within a limit.
+
+        Args:
+            start_length (int): Starting length of the line (indent, prefix, suffix).
+            max_length (int): Maximum length.
+
+        Returns:
+            bool: True if the node can be rendered within max length, otherwise False.
+        """
+        total_length = start_length
+        for token in self.iter_tokens():
+            total_length += cell_len(token)
+            if total_length > max_length:
+                return False
+        return True
+
+    def __str__(self) -> str:
+        repr_text = "".join(self.iter_tokens())
+        return repr_text
+
+    def render(
+        self, max_width: int = 80, indent_size: int = 4, expand_all: bool = False
+    ) -> str:
+        """Render the node to a pretty repr.
+
+        Args:
+            max_width (int, optional): Maximum width of the repr. Defaults to 80.
+            indent_size (int, optional): Size of indents. Defaults to 4.
+            expand_all (bool, optional): Expand all levels. Defaults to False.
+
+        Returns:
+            str: A repr string of the original object.
+        """
+        lines = [_Line(node=self, is_root=True)]
+        line_no = 0
+        while line_no < len(lines):
+            line = lines[line_no]
+            if line.expandable and not line.expanded:
+                if expand_all or not line.check_length(max_width):
+                    lines[line_no : line_no + 1] = line.expand(indent_size)
+            line_no += 1
+
+        repr_str = "\n".join(str(line) for line in lines)
+        return repr_str
+
+
+@dataclass
+class _Line:
+    """A line in repr output."""
+
+    parent: Optional["_Line"] = None
+    is_root: bool = False
+    node: Optional[Node] = None
+    text: str = ""
+    suffix: str = ""
+    whitespace: str = ""
+    expanded: bool = False
+    last: bool = False
+
+    @property
+    def expandable(self) -> bool:
+        """Check if the line may be expanded."""
+        return bool(self.node is not None and self.node.children)
+
+    def check_length(self, max_length: int) -> bool:
+        """Check this line fits within a given number of cells."""
+        start_length = (
+            len(self.whitespace) + cell_len(self.text) + cell_len(self.suffix)
+        )
+        assert self.node is not None
+        return self.node.check_length(start_length, max_length)
+
+    def expand(self, indent_size: int) -> Iterable["_Line"]:
+        """Expand this line by adding children on their own line."""
+        node = self.node
+        assert node is not None
+        whitespace = self.whitespace
+        assert node.children
+        if node.key_repr:
+            new_line = yield _Line(
+                text=f"{node.key_repr}{node.key_separator}{node.open_brace}",
+                whitespace=whitespace,
+            )
+        else:
+            new_line = yield _Line(text=node.open_brace, whitespace=whitespace)
+        child_whitespace = self.whitespace + " " * indent_size
+        tuple_of_one = node.is_tuple and len(node.children) == 1
+        for last, child in loop_last(node.children):
+            separator = "," if tuple_of_one else node.separator
+            line = _Line(
+                parent=new_line,
+                node=child,
+                whitespace=child_whitespace,
+                suffix=separator,
+                last=last and not tuple_of_one,
+            )
+            yield line
+
+        yield _Line(
+            text=node.close_brace,
+            whitespace=whitespace,
+            suffix=self.suffix,
+            last=self.last,
+        )
+
+    def __str__(self) -> str:
+        if self.last:
+            return f"{self.whitespace}{self.text}{self.node or ''}"
+        else:
+            return (
+                f"{self.whitespace}{self.text}{self.node or ''}{self.suffix.rstrip()}"
+            )
+
+
+def traverse(
+    _object: Any,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+    max_depth: Optional[int] = None,
+) -> Node:
+    """Traverse object and generate a tree.
+
+    Args:
+        _object (Any): Object to be traversed.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of string before truncating, or None to disable truncating.
+            Defaults to None.
+        max_depth (int, optional): Maximum depth of data structures, or None for no maximum.
+            Defaults to None.
+
+    Returns:
+        Node: The root of a tree structure which can be used to render a pretty repr.
+    """
+
+    def to_repr(obj: Any) -> str:
+        """Get repr string for an object, but catch errors."""
+        if (
+            max_string is not None
+            and isinstance(obj, (bytes, str))
+            and len(obj) > max_string
+        ):
+            truncated = len(obj) - max_string
+            obj_repr = f"{obj[:max_string]!r}+{truncated}"
+        else:
+            try:
+                obj_repr = repr(obj)
+            except Exception as error:
+                obj_repr = f""
+        return obj_repr
+
+    visited_ids: Set[int] = set()
+    push_visited = visited_ids.add
+    pop_visited = visited_ids.remove
+
+    def _traverse(obj: Any, root: bool = False, depth: int = 0) -> Node:
+        """Walk the object depth first."""
+
+        obj_type = type(obj)
+        py_version = (sys.version_info.major, sys.version_info.minor)
+        children: List[Node]
+        reached_max_depth = max_depth is not None and depth >= max_depth
+
+        def iter_rich_args(rich_args: Any) -> Iterable[Union[Any, Tuple[str, Any]]]:
+            for arg in rich_args:
+                if isinstance(arg, tuple):
+                    if len(arg) == 3:
+                        key, child, default = arg
+                        if default == child:
+                            continue
+                        yield key, child
+                    elif len(arg) == 2:
+                        key, child = arg
+                        yield key, child
+                    elif len(arg) == 1:
+                        yield arg[0]
+                else:
+                    yield arg
+
+        try:
+            fake_attributes = hasattr(
+                obj, "awehoi234_wdfjwljet234_234wdfoijsdfmmnxpi492"
+            )
+        except Exception:
+            fake_attributes = False
+
+        rich_repr_result: Optional[RichReprResult] = None
+        if not fake_attributes:
+            try:
+                if hasattr(obj, "__rich_repr__") and not isclass(obj):
+                    rich_repr_result = obj.__rich_repr__()
+            except Exception:
+                pass
+
+        if rich_repr_result is not None:
+            angular = getattr(obj.__rich_repr__, "angular", False)
+            args = list(iter_rich_args(rich_repr_result))
+            class_name = obj.__class__.__name__
+
+            if args:
+                children = []
+                append = children.append
+
+                if reached_max_depth:
+                    node = Node(value_repr=f"...")
+                else:
+                    if angular:
+                        node = Node(
+                            open_brace=f"<{class_name} ",
+                            close_brace=">",
+                            children=children,
+                            last=root,
+                            separator=" ",
+                        )
+                    else:
+                        node = Node(
+                            open_brace=f"{class_name}(",
+                            close_brace=")",
+                            children=children,
+                            last=root,
+                        )
+                    for last, arg in loop_last(args):
+                        if isinstance(arg, tuple):
+                            key, child = arg
+                            child_node = _traverse(child, depth=depth + 1)
+                            child_node.last = last
+                            child_node.key_repr = key
+                            child_node.key_separator = "="
+                            append(child_node)
+                        else:
+                            child_node = _traverse(arg, depth=depth + 1)
+                            child_node.last = last
+                            append(child_node)
+            else:
+                node = Node(
+                    value_repr=f"<{class_name}>" if angular else f"{class_name}()",
+                    children=[],
+                    last=root,
+                )
+        elif _is_attr_object(obj) and not fake_attributes:
+            children = []
+            append = children.append
+
+            attr_fields = _get_attr_fields(obj)
+            if attr_fields:
+                if reached_max_depth:
+                    node = Node(value_repr=f"...")
+                else:
+                    node = Node(
+                        open_brace=f"{obj.__class__.__name__}(",
+                        close_brace=")",
+                        children=children,
+                        last=root,
+                    )
+
+                    def iter_attrs() -> Iterable[
+                        Tuple[str, Any, Optional[Callable[[Any], str]]]
+                    ]:
+                        """Iterate over attr fields and values."""
+                        for attr in attr_fields:
+                            if attr.repr:
+                                try:
+                                    value = getattr(obj, attr.name)
+                                except Exception as error:
+                                    # Can happen, albeit rarely
+                                    yield (attr.name, error, None)
+                                else:
+                                    yield (
+                                        attr.name,
+                                        value,
+                                        attr.repr if callable(attr.repr) else None,
+                                    )
+
+                    for last, (name, value, repr_callable) in loop_last(iter_attrs()):
+                        if repr_callable:
+                            child_node = Node(value_repr=str(repr_callable(value)))
+                        else:
+                            child_node = _traverse(value, depth=depth + 1)
+                        child_node.last = last
+                        child_node.key_repr = name
+                        child_node.key_separator = "="
+                        append(child_node)
+            else:
+                node = Node(
+                    value_repr=f"{obj.__class__.__name__}()", children=[], last=root
+                )
+
+        elif (
+            is_dataclass(obj)
+            and not isinstance(obj, type)
+            and not fake_attributes
+            and (_is_dataclass_repr(obj) or py_version == (3, 6))
+        ):
+            obj_id = id(obj)
+            if obj_id in visited_ids:
+                # Recursion detected
+                return Node(value_repr="...")
+            push_visited(obj_id)
+
+            children = []
+            append = children.append
+            if reached_max_depth:
+                node = Node(value_repr=f"...")
+            else:
+                node = Node(
+                    open_brace=f"{obj.__class__.__name__}(",
+                    close_brace=")",
+                    children=children,
+                    last=root,
+                )
+
+                for last, field in loop_last(
+                    field for field in fields(obj) if field.repr
+                ):
+                    child_node = _traverse(getattr(obj, field.name), depth=depth + 1)
+                    child_node.key_repr = field.name
+                    child_node.last = last
+                    child_node.key_separator = "="
+                    append(child_node)
+
+                pop_visited(obj_id)
+
+        elif isinstance(obj, _CONTAINERS):
+            for container_type in _CONTAINERS:
+                if isinstance(obj, container_type):
+                    obj_type = container_type
+                    break
+
+            obj_id = id(obj)
+            if obj_id in visited_ids:
+                # Recursion detected
+                return Node(value_repr="...")
+            push_visited(obj_id)
+
+            open_brace, close_brace, empty = _BRACES[obj_type](obj)
+
+            if reached_max_depth:
+                node = Node(value_repr=f"...", last=root)
+            elif obj_type.__repr__ != type(obj).__repr__:
+                node = Node(value_repr=to_repr(obj), last=root)
+            elif obj:
+                children = []
+                node = Node(
+                    open_brace=open_brace,
+                    close_brace=close_brace,
+                    children=children,
+                    last=root,
+                )
+                append = children.append
+                num_items = len(obj)
+                last_item_index = num_items - 1
+
+                if isinstance(obj, _MAPPING_CONTAINERS):
+                    iter_items = iter(obj.items())
+                    if max_length is not None:
+                        iter_items = islice(iter_items, max_length)
+                    for index, (key, child) in enumerate(iter_items):
+                        child_node = _traverse(child, depth=depth + 1)
+                        child_node.key_repr = to_repr(key)
+                        child_node.last = index == last_item_index
+                        append(child_node)
+                else:
+                    iter_values = iter(obj)
+                    if max_length is not None:
+                        iter_values = islice(iter_values, max_length)
+                    for index, child in enumerate(iter_values):
+                        child_node = _traverse(child, depth=depth + 1)
+                        child_node.last = index == last_item_index
+                        append(child_node)
+                if max_length is not None and num_items > max_length:
+                    append(Node(value_repr=f"... +{num_items-max_length}", last=True))
+            else:
+                node = Node(empty=empty, children=[], last=root)
+
+            pop_visited(obj_id)
+        else:
+            node = Node(value_repr=to_repr(obj), last=root)
+        node.is_tuple = isinstance(obj, tuple)
+        return node
+
+    node = _traverse(_object, root=True)
+    return node
+
+
+def pretty_repr(
+    _object: Any,
+    *,
+    max_width: int = 80,
+    indent_size: int = 4,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+    max_depth: Optional[int] = None,
+    expand_all: bool = False,
+) -> str:
+    """Prettify repr string by expanding on to new lines to fit within a given width.
+
+    Args:
+        _object (Any): Object to repr.
+        max_width (int, optional): Desired maximum width of repr string. Defaults to 80.
+        indent_size (int, optional): Number of spaces to indent. Defaults to 4.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of string before truncating, or None to disable truncating.
+            Defaults to None.
+        max_depth (int, optional): Maximum depth of nested data structure, or None for no depth.
+            Defaults to None.
+        expand_all (bool, optional): Expand all containers regardless of available width. Defaults to False.
+
+    Returns:
+        str: A possibly multi-line representation of the object.
+    """
+
+    if isinstance(_object, Node):
+        node = _object
+    else:
+        node = traverse(
+            _object, max_length=max_length, max_string=max_string, max_depth=max_depth
+        )
+    repr_str = node.render(
+        max_width=max_width, indent_size=indent_size, expand_all=expand_all
+    )
+    return repr_str
+
+
+def pprint(
+    _object: Any,
+    *,
+    console: Optional["Console"] = None,
+    indent_guides: bool = True,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+    max_depth: Optional[int] = None,
+    expand_all: bool = False,
+) -> None:
+    """A convenience function for pretty printing.
+
+    Args:
+        _object (Any): Object to pretty print.
+        console (Console, optional): Console instance, or None to use default. Defaults to None.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of strings before truncating, or None to disable. Defaults to None.
+        max_depth (int, optional): Maximum depth for nested data structures, or None for unlimited depth. Defaults to None.
+        indent_guides (bool, optional): Enable indentation guides. Defaults to True.
+        expand_all (bool, optional): Expand all containers. Defaults to False.
+    """
+    _console = get_console() if console is None else console
+    _console.print(
+        Pretty(
+            _object,
+            max_length=max_length,
+            max_string=max_string,
+            max_depth=max_depth,
+            indent_guides=indent_guides,
+            expand_all=expand_all,
+            overflow="ignore",
+        ),
+        soft_wrap=True,
+    )
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    class BrokenRepr:
+        def __repr__(self) -> str:
+            1 / 0
+            return "this will fail"
+
+    d = defaultdict(int)
+    d["foo"] = 5
+    data = {
+        "foo": [
+            1,
+            "Hello World!",
+            100.123,
+            323.232,
+            432324.0,
+            {5, 6, 7, (1, 2, 3, 4), 8},
+        ],
+        "bar": frozenset({1, 2, 3}),
+        "defaultdict": defaultdict(
+            list, {"crumble": ["apple", "rhubarb", "butter", "sugar", "flour"]}
+        ),
+        "counter": Counter(
+            [
+                "apple",
+                "orange",
+                "pear",
+                "kumquat",
+                "kumquat",
+                "durian" * 100,
+            ]
+        ),
+        "atomic": (False, True, None),
+        "Broken": BrokenRepr(),
+    }
+    data["foo"].append(data)  # type: ignore
+
+    from pip._vendor.rich import print
+
+    print(Pretty(data, indent_guides=True, max_string=20))
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/progress_bar.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/progress_bar.py
new file mode 100644
index 0000000000000000000000000000000000000000..1797b5f786eb0d5adb2f5d1e3e5ee0e2b4541eaf
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/progress_bar.py
@@ -0,0 +1,216 @@
+import math
+from functools import lru_cache
+from time import monotonic
+from typing import Iterable, List, Optional
+
+from .color import Color, blend_rgb
+from .color_triplet import ColorTriplet
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleType
+
+# Number of characters before 'pulse' animation repeats
+PULSE_SIZE = 20
+
+
+class ProgressBar(JupyterMixin):
+    """Renders a (progress) bar. Used by rich.progress.
+
+    Args:
+        total (float, optional): Number of steps in the bar. Defaults to 100.
+        completed (float, optional): Number of steps completed. Defaults to 0.
+        width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None.
+        pulse (bool, optional): Enable pulse effect. Defaults to False.
+        style (StyleType, optional): Style for the bar background. Defaults to "bar.back".
+        complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete".
+        finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done".
+        pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse".
+        animation_time (Optional[float], optional): Time in seconds to use for animation, or None to use system time.
+    """
+
+    def __init__(
+        self,
+        total: float = 100.0,
+        completed: float = 0,
+        width: Optional[int] = None,
+        pulse: bool = False,
+        style: StyleType = "bar.back",
+        complete_style: StyleType = "bar.complete",
+        finished_style: StyleType = "bar.finished",
+        pulse_style: StyleType = "bar.pulse",
+        animation_time: Optional[float] = None,
+    ):
+        self.total = total
+        self.completed = completed
+        self.width = width
+        self.pulse = pulse
+        self.style = style
+        self.complete_style = complete_style
+        self.finished_style = finished_style
+        self.pulse_style = pulse_style
+        self.animation_time = animation_time
+
+        self._pulse_segments: Optional[List[Segment]] = None
+
+    def __repr__(self) -> str:
+        return f""
+
+    @property
+    def percentage_completed(self) -> float:
+        """Calculate percentage complete."""
+        completed = (self.completed / self.total) * 100.0
+        completed = min(100, max(0.0, completed))
+        return completed
+
+    @lru_cache(maxsize=16)
+    def _get_pulse_segments(
+        self,
+        fore_style: Style,
+        back_style: Style,
+        color_system: str,
+        no_color: bool,
+        ascii: bool = False,
+    ) -> List[Segment]:
+        """Get a list of segments to render a pulse animation.
