Add files using upload-large-folder tool
Browse filesThis view is limited to 50 files because it contains too many changes.
See raw diff
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__init__.py +14 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/__init__.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_array_api.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_bunch.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_ccallback.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_disjoint_set.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_docscrape.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_elementwise_iterative_method.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_finite_differences.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_pep440.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_testutils.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_threadsafety.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_tmpdirs.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_util.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/decorator.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/deprecation.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_array_api.py +524 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_bunch.py +225 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_ccallback.py +251 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_disjoint_set.py +254 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_docscrape.py +679 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_elementwise_iterative_method.py +348 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_finite_differences.py +145 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_fpumode.cpython-310-x86_64-linux-gnu.so +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_gcutils.py +105 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_pep440.py +487 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_test_ccallback.cpython-310-x86_64-linux-gnu.so +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_test_deprecation_call.cpython-310-x86_64-linux-gnu.so +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_test_deprecation_def.cpython-310-x86_64-linux-gnu.so +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_testutils.py +337 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_threadsafety.py +58 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_tmpdirs.py +86 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_util.py +954 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/decorator.py +399 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/deprecation.py +239 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/doccer.py +275 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/messagestream.cpython-310-x86_64-linux-gnu.so +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__init__.py +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/__init__.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__gcutils.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__pep440.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__testutils.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__threadsafety.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__util.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_array_api.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_bunch.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_ccallback.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_deprecation.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_import_cycles.cpython-310.pyc +0 -0
- emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_public_api.cpython-310.pyc +0 -0
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__init__.py
ADDED
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"""
|
2 |
+
Module containing private utility functions
|
3 |
+
===========================================
|
4 |
+
|
5 |
+
The ``scipy._lib`` namespace is empty (for now). Tests for all
|
6 |
+
utilities in submodules of ``_lib`` can be run with::
|
7 |
+
|
8 |
+
from scipy import _lib
|
9 |
+
_lib.test()
|
10 |
+
|
11 |
+
"""
|
12 |
+
from scipy._lib._testutils import PytestTester
|
13 |
+
test = PytestTester(__name__)
|
14 |
+
del PytestTester
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/__init__.cpython-310.pyc
ADDED
Binary file (565 Bytes). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_array_api.cpython-310.pyc
ADDED
Binary file (13.7 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_bunch.cpython-310.pyc
ADDED
Binary file (6.94 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_ccallback.cpython-310.pyc
ADDED
Binary file (7.04 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_disjoint_set.cpython-310.pyc
ADDED
Binary file (6.46 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_docscrape.cpython-310.pyc
ADDED
Binary file (19 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_elementwise_iterative_method.cpython-310.pyc
ADDED
Binary file (11.1 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_finite_differences.cpython-310.pyc
ADDED
Binary file (4.08 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_pep440.cpython-310.pyc
ADDED
Binary file (12.7 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_testutils.cpython-310.pyc
ADDED
Binary file (9.93 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_threadsafety.cpython-310.pyc
ADDED
Binary file (2.32 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_tmpdirs.cpython-310.pyc
ADDED
Binary file (2.78 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/_util.cpython-310.pyc
ADDED
Binary file (30.5 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/decorator.cpython-310.pyc
ADDED
Binary file (11.5 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/__pycache__/deprecation.cpython-310.pyc
ADDED
Binary file (7.43 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_array_api.py
ADDED
@@ -0,0 +1,524 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"""Utility functions to use Python Array API compatible libraries.
|
2 |
+
|
3 |
+
For the context about the Array API see:
|
4 |
+
https://data-apis.org/array-api/latest/purpose_and_scope.html
|
5 |
+
|
6 |
+
The SciPy use case of the Array API is described on the following page:
|
7 |
+
https://data-apis.org/array-api/latest/use_cases.html#use-case-scipy
|
8 |
+
"""
|
9 |
+
from __future__ import annotations
|
10 |
+
|
11 |
+
import os
|
12 |
+
import warnings
|
13 |
+
|
14 |
+
from types import ModuleType
|
15 |
+
from typing import Any, Literal, TYPE_CHECKING
|
16 |
+
|
17 |
+
import numpy as np
|
18 |
+
import numpy.typing as npt
|
19 |
+
|
20 |
+
from scipy._lib import array_api_compat
|
21 |
+
from scipy._lib.array_api_compat import (
|
22 |
+
is_array_api_obj,
|
23 |
+
size,
|
24 |
+
numpy as np_compat,
|
25 |
+
device
|
26 |
+
)
|
27 |
+
|
28 |
+
__all__ = ['array_namespace', '_asarray', 'size', 'device']
|
29 |
+
|
30 |
+
|
31 |
+
# To enable array API and strict array-like input validation
|
32 |
+
SCIPY_ARRAY_API: str | bool = os.environ.get("SCIPY_ARRAY_API", False)
|
33 |
+
# To control the default device - for use in the test suite only
|
34 |
+
SCIPY_DEVICE = os.environ.get("SCIPY_DEVICE", "cpu")
|
35 |
+
|
36 |
+
_GLOBAL_CONFIG = {
|
37 |
+
"SCIPY_ARRAY_API": SCIPY_ARRAY_API,
|
38 |
+
"SCIPY_DEVICE": SCIPY_DEVICE,
|
39 |
+
}
|
40 |
+
|
41 |
+
|
42 |
+
if TYPE_CHECKING:
|
43 |
+
Array = Any # To be changed to a Protocol later (see array-api#589)
|
44 |
+
ArrayLike = Array | npt.ArrayLike
|
45 |
+
|
46 |
+
|
47 |
+
def compliance_scipy(arrays: list[ArrayLike]) -> list[Array]:
|
48 |
+
"""Raise exceptions on known-bad subclasses.
|
49 |
+
|
50 |
+
The following subclasses are not supported and raise and error:
|
51 |
+
- `numpy.ma.MaskedArray`
|
52 |
+
- `numpy.matrix`
|
53 |
+
- NumPy arrays which do not have a boolean or numerical dtype
|
54 |
+
- Any array-like which is neither array API compatible nor coercible by NumPy
|
55 |
+
- Any array-like which is coerced by NumPy to an unsupported dtype
|
56 |
+
"""
|
57 |
+
for i in range(len(arrays)):
|
58 |
+
array = arrays[i]
|
59 |
+
if isinstance(array, np.ma.MaskedArray):
|
60 |
+
raise TypeError("Inputs of type `numpy.ma.MaskedArray` are not supported.")
|
61 |
+
elif isinstance(array, np.matrix):
|
62 |
+
raise TypeError("Inputs of type `numpy.matrix` are not supported.")
|
63 |
+
if isinstance(array, (np.ndarray, np.generic)):
|
64 |
+
dtype = array.dtype
|
65 |
+
if not (np.issubdtype(dtype, np.number) or np.issubdtype(dtype, np.bool_)):
|
66 |
+
raise TypeError(f"An argument has dtype `{dtype!r}`; "
|
67 |
+
f"only boolean and numerical dtypes are supported.")
|
68 |
+
elif not is_array_api_obj(array):
|
69 |
+
try:
|
70 |
+
array = np.asanyarray(array)
|
71 |
+
except TypeError:
|
72 |
+
raise TypeError("An argument is neither array API compatible nor "
|
73 |
+
"coercible by NumPy.")
|
74 |
+
dtype = array.dtype
|
75 |
+
if not (np.issubdtype(dtype, np.number) or np.issubdtype(dtype, np.bool_)):
|
76 |
+
message = (
|
77 |
+
f"An argument was coerced to an unsupported dtype `{dtype!r}`; "
|
78 |
+
f"only boolean and numerical dtypes are supported."
|
79 |
+
)
|
80 |
+
raise TypeError(message)
|
81 |
+
arrays[i] = array
|
82 |
+
return arrays
|
83 |
+
|
84 |
+
|
85 |
+
def _check_finite(array: Array, xp: ModuleType) -> None:
|
86 |
+
"""Check for NaNs or Infs."""
|
87 |
+
msg = "array must not contain infs or NaNs"
|
88 |
+
try:
|
89 |
+
if not xp.all(xp.isfinite(array)):
|
90 |
+
raise ValueError(msg)
|
91 |
+
except TypeError:
|
92 |
+
raise ValueError(msg)
|
93 |
+
|
94 |
+
|
95 |
+
def array_namespace(*arrays: Array) -> ModuleType:
|
96 |
+
"""Get the array API compatible namespace for the arrays xs.
|
97 |
+
|
98 |
+
Parameters
|
99 |
+
----------
|
100 |
+
*arrays : sequence of array_like
|
101 |
+
Arrays used to infer the common namespace.
|
102 |
+
|
103 |
+
Returns
|
104 |
+
-------
|
105 |
+
namespace : module
|
106 |
+
Common namespace.
|
107 |
+
|
108 |
+
Notes
|
109 |
+
-----
|
110 |
+
Thin wrapper around `array_api_compat.array_namespace`.
|
111 |
+
|
112 |
+
1. Check for the global switch: SCIPY_ARRAY_API. This can also be accessed
|
113 |
+
dynamically through ``_GLOBAL_CONFIG['SCIPY_ARRAY_API']``.
|
114 |
+
2. `compliance_scipy` raise exceptions on known-bad subclasses. See
|
115 |
+
its definition for more details.
|
116 |
+
|
117 |
+
When the global switch is False, it defaults to the `numpy` namespace.
|
118 |
+
In that case, there is no compliance check. This is a convenience to
|
119 |
+
ease the adoption. Otherwise, arrays must comply with the new rules.
|
120 |
+
"""
|
121 |
+
if not _GLOBAL_CONFIG["SCIPY_ARRAY_API"]:
|
122 |
+
# here we could wrap the namespace if needed
|
123 |
+
return np_compat
|
124 |
+
|
125 |
+
_arrays = [array for array in arrays if array is not None]
|
126 |
+
|
127 |
+
_arrays = compliance_scipy(_arrays)
|
128 |
+
|
129 |
+
return array_api_compat.array_namespace(*_arrays)
|
130 |
+
|
131 |
+
|
132 |
+
def _asarray(
|
133 |
+
array: ArrayLike,
|
134 |
+
dtype: Any = None,
|
135 |
+
order: Literal['K', 'A', 'C', 'F'] | None = None,
|
136 |
+
copy: bool | None = None,
|
137 |
+
*,
|
138 |
+
xp: ModuleType | None = None,
|
139 |
+
check_finite: bool = False,
|
140 |
+
subok: bool = False,
|
141 |
+
) -> Array:
|
142 |
+
"""SciPy-specific replacement for `np.asarray` with `order`, `check_finite`, and
|
143 |
+
`subok`.
|
144 |
+
|
145 |
+
Memory layout parameter `order` is not exposed in the Array API standard.
|
146 |
+
`order` is only enforced if the input array implementation
|
147 |
+
is NumPy based, otherwise `order` is just silently ignored.
|
148 |
+
|
149 |
+
`check_finite` is also not a keyword in the array API standard; included
|
150 |
+
here for convenience rather than that having to be a separate function
|
151 |
+
call inside SciPy functions.
|
152 |
+
|
153 |
+
`subok` is included to allow this function to preserve the behaviour of
|
154 |
+
`np.asanyarray` for NumPy based inputs.
|
155 |
+
"""
|
156 |
+
if xp is None:
|
157 |
+
xp = array_namespace(array)
|
158 |
+
if xp.__name__ in {"numpy", "scipy._lib.array_api_compat.numpy"}:
|
159 |
+
# Use NumPy API to support order
|
160 |
+
if copy is True:
|
161 |
+
array = np.array(array, order=order, dtype=dtype, subok=subok)
|
162 |
+
elif subok:
|
163 |
+
array = np.asanyarray(array, order=order, dtype=dtype)
|
164 |
+
else:
|
165 |
+
array = np.asarray(array, order=order, dtype=dtype)
|
166 |
+
|
167 |
+
# At this point array is a NumPy ndarray. We convert it to an array
|
168 |
+
# container that is consistent with the input's namespace.
|
169 |
+
array = xp.asarray(array)
|
170 |
+
else:
|
171 |
+
try:
|
172 |
+
array = xp.asarray(array, dtype=dtype, copy=copy)
|
173 |
+
except TypeError:
|
174 |
+
coerced_xp = array_namespace(xp.asarray(3))
|
175 |
+
array = coerced_xp.asarray(array, dtype=dtype, copy=copy)
|
176 |
+
|
177 |
+
if check_finite:
|
178 |
+
_check_finite(array, xp)
|
179 |
+
|
180 |
+
return array
|
181 |
+
|
182 |
+
|
183 |
+
def atleast_nd(x: Array, *, ndim: int, xp: ModuleType | None = None) -> Array:
|
184 |
+
"""Recursively expand the dimension to have at least `ndim`."""
|
185 |
+
if xp is None:
|
186 |
+
xp = array_namespace(x)
|
187 |
+
x = xp.asarray(x)
|
188 |
+
if x.ndim < ndim:
|
189 |
+
x = xp.expand_dims(x, axis=0)
|
190 |
+
x = atleast_nd(x, ndim=ndim, xp=xp)
|
191 |
+
return x
|
192 |
+
|
193 |
+
|
194 |
+
def copy(x: Array, *, xp: ModuleType | None = None) -> Array:
|
195 |
+
"""
|
196 |
+
Copies an array.
|
197 |
+
|
198 |
+
Parameters
|
199 |
+
----------
|
200 |
+
x : array
|
201 |
+
|
202 |
+
xp : array_namespace
|
203 |
+
|
204 |
+
Returns
|
205 |
+
-------
|
206 |
+
copy : array
|
207 |
+
Copied array
|
208 |
+
|
209 |
+
Notes
|
210 |
+
-----
|
211 |
+
This copy function does not offer all the semantics of `np.copy`, i.e. the
|
212 |
+
`subok` and `order` keywords are not used.
|
213 |
+
"""
|
214 |
+
# Note: xp.asarray fails if xp is numpy.
|
215 |
+
if xp is None:
|
216 |
+
xp = array_namespace(x)
|
217 |
+
|
218 |
+
return _asarray(x, copy=True, xp=xp)
|
219 |
+
|
220 |
+
|
221 |
+
def is_numpy(xp: ModuleType) -> bool:
|
222 |
+
return xp.__name__ in ('numpy', 'scipy._lib.array_api_compat.numpy')
|
223 |
+
|
224 |
+
|
225 |
+
def is_cupy(xp: ModuleType) -> bool:
|
226 |
+
return xp.__name__ in ('cupy', 'scipy._lib.array_api_compat.cupy')
|
227 |
+
|
228 |
+
|
229 |
+
def is_torch(xp: ModuleType) -> bool:
|
230 |
+
return xp.__name__ in ('torch', 'scipy._lib.array_api_compat.torch')
|
231 |
+
|
232 |
+
def is_jax(xp):
|
233 |
+
return xp.__name__ in ('jax.numpy', 'jax.experimental.array_api')
|
234 |
+
|
235 |
+
|
236 |
+
def _strict_check(actual, desired, xp,
|
237 |
+
check_namespace=True, check_dtype=True, check_shape=True):
|
238 |
+
__tracebackhide__ = True # Hide traceback for py.test
|
239 |
+
if check_namespace:
|
240 |
+
_assert_matching_namespace(actual, desired)
|
241 |
+
|
242 |
+
desired = xp.asarray(desired)
|
243 |
+
|
244 |
+
if check_dtype:
|
245 |
+
_msg = f"dtypes do not match.\nActual: {actual.dtype}\nDesired: {desired.dtype}"
|
246 |
+
assert actual.dtype == desired.dtype, _msg
|
247 |
+
|
248 |
+
if check_shape:
|
249 |
+
_msg = f"Shapes do not match.\nActual: {actual.shape}\nDesired: {desired.shape}"
|
250 |
+
assert actual.shape == desired.shape, _msg
|
251 |
+
_check_scalar(actual, desired, xp)
|
252 |
+
|
253 |
+
desired = xp.broadcast_to(desired, actual.shape)
|
254 |
+
return desired
|
255 |
+
|
256 |
+
|
257 |
+
def _assert_matching_namespace(actual, desired):
|
258 |
+
__tracebackhide__ = True # Hide traceback for py.test
|
259 |
+
actual = actual if isinstance(actual, tuple) else (actual,)
|
260 |
+
desired_space = array_namespace(desired)
|
261 |
+
for arr in actual:
|
262 |
+
arr_space = array_namespace(arr)
|
263 |
+
_msg = (f"Namespaces do not match.\n"
|
264 |
+
f"Actual: {arr_space.__name__}\n"
|
265 |
+
f"Desired: {desired_space.__name__}")
|
266 |
+
assert arr_space == desired_space, _msg
|
267 |
+
|
268 |
+
|
269 |
+
def _check_scalar(actual, desired, xp):
|
270 |
+
__tracebackhide__ = True # Hide traceback for py.test
|
271 |
+
# Shape check alone is sufficient unless desired.shape == (). Also,
|
272 |
+
# only NumPy distinguishes between scalars and arrays.
|
273 |
+
if desired.shape != () or not is_numpy(xp):
|
274 |
+
return
|
275 |
+
# We want to follow the conventions of the `xp` library. Libraries like
|
276 |
+
# NumPy, for which `np.asarray(0)[()]` returns a scalar, tend to return
|
277 |
+
# a scalar even when a 0D array might be more appropriate:
|
278 |
+
# import numpy as np
|
279 |
+
# np.mean([1, 2, 3]) # scalar, not 0d array
|
280 |
+
# np.asarray(0)*2 # scalar, not 0d array
|
281 |
+
# np.sin(np.asarray(0)) # scalar, not 0d array
|
282 |
+
# Libraries like CuPy, for which `cp.asarray(0)[()]` returns a 0D array,
|
283 |
+
# tend to return a 0D array in scenarios like those above.
|
284 |
+
# Therefore, regardless of whether the developer provides a scalar or 0D
|
285 |
+
# array for `desired`, we would typically want the type of `actual` to be
|
286 |
+
# the type of `desired[()]`. If the developer wants to override this
|
287 |
+
# behavior, they can set `check_shape=False`.
|
288 |
+
desired = desired[()]
|
289 |
+
_msg = f"Types do not match:\n Actual: {type(actual)}\n Desired: {type(desired)}"
|
290 |
+
assert (xp.isscalar(actual) and xp.isscalar(desired)
|
291 |
+
or (not xp.isscalar(actual) and not xp.isscalar(desired))), _msg
|
292 |
+
|
293 |
+
|
294 |
+
def xp_assert_equal(actual, desired, check_namespace=True, check_dtype=True,
|
295 |
+
check_shape=True, err_msg='', xp=None):
|
296 |
+
__tracebackhide__ = True # Hide traceback for py.test
|
297 |
+
if xp is None:
|
298 |
+
xp = array_namespace(actual)
|
299 |
+
desired = _strict_check(actual, desired, xp, check_namespace=check_namespace,
|
300 |
+
check_dtype=check_dtype, check_shape=check_shape)
|
301 |
+
if is_cupy(xp):
|
302 |
+
return xp.testing.assert_array_equal(actual, desired, err_msg=err_msg)
|
303 |
+
elif is_torch(xp):
|
304 |
+
# PyTorch recommends using `rtol=0, atol=0` like this
|
305 |
+
# to test for exact equality
|
306 |
+
err_msg = None if err_msg == '' else err_msg
|
307 |
+
return xp.testing.assert_close(actual, desired, rtol=0, atol=0, equal_nan=True,
|
308 |
+
check_dtype=False, msg=err_msg)
|
309 |
+
# JAX uses `np.testing`
|
310 |
+
return np.testing.assert_array_equal(actual, desired, err_msg=err_msg)
|
311 |
+
|
312 |
+
|
313 |
+
def xp_assert_close(actual, desired, rtol=None, atol=0, check_namespace=True,
|
314 |
+
check_dtype=True, check_shape=True, err_msg='', xp=None):
|
315 |
+
__tracebackhide__ = True # Hide traceback for py.test
|
316 |
+
if xp is None:
|
317 |
+
xp = array_namespace(actual)
|
318 |
+
desired = _strict_check(actual, desired, xp, check_namespace=check_namespace,
|
319 |
+
check_dtype=check_dtype, check_shape=check_shape)
|
320 |
+
|
321 |
+
floating = xp.isdtype(actual.dtype, ('real floating', 'complex floating'))
|
322 |
+
if rtol is None and floating:
|
323 |
+
# multiplier of 4 is used as for `np.float64` this puts the default `rtol`
|
324 |
+
# roughly half way between sqrt(eps) and the default for
|
325 |
+
# `numpy.testing.assert_allclose`, 1e-7
|
326 |
+
rtol = xp.finfo(actual.dtype).eps**0.5 * 4
|
327 |
+
elif rtol is None:
|
328 |
+
rtol = 1e-7
|
329 |
+
|
330 |
+
if is_cupy(xp):
|
331 |
+
return xp.testing.assert_allclose(actual, desired, rtol=rtol,
|
332 |
+
atol=atol, err_msg=err_msg)
|
333 |
+
elif is_torch(xp):
|
334 |
+
err_msg = None if err_msg == '' else err_msg
|
335 |
+
return xp.testing.assert_close(actual, desired, rtol=rtol, atol=atol,
|
336 |
+
equal_nan=True, check_dtype=False, msg=err_msg)
|
337 |
+
# JAX uses `np.testing`
|
338 |
+
return np.testing.assert_allclose(actual, desired, rtol=rtol,
|
339 |
+
atol=atol, err_msg=err_msg)
|
340 |
+
|
341 |
+
|
342 |
+
def xp_assert_less(actual, desired, check_namespace=True, check_dtype=True,
|
343 |
+
check_shape=True, err_msg='', verbose=True, xp=None):
|
344 |
+
__tracebackhide__ = True # Hide traceback for py.test
|
345 |
+
if xp is None:
|
346 |
+
xp = array_namespace(actual)
|
347 |
+
desired = _strict_check(actual, desired, xp, check_namespace=check_namespace,
|
348 |
+
check_dtype=check_dtype, check_shape=check_shape)
|
349 |
+
if is_cupy(xp):
|
350 |
+
return xp.testing.assert_array_less(actual, desired,
|
351 |
+
err_msg=err_msg, verbose=verbose)
|
352 |
+
elif is_torch(xp):
|
353 |
+
if actual.device.type != 'cpu':
|
354 |
+
actual = actual.cpu()
|
355 |
+
if desired.device.type != 'cpu':
|
356 |
+
desired = desired.cpu()
|
357 |
+
# JAX uses `np.testing`
|
358 |
+
return np.testing.assert_array_less(actual, desired,
|
359 |
+
err_msg=err_msg, verbose=verbose)
|
360 |
+
|
361 |
+
|
362 |
+
def cov(x: Array, *, xp: ModuleType | None = None) -> Array:
|
363 |
+
if xp is None:
|
364 |
+
xp = array_namespace(x)
|
365 |
+
|
366 |
+
X = copy(x, xp=xp)
|
367 |
+
dtype = xp.result_type(X, xp.float64)
|
368 |
+
|
369 |
+
X = atleast_nd(X, ndim=2, xp=xp)
|
370 |
+
X = xp.asarray(X, dtype=dtype)
|
371 |
+
|
372 |
+
avg = xp.mean(X, axis=1)
|
373 |
+
fact = X.shape[1] - 1
|
374 |
+
|
375 |
+
if fact <= 0:
|
376 |
+
warnings.warn("Degrees of freedom <= 0 for slice",
|
377 |
+
RuntimeWarning, stacklevel=2)
|
378 |
+
fact = 0.0
|
379 |
+
|
380 |
+
X -= avg[:, None]
|
381 |
+
X_T = X.T
|
382 |
+
if xp.isdtype(X_T.dtype, 'complex floating'):
|
383 |
+
X_T = xp.conj(X_T)
|
384 |
+
c = X @ X_T
|
385 |
+
c /= fact
|
386 |
+
axes = tuple(axis for axis, length in enumerate(c.shape) if length == 1)
|
387 |
+
return xp.squeeze(c, axis=axes)
|
388 |
+
|
389 |
+
|
390 |
+
def xp_unsupported_param_msg(param: Any) -> str:
|
391 |
+
return f'Providing {param!r} is only supported for numpy arrays.'