+
+        Returns:
+            List[Segment]: A list of segments, one segment per character.
+        """
+        bar = "-" if ascii else "━"
+        segments: List[Segment] = []
+        if color_system not in ("standard", "eight_bit", "truecolor") or no_color:
+            segments += [Segment(bar, fore_style)] * (PULSE_SIZE // 2)
+            segments += [Segment(" " if no_color else bar, back_style)] * (
+                PULSE_SIZE - (PULSE_SIZE // 2)
+            )
+            return segments
+
+        append = segments.append
+        fore_color = (
+            fore_style.color.get_truecolor()
+            if fore_style.color
+            else ColorTriplet(255, 0, 255)
+        )
+        back_color = (
+            back_style.color.get_truecolor()
+            if back_style.color
+            else ColorTriplet(0, 0, 0)
+        )
+        cos = math.cos
+        pi = math.pi
+        _Segment = Segment
+        _Style = Style
+        from_triplet = Color.from_triplet
+
+        for index in range(PULSE_SIZE):
+            position = index / PULSE_SIZE
+            fade = 0.5 + cos((position * pi * 2)) / 2.0
+            color = blend_rgb(fore_color, back_color, cross_fade=fade)
+            append(_Segment(bar, _Style(color=from_triplet(color))))
+        return segments
+
+    def update(self, completed: float, total: Optional[float] = None) -> None:
+        """Update progress with new values.
+
+        Args:
+            completed (float): Number of steps completed.
+            total (float, optional): Total number of steps, or ``None`` to not change. Defaults to None.
+        """
+        self.completed = completed
+        self.total = total if total is not None else self.total
+
+    def _render_pulse(
+        self, console: Console, width: int, ascii: bool = False
+    ) -> Iterable[Segment]:
+        """Renders the pulse animation.
+
+        Args:
+            console (Console): Console instance.
+            width (int): Width in characters of pulse animation.
+
+        Returns:
+            RenderResult: [description]
+
+        Yields:
+            Iterator[Segment]: Segments to render pulse
+        """
+        fore_style = console.get_style(self.pulse_style, default="white")
+        back_style = console.get_style(self.style, default="black")
+
+        pulse_segments = self._get_pulse_segments(
+            fore_style, back_style, console.color_system, console.no_color, ascii=ascii
+        )
+        segment_count = len(pulse_segments)
+        current_time = (
+            monotonic() if self.animation_time is None else self.animation_time
+        )
+        segments = pulse_segments * (int(width / segment_count) + 2)
+        offset = int(-current_time * 15) % segment_count
+        segments = segments[offset : offset + width]
+        yield from segments
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        width = min(self.width or options.max_width, options.max_width)
+        ascii = options.legacy_windows or options.ascii_only
+        if self.pulse:
+            yield from self._render_pulse(console, width, ascii=ascii)
+            return
+
+        completed = min(self.total, max(0, self.completed))
+
+        bar = "-" if ascii else "━"
+        half_bar_right = " " if ascii else "╸"
+        half_bar_left = " " if ascii else "╺"
+        complete_halves = (
+            int(width * 2 * completed / self.total) if self.total else width * 2
+        )
+        bar_count = complete_halves // 2
+        half_bar_count = complete_halves % 2
+        style = console.get_style(self.style)
+        complete_style = console.get_style(
+            self.complete_style if self.completed < self.total else self.finished_style
+        )
+        _Segment = Segment
+        if bar_count:
+            yield _Segment(bar * bar_count, complete_style)
+        if half_bar_count:
+            yield _Segment(half_bar_right * half_bar_count, complete_style)
+
+        if not console.no_color:
+            remaining_bars = width - bar_count - half_bar_count
+            if remaining_bars and console.color_system is not None:
+                if not half_bar_count and bar_count:
+                    yield _Segment(half_bar_left, style)
+                    remaining_bars -= 1
+                if remaining_bars:
+                    yield _Segment(bar * remaining_bars, style)
+
+    def __rich_measure__(
+        self, console: Console, options: ConsoleOptions
+    ) -> Measurement:
+        return (
+            Measurement(self.width, self.width)
+            if self.width is not None
+            else Measurement(4, options.max_width)
+        )
+
+
+if __name__ == "__main__":  # pragma: no cover
+    console = Console()
+    bar = ProgressBar(width=50, total=100)
+
+    import time
+
+    console.show_cursor(False)
+    for n in range(0, 101, 1):
+        bar.update(n)
+        console.print(bar)
+        console.file.write("\r")
+        time.sleep(0.05)
+    console.show_cursor(True)
+    console.print()
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/protocol.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/protocol.py
new file mode 100644
index 0000000000000000000000000000000000000000..6248052119ac68bd6be0e188cbd83ef4b4deffd7
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/protocol.py
@@ -0,0 +1,42 @@
+from typing import Any, Callable, cast, Set, TYPE_CHECKING
+from inspect import isclass
+
+if TYPE_CHECKING:
+    from pip._vendor.rich.console import RenderableType
+
+_GIBBERISH = """aihwerij235234ljsdnp34ksodfipwoe234234jlskjdf"""
+
+
+def is_renderable(check_object: Any) -> bool:
+    """Check if an object may be rendered by Rich."""
+    return (
+        isinstance(check_object, str)
+        or hasattr(check_object, "__rich__")
+        or hasattr(check_object, "__rich_console__")
+    )
+
+
+def rich_cast(renderable: object) -> "RenderableType":
+    """Cast an object to a renderable by calling __rich__ if present.
+
+    Args:
+        renderable (object): A potentially renderable object
+
+    Returns:
+        object: The result of recursively calling __rich__.
+    """
+    from pip._vendor.rich.console import RenderableType
+
+    rich_visited_set: Set[type] = set()  # Prevent potential infinite loop
+    while hasattr(renderable, "__rich__") and not isclass(renderable):
+        # Detect object which claim to have all the attributes
+        if hasattr(renderable, _GIBBERISH):
+            return repr(renderable)
+        cast_method = getattr(renderable, "__rich__")
+        renderable = cast_method()
+        renderable_type = type(renderable)
+        if renderable_type in rich_visited_set:
+            break
+        rich_visited_set.add(renderable_type)
+
+    return cast(RenderableType, renderable)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/rule.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/rule.py
new file mode 100644
index 0000000000000000000000000000000000000000..ce4754f6a8c0de77f1abd6bd61ad5c4dd9882cba
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/rule.py
@@ -0,0 +1,115 @@
+from typing import Union
+
+from .align import AlignMethod
+from .cells import cell_len, set_cell_size
+from .console import Console, ConsoleOptions, RenderResult
+from .jupyter import JupyterMixin
+from .style import Style
+from .text import Text
+
+
+class Rule(JupyterMixin):
+    """A console renderable to draw a horizontal rule (line).
+
+    Args:
+        title (Union[str, Text], optional): Text to render in the rule. Defaults to "".
+        characters (str, optional): Character(s) used to draw the line. Defaults to "─".
+        style (StyleType, optional): Style of Rule. Defaults to "rule.line".
+        end (str, optional): Character at end of Rule. defaults to "\\\\n"
+        align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center".
+    """
+
+    def __init__(
+        self,
+        title: Union[str, Text] = "",
+        *,
+        characters: str = "─",
+        style: Union[str, Style] = "rule.line",
+        end: str = "\n",
+        align: AlignMethod = "center",
+    ) -> None:
+        if cell_len(characters) < 1:
+            raise ValueError(
+                "'characters' argument must have a cell width of at least 1"
+            )
+        if align not in ("left", "center", "right"):
+            raise ValueError(
+                f'invalid value for align, expected "left", "center", "right" (not {align!r})'
+            )
+        self.title = title
+        self.characters = characters
+        self.style = style
+        self.end = end
+        self.align = align
+
+    def __repr__(self) -> str:
+        return f"Rule({self.title!r}, {self.characters!r})"
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        width = options.max_width
+
+        # Python3.6 doesn't have an isascii method on str
+        isascii = getattr(str, "isascii", None) or (
+            lambda s: all(ord(c) < 128 for c in s)
+        )
+        characters = (
+            "-"
+            if (options.ascii_only and not isascii(self.characters))
+            else self.characters
+        )
+
+        chars_len = cell_len(characters)
+        if not self.title:
+            rule_text = Text(characters * ((width // chars_len) + 1), self.style)
+            rule_text.truncate(width)
+            rule_text.plain = set_cell_size(rule_text.plain, width)
+            yield rule_text
+            return
+
+        if isinstance(self.title, Text):
+            title_text = self.title
+        else:
+            title_text = console.render_str(self.title, style="rule.text")
+
+        title_text.plain = title_text.plain.replace("\n", " ")
+        title_text.expand_tabs()
+        rule_text = Text(end=self.end)
+
+        if self.align == "center":
+            title_text.truncate(width - 4, overflow="ellipsis")
+            side_width = (width - cell_len(title_text.plain)) // 2
+            left = Text(characters * (side_width // chars_len + 1))
+            left.truncate(side_width - 1)
+            right_length = width - cell_len(left.plain) - cell_len(title_text.plain)
+            right = Text(characters * (side_width // chars_len + 1))
+            right.truncate(right_length)
+            rule_text.append(left.plain + " ", self.style)
+            rule_text.append(title_text)
+            rule_text.append(" " + right.plain, self.style)
+        elif self.align == "left":
+            title_text.truncate(width - 2, overflow="ellipsis")
+            rule_text.append(title_text)
+            rule_text.append(" ")
+            rule_text.append(characters * (width - rule_text.cell_len), self.style)
+        elif self.align == "right":
+            title_text.truncate(width - 2, overflow="ellipsis")
+            rule_text.append(characters * (width - title_text.cell_len - 1), self.style)
+            rule_text.append(" ")
+            rule_text.append(title_text)
+
+        rule_text.plain = set_cell_size(rule_text.plain, width)
+        yield rule_text
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+    import sys
+
+    try:
+        text = sys.argv[1]
+    except IndexError:
+        text = "Hello, World"
+    console = Console()
+    console.print(Rule(title=text))
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/scope.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/scope.py
new file mode 100644
index 0000000000000000000000000000000000000000..6822b8ca5429db9785881dd30e3964a655a64a88
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/scope.py
@@ -0,0 +1,86 @@
+from collections.abc import Mapping
+from typing import TYPE_CHECKING, Any, Optional, Tuple
+
+from .highlighter import ReprHighlighter
+from .panel import Panel
+from .pretty import Pretty
+from .table import Table
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import ConsoleRenderable
+
+
+def render_scope(
+    scope: "Mapping[str, Any]",
+    *,
+    title: Optional[TextType] = None,
+    sort_keys: bool = True,
+    indent_guides: bool = False,
+    max_length: Optional[int] = None,
+    max_string: Optional[int] = None,
+) -> "ConsoleRenderable":
+    """Render python variables in a given scope.
+
+    Args:
+        scope (Mapping): A mapping containing variable names and values.
+        title (str, optional): Optional title. Defaults to None.
+        sort_keys (bool, optional): Enable sorting of items. Defaults to True.
+        indent_guides (bool, optional): Enable indentaton guides. Defaults to False.
+        max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to None.
+        max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None.
+
+    Returns:
+        ConsoleRenderable: A renderable object.
+    """
+    highlighter = ReprHighlighter()
+    items_table = Table.grid(padding=(0, 1), expand=False)
+    items_table.add_column(justify="right")
+
+    def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]:
+        """Sort special variables first, then alphabetically."""
+        key, _ = item
+        return (not key.startswith("__"), key.lower())
+
+    items = sorted(scope.items(), key=sort_items) if sort_keys else scope.items()
+    for key, value in items:
+        key_text = Text.assemble(
+            (key, "scope.key.special" if key.startswith("__") else "scope.key"),
+            (" =", "scope.equals"),
+        )
+        items_table.add_row(
+            key_text,
+            Pretty(
+                value,
+                highlighter=highlighter,
+                indent_guides=indent_guides,
+                max_length=max_length,
+                max_string=max_string,
+            ),
+        )
+    return Panel.fit(
+        items_table,
+        title=title,
+        border_style="scope.border",
+        padding=(0, 1),
+    )
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich import print
+
+    print()
+
+    def test(foo: float, bar: float) -> None:
+        list_of_things = [1, 2, 3, None, 4, True, False, "Hello World"]
+        dict_of_things = {
+            "version": "1.1",
+            "method": "confirmFruitPurchase",
+            "params": [["apple", "orange", "mangoes", "pomelo"], 1.123],
+            "id": "194521489",
+        }
+        print(render_scope(locals(), title="[i]locals", sort_keys=False))
+
+    test(20.3423, 3.1427)
+    print()
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/segment.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/segment.py
new file mode 100644
index 0000000000000000000000000000000000000000..94ca73076d8ec9c7a6d47e401736dad084070437
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/segment.py
@@ -0,0 +1,720 @@
+from enum import IntEnum
+from functools import lru_cache
+from itertools import filterfalse
+from logging import getLogger
+from operator import attrgetter
+from typing import (
+    TYPE_CHECKING,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Tuple,
+    Type,
+    Union,
+)
+
+from .cells import (
+    _is_single_cell_widths,
+    cell_len,
+    get_character_cell_size,
+    set_cell_size,
+)
+from .repr import Result, rich_repr
+from .style import Style
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult
+
+log = getLogger("rich")
+
+
+class ControlType(IntEnum):
+    """Non-printable control codes which typically translate to ANSI codes."""
+
+    BELL = 1
+    CARRIAGE_RETURN = 2
+    HOME = 3
+    CLEAR = 4
+    SHOW_CURSOR = 5
+    HIDE_CURSOR = 6
+    ENABLE_ALT_SCREEN = 7
+    DISABLE_ALT_SCREEN = 8
+    CURSOR_UP = 9
+    CURSOR_DOWN = 10
+    CURSOR_FORWARD = 11
+    CURSOR_BACKWARD = 12
+    CURSOR_MOVE_TO_COLUMN = 13
+    CURSOR_MOVE_TO = 14
+    ERASE_IN_LINE = 15
+
+
+ControlCode = Union[
+    Tuple[ControlType], Tuple[ControlType, int], Tuple[ControlType, int, int]
+]
+
+
+@rich_repr()
+class Segment(NamedTuple):
+    """A piece of text with associated style. Segments are produced by the Console render process and
+    are ultimately converted in to strings to be written to the terminal.
+
+    Args:
+        text (str): A piece of text.
+        style (:class:`~rich.style.Style`, optional): An optional style to apply to the text.
+        control (Tuple[ControlCode..], optional): Optional sequence of control codes.
+    """
+
+    text: str = ""
+    """Raw text."""
+    style: Optional[Style] = None
+    """An optional style."""
+    control: Optional[Sequence[ControlCode]] = None
+    """Optional sequence of control codes."""
+
+    def __rich_repr__(self) -> Result:
+        yield self.text
+        if self.control is None:
+            if self.style is not None:
+                yield self.style
+        else:
+            yield self.style
+            yield self.control
+
+    def __bool__(self) -> bool:
+        """Check if the segment contains text."""
+        return bool(self.text)
+
+    @property
+    def cell_length(self) -> int:
+        """Get cell length of segment."""
+        return 0 if self.control else cell_len(self.text)
+
+    @property
+    def is_control(self) -> bool:
+        """Check if the segment contains control codes."""
+        return self.control is not None
+
+    @classmethod
+    @lru_cache(1024 * 16)
+    def _split_cells(cls, segment: "Segment", cut: int) -> Tuple["Segment", "Segment"]:  # type: ignore
+
+        text, style, control = segment
+        _Segment = Segment
+
+        cell_length = segment.cell_length
+        if cut >= cell_length:
+            return segment, _Segment("", style, control)
+
+        cell_size = get_character_cell_size
+
+        pos = int((cut / cell_length) * len(text))
+
+        before = text[:pos]
+        cell_pos = cell_len(before)
+        if cell_pos == cut:
+            return (
+                _Segment(before, style, control),
+                _Segment(text[pos:], style, control),
+            )
+        while pos < len(text):
+            char = text[pos]
+            pos += 1
+            cell_pos += cell_size(char)
+            before = text[:pos]
+            if cell_pos == cut:
+                return (
+                    _Segment(before, style, control),
+                    _Segment(text[pos:], style, control),
+                )
+            if cell_pos > cut:
+                return (
+                    _Segment(before[: pos - 1] + " ", style, control),
+                    _Segment(" " + text[pos:], style, control),
+                )
+
+    def split_cells(self, cut: int) -> Tuple["Segment", "Segment"]:
+        """Split segment in to two segments at the specified column.
+
+        If the cut point falls in the middle of a 2-cell wide character then it is replaced
+        by two spaces, to preserve the display width of the parent segment.
+
+        Returns:
+            Tuple[Segment, Segment]: Two segments.