|
392 |
+
|
393 |
+
|
394 |
+
def is_complex(x: Array, xp: ModuleType) -> bool:
|
395 |
+
return xp.isdtype(x.dtype, 'complex floating')
|
396 |
+
|
397 |
+
|
398 |
+
def get_xp_devices(xp: ModuleType) -> list[str] | list[None]:
|
399 |
+
"""Returns a list of available devices for the given namespace."""
|
400 |
+
devices: list[str] = []
|
401 |
+
if is_torch(xp):
|
402 |
+
devices += ['cpu']
|
403 |
+
import torch # type: ignore[import]
|
404 |
+
num_cuda = torch.cuda.device_count()
|
405 |
+
for i in range(0, num_cuda):
|
406 |
+
devices += [f'cuda:{i}']
|
407 |
+
if torch.backends.mps.is_available():
|
408 |
+
devices += ['mps']
|
409 |
+
return devices
|
410 |
+
elif is_cupy(xp):
|
411 |
+
import cupy # type: ignore[import]
|
412 |
+
num_cuda = cupy.cuda.runtime.getDeviceCount()
|
413 |
+
for i in range(0, num_cuda):
|
414 |
+
devices += [f'cuda:{i}']
|
415 |
+
return devices
|
416 |
+
elif is_jax(xp):
|
417 |
+
import jax # type: ignore[import]
|
418 |
+
num_cpu = jax.device_count(backend='cpu')
|
419 |
+
for i in range(0, num_cpu):
|
420 |
+
devices += [f'cpu:{i}']
|
421 |
+
num_gpu = jax.device_count(backend='gpu')
|
422 |
+
for i in range(0, num_gpu):
|
423 |
+
devices += [f'gpu:{i}']
|
424 |
+
num_tpu = jax.device_count(backend='tpu')
|
425 |
+
for i in range(0, num_tpu):
|
426 |
+
devices += [f'tpu:{i}']
|
427 |
+
return devices
|
428 |
+
|
429 |
+
# given namespace is not known to have a list of available devices;
|
430 |
+
# return `[None]` so that one can use this in tests for `device=None`.
|
431 |
+
return [None]
|
432 |
+
|
433 |
+
|
434 |
+
def scipy_namespace_for(xp: ModuleType) -> ModuleType:
|
435 |
+
"""
|
436 |
+
Return the `scipy` namespace for alternative backends, where it exists,
|
437 |
+
such as `cupyx.scipy` and `jax.scipy`. Useful for ad hoc dispatching.
|
438 |
+
|
439 |
+
Default: return `scipy` (this package).
|
440 |
+
"""
|
441 |
+
|
442 |
+
|
443 |
+
if is_cupy(xp):
|
444 |
+
import cupyx # type: ignore[import-not-found,import-untyped]
|
445 |
+
return cupyx.scipy
|
446 |
+
|
447 |
+
if is_jax(xp):
|
448 |
+
import jax # type: ignore[import-not-found]
|
449 |
+
return jax.scipy
|
450 |
+
|
451 |
+
import scipy
|
452 |
+
return scipy
|
453 |
+
|
454 |
+
|
455 |
+
# temporary substitute for xp.minimum, which is not yet in all backends
|
456 |
+
# or covered by array_api_compat.
|
457 |
+
def xp_minimum(x1: Array, x2: Array, /) -> Array:
|
458 |
+
# xp won't be passed in because it doesn't need to be passed in to xp.minimum
|
459 |
+
xp = array_namespace(x1, x2)
|
460 |
+
if hasattr(xp, 'minimum'):
|
461 |
+
return xp.minimum(x1, x2)
|
462 |
+
x1, x2 = xp.broadcast_arrays(x1, x2)
|
463 |
+
i = (x2 < x1) | xp.isnan(x2)
|
464 |
+
res = xp.where(i, x2, x1)
|
465 |
+
return res[()] if res.ndim == 0 else res
|
466 |
+
|
467 |
+
|
468 |
+
# temporary substitute for xp.clip, which is not yet in all backends
|
469 |
+
# or covered by array_api_compat.
|
470 |
+
def xp_clip(
|
471 |
+
x: Array,
|
472 |
+
/,
|
473 |
+
min: int | float | Array | None = None,
|
474 |
+
max: int | float | Array | None = None,
|
475 |
+
*,
|
476 |
+
xp: ModuleType | None = None) -> Array:
|
477 |
+
xp = array_namespace(x) if xp is None else xp
|
478 |
+
a, b = xp.asarray(min, dtype=x.dtype), xp.asarray(max, dtype=x.dtype)
|
479 |
+
if hasattr(xp, 'clip'):
|
480 |
+
return xp.clip(x, a, b)
|
481 |
+
x, a, b = xp.broadcast_arrays(x, a, b)
|
482 |
+
y = xp.asarray(x, copy=True)
|
483 |
+
ia = y < a
|
484 |
+
y[ia] = a[ia]
|
485 |
+
ib = y > b
|
486 |
+
y[ib] = b[ib]
|
487 |
+
return y[()] if y.ndim == 0 else y
|
488 |
+
|
489 |
+
|
490 |
+
# temporary substitute for xp.moveaxis, which is not yet in all backends
|
491 |
+
# or covered by array_api_compat.
|
492 |
+
def xp_moveaxis_to_end(
|
493 |
+
x: Array,
|
494 |
+
source: int,
|
495 |
+
/, *,
|
496 |
+
xp: ModuleType | None = None) -> Array:
|
497 |
+
xp = array_namespace(xp) if xp is None else xp
|
498 |
+
axes = list(range(x.ndim))
|
499 |
+
temp = axes.pop(source)
|
500 |
+
axes = axes + [temp]
|
501 |
+
return xp.permute_dims(x, axes)
|
502 |
+
|
503 |
+
|
504 |
+
# temporary substitute for xp.copysign, which is not yet in all backends
|
505 |
+
# or covered by array_api_compat.
|
506 |
+
def xp_copysign(x1: Array, x2: Array, /, *, xp: ModuleType | None = None) -> Array:
|
507 |
+
# no attempt to account for special cases
|
508 |
+
xp = array_namespace(x1, x2) if xp is None else xp
|
509 |
+
abs_x1 = xp.abs(x1)
|
510 |
+
return xp.where(x2 >= 0, abs_x1, -abs_x1)
|
511 |
+
|
512 |
+
|
513 |
+
# partial substitute for xp.sign, which does not cover the NaN special case
|
514 |
+
# that I need. (https://github.com/data-apis/array-api-compat/issues/136)
|
515 |
+
def xp_sign(x: Array, /, *, xp: ModuleType | None = None) -> Array:
|
516 |
+
xp = array_namespace(x) if xp is None else xp
|
517 |
+
if is_numpy(xp): # only NumPy implements the special cases correctly
|
518 |
+
return xp.sign(x)
|
519 |
+
sign = xp.full_like(x, xp.nan)
|
520 |
+
one = xp.asarray(1, dtype=x.dtype)
|
521 |
+
sign = xp.where(x > 0, one, sign)
|
522 |
+
sign = xp.where(x < 0, -one, sign)
|
523 |
+
sign = xp.where(x == 0, 0*one, sign)
|
524 |
+
return sign
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_bunch.py
ADDED
@@ -0,0 +1,225 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
import sys as _sys
|
2 |
+
from keyword import iskeyword as _iskeyword
|
3 |
+
|
4 |
+
|
5 |
+
def _validate_names(typename, field_names, extra_field_names):
|
6 |
+
"""
|
7 |
+
Ensure that all the given names are valid Python identifiers that
|
8 |
+
do not start with '_'. Also check that there are no duplicates
|
9 |
+
among field_names + extra_field_names.
|
10 |
+
"""
|
11 |
+
for name in [typename] + field_names + extra_field_names:
|
12 |
+
if not isinstance(name, str):
|
13 |
+
raise TypeError('typename and all field names must be strings')
|
14 |
+
if not name.isidentifier():
|
15 |
+
raise ValueError('typename and all field names must be valid '
|
16 |
+
f'identifiers: {name!r}')
|
17 |
+
if _iskeyword(name):
|
18 |
+
raise ValueError('typename and all field names cannot be a '
|
19 |
+
f'keyword: {name!r}')
|
20 |
+
|
21 |
+
seen = set()
|
22 |
+
for name in field_names + extra_field_names:
|
23 |
+
if name.startswith('_'):
|
24 |
+
raise ValueError('Field names cannot start with an underscore: '
|
25 |
+
f'{name!r}')
|
26 |
+
if name in seen:
|
27 |
+
raise ValueError(f'Duplicate field name: {name!r}')
|
28 |
+
seen.add(name)
|
29 |
+
|
30 |
+
|
31 |
+
# Note: This code is adapted from CPython:Lib/collections/__init__.py
|
32 |
+
def _make_tuple_bunch(typename, field_names, extra_field_names=None,
|
33 |
+
module=None):
|
34 |
+
"""
|
35 |
+
Create a namedtuple-like class with additional attributes.
|
36 |
+
|
37 |
+
This function creates a subclass of tuple that acts like a namedtuple
|
38 |
+
and that has additional attributes.
|
39 |
+
|
40 |
+
The additional attributes are listed in `extra_field_names`. The
|
41 |
+
values assigned to these attributes are not part of the tuple.
|
42 |
+
|
43 |
+
The reason this function exists is to allow functions in SciPy
|
44 |
+
that currently return a tuple or a namedtuple to returned objects
|
45 |
+
that have additional attributes, while maintaining backwards
|
46 |
+
compatibility.
|
47 |
+
|
48 |
+
This should only be used to enhance *existing* functions in SciPy.
|
49 |
+
New functions are free to create objects as return values without
|
50 |
+
having to maintain backwards compatibility with an old tuple or
|
51 |
+
namedtuple return value.
|
52 |
+
|
53 |
+
Parameters
|
54 |
+
----------
|
55 |
+
typename : str
|
56 |
+
The name of the type.
|
57 |
+
field_names : list of str
|
58 |
+
List of names of the values to be stored in the tuple. These names
|
59 |
+
will also be attributes of instances, so the values in the tuple
|
60 |
+
can be accessed by indexing or as attributes. At least one name
|
61 |
+
is required. See the Notes for additional restrictions.
|
62 |
+
extra_field_names : list of str, optional
|
63 |
+
List of names of values that will be stored as attributes of the
|
64 |
+
object. See the notes for additional restrictions.
|
65 |
+
|
66 |
+
Returns
|
67 |
+
-------
|
68 |
+
cls : type
|
69 |
+
The new class.
|
70 |
+
|
71 |
+
Notes
|
72 |
+
-----
|
73 |
+
There are restrictions on the names that may be used in `field_names`
|
74 |
+
and `extra_field_names`:
|
75 |
+
|
76 |
+
* The names must be unique--no duplicates allowed.
|
77 |
+
* The names must be valid Python identifiers, and must not begin with
|
78 |
+
an underscore.
|
79 |
+
* The names must not be Python keywords (e.g. 'def', 'and', etc., are
|
80 |
+
not allowed).
|
81 |
+
|
82 |
+
Examples
|
83 |
+
--------
|
84 |
+
>>> from scipy._lib._bunch import _make_tuple_bunch
|
85 |
+
|
86 |
+
Create a class that acts like a namedtuple with length 2 (with field
|
87 |
+
names `x` and `y`) that will also have the attributes `w` and `beta`:
|
88 |
+
|
89 |
+
>>> Result = _make_tuple_bunch('Result', ['x', 'y'], ['w', 'beta'])
|
90 |
+
|
91 |
+
`Result` is the new class. We call it with keyword arguments to create
|
92 |
+
a new instance with given values.
|
93 |
+
|
94 |
+
>>> result1 = Result(x=1, y=2, w=99, beta=0.5)
|
95 |
+
>>> result1
|
96 |
+
Result(x=1, y=2, w=99, beta=0.5)
|
97 |
+
|
98 |
+
`result1` acts like a tuple of length 2:
|
99 |
+
|
100 |
+
>>> len(result1)
|
101 |
+
2
|
102 |
+
>>> result1[:]
|
103 |
+
(1, 2)
|
104 |
+
|
105 |
+
The values assigned when the instance was created are available as
|
106 |
+
attributes:
|
107 |
+
|
108 |
+
>>> result1.y
|
109 |
+
2
|
110 |
+
>>> result1.beta
|
111 |
+
0.5
|
112 |
+
"""
|
113 |
+
if len(field_names) == 0:
|
114 |
+
raise ValueError('field_names must contain at least one name')
|
115 |
+
|
116 |
+
if extra_field_names is None:
|
117 |
+
extra_field_names = []
|
118 |
+
_validate_names(typename, field_names, extra_field_names)
|
119 |
+
|
120 |
+
typename = _sys.intern(str(typename))
|
121 |
+
field_names = tuple(map(_sys.intern, field_names))
|
122 |
+
extra_field_names = tuple(map(_sys.intern, extra_field_names))
|
123 |
+
|
124 |
+
all_names = field_names + extra_field_names
|
125 |
+
arg_list = ', '.join(field_names)
|
126 |
+
full_list = ', '.join(all_names)
|
127 |
+
repr_fmt = ''.join(('(',
|
128 |
+
', '.join(f'{name}=%({name})r' for name in all_names),
|
129 |
+
')'))
|
130 |
+
tuple_new = tuple.__new__
|
131 |
+
_dict, _tuple, _zip = dict, tuple, zip
|
132 |
+
|
133 |
+
# Create all the named tuple methods to be added to the class namespace
|
134 |
+
|
135 |
+
s = f"""\
|
136 |
+
def __new__(_cls, {arg_list}, **extra_fields):
|
137 |
+
return _tuple_new(_cls, ({arg_list},))
|
138 |
+
|
139 |
+
def __init__(self, {arg_list}, **extra_fields):
|
140 |
+
for key in self._extra_fields:
|
141 |
+
if key not in extra_fields:
|
142 |
+
raise TypeError("missing keyword argument '%s'" % (key,))
|
143 |
+
for key, val in extra_fields.items():
|
144 |
+
if key not in self._extra_fields:
|
145 |
+
raise TypeError("unexpected keyword argument '%s'" % (key,))
|
146 |
+
self.__dict__[key] = val
|
147 |
+
|
148 |
+
def __setattr__(self, key, val):
|
149 |
+
if key in {repr(field_names)}:
|
150 |
+
raise AttributeError("can't set attribute %r of class %r"
|
151 |
+
% (key, self.__class__.__name__))
|
152 |
+
else:
|
153 |
+
self.__dict__[key] = val
|
154 |
+
"""
|
155 |
+
del arg_list
|
156 |
+
namespace = {'_tuple_new': tuple_new,
|
157 |
+
'__builtins__': dict(TypeError=TypeError,
|
158 |
+
AttributeError=AttributeError),
|
159 |
+
'__name__': f'namedtuple_{typename}'}
|
160 |
+
exec(s, namespace)
|
161 |
+
__new__ = namespace['__new__']
|
162 |
+
__new__.__doc__ = f'Create new instance of {typename}({full_list})'
|
163 |
+
__init__ = namespace['__init__']
|
164 |
+
__init__.__doc__ = f'Instantiate instance of {typename}({full_list})'
|
165 |
+
__setattr__ = namespace['__setattr__']
|
166 |
+
|
167 |
+
def __repr__(self):
|
168 |
+
'Return a nicely formatted representation string'
|
169 |
+
return self.__class__.__name__ + repr_fmt % self._asdict()
|
170 |
+
|
171 |
+
def _asdict(self):
|
172 |
+
'Return a new dict which maps field names to their values.'
|
173 |
+
out = _dict(_zip(self._fields, self))
|
174 |
+
out.update(self.__dict__)
|
175 |
+
return out
|
176 |
+
|
177 |
+
def __getnewargs_ex__(self):
|
178 |
+
'Return self as a plain tuple. Used by copy and pickle.'
|
179 |
+
return _tuple(self), self.__dict__
|
180 |
+
|
181 |
+
# Modify function metadata to help with introspection and debugging
|
182 |
+
for method in (__new__, __repr__, _asdict, __getnewargs_ex__):
|
183 |
+
method.__qualname__ = f'{typename}.{method.__name__}'
|
184 |
+
|
185 |
+
# Build-up the class namespace dictionary
|
186 |
+
# and use type() to build the result class
|
187 |
+
class_namespace = {
|
188 |
+
'__doc__': f'{typename}({full_list})',
|
189 |
+
'_fields': field_names,
|
190 |
+
'__new__': __new__,
|
191 |
+
'__init__': __init__,
|
192 |
+
'__repr__': __repr__,
|
193 |
+
'__setattr__': __setattr__,
|
194 |
+
'_asdict': _asdict,
|
195 |
+
'_extra_fields': extra_field_names,
|
196 |
+
'__getnewargs_ex__': __getnewargs_ex__,
|
197 |
+
}
|
198 |
+
for index, name in enumerate(field_names):
|
199 |
+
|
200 |
+
def _get(self, index=index):
|
201 |
+
return self[index]
|
202 |
+
class_namespace[name] = property(_get)
|
203 |
+
for name in extra_field_names:
|
204 |
+
|
205 |
+
def _get(self, name=name):
|
206 |
+
return self.__dict__[name]
|
207 |
+
class_namespace[name] = property(_get)
|
208 |
+
|
209 |
+
result = type(typename, (tuple,), class_namespace)
|
210 |
+
|
211 |
+
# For pickling to work, the __module__ variable needs to be set to the
|
212 |
+
# frame where the named tuple is created. Bypass this step in environments
|
213 |
+
# where sys._getframe is not defined (Jython for example) or sys._getframe
|
214 |
+
# is not defined for arguments greater than 0 (IronPython), or where the
|
215 |
+
# user has specified a particular module.
|
216 |
+
if module is None:
|
217 |
+
try:
|
218 |
+
module = _sys._getframe(1).f_globals.get('__name__', '__main__')
|
219 |
+
except (AttributeError, ValueError):
|
220 |
+
pass
|
221 |
+
if module is not None:
|
222 |
+
result.__module__ = module
|
223 |
+
__new__.__module__ = module
|
224 |
+
|
225 |
+
return result
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_ccallback.py
ADDED
@@ -0,0 +1,251 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
from . import _ccallback_c
|
2 |
+
|
3 |
+
import ctypes
|
4 |
+
|
5 |
+
PyCFuncPtr = ctypes.CFUNCTYPE(ctypes.c_void_p).__bases__[0]
|
6 |
+
|
7 |
+
ffi = None
|
8 |
+
|
9 |
+
class CData:
|
10 |
+
pass
|
11 |
+
|
12 |
+
def _import_cffi():
|
13 |
+
global ffi, CData
|
14 |
+
|
15 |
+
if ffi is not None:
|
16 |
+
return
|
17 |
+
|
18 |
+
try:
|
19 |
+
import cffi
|
20 |
+
ffi = cffi.FFI()
|
21 |
+
CData = ffi.CData
|
22 |
+
except ImportError:
|
23 |
+
ffi = False
|
24 |
+
|
25 |
+
|
26 |
+
class LowLevelCallable(tuple):
|
27 |
+
"""
|
28 |
+
Low-level callback function.
|
29 |
+
|
30 |
+
Some functions in SciPy take as arguments callback functions, which
|
31 |
+
can either be python callables or low-level compiled functions. Using
|
32 |
+
compiled callback functions can improve performance somewhat by
|
33 |
+
avoiding wrapping data in Python objects.
|
34 |
+
|
35 |
+
Such low-level functions in SciPy are wrapped in `LowLevelCallable`
|
36 |
+
objects, which can be constructed from function pointers obtained from
|
37 |
+
ctypes, cffi, Cython, or contained in Python `PyCapsule` objects.
|
38 |
+
|
39 |
+
.. seealso::
|
40 |
+
|
41 |
+
Functions accepting low-level callables:
|
42 |
+
|
43 |
+
`scipy.integrate.quad`, `scipy.ndimage.generic_filter`,
|
44 |
+
`scipy.ndimage.generic_filter1d`, `scipy.ndimage.geometric_transform`
|
45 |
+
|
46 |
+
Usage examples:
|
47 |
+
|
48 |
+
:ref:`ndimage-ccallbacks`, :ref:`quad-callbacks`
|
49 |
+
|
50 |
+
Parameters
|
51 |
+
----------
|
52 |
+
function : {PyCapsule, ctypes function pointer, cffi function pointer}
|
53 |
+
Low-level callback function.
|
54 |
+
user_data : {PyCapsule, ctypes void pointer, cffi void pointer}
|
55 |
+
User data to pass on to the callback function.
|
56 |
+
signature : str, optional
|
57 |
+
Signature of the function. If omitted, determined from *function*,
|
58 |
+
if possible.
|
59 |
+
|
60 |
+
Attributes
|
61 |
+
----------
|
62 |
+
function
|
63 |
+
Callback function given.
|
64 |
+
user_data
|
65 |
+
User data given.
|
66 |
+
signature
|
67 |
+
Signature of the function.
|
68 |
+
|
69 |
+
Methods
|
70 |
+
-------
|
71 |
+
from_cython
|
72 |
+
Class method for constructing callables from Cython C-exported
|
73 |
+
functions.
|
74 |
+
|
75 |
+
Notes
|
76 |
+
-----
|
77 |
+
The argument ``function`` can be one of:
|
78 |
+
|
79 |
+
- PyCapsule, whose name contains the C function signature
|
80 |
+
- ctypes function pointer
|
81 |
+
- cffi function pointer
|
82 |
+
|
83 |
+
The signature of the low-level callback must match one of those expected
|
84 |
+
by the routine it is passed to.
|
85 |
+
|
86 |
+
If constructing low-level functions from a PyCapsule, the name of the
|
87 |
+
capsule must be the corresponding signature, in the format::
|
88 |
+
|
89 |
+
return_type (arg1_type, arg2_type, ...)