+        """
+        text, style, control = self
+
+        if _is_single_cell_widths(text):
+            # Fast path with all 1 cell characters
+            if cut >= len(text):
+                return self, Segment("", style, control)
+            return (
+                Segment(text[:cut], style, control),
+                Segment(text[cut:], style, control),
+            )
+
+        return self._split_cells(self, cut)
+
+    @classmethod
+    def line(cls) -> "Segment":
+        """Make a new line segment."""
+        return cls("\n")
+
+    @classmethod
+    def apply_style(
+        cls,
+        segments: Iterable["Segment"],
+        style: Optional[Style] = None,
+        post_style: Optional[Style] = None,
+    ) -> Iterable["Segment"]:
+        """Apply style(s) to an iterable of segments.
+
+        Returns an iterable of segments where the style is replaced by ``style + segment.style + post_style``.
+
+        Args:
+            segments (Iterable[Segment]): Segments to process.
+            style (Style, optional): Base style. Defaults to None.
+            post_style (Style, optional): Style to apply on top of segment style. Defaults to None.
+
+        Returns:
+            Iterable[Segments]: A new iterable of segments (possibly the same iterable).
+        """
+        result_segments = segments
+        if style:
+            apply = style.__add__
+            result_segments = (
+                cls(text, None if control else apply(_style), control)
+                for text, _style, control in result_segments
+            )
+        if post_style:
+            result_segments = (
+                cls(
+                    text,
+                    (
+                        None
+                        if control
+                        else (_style + post_style if _style else post_style)
+                    ),
+                    control,
+                )
+                for text, _style, control in result_segments
+            )
+        return result_segments
+
+    @classmethod
+    def filter_control(
+        cls, segments: Iterable["Segment"], is_control: bool = False
+    ) -> Iterable["Segment"]:
+        """Filter segments by ``is_control`` attribute.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of Segment instances.
+            is_control (bool, optional): is_control flag to match in search.
+
+        Returns:
+            Iterable[Segment]: And iterable of Segment instances.
+
+        """
+        if is_control:
+            return filter(attrgetter("control"), segments)
+        else:
+            return filterfalse(attrgetter("control"), segments)
+
+    @classmethod
+    def split_lines(cls, segments: Iterable["Segment"]) -> Iterable[List["Segment"]]:
+        """Split a sequence of segments in to a list of lines.
+
+        Args:
+            segments (Iterable[Segment]): Segments potentially containing line feeds.
+
+        Yields:
+            Iterable[List[Segment]]: Iterable of segment lists, one per line.
+        """
+        line: List[Segment] = []
+        append = line.append
+
+        for segment in segments:
+            if "\n" in segment.text and not segment.control:
+                text, style, _ = segment
+                while text:
+                    _text, new_line, text = text.partition("\n")
+                    if _text:
+                        append(cls(_text, style))
+                    if new_line:
+                        yield line
+                        line = []
+                        append = line.append
+            else:
+                append(segment)
+        if line:
+            yield line
+
+    @classmethod
+    def split_and_crop_lines(
+        cls,
+        segments: Iterable["Segment"],
+        length: int,
+        style: Optional[Style] = None,
+        pad: bool = True,
+        include_new_lines: bool = True,
+    ) -> Iterable[List["Segment"]]:
+        """Split segments in to lines, and crop lines greater than a given length.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of segments, probably
+                generated from console.render.
+            length (int): Desired line length.
+            style (Style, optional): Style to use for any padding.
+            pad (bool): Enable padding of lines that are less than `length`.
+
+        Returns:
+            Iterable[List[Segment]]: An iterable of lines of segments.
+        """
+        line: List[Segment] = []
+        append = line.append
+
+        adjust_line_length = cls.adjust_line_length
+        new_line_segment = cls("\n")
+
+        for segment in segments:
+            if "\n" in segment.text and not segment.control:
+                text, style, _ = segment
+                while text:
+                    _text, new_line, text = text.partition("\n")
+                    if _text:
+                        append(cls(_text, style))
+                    if new_line:
+                        cropped_line = adjust_line_length(
+                            line, length, style=style, pad=pad
+                        )
+                        if include_new_lines:
+                            cropped_line.append(new_line_segment)
+                        yield cropped_line
+                        del line[:]
+            else:
+                append(segment)
+        if line:
+            yield adjust_line_length(line, length, style=style, pad=pad)
+
+    @classmethod
+    def adjust_line_length(
+        cls,
+        line: List["Segment"],
+        length: int,
+        style: Optional[Style] = None,
+        pad: bool = True,
+    ) -> List["Segment"]:
+        """Adjust a line to a given width (cropping or padding as required).
+
+        Args:
+            segments (Iterable[Segment]): A list of segments in a single line.
+            length (int): The desired width of the line.
+            style (Style, optional): The style of padding if used (space on the end). Defaults to None.
+            pad (bool, optional): Pad lines with spaces if they are shorter than `length`. Defaults to True.
+
+        Returns:
+            List[Segment]: A line of segments with the desired length.
+        """
+        line_length = sum(segment.cell_length for segment in line)
+        new_line: List[Segment]
+
+        if line_length < length:
+            if pad:
+                new_line = line + [cls(" " * (length - line_length), style)]
+            else:
+                new_line = line[:]
+        elif line_length > length:
+            new_line = []
+            append = new_line.append
+            line_length = 0
+            for segment in line:
+                segment_length = segment.cell_length
+                if line_length + segment_length < length or segment.control:
+                    append(segment)
+                    line_length += segment_length
+                else:
+                    text, segment_style, _ = segment
+                    text = set_cell_size(text, length - line_length)
+                    append(cls(text, segment_style))
+                    break
+        else:
+            new_line = line[:]
+        return new_line
+
+    @classmethod
+    def get_line_length(cls, line: List["Segment"]) -> int:
+        """Get the length of list of segments.
+
+        Args:
+            line (List[Segment]): A line encoded as a list of Segments (assumes no '\\\\n' characters),
+
+        Returns:
+            int: The length of the line.
+        """
+        _cell_len = cell_len
+        return sum(_cell_len(segment.text) for segment in line)
+
+    @classmethod
+    def get_shape(cls, lines: List[List["Segment"]]) -> Tuple[int, int]:
+        """Get the shape (enclosing rectangle) of a list of lines.
+
+        Args:
+            lines (List[List[Segment]]): A list of lines (no '\\\\n' characters).
+
+        Returns:
+            Tuple[int, int]: Width and height in characters.
+        """
+        get_line_length = cls.get_line_length
+        max_width = max(get_line_length(line) for line in lines) if lines else 0
+        return (max_width, len(lines))
+
+    @classmethod
+    def set_shape(
+        cls,
+        lines: List[List["Segment"]],
+        width: int,
+        height: Optional[int] = None,
+        style: Optional[Style] = None,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Set the shape of a list of lines (enclosing rectangle).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style, optional): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        _height = height or len(lines)
+
+        blank = (
+            [cls(" " * width + "\n", style)] if new_lines else [cls(" " * width, style)]
+        )
+
+        adjust_line_length = cls.adjust_line_length
+        shaped_lines = lines[:_height]
+        shaped_lines[:] = [
+            adjust_line_length(line, width, style=style) for line in lines
+        ]
+        if len(shaped_lines) < _height:
+            shaped_lines.extend([blank] * (_height - len(shaped_lines)))
+        return shaped_lines
+
+    @classmethod
+    def align_top(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns lines to top (adds extra lines to bottom as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        lines = lines + [[blank]] * extra_lines
+        return lines
+
+    @classmethod
+    def align_bottom(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns render to bottom (adds extra lines above as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added. Defaults to None.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        lines = [[blank]] * extra_lines + lines
+        return lines
+
+    @classmethod
+    def align_middle(
+        cls: Type["Segment"],
+        lines: List[List["Segment"]],
+        width: int,
+        height: int,
+        style: Style,
+        new_lines: bool = False,
+    ) -> List[List["Segment"]]:
+        """Aligns lines to middle (adds extra lines to above and below as required).
+
+        Args:
+            lines (List[List[Segment]]): A list of lines.
+            width (int): Desired width.
+            height (int, optional): Desired height or None for no change.
+            style (Style): Style of any padding added.
+            new_lines (bool, optional): Padded lines should include "\n". Defaults to False.
+
+        Returns:
+            List[List[Segment]]: New list of lines.
+        """
+        extra_lines = height - len(lines)
+        if not extra_lines:
+            return lines[:]
+        lines = lines[:height]
+        blank = cls(" " * width + "\n", style) if new_lines else cls(" " * width, style)
+        top_lines = extra_lines // 2
+        bottom_lines = extra_lines - top_lines
+        lines = [[blank]] * top_lines + lines + [[blank]] * bottom_lines
+        return lines
+
+    @classmethod
+    def simplify(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Simplify an iterable of segments by combining contiguous segments with the same style.
+
+        Args:
+            segments (Iterable[Segment]): An iterable of segments.
+
+        Returns:
+            Iterable[Segment]: A possibly smaller iterable of segments that will render the same way.
+        """
+        iter_segments = iter(segments)
+        try:
+            last_segment = next(iter_segments)
+        except StopIteration:
+            return
+
+        _Segment = Segment
+        for segment in iter_segments:
+            if last_segment.style == segment.style and not segment.control:
+                last_segment = _Segment(
+                    last_segment.text + segment.text, last_segment.style
+                )
+            else:
+                yield last_segment
+                last_segment = segment
+        yield last_segment
+
+    @classmethod
+    def strip_links(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all links from an iterable of styles.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with link removed.
+        """
+        for segment in segments:
+            if segment.control or segment.style is None:
+                yield segment
+            else:
+                text, style, _control = segment
+                yield cls(text, style.update_link(None) if style else None)
+
+    @classmethod
+    def strip_styles(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all styles from an iterable of segments.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with styles replace with None
+        """
+        for text, _style, control in segments:
+            yield cls(text, None, control)
+
+    @classmethod
+    def remove_color(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]:
+        """Remove all color from an iterable of segments.
+
+        Args:
+            segments (Iterable[Segment]): An iterable segments.
+
+        Yields:
+            Segment: Segments with colorless style.
+        """
+
+        cache: Dict[Style, Style] = {}
+        for text, style, control in segments:
+            if style:
+                colorless_style = cache.get(style)
+                if colorless_style is None:
+                    colorless_style = style.without_color
+                    cache[style] = colorless_style
+                yield cls(text, colorless_style, control)
+            else:
+                yield cls(text, None, control)
+
+    @classmethod
+    def divide(
+        cls, segments: Iterable["Segment"], cuts: Iterable[int]
+    ) -> Iterable[List["Segment"]]:
+        """Divides an iterable of segments in to portions.
+
+        Args:
+            cuts (Iterable[int]): Cell positions where to divide.
+
+        Yields:
+            [Iterable[List[Segment]]]: An iterable of Segments in List.
+        """
+        split_segments: List["Segment"] = []
+        add_segment = split_segments.append
+
+        iter_cuts = iter(cuts)
+
+        while True:
+            try:
+                cut = next(iter_cuts)
+            except StopIteration:
+                return []
+            if cut != 0:
+                break
+            yield []
+        pos = 0
+
+        for segment in segments:
+            while segment.text:
+                end_pos = pos + segment.cell_length
+                if end_pos < cut:
+                    add_segment(segment)
+                    pos = end_pos
+                    break
+
+                try:
+                    if end_pos == cut:
+                        add_segment(segment)
+                        yield split_segments[:]
+                        del split_segments[:]
+                        pos = end_pos
+                        break
+                    else:
+                        before, segment = segment.split_cells(cut - pos)
+                        add_segment(before)
+                        yield split_segments[:]
+                        del split_segments[:]
+                        pos = cut
+                finally:
+                    try:
+                        cut = next(iter_cuts)
+                    except StopIteration:
+                        if split_segments:
+                            yield split_segments[:]
+                        return
+        yield split_segments[:]
+
+
+class Segments:
+    """A simple renderable to render an iterable of segments. This class may be useful if
+    you want to print segments outside of a __rich_console__ method.
+
+    Args:
+        segments (Iterable[Segment]): An iterable of segments.
+        new_lines (bool, optional): Add new lines between segments. Defaults to False.
+    """
+
+    def __init__(self, segments: Iterable[Segment], new_lines: bool = False) -> None:
+        self.segments = list(segments)
+        self.new_lines = new_lines
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.new_lines:
+            line = Segment.line()
+            for segment in self.segments:
+                yield segment
+                yield line
+        else:
+            yield from self.segments
+
+
+class SegmentLines:
+    def __init__(self, lines: Iterable[List[Segment]], new_lines: bool = False) -> None:
+        """A simple renderable containing a number of lines of segments. May be used as an intermediate
+        in rendering process.
+
+        Args:
+            lines (Iterable[List[Segment]]): Lists of segments forming lines.
+            new_lines (bool, optional): Insert new lines after each line. Defaults to False.
+        """
+        self.lines = list(lines)
+        self.new_lines = new_lines
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        if self.new_lines:
+            new_line = Segment.line()
+            for line in self.lines:
+                yield from line
+                yield new_line
+        else:
+            for line in self.lines:
+                yield from line
+
+
+if __name__ == "__main__":
+
+    if __name__ == "__main__":  # pragma: no cover
+        from pip._vendor.rich.console import Console
+        from pip._vendor.rich.syntax import Syntax
+        from pip._vendor.rich.text import Text
+
+        code = """from rich.console import Console
+    console = Console()
+    text = Text.from_markup("Hello, [bold magenta]World[/]!")
+    console.print(text)"""
+
+        text = Text.from_markup("Hello, [bold magenta]World[/]!")
+
+        console = Console()
+
+        console.rule("rich.Segment")
+        console.print(
+            "A Segment is the last step in the Rich render process before generating text with ANSI codes."
+        )
+        console.print("\nConsider the following code:\n")
+        console.print(Syntax(code, "python", line_numbers=True))
+        console.print()
+        console.print(
+            "When you call [b]print()[/b], Rich [i]renders[/i] the object in to the the following:\n"
+        )
+        fragments = list(console.render(text))
+        console.print(fragments)
+        console.print()
+        console.print(
+            "The Segments are then processed to produce the following output:\n"
+        )
+        console.print(text)
+        console.print(
+            "\nYou will only need to know this if you are implementing your own Rich renderables."
+        )
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/styled.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/styled.py
new file mode 100644
index 0000000000000000000000000000000000000000..91cd0db31c14e30d4c1e2e9f36382b7a5e022870
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/styled.py
@@ -0,0 +1,42 @@
+from typing import TYPE_CHECKING
+
+from .measure import Measurement
+from .segment import Segment
+from .style import StyleType
+
+if TYPE_CHECKING:
+    from .console import Console, ConsoleOptions, RenderResult, RenderableType
+
+
+class Styled:
+    """Apply a style to a renderable.
+
+    Args:
+        renderable (RenderableType): Any renderable.
+        style (StyleType): A style to apply across the entire renderable.
+    """
+
+    def __init__(self, renderable: "RenderableType", style: "StyleType") -> None:
+        self.renderable = renderable
+        self.style = style
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+        style = console.get_style(self.style)
+        rendered_segments = console.render(self.renderable, options)
+        segments = Segment.apply_style(rendered_segments, style)
+        return segments
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        return Measurement.get(console, options, self.renderable)
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich import print
+    from pip._vendor.rich.panel import Panel
+
+    panel = Styled(Panel("hello"), "on blue")
+    print(panel)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/syntax.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/syntax.py
new file mode 100644
index 0000000000000000000000000000000000000000..58cc1037fae77d5d71f3280a73a2cf2cbdbb1ac9
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/syntax.py
@@ -0,0 +1,735 @@
+import os.path
+import platform
+from pip._vendor.rich.containers import Lines
+import textwrap
+from abc import ABC, abstractmethod
+from typing import Any, Dict, Iterable, List, Optional, Set, Tuple, Type, Union
+
+from pip._vendor.pygments.lexer import Lexer
+from pip._vendor.pygments.lexers import get_lexer_by_name, guess_lexer_for_filename
+from pip._vendor.pygments.style import Style as PygmentsStyle
+from pip._vendor.pygments.styles import get_style_by_name
+from pip._vendor.pygments.token import (
+    Comment,
+    Error,
+    Generic,
+    Keyword,
+    Name,
+    Number,
+    Operator,
+    String,
+    Token,
+    Whitespace,
+)
+from pip._vendor.pygments.util import ClassNotFound
+
+from ._loop import loop_first
+from .color import Color, blend_rgb
+from .console import Console, ConsoleOptions, JustifyMethod, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style
+from .text import Text
+
+TokenType = Tuple[str, ...]
+
+WINDOWS = platform.system() == "Windows"
+DEFAULT_THEME = "monokai"
+
+# The following styles are based on https://github.com/pygments/pygments/blob/master/pygments/formatters/terminal.py
+# A few modifications were made
+
+ANSI_LIGHT: Dict[TokenType, Style] = {
+    Token: Style(),
+    Whitespace: Style(color="white"),
+    Comment: Style(dim=True),
+    Comment.Preproc: Style(color="cyan"),
+    Keyword: Style(color="blue"),
+    Keyword.Type: Style(color="cyan"),
+    Operator.Word: Style(color="magenta"),
+    Name.Builtin: Style(color="cyan"),
+    Name.Function: Style(color="green"),
+    Name.Namespace: Style(color="cyan", underline=True),
+    Name.Class: Style(color="green", underline=True),
+    Name.Exception: Style(color="cyan"),
+    Name.Decorator: Style(color="magenta", bold=True),
+    Name.Variable: Style(color="red"),
+    Name.Constant: Style(color="red"),
+    Name.Attribute: Style(color="cyan"),
+    Name.Tag: Style(color="bright_blue"),
+    String: Style(color="yellow"),
+    Number: Style(color="blue"),
+    Generic.Deleted: Style(color="bright_red"),
+    Generic.Inserted: Style(color="green"),
+    Generic.Heading: Style(bold=True),
+    Generic.Subheading: Style(color="magenta", bold=True),
+    Generic.Prompt: Style(bold=True),
+    Generic.Error: Style(color="bright_red"),
+    Error: Style(color="red", underline=True),
+}
+
+ANSI_DARK: Dict[TokenType, Style] = {
+    Token: Style(),
+    Whitespace: Style(color="bright_black"),
+    Comment: Style(dim=True),
+    Comment.Preproc: Style(color="bright_cyan"),
+    Keyword: Style(color="bright_blue"),
+    Keyword.Type: Style(color="bright_cyan"),
+    Operator.Word: Style(color="bright_magenta"),
+    Name.Builtin: Style(color="bright_cyan"),
+    Name.Function: Style(color="bright_green"),
+    Name.Namespace: Style(color="bright_cyan", underline=True),
+    Name.Class: Style(color="bright_green", underline=True),
+    Name.Exception: Style(color="bright_cyan"),
+    Name.Decorator: Style(color="bright_magenta", bold=True),
+    Name.Variable: Style(color="bright_red"),
+    Name.Constant: Style(color="bright_red"),
+    Name.Attribute: Style(color="bright_cyan"),
+    Name.Tag: Style(color="bright_blue"),
+    String: Style(color="yellow"),
+    Number: Style(color="bright_blue"),
+    Generic.Deleted: Style(color="bright_red"),
+    Generic.Inserted: Style(color="bright_green"),
+    Generic.Heading: Style(bold=True),
+    Generic.Subheading: Style(color="bright_magenta", bold=True),
+    Generic.Prompt: Style(bold=True),
+    Generic.Error: Style(color="bright_red"),
+    Error: Style(color="red", underline=True),
+}
+
+RICH_SYNTAX_THEMES = {"ansi_light": ANSI_LIGHT, "ansi_dark": ANSI_DARK}
+
+
+class SyntaxTheme(ABC):
+    """Base class for a syntax theme."""
+
+    @abstractmethod
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Get a style for a given Pygments token."""
+        raise NotImplementedError  # pragma: no cover
+
+    @abstractmethod
+    def get_background_style(self) -> Style:
+        """Get the background color."""
+        raise NotImplementedError  # pragma: no cover
+
+
+class PygmentsSyntaxTheme(SyntaxTheme):
+    """Syntax theme that delegates to Pygments theme."""
+
+    def __init__(self, theme: Union[str, Type[PygmentsStyle]]) -> None:
+        self._style_cache: Dict[TokenType, Style] = {}
+        if isinstance(theme, str):
+            try:
+                self._pygments_style_class = get_style_by_name(theme)
+            except ClassNotFound:
+                self._pygments_style_class = get_style_by_name("default")
+        else:
+            self._pygments_style_class = theme
+
+        self._background_color = self._pygments_style_class.background_color
+        self._background_style = Style(bgcolor=self._background_color)
+
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Get a style from a Pygments class."""
+        try:
+            return self._style_cache[token_type]
+        except KeyError:
+            try:
+                pygments_style = self._pygments_style_class.style_for_token(token_type)
+            except KeyError:
+                style = Style.null()
+            else:
+                color = pygments_style["color"]
+                bgcolor = pygments_style["bgcolor"]
+                style = Style(
+                    color="#" + color if color else "#000000",
+                    bgcolor="#" + bgcolor if bgcolor else self._background_color,
+                    bold=pygments_style["bold"],
+                    italic=pygments_style["italic"],
+                    underline=pygments_style["underline"],
+                )
+            self._style_cache[token_type] = style
+        return style
+
+    def get_background_style(self) -> Style:
+        return self._background_style
+
+
+class ANSISyntaxTheme(SyntaxTheme):
+    """Syntax theme to use standard colors."""
+
+    def __init__(self, style_map: Dict[TokenType, Style]) -> None:
+        self.style_map = style_map
+        self._missing_style = Style.null()
+        self._background_style = Style.null()
+        self._style_cache: Dict[TokenType, Style] = {}
+
+    def get_style_for_token(self, token_type: TokenType) -> Style:
+        """Look up style in the style map."""
+        try:
+            return self._style_cache[token_type]
+        except KeyError:
+            # Styles form a hierarchy
+            # We need to go from most to least specific
+            # e.g. ("foo", "bar", "baz") to ("foo", "bar")  to ("foo",)
+            get_style = self.style_map.get
+            token = tuple(token_type)
+            style = self._missing_style
+            while token:
+                _style = get_style(token)
+                if _style is not None:
+                    style = _style
+                    break
+                token = token[:-1]
+            self._style_cache[token_type] = style
+            return style
+
+    def get_background_style(self) -> Style:
+        return self._background_style
+
+
+class Syntax(JupyterMixin):
+    """Construct a Syntax object to render syntax highlighted code.
+
+    Args:
+        code (str): Code to highlight.
+        lexer (Lexer | str): Lexer to use (see https://pygments.org/docs/lexers/)
+        theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "monokai".
+        dedent (bool, optional): Enable stripping of initial whitespace. Defaults to False.
+        line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False.
+        start_line (int, optional): Starting number for line numbers. Defaults to 1.
+        line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render.
+        highlight_lines (Set[int]): A set of line numbers to highlight.
+        code_width: Width of code to render (not including line numbers), or ``None`` to use all available width.
+        tab_size (int, optional): Size of tabs. Defaults to 4.
+        word_wrap (bool, optional): Enable word wrapping.
+        background_color (str, optional): Optional background color, or None to use theme color. Defaults to None.
+        indent_guides (bool, optional): Show indent guides. Defaults to False.
+    """
+
+    _pygments_style_class: Type[PygmentsStyle]
+    _theme: SyntaxTheme
+
+    @classmethod
+    def get_theme(cls, name: Union[str, SyntaxTheme]) -> SyntaxTheme:
+        """Get a syntax theme instance."""
+        if isinstance(name, SyntaxTheme):
+            return name
+        theme: SyntaxTheme
+        if name in RICH_SYNTAX_THEMES:
+            theme = ANSISyntaxTheme(RICH_SYNTAX_THEMES[name])
+        else:
+            theme = PygmentsSyntaxTheme(name)
+        return theme
+
+    def __init__(
+        self,
+        code: str,
+        lexer: Union[Lexer, str],
+        *,
+        theme: Union[str, SyntaxTheme] = DEFAULT_THEME,
+        dedent: bool = False,
+        line_numbers: bool = False,
+        start_line: int = 1,
+        line_range: Optional[Tuple[int, int]] = None,
+        highlight_lines: Optional[Set[int]] = None,
+        code_width: Optional[int] = None,
+        tab_size: int = 4,
+        word_wrap: bool = False,
+        background_color: Optional[str] = None,
+        indent_guides: bool = False,
+    ) -> None:
+        self.code = code
+        self._lexer = lexer
+        self.dedent = dedent
+        self.line_numbers = line_numbers
+        self.start_line = start_line
+        self.line_range = line_range
+        self.highlight_lines = highlight_lines or set()
+        self.code_width = code_width
+        self.tab_size = tab_size
+        self.word_wrap = word_wrap
+        self.background_color = background_color
+        self.background_style = (
+            Style(bgcolor=background_color) if background_color else Style()
+        )
+        self.indent_guides = indent_guides
+
+        self._theme = self.get_theme(theme)
+
+    @classmethod
+    def from_path(
+        cls,
+        path: str,
+        encoding: str = "utf-8",
+        theme: Union[str, SyntaxTheme] = DEFAULT_THEME,
+        dedent: bool = False,
+        line_numbers: bool = False,
+        line_range: Optional[Tuple[int, int]] = None,
+        start_line: int = 1,
+        highlight_lines: Optional[Set[int]] = None,
+        code_width: Optional[int] = None,
+        tab_size: int = 4,
+        word_wrap: bool = False,
+        background_color: Optional[str] = None,
+        indent_guides: bool = False,
+    ) -> "Syntax":
+        """Construct a Syntax object from a file.
+
+        Args:
+            path (str): Path to file to highlight.
+            encoding (str): Encoding of file.
+            theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "emacs".
+            dedent (bool, optional): Enable stripping of initial whitespace. Defaults to True.
+            line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False.
+            start_line (int, optional): Starting number for line numbers. Defaults to 1.
+            line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render.
+            highlight_lines (Set[int]): A set of line numbers to highlight.
+            code_width: Width of code to render (not including line numbers), or ``None`` to use all available width.
+            tab_size (int, optional): Size of tabs. Defaults to 4.
+            word_wrap (bool, optional): Enable word wrapping of code.
+            background_color (str, optional): Optional background color, or None to use theme color. Defaults to None.
+            indent_guides (bool, optional): Show indent guides. Defaults to False.
+
+        Returns:
+            [Syntax]: A Syntax object that may be printed to the console
+        """
+        with open(path, "rt", encoding=encoding) as code_file:
+            code = code_file.read()
+
+        lexer = None
+        lexer_name = "default"
+        try:
+            _, ext = os.path.splitext(path)
+            if ext:
+                extension = ext.lstrip(".").lower()
+                lexer = get_lexer_by_name(extension)
+                lexer_name = lexer.name
+        except ClassNotFound:
+            pass
+
+        if lexer is None:
+            try:
+                lexer_name = guess_lexer_for_filename(path, code).name
+            except ClassNotFound:
+                pass
+
+        return cls(
+            code,
+            lexer_name,
+            theme=theme,
+            dedent=dedent,
+            line_numbers=line_numbers,
+            line_range=line_range,
+            start_line=start_line,
+            highlight_lines=highlight_lines,
+            code_width=code_width,
+            tab_size=tab_size,
+            word_wrap=word_wrap,
+            background_color=background_color,
+            indent_guides=indent_guides,
+        )
+
+    def _get_base_style(self) -> Style:
+        """Get the base style."""
+        default_style = self._theme.get_background_style() + self.background_style
+        return default_style
+
+    def _get_token_color(self, token_type: TokenType) -> Optional[Color]:
+        """Get a color (if any) for the given token.
+
+        Args:
+            token_type (TokenType): A token type tuple from Pygments.
+
+        Returns:
+            Optional[Color]: Color from theme, or None for no color.
+        """
+        style = self._theme.get_style_for_token(token_type)
+        return style.color
+
+    @property
+    def lexer(self) -> Optional[Lexer]:
+        """The lexer for this syntax, or None if no lexer was found.
+
+        Tries to find the lexer by name if a string was passed to the constructor.
+        """
+
+        if isinstance(self._lexer, Lexer):
+            return self._lexer
+        try:
+            return get_lexer_by_name(
+                self._lexer,
+                stripnl=False,
+                ensurenl=True,
+                tabsize=self.tab_size,
+            )
+        except ClassNotFound:
+            return None
+
+    def highlight(
+        self, code: str, line_range: Optional[Tuple[int, int]] = None
+    ) -> Text:
+        """Highlight code and return a Text instance.
+
+        Args:
+            code (str): Code to highlight.
+            line_range(Tuple[int, int], optional): Optional line range to highlight.
+
+        Returns:
+            Text: A text instance containing highlighted syntax.
+        """
+
+        base_style = self._get_base_style()
+        justify: JustifyMethod = (
+            "default" if base_style.transparent_background else "left"
+        )
+
+        text = Text(
+            justify=justify,
+            style=base_style,
+            tab_size=self.tab_size,
+            no_wrap=not self.word_wrap,
+        )
+        _get_theme_style = self._theme.get_style_for_token
+
+        lexer = self.lexer
+
+        if lexer is None:
+            text.append(code)
+        else:
+            if line_range:
+                # More complicated path to only stylize a portion of the code
+                # This speeds up further operations as there are less spans to process
+                line_start, line_end = line_range
+
+                def line_tokenize() -> Iterable[Tuple[Any, str]]:
+                    """Split tokens to one per line."""
+                    assert lexer
+
+                    for token_type, token in lexer.get_tokens(code):
+                        while token:
+                            line_token, new_line, token = token.partition("\n")
+                            yield token_type, line_token + new_line
+
+                def tokens_to_spans() -> Iterable[Tuple[str, Optional[Style]]]:
+                    """Convert tokens to spans."""
+                    tokens = iter(line_tokenize())
+                    line_no = 0
+                    _line_start = line_start - 1
+
+                    # Skip over tokens until line start
+                    while line_no < _line_start:
+                        _token_type, token = next(tokens)
+                        yield (token, None)
+                        if token.endswith("\n"):
+                            line_no += 1
+                    # Generate spans until line end
+                    for token_type, token in tokens:
+                        yield (token, _get_theme_style(token_type))
+                        if token.endswith("\n"):
+                            line_no += 1
+                            if line_no >= line_end:
+                                break
+
+                text.append_tokens(tokens_to_spans())
+
+            else:
+                text.append_tokens(
+                    (token, _get_theme_style(token_type))
+                    for token_type, token in lexer.get_tokens(code)
+                )
+            if self.background_color is not None:
+                text.stylize(f"on {self.background_color}")
+        return text
+
+    def _get_line_numbers_color(self, blend: float = 0.3) -> Color:
+        background_style = self._theme.get_background_style() + self.background_style
+        background_color = background_style.bgcolor
+        if background_color is None or background_color.is_system_defined:
+            return Color.default()
+        foreground_color = self._get_token_color(Token.Text)
+        if foreground_color is None or foreground_color.is_system_defined:
+            return foreground_color or Color.default()
+        new_color = blend_rgb(
+            background_color.get_truecolor(),
+            foreground_color.get_truecolor(),
+            cross_fade=blend,
+        )
+        return Color.from_triplet(new_color)
+
+    @property
+    def _numbers_column_width(self) -> int:
+        """Get the number of characters used to render the numbers column."""
+        column_width = 0
+        if self.line_numbers:
+            column_width = len(str(self.start_line + self.code.count("\n"))) + 2
+        return column_width
+
+    def _get_number_styles(self, console: Console) -> Tuple[Style, Style, Style]:
+        """Get background, number, and highlight styles for line numbers."""