|
90 |
+
|
91 |
+
For example::
|
92 |
+
|
93 |
+
"void (double)"
|
94 |
+
"double (double, int *, void *)"
|
95 |
+
|
96 |
+
The context of a PyCapsule passed in as ``function`` is used as ``user_data``,
|
97 |
+
if an explicit value for ``user_data`` was not given.
|
98 |
+
|
99 |
+
"""
|
100 |
+
|
101 |
+
# Make the class immutable
|
102 |
+
__slots__ = ()
|
103 |
+
|
104 |
+
def __new__(cls, function, user_data=None, signature=None):
|
105 |
+
# We need to hold a reference to the function & user data,
|
106 |
+
# to prevent them going out of scope
|
107 |
+
item = cls._parse_callback(function, user_data, signature)
|
108 |
+
return tuple.__new__(cls, (item, function, user_data))
|
109 |
+
|
110 |
+
def __repr__(self):
|
111 |
+
return f"LowLevelCallable({self.function!r}, {self.user_data!r})"
|
112 |
+
|
113 |
+
@property
|
114 |
+
def function(self):
|
115 |
+
return tuple.__getitem__(self, 1)
|
116 |
+
|
117 |
+
@property
|
118 |
+
def user_data(self):
|
119 |
+
return tuple.__getitem__(self, 2)
|
120 |
+
|
121 |
+
@property
|
122 |
+
def signature(self):
|
123 |
+
return _ccallback_c.get_capsule_signature(tuple.__getitem__(self, 0))
|
124 |
+
|
125 |
+
def __getitem__(self, idx):
|
126 |
+
raise ValueError()
|
127 |
+
|
128 |
+
@classmethod
|
129 |
+
def from_cython(cls, module, name, user_data=None, signature=None):
|
130 |
+
"""
|
131 |
+
Create a low-level callback function from an exported Cython function.
|
132 |
+
|
133 |
+
Parameters
|
134 |
+
----------
|
135 |
+
module : module
|
136 |
+
Cython module where the exported function resides
|
137 |
+
name : str
|
138 |
+
Name of the exported function
|
139 |
+
user_data : {PyCapsule, ctypes void pointer, cffi void pointer}, optional
|
140 |
+
User data to pass on to the callback function.
|
141 |
+
signature : str, optional
|
142 |
+
Signature of the function. If omitted, determined from *function*.
|
143 |
+
|
144 |
+
"""
|
145 |
+
try:
|
146 |
+
function = module.__pyx_capi__[name]
|
147 |
+
except AttributeError as e:
|
148 |
+
message = "Given module is not a Cython module with __pyx_capi__ attribute"
|
149 |
+
raise ValueError(message) from e
|
150 |
+
except KeyError as e:
|
151 |
+
message = f"No function {name!r} found in __pyx_capi__ of the module"
|
152 |
+
raise ValueError(message) from e
|
153 |
+
return cls(function, user_data, signature)
|
154 |
+
|
155 |
+
@classmethod
|
156 |
+
def _parse_callback(cls, obj, user_data=None, signature=None):
|
157 |
+
_import_cffi()
|
158 |
+
|
159 |
+
if isinstance(obj, LowLevelCallable):
|
160 |
+
func = tuple.__getitem__(obj, 0)
|
161 |
+
elif isinstance(obj, PyCFuncPtr):
|
162 |
+
func, signature = _get_ctypes_func(obj, signature)
|
163 |
+
elif isinstance(obj, CData):
|
164 |
+
func, signature = _get_cffi_func(obj, signature)
|
165 |
+
elif _ccallback_c.check_capsule(obj):
|
166 |
+
func = obj
|
167 |
+
else:
|
168 |
+
raise ValueError("Given input is not a callable or a "
|
169 |
+
"low-level callable (pycapsule/ctypes/cffi)")
|
170 |
+
|
171 |
+
if isinstance(user_data, ctypes.c_void_p):
|
172 |
+
context = _get_ctypes_data(user_data)
|
173 |
+
elif isinstance(user_data, CData):
|
174 |
+
context = _get_cffi_data(user_data)
|
175 |
+
elif user_data is None:
|
176 |
+
context = 0
|
177 |
+
elif _ccallback_c.check_capsule(user_data):
|
178 |
+
context = user_data
|
179 |
+
else:
|
180 |
+
raise ValueError("Given user data is not a valid "
|
181 |
+
"low-level void* pointer (pycapsule/ctypes/cffi)")
|
182 |
+
|
183 |
+
return _ccallback_c.get_raw_capsule(func, signature, context)
|
184 |
+
|
185 |
+
|
186 |
+
#
|
187 |
+
# ctypes helpers
|
188 |
+
#
|
189 |
+
|
190 |
+
def _get_ctypes_func(func, signature=None):
|
191 |
+
# Get function pointer
|
192 |
+
func_ptr = ctypes.cast(func, ctypes.c_void_p).value
|
193 |
+
|
194 |
+
# Construct function signature
|
195 |
+
if signature is None:
|
196 |
+
signature = _typename_from_ctypes(func.restype) + " ("
|
197 |
+
for j, arg in enumerate(func.argtypes):
|
198 |
+
if j == 0:
|
199 |
+
signature += _typename_from_ctypes(arg)
|
200 |
+
else:
|
201 |
+
signature += ", " + _typename_from_ctypes(arg)
|
202 |
+
signature += ")"
|
203 |
+
|
204 |
+
return func_ptr, signature
|
205 |
+
|
206 |
+
|
207 |
+
def _typename_from_ctypes(item):
|
208 |
+
if item is None:
|
209 |
+
return "void"
|
210 |
+
elif item is ctypes.c_void_p:
|
211 |
+
return "void *"
|
212 |
+
|
213 |
+
name = item.__name__
|
214 |
+
|
215 |
+
pointer_level = 0
|
216 |
+
while name.startswith("LP_"):
|
217 |
+
pointer_level += 1
|
218 |
+
name = name[3:]
|
219 |
+
|
220 |
+
if name.startswith('c_'):
|
221 |
+
name = name[2:]
|
222 |
+
|
223 |
+
if pointer_level > 0:
|
224 |
+
name += " " + "*"*pointer_level
|
225 |
+
|
226 |
+
return name
|
227 |
+
|
228 |
+
|
229 |
+
def _get_ctypes_data(data):
|
230 |
+
# Get voidp pointer
|
231 |
+
return ctypes.cast(data, ctypes.c_void_p).value
|
232 |
+
|
233 |
+
|
234 |
+
#
|
235 |
+
# CFFI helpers
|
236 |
+
#
|
237 |
+
|
238 |
+
def _get_cffi_func(func, signature=None):
|
239 |
+
# Get function pointer
|
240 |
+
func_ptr = ffi.cast('uintptr_t', func)
|
241 |
+
|
242 |
+
# Get signature
|
243 |
+
if signature is None:
|
244 |
+
signature = ffi.getctype(ffi.typeof(func)).replace('(*)', ' ')
|
245 |
+
|
246 |
+
return func_ptr, signature
|
247 |
+
|
248 |
+
|
249 |
+
def _get_cffi_data(data):
|
250 |
+
# Get pointer
|
251 |
+
return ffi.cast('uintptr_t', data)
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_disjoint_set.py
ADDED
@@ -0,0 +1,254 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"""
|
2 |
+
Disjoint set data structure
|
3 |
+
"""
|
4 |
+
|
5 |
+
|
6 |
+
class DisjointSet:
|
7 |
+
""" Disjoint set data structure for incremental connectivity queries.
|
8 |
+
|
9 |
+
.. versionadded:: 1.6.0
|
10 |
+
|
11 |
+
Attributes
|
12 |
+
----------
|
13 |
+
n_subsets : int
|
14 |
+
The number of subsets.
|
15 |
+
|
16 |
+
Methods
|
17 |
+
-------
|
18 |
+
add
|
19 |
+
merge
|
20 |
+
connected
|
21 |
+
subset
|
22 |
+
subset_size
|
23 |
+
subsets
|
24 |
+
__getitem__
|
25 |
+
|
26 |
+
Notes
|
27 |
+
-----
|
28 |
+
This class implements the disjoint set [1]_, also known as the *union-find*
|
29 |
+
or *merge-find* data structure. The *find* operation (implemented in
|
30 |
+
`__getitem__`) implements the *path halving* variant. The *merge* method
|
31 |
+
implements the *merge by size* variant.
|
32 |
+
|
33 |
+
References
|
34 |
+
----------
|
35 |
+
.. [1] https://en.wikipedia.org/wiki/Disjoint-set_data_structure
|
36 |
+
|
37 |
+
Examples
|
38 |
+
--------
|
39 |
+
>>> from scipy.cluster.hierarchy import DisjointSet
|
40 |
+
|
41 |
+
Initialize a disjoint set:
|
42 |
+
|
43 |
+
>>> disjoint_set = DisjointSet([1, 2, 3, 'a', 'b'])
|
44 |
+
|
45 |
+
Merge some subsets:
|
46 |
+
|
47 |
+
>>> disjoint_set.merge(1, 2)
|
48 |
+
True
|
49 |
+
>>> disjoint_set.merge(3, 'a')
|
50 |
+
True
|
51 |
+
>>> disjoint_set.merge('a', 'b')
|
52 |
+
True
|
53 |
+
>>> disjoint_set.merge('b', 'b')
|
54 |
+
False
|
55 |
+
|
56 |
+
Find root elements:
|
57 |
+
|
58 |
+
>>> disjoint_set[2]
|
59 |
+
1
|
60 |
+
>>> disjoint_set['b']
|
61 |
+
3
|
62 |
+
|
63 |
+
Test connectivity:
|
64 |
+
|
65 |
+
>>> disjoint_set.connected(1, 2)
|
66 |
+
True
|
67 |
+
>>> disjoint_set.connected(1, 'b')
|
68 |
+
False
|
69 |
+
|
70 |
+
List elements in disjoint set:
|
71 |
+
|
72 |
+
>>> list(disjoint_set)
|
73 |
+
[1, 2, 3, 'a', 'b']
|
74 |
+
|
75 |
+
Get the subset containing 'a':
|
76 |
+
|
77 |
+
>>> disjoint_set.subset('a')
|
78 |
+
{'a', 3, 'b'}
|
79 |
+
|
80 |
+
Get the size of the subset containing 'a' (without actually instantiating
|
81 |
+
the subset):
|
82 |
+
|
83 |
+
>>> disjoint_set.subset_size('a')
|
84 |
+
3
|
85 |
+
|
86 |
+
Get all subsets in the disjoint set:
|
87 |
+
|
88 |
+
>>> disjoint_set.subsets()
|
89 |
+
[{1, 2}, {'a', 3, 'b'}]
|
90 |
+
"""
|
91 |
+
def __init__(self, elements=None):
|
92 |
+
self.n_subsets = 0
|
93 |
+
self._sizes = {}
|
94 |
+
self._parents = {}
|
95 |
+
# _nbrs is a circular linked list which links connected elements.
|
96 |
+
self._nbrs = {}
|
97 |
+
# _indices tracks the element insertion order in `__iter__`.
|
98 |
+
self._indices = {}
|
99 |
+
if elements is not None:
|
100 |
+
for x in elements:
|
101 |
+
self.add(x)
|
102 |
+
|
103 |
+
def __iter__(self):
|
104 |
+
"""Returns an iterator of the elements in the disjoint set.
|
105 |
+
|
106 |
+
Elements are ordered by insertion order.
|
107 |
+
"""
|
108 |
+
return iter(self._indices)
|
109 |
+
|
110 |
+
def __len__(self):
|
111 |
+
return len(self._indices)
|
112 |
+
|
113 |
+
def __contains__(self, x):
|
114 |
+
return x in self._indices
|
115 |
+
|
116 |
+
def __getitem__(self, x):
|
117 |
+
"""Find the root element of `x`.
|
118 |
+
|
119 |
+
Parameters
|
120 |
+
----------
|
121 |
+
x : hashable object
|
122 |
+
Input element.
|
123 |
+
|
124 |
+
Returns
|
125 |
+
-------
|
126 |
+
root : hashable object
|
127 |
+
Root element of `x`.
|
128 |
+
"""
|
129 |
+
if x not in self._indices:
|
130 |
+
raise KeyError(x)
|
131 |
+
|
132 |
+
# find by "path halving"
|
133 |
+
parents = self._parents
|
134 |
+
while self._indices[x] != self._indices[parents[x]]:
|
135 |
+
parents[x] = parents[parents[x]]
|
136 |
+
x = parents[x]
|
137 |
+
return x
|
138 |
+
|
139 |
+
def add(self, x):
|
140 |
+
"""Add element `x` to disjoint set
|
141 |
+
"""
|
142 |
+
if x in self._indices:
|
143 |
+
return
|
144 |
+
|
145 |
+
self._sizes[x] = 1
|
146 |
+
self._parents[x] = x
|
147 |
+
self._nbrs[x] = x
|
148 |
+
self._indices[x] = len(self._indices)
|
149 |
+
self.n_subsets += 1
|
150 |
+
|
151 |
+
def merge(self, x, y):
|
152 |
+
"""Merge the subsets of `x` and `y`.
|
153 |
+
|
154 |
+
The smaller subset (the child) is merged into the larger subset (the
|
155 |
+
parent). If the subsets are of equal size, the root element which was
|
156 |
+
first inserted into the disjoint set is selected as the parent.
|
157 |
+
|
158 |
+
Parameters
|
159 |
+
----------
|
160 |
+
x, y : hashable object
|
161 |
+
Elements to merge.
|
162 |
+
|
163 |
+
Returns
|
164 |
+
-------
|
165 |
+
merged : bool
|
166 |
+
True if `x` and `y` were in disjoint sets, False otherwise.
|
167 |
+
"""
|
168 |
+
xr = self[x]
|
169 |
+
yr = self[y]
|
170 |
+
if self._indices[xr] == self._indices[yr]:
|
171 |
+
return False
|
172 |
+
|
173 |
+
sizes = self._sizes
|
174 |
+
if (sizes[xr], self._indices[yr]) < (sizes[yr], self._indices[xr]):
|
175 |
+
xr, yr = yr, xr
|
176 |
+
self._parents[yr] = xr
|
177 |
+
self._sizes[xr] += self._sizes[yr]
|
178 |
+
self._nbrs[xr], self._nbrs[yr] = self._nbrs[yr], self._nbrs[xr]
|
179 |
+
self.n_subsets -= 1
|
180 |
+
return True
|
181 |
+
|
182 |
+
def connected(self, x, y):
|
183 |
+
"""Test whether `x` and `y` are in the same subset.
|
184 |
+
|
185 |
+
Parameters
|
186 |
+
----------
|
187 |
+
x, y : hashable object
|
188 |
+
Elements to test.
|
189 |
+
|
190 |
+
Returns
|
191 |
+
-------
|
192 |
+
result : bool
|
193 |
+
True if `x` and `y` are in the same set, False otherwise.
|
194 |
+
"""
|
195 |
+
return self._indices[self[x]] == self._indices[self[y]]
|
196 |
+
|
197 |
+
def subset(self, x):
|
198 |
+
"""Get the subset containing `x`.
|
199 |
+
|
200 |
+
Parameters
|
201 |
+
----------
|
202 |
+
x : hashable object
|
203 |
+
Input element.
|
204 |
+
|
205 |
+
Returns
|
206 |
+
-------
|
207 |
+
result : set
|
208 |
+
Subset containing `x`.
|
209 |
+
"""
|
210 |
+
if x not in self._indices:
|
211 |
+
raise KeyError(x)
|
212 |
+
|
213 |
+
result = [x]
|
214 |
+
nxt = self._nbrs[x]
|
215 |
+
while self._indices[nxt] != self._indices[x]:
|
216 |
+
result.append(nxt)
|
217 |
+
nxt = self._nbrs[nxt]
|
218 |
+
return set(result)
|
219 |
+
|
220 |
+
def subset_size(self, x):
|
221 |
+
"""Get the size of the subset containing `x`.
|
222 |
+
|
223 |
+
Note that this method is faster than ``len(self.subset(x))`` because
|
224 |
+
the size is directly read off an internal field, without the need to
|
225 |
+
instantiate the full subset.
|
226 |
+
|
227 |
+
Parameters
|
228 |
+
----------
|
229 |
+
x : hashable object
|
230 |
+
Input element.
|
231 |
+
|
232 |
+
Returns
|
233 |
+
-------
|
234 |
+
result : int
|
235 |
+
Size of the subset containing `x`.
|
236 |
+
"""
|
237 |
+
return self._sizes[self[x]]
|
238 |
+
|
239 |
+
def subsets(self):
|
240 |
+
"""Get all the subsets in the disjoint set.
|
241 |
+
|
242 |
+
Returns
|
243 |
+
-------
|
244 |
+
result : list
|
245 |
+
Subsets in the disjoint set.
|
246 |
+
"""
|
247 |
+
result = []
|
248 |
+
visited = set()
|
249 |
+
for x in self:
|
250 |
+
if x not in visited:
|
251 |
+
xset = self.subset(x)
|
252 |
+
visited.update(xset)
|
253 |
+
result.append(xset)
|
254 |
+
return result
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_docscrape.py
ADDED
@@ -0,0 +1,679 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"""Extract reference documentation from the NumPy source tree.
|
2 |
+
|
3 |
+
"""
|
4 |
+
# copied from numpydoc/docscrape.py
|
5 |
+
import inspect
|
6 |
+
import textwrap
|
7 |
+
import re
|
8 |
+
import pydoc
|
9 |
+
from warnings import warn
|
10 |
+
from collections import namedtuple
|
11 |
+
from collections.abc import Callable, Mapping
|
12 |
+
import copy
|
13 |
+
import sys
|
14 |
+
|
15 |
+
|
16 |
+
def strip_blank_lines(l):
|
17 |
+
"Remove leading and trailing blank lines from a list of lines"
|
18 |
+
while l and not l[0].strip():
|
19 |
+
del l[0]
|
20 |
+
while l and not l[-1].strip():
|
21 |
+
del l[-1]
|
22 |
+
return l
|
23 |
+
|
24 |
+
|
25 |
+
class Reader:
|
26 |
+
"""A line-based string reader.
|
27 |
+
|
28 |
+
"""
|
29 |
+
def __init__(self, data):
|
30 |
+
"""
|
31 |
+
Parameters
|
32 |
+
----------
|
33 |
+
data : str
|
34 |
+
String with lines separated by '\\n'.
|
35 |
+
|
36 |
+
"""
|
37 |
+
if isinstance(data, list):
|
38 |
+
self._str = data
|
39 |
+
else:
|
40 |
+
self._str = data.split('\n') # store string as list of lines
|
41 |
+
|
42 |
+
self.reset()
|
43 |
+
|
44 |
+
def __getitem__(self, n):
|
45 |
+
return self._str[n]
|
46 |
+
|
47 |
+
def reset(self):
|
48 |
+
self._l = 0 # current line nr
|
49 |
+
|
50 |
+
def read(self):
|
51 |
+
if not self.eof():
|
52 |
+
out = self[self._l]
|
53 |
+
self._l += 1
|
54 |
+
return out
|
55 |
+
else:
|
56 |
+
return ''
|
57 |
+
|
58 |
+
def seek_next_non_empty_line(self):
|
59 |
+
for l in self[self._l:]:
|
60 |
+
if l.strip():
|
61 |
+
break
|
62 |
+
else:
|
63 |
+
self._l += 1
|
64 |
+
|
65 |
+
def eof(self):
|
66 |
+
return self._l >= len(self._str)
|
67 |
+
|
68 |
+
def read_to_condition(self, condition_func):
|
69 |
+
start = self._l
|
70 |
+
for line in self[start:]:
|
71 |
+
if condition_func(line):
|
72 |
+
return self[start:self._l]
|
73 |
+
self._l += 1
|
74 |
+
if self.eof():
|
75 |
+
return self[start:self._l+1]
|
76 |
+
return []
|
77 |
+
|
78 |
+
def read_to_next_empty_line(self):
|
79 |
+
self.seek_next_non_empty_line()
|
80 |
+
|
81 |
+
def is_empty(line):
|
82 |
+
return not line.strip()
|
83 |
+
|
84 |
+
return self.read_to_condition(is_empty)
|
85 |
+
|
86 |
+
def read_to_next_unindented_line(self):
|
87 |
+
def is_unindented(line):
|
88 |
+
return (line.strip() and (len(line.lstrip()) == len(line)))
|
89 |
+
return self.read_to_condition(is_unindented)
|
90 |
+
|
91 |
+
def peek(self, n=0):
|
92 |
+
if self._l + n < len(self._str):
|
93 |
+
return self[self._l + n]
|
94 |
+
else:
|
95 |
+
return ''
|
96 |
+
|
97 |
+
def is_empty(self):
|
98 |
+
return not ''.join(self._str).strip()
|
99 |
+
|
100 |
+
|
101 |
+
class ParseError(Exception):
|
102 |
+
def __str__(self):
|
103 |
+
message = self.args[0]
|
104 |
+
if hasattr(self, 'docstring'):
|
105 |
+
message = f"{message} in {self.docstring!r}"
|
106 |
+
return message
|
107 |
+
|
108 |
+
|
109 |
+
Parameter = namedtuple('Parameter', ['name', 'type', 'desc'])
|
110 |
+
|
111 |
+
|
112 |
+
class NumpyDocString(Mapping):
|
113 |
+
"""Parses a numpydoc string to an abstract representation
|
114 |
+
|
115 |
+
Instances define a mapping from section title to structured data.