+        background_style = self._get_base_style()
+        if background_style.transparent_background:
+            return Style.null(), Style(dim=True), Style.null()
+        if console.color_system in ("256", "truecolor"):
+            number_style = Style.chain(
+                background_style,
+                self._theme.get_style_for_token(Token.Text),
+                Style(color=self._get_line_numbers_color()),
+                self.background_style,
+            )
+            highlight_number_style = Style.chain(
+                background_style,
+                self._theme.get_style_for_token(Token.Text),
+                Style(bold=True, color=self._get_line_numbers_color(0.9)),
+                self.background_style,
+            )
+        else:
+            number_style = background_style + Style(dim=True)
+            highlight_number_style = background_style + Style(dim=False)
+        return background_style, number_style, highlight_number_style
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        if self.code_width is not None:
+            width = self.code_width + self._numbers_column_width
+            return Measurement(self._numbers_column_width, width)
+        return Measurement(self._numbers_column_width, options.max_width)
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+
+        transparent_background = self._get_base_style().transparent_background
+        code_width = (
+            (
+                (options.max_width - self._numbers_column_width - 1)
+                if self.line_numbers
+                else options.max_width
+            )
+            if self.code_width is None
+            else self.code_width
+        )
+
+        line_offset = 0
+        if self.line_range:
+            start_line, end_line = self.line_range
+            line_offset = max(0, start_line - 1)
+
+        ends_on_nl = self.code.endswith("\n")
+        code = self.code if ends_on_nl else self.code + "\n"
+        code = textwrap.dedent(code) if self.dedent else code
+        code = code.expandtabs(self.tab_size)
+        text = self.highlight(code, self.line_range)
+
+        (
+            background_style,
+            number_style,
+            highlight_number_style,
+        ) = self._get_number_styles(console)
+
+        if not self.line_numbers and not self.word_wrap and not self.line_range:
+            if not ends_on_nl:
+                text.remove_suffix("\n")
+            # Simple case of just rendering text
+            style = (
+                self._get_base_style()
+                + self._theme.get_style_for_token(Comment)
+                + Style(dim=True)
+                + self.background_style
+            )
+            if self.indent_guides and not options.ascii_only:
+                text = text.with_indent_guides(self.tab_size, style=style)
+                text.overflow = "crop"
+            if style.transparent_background:
+                yield from console.render(
+                    text, options=options.update(width=code_width)
+                )
+            else:
+                syntax_lines = console.render_lines(
+                    text,
+                    options.update(width=code_width, height=None),
+                    style=self.background_style,
+                    pad=True,
+                    new_lines=True,
+                )
+                for syntax_line in syntax_lines:
+                    yield from syntax_line
+            return
+
+        lines: Union[List[Text], Lines] = text.split("\n", allow_blank=ends_on_nl)
+        if self.line_range:
+            lines = lines[line_offset:end_line]
+
+        if self.indent_guides and not options.ascii_only:
+            style = (
+                self._get_base_style()
+                + self._theme.get_style_for_token(Comment)
+                + Style(dim=True)
+                + self.background_style
+            )
+            lines = (
+                Text("\n")
+                .join(lines)
+                .with_indent_guides(self.tab_size, style=style)
+                .split("\n", allow_blank=True)
+            )
+
+        numbers_column_width = self._numbers_column_width
+        render_options = options.update(width=code_width)
+
+        highlight_line = self.highlight_lines.__contains__
+        _Segment = Segment
+        padding = _Segment(" " * numbers_column_width + " ", background_style)
+        new_line = _Segment("\n")
+
+        line_pointer = "> " if options.legacy_windows else "❱ "
+
+        for line_no, line in enumerate(lines, self.start_line + line_offset):
+            if self.word_wrap:
+                wrapped_lines = console.render_lines(
+                    line,
+                    render_options.update(height=None),
+                    style=background_style,
+                    pad=not transparent_background,
+                )
+
+            else:
+                segments = list(line.render(console, end=""))
+                if options.no_wrap:
+                    wrapped_lines = [segments]
+                else:
+                    wrapped_lines = [
+                        _Segment.adjust_line_length(
+                            segments,
+                            render_options.max_width,
+                            style=background_style,
+                            pad=not transparent_background,
+                        )
+                    ]
+            if self.line_numbers:
+                for first, wrapped_line in loop_first(wrapped_lines):
+                    if first:
+                        line_column = str(line_no).rjust(numbers_column_width - 2) + " "
+                        if highlight_line(line_no):
+                            yield _Segment(line_pointer, Style(color="red"))
+                            yield _Segment(line_column, highlight_number_style)
+                        else:
+                            yield _Segment("  ", highlight_number_style)
+                            yield _Segment(line_column, number_style)
+                    else:
+                        yield padding
+                    yield from wrapped_line
+                    yield new_line
+            else:
+                for wrapped_line in wrapped_lines:
+                    yield from wrapped_line
+                    yield new_line
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    import argparse
+    import sys
+
+    parser = argparse.ArgumentParser(
+        description="Render syntax to the console with Rich"
+    )
+    parser.add_argument(
+        "path",
+        metavar="PATH",
+        help="path to file, or - for stdin",
+    )
+    parser.add_argument(
+        "-c",
+        "--force-color",
+        dest="force_color",
+        action="store_true",
+        default=None,
+        help="force color for non-terminals",
+    )
+    parser.add_argument(
+        "-i",
+        "--indent-guides",
+        dest="indent_guides",
+        action="store_true",
+        default=False,
+        help="display indent guides",
+    )
+    parser.add_argument(
+        "-l",
+        "--line-numbers",
+        dest="line_numbers",
+        action="store_true",
+        help="render line numbers",
+    )
+    parser.add_argument(
+        "-w",
+        "--width",
+        type=int,
+        dest="width",
+        default=None,
+        help="width of output (default will auto-detect)",
+    )
+    parser.add_argument(
+        "-r",
+        "--wrap",
+        dest="word_wrap",
+        action="store_true",
+        default=False,
+        help="word wrap long lines",
+    )
+    parser.add_argument(
+        "-s",
+        "--soft-wrap",
+        action="store_true",
+        dest="soft_wrap",
+        default=False,
+        help="enable soft wrapping mode",
+    )
+    parser.add_argument(
+        "-t", "--theme", dest="theme", default="monokai", help="pygments theme"
+    )
+    parser.add_argument(
+        "-b",
+        "--background-color",
+        dest="background_color",
+        default=None,
+        help="Override background color",
+    )
+    parser.add_argument(
+        "-x",
+        "--lexer",
+        default="default",
+        dest="lexer_name",
+        help="Lexer name",
+    )
+    args = parser.parse_args()
+
+    from pip._vendor.rich.console import Console
+
+    console = Console(force_terminal=args.force_color, width=args.width)
+
+    if args.path == "-":
+        code = sys.stdin.read()
+        syntax = Syntax(
+            code=code,
+            lexer=args.lexer_name,
+            line_numbers=args.line_numbers,
+            word_wrap=args.word_wrap,
+            theme=args.theme,
+            background_color=args.background_color,
+            indent_guides=args.indent_guides,
+        )
+    else:
+        syntax = Syntax.from_path(
+            args.path,
+            line_numbers=args.line_numbers,
+            word_wrap=args.word_wrap,
+            theme=args.theme,
+            background_color=args.background_color,
+            indent_guides=args.indent_guides,
+        )
+    console.print(syntax, soft_wrap=args.soft_wrap)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/table.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/table.py
new file mode 100644
index 0000000000000000000000000000000000000000..da4386085a8191256a882579b37faaa01e59f731
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/table.py
@@ -0,0 +1,968 @@
+from dataclasses import dataclass, field, replace
+from typing import (
+    TYPE_CHECKING,
+    Dict,
+    Iterable,
+    List,
+    NamedTuple,
+    Optional,
+    Sequence,
+    Tuple,
+    Union,
+)
+
+from . import box, errors
+from ._loop import loop_first_last, loop_last
+from ._pick import pick_bool
+from ._ratio import ratio_distribute, ratio_reduce
+from .align import VerticalAlignMethod
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .padding import Padding, PaddingDimensions
+from .protocol import is_renderable
+from .segment import Segment
+from .style import Style, StyleType
+from .text import Text, TextType
+
+if TYPE_CHECKING:
+    from .console import (
+        Console,
+        ConsoleOptions,
+        JustifyMethod,
+        OverflowMethod,
+        RenderableType,
+        RenderResult,
+    )
+
+
+@dataclass
+class Column:
+    """Defines a column in a table."""
+
+    header: "RenderableType" = ""
+    """RenderableType: Renderable for the header (typically a string)"""
+
+    footer: "RenderableType" = ""
+    """RenderableType: Renderable for the footer (typically a string)"""
+
+    header_style: StyleType = ""
+    """StyleType: The style of the header."""
+
+    footer_style: StyleType = ""
+    """StyleType: The style of the footer."""
+
+    style: StyleType = ""
+    """StyleType: The style of the column."""
+
+    justify: "JustifyMethod" = "left"
+    """str: How to justify text within the column ("left", "center", "right", or "full")"""
+
+    vertical: "VerticalAlignMethod" = "top"
+    """str: How to vertically align content ("top", "middle", or "bottom")"""
+
+    overflow: "OverflowMethod" = "ellipsis"
+    """str: Overflow method."""
+
+    width: Optional[int] = None
+    """Optional[int]: Width of the column, or ``None`` (default) to auto calculate width."""
+
+    min_width: Optional[int] = None
+    """Optional[int]: Minimum width of column, or ``None`` for no minimum. Defaults to None."""
+
+    max_width: Optional[int] = None
+    """Optional[int]: Maximum width of column, or ``None`` for no maximum. Defaults to None."""
+
+    ratio: Optional[int] = None
+    """Optional[int]: Ratio to use when calculating column width, or ``None`` (default) to adapt to column contents."""
+
+    no_wrap: bool = False
+    """bool: Prevent wrapping of text within the column. Defaults to ``False``."""
+
+    _index: int = 0
+    """Index of column."""
+
+    _cells: List["RenderableType"] = field(default_factory=list)
+
+    def copy(self) -> "Column":
+        """Return a copy of this Column."""
+        return replace(self, _cells=[])
+
+    @property
+    def cells(self) -> Iterable["RenderableType"]:
+        """Get all cells in the column, not including header."""
+        yield from self._cells
+
+    @property
+    def flexible(self) -> bool:
+        """Check if this column is flexible."""
+        return self.ratio is not None
+
+
+@dataclass
+class Row:
+    """Information regarding a row."""
+
+    style: Optional[StyleType] = None
+    """Style to apply to row."""
+
+    end_section: bool = False
+    """Indicated end of section, which will force a line beneath the row."""
+
+
+class _Cell(NamedTuple):
+    """A single cell in a table."""
+
+    style: StyleType
+    """Style to apply to cell."""
+    renderable: "RenderableType"
+    """Cell renderable."""
+    vertical: VerticalAlignMethod
+    """Cell vertical alignment."""
+
+
+class Table(JupyterMixin):
+    """A console renderable to draw a table.
+
+    Args:
+        *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance.
+        title (Union[str, Text], optional): The title of the table rendered at the top. Defaults to None.
+        caption (Union[str, Text], optional): The table caption rendered below. Defaults to None.
+        width (int, optional): The width in characters of the table, or ``None`` to automatically fit. Defaults to None.
+        min_width (Optional[int], optional): The minimum width of the table, or ``None`` for no minimum. Defaults to None.
+        box (box.Box, optional): One of the constants in box.py used to draw the edges (see :ref:`appendix_box`), or ``None`` for no box lines. Defaults to box.HEAVY_HEAD.
+        safe_box (Optional[bool], optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True.
+        padding (PaddingDimensions, optional): Padding for cells (top, right, bottom, left). Defaults to (0, 1).
+        collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to False.
+        pad_edge (bool, optional): Enable padding of edge cells. Defaults to True.
+        expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False.
+        show_header (bool, optional): Show a header row. Defaults to True.
+        show_footer (bool, optional): Show a footer row. Defaults to False.
+        show_edge (bool, optional): Draw a box around the outside of the table. Defaults to True.
+        show_lines (bool, optional): Draw lines between every row. Defaults to False.
+        leading (bool, optional): Number of blank lines between rows (precludes ``show_lines``). Defaults to 0.
+        style (Union[str, Style], optional): Default style for the table. Defaults to "none".
+        row_styles (List[Union, str], optional): Optional list of row styles, if more than one style is given then the styles will alternate. Defaults to None.
+        header_style (Union[str, Style], optional): Style of the header. Defaults to "table.header".
+        footer_style (Union[str, Style], optional): Style of the footer. Defaults to "table.footer".
+        border_style (Union[str, Style], optional): Style of the border. Defaults to None.
+        title_style (Union[str, Style], optional): Style of the title. Defaults to None.
+        caption_style (Union[str, Style], optional): Style of the caption. Defaults to None.
+        title_justify (str, optional): Justify method for title. Defaults to "center".
+        caption_justify (str, optional): Justify method for caption. Defaults to "center".
+        highlight (bool, optional): Highlight cell contents (if str). Defaults to False.
+    """
+
+    columns: List[Column]
+    rows: List[Row]
+
+    def __init__(
+        self,
+        *headers: Union[Column, str],
+        title: Optional[TextType] = None,
+        caption: Optional[TextType] = None,
+        width: Optional[int] = None,
+        min_width: Optional[int] = None,
+        box: Optional[box.Box] = box.HEAVY_HEAD,
+        safe_box: Optional[bool] = None,
+        padding: PaddingDimensions = (0, 1),
+        collapse_padding: bool = False,
+        pad_edge: bool = True,
+        expand: bool = False,
+        show_header: bool = True,
+        show_footer: bool = False,
+        show_edge: bool = True,
+        show_lines: bool = False,
+        leading: int = 0,
+        style: StyleType = "none",
+        row_styles: Optional[Iterable[StyleType]] = None,
+        header_style: Optional[StyleType] = "table.header",
+        footer_style: Optional[StyleType] = "table.footer",
+        border_style: Optional[StyleType] = None,
+        title_style: Optional[StyleType] = None,
+        caption_style: Optional[StyleType] = None,
+        title_justify: "JustifyMethod" = "center",
+        caption_justify: "JustifyMethod" = "center",
+        highlight: bool = False,
+    ) -> None:
+
+        self.columns: List[Column] = []
+        self.rows: List[Row] = []
+        self.title = title
+        self.caption = caption
+        self.width = width
+        self.min_width = min_width
+        self.box = box
+        self.safe_box = safe_box
+        self._padding = Padding.unpack(padding)
+        self.pad_edge = pad_edge
+        self._expand = expand
+        self.show_header = show_header
+        self.show_footer = show_footer
+        self.show_edge = show_edge
+        self.show_lines = show_lines
+        self.leading = leading
+        self.collapse_padding = collapse_padding
+        self.style = style
+        self.header_style = header_style or ""
+        self.footer_style = footer_style or ""
+        self.border_style = border_style
+        self.title_style = title_style
+        self.caption_style = caption_style
+        self.title_justify: "JustifyMethod" = title_justify
+        self.caption_justify: "JustifyMethod" = caption_justify
+        self.highlight = highlight
+        self.row_styles: Sequence[StyleType] = list(row_styles or [])
+        append_column = self.columns.append
+        for header in headers:
+            if isinstance(header, str):
+                self.add_column(header=header)
+            else:
+                header._index = len(self.columns)
+                append_column(header)
+
+    @classmethod
+    def grid(
+        cls,
+        *headers: Union[Column, str],
+        padding: PaddingDimensions = 0,
+        collapse_padding: bool = True,
+        pad_edge: bool = False,
+        expand: bool = False,
+    ) -> "Table":
+        """Get a table with no lines, headers, or footer.
+
+        Args:
+            *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance.
+            padding (PaddingDimensions, optional): Get padding around cells. Defaults to 0.
+            collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to True.
+            pad_edge (bool, optional): Enable padding around edges of table. Defaults to False.
+            expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False.
+
+        Returns:
+            Table: A table instance.
+        """
+        return cls(
+            *headers,
+            box=None,
+            padding=padding,
+            collapse_padding=collapse_padding,
+            show_header=False,
+            show_footer=False,
+            show_edge=False,
+            pad_edge=pad_edge,
+            expand=expand,
+        )
+
+    @property
+    def expand(self) -> bool:
+        """Setting a non-None self.width implies expand."""
+        return self._expand or self.width is not None
+
+    @expand.setter
+    def expand(self, expand: bool) -> None:
+        """Set expand."""
+        self._expand = expand
+
+    @property
+    def _extra_width(self) -> int:
+        """Get extra width to add to cell content."""
+        width = 0
+        if self.box and self.show_edge:
+            width += 2
+        if self.box:
+            width += len(self.columns) - 1
+        return width
+
+    @property
+    def row_count(self) -> int:
+        """Get the current number of rows."""
+        return len(self.rows)
+
+    def get_row_style(self, console: "Console", index: int) -> StyleType:
+        """Get the current row style."""
+        style = Style.null()
+        if self.row_styles:
+            style += console.get_style(self.row_styles[index % len(self.row_styles)])
+        row_style = self.rows[index].style
+        if row_style is not None:
+            style += console.get_style(row_style)
+        return style
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> Measurement:
+        max_width = options.max_width
+        if self.width is not None:
+            max_width = self.width
+        if max_width < 0:
+            return Measurement(0, 0)
+
+        extra_width = self._extra_width
+        max_width = sum(
+            self._calculate_column_widths(
+                console, options.update_width(max_width - extra_width)
+            )
+        )
+        _measure_column = self._measure_column
+
+        measurements = [
+            _measure_column(console, options.update_width(max_width), column)
+            for column in self.columns
+        ]
+        minimum_width = (
+            sum(measurement.minimum for measurement in measurements) + extra_width
+        )
+        maximum_width = (
+            sum(measurement.maximum for measurement in measurements) + extra_width
+            if (self.width is None)
+            else self.width
+        )
+        measurement = Measurement(minimum_width, maximum_width)
+        measurement = measurement.clamp(self.min_width)
+        return measurement
+
+    @property
+    def padding(self) -> Tuple[int, int, int, int]:
+        """Get cell padding."""
+        return self._padding
+
+    @padding.setter
+    def padding(self, padding: PaddingDimensions) -> "Table":
+        """Set cell padding."""
+        self._padding = Padding.unpack(padding)
+        return self
+
+    def add_column(
+        self,
+        header: "RenderableType" = "",
+        footer: "RenderableType" = "",
+        *,
+        header_style: Optional[StyleType] = None,
+        footer_style: Optional[StyleType] = None,
+        style: Optional[StyleType] = None,
+        justify: "JustifyMethod" = "left",
+        vertical: "VerticalAlignMethod" = "top",
+        overflow: "OverflowMethod" = "ellipsis",
+        width: Optional[int] = None,
+        min_width: Optional[int] = None,
+        max_width: Optional[int] = None,
+        ratio: Optional[int] = None,
+        no_wrap: bool = False,
+    ) -> None:
+        """Add a column to the table.
+
+        Args:
+            header (RenderableType, optional): Text or renderable for the header.
+                Defaults to "".
+            footer (RenderableType, optional): Text or renderable for the footer.
+                Defaults to "".
+            header_style (Union[str, Style], optional): Style for the header, or None for default. Defaults to None.
+            footer_style (Union[str, Style], optional): Style for the footer, or None for default. Defaults to None.