|
116 |
+
|
117 |
+
"""
|
118 |
+
|
119 |
+
sections = {
|
120 |
+
'Signature': '',
|
121 |
+
'Summary': [''],
|
122 |
+
'Extended Summary': [],
|
123 |
+
'Parameters': [],
|
124 |
+
'Returns': [],
|
125 |
+
'Yields': [],
|
126 |
+
'Receives': [],
|
127 |
+
'Raises': [],
|
128 |
+
'Warns': [],
|
129 |
+
'Other Parameters': [],
|
130 |
+
'Attributes': [],
|
131 |
+
'Methods': [],
|
132 |
+
'See Also': [],
|
133 |
+
'Notes': [],
|
134 |
+
'Warnings': [],
|
135 |
+
'References': '',
|
136 |
+
'Examples': '',
|
137 |
+
'index': {}
|
138 |
+
}
|
139 |
+
|
140 |
+
def __init__(self, docstring, config={}):
|
141 |
+
orig_docstring = docstring
|
142 |
+
docstring = textwrap.dedent(docstring).split('\n')
|
143 |
+
|
144 |
+
self._doc = Reader(docstring)
|
145 |
+
self._parsed_data = copy.deepcopy(self.sections)
|
146 |
+
|
147 |
+
try:
|
148 |
+
self._parse()
|
149 |
+
except ParseError as e:
|
150 |
+
e.docstring = orig_docstring
|
151 |
+
raise
|
152 |
+
|
153 |
+
def __getitem__(self, key):
|
154 |
+
return self._parsed_data[key]
|
155 |
+
|
156 |
+
def __setitem__(self, key, val):
|
157 |
+
if key not in self._parsed_data:
|
158 |
+
self._error_location("Unknown section %s" % key, error=False)
|
159 |
+
else:
|
160 |
+
self._parsed_data[key] = val
|
161 |
+
|
162 |
+
def __iter__(self):
|
163 |
+
return iter(self._parsed_data)
|
164 |
+
|
165 |
+
def __len__(self):
|
166 |
+
return len(self._parsed_data)
|
167 |
+
|
168 |
+
def _is_at_section(self):
|
169 |
+
self._doc.seek_next_non_empty_line()
|
170 |
+
|
171 |
+
if self._doc.eof():
|
172 |
+
return False
|
173 |
+
|
174 |
+
l1 = self._doc.peek().strip() # e.g. Parameters
|
175 |
+
|
176 |
+
if l1.startswith('.. index::'):
|
177 |
+
return True
|
178 |
+
|
179 |
+
l2 = self._doc.peek(1).strip() # ---------- or ==========
|
180 |
+
return l2.startswith('-'*len(l1)) or l2.startswith('='*len(l1))
|
181 |
+
|
182 |
+
def _strip(self, doc):
|
183 |
+
i = 0
|
184 |
+
j = 0
|
185 |
+
for i, line in enumerate(doc):
|
186 |
+
if line.strip():
|
187 |
+
break
|
188 |
+
|
189 |
+
for j, line in enumerate(doc[::-1]):
|
190 |
+
if line.strip():
|
191 |
+
break
|
192 |
+
|
193 |
+
return doc[i:len(doc)-j]
|
194 |
+
|
195 |
+
def _read_to_next_section(self):
|
196 |
+
section = self._doc.read_to_next_empty_line()
|
197 |
+
|
198 |
+
while not self._is_at_section() and not self._doc.eof():
|
199 |
+
if not self._doc.peek(-1).strip(): # previous line was empty
|
200 |
+
section += ['']
|
201 |
+
|
202 |
+
section += self._doc.read_to_next_empty_line()
|
203 |
+
|
204 |
+
return section
|
205 |
+
|
206 |
+
def _read_sections(self):
|
207 |
+
while not self._doc.eof():
|
208 |
+
data = self._read_to_next_section()
|
209 |
+
name = data[0].strip()
|
210 |
+
|
211 |
+
if name.startswith('..'): # index section
|
212 |
+
yield name, data[1:]
|
213 |
+
elif len(data) < 2:
|
214 |
+
yield StopIteration
|
215 |
+
else:
|
216 |
+
yield name, self._strip(data[2:])
|
217 |
+
|
218 |
+
def _parse_param_list(self, content, single_element_is_type=False):
|
219 |
+
r = Reader(content)
|
220 |
+
params = []
|
221 |
+
while not r.eof():
|
222 |
+
header = r.read().strip()
|
223 |
+
if ' : ' in header:
|
224 |
+
arg_name, arg_type = header.split(' : ')[:2]
|
225 |
+
else:
|
226 |
+
if single_element_is_type:
|
227 |
+
arg_name, arg_type = '', header
|
228 |
+
else:
|
229 |
+
arg_name, arg_type = header, ''
|
230 |
+
|
231 |
+
desc = r.read_to_next_unindented_line()
|
232 |
+
desc = dedent_lines(desc)
|
233 |
+
desc = strip_blank_lines(desc)
|
234 |
+
|
235 |
+
params.append(Parameter(arg_name, arg_type, desc))
|
236 |
+
|
237 |
+
return params
|
238 |
+
|
239 |
+
# See also supports the following formats.
|
240 |
+
#
|
241 |
+
# <FUNCNAME>
|
242 |
+
# <FUNCNAME> SPACE* COLON SPACE+ <DESC> SPACE*
|
243 |
+
# <FUNCNAME> ( COMMA SPACE+ <FUNCNAME>)+ (COMMA | PERIOD)? SPACE*
|
244 |
+
# <FUNCNAME> ( COMMA SPACE+ <FUNCNAME>)* SPACE* COLON SPACE+ <DESC> SPACE*
|
245 |
+
|
246 |
+
# <FUNCNAME> is one of
|
247 |
+
# <PLAIN_FUNCNAME>
|
248 |
+
# COLON <ROLE> COLON BACKTICK <PLAIN_FUNCNAME> BACKTICK
|
249 |
+
# where
|
250 |
+
# <PLAIN_FUNCNAME> is a legal function name, and
|
251 |
+
# <ROLE> is any nonempty sequence of word characters.
|
252 |
+
# Examples: func_f1 :meth:`func_h1` :obj:`~baz.obj_r` :class:`class_j`
|
253 |
+
# <DESC> is a string describing the function.
|
254 |
+
|
255 |
+
_role = r":(?P<role>\w+):"
|
256 |
+
_funcbacktick = r"`(?P<name>(?:~\w+\.)?[a-zA-Z0-9_\.-]+)`"
|
257 |
+
_funcplain = r"(?P<name2>[a-zA-Z0-9_\.-]+)"
|
258 |
+
_funcname = r"(" + _role + _funcbacktick + r"|" + _funcplain + r")"
|
259 |
+
_funcnamenext = _funcname.replace('role', 'rolenext')
|
260 |
+
_funcnamenext = _funcnamenext.replace('name', 'namenext')
|
261 |
+
_description = r"(?P<description>\s*:(\s+(?P<desc>\S+.*))?)?\s*$"
|
262 |
+
_func_rgx = re.compile(r"^\s*" + _funcname + r"\s*")
|
263 |
+
_line_rgx = re.compile(
|
264 |
+
r"^\s*" +
|
265 |
+
r"(?P<allfuncs>" + # group for all function names
|
266 |
+
_funcname +
|
267 |
+
r"(?P<morefuncs>([,]\s+" + _funcnamenext + r")*)" +
|
268 |
+
r")" + # end of "allfuncs"
|
269 |
+
# Some function lists have a trailing comma (or period) '\s*'
|
270 |
+
r"(?P<trailing>[,\.])?" +
|
271 |
+
_description)
|
272 |
+
|
273 |
+
# Empty <DESC> elements are replaced with '..'
|
274 |
+
empty_description = '..'
|
275 |
+
|
276 |
+
def _parse_see_also(self, content):
|
277 |
+
"""
|
278 |
+
func_name : Descriptive text
|
279 |
+
continued text
|
280 |
+
another_func_name : Descriptive text
|
281 |
+
func_name1, func_name2, :meth:`func_name`, func_name3
|
282 |
+
|
283 |
+
"""
|
284 |
+
|
285 |
+
items = []
|
286 |
+
|
287 |
+
def parse_item_name(text):
|
288 |
+
"""Match ':role:`name`' or 'name'."""
|
289 |
+
m = self._func_rgx.match(text)
|
290 |
+
if not m:
|
291 |
+
raise ParseError("%s is not a item name" % text)
|
292 |
+
role = m.group('role')
|
293 |
+
name = m.group('name') if role else m.group('name2')
|
294 |
+
return name, role, m.end()
|
295 |
+
|
296 |
+
rest = []
|
297 |
+
for line in content:
|
298 |
+
if not line.strip():
|
299 |
+
continue
|
300 |
+
|
301 |
+
line_match = self._line_rgx.match(line)
|
302 |
+
description = None
|
303 |
+
if line_match:
|
304 |
+
description = line_match.group('desc')
|
305 |
+
if line_match.group('trailing') and description:
|
306 |
+
self._error_location(
|
307 |
+
'Unexpected comma or period after function list at '
|
308 |
+
'index %d of line "%s"' % (line_match.end('trailing'),
|
309 |
+
line),
|
310 |
+
error=False)
|
311 |
+
if not description and line.startswith(' '):
|
312 |
+
rest.append(line.strip())
|
313 |
+
elif line_match:
|
314 |
+
funcs = []
|
315 |
+
text = line_match.group('allfuncs')
|
316 |
+
while True:
|
317 |
+
if not text.strip():
|
318 |
+
break
|
319 |
+
name, role, match_end = parse_item_name(text)
|
320 |
+
funcs.append((name, role))
|
321 |
+
text = text[match_end:].strip()
|
322 |
+
if text and text[0] == ',':
|
323 |
+
text = text[1:].strip()
|
324 |
+
rest = list(filter(None, [description]))
|
325 |
+
items.append((funcs, rest))
|
326 |
+
else:
|
327 |
+
raise ParseError("%s is not a item name" % line)
|
328 |
+
return items
|
329 |
+
|
330 |
+
def _parse_index(self, section, content):
|
331 |
+
"""
|
332 |
+
.. index:: default
|
333 |
+
:refguide: something, else, and more
|
334 |
+
|
335 |
+
"""
|
336 |
+
def strip_each_in(lst):
|
337 |
+
return [s.strip() for s in lst]
|
338 |
+
|
339 |
+
out = {}
|
340 |
+
section = section.split('::')
|
341 |
+
if len(section) > 1:
|
342 |
+
out['default'] = strip_each_in(section[1].split(','))[0]
|
343 |
+
for line in content:
|
344 |
+
line = line.split(':')
|
345 |
+
if len(line) > 2:
|
346 |
+
out[line[1]] = strip_each_in(line[2].split(','))
|
347 |
+
return out
|
348 |
+
|
349 |
+
def _parse_summary(self):
|
350 |
+
"""Grab signature (if given) and summary"""
|
351 |
+
if self._is_at_section():
|
352 |
+
return
|
353 |
+
|
354 |
+
# If several signatures present, take the last one
|
355 |
+
while True:
|
356 |
+
summary = self._doc.read_to_next_empty_line()
|
357 |
+
summary_str = " ".join([s.strip() for s in summary]).strip()
|
358 |
+
compiled = re.compile(r'^([\w., ]+=)?\s*[\w\.]+\(.*\)$')
|
359 |
+
if compiled.match(summary_str):
|
360 |
+
self['Signature'] = summary_str
|
361 |
+
if not self._is_at_section():
|
362 |
+
continue
|
363 |
+
break
|
364 |
+
|
365 |
+
if summary is not None:
|
366 |
+
self['Summary'] = summary
|
367 |
+
|
368 |
+
if not self._is_at_section():
|
369 |
+
self['Extended Summary'] = self._read_to_next_section()
|
370 |
+
|
371 |
+
def _parse(self):
|
372 |
+
self._doc.reset()
|
373 |
+
self._parse_summary()
|
374 |
+
|
375 |
+
sections = list(self._read_sections())
|
376 |
+
section_names = {section for section, content in sections}
|
377 |
+
|
378 |
+
has_returns = 'Returns' in section_names
|
379 |
+
has_yields = 'Yields' in section_names
|
380 |
+
# We could do more tests, but we are not. Arbitrarily.
|
381 |
+
if has_returns and has_yields:
|
382 |
+
msg = 'Docstring contains both a Returns and Yields section.'
|
383 |
+
raise ValueError(msg)
|
384 |
+
if not has_yields and 'Receives' in section_names:
|
385 |
+
msg = 'Docstring contains a Receives section but not Yields.'
|
386 |
+
raise ValueError(msg)
|
387 |
+
|
388 |
+
for (section, content) in sections:
|
389 |
+
if not section.startswith('..'):
|
390 |
+
section = (s.capitalize() for s in section.split(' '))
|
391 |
+
section = ' '.join(section)
|
392 |
+
if self.get(section):
|
393 |
+
self._error_location("The section %s appears twice"
|
394 |
+
% section)
|
395 |
+
|
396 |
+
if section in ('Parameters', 'Other Parameters', 'Attributes',
|
397 |
+
'Methods'):
|
398 |
+
self[section] = self._parse_param_list(content)
|
399 |
+
elif section in ('Returns', 'Yields', 'Raises', 'Warns',
|
400 |
+
'Receives'):
|
401 |
+
self[section] = self._parse_param_list(
|
402 |
+
content, single_element_is_type=True)
|
403 |
+
elif section.startswith('.. index::'):
|
404 |
+
self['index'] = self._parse_index(section, content)
|
405 |
+
elif section == 'See Also':
|
406 |
+
self['See Also'] = self._parse_see_also(content)
|
407 |
+
else:
|
408 |
+
self[section] = content
|
409 |
+
|
410 |
+
def _error_location(self, msg, error=True):
|
411 |
+
if hasattr(self, '_obj'):
|
412 |
+
# we know where the docs came from:
|
413 |
+
try:
|
414 |
+
filename = inspect.getsourcefile(self._obj)
|
415 |
+
except TypeError:
|
416 |
+
filename = None
|
417 |
+
msg = msg + (f" in the docstring of {self._obj} in {filename}.")
|
418 |
+
if error:
|
419 |
+
raise ValueError(msg)
|
420 |
+
else:
|
421 |
+
warn(msg, stacklevel=3)
|
422 |
+
|
423 |
+
# string conversion routines
|
424 |
+
|
425 |
+
def _str_header(self, name, symbol='-'):
|
426 |
+
return [name, len(name)*symbol]
|
427 |
+
|
428 |
+
def _str_indent(self, doc, indent=4):
|
429 |
+
out = []
|
430 |
+
for line in doc:
|
431 |
+
out += [' '*indent + line]
|
432 |
+
return out
|
433 |
+
|
434 |
+
def _str_signature(self):
|
435 |
+
if self['Signature']:
|
436 |
+
return [self['Signature'].replace('*', r'\*')] + ['']
|
437 |
+
else:
|
438 |
+
return ['']
|
439 |
+
|
440 |
+
def _str_summary(self):
|
441 |
+
if self['Summary']:
|
442 |
+
return self['Summary'] + ['']
|
443 |
+
else:
|
444 |
+
return []
|
445 |
+
|
446 |
+
def _str_extended_summary(self):
|
447 |
+
if self['Extended Summary']:
|
448 |
+
return self['Extended Summary'] + ['']
|
449 |
+
else:
|
450 |
+
return []
|
451 |
+
|
452 |
+
def _str_param_list(self, name):
|
453 |
+
out = []
|
454 |
+
if self[name]:
|
455 |
+
out += self._str_header(name)
|
456 |
+
for param in self[name]:
|
457 |
+
parts = []
|
458 |
+
if param.name:
|
459 |
+
parts.append(param.name)
|
460 |
+
if param.type:
|
461 |
+
parts.append(param.type)
|
462 |
+
out += [' : '.join(parts)]
|
463 |
+
if param.desc and ''.join(param.desc).strip():
|
464 |
+
out += self._str_indent(param.desc)
|
465 |
+
out += ['']
|
466 |
+
return out
|
467 |
+
|
468 |
+
def _str_section(self, name):
|
469 |
+
out = []
|
470 |
+
if self[name]:
|
471 |
+
out += self._str_header(name)
|
472 |
+
out += self[name]
|
473 |
+
out += ['']
|
474 |
+
return out
|
475 |
+
|
476 |
+
def _str_see_also(self, func_role):
|
477 |
+
if not self['See Also']:
|
478 |
+
return []
|
479 |
+
out = []
|
480 |
+
out += self._str_header("See Also")
|
481 |
+
out += ['']
|
482 |
+
last_had_desc = True
|
483 |
+
for funcs, desc in self['See Also']:
|
484 |
+
assert isinstance(funcs, list)
|
485 |
+
links = []
|
486 |
+
for func, role in funcs:
|
487 |
+
if role:
|
488 |
+
link = f':{role}:`{func}`'
|
489 |
+
elif func_role:
|
490 |
+
link = f':{func_role}:`{func}`'
|
491 |
+
else:
|
492 |
+
link = "`%s`_" % func
|
493 |
+
links.append(link)
|
494 |
+
link = ', '.join(links)
|
495 |
+
out += [link]
|
496 |
+
if desc:
|
497 |
+
out += self._str_indent([' '.join(desc)])
|
498 |
+
last_had_desc = True
|
499 |
+
else:
|
500 |
+
last_had_desc = False
|
501 |
+
out += self._str_indent([self.empty_description])
|
502 |
+
|
503 |
+
if last_had_desc:
|
504 |
+
out += ['']
|
505 |
+
out += ['']
|
506 |
+
return out
|
507 |
+
|
508 |
+
def _str_index(self):
|
509 |
+
idx = self['index']
|
510 |
+
out = []
|
511 |
+
output_index = False
|
512 |
+
default_index = idx.get('default', '')
|
513 |
+
if default_index:
|
514 |
+
output_index = True
|
515 |
+
out += ['.. index:: %s' % default_index]
|
516 |
+
for section, references in idx.items():
|
517 |
+
if section == 'default':
|
518 |
+
continue
|
519 |
+
output_index = True
|
520 |
+
out += [' :{}: {}'.format(section, ', '.join(references))]
|
521 |
+
if output_index:
|
522 |
+
return out
|
523 |
+
else:
|
524 |
+
return ''
|
525 |
+
|
526 |
+
def __str__(self, func_role=''):
|
527 |
+
out = []
|
528 |
+
out += self._str_signature()
|
529 |
+
out += self._str_summary()
|
530 |
+
out += self._str_extended_summary()
|
531 |
+
for param_list in ('Parameters', 'Returns', 'Yields', 'Receives',
|
532 |
+
'Other Parameters', 'Raises', 'Warns'):
|
533 |
+
out += self._str_param_list(param_list)
|
534 |
+
out += self._str_section('Warnings')
|
535 |
+
out += self._str_see_also(func_role)
|
536 |
+
for s in ('Notes', 'References', 'Examples'):
|
537 |
+
out += self._str_section(s)
|
538 |
+
for param_list in ('Attributes', 'Methods'):
|
539 |
+
out += self._str_param_list(param_list)
|
540 |
+
out += self._str_index()
|
541 |
+
return '\n'.join(out)
|
542 |
+
|
543 |
+
|
544 |
+
def indent(str, indent=4):
|
545 |
+
indent_str = ' '*indent
|
546 |
+
if str is None:
|
547 |
+
return indent_str
|
548 |
+
lines = str.split('\n')
|
549 |
+
return '\n'.join(indent_str + l for l in lines)
|
550 |
+
|
551 |
+
|
552 |
+
def dedent_lines(lines):
|
553 |
+
"""Deindent a list of lines maximally"""
|
554 |
+
return textwrap.dedent("\n".join(lines)).split("\n")
|
555 |
+
|
556 |
+
|
557 |
+
def header(text, style='-'):
|
558 |
+
return text + '\n' + style*len(text) + '\n'
|
559 |
+
|
560 |
+
|
561 |
+
class FunctionDoc(NumpyDocString):
|
562 |
+
def __init__(self, func, role='func', doc=None, config={}):
|
563 |
+
self._f = func
|
564 |
+
self._role = role # e.g. "func" or "meth"
|
565 |
+
|
566 |
+
if doc is None:
|
567 |
+
if func is None:
|
568 |
+
raise ValueError("No function or docstring given")
|
569 |
+
doc = inspect.getdoc(func) or ''
|
570 |
+
NumpyDocString.__init__(self, doc, config)
|
571 |
+
|
572 |
+
def get_func(self):
|
573 |
+
func_name = getattr(self._f, '__name__', self.__class__.__name__)
|
574 |
+
if inspect.isclass(self._f):
|
575 |
+
func = getattr(self._f, '__call__', self._f.__init__)
|
576 |
+
else:
|
577 |
+
func = self._f
|
578 |
+
return func, func_name
|
579 |
+
|
580 |
+
def __str__(self):
|
581 |
+
out = ''
|
582 |
+
|
583 |
+
func, func_name = self.get_func()
|
584 |
+
|
585 |
+
roles = {'func': 'function',
|
586 |
+
'meth': 'method'}
|
587 |
+
|
588 |
+
if self._role:
|
589 |
+
if self._role not in roles:
|
590 |
+
print("Warning: invalid role %s" % self._role)
|
591 |
+
out += '.. {}:: {}\n \n\n'.format(roles.get(self._role, ''),
|
592 |
+
func_name)
|
593 |
+
|
594 |
+
out += super().__str__(func_role=self._role)
|
595 |
+
return out
|
596 |
+
|
597 |
+
|
598 |
+
class ClassDoc(NumpyDocString):
|
599 |
+
|
600 |
+
extra_public_methods = ['__call__']
|
601 |
+
|
602 |
+
def __init__(self, cls, doc=None, modulename='', func_doc=FunctionDoc,
|
603 |
+
config={}):
|
604 |
+
if not inspect.isclass(cls) and cls is not None:
|
605 |
+
raise ValueError("Expected a class or None, but got %r" % cls)
|
606 |
+
self._cls = cls
|
607 |
+
|
608 |
+
if 'sphinx' in sys.modules:
|
609 |
+
from sphinx.ext.autodoc import ALL
|
610 |
+
else:
|
611 |
+
ALL = object()
|
612 |
+
|
613 |
+
self.show_inherited_members = config.get(
|
614 |
+
'show_inherited_class_members', True)
|
615 |
+
|
616 |
+
if modulename and not modulename.endswith('.'):
|
617 |
+
modulename += '.'
|
618 |
+
self._mod = modulename
|
619 |
+
|
620 |
+
if doc is None:
|
621 |
+
if cls is None:
|
622 |
+
raise ValueError("No class or documentation string given")
|
623 |
+
doc = pydoc.getdoc(cls)
|
624 |
+
|
625 |
+
NumpyDocString.__init__(self, doc)
|
626 |
+
|
627 |
+
_members = config.get('members', [])
|
628 |
+
if _members is ALL:
|
629 |
+
_members = None
|
630 |
+
_exclude = config.get('exclude-members', [])
|
631 |
+
|
632 |
+
if config.get('show_class_members', True) and _exclude is not ALL:
|
633 |
+
def splitlines_x(s):
|
634 |
+
if not s:
|
635 |
+
return []
|
636 |
+
else:
|
637 |
+
return s.splitlines()
|
638 |
+
for field, items in [('Methods', self.methods),
|
639 |
+
('Attributes', self.properties)]:
|
640 |
+
if not self[field]:
|
641 |
+
doc_list = []
|
642 |
+
for name in sorted(items):
|
643 |
+
if (name in _exclude or
|
644 |
+
(_members and name not in _members)):
|
645 |
+
continue
|
646 |
+
try:
|
647 |
+
doc_item = pydoc.getdoc(getattr(self._cls, name))
|
648 |
+
doc_list.append(
|
649 |
+
Parameter(name, '', splitlines_x(doc_item)))
|
650 |
+
except AttributeError:
|
651 |
+
pass # method doesn't exist
|
652 |
+
self[field] = doc_list
|
653 |
+
|
654 |
+
@property
|
655 |
+
def methods(self):
|
656 |
+
if self._cls is None:
|
657 |
+
return []
|
658 |
+
return [name for name, func in inspect.getmembers(self._cls)
|
659 |
+
if ((not name.startswith('_')
|
660 |
+
or name in self.extra_public_methods)
|
661 |
+
and isinstance(func, Callable)
|
662 |
+
and self._is_show_member(name))]
|
663 |
+
|
664 |
+
@property
|
665 |
+
def properties(self):
|
666 |
+
if self._cls is None:
|
667 |
+
return []
|
668 |
+
return [name for name, func in inspect.getmembers(self._cls)
|
669 |
+
if (not name.startswith('_') and
|
670 |
+
(func is None or isinstance(func, property) or
|
671 |
+
inspect.isdatadescriptor(func))
|
672 |
+
and self._is_show_member(name))]
|
673 |
+
|
674 |
+
def _is_show_member(self, name):
|
675 |
+
if self.show_inherited_members:
|
676 |
+
return True # show all class members
|
677 |
+
if name not in self._cls.__dict__:
|
678 |
+
return False # class member is inherited, we do not show it
|
679 |
+
return True
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_elementwise_iterative_method.py
ADDED
@@ -0,0 +1,348 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
# `_elementwise_iterative_method.py` includes tools for writing functions that
|
2 |
+
# - are vectorized to work elementwise on arrays,
|
3 |
+
# - implement non-trivial, iterative algorithms with a callback interface, and
|
4 |
+
# - return rich objects with iteration count, termination status, etc.
|
5 |
+
#
|
6 |
+
# Examples include:
|
7 |
+
# `scipy.optimize._chandrupatla._chandrupatla for scalar rootfinding,
|
8 |
+
# `scipy.optimize._chandrupatla._chandrupatla_minimize for scalar minimization,
|
9 |
+
# `scipy.optimize._differentiate._differentiate for numerical differentiation,
|
10 |
+
# `scipy.optimize._bracket._bracket_root for finding rootfinding brackets,
|
11 |
+
# `scipy.optimize._bracket._bracket_minimize for finding minimization brackets,
|
12 |
+
# `scipy.integrate._tanhsinh._tanhsinh` for numerical quadrature.
|
13 |
+
|
14 |
+
import math
|
15 |
+
import numpy as np
|
16 |
+
from ._util import _RichResult, _call_callback_maybe_halt
|
17 |
+
from ._array_api import array_namespace, size as xp_size
|
18 |
+
|
19 |
+
_ESIGNERR = -1
|
20 |
+
_ECONVERR = -2
|
21 |
+
_EVALUEERR = -3
|
22 |
+
_ECALLBACK = -4
|
23 |
+
_EINPUTERR = -5
|
24 |
+
_ECONVERGED = 0
|
25 |
+
_EINPROGRESS = 1
|
26 |
+
|
27 |
+
def _initialize(func, xs, args, complex_ok=False, preserve_shape=None):
|
28 |
+
"""Initialize abscissa, function, and args arrays for elementwise function
|
29 |
+
|
30 |
+
Parameters
|
31 |
+
----------
|
32 |
+
func : callable
|
33 |
+
An elementwise function with signature
|
34 |
+
|
35 |
+
func(x: ndarray, *args) -> ndarray
|
36 |
+
|
37 |
+
where each element of ``x`` is a finite real and ``args`` is a tuple,
|
38 |
+
which may contain an arbitrary number of arrays that are broadcastable
|
39 |
+
with ``x``.
|
40 |
+
xs : tuple of arrays
|
41 |
+
Finite real abscissa arrays. Must be broadcastable.
|
42 |
+
args : tuple, optional
|
43 |
+
Additional positional arguments to be passed to `func`.
|
44 |
+
preserve_shape : bool, default:False
|
45 |
+
When ``preserve_shape=False`` (default), `func` may be passed
|
46 |
+
arguments of any shape; `_scalar_optimization_loop` is permitted
|
47 |
+
to reshape and compress arguments at will. When
|
48 |
+
``preserve_shape=False``, arguments passed to `func` must have shape
|
49 |
+
`shape` or ``shape + (n,)``, where ``n`` is any integer.
|
50 |
+
|
51 |
+
Returns
|
52 |
+
-------
|
53 |
+
xs, fs, args : tuple of arrays
|
54 |
+
Broadcasted, writeable, 1D abscissa and function value arrays (or
|
55 |
+
NumPy floats, if appropriate). The dtypes of the `xs` and `fs` are
|
56 |
+
`xfat`; the dtype of the `args` are unchanged.
|
57 |
+
shape : tuple of ints
|
58 |
+
Original shape of broadcasted arrays.
|
59 |
+
xfat : NumPy dtype
|
60 |
+
Result dtype of abscissae, function values, and args determined using
|
61 |
+
`np.result_type`, except integer types are promoted to `np.float64`.
|
62 |
+
|
63 |
+
Raises
|
64 |
+
------
|
65 |
+
ValueError
|
66 |
+
If the result dtype is not that of a real scalar
|
67 |
+
|
68 |
+
Notes
|
69 |
+
-----
|
70 |
+
Useful for initializing the input of SciPy functions that accept
|
71 |
+
an elementwise callable, abscissae, and arguments; e.g.
|
72 |
+
`scipy.optimize._chandrupatla`.
|
73 |
+
"""
|
74 |
+
nx = len(xs)
|
75 |
+
xp = array_namespace(*xs)
|
76 |
+
|
77 |
+
# Try to preserve `dtype`, but we need to ensure that the arguments are at
|
78 |
+
# least floats before passing them into the function; integers can overflow
|
79 |
+
# and cause failure.
|
80 |
+
# There might be benefit to combining the `xs` into a single array and
|
81 |
+
# calling `func` once on the combined array. For now, keep them separate.
|
82 |
+
xas = xp.broadcast_arrays(*xs, *args) # broadcast and rename
|
83 |
+
xat = xp.result_type(*[xa.dtype for xa in xas])
|
84 |
+
xat = xp.asarray(1.).dtype if xp.isdtype(xat, "integral") else xat
|
85 |
+
xs, args = xas[:nx], xas[nx:]
|
86 |
+
xs = [xp.asarray(x, dtype=xat) for x in xs] # use copy=False when implemented
|
87 |
+
fs = [xp.asarray(func(x, *args)) for x in xs]
|
88 |
+
shape = xs[0].shape
|
89 |
+
fshape = fs[0].shape
|
90 |
+
|
91 |
+
if preserve_shape:
|
92 |
+
# bind original shape/func now to avoid late-binding gotcha
|
93 |
+
def func(x, *args, shape=shape, func=func, **kwargs):
|
94 |
+
i = (0,)*(len(fshape) - len(shape))
|
95 |
+
return func(x[i], *args, **kwargs)
|
96 |
+
shape = np.broadcast_shapes(fshape, shape) # just shapes; use of NumPy OK
|
97 |
+
xs = [xp.broadcast_to(x, shape) for x in xs]
|
98 |
+
args = [xp.broadcast_to(arg, shape) for arg in args]
|
99 |
+
|
100 |
+
message = ("The shape of the array returned by `func` must be the same as "
|
101 |
+
"the broadcasted shape of `x` and all other `args`.")
|
102 |
+
if preserve_shape is not None: # only in tanhsinh for now
|
103 |
+
message = f"When `preserve_shape=False`, {message.lower()}"
|
104 |
+
shapes_equal = [f.shape == shape for f in fs]
|
105 |
+
if not all(shapes_equal): # use Python all to reduce overhead
|
106 |
+
raise ValueError(message)
|
107 |
+
|
108 |
+
# These algorithms tend to mix the dtypes of the abscissae and function
|
109 |
+
# values, so figure out what the result will be and convert them all to
|
110 |
+
# that type from the outset.
|
111 |
+
xfat = xp.result_type(*([f.dtype for f in fs] + [xat]))
|
112 |
+
if not complex_ok and not xp.isdtype(xfat, "real floating"):
|
113 |
+
raise ValueError("Abscissae and function output must be real numbers.")
|
114 |
+
xs = [xp.asarray(x, dtype=xfat, copy=True) for x in xs]
|
115 |
+
fs = [xp.asarray(f, dtype=xfat, copy=True) for f in fs]
|
116 |
+
|
117 |
+
# To ensure that we can do indexing, we'll work with at least 1d arrays,
|
118 |
+
# but remember the appropriate shape of the output.
|
119 |
+
xs = [xp.reshape(x, (-1,)) for x in xs]
|
120 |
+
fs = [xp.reshape(f, (-1,)) for f in fs]
|
121 |
+
args = [xp.reshape(xp.asarray(arg, copy=True), (-1,)) for arg in args]
|
122 |
+
return func, xs, fs, args, shape, xfat, xp
|
123 |
+
|
124 |
+
|
125 |
+
def _loop(work, callback, shape, maxiter, func, args, dtype, pre_func_eval,
|
126 |
+
post_func_eval, check_termination, post_termination_check,
|
127 |
+
customize_result, res_work_pairs, xp, preserve_shape=False):
|
128 |
+
"""Main loop of a vectorized scalar optimization algorithm
|
129 |
+
|
130 |
+
Parameters
|
131 |
+
----------
|
132 |
+
work : _RichResult
|
133 |
+
All variables that need to be retained between iterations. Must
|
134 |
+
contain attributes `nit`, `nfev`, and `success`
|
135 |
+
callback : callable
|
136 |
+
User-specified callback function
|
137 |
+
shape : tuple of ints
|
138 |
+
The shape of all output arrays
|
139 |
+
maxiter :
|
140 |
+
Maximum number of iterations of the algorithm
|
141 |
+
func : callable
|
142 |
+
The user-specified callable that is being optimized or solved
|
143 |
+
args : tuple
|
144 |
+
Additional positional arguments to be passed to `func`.
|
145 |
+
dtype : NumPy dtype
|
146 |
+
The common dtype of all abscissae and function values
|
147 |
+
pre_func_eval : callable
|
148 |
+
A function that accepts `work` and returns `x`, the active elements
|
149 |
+
of `x` at which `func` will be evaluated. May modify attributes
|
150 |
+
of `work` with any algorithmic steps that need to happen
|
151 |
+
at the beginning of an iteration, before `func` is evaluated,
|
152 |
+
post_func_eval : callable
|
153 |
+
A function that accepts `x`, `func(x)`, and `work`. May modify
|
154 |
+
attributes of `work` with any algorithmic steps that need to happen
|
155 |
+
in the middle of an iteration, after `func` is evaluated but before
|
156 |
+
the termination check.
|
157 |
+
check_termination : callable
|
158 |
+
A function that accepts `work` and returns `stop`, a boolean array
|
159 |
+
indicating which of the active elements have met a termination
|
160 |
+
condition.
|
161 |
+
post_termination_check : callable
|
162 |
+
A function that accepts `work`. May modify `work` with any algorithmic
|
163 |
+
steps that need to happen after the termination check and before the
|
164 |
+
end of the iteration.
|
165 |
+
customize_result : callable
|
166 |
+
A function that accepts `res` and `shape` and returns `shape`. May
|
167 |
+
modify `res` (in-place) according to preferences (e.g. rearrange
|
168 |
+
elements between attributes) and modify `shape` if needed.
|
169 |
+
res_work_pairs : list of (str, str)
|
170 |
+
Identifies correspondence between attributes of `res` and attributes
|
171 |
+
of `work`; i.e., attributes of active elements of `work` will be
|
172 |
+
copied to the appropriate indices of `res` when appropriate. The order
|
173 |
+
determines the order in which _RichResult attributes will be
|
174 |
+
pretty-printed.
|
175 |
+
|
176 |
+
Returns
|
177 |
+
-------
|
178 |
+
res : _RichResult
|
179 |
+
The final result object
|
180 |
+
|
181 |
+
Notes
|
182 |
+
-----
|
183 |
+
Besides providing structure, this framework provides several important
|
184 |
+
services for a vectorized optimization algorithm.
|
185 |
+
|
186 |
+
- It handles common tasks involving iteration count, function evaluation
|
187 |
+
count, a user-specified callback, and associated termination conditions.
|
188 |
+
- It compresses the attributes of `work` to eliminate unnecessary
|
189 |
+
computation on elements that have already converged.
|
190 |
+
|
191 |
+
"""
|
192 |
+
if xp is None:
|
193 |
+
raise NotImplementedError("Must provide xp.")
|
194 |
+
|
195 |
+
cb_terminate = False
|
196 |
+
|
197 |
+
# Initialize the result object and active element index array
|
198 |
+
n_elements = math.prod(shape)
|
199 |
+
active = xp.arange(n_elements) # in-progress element indices
|
200 |
+
res_dict = {i: xp.zeros(n_elements, dtype=dtype) for i, j in res_work_pairs}
|
201 |
+
res_dict['success'] = xp.zeros(n_elements, dtype=xp.bool)
|
202 |
+
res_dict['status'] = xp.full(n_elements, _EINPROGRESS, dtype=xp.int32)
|
203 |
+
res_dict['nit'] = xp.zeros(n_elements, dtype=xp.int32)
|
204 |
+
res_dict['nfev'] = xp.zeros(n_elements, dtype=xp.int32)
|
205 |
+
res = _RichResult(res_dict)
|
206 |
+
work.args = args
|
207 |
+
|
208 |
+
active = _check_termination(work, res, res_work_pairs, active,
|
209 |
+
check_termination, preserve_shape, xp)
|
210 |
+
|
211 |
+
if callback is not None:
|
212 |
+
temp = _prepare_result(work, res, res_work_pairs, active, shape,
|
213 |
+
customize_result, preserve_shape, xp)
|
214 |
+
if _call_callback_maybe_halt(callback, temp):
|
215 |
+
cb_terminate = True
|
216 |
+
|
217 |
+
while work.nit < maxiter and xp_size(active) and not cb_terminate and n_elements:
|
218 |
+
x = pre_func_eval(work)
|
219 |
+
|
220 |
+
if work.args and work.args[0].ndim != x.ndim:
|
221 |
+
# `x` always starts as 1D. If the SciPy function that uses
|
222 |
+
# _loop added dimensions to `x`, we need to
|
223 |
+
# add them to the elements of `args`.
|
224 |
+
args = []
|
225 |
+
for arg in work.args:
|
226 |
+
n_new_dims = x.ndim - arg.ndim
|
227 |
+
new_shape = arg.shape + (1,)*n_new_dims
|
228 |
+
args.append(xp.reshape(arg, new_shape))
|
229 |
+
work.args = args
|
230 |
+
|
231 |
+
x_shape = x.shape
|
232 |
+
if preserve_shape:
|
233 |
+
x = xp.reshape(x, (shape + (-1,)))
|
234 |
+
f = func(x, *work.args)
|
235 |
+
f = xp.asarray(f, dtype=dtype)
|
236 |
+
if preserve_shape:
|
237 |
+
x = xp.reshape(x, x_shape)
|
238 |
+
f = xp.reshape(f, x_shape)
|
239 |
+
work.nfev += 1 if x.ndim == 1 else x.shape[-1]
|
240 |
+
|
241 |
+
post_func_eval(x, f, work)
|
242 |
+
|
243 |
+
work.nit += 1
|
244 |
+
active = _check_termination(work, res, res_work_pairs, active,
|
245 |
+
check_termination, preserve_shape, xp)
|
246 |
+
|
247 |
+
if callback is not None:
|
248 |
+
temp = _prepare_result(work, res, res_work_pairs, active, shape,
|
249 |
+
customize_result, preserve_shape, xp)
|
250 |
+
if _call_callback_maybe_halt(callback, temp):
|
251 |
+
cb_terminate = True
|
252 |
+
break
|
253 |
+
if xp_size(active) == 0:
|
254 |
+
break
|
255 |
+
|
256 |
+
post_termination_check(work)
|
257 |
+
|
258 |
+
work.status[:] = _ECALLBACK if cb_terminate else _ECONVERR
|
259 |
+
return _prepare_result(work, res, res_work_pairs, active, shape,
|
260 |
+
customize_result, preserve_shape, xp)
|
261 |
+
|
262 |
+
|
263 |
+
def _check_termination(work, res, res_work_pairs, active, check_termination,
|
264 |
+
preserve_shape, xp):
|
265 |
+
# Checks termination conditions, updates elements of `res` with
|
266 |
+
# corresponding elements of `work`, and compresses `work`.
|
267 |
+
|
268 |
+
stop = check_termination(work)
|
269 |
+
|
270 |
+
if xp.any(stop):
|
271 |
+
# update the active elements of the result object with the active
|
272 |
+
# elements for which a termination condition has been met
|
273 |
+
_update_active(work, res, res_work_pairs, active, stop, preserve_shape, xp)
|
274 |
+
|
275 |
+
if preserve_shape:
|
276 |
+
stop = stop[active]
|
277 |
+
|
278 |
+
proceed = ~stop
|
279 |
+
active = active[proceed]
|
280 |
+
|
281 |
+
if not preserve_shape:
|
282 |
+
# compress the arrays to avoid unnecessary computation
|
283 |
+
for key, val in work.items():
|
284 |
+
# Need to find a better way than these try/excepts
|
285 |
+
# Somehow need to keep compressible numerical args separate
|
286 |
+
if key == 'args':
|
287 |
+
continue
|
288 |
+
try:
|
289 |
+
work[key] = val[proceed]
|
290 |
+
except (IndexError, TypeError, KeyError): # not a compressible array
|
291 |
+
work[key] = val
|
292 |
+
work.args = [arg[proceed] for arg in work.args]
|
293 |
+
|
294 |
+
return active
|
295 |
+
|
296 |
+
|
297 |
+
def _update_active(work, res, res_work_pairs, active, mask, preserve_shape, xp):
|
298 |
+
# Update `active` indices of the arrays in result object `res` with the
|
299 |
+
# contents of the scalars and arrays in `update_dict`. When provided,
|
300 |
+
# `mask` is a boolean array applied both to the arrays in `update_dict`
|
301 |
+
# that are to be used and to the arrays in `res` that are to be updated.
|
302 |
+
update_dict = {key1: work[key2] for key1, key2 in res_work_pairs}
|
303 |
+
update_dict['success'] = work.status == 0
|
304 |
+
|
305 |
+
if mask is not None:
|
306 |
+
if preserve_shape:
|
307 |
+
active_mask = xp.zeros_like(mask)
|
308 |
+
active_mask[active] = 1
|
309 |
+
active_mask = active_mask & mask
|
310 |
+
for key, val in update_dict.items():
|
311 |
+
try:
|
312 |
+
res[key][active_mask] = val[active_mask]
|
313 |
+
except (IndexError, TypeError, KeyError):
|
314 |
+
res[key][active_mask] = val
|
315 |
+
else:
|
316 |
+
active_mask = active[mask]
|
317 |
+
for key, val in update_dict.items():
|
318 |
+
try:
|
319 |
+
res[key][active_mask] = val[mask]
|
320 |
+
except (IndexError, TypeError, KeyError):
|
321 |
+
res[key][active_mask] = val
|
322 |
+
else:
|
323 |
+
for key, val in update_dict.items():
|
324 |
+
if preserve_shape:
|
325 |
+
try:
|
326 |
+
val = val[active]
|
327 |
+
except (IndexError, TypeError, KeyError):
|
328 |
+
pass
|
329 |
+
res[key][active] = val
|
330 |
+
|
331 |
+
|
332 |
+
def _prepare_result(work, res, res_work_pairs, active, shape, customize_result,
|
333 |
+
preserve_shape, xp):
|
334 |
+
# Prepare the result object `res` by creating a copy, copying the latest
|
335 |
+
# data from work, running the provided result customization function,
|
336 |
+
# and reshaping the data to the original shapes.
|
337 |
+
res = res.copy()
|
338 |
+
_update_active(work, res, res_work_pairs, active, None, preserve_shape, xp)
|
339 |
+
|
340 |
+
shape = customize_result(res, shape)
|
341 |
+
|
342 |
+
for key, val in res.items():
|
343 |
+
# this looks like it won't work for xp != np if val is not numeric
|
344 |
+
temp = xp.reshape(val, shape)
|
345 |
+
res[key] = temp[()] if temp.ndim == 0 else temp
|
346 |
+
|
347 |
+
res['_order_keys'] = ['success'] + [i for i, j in res_work_pairs]
|
348 |
+
return _RichResult(**res)
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_finite_differences.py
ADDED
@@ -0,0 +1,145 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
from numpy import arange, newaxis, hstack, prod, array
|
2 |
+
|
3 |
+
|
4 |
+
def _central_diff_weights(Np, ndiv=1):
|
5 |
+
"""
|
6 |
+
Return weights for an Np-point central derivative.
|
7 |
+
|
8 |
+
Assumes equally-spaced function points.
|
9 |
+
|
10 |
+
If weights are in the vector w, then
|
11 |
+
derivative is w[0] * f(x-ho*dx) + ... + w[-1] * f(x+h0*dx)
|
12 |
+
|
13 |
+
Parameters
|
14 |
+
----------
|
15 |
+
Np : int
|
16 |
+
Number of points for the central derivative.
|
17 |
+
ndiv : int, optional
|
18 |
+
Number of divisions. Default is 1.
|
19 |
+
|
20 |
+
Returns
|
21 |
+
-------
|
22 |
+
w : ndarray
|
23 |
+
Weights for an Np-point central derivative. Its size is `Np`.
|
24 |
+
|
25 |
+
Notes
|
26 |
+
-----
|
27 |
+
Can be inaccurate for a large number of points.
|
28 |
+
|
29 |
+
Examples
|
30 |
+
--------
|
31 |
+
We can calculate a derivative value of a function.
|
32 |
+
|
33 |
+
>>> def f(x):
|
34 |
+
... return 2 * x**2 + 3
|
35 |
+
>>> x = 3.0 # derivative point
|
36 |
+
>>> h = 0.1 # differential step
|
37 |
+
>>> Np = 3 # point number for central derivative
|
38 |
+
>>> weights = _central_diff_weights(Np) # weights for first derivative
|
39 |
+
>>> vals = [f(x + (i - Np/2) * h) for i in range(Np)]
|
40 |
+
>>> sum(w * v for (w, v) in zip(weights, vals))/h
|
41 |
+
11.79999999999998
|
42 |
+
|
43 |
+
This value is close to the analytical solution:
|
44 |
+
f'(x) = 4x, so f'(3) = 12
|
45 |
+
|
46 |
+
References
|
47 |
+
----------
|
48 |
+
.. [1] https://en.wikipedia.org/wiki/Finite_difference
|
49 |
+
|
50 |
+
"""
|
51 |
+
if Np < ndiv + 1:
|
52 |
+
raise ValueError(
|
53 |
+
"Number of points must be at least the derivative order + 1."
|
54 |
+
)
|
55 |
+
if Np % 2 == 0:
|
56 |
+
raise ValueError("The number of points must be odd.")
|
57 |
+
from scipy import linalg
|
58 |
+
|
59 |
+
ho = Np >> 1
|
60 |
+
x = arange(-ho, ho + 1.0)
|
61 |
+
x = x[:, newaxis]
|
62 |
+
X = x**0.0
|
63 |
+
for k in range(1, Np):
|
64 |
+
X = hstack([X, x**k])
|
65 |
+
w = prod(arange(1, ndiv + 1), axis=0) * linalg.inv(X)[ndiv]
|
66 |
+
return w
|
67 |
+
|
68 |
+
|
69 |
+
def _derivative(func, x0, dx=1.0, n=1, args=(), order=3):
|
70 |
+
"""
|
71 |
+
Find the nth derivative of a function at a point.
|
72 |
+
|
73 |
+
Given a function, use a central difference formula with spacing `dx` to
|
74 |
+
compute the nth derivative at `x0`.
|
75 |
+
|
76 |
+
Parameters
|
77 |
+
----------
|
78 |
+
func : function
|
79 |
+
Input function.