+            style (Union[str, Style], optional): Style for the column cells, or None for default. Defaults to None.
+            justify (JustifyMethod, optional): Alignment for cells. Defaults to "left".
+            vertical (VerticalAlignMethod, optional): Vertical alignment, one of "top", "middle", or "bottom". Defaults to "top".
+            overflow (OverflowMethod): Overflow method: "crop", "fold", "ellipsis". Defaults to "ellipsis".
+            width (int, optional): Desired width of column in characters, or None to fit to contents. Defaults to None.
+            min_width (Optional[int], optional): Minimum width of column, or ``None`` for no minimum. Defaults to None.
+            max_width (Optional[int], optional): Maximum width of column, or ``None`` for no maximum. Defaults to None.
+            ratio (int, optional): Flexible ratio for the column (requires ``Table.expand`` or ``Table.width``). Defaults to None.
+            no_wrap (bool, optional): Set to ``True`` to disable wrapping of this column.
+        """
+
+        column = Column(
+            _index=len(self.columns),
+            header=header,
+            footer=footer,
+            header_style=header_style or "",
+            footer_style=footer_style or "",
+            style=style or "",
+            justify=justify,
+            vertical=vertical,
+            overflow=overflow,
+            width=width,
+            min_width=min_width,
+            max_width=max_width,
+            ratio=ratio,
+            no_wrap=no_wrap,
+        )
+        self.columns.append(column)
+
+    def add_row(
+        self,
+        *renderables: Optional["RenderableType"],
+        style: Optional[StyleType] = None,
+        end_section: bool = False,
+    ) -> None:
+        """Add a row of renderables.
+
+        Args:
+            *renderables (None or renderable): Each cell in a row must be a renderable object (including str),
+                or ``None`` for a blank cell.
+            style (StyleType, optional): An optional style to apply to the entire row. Defaults to None.
+            end_section (bool, optional): End a section and draw a line. Defaults to False.
+
+        Raises:
+            errors.NotRenderableError: If you add something that can't be rendered.
+        """
+
+        def add_cell(column: Column, renderable: "RenderableType") -> None:
+            column._cells.append(renderable)
+
+        cell_renderables: List[Optional["RenderableType"]] = list(renderables)
+
+        columns = self.columns
+        if len(cell_renderables) < len(columns):
+            cell_renderables = [
+                *cell_renderables,
+                *[None] * (len(columns) - len(cell_renderables)),
+            ]
+        for index, renderable in enumerate(cell_renderables):
+            if index == len(columns):
+                column = Column(_index=index)
+                for _ in self.rows:
+                    add_cell(column, Text(""))
+                self.columns.append(column)
+            else:
+                column = columns[index]
+            if renderable is None:
+                add_cell(column, "")
+            elif is_renderable(renderable):
+                add_cell(column, renderable)
+            else:
+                raise errors.NotRenderableError(
+                    f"unable to render {type(renderable).__name__}; a string or other renderable object is required"
+                )
+        self.rows.append(Row(style=style, end_section=end_section))
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+
+        if not self.columns:
+            yield Segment("\n")
+            return
+
+        max_width = options.max_width
+        if self.width is not None:
+            max_width = self.width
+
+        extra_width = self._extra_width
+        widths = self._calculate_column_widths(
+            console, options.update_width(max_width - extra_width)
+        )
+        table_width = sum(widths) + extra_width
+
+        render_options = options.update(
+            width=table_width, highlight=self.highlight, height=None
+        )
+
+        def render_annotation(
+            text: TextType, style: StyleType, justify: "JustifyMethod" = "center"
+        ) -> "RenderResult":
+            render_text = (
+                console.render_str(text, style=style, highlight=False)
+                if isinstance(text, str)
+                else text
+            )
+            return console.render(
+                render_text, options=render_options.update(justify=justify)
+            )
+
+        if self.title:
+            yield from render_annotation(
+                self.title,
+                style=Style.pick_first(self.title_style, "table.title"),
+                justify=self.title_justify,
+            )
+        yield from self._render(console, render_options, widths)
+        if self.caption:
+            yield from render_annotation(
+                self.caption,
+                style=Style.pick_first(self.caption_style, "table.caption"),
+                justify=self.caption_justify,
+            )
+
+    def _calculate_column_widths(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> List[int]:
+        """Calculate the widths of each column, including padding, not including borders."""
+        max_width = options.max_width
+        columns = self.columns
+        width_ranges = [
+            self._measure_column(console, options, column) for column in columns
+        ]
+        widths = [_range.maximum or 1 for _range in width_ranges]
+        get_padding_width = self._get_padding_width
+        extra_width = self._extra_width
+        if self.expand:
+            ratios = [col.ratio or 0 for col in columns if col.flexible]
+            if any(ratios):
+                fixed_widths = [
+                    0 if column.flexible else _range.maximum
+                    for _range, column in zip(width_ranges, columns)
+                ]
+                flex_minimum = [
+                    (column.width or 1) + get_padding_width(column._index)
+                    for column in columns
+                    if column.flexible
+                ]
+                flexible_width = max_width - sum(fixed_widths)
+                flex_widths = ratio_distribute(flexible_width, ratios, flex_minimum)
+                iter_flex_widths = iter(flex_widths)
+                for index, column in enumerate(columns):
+                    if column.flexible:
+                        widths[index] = fixed_widths[index] + next(iter_flex_widths)
+        table_width = sum(widths)
+
+        if table_width > max_width:
+            widths = self._collapse_widths(
+                widths,
+                [(column.width is None and not column.no_wrap) for column in columns],
+                max_width,
+            )
+            table_width = sum(widths)
+            # last resort, reduce columns evenly
+            if table_width > max_width:
+                excess_width = table_width - max_width
+                widths = ratio_reduce(excess_width, [1] * len(widths), widths, widths)
+                table_width = sum(widths)
+
+            width_ranges = [
+                self._measure_column(console, options.update_width(width), column)
+                for width, column in zip(widths, columns)
+            ]
+            widths = [_range.maximum or 0 for _range in width_ranges]
+
+        if (table_width < max_width and self.expand) or (
+            self.min_width is not None and table_width < (self.min_width - extra_width)
+        ):
+            _max_width = (
+                max_width
+                if self.min_width is None
+                else min(self.min_width - extra_width, max_width)
+            )
+            pad_widths = ratio_distribute(_max_width - table_width, widths)
+            widths = [_width + pad for _width, pad in zip(widths, pad_widths)]
+
+        return widths
+
+    @classmethod
+    def _collapse_widths(
+        cls, widths: List[int], wrapable: List[bool], max_width: int
+    ) -> List[int]:
+        """Reduce widths so that the total is under max_width.
+
+        Args:
+            widths (List[int]): List of widths.
+            wrapable (List[bool]): List of booleans that indicate if a column may shrink.
+            max_width (int): Maximum width to reduce to.
+
+        Returns:
+            List[int]: A new list of widths.
+        """
+        total_width = sum(widths)
+        excess_width = total_width - max_width
+        if any(wrapable):
+            while total_width and excess_width > 0:
+                max_column = max(
+                    width for width, allow_wrap in zip(widths, wrapable) if allow_wrap
+                )
+                second_max_column = max(
+                    width if allow_wrap and width != max_column else 0
+                    for width, allow_wrap in zip(widths, wrapable)
+                )
+                column_difference = max_column - second_max_column
+                ratios = [
+                    (1 if (width == max_column and allow_wrap) else 0)
+                    for width, allow_wrap in zip(widths, wrapable)
+                ]
+                if not any(ratios) or not column_difference:
+                    break
+                max_reduce = [min(excess_width, column_difference)] * len(widths)
+                widths = ratio_reduce(excess_width, ratios, max_reduce, widths)
+
+                total_width = sum(widths)
+                excess_width = total_width - max_width
+        return widths
+
+    def _get_cells(
+        self, console: "Console", column_index: int, column: Column
+    ) -> Iterable[_Cell]:
+        """Get all the cells with padding and optional header."""
+
+        collapse_padding = self.collapse_padding
+        pad_edge = self.pad_edge
+        padding = self.padding
+        any_padding = any(padding)
+
+        first_column = column_index == 0
+        last_column = column_index == len(self.columns) - 1
+
+        _padding_cache: Dict[Tuple[bool, bool], Tuple[int, int, int, int]] = {}
+
+        def get_padding(first_row: bool, last_row: bool) -> Tuple[int, int, int, int]:
+            cached = _padding_cache.get((first_row, last_row))
+            if cached:
+                return cached
+            top, right, bottom, left = padding
+
+            if collapse_padding:
+                if not first_column:
+                    left = max(0, left - right)
+                if not last_row:
+                    bottom = max(0, top - bottom)
+
+            if not pad_edge:
+                if first_column:
+                    left = 0
+                if last_column:
+                    right = 0
+                if first_row:
+                    top = 0
+                if last_row:
+                    bottom = 0
+            _padding = (top, right, bottom, left)
+            _padding_cache[(first_row, last_row)] = _padding
+            return _padding
+
+        raw_cells: List[Tuple[StyleType, "RenderableType"]] = []
+        _append = raw_cells.append
+        get_style = console.get_style
+        if self.show_header:
+            header_style = get_style(self.header_style or "") + get_style(
+                column.header_style
+            )
+            _append((header_style, column.header))
+        cell_style = get_style(column.style or "")
+        for cell in column.cells:
+            _append((cell_style, cell))
+        if self.show_footer:
+            footer_style = get_style(self.footer_style or "") + get_style(
+                column.footer_style
+            )
+            _append((footer_style, column.footer))
+
+        if any_padding:
+            _Padding = Padding
+            for first, last, (style, renderable) in loop_first_last(raw_cells):
+                yield _Cell(
+                    style,
+                    _Padding(renderable, get_padding(first, last)),
+                    getattr(renderable, "vertical", None) or column.vertical,
+                )
+        else:
+            for (style, renderable) in raw_cells:
+                yield _Cell(
+                    style,
+                    renderable,
+                    getattr(renderable, "vertical", None) or column.vertical,
+                )
+
+    def _get_padding_width(self, column_index: int) -> int:
+        """Get extra width from padding."""
+        _, pad_right, _, pad_left = self.padding
+        if self.collapse_padding:
+            if column_index > 0:
+                pad_left = max(0, pad_left - pad_right)
+        return pad_left + pad_right
+
+    def _measure_column(
+        self,
+        console: "Console",
+        options: "ConsoleOptions",
+        column: Column,
+    ) -> Measurement:
+        """Get the minimum and maximum width of the column."""
+
+        max_width = options.max_width
+        if max_width < 1:
+            return Measurement(0, 0)
+
+        padding_width = self._get_padding_width(column._index)
+
+        if column.width is not None:
+            # Fixed width column
+            return Measurement(
+                column.width + padding_width, column.width + padding_width
+            ).with_maximum(max_width)
+        # Flexible column, we need to measure contents
+        min_widths: List[int] = []
+        max_widths: List[int] = []
+        append_min = min_widths.append
+        append_max = max_widths.append
+        get_render_width = Measurement.get
+        for cell in self._get_cells(console, column._index, column):
+            _min, _max = get_render_width(console, options, cell.renderable)
+            append_min(_min)
+            append_max(_max)
+
+        measurement = Measurement(
+            max(min_widths) if min_widths else 1,
+            max(max_widths) if max_widths else max_width,
+        ).with_maximum(max_width)
+        measurement = measurement.clamp(
+            None if column.min_width is None else column.min_width + padding_width,
+            None if column.max_width is None else column.max_width + padding_width,
+        )
+        return measurement
+
+    def _render(
+        self, console: "Console", options: "ConsoleOptions", widths: List[int]
+    ) -> "RenderResult":
+        table_style = console.get_style(self.style or "")
+
+        border_style = table_style + console.get_style(self.border_style or "")
+        _column_cells = (
+            self._get_cells(console, column_index, column)
+            for column_index, column in enumerate(self.columns)
+        )
+        row_cells: List[Tuple[_Cell, ...]] = list(zip(*_column_cells))
+        _box = (
+            self.box.substitute(
+                options, safe=pick_bool(self.safe_box, console.safe_box)
+            )
+            if self.box
+            else None
+        )
+
+        # _box = self.box
+        new_line = Segment.line()
+
+        columns = self.columns
+        show_header = self.show_header
+        show_footer = self.show_footer
+        show_edge = self.show_edge
+        show_lines = self.show_lines
+        leading = self.leading
+
+        _Segment = Segment
+        if _box:
+            box_segments = [
+                (
+                    _Segment(_box.head_left, border_style),
+                    _Segment(_box.head_right, border_style),
+                    _Segment(_box.head_vertical, border_style),
+                ),
+                (
+                    _Segment(_box.foot_left, border_style),
+                    _Segment(_box.foot_right, border_style),
+                    _Segment(_box.foot_vertical, border_style),
+                ),
+                (
+                    _Segment(_box.mid_left, border_style),
+                    _Segment(_box.mid_right, border_style),
+                    _Segment(_box.mid_vertical, border_style),
+                ),
+            ]
+            if show_edge:
+                yield _Segment(_box.get_top(widths), border_style)
+                yield new_line
+        else:
+            box_segments = []
+
+        get_row_style = self.get_row_style
+        get_style = console.get_style
+
+        for index, (first, last, row_cell) in enumerate(loop_first_last(row_cells)):
+            header_row = first and show_header
+            footer_row = last and show_footer
+            row = (
+                self.rows[index - show_header]
+                if (not header_row and not footer_row)
+                else None
+            )
+            max_height = 1
+            cells: List[List[List[Segment]]] = []
+            if header_row or footer_row:
+                row_style = Style.null()
+            else:
+                row_style = get_style(
+                    get_row_style(console, index - 1 if show_header else index)
+                )
+            for width, cell, column in zip(widths, row_cell, columns):
+                render_options = options.update(
+                    width=width,
+                    justify=column.justify,
+                    no_wrap=column.no_wrap,
+                    overflow=column.overflow,
+                    height=None,
+                )
+                lines = console.render_lines(
+                    cell.renderable,
+                    render_options,
+                    style=get_style(cell.style) + row_style,
+                )
+                max_height = max(max_height, len(lines))
+                cells.append(lines)
+
+            row_height = max(len(cell) for cell in cells)
+
+            def align_cell(
+                cell: List[List[Segment]],
+                vertical: "VerticalAlignMethod",
+                width: int,
+                style: Style,
+            ) -> List[List[Segment]]:
+                if header_row:
+                    vertical = "bottom"
+                elif footer_row:
+                    vertical = "top"
+
+                if vertical == "top":
+                    return _Segment.align_top(cell, width, row_height, style)
+                elif vertical == "middle":
+                    return _Segment.align_middle(cell, width, row_height, style)
+                return _Segment.align_bottom(cell, width, row_height, style)
+
+            cells[:] = [
+                _Segment.set_shape(
+                    align_cell(
+                        cell,
+                        _cell.vertical,
+                        width,
+                        get_style(_cell.style) + row_style,
+                    ),
+                    width,
+                    max_height,
+                )
+                for width, _cell, cell, column in zip(widths, row_cell, cells, columns)
+            ]
+
+            if _box:
+                if last and show_footer:
+                    yield _Segment(
+                        _box.get_row(widths, "foot", edge=show_edge), border_style
+                    )
+                    yield new_line
+                left, right, _divider = box_segments[0 if first else (2 if last else 1)]
+
+                # If the column divider is whitespace also style it with the row background
+                divider = (
+                    _divider
+                    if _divider.text.strip()
+                    else _Segment(
+                        _divider.text, row_style.background_style + _divider.style
+                    )
+                )
+                for line_no in range(max_height):
+                    if show_edge:
+                        yield left
+                    for last_cell, rendered_cell in loop_last(cells):
+                        yield from rendered_cell[line_no]
+                        if not last_cell:
+                            yield divider
+                    if show_edge:
+                        yield right
+                    yield new_line
+            else:
+                for line_no in range(max_height):
+                    for rendered_cell in cells:
+                        yield from rendered_cell[line_no]
+                    yield new_line
+            if _box and first and show_header:
+                yield _Segment(
+                    _box.get_row(widths, "head", edge=show_edge), border_style
+                )
+                yield new_line
+            end_section = row and row.end_section
+            if _box and (show_lines or leading or end_section):
+                if (
+                    not last
+                    and not (show_footer and index >= len(row_cells) - 2)
+                    and not (show_header and header_row)
+                ):
+                    if leading:
+                        yield _Segment(
+                            _box.get_row(widths, "mid", edge=show_edge) * leading,
+                            border_style,
+                        )
+                    else:
+                        yield _Segment(
+                            _box.get_row(widths, "row", edge=show_edge), border_style
+                        )
+                    yield new_line
+
+        if _box and show_edge:
+            yield _Segment(_box.get_bottom(widths), border_style)
+            yield new_line
+
+
+if __name__ == "__main__":  # pragma: no cover
+    from pip._vendor.rich.console import Console
+    from pip._vendor.rich.highlighter import ReprHighlighter
+    from pip._vendor.rich.table import Table as Table
+
+    from ._timer import timer
+
+    with timer("Table render"):
+        table = Table(
+            title="Star Wars Movies",
+            caption="Rich example table",
+            caption_justify="right",
+        )
+
+        table.add_column(
+            "Released", header_style="bright_cyan", style="cyan", no_wrap=True
+        )
+        table.add_column("Title", style="magenta")
+        table.add_column("Box Office", justify="right", style="green")
+
+        table.add_row(
+            "Dec 20, 2019",
+            "Star Wars: The Rise of Skywalker",
+            "$952,110,690",
+        )
+        table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347")
+        table.add_row(
+            "Dec 15, 2017",
+            "Star Wars Ep. V111: The Last Jedi",
+            "$1,332,539,889",
+            style="on black",
+            end_section=True,
+        )
+        table.add_row(
+            "Dec 16, 2016",
+            "Rogue One: A Star Wars Story",
+            "$1,332,439,889",
+        )
+
+        def header(text: str) -> None:
+            console.print()
+            console.rule(highlight(text))
+            console.print()
+
+        console = Console()
+        highlight = ReprHighlighter()
+        header("Example Table")
+        console.print(table, justify="center")
+
+        table.expand = True
+        header("expand=True")
+        console.print(table)
+
+        table.width = 50
+        header("width=50")
+
+        console.print(table, justify="center")
+
+        table.width = None
+        table.expand = False
+        table.row_styles = ["dim", "none"]
+        header("row_styles=['dim', 'none']")
+
+        console.print(table, justify="center")
+
+        table.width = None
+        table.expand = False
+        table.row_styles = ["dim", "none"]
+        table.leading = 1
+        header("leading=1, row_styles=['dim', 'none']")
+        console.print(table, justify="center")
+
+        table.width = None
+        table.expand = False
+        table.row_styles = ["dim", "none"]
+        table.show_lines = True
+        table.leading = 0
+        header("show_lines=True, row_styles=['dim', 'none']")
+        console.print(table, justify="center")
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/terminal_theme.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/terminal_theme.py
new file mode 100644
index 0000000000000000000000000000000000000000..801ac0b7b8581632e4f77b436b1a04d3f94a876d
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/terminal_theme.py
@@ -0,0 +1,55 @@
+from typing import List, Optional, Tuple
+
+from .color_triplet import ColorTriplet
+from .palette import Palette
+
+_ColorTuple = Tuple[int, int, int]
+
+
+class TerminalTheme:
+    """A color theme used when exporting console content.