|
80 |
+
x0 : float
|
81 |
+
The point at which the nth derivative is found.
|
82 |
+
dx : float, optional
|
83 |
+
Spacing.
|
84 |
+
n : int, optional
|
85 |
+
Order of the derivative. Default is 1.
|
86 |
+
args : tuple, optional
|
87 |
+
Arguments
|
88 |
+
order : int, optional
|
89 |
+
Number of points to use, must be odd.
|
90 |
+
|
91 |
+
Notes
|
92 |
+
-----
|
93 |
+
Decreasing the step size too small can result in round-off error.
|
94 |
+
|
95 |
+
Examples
|
96 |
+
--------
|
97 |
+
>>> def f(x):
|
98 |
+
... return x**3 + x**2
|
99 |
+
>>> _derivative(f, 1.0, dx=1e-6)
|
100 |
+
4.9999999999217337
|
101 |
+
|
102 |
+
"""
|
103 |
+
if order < n + 1:
|
104 |
+
raise ValueError(
|
105 |
+
"'order' (the number of points used to compute the derivative), "
|
106 |
+
"must be at least the derivative order 'n' + 1."
|
107 |
+
)
|
108 |
+
if order % 2 == 0:
|
109 |
+
raise ValueError(
|
110 |
+
"'order' (the number of points used to compute the derivative) "
|
111 |
+
"must be odd."
|
112 |
+
)
|
113 |
+
# pre-computed for n=1 and 2 and low-order for speed.
|
114 |
+
if n == 1:
|
115 |
+
if order == 3:
|
116 |
+
weights = array([-1, 0, 1]) / 2.0
|
117 |
+
elif order == 5:
|
118 |
+
weights = array([1, -8, 0, 8, -1]) / 12.0
|
119 |
+
elif order == 7:
|
120 |
+
weights = array([-1, 9, -45, 0, 45, -9, 1]) / 60.0
|
121 |
+
elif order == 9:
|
122 |
+
weights = array([3, -32, 168, -672, 0, 672, -168, 32, -3]) / 840.0
|
123 |
+
else:
|
124 |
+
weights = _central_diff_weights(order, 1)
|
125 |
+
elif n == 2:
|
126 |
+
if order == 3:
|
127 |
+
weights = array([1, -2.0, 1])
|
128 |
+
elif order == 5:
|
129 |
+
weights = array([-1, 16, -30, 16, -1]) / 12.0
|
130 |
+
elif order == 7:
|
131 |
+
weights = array([2, -27, 270, -490, 270, -27, 2]) / 180.0
|
132 |
+
elif order == 9:
|
133 |
+
weights = (
|
134 |
+
array([-9, 128, -1008, 8064, -14350, 8064, -1008, 128, -9])
|
135 |
+
/ 5040.0
|
136 |
+
)
|
137 |
+
else:
|
138 |
+
weights = _central_diff_weights(order, 2)
|
139 |
+
else:
|
140 |
+
weights = _central_diff_weights(order, n)
|
141 |
+
val = 0.0
|
142 |
+
ho = order >> 1
|
143 |
+
for k in range(order):
|
144 |
+
val += weights[k] * func(x0 + (k - ho) * dx, *args)
|
145 |
+
return val / prod((dx,) * n, axis=0)
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_fpumode.cpython-310-x86_64-linux-gnu.so
ADDED
Binary file (16.4 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_gcutils.py
ADDED
@@ -0,0 +1,105 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"""
|
2 |
+
Module for testing automatic garbage collection of objects
|
3 |
+
|
4 |
+
.. autosummary::
|
5 |
+
:toctree: generated/
|
6 |
+
|
7 |
+
set_gc_state - enable or disable garbage collection
|
8 |
+
gc_state - context manager for given state of garbage collector
|
9 |
+
assert_deallocated - context manager to check for circular references on object
|
10 |
+
|
11 |
+
"""
|
12 |
+
import weakref
|
13 |
+
import gc
|
14 |
+
|
15 |
+
from contextlib import contextmanager
|
16 |
+
from platform import python_implementation
|
17 |
+
|
18 |
+
__all__ = ['set_gc_state', 'gc_state', 'assert_deallocated']
|
19 |
+
|
20 |
+
|
21 |
+
IS_PYPY = python_implementation() == 'PyPy'
|
22 |
+
|
23 |
+
|
24 |
+
class ReferenceError(AssertionError):
|
25 |
+
pass
|
26 |
+
|
27 |
+
|
28 |
+
def set_gc_state(state):
|
29 |
+
""" Set status of garbage collector """
|
30 |
+
if gc.isenabled() == state:
|
31 |
+
return
|
32 |
+
if state:
|
33 |
+
gc.enable()
|
34 |
+
else:
|
35 |
+
gc.disable()
|
36 |
+
|
37 |
+
|
38 |
+
@contextmanager
|
39 |
+
def gc_state(state):
|
40 |
+
""" Context manager to set state of garbage collector to `state`
|
41 |
+
|
42 |
+
Parameters
|
43 |
+
----------
|
44 |
+
state : bool
|
45 |
+
True for gc enabled, False for disabled
|
46 |
+
|
47 |
+
Examples
|
48 |
+
--------
|
49 |
+
>>> with gc_state(False):
|
50 |
+
... assert not gc.isenabled()
|
51 |
+
>>> with gc_state(True):
|
52 |
+
... assert gc.isenabled()
|
53 |
+
"""
|
54 |
+
orig_state = gc.isenabled()
|
55 |
+
set_gc_state(state)
|
56 |
+
yield
|
57 |
+
set_gc_state(orig_state)
|
58 |
+
|
59 |
+
|
60 |
+
@contextmanager
|
61 |
+
def assert_deallocated(func, *args, **kwargs):
|
62 |
+
"""Context manager to check that object is deallocated
|
63 |
+
|
64 |
+
This is useful for checking that an object can be freed directly by
|
65 |
+
reference counting, without requiring gc to break reference cycles.
|
66 |
+
GC is disabled inside the context manager.
|
67 |
+
|
68 |
+
This check is not available on PyPy.
|
69 |
+
|
70 |
+
Parameters
|
71 |
+
----------
|
72 |
+
func : callable
|
73 |
+
Callable to create object to check
|
74 |
+
\\*args : sequence
|
75 |
+
positional arguments to `func` in order to create object to check
|
76 |
+
\\*\\*kwargs : dict
|
77 |
+
keyword arguments to `func` in order to create object to check
|
78 |
+
|
79 |
+
Examples
|
80 |
+
--------
|
81 |
+
>>> class C: pass
|
82 |
+
>>> with assert_deallocated(C) as c:
|
83 |
+
... # do something
|
84 |
+
... del c
|
85 |
+
|
86 |
+
>>> class C:
|
87 |
+
... def __init__(self):
|
88 |
+
... self._circular = self # Make circular reference
|
89 |
+
>>> with assert_deallocated(C) as c: #doctest: +IGNORE_EXCEPTION_DETAIL
|
90 |
+
... # do something
|
91 |
+
... del c
|
92 |
+
Traceback (most recent call last):
|
93 |
+
...
|
94 |
+
ReferenceError: Remaining reference(s) to object
|
95 |
+
"""
|
96 |
+
if IS_PYPY:
|
97 |
+
raise RuntimeError("assert_deallocated is unavailable on PyPy")
|
98 |
+
|
99 |
+
with gc_state(False):
|
100 |
+
obj = func(*args, **kwargs)
|
101 |
+
ref = weakref.ref(obj)
|
102 |
+
yield obj
|
103 |
+
del obj
|
104 |
+
if ref() is not None:
|
105 |
+
raise ReferenceError("Remaining reference(s) to object")
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_pep440.py
ADDED
@@ -0,0 +1,487 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"""Utility to compare pep440 compatible version strings.
|
2 |
+
|
3 |
+
The LooseVersion and StrictVersion classes that distutils provides don't
|
4 |
+
work; they don't recognize anything like alpha/beta/rc/dev versions.
|
5 |
+
"""
|
6 |
+
|
7 |
+
# Copyright (c) Donald Stufft and individual contributors.
|
8 |
+
# All rights reserved.
|
9 |
+
|
10 |
+
# Redistribution and use in source and binary forms, with or without
|
11 |
+
# modification, are permitted provided that the following conditions are met:
|
12 |
+
|
13 |
+
# 1. Redistributions of source code must retain the above copyright notice,
|
14 |
+
# this list of conditions and the following disclaimer.
|
15 |
+
|
16 |
+
# 2. Redistributions in binary form must reproduce the above copyright
|
17 |
+
# notice, this list of conditions and the following disclaimer in the
|
18 |
+
# documentation and/or other materials provided with the distribution.
|
19 |
+
|
20 |
+
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
|
21 |
+
# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
|
22 |
+
# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
|
23 |
+
# ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE
|
24 |
+
# LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
|
25 |
+
# CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
|
26 |
+
# SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
|
27 |
+
# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
|
28 |
+
# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
|
29 |
+
# ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
|
30 |
+
# POSSIBILITY OF SUCH DAMAGE.
|
31 |
+
|
32 |
+
import collections
|
33 |
+
import itertools
|
34 |
+
import re
|
35 |
+
|
36 |
+
|
37 |
+
__all__ = [
|
38 |
+
"parse", "Version", "LegacyVersion", "InvalidVersion", "VERSION_PATTERN",
|
39 |
+
]
|
40 |
+
|
41 |
+
|
42 |
+
# BEGIN packaging/_structures.py
|
43 |
+
|
44 |
+
|
45 |
+
class Infinity:
|
46 |
+
def __repr__(self):
|
47 |
+
return "Infinity"
|
48 |
+
|
49 |
+
def __hash__(self):
|
50 |
+
return hash(repr(self))
|
51 |
+
|
52 |
+
def __lt__(self, other):
|
53 |
+
return False
|
54 |
+
|
55 |
+
def __le__(self, other):
|
56 |
+
return False
|
57 |
+
|
58 |
+
def __eq__(self, other):
|
59 |
+
return isinstance(other, self.__class__)
|
60 |
+
|
61 |
+
def __ne__(self, other):
|
62 |
+
return not isinstance(other, self.__class__)
|
63 |
+
|
64 |
+
def __gt__(self, other):
|
65 |
+
return True
|
66 |
+
|
67 |
+
def __ge__(self, other):
|
68 |
+
return True
|
69 |
+
|
70 |
+
def __neg__(self):
|
71 |
+
return NegativeInfinity
|
72 |
+
|
73 |
+
|
74 |
+
Infinity = Infinity()
|
75 |
+
|
76 |
+
|
77 |
+
class NegativeInfinity:
|
78 |
+
def __repr__(self):
|
79 |
+
return "-Infinity"
|
80 |
+
|
81 |
+
def __hash__(self):
|
82 |
+
return hash(repr(self))
|
83 |
+
|
84 |
+
def __lt__(self, other):
|
85 |
+
return True
|
86 |
+
|
87 |
+
def __le__(self, other):
|
88 |
+
return True
|
89 |
+
|
90 |
+
def __eq__(self, other):
|
91 |
+
return isinstance(other, self.__class__)
|
92 |
+
|
93 |
+
def __ne__(self, other):
|
94 |
+
return not isinstance(other, self.__class__)
|
95 |
+
|
96 |
+
def __gt__(self, other):
|
97 |
+
return False
|
98 |
+
|
99 |
+
def __ge__(self, other):
|
100 |
+
return False
|
101 |
+
|
102 |
+
def __neg__(self):
|
103 |
+
return Infinity
|
104 |
+
|
105 |
+
|
106 |
+
# BEGIN packaging/version.py
|
107 |
+
|
108 |
+
|
109 |
+
NegativeInfinity = NegativeInfinity()
|
110 |
+
|
111 |
+
_Version = collections.namedtuple(
|
112 |
+
"_Version",
|
113 |
+
["epoch", "release", "dev", "pre", "post", "local"],
|
114 |
+
)
|
115 |
+
|
116 |
+
|
117 |
+
def parse(version):
|
118 |
+
"""
|
119 |
+
Parse the given version string and return either a :class:`Version` object
|
120 |
+
or a :class:`LegacyVersion` object depending on if the given version is
|
121 |
+
a valid PEP 440 version or a legacy version.
|
122 |
+
"""
|
123 |
+
try:
|
124 |
+
return Version(version)
|
125 |
+
except InvalidVersion:
|
126 |
+
return LegacyVersion(version)
|
127 |
+
|
128 |
+
|
129 |
+
class InvalidVersion(ValueError):
|
130 |
+
"""
|
131 |
+
An invalid version was found, users should refer to PEP 440.
|
132 |
+
"""
|
133 |
+
|
134 |
+
|
135 |
+
class _BaseVersion:
|
136 |
+
|
137 |
+
def __hash__(self):
|
138 |
+
return hash(self._key)
|
139 |
+
|
140 |
+
def __lt__(self, other):
|
141 |
+
return self._compare(other, lambda s, o: s < o)
|
142 |
+
|
143 |
+
def __le__(self, other):
|
144 |
+
return self._compare(other, lambda s, o: s <= o)
|
145 |
+
|
146 |
+
def __eq__(self, other):
|
147 |
+
return self._compare(other, lambda s, o: s == o)
|
148 |
+
|
149 |
+
def __ge__(self, other):
|
150 |
+
return self._compare(other, lambda s, o: s >= o)
|
151 |
+
|
152 |
+
def __gt__(self, other):
|
153 |
+
return self._compare(other, lambda s, o: s > o)
|
154 |
+
|
155 |
+
def __ne__(self, other):
|
156 |
+
return self._compare(other, lambda s, o: s != o)
|
157 |
+
|
158 |
+
def _compare(self, other, method):
|
159 |
+
if not isinstance(other, _BaseVersion):
|
160 |
+
return NotImplemented
|
161 |
+
|
162 |
+
return method(self._key, other._key)
|
163 |
+
|
164 |
+
|
165 |
+
class LegacyVersion(_BaseVersion):
|
166 |
+
|
167 |
+
def __init__(self, version):
|
168 |
+
self._version = str(version)
|
169 |
+
self._key = _legacy_cmpkey(self._version)
|
170 |
+
|
171 |
+
def __str__(self):
|
172 |
+
return self._version
|
173 |
+
|
174 |
+
def __repr__(self):
|
175 |
+
return f"<LegacyVersion({repr(str(self))})>"
|
176 |
+
|
177 |
+
@property
|
178 |
+
def public(self):
|
179 |
+
return self._version
|
180 |
+
|
181 |
+
@property
|
182 |
+
def base_version(self):
|
183 |
+
return self._version
|
184 |
+
|
185 |
+
@property
|
186 |
+
def local(self):
|
187 |
+
return None
|
188 |
+
|
189 |
+
@property
|
190 |
+
def is_prerelease(self):
|
191 |
+
return False
|
192 |
+
|
193 |
+
@property
|
194 |
+
def is_postrelease(self):
|
195 |
+
return False
|
196 |
+
|
197 |
+
|
198 |
+
_legacy_version_component_re = re.compile(
|
199 |
+
r"(\d+ | [a-z]+ | \.| -)", re.VERBOSE,
|
200 |
+
)
|
201 |
+
|
202 |
+
_legacy_version_replacement_map = {
|
203 |
+
"pre": "c", "preview": "c", "-": "final-", "rc": "c", "dev": "@",
|
204 |
+
}
|
205 |
+
|
206 |
+
|
207 |
+
def _parse_version_parts(s):
|
208 |
+
for part in _legacy_version_component_re.split(s):
|
209 |
+
part = _legacy_version_replacement_map.get(part, part)
|
210 |
+
|
211 |
+
if not part or part == ".":
|
212 |
+
continue
|
213 |
+
|
214 |
+
if part[:1] in "0123456789":
|
215 |
+
# pad for numeric comparison
|
216 |
+
yield part.zfill(8)
|
217 |
+
else:
|
218 |
+
yield "*" + part
|
219 |
+
|
220 |
+
# ensure that alpha/beta/candidate are before final
|
221 |
+
yield "*final"
|
222 |
+
|
223 |
+
|
224 |
+
def _legacy_cmpkey(version):
|
225 |
+
# We hardcode an epoch of -1 here. A PEP 440 version can only have an epoch
|
226 |
+
# greater than or equal to 0. This will effectively put the LegacyVersion,
|
227 |
+
# which uses the defacto standard originally implemented by setuptools,
|
228 |
+
# as before all PEP 440 versions.
|
229 |
+
epoch = -1
|
230 |
+
|
231 |
+
# This scheme is taken from pkg_resources.parse_version setuptools prior to
|
232 |
+
# its adoption of the packaging library.
|
233 |
+
parts = []
|
234 |
+
for part in _parse_version_parts(version.lower()):
|
235 |
+
if part.startswith("*"):
|
236 |
+
# remove "-" before a prerelease tag
|
237 |
+
if part < "*final":
|
238 |
+
while parts and parts[-1] == "*final-":
|
239 |
+
parts.pop()
|
240 |
+
|
241 |
+
# remove trailing zeros from each series of numeric parts
|
242 |
+
while parts and parts[-1] == "00000000":
|
243 |
+
parts.pop()
|
244 |
+
|
245 |
+
parts.append(part)
|
246 |
+
parts = tuple(parts)
|
247 |
+
|
248 |
+
return epoch, parts
|
249 |
+
|
250 |
+
|
251 |
+
# Deliberately not anchored to the start and end of the string, to make it
|
252 |
+
# easier for 3rd party code to reuse
|
253 |
+
VERSION_PATTERN = r"""
|
254 |
+
v?
|
255 |
+
(?:
|
256 |
+
(?:(?P<epoch>[0-9]+)!)? # epoch
|
257 |
+
(?P<release>[0-9]+(?:\.[0-9]+)*) # release segment
|
258 |
+
(?P<pre> # pre-release
|
259 |
+
[-_\.]?
|
260 |
+
(?P<pre_l>(a|b|c|rc|alpha|beta|pre|preview))
|
261 |
+
[-_\.]?
|
262 |
+
(?P<pre_n>[0-9]+)?
|
263 |
+
)?
|
264 |
+
(?P<post> # post release
|
265 |
+
(?:-(?P<post_n1>[0-9]+))
|
266 |
+
|
|
267 |
+
(?:
|
268 |
+
[-_\.]?
|
269 |
+
(?P<post_l>post|rev|r)
|
270 |
+
[-_\.]?
|
271 |
+
(?P<post_n2>[0-9]+)?
|
272 |
+
)
|
273 |
+
)?
|
274 |
+
(?P<dev> # dev release
|
275 |
+
[-_\.]?
|
276 |
+
(?P<dev_l>dev)
|
277 |
+
[-_\.]?
|
278 |
+
(?P<dev_n>[0-9]+)?
|
279 |
+
)?
|
280 |
+
)
|
281 |
+
(?:\+(?P<local>[a-z0-9]+(?:[-_\.][a-z0-9]+)*))? # local version
|
282 |
+
"""
|
283 |
+
|
284 |
+
|
285 |
+
class Version(_BaseVersion):
|
286 |
+
|
287 |
+
_regex = re.compile(
|
288 |
+
r"^\s*" + VERSION_PATTERN + r"\s*$",
|
289 |
+
re.VERBOSE | re.IGNORECASE,
|
290 |
+
)
|
291 |
+
|
292 |
+
def __init__(self, version):
|
293 |
+
# Validate the version and parse it into pieces
|
294 |
+
match = self._regex.search(version)
|
295 |
+
if not match:
|
296 |
+
raise InvalidVersion(f"Invalid version: '{version}'")
|
297 |
+
|
298 |
+
# Store the parsed out pieces of the version
|
299 |
+
self._version = _Version(
|
300 |
+
epoch=int(match.group("epoch")) if match.group("epoch") else 0,
|
301 |
+
release=tuple(int(i) for i in match.group("release").split(".")),
|
302 |
+
pre=_parse_letter_version(
|
303 |
+
match.group("pre_l"),
|
304 |
+
match.group("pre_n"),
|
305 |
+
),
|
306 |
+
post=_parse_letter_version(
|
307 |
+
match.group("post_l"),
|
308 |
+
match.group("post_n1") or match.group("post_n2"),
|
309 |
+
),
|
310 |
+
dev=_parse_letter_version(
|
311 |
+
match.group("dev_l"),
|
312 |
+
match.group("dev_n"),
|
313 |
+
),
|
314 |
+
local=_parse_local_version(match.group("local")),
|
315 |
+
)
|
316 |
+
|
317 |
+
# Generate a key which will be used for sorting
|
318 |
+
self._key = _cmpkey(
|
319 |
+
self._version.epoch,
|
320 |
+
self._version.release,
|
321 |
+
self._version.pre,
|
322 |
+
self._version.post,
|
323 |
+
self._version.dev,
|
324 |
+
self._version.local,
|
325 |
+
)
|
326 |
+
|
327 |
+
def __repr__(self):
|
328 |
+
return f"<Version({repr(str(self))})>"
|
329 |
+
|
330 |
+
def __str__(self):
|
331 |
+
parts = []
|
332 |
+
|
333 |
+
# Epoch
|
334 |
+
if self._version.epoch != 0:
|
335 |
+
parts.append(f"{self._version.epoch}!")
|
336 |
+
|
337 |
+
# Release segment
|
338 |
+
parts.append(".".join(str(x) for x in self._version.release))
|
339 |
+
|
340 |
+
# Pre-release
|
341 |
+
if self._version.pre is not None:
|
342 |
+
parts.append("".join(str(x) for x in self._version.pre))
|
343 |
+
|
344 |
+
# Post-release
|
345 |
+
if self._version.post is not None:
|
346 |
+
parts.append(f".post{self._version.post[1]}")
|
347 |
+
|
348 |
+
# Development release
|
349 |
+
if self._version.dev is not None:
|
350 |
+
parts.append(f".dev{self._version.dev[1]}")
|
351 |
+
|
352 |
+
# Local version segment
|
353 |
+
if self._version.local is not None:
|
354 |
+
parts.append(
|
355 |
+
"+{}".format(".".join(str(x) for x in self._version.local))
|
356 |
+
)
|
357 |
+
|
358 |
+
return "".join(parts)
|
359 |
+
|
360 |
+
@property
|
361 |
+
def public(self):
|
362 |
+
return str(self).split("+", 1)[0]
|
363 |
+
|
364 |
+
@property
|
365 |
+
def base_version(self):
|
366 |
+
parts = []
|
367 |
+
|
368 |
+
# Epoch
|
369 |
+
if self._version.epoch != 0:
|
370 |
+
parts.append(f"{self._version.epoch}!")