+
+    Args:
+        background (Tuple[int, int, int]): The background color.
+        foreground (Tuple[int, int, int]): The foreground (text) color.
+        normal (List[Tuple[int, int, int]]): A list of 8 normal intensity colors.
+        bright (List[Tuple[int, int, int]], optional): A list of 8 bright colors, or None
+            to repeat normal intensity. Defaults to None.
+    """
+
+    def __init__(
+        self,
+        background: _ColorTuple,
+        foreground: _ColorTuple,
+        normal: List[_ColorTuple],
+        bright: Optional[List[_ColorTuple]] = None,
+    ) -> None:
+        self.background_color = ColorTriplet(*background)
+        self.foreground_color = ColorTriplet(*foreground)
+        self.ansi_colors = Palette(normal + (bright or normal))
+
+
+DEFAULT_TERMINAL_THEME = TerminalTheme(
+    (255, 255, 255),
+    (0, 0, 0),
+    [
+        (0, 0, 0),
+        (128, 0, 0),
+        (0, 128, 0),
+        (128, 128, 0),
+        (0, 0, 128),
+        (128, 0, 128),
+        (0, 128, 128),
+        (192, 192, 192),
+    ],
+    [
+        (128, 128, 128),
+        (255, 0, 0),
+        (0, 255, 0),
+        (255, 255, 0),
+        (0, 0, 255),
+        (255, 0, 255),
+        (0, 255, 255),
+        (255, 255, 255),
+    ],
+)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/themes.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/themes.py
new file mode 100644
index 0000000000000000000000000000000000000000..bf6db104a2c4fd4f3dc699e85f2b262c3d31e9a0
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/themes.py
@@ -0,0 +1,5 @@
+from .default_styles import DEFAULT_STYLES
+from .theme import Theme
+
+
+DEFAULT = Theme(DEFAULT_STYLES)
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/traceback.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/traceback.py
new file mode 100644
index 0000000000000000000000000000000000000000..66a39ebab3c8d78fd116998330579c2d2c873375
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/traceback.py
@@ -0,0 +1,678 @@
+from __future__ import absolute_import
+
+import os
+import platform
+import sys
+from dataclasses import dataclass, field
+from traceback import walk_tb
+from types import ModuleType, TracebackType
+from typing import Any, Callable, Dict, Iterable, List, Optional, Sequence, Type, Union
+
+from pip._vendor.pygments.lexers import guess_lexer_for_filename
+from pip._vendor.pygments.token import Comment, Keyword, Name, Number, Operator, String
+from pip._vendor.pygments.token import Text as TextToken
+from pip._vendor.pygments.token import Token
+
+from . import pretty
+from ._loop import loop_first, loop_last
+from .columns import Columns
+from .console import Console, ConsoleOptions, ConsoleRenderable, RenderResult, group
+from .constrain import Constrain
+from .highlighter import RegexHighlighter, ReprHighlighter
+from .panel import Panel
+from .scope import render_scope
+from .style import Style
+from .syntax import Syntax
+from .text import Text
+from .theme import Theme
+
+WINDOWS = platform.system() == "Windows"
+
+LOCALS_MAX_LENGTH = 10
+LOCALS_MAX_STRING = 80
+
+
+def install(
+    *,
+    console: Optional[Console] = None,
+    width: Optional[int] = 100,
+    extra_lines: int = 3,
+    theme: Optional[str] = None,
+    word_wrap: bool = False,
+    show_locals: bool = False,
+    indent_guides: bool = True,
+    suppress: Iterable[Union[str, ModuleType]] = (),
+    max_frames: int = 100,
+) -> Callable[[Type[BaseException], BaseException, Optional[TracebackType]], Any]:
+    """Install a rich traceback handler.
+
+    Once installed, any tracebacks will be printed with syntax highlighting and rich formatting.
+
+
+    Args:
+        console (Optional[Console], optional): Console to write exception to. Default uses internal Console instance.
+        width (Optional[int], optional): Width (in characters) of traceback. Defaults to 100.
+        extra_lines (int, optional): Extra lines of code. Defaults to 3.
+        theme (Optional[str], optional): Pygments theme to use in traceback. Defaults to ``None`` which will pick
+            a theme appropriate for the platform.
+        word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+        show_locals (bool, optional): Enable display of local variables. Defaults to False.
+        indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.
+        suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+
+    Returns:
+        Callable: The previous exception handler that was replaced.
+
+    """
+    traceback_console = Console(file=sys.stderr) if console is None else console
+
+    def excepthook(
+        type_: Type[BaseException],
+        value: BaseException,
+        traceback: Optional[TracebackType],
+    ) -> None:
+        traceback_console.print(
+            Traceback.from_exception(
+                type_,
+                value,
+                traceback,
+                width=width,
+                extra_lines=extra_lines,
+                theme=theme,
+                word_wrap=word_wrap,
+                show_locals=show_locals,
+                indent_guides=indent_guides,
+                suppress=suppress,
+                max_frames=max_frames,
+            )
+        )
+
+    def ipy_excepthook_closure(ip: Any) -> None:  # pragma: no cover
+        tb_data = {}  # store information about showtraceback call
+        default_showtraceback = ip.showtraceback  # keep reference of default traceback
+
+        def ipy_show_traceback(*args: Any, **kwargs: Any) -> None:
+            """wrap the default ip.showtraceback to store info for ip._showtraceback"""
+            nonlocal tb_data
+            tb_data = kwargs
+            default_showtraceback(*args, **kwargs)
+
+        def ipy_display_traceback(
+            *args: Any, is_syntax: bool = False, **kwargs: Any
+        ) -> None:
+            """Internally called traceback from ip._showtraceback"""
+            nonlocal tb_data
+            exc_tuple = ip._get_exc_info()
+
+            # do not display trace on syntax error
+            tb: Optional[TracebackType] = None if is_syntax else exc_tuple[2]
+
+            # determine correct tb_offset
+            compiled = tb_data.get("running_compiled_code", False)
+            tb_offset = tb_data.get("tb_offset", 1 if compiled else 0)
+            # remove ipython internal frames from trace with tb_offset
+            for _ in range(tb_offset):
+                if tb is None:
+                    break
+                tb = tb.tb_next
+
+            excepthook(exc_tuple[0], exc_tuple[1], tb)
+            tb_data = {}  # clear data upon usage
+
+        # replace _showtraceback instead of showtraceback to allow ipython features such as debugging to work
+        # this is also what the ipython docs recommends to modify when subclassing InteractiveShell
+        ip._showtraceback = ipy_display_traceback
+        # add wrapper to capture tb_data
+        ip.showtraceback = ipy_show_traceback
+        ip.showsyntaxerror = lambda *args, **kwargs: ipy_display_traceback(
+            *args, is_syntax=True, **kwargs
+        )
+
+    try:  # pragma: no cover
+        # if within ipython, use customized traceback
+        ip = get_ipython()  # type: ignore
+        ipy_excepthook_closure(ip)
+        return sys.excepthook
+    except Exception:
+        # otherwise use default system hook
+        old_excepthook = sys.excepthook
+        sys.excepthook = excepthook
+        return old_excepthook
+
+
+@dataclass
+class Frame:
+    filename: str
+    lineno: int
+    name: str
+    line: str = ""
+    locals: Optional[Dict[str, pretty.Node]] = None
+
+
+@dataclass
+class _SyntaxError:
+    offset: int
+    filename: str
+    line: str
+    lineno: int
+    msg: str
+
+
+@dataclass
+class Stack:
+    exc_type: str
+    exc_value: str
+    syntax_error: Optional[_SyntaxError] = None
+    is_cause: bool = False
+    frames: List[Frame] = field(default_factory=list)
+
+
+@dataclass
+class Trace:
+    stacks: List[Stack]
+
+
+class PathHighlighter(RegexHighlighter):
+    highlights = [r"(?P.*/)(?P.+)"]
+
+
+class Traceback:
+    """A Console renderable that renders a traceback.
+
+    Args:
+        trace (Trace, optional): A `Trace` object produced from `extract`. Defaults to None, which uses
+            the last exception.
+        width (Optional[int], optional): Number of characters used to traceback. Defaults to 100.
+        extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+        theme (str, optional): Override pygments theme used in traceback.
+        word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+        show_locals (bool, optional): Enable display of local variables. Defaults to False.
+        indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.
+        locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+            Defaults to 10.
+        locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+        suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+        max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+
+    """
+
+    LEXERS = {
+        "": "text",
+        ".py": "python",
+        ".pxd": "cython",
+        ".pyx": "cython",
+        ".pxi": "pyrex",
+    }
+
+    def __init__(
+        self,
+        trace: Optional[Trace] = None,
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        indent_guides: bool = True,
+        locals_max_length: int = LOCALS_MAX_LENGTH,
+        locals_max_string: int = LOCALS_MAX_STRING,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ):
+        if trace is None:
+            exc_type, exc_value, traceback = sys.exc_info()
+            if exc_type is None or exc_value is None or traceback is None:
+                raise ValueError(
+                    "Value for 'trace' required if not called in except: block"
+                )
+            trace = self.extract(
+                exc_type, exc_value, traceback, show_locals=show_locals
+            )
+        self.trace = trace
+        self.width = width
+        self.extra_lines = extra_lines
+        self.theme = Syntax.get_theme(theme or "ansi_dark")
+        self.word_wrap = word_wrap
+        self.show_locals = show_locals
+        self.indent_guides = indent_guides
+        self.locals_max_length = locals_max_length
+        self.locals_max_string = locals_max_string
+
+        self.suppress: Sequence[str] = []
+        for suppress_entity in suppress:
+            if not isinstance(suppress_entity, str):
+                assert (
+                    suppress_entity.__file__ is not None
+                ), f"{suppress_entity!r} must be a module with '__file__' attribute"
+                path = os.path.dirname(suppress_entity.__file__)
+            else:
+                path = suppress_entity
+            path = os.path.normpath(os.path.abspath(path))
+            self.suppress.append(path)
+        self.max_frames = max(4, max_frames) if max_frames > 0 else 0
+
+    @classmethod
+    def from_exception(
+        cls,
+        exc_type: Type[Any],
+        exc_value: BaseException,
+        traceback: Optional[TracebackType],
+        width: Optional[int] = 100,
+        extra_lines: int = 3,
+        theme: Optional[str] = None,
+        word_wrap: bool = False,
+        show_locals: bool = False,
+        indent_guides: bool = True,
+        locals_max_length: int = LOCALS_MAX_LENGTH,
+        locals_max_string: int = LOCALS_MAX_STRING,
+        suppress: Iterable[Union[str, ModuleType]] = (),
+        max_frames: int = 100,
+    ) -> "Traceback":
+        """Create a traceback from exception info
+
+        Args:
+            exc_type (Type[BaseException]): Exception type.
+            exc_value (BaseException): Exception value.
+            traceback (TracebackType): Python Traceback object.
+            width (Optional[int], optional): Number of characters used to traceback. Defaults to 100.
+            extra_lines (int, optional): Additional lines of code to render. Defaults to 3.
+            theme (str, optional): Override pygments theme used in traceback.
+            word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True.
+            locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+                Defaults to 10.
+            locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+            suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback.
+            max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100.
+
+        Returns:
+            Traceback: A Traceback instance that may be printed.
+        """
+        rich_traceback = cls.extract(
+            exc_type, exc_value, traceback, show_locals=show_locals
+        )
+        return cls(
+            rich_traceback,
+            width=width,
+            extra_lines=extra_lines,
+            theme=theme,
+            word_wrap=word_wrap,
+            show_locals=show_locals,
+            indent_guides=indent_guides,
+            locals_max_length=locals_max_length,
+            locals_max_string=locals_max_string,
+            suppress=suppress,
+            max_frames=max_frames,
+        )
+
+    @classmethod
+    def extract(
+        cls,
+        exc_type: Type[BaseException],
+        exc_value: BaseException,
+        traceback: Optional[TracebackType],
+        show_locals: bool = False,
+        locals_max_length: int = LOCALS_MAX_LENGTH,
+        locals_max_string: int = LOCALS_MAX_STRING,
+    ) -> Trace:
+        """Extract traceback information.
+
+        Args:
+            exc_type (Type[BaseException]): Exception type.
+            exc_value (BaseException): Exception value.
+            traceback (TracebackType): Python Traceback object.
+            show_locals (bool, optional): Enable display of local variables. Defaults to False.
+            locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation.
+                Defaults to 10.
+            locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80.
+
+        Returns:
+            Trace: A Trace instance which you can use to construct a `Traceback`.
+        """
+
+        stacks: List[Stack] = []
+        is_cause = False
+
+        from pip._vendor.rich import _IMPORT_CWD
+
+        def safe_str(_object: Any) -> str:
+            """Don't allow exceptions from __str__ to propegate."""
+            try:
+                return str(_object)
+            except Exception:
+                return ""
+
+        while True:
+            stack = Stack(
+                exc_type=safe_str(exc_type.__name__),
+                exc_value=safe_str(exc_value),
+                is_cause=is_cause,
+            )
+
+            if isinstance(exc_value, SyntaxError):
+                stack.syntax_error = _SyntaxError(
+                    offset=exc_value.offset or 0,
+                    filename=exc_value.filename or "?",
+                    lineno=exc_value.lineno or 0,
+                    line=exc_value.text or "",
+                    msg=exc_value.msg,
+                )
+
+            stacks.append(stack)
+            append = stack.frames.append
+
+            for frame_summary, line_no in walk_tb(traceback):
+                filename = frame_summary.f_code.co_filename
+                if filename and not filename.startswith("<"):
+                    if not os.path.isabs(filename):
+                        filename = os.path.join(_IMPORT_CWD, filename)
+                frame = Frame(
+                    filename=filename or "?",
+                    lineno=line_no,
+                    name=frame_summary.f_code.co_name,
+                    locals={
+                        key: pretty.traverse(
+                            value,
+                            max_length=locals_max_length,
+                            max_string=locals_max_string,
+                        )
+                        for key, value in frame_summary.f_locals.items()
+                    }
+                    if show_locals
+                    else None,
+                )
+                append(frame)
+                if "_rich_traceback_guard" in frame_summary.f_locals:
+                    del stack.frames[:]
+
+            cause = getattr(exc_value, "__cause__", None)
+            if cause and cause.__traceback__:
+                exc_type = cause.__class__
+                exc_value = cause
+                traceback = cause.__traceback__
+                if traceback:
+                    is_cause = True
+                    continue
+
+            cause = exc_value.__context__
+            if (
+                cause
+                and cause.__traceback__
+                and not getattr(exc_value, "__suppress_context__", False)
+            ):
+                exc_type = cause.__class__
+                exc_value = cause
+                traceback = cause.__traceback__
+                if traceback:
+                    is_cause = False
+                    continue
+            # No cover, code is reached but coverage doesn't recognize it.
+            break  # pragma: no cover
+
+        trace = Trace(stacks=stacks)
+        return trace
+
+    def __rich_console__(
+        self, console: Console, options: ConsoleOptions
+    ) -> RenderResult:
+        theme = self.theme
+        background_style = theme.get_background_style()
+        token_style = theme.get_style_for_token
+
+        traceback_theme = Theme(
+            {
+                "pretty": token_style(TextToken),
+                "pygments.text": token_style(Token),
+                "pygments.string": token_style(String),
+                "pygments.function": token_style(Name.Function),
+                "pygments.number": token_style(Number),
+                "repr.indent": token_style(Comment) + Style(dim=True),
+                "repr.str": token_style(String),
+                "repr.brace": token_style(TextToken) + Style(bold=True),
+                "repr.number": token_style(Number),
+                "repr.bool_true": token_style(Keyword.Constant),
+                "repr.bool_false": token_style(Keyword.Constant),
+                "repr.none": token_style(Keyword.Constant),
+                "scope.border": token_style(String.Delimiter),
+                "scope.equals": token_style(Operator),
+                "scope.key": token_style(Name),
+                "scope.key.special": token_style(Name.Constant) + Style(dim=True),
+            },
+            inherit=False,
+        )
+
+        highlighter = ReprHighlighter()
+        for last, stack in loop_last(reversed(self.trace.stacks)):
+            if stack.frames:
+                stack_renderable: ConsoleRenderable = Panel(
+                    self._render_stack(stack),
+                    title="[traceback.title]Traceback [dim](most recent call last)",
+                    style=background_style,
+                    border_style="traceback.border",
+                    expand=True,
+                    padding=(0, 1),
+                )
+                stack_renderable = Constrain(stack_renderable, self.width)
+                with console.use_theme(traceback_theme):
+                    yield stack_renderable
+            if stack.syntax_error is not None:
+                with console.use_theme(traceback_theme):
+                    yield Constrain(
+                        Panel(
+                            self._render_syntax_error(stack.syntax_error),
+                            style=background_style,
+                            border_style="traceback.border.syntax_error",
+                            expand=True,
+                            padding=(0, 1),
+                            width=self.width,
+                        ),
+                        self.width,
+                    )
+                yield Text.assemble(
+                    (f"{stack.exc_type}: ", "traceback.exc_type"),
+                    highlighter(stack.syntax_error.msg),
+                )
+            elif stack.exc_value:
+                yield Text.assemble(
+                    (f"{stack.exc_type}: ", "traceback.exc_type"),
+                    highlighter(stack.exc_value),
+                )
+            else:
+                yield Text.assemble((f"{stack.exc_type}", "traceback.exc_type"))
+
+            if not last:
+                if stack.is_cause:
+                    yield Text.from_markup(
+                        "\n[i]The above exception was the direct cause of the following exception:\n",
+                    )
+                else:
+                    yield Text.from_markup(
+                        "\n[i]During handling of the above exception, another exception occurred:\n",
+                    )
+
+    @group()
+    def _render_syntax_error(self, syntax_error: _SyntaxError) -> RenderResult:
+        highlighter = ReprHighlighter()
+        path_highlighter = PathHighlighter()
+        if syntax_error.filename != "":
+            text = Text.assemble(
+                (f" {syntax_error.filename}", "pygments.string"),
+                (":", "pygments.text"),
+                (str(syntax_error.lineno), "pygments.number"),
+                style="pygments.text",
+            )
+            yield path_highlighter(text)
+        syntax_error_text = highlighter(syntax_error.line.rstrip())
+        syntax_error_text.no_wrap = True
+        offset = min(syntax_error.offset - 1, len(syntax_error_text))
+        syntax_error_text.stylize("bold underline", offset, offset)
+        syntax_error_text += Text.from_markup(
+            "\n" + " " * offset + "[traceback.offset]▲[/]",
+            style="pygments.text",
+        )
+        yield syntax_error_text
+
+    @classmethod
+    def _guess_lexer(cls, filename: str, code: str) -> str:
+        ext = os.path.splitext(filename)[-1]
+        if not ext:
+            # No extension, look at first line to see if it is a hashbang
+            # Note, this is an educated guess and not a guarantee
+            # If it fails, the only downside is that the code is highlighted strangely
+            new_line_index = code.index("\n")
+            first_line = code[:new_line_index] if new_line_index != -1 else code
+            if first_line.startswith("#!") and "python" in first_line.lower():
+                return "python"
+        lexer_name = (
+            cls.LEXERS.get(ext) or guess_lexer_for_filename(filename, code).name
+        )
+        return lexer_name
+
+    @group()
+    def _render_stack(self, stack: Stack) -> RenderResult:
+        path_highlighter = PathHighlighter()
+        theme = self.theme
+        code_cache: Dict[str, str] = {}
+
+        def read_code(filename: str) -> str:
+            """Read files, and cache results on filename.
+
+            Args:
+                filename (str): Filename to read
+
+            Returns:
+                str: Contents of file
+            """
+            code = code_cache.get(filename)
+            if code is None:
+                with open(
+                    filename, "rt", encoding="utf-8", errors="replace"
+                ) as code_file:
+                    code = code_file.read()
+                code_cache[filename] = code
+            return code
+
+        def render_locals(frame: Frame) -> Iterable[ConsoleRenderable]:
+            if frame.locals:
+                yield render_scope(
+                    frame.locals,
+                    title="locals",
+                    indent_guides=self.indent_guides,
+                    max_length=self.locals_max_length,
+                    max_string=self.locals_max_string,
+                )
+
+        exclude_frames: Optional[range] = None
+        if self.max_frames != 0:
+            exclude_frames = range(
+                self.max_frames // 2,
+                len(stack.frames) - self.max_frames // 2,
+            )
+
+        excluded = False
+        for frame_index, frame in enumerate(stack.frames):
+
+            if exclude_frames and frame_index in exclude_frames:
+                excluded = True
+                continue
+
+            if excluded:
+                assert exclude_frames is not None
+                yield Text(
+                    f"\n... {len(exclude_frames)} frames hidden ...",
+                    justify="center",
+                    style="traceback.error",
+                )
+                excluded = False
+
+            first = frame_index == 1
+            frame_filename = frame.filename
+            suppressed = any(frame_filename.startswith(path) for path in self.suppress)
+
+            text = Text.assemble(
+                path_highlighter(Text(frame.filename, style="pygments.string")),
+                (":", "pygments.text"),
+                (str(frame.lineno), "pygments.number"),
+                " in ",
+                (frame.name, "pygments.function"),
+                style="pygments.text",
+            )
+            if not frame.filename.startswith("<") and not first:
+                yield ""
+            yield text
+            if frame.filename.startswith("<"):
+                yield from render_locals(frame)
+                continue
+            if not suppressed:
+                try:
+                    code = read_code(frame.filename)
+                    lexer_name = self._guess_lexer(frame.filename, code)
+                    syntax = Syntax(
+                        code,
+                        lexer_name,
+                        theme=theme,
+                        line_numbers=True,
+                        line_range=(
+                            frame.lineno - self.extra_lines,
+                            frame.lineno + self.extra_lines,
+                        ),
+                        highlight_lines={frame.lineno},
+                        word_wrap=self.word_wrap,
+                        code_width=88,
+                        indent_guides=self.indent_guides,
+                        dedent=False,
+                    )
+                    yield ""
+                except Exception as error:
+                    yield Text.assemble(
+                        (f"\n{error}", "traceback.error"),
+                    )
+                else:
+                    yield (
+                        Columns(
+                            [
+                                syntax,
+                                *render_locals(frame),
+                            ],
+                            padding=1,
+                        )
+                        if frame.locals
+                        else syntax
+                    )
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from .console import Console
+
+    console = Console()
+    import sys
+
+    def bar(a: Any) -> None:  # 这是对亚洲语言支持的测试。面对模棱两可的想法，拒绝猜测的诱惑
+        one = 1
+        print(one / a)
+
+    def foo(a: Any) -> None:
+        _rich_traceback_guard = True
+        zed = {
+            "characters": {
+                "Paul Atreides",
+                "Vladimir Harkonnen",
+                "Thufir Hawat",
+                "Duncan Idaho",
+            },
+            "atomic_types": (None, False, True),
+        }
+        bar(a)
+
+    def error() -> None:
+
+        try:
+            try:
+                foo(0)
+            except:
+                slfkjsldkfj  # type: ignore
+        except:
+            console.print_exception(show_locals=True)
+
+    error()
diff --git a/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/tree.py b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/tree.py
new file mode 100644
index 0000000000000000000000000000000000000000..c5ec27da93223300dd22648d29f53fd79797aae6
--- /dev/null
+++ b/scripts/myenv/lib/python3.10/site-packages/pip/_vendor/rich/tree.py
@@ -0,0 +1,249 @@
+from typing import Iterator, List, Optional, Tuple
+
+from ._loop import loop_first, loop_last
+from .console import Console, ConsoleOptions, RenderableType, RenderResult
+from .jupyter import JupyterMixin
+from .measure import Measurement
+from .segment import Segment
+from .style import Style, StyleStack, StyleType
+from .styled import Styled
+
+
+class Tree(JupyterMixin):
+    """A renderable for a tree structure.
+
+    Args:
+        label (RenderableType): The renderable or str for the tree label.
+        style (StyleType, optional): Style of this tree. Defaults to "tree".
+        guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line".
+        expanded (bool, optional): Also display children. Defaults to True.
+        highlight (bool, optional): Highlight renderable (if str). Defaults to False.
+    """
+
+    def __init__(
+        self,
+        label: RenderableType,
+        *,
+        style: StyleType = "tree",
+        guide_style: StyleType = "tree.line",
+        expanded: bool = True,
+        highlight: bool = False,
+        hide_root: bool = False,
+    ) -> None:
+        self.label = label
+        self.style = style
+        self.guide_style = guide_style
+        self.children: List[Tree] = []
+        self.expanded = expanded
+        self.highlight = highlight
+        self.hide_root = hide_root
+
+    def add(
+        self,
+        label: RenderableType,
+        *,
+        style: Optional[StyleType] = None,
+        guide_style: Optional[StyleType] = None,
+        expanded: bool = True,
+        highlight: bool = False,
+    ) -> "Tree":
+        """Add a child tree.
+
+        Args:
+            label (RenderableType): The renderable or str for the tree label.
+            style (StyleType, optional): Style of this tree. Defaults to "tree".
+            guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line".
+            expanded (bool, optional): Also display children. Defaults to True.
+            highlight (Optional[bool], optional): Highlight renderable (if str). Defaults to False.
+
+        Returns:
+            Tree: A new child Tree, which may be further modified.
+        """
+        node = Tree(
+            label,
+            style=self.style if style is None else style,
+            guide_style=self.guide_style if guide_style is None else guide_style,
+            expanded=expanded,
+            highlight=self.highlight if highlight is None else highlight,
+        )
+        self.children.append(node)
+        return node
+
+    def __rich_console__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "RenderResult":
+
+        stack: List[Iterator[Tuple[bool, Tree]]] = []
+        pop = stack.pop
+        push = stack.append
+        new_line = Segment.line()
+
+        get_style = console.get_style
+        null_style = Style.null()
+        guide_style = get_style(self.guide_style, default="") or null_style
+        SPACE, CONTINUE, FORK, END = range(4)
+
+        ASCII_GUIDES = ("    ", "|   ", "+-- ", "`-- ")
+        TREE_GUIDES = [
+            ("    ", "│   ", "├── ", "└── "),
+            ("    ", "┃   ", "┣━━ ", "┗━━ "),
+            ("    ", "║   ", "╠══ ", "╚══ "),
+        ]
+        _Segment = Segment
+
+        def make_guide(index: int, style: Style) -> Segment:
+            """Make a Segment for a level of the guide lines."""
+            if options.ascii_only:
+                line = ASCII_GUIDES[index]
+            else:
+                guide = 1 if style.bold else (2 if style.underline2 else 0)
+                line = TREE_GUIDES[0 if options.legacy_windows else guide][index]
+            return _Segment(line, style)
+
+        levels: List[Segment] = [make_guide(CONTINUE, guide_style)]
+        push(iter(loop_last([self])))
+
+        guide_style_stack = StyleStack(get_style(self.guide_style))
+        style_stack = StyleStack(get_style(self.style))
+        remove_guide_styles = Style(bold=False, underline2=False)
+
+        depth = 0
+
+        while stack:
+            stack_node = pop()
+            try:
+                last, node = next(stack_node)
+            except StopIteration:
+                levels.pop()
+                if levels:
+                    guide_style = levels[-1].style or null_style
+                    levels[-1] = make_guide(FORK, guide_style)
+                    guide_style_stack.pop()
+                    style_stack.pop()
+                continue
+            push(stack_node)
+            if last:
+                levels[-1] = make_guide(END, levels[-1].style or null_style)
+
+            guide_style = guide_style_stack.current + get_style(node.guide_style)
+            style = style_stack.current + get_style(node.style)
+            prefix = levels[(2 if self.hide_root else 1) :]
+            renderable_lines = console.render_lines(
+                Styled(node.label, style),
+                options.update(
+                    width=options.max_width
+                    - sum(level.cell_length for level in prefix),
+                    highlight=self.highlight,
+                    height=None,
+                ),
+            )
+
+            if not (depth == 0 and self.hide_root):
+                for first, line in loop_first(renderable_lines):
+                    if prefix:
+                        yield from _Segment.apply_style(
+                            prefix,
+                            style.background_style,
+                            post_style=remove_guide_styles,
+                        )
+                    yield from line
+                    yield new_line
+                    if first and prefix:
+                        prefix[-1] = make_guide(
+                            SPACE if last else CONTINUE, prefix[-1].style or null_style
+                        )
+
+            if node.expanded and node.children:
+                levels[-1] = make_guide(
+                    SPACE if last else CONTINUE, levels[-1].style or null_style
+                )
+                levels.append(
+                    make_guide(END if len(node.children) == 1 else FORK, guide_style)
+                )
+                style_stack.push(get_style(node.style))
+                guide_style_stack.push(get_style(node.guide_style))
+                push(iter(loop_last(node.children)))
+                depth += 1
+
+    def __rich_measure__(
+        self, console: "Console", options: "ConsoleOptions"
+    ) -> "Measurement":
+        stack: List[Iterator[Tree]] = [iter([self])]
+        pop = stack.pop
+        push = stack.append
+        minimum = 0
+        maximum = 0
+        measure = Measurement.get
+        level = 0
+        while stack:
+            iter_tree = pop()
+            try:
+                tree = next(iter_tree)
+            except StopIteration:
+                level -= 1
+                continue
+            push(iter_tree)
+            min_measure, max_measure = measure(console, options, tree.label)
+            indent = level * 4
+            minimum = max(min_measure + indent, minimum)
+            maximum = max(max_measure + indent, maximum)
+            if tree.expanded and tree.children:
+                push(iter(tree.children))
+                level += 1
+        return Measurement(minimum, maximum)
+
+
+if __name__ == "__main__":  # pragma: no cover
+
+    from pip._vendor.rich.console import Group
+    from pip._vendor.rich.markdown import Markdown
+    from pip._vendor.rich.panel import Panel
+    from pip._vendor.rich.syntax import Syntax
+    from pip._vendor.rich.table import Table
+
+    table = Table(row_styles=["", "dim"])
+
+    table.add_column("Released", style="cyan", no_wrap=True)
+    table.add_column("Title", style="magenta")
+    table.add_column("Box Office", justify="right", style="green")
+
+    table.add_row("Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$952,110,690")
+    table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347")
+    table.add_row("Dec 15, 2017", "Star Wars Ep. V111: The Last Jedi", "$1,332,539,889")
+    table.add_row("Dec 16, 2016", "Rogue One: A Star Wars Story", "$1,332,439,889")
+
+    code = """\
+class Segment(NamedTuple):
+    text: str = ""    
+    style: Optional[Style] = None    
+    is_control: bool = False    
+"""
+    syntax = Syntax(code, "python", theme="monokai", line_numbers=True)
+
+    markdown = Markdown(
+        """\
+### example.md
+> Hello, World!
+> 
+> Markdown _all_ the things
+"""
+    )
+
+    root = Tree("🌲 [b green]Rich Tree", highlight=True, hide_root=True)
+
+    node = root.add(":file_folder: Renderables", guide_style="red")
+    simple_node = node.add(":file_folder: [bold yellow]Atomic", guide_style="uu green")
+    simple_node.add(Group("📄 Syntax", syntax))
+    simple_node.add(Group("📄 Markdown", Panel(markdown, border_style="green")))
+
+    containers_node = node.add(
+        ":file_folder: [bold magenta]Containers", guide_style="bold magenta"
+    )
+    containers_node.expanded = True
+    panel = Panel.fit("Just a panel", border_style="red")
+    containers_node.add(Group("📄 Panels", panel))
+
+    containers_node.add(Group("📄 [b magenta]Table", table))
+
+    console = Console()
+    console.print(root)