|
371 |
+
|
372 |
+
# Release segment
|
373 |
+
parts.append(".".join(str(x) for x in self._version.release))
|
374 |
+
|
375 |
+
return "".join(parts)
|
376 |
+
|
377 |
+
@property
|
378 |
+
def local(self):
|
379 |
+
version_string = str(self)
|
380 |
+
if "+" in version_string:
|
381 |
+
return version_string.split("+", 1)[1]
|
382 |
+
|
383 |
+
@property
|
384 |
+
def is_prerelease(self):
|
385 |
+
return bool(self._version.dev or self._version.pre)
|
386 |
+
|
387 |
+
@property
|
388 |
+
def is_postrelease(self):
|
389 |
+
return bool(self._version.post)
|
390 |
+
|
391 |
+
|
392 |
+
def _parse_letter_version(letter, number):
|
393 |
+
if letter:
|
394 |
+
# We assume there is an implicit 0 in a pre-release if there is
|
395 |
+
# no numeral associated with it.
|
396 |
+
if number is None:
|
397 |
+
number = 0
|
398 |
+
|
399 |
+
# We normalize any letters to their lower-case form
|
400 |
+
letter = letter.lower()
|
401 |
+
|
402 |
+
# We consider some words to be alternate spellings of other words and
|
403 |
+
# in those cases we want to normalize the spellings to our preferred
|
404 |
+
# spelling.
|
405 |
+
if letter == "alpha":
|
406 |
+
letter = "a"
|
407 |
+
elif letter == "beta":
|
408 |
+
letter = "b"
|
409 |
+
elif letter in ["c", "pre", "preview"]:
|
410 |
+
letter = "rc"
|
411 |
+
elif letter in ["rev", "r"]:
|
412 |
+
letter = "post"
|
413 |
+
|
414 |
+
return letter, int(number)
|
415 |
+
if not letter and number:
|
416 |
+
# We assume that if we are given a number but not given a letter,
|
417 |
+
# then this is using the implicit post release syntax (e.g., 1.0-1)
|
418 |
+
letter = "post"
|
419 |
+
|
420 |
+
return letter, int(number)
|
421 |
+
|
422 |
+
|
423 |
+
_local_version_seperators = re.compile(r"[\._-]")
|
424 |
+
|
425 |
+
|
426 |
+
def _parse_local_version(local):
|
427 |
+
"""
|
428 |
+
Takes a string like abc.1.twelve and turns it into ("abc", 1, "twelve").
|
429 |
+
"""
|
430 |
+
if local is not None:
|
431 |
+
return tuple(
|
432 |
+
part.lower() if not part.isdigit() else int(part)
|
433 |
+
for part in _local_version_seperators.split(local)
|
434 |
+
)
|
435 |
+
|
436 |
+
|
437 |
+
def _cmpkey(epoch, release, pre, post, dev, local):
|
438 |
+
# When we compare a release version, we want to compare it with all of the
|
439 |
+
# trailing zeros removed. So we'll use a reverse the list, drop all the now
|
440 |
+
# leading zeros until we come to something non-zero, then take the rest,
|
441 |
+
# re-reverse it back into the correct order, and make it a tuple and use
|
442 |
+
# that for our sorting key.
|
443 |
+
release = tuple(
|
444 |
+
reversed(list(
|
445 |
+
itertools.dropwhile(
|
446 |
+
lambda x: x == 0,
|
447 |
+
reversed(release),
|
448 |
+
)
|
449 |
+
))
|
450 |
+
)
|
451 |
+
|
452 |
+
# We need to "trick" the sorting algorithm to put 1.0.dev0 before 1.0a0.
|
453 |
+
# We'll do this by abusing the pre-segment, but we _only_ want to do this
|
454 |
+
# if there is no pre- or a post-segment. If we have one of those, then
|
455 |
+
# the normal sorting rules will handle this case correctly.
|
456 |
+
if pre is None and post is None and dev is not None:
|
457 |
+
pre = -Infinity
|
458 |
+
# Versions without a pre-release (except as noted above) should sort after
|
459 |
+
# those with one.
|
460 |
+
elif pre is None:
|
461 |
+
pre = Infinity
|
462 |
+
|
463 |
+
# Versions without a post-segment should sort before those with one.
|
464 |
+
if post is None:
|
465 |
+
post = -Infinity
|
466 |
+
|
467 |
+
# Versions without a development segment should sort after those with one.
|
468 |
+
if dev is None:
|
469 |
+
dev = Infinity
|
470 |
+
|
471 |
+
if local is None:
|
472 |
+
# Versions without a local segment should sort before those with one.
|
473 |
+
local = -Infinity
|
474 |
+
else:
|
475 |
+
# Versions with a local segment need that segment parsed to implement
|
476 |
+
# the sorting rules in PEP440.
|
477 |
+
# - Alphanumeric segments sort before numeric segments
|
478 |
+
# - Alphanumeric segments sort lexicographically
|
479 |
+
# - Numeric segments sort numerically
|
480 |
+
# - Shorter versions sort before longer versions when the prefixes
|
481 |
+
# match exactly
|
482 |
+
local = tuple(
|
483 |
+
(i, "") if isinstance(i, int) else (-Infinity, i)
|
484 |
+
for i in local
|
485 |
+
)
|
486 |
+
|
487 |
+
return epoch, release, pre, post, dev, local
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_test_ccallback.cpython-310-x86_64-linux-gnu.so
ADDED
Binary file (23.2 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_test_deprecation_call.cpython-310-x86_64-linux-gnu.so
ADDED
Binary file (49.5 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_test_deprecation_def.cpython-310-x86_64-linux-gnu.so
ADDED
Binary file (34.4 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_testutils.py
ADDED
@@ -0,0 +1,337 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
"""
|
2 |
+
Generic test utilities.
|
3 |
+
|
4 |
+
"""
|
5 |
+
|
6 |
+
import inspect
|
7 |
+
import os
|
8 |
+
import re
|
9 |
+
import shutil
|
10 |
+
import subprocess
|
11 |
+
import sys
|
12 |
+
import sysconfig
|
13 |
+
from importlib.util import module_from_spec, spec_from_file_location
|
14 |
+
|
15 |
+
import numpy as np
|
16 |
+
import scipy
|
17 |
+
|
18 |
+
try:
|
19 |
+
# Need type: ignore[import-untyped] for mypy >= 1.6
|
20 |
+
import cython # type: ignore[import-untyped]
|
21 |
+
from Cython.Compiler.Version import ( # type: ignore[import-untyped]
|
22 |
+
version as cython_version,
|
23 |
+
)
|
24 |
+
except ImportError:
|
25 |
+
cython = None
|
26 |
+
else:
|
27 |
+
from scipy._lib import _pep440
|
28 |
+
required_version = '3.0.8'
|
29 |
+
if _pep440.parse(cython_version) < _pep440.Version(required_version):
|
30 |
+
# too old or wrong cython, skip Cython API tests
|
31 |
+
cython = None
|
32 |
+
|
33 |
+
|
34 |
+
__all__ = ['PytestTester', 'check_free_memory', '_TestPythranFunc', 'IS_MUSL']
|
35 |
+
|
36 |
+
|
37 |
+
IS_MUSL = False
|
38 |
+
# alternate way is
|
39 |
+
# from packaging.tags import sys_tags
|
40 |
+
# _tags = list(sys_tags())
|
41 |
+
# if 'musllinux' in _tags[0].platform:
|
42 |
+
_v = sysconfig.get_config_var('HOST_GNU_TYPE') or ''
|
43 |
+
if 'musl' in _v:
|
44 |
+
IS_MUSL = True
|
45 |
+
|
46 |
+
|
47 |
+
IS_EDITABLE = 'editable' in scipy.__path__[0]
|
48 |
+
|
49 |
+
|
50 |
+
class FPUModeChangeWarning(RuntimeWarning):
|
51 |
+
"""Warning about FPU mode change"""
|
52 |
+
pass
|
53 |
+
|
54 |
+
|
55 |
+
class PytestTester:
|
56 |
+
"""
|
57 |
+
Run tests for this namespace
|
58 |
+
|
59 |
+
``scipy.test()`` runs tests for all of SciPy, with the default settings.
|
60 |
+
When used from a submodule (e.g., ``scipy.cluster.test()``, only the tests
|
61 |
+
for that namespace are run.
|
62 |
+
|
63 |
+
Parameters
|
64 |
+
----------
|
65 |
+
label : {'fast', 'full'}, optional
|
66 |
+
Whether to run only the fast tests, or also those marked as slow.
|
67 |
+
Default is 'fast'.
|
68 |
+
verbose : int, optional
|
69 |
+
Test output verbosity. Default is 1.
|
70 |
+
extra_argv : list, optional
|
71 |
+
Arguments to pass through to Pytest.
|
72 |
+
doctests : bool, optional
|
73 |
+
Whether to run doctests or not. Default is False.
|
74 |
+
coverage : bool, optional
|
75 |
+
Whether to run tests with code coverage measurements enabled.
|
76 |
+
Default is False.
|
77 |
+
tests : list of str, optional
|
78 |
+
List of module names to run tests for. By default, uses the module
|
79 |
+
from which the ``test`` function is called.
|
80 |
+
parallel : int, optional
|
81 |
+
Run tests in parallel with pytest-xdist, if number given is larger than
|
82 |
+
1. Default is 1.
|
83 |
+
|
84 |
+
"""
|
85 |
+
def __init__(self, module_name):
|
86 |
+
self.module_name = module_name
|
87 |
+
|
88 |
+
def __call__(self, label="fast", verbose=1, extra_argv=None, doctests=False,
|
89 |
+
coverage=False, tests=None, parallel=None):
|
90 |
+
import pytest
|
91 |
+
|
92 |
+
module = sys.modules[self.module_name]
|
93 |
+
module_path = os.path.abspath(module.__path__[0])
|
94 |
+
|
95 |
+
pytest_args = ['--showlocals', '--tb=short']
|
96 |
+
|
97 |
+
if doctests:
|
98 |
+
pytest_args += [
|
99 |
+
"--doctest-modules",
|
100 |
+
"--ignore=scipy/interpolate/_interpnd_info.py",
|
101 |
+
"--ignore=scipy/_lib/array_api_compat",
|
102 |
+
"--ignore=scipy/_lib/highs",
|
103 |
+
"--ignore=scipy/_lib/unuran",
|
104 |
+
"--ignore=scipy/_lib/_gcutils.py",
|
105 |
+
"--ignore=scipy/_lib/doccer.py",
|
106 |
+
"--ignore=scipy/_lib/_uarray",
|
107 |
+
]
|
108 |
+
|
109 |
+
if extra_argv:
|
110 |
+
pytest_args += list(extra_argv)
|
111 |
+
|
112 |
+
if verbose and int(verbose) > 1:
|
113 |
+
pytest_args += ["-" + "v"*(int(verbose)-1)]
|
114 |
+
|
115 |
+
if coverage:
|
116 |
+
pytest_args += ["--cov=" + module_path]
|
117 |
+
|
118 |
+
if label == "fast":
|
119 |
+
pytest_args += ["-m", "not slow"]
|
120 |
+
elif label != "full":
|
121 |
+
pytest_args += ["-m", label]
|
122 |
+
|
123 |
+
if tests is None:
|
124 |
+
tests = [self.module_name]
|
125 |
+
|
126 |
+
if parallel is not None and parallel > 1:
|
127 |
+
if _pytest_has_xdist():
|
128 |
+
pytest_args += ['-n', str(parallel)]
|
129 |
+
else:
|
130 |
+
import warnings
|
131 |
+
warnings.warn('Could not run tests in parallel because '
|
132 |
+
'pytest-xdist plugin is not available.',
|
133 |
+
stacklevel=2)
|
134 |
+
|
135 |
+
pytest_args += ['--pyargs'] + list(tests)
|
136 |
+
|
137 |
+
try:
|
138 |
+
code = pytest.main(pytest_args)
|
139 |
+
except SystemExit as exc:
|
140 |
+
code = exc.code
|
141 |
+
|
142 |
+
return (code == 0)
|
143 |
+
|
144 |
+
|
145 |
+
class _TestPythranFunc:
|
146 |
+
'''
|
147 |
+
These are situations that can be tested in our pythran tests:
|
148 |
+
- A function with multiple array arguments and then
|
149 |
+
other positional and keyword arguments.
|
150 |
+
- A function with array-like keywords (e.g. `def somefunc(x0, x1=None)`.
|
151 |
+
Note: list/tuple input is not yet tested!
|
152 |
+
|
153 |
+
`self.arguments`: A dictionary which key is the index of the argument,
|
154 |
+
value is tuple(array value, all supported dtypes)
|
155 |
+
`self.partialfunc`: A function used to freeze some non-array argument
|
156 |
+
that of no interests in the original function
|
157 |
+
'''
|
158 |
+
ALL_INTEGER = [np.int8, np.int16, np.int32, np.int64, np.intc, np.intp]
|
159 |
+
ALL_FLOAT = [np.float32, np.float64]
|
160 |
+
ALL_COMPLEX = [np.complex64, np.complex128]
|
161 |
+
|
162 |
+
def setup_method(self):
|
163 |
+
self.arguments = {}
|
164 |
+
self.partialfunc = None
|
165 |
+
self.expected = None
|
166 |
+
|
167 |
+
def get_optional_args(self, func):
|
168 |
+
# get optional arguments with its default value,
|
169 |
+
# used for testing keywords
|
170 |
+
signature = inspect.signature(func)
|
171 |
+
optional_args = {}
|
172 |
+
for k, v in signature.parameters.items():
|
173 |
+
if v.default is not inspect.Parameter.empty:
|
174 |
+
optional_args[k] = v.default
|
175 |
+
return optional_args
|
176 |
+
|
177 |
+
def get_max_dtype_list_length(self):
|
178 |
+
# get the max supported dtypes list length in all arguments
|
179 |
+
max_len = 0
|
180 |
+
for arg_idx in self.arguments:
|
181 |
+
cur_len = len(self.arguments[arg_idx][1])
|
182 |
+
if cur_len > max_len:
|
183 |
+
max_len = cur_len
|
184 |
+
return max_len
|
185 |
+
|
186 |
+
def get_dtype(self, dtype_list, dtype_idx):
|
187 |
+
# get the dtype from dtype_list via index
|
188 |
+
# if the index is out of range, then return the last dtype
|
189 |
+
if dtype_idx > len(dtype_list)-1:
|
190 |
+
return dtype_list[-1]
|
191 |
+
else:
|
192 |
+
return dtype_list[dtype_idx]
|
193 |
+
|
194 |
+
def test_all_dtypes(self):
|
195 |
+
for type_idx in range(self.get_max_dtype_list_length()):
|
196 |
+
args_array = []
|
197 |
+
for arg_idx in self.arguments:
|
198 |
+
new_dtype = self.get_dtype(self.arguments[arg_idx][1],
|
199 |
+
type_idx)
|
200 |
+
args_array.append(self.arguments[arg_idx][0].astype(new_dtype))
|
201 |
+
self.pythranfunc(*args_array)
|
202 |
+
|
203 |
+
def test_views(self):
|
204 |
+
args_array = []
|
205 |
+
for arg_idx in self.arguments:
|
206 |
+
args_array.append(self.arguments[arg_idx][0][::-1][::-1])
|
207 |
+
self.pythranfunc(*args_array)
|
208 |
+
|
209 |
+
def test_strided(self):
|
210 |
+
args_array = []
|
211 |
+
for arg_idx in self.arguments:
|
212 |
+
args_array.append(np.repeat(self.arguments[arg_idx][0],
|
213 |
+
2, axis=0)[::2])
|
214 |
+
self.pythranfunc(*args_array)
|
215 |
+
|
216 |
+
|
217 |
+
def _pytest_has_xdist():
|
218 |
+
"""
|
219 |
+
Check if the pytest-xdist plugin is installed, providing parallel tests
|
220 |
+
"""
|
221 |
+
# Check xdist exists without importing, otherwise pytests emits warnings
|
222 |
+
from importlib.util import find_spec
|
223 |
+
return find_spec('xdist') is not None
|
224 |
+
|
225 |
+
|
226 |
+
def check_free_memory(free_mb):
|
227 |
+
"""
|
228 |
+
Check *free_mb* of memory is available, otherwise do pytest.skip
|
229 |
+
"""
|
230 |
+
import pytest
|
231 |
+
|
232 |
+
try:
|
233 |
+
mem_free = _parse_size(os.environ['SCIPY_AVAILABLE_MEM'])
|
234 |
+
msg = '{} MB memory required, but environment SCIPY_AVAILABLE_MEM={}'.format(
|
235 |
+
free_mb, os.environ['SCIPY_AVAILABLE_MEM'])
|
236 |
+
except KeyError:
|
237 |
+
mem_free = _get_mem_available()
|
238 |
+
if mem_free is None:
|
239 |
+
pytest.skip("Could not determine available memory; set SCIPY_AVAILABLE_MEM "
|
240 |
+
"variable to free memory in MB to run the test.")
|
241 |
+
msg = f'{free_mb} MB memory required, but {mem_free/1e6} MB available'
|
242 |
+
|
243 |
+
if mem_free < free_mb * 1e6:
|
244 |
+
pytest.skip(msg)
|
245 |
+
|
246 |
+
|
247 |
+
def _parse_size(size_str):
|
248 |
+
suffixes = {'': 1e6,
|
249 |
+
'b': 1.0,
|
250 |
+
'k': 1e3, 'M': 1e6, 'G': 1e9, 'T': 1e12,
|
251 |
+
'kb': 1e3, 'Mb': 1e6, 'Gb': 1e9, 'Tb': 1e12,
|
252 |
+
'kib': 1024.0, 'Mib': 1024.0**2, 'Gib': 1024.0**3, 'Tib': 1024.0**4}
|
253 |
+
m = re.match(r'^\s*(\d+)\s*({})\s*$'.format('|'.join(suffixes.keys())),
|
254 |
+
size_str,
|
255 |
+
re.I)
|
256 |
+
if not m or m.group(2) not in suffixes:
|
257 |
+
raise ValueError("Invalid size string")
|
258 |
+
|
259 |
+
return float(m.group(1)) * suffixes[m.group(2)]
|
260 |
+
|
261 |
+
|
262 |
+
def _get_mem_available():
|
263 |
+
"""
|
264 |
+
Get information about memory available, not counting swap.
|
265 |
+
"""
|
266 |
+
try:
|
267 |
+
import psutil
|
268 |
+
return psutil.virtual_memory().available
|
269 |
+
except (ImportError, AttributeError):
|
270 |
+
pass
|
271 |
+
|
272 |
+
if sys.platform.startswith('linux'):
|
273 |
+
info = {}
|
274 |
+
with open('/proc/meminfo') as f:
|
275 |
+
for line in f:
|
276 |
+
p = line.split()
|
277 |
+
info[p[0].strip(':').lower()] = float(p[1]) * 1e3
|
278 |
+
|
279 |
+
if 'memavailable' in info:
|
280 |
+
# Linux >= 3.14
|
281 |
+
return info['memavailable']
|
282 |
+
else:
|
283 |
+
return info['memfree'] + info['cached']
|
284 |
+
|
285 |
+
return None
|
286 |
+
|
287 |
+
def _test_cython_extension(tmp_path, srcdir):
|
288 |
+
"""
|
289 |
+
Helper function to test building and importing Cython modules that
|
290 |
+
make use of the Cython APIs for BLAS, LAPACK, optimize, and special.
|
291 |
+
"""
|
292 |
+
import pytest
|
293 |
+
try:
|
294 |
+
subprocess.check_call(["meson", "--version"])
|
295 |
+
except FileNotFoundError:
|
296 |
+
pytest.skip("No usable 'meson' found")
|
297 |
+
|
298 |
+
# build the examples in a temporary directory
|
299 |
+
mod_name = os.path.split(srcdir)[1]
|
300 |
+
shutil.copytree(srcdir, tmp_path / mod_name)
|
301 |
+
build_dir = tmp_path / mod_name / 'tests' / '_cython_examples'
|
302 |
+
target_dir = build_dir / 'build'
|
303 |
+
os.makedirs(target_dir, exist_ok=True)
|
304 |
+
|
305 |
+
# Ensure we use the correct Python interpreter even when `meson` is
|
306 |
+
# installed in a different Python environment (see numpy#24956)
|
307 |
+
native_file = str(build_dir / 'interpreter-native-file.ini')
|
308 |
+
with open(native_file, 'w') as f:
|
309 |
+
f.write("[binaries]\n")
|
310 |
+
f.write(f"python = '{sys.executable}'")
|
311 |
+
|
312 |
+
if sys.platform == "win32":
|
313 |
+
subprocess.check_call(["meson", "setup",
|
314 |
+
"--buildtype=release",
|
315 |
+
"--native-file", native_file,
|
316 |
+
"--vsenv", str(build_dir)],
|
317 |
+
cwd=target_dir,
|
318 |
+
)
|
319 |
+
else:
|
320 |
+
subprocess.check_call(["meson", "setup",
|
321 |
+
"--native-file", native_file, str(build_dir)],
|
322 |
+
cwd=target_dir
|
323 |
+
)
|
324 |
+
subprocess.check_call(["meson", "compile", "-vv"], cwd=target_dir)
|
325 |
+
|
326 |
+
# import without adding the directory to sys.path
|
327 |
+
suffix = sysconfig.get_config_var('EXT_SUFFIX')
|
328 |
+
|
329 |
+
def load(modname):
|
330 |
+
so = (target_dir / modname).with_suffix(suffix)
|
331 |
+
spec = spec_from_file_location(modname, so)
|
332 |
+
mod = module_from_spec(spec)
|
333 |
+
spec.loader.exec_module(mod)
|
334 |
+
return mod
|
335 |
+
|
336 |
+
# test that the module can be imported
|
337 |
+
return load("extending"), load("extending_cpp")
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_threadsafety.py
ADDED
@@ -0,0 +1,58 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
import threading
|
2 |
+
|
3 |
+
import scipy._lib.decorator
|
4 |
+
|
5 |
+
|
6 |
+
__all__ = ['ReentrancyError', 'ReentrancyLock', 'non_reentrant']
|
7 |
+
|
8 |
+
|
9 |
+
class ReentrancyError(RuntimeError):
|
10 |
+
pass
|
11 |
+
|
12 |
+
|
13 |
+
class ReentrancyLock:
|
14 |
+
"""
|
15 |
+
Threading lock that raises an exception for reentrant calls.
|
16 |
+
|
17 |
+
Calls from different threads are serialized, and nested calls from the
|
18 |
+
same thread result to an error.
|
19 |
+
|
20 |
+
The object can be used as a context manager or to decorate functions
|
21 |
+
via the decorate() method.
|
22 |
+
|
23 |
+
"""
|
24 |
+
|
25 |
+
def __init__(self, err_msg):
|
26 |
+
self._rlock = threading.RLock()
|
27 |
+
self._entered = False
|
28 |
+
self._err_msg = err_msg
|
29 |
+
|
30 |
+
def __enter__(self):
|
31 |
+
self._rlock.acquire()
|
32 |
+
if self._entered:
|
33 |
+
self._rlock.release()
|
34 |
+
raise ReentrancyError(self._err_msg)
|
35 |
+
self._entered = True
|
36 |
+
|
37 |
+
def __exit__(self, type, value, traceback):
|
38 |
+
self._entered = False
|
39 |
+
self._rlock.release()
|
40 |
+
|
41 |
+
def decorate(self, func):
|
42 |
+
def caller(func, *a, **kw):
|
43 |
+
with self:
|
44 |
+
return func(*a, **kw)
|
45 |
+
return scipy._lib.decorator.decorate(func, caller)
|
46 |
+
|
47 |
+
|
48 |
+
def non_reentrant(err_msg=None):
|
49 |
+
"""
|
50 |
+
Decorate a function with a threading lock and prevent reentrant calls.
|
51 |
+
"""
|
52 |
+
def decorator(func):
|
53 |
+
msg = err_msg
|
54 |
+
if msg is None:
|
55 |
+
msg = "%s is not re-entrant" % func.__name__
|
56 |
+
lock = ReentrancyLock(msg)
|
57 |
+
return lock.decorate(func)
|
58 |
+
return decorator
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_tmpdirs.py
ADDED
@@ -0,0 +1,86 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
''' Contexts for *with* statement providing temporary directories
|
2 |
+
'''
|
3 |
+
import os
|
4 |
+
from contextlib import contextmanager
|
5 |
+
from shutil import rmtree
|
6 |
+
from tempfile import mkdtemp
|
7 |
+
|
8 |
+
|
9 |
+
@contextmanager
|
10 |
+
def tempdir():
|
11 |
+
"""Create and return a temporary directory. This has the same
|
12 |
+
behavior as mkdtemp but can be used as a context manager.
|
13 |
+
|
14 |
+
Upon exiting the context, the directory and everything contained
|
15 |
+
in it are removed.
|
16 |
+
|
17 |
+
Examples
|
18 |
+
--------
|
19 |
+
>>> import os
|
20 |
+
>>> with tempdir() as tmpdir:
|
21 |
+
... fname = os.path.join(tmpdir, 'example_file.txt')
|
22 |
+
... with open(fname, 'wt') as fobj:
|
23 |
+
... _ = fobj.write('a string\\n')
|
24 |
+
>>> os.path.exists(tmpdir)
|
25 |
+
False
|
26 |
+
"""
|
27 |
+
d = mkdtemp()
|
28 |
+
yield d
|
29 |
+
rmtree(d)
|
30 |
+
|
31 |
+
|
32 |
+
@contextmanager
|
33 |
+
def in_tempdir():
|
34 |
+
''' Create, return, and change directory to a temporary directory
|
35 |
+
|
36 |
+
Examples
|
37 |
+
--------
|
38 |
+
>>> import os
|
39 |
+
>>> my_cwd = os.getcwd()
|
40 |
+
>>> with in_tempdir() as tmpdir:
|
41 |
+
... _ = open('test.txt', 'wt').write('some text')
|
42 |
+
... assert os.path.isfile('test.txt')
|
43 |
+
... assert os.path.isfile(os.path.join(tmpdir, 'test.txt'))
|
44 |
+
>>> os.path.exists(tmpdir)
|
45 |
+
False
|
46 |
+
>>> os.getcwd() == my_cwd
|
47 |
+
True
|
48 |
+
'''
|
49 |
+
pwd = os.getcwd()
|
50 |
+
d = mkdtemp()
|
51 |
+
os.chdir(d)
|
52 |
+
yield d
|
53 |
+
os.chdir(pwd)
|
54 |
+
rmtree(d)
|
55 |
+
|
56 |
+
|
57 |
+
@contextmanager
|
58 |
+
def in_dir(dir=None):
|
59 |
+
""" Change directory to given directory for duration of ``with`` block
|
60 |
+
|
61 |
+
Useful when you want to use `in_tempdir` for the final test, but
|
62 |
+
you are still debugging. For example, you may want to do this in the end:
|
63 |
+
|
64 |
+
>>> with in_tempdir() as tmpdir:
|
65 |
+
... # do something complicated which might break
|
66 |
+
... pass
|
67 |
+
|
68 |
+
But, indeed, the complicated thing does break, and meanwhile, the
|
69 |
+
``in_tempdir`` context manager wiped out the directory with the
|
70 |
+
temporary files that you wanted for debugging. So, while debugging, you
|
71 |
+
replace with something like:
|
72 |
+
|
73 |
+
>>> with in_dir() as tmpdir: # Use working directory by default
|
74 |
+
... # do something complicated which might break
|
75 |
+
... pass
|
76 |
+
|
77 |
+
You can then look at the temporary file outputs to debug what is happening,
|
78 |
+
fix, and finally replace ``in_dir`` with ``in_tempdir`` again.
|
79 |
+
"""
|
80 |
+
cwd = os.getcwd()
|
81 |
+
if dir is None:
|
82 |
+
yield cwd
|
83 |
+
return
|
84 |
+
os.chdir(dir)
|
85 |
+
yield dir
|
86 |
+
os.chdir(cwd)
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/_util.py
ADDED
@@ -0,0 +1,954 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
import re
|
2 |
+
from contextlib import contextmanager
|
3 |
+
import functools
|
4 |
+
import operator
|
5 |
+
import warnings
|
6 |
+
import numbers
|
7 |
+
from collections import namedtuple
|
8 |
+
import inspect
|
9 |
+
import math
|
10 |
+
from typing import (
|
11 |
+
Optional,
|
12 |
+
Union,
|
13 |
+
TYPE_CHECKING,
|
14 |
+
TypeVar,
|
15 |
+
)
|
16 |
+
|
17 |
+
import numpy as np
|
18 |
+
from scipy._lib._array_api import array_namespace, is_numpy, size as xp_size
|
19 |
+
|
20 |
+
|
21 |
+
AxisError: type[Exception]
|
22 |
+
ComplexWarning: type[Warning]
|
23 |
+
VisibleDeprecationWarning: type[Warning]
|
24 |
+
|
25 |
+
if np.lib.NumpyVersion(np.__version__) >= '1.25.0':
|
26 |
+
from numpy.exceptions import (
|
27 |
+
AxisError, ComplexWarning, VisibleDeprecationWarning,
|
28 |
+
DTypePromotionError
|
29 |
+
)
|
30 |
+
else:
|
31 |
+
from numpy import ( # type: ignore[attr-defined, no-redef]
|
32 |
+
AxisError, ComplexWarning, VisibleDeprecationWarning # noqa: F401
|
33 |
+
)
|
34 |
+
DTypePromotionError = TypeError # type: ignore
|
35 |
+
|
36 |
+
np_long: type
|
37 |
+
np_ulong: type
|
38 |
+
|
39 |
+
if np.lib.NumpyVersion(np.__version__) >= "2.0.0.dev0":
|
40 |
+
try:
|
41 |
+
with warnings.catch_warnings():
|
42 |
+
warnings.filterwarnings(
|
43 |
+
"ignore",
|
44 |
+
r".*In the future `np\.long` will be defined as.*",
|
45 |
+
FutureWarning,
|
46 |
+
)
|
47 |
+
np_long = np.long # type: ignore[attr-defined]
|
48 |
+
np_ulong = np.ulong # type: ignore[attr-defined]
|
49 |
+
except AttributeError:
|
50 |
+
np_long = np.int_
|
51 |
+
np_ulong = np.uint
|
52 |
+
else:
|
53 |
+
np_long = np.int_
|
54 |
+
np_ulong = np.uint
|
55 |
+
|
56 |
+
IntNumber = Union[int, np.integer]
|
57 |
+
DecimalNumber = Union[float, np.floating, np.integer]
|
58 |
+
|
59 |
+
copy_if_needed: Optional[bool]
|
60 |
+
|
61 |
+
if np.lib.NumpyVersion(np.__version__) >= "2.0.0":
|
62 |
+
copy_if_needed = None
|
63 |
+
elif np.lib.NumpyVersion(np.__version__) < "1.28.0":
|
64 |
+
copy_if_needed = False
|
65 |
+
else:
|
66 |
+
# 2.0.0 dev versions, handle cases where copy may or may not exist
|
67 |
+
try:
|
68 |
+
np.array([1]).__array__(copy=None) # type: ignore[call-overload]
|
69 |
+
copy_if_needed = None
|
70 |
+
except TypeError:
|
71 |
+
copy_if_needed = False
|
72 |
+
|
73 |
+
# Since Generator was introduced in numpy 1.17, the following condition is needed for
|
74 |
+
# backward compatibility
|
75 |
+
if TYPE_CHECKING:
|
76 |
+
SeedType = Optional[Union[IntNumber, np.random.Generator,
|
77 |
+
np.random.RandomState]]
|
78 |
+
GeneratorType = TypeVar("GeneratorType", bound=Union[np.random.Generator,
|
79 |
+
np.random.RandomState])
|
80 |
+
|
81 |
+
try:
|
82 |
+
from numpy.random import Generator as Generator
|
83 |
+
except ImportError:
|
84 |
+
class Generator: # type: ignore[no-redef]
|
85 |
+
pass
|
86 |
+
|
87 |
+
|
88 |
+
def _lazywhere(cond, arrays, f, fillvalue=None, f2=None):
|
89 |
+
"""Return elements chosen from two possibilities depending on a condition
|
90 |
+
|
91 |
+
Equivalent to ``f(*arrays) if cond else fillvalue`` performed elementwise.
|
92 |
+
|
93 |
+
Parameters
|
94 |
+
----------
|
95 |
+
cond : array
|
96 |
+
The condition (expressed as a boolean array).
|
97 |
+
arrays : tuple of array
|
98 |
+
Arguments to `f` (and `f2`). Must be broadcastable with `cond`.
|
99 |
+
f : callable
|
100 |
+
Where `cond` is True, output will be ``f(arr1[cond], arr2[cond], ...)``
|
101 |
+
fillvalue : object
|
102 |
+
If provided, value with which to fill output array where `cond` is
|
103 |
+
not True.
|
104 |
+
f2 : callable
|
105 |
+
If provided, output will be ``f2(arr1[cond], arr2[cond], ...)`` where
|
106 |
+
`cond` is not True.
|
107 |
+
|
108 |
+
Returns
|
109 |
+
-------
|
110 |
+
out : array
|
111 |
+
An array with elements from the output of `f` where `cond` is True
|
112 |
+
and `fillvalue` (or elements from the output of `f2`) elsewhere. The
|
113 |
+
returned array has data type determined by Type Promotion Rules
|
114 |
+
with the output of `f` and `fillvalue` (or the output of `f2`).
|
115 |
+
|
116 |
+
Notes
|
117 |
+
-----
|
118 |
+
``xp.where(cond, x, fillvalue)`` requires explicitly forming `x` even where
|
119 |
+
`cond` is False. This function evaluates ``f(arr1[cond], arr2[cond], ...)``
|
120 |
+
onle where `cond` ``is True.
|
121 |
+
|
122 |
+
Examples
|
123 |
+
--------
|
124 |
+
>>> import numpy as np
|
125 |
+
>>> a, b = np.array([1, 2, 3, 4]), np.array([5, 6, 7, 8])
|
126 |
+
>>> def f(a, b):
|
127 |
+
... return a*b
|
128 |
+
>>> _lazywhere(a > 2, (a, b), f, np.nan)
|
129 |
+
array([ nan, nan, 21., 32.])
|
130 |
+
|
131 |
+
"""
|
132 |
+
xp = array_namespace(cond, *arrays)
|
133 |
+
|
134 |
+
if (f2 is fillvalue is None) or (f2 is not None and fillvalue is not None):
|
135 |
+
raise ValueError("Exactly one of `fillvalue` or `f2` must be given.")
|
136 |
+
|
137 |
+
args = xp.broadcast_arrays(cond, *arrays)
|
138 |
+
bool_dtype = xp.asarray([True]).dtype # numpy 1.xx doesn't have `bool`
|
139 |
+
cond, arrays = xp.astype(args[0], bool_dtype, copy=False), args[1:]
|
140 |
+
|
141 |
+
temp1 = xp.asarray(f(*(arr[cond] for arr in arrays)))
|
142 |
+
|
143 |
+
if f2 is None:
|
144 |
+
fillvalue = xp.asarray(fillvalue)
|
145 |
+
dtype = xp.result_type(temp1.dtype, fillvalue.dtype)
|
146 |
+
out = xp.full(cond.shape, fill_value=fillvalue, dtype=dtype)
|
147 |
+
else:
|
148 |
+
ncond = ~cond
|
149 |
+
temp2 = xp.asarray(f2(*(arr[ncond] for arr in arrays)))
|
150 |
+
dtype = xp.result_type(temp1, temp2)
|
151 |
+
out = xp.empty(cond.shape, dtype=dtype)
|
152 |
+
out[ncond] = temp2
|
153 |
+
|
154 |
+
out[cond] = temp1
|
155 |
+
|
156 |
+
return out
|
157 |
+
|
158 |
+
|
159 |
+
def _lazyselect(condlist, choicelist, arrays, default=0):
|
160 |
+
"""
|
161 |
+
Mimic `np.select(condlist, choicelist)`.
|
162 |
+
|
163 |
+
Notice, it assumes that all `arrays` are of the same shape or can be
|
164 |
+
broadcasted together.
|
165 |
+
|
166 |
+
All functions in `choicelist` must accept array arguments in the order
|
167 |
+
given in `arrays` and must return an array of the same shape as broadcasted
|
168 |
+
`arrays`.
|
169 |
+
|
170 |
+
Examples
|
171 |
+
--------
|
172 |
+
>>> import numpy as np
|
173 |
+
>>> x = np.arange(6)
|
174 |
+
>>> np.select([x <3, x > 3], [x**2, x**3], default=0)
|
175 |
+
array([ 0, 1, 4, 0, 64, 125])
|
176 |
+
|
177 |
+
>>> _lazyselect([x < 3, x > 3], [lambda x: x**2, lambda x: x**3], (x,))
|
178 |
+
array([ 0., 1., 4., 0., 64., 125.])
|
179 |
+
|
180 |
+
>>> a = -np.ones_like(x)
|
181 |
+
>>> _lazyselect([x < 3, x > 3],
|
182 |
+
... [lambda x, a: x**2, lambda x, a: a * x**3],
|
183 |
+
... (x, a), default=np.nan)
|
184 |
+
array([ 0., 1., 4., nan, -64., -125.])
|
185 |
+
|
186 |
+
"""
|
187 |
+
arrays = np.broadcast_arrays(*arrays)
|
188 |
+
tcode = np.mintypecode([a.dtype.char for a in arrays])
|
189 |
+
out = np.full(np.shape(arrays[0]), fill_value=default, dtype=tcode)
|
190 |
+
for func, cond in zip(choicelist, condlist):
|
191 |
+
if np.all(cond is False):
|
192 |
+
continue
|
193 |
+
cond, _ = np.broadcast_arrays(cond, arrays[0])
|
194 |
+
temp = tuple(np.extract(cond, arr) for arr in arrays)
|
195 |
+
np.place(out, cond, func(*temp))
|
196 |
+
return out
|
197 |
+
|
198 |
+
|
199 |
+
def _aligned_zeros(shape, dtype=float, order="C", align=None):
|
200 |
+
"""Allocate a new ndarray with aligned memory.
|
201 |
+
|
202 |
+
Primary use case for this currently is working around a f2py issue
|
203 |
+
in NumPy 1.9.1, where dtype.alignment is such that np.zeros() does
|
204 |
+
not necessarily create arrays aligned up to it.
|
205 |
+
|
206 |
+
"""
|
207 |
+
dtype = np.dtype(dtype)
|
208 |
+
if align is None:
|
209 |
+
align = dtype.alignment
|
210 |
+
if not hasattr(shape, '__len__'):
|
211 |
+
shape = (shape,)
|
212 |
+
size = functools.reduce(operator.mul, shape) * dtype.itemsize
|
213 |
+
buf = np.empty(size + align + 1, np.uint8)
|
214 |
+
offset = buf.__array_interface__['data'][0] % align
|
215 |
+
if offset != 0:
|
216 |
+
offset = align - offset
|
217 |
+
# Note: slices producing 0-size arrays do not necessarily change
|
218 |
+
# data pointer --- so we use and allocate size+1
|
219 |
+
buf = buf[offset:offset+size+1][:-1]
|
220 |
+
data = np.ndarray(shape, dtype, buf, order=order)
|
221 |
+
data.fill(0)
|
222 |
+
return data
|
223 |
+
|
224 |
+
|
225 |
+
def _prune_array(array):
|
226 |
+
"""Return an array equivalent to the input array. If the input
|
227 |
+
array is a view of a much larger array, copy its contents to a
|
228 |
+
newly allocated array. Otherwise, return the input unchanged.
|
229 |
+
"""
|
230 |
+
if array.base is not None and array.size < array.base.size // 2:
|
231 |
+
return array.copy()
|
232 |
+
return array
|
233 |
+
|
234 |
+
|
235 |
+
def float_factorial(n: int) -> float:
|
236 |
+
"""Compute the factorial and return as a float
|
237 |
+
|
238 |
+
Returns infinity when result is too large for a double
|
239 |
+
"""
|
240 |
+
return float(math.factorial(n)) if n < 171 else np.inf
|
241 |
+
|
242 |
+
|
243 |
+
# copy-pasted from scikit-learn utils/validation.py
|
244 |
+
# change this to scipy.stats._qmc.check_random_state once numpy 1.16 is dropped
|
245 |
+
def check_random_state(seed):
|
246 |
+
"""Turn `seed` into a `np.random.RandomState` instance.
|
247 |
+
|
248 |
+
Parameters
|
249 |
+
----------
|
250 |
+
seed : {None, int, `numpy.random.Generator`, `numpy.random.RandomState`}, optional
|
251 |
+
If `seed` is None (or `np.random`), the `numpy.random.RandomState`
|
252 |
+
singleton is used.
|
253 |
+
If `seed` is an int, a new ``RandomState`` instance is used,
|
254 |
+
seeded with `seed`.
|
255 |
+
If `seed` is already a ``Generator`` or ``RandomState`` instance then
|
256 |
+
that instance is used.
|
257 |
+
|
258 |
+
Returns
|
259 |
+
-------
|
260 |
+
seed : {`numpy.random.Generator`, `numpy.random.RandomState`}
|
261 |
+
Random number generator.
|
262 |
+
|
263 |
+
"""
|
264 |
+
if seed is None or seed is np.random:
|
265 |
+
return np.random.mtrand._rand
|
266 |
+
if isinstance(seed, (numbers.Integral, np.integer)):
|
267 |
+
return np.random.RandomState(seed)
|
268 |
+
if isinstance(seed, (np.random.RandomState, np.random.Generator)):
|
269 |
+
return seed
|
270 |
+
|
271 |
+
raise ValueError(f"'{seed}' cannot be used to seed a numpy.random.RandomState"
|
272 |
+
" instance")
|
273 |
+
|
274 |
+
|
275 |
+
def _asarray_validated(a, check_finite=True,
|
276 |
+
sparse_ok=False, objects_ok=False, mask_ok=False,
|
277 |
+
as_inexact=False):
|
278 |
+
"""
|
279 |
+
Helper function for SciPy argument validation.
|
280 |
+
|
281 |
+
Many SciPy linear algebra functions do support arbitrary array-like
|
282 |
+
input arguments. Examples of commonly unsupported inputs include
|
283 |
+
matrices containing inf/nan, sparse matrix representations, and
|
284 |
+
matrices with complicated elements.
|
285 |
+
|
286 |
+
Parameters
|
287 |
+
----------
|
288 |
+
a : array_like
|
289 |
+
The array-like input.
|
290 |
+
check_finite : bool, optional
|
291 |
+
Whether to check that the input matrices contain only finite numbers.
|
292 |
+
Disabling may give a performance gain, but may result in problems
|
293 |
+
(crashes, non-termination) if the inputs do contain infinities or NaNs.
|
294 |
+
Default: True
|
295 |
+
sparse_ok : bool, optional
|
296 |
+
True if scipy sparse matrices are allowed.
|
297 |
+
objects_ok : bool, optional
|
298 |
+
True if arrays with dype('O') are allowed.
|
299 |
+
mask_ok : bool, optional
|
300 |
+
True if masked arrays are allowed.
|
301 |
+
as_inexact : bool, optional
|
302 |
+
True to convert the input array to a np.inexact dtype.
|
303 |
+
|
304 |
+
Returns
|
305 |
+
-------
|
306 |
+
ret : ndarray
|
307 |
+
The converted validated array.
|
308 |
+
|
309 |
+
"""
|
310 |
+
if not sparse_ok:
|
311 |
+
import scipy.sparse
|
312 |
+
if scipy.sparse.issparse(a):
|
313 |
+
msg = ('Sparse matrices are not supported by this function. '
|
314 |
+
'Perhaps one of the scipy.sparse.linalg functions '
|
315 |
+
'would work instead.')
|
316 |
+
raise ValueError(msg)
|
317 |
+
if not mask_ok:
|
318 |
+
if np.ma.isMaskedArray(a):
|
319 |
+
raise ValueError('masked arrays are not supported')
|
320 |
+
toarray = np.asarray_chkfinite if check_finite else np.asarray
|
321 |
+
a = toarray(a)
|
322 |
+
if not objects_ok:
|
323 |
+
if a.dtype is np.dtype('O'):
|
324 |
+
raise ValueError('object arrays are not supported')
|
325 |
+
if as_inexact:
|
326 |
+
if not np.issubdtype(a.dtype, np.inexact):
|
327 |
+
a = toarray(a, dtype=np.float64)
|
328 |
+
return a
|
329 |
+
|
330 |
+
|
331 |
+
def _validate_int(k, name, minimum=None):
|
332 |
+
"""
|
333 |
+
Validate a scalar integer.
|
334 |
+
|
335 |
+
This function can be used to validate an argument to a function
|
336 |
+
that expects the value to be an integer. It uses `operator.index`
|
337 |
+
to validate the value (so, for example, k=2.0 results in a
|
338 |
+
TypeError).
|
339 |
+
|
340 |
+
Parameters
|
341 |
+
----------
|
342 |
+
k : int
|
343 |
+
The value to be validated.
|
344 |
+
name : str
|
345 |
+
The name of the parameter.
|
346 |
+
minimum : int, optional
|
347 |
+
An optional lower bound.
|
348 |
+
"""
|
349 |
+
try:
|
350 |
+
k = operator.index(k)
|
351 |
+
except TypeError:
|
352 |
+
raise TypeError(f'{name} must be an integer.') from None
|
353 |
+
if minimum is not None and k < minimum:
|
354 |
+
raise ValueError(f'{name} must be an integer not less '
|
355 |
+
f'than {minimum}') from None
|
356 |
+
return k
|
357 |
+
|
358 |
+
|
359 |
+
# Add a replacement for inspect.getfullargspec()/
|
360 |
+
# The version below is borrowed from Django,
|
361 |
+
# https://github.com/django/django/pull/4846.
|
362 |
+
|
363 |
+
# Note an inconsistency between inspect.getfullargspec(func) and
|
364 |
+
# inspect.signature(func). If `func` is a bound method, the latter does *not*
|
365 |
+
# list `self` as a first argument, while the former *does*.
|
366 |
+
# Hence, cook up a common ground replacement: `getfullargspec_no_self` which
|
367 |
+
# mimics `inspect.getfullargspec` but does not list `self`.
|
368 |
+
#
|
369 |
+
# This way, the caller code does not need to know whether it uses a legacy
|
370 |
+
# .getfullargspec or a bright and shiny .signature.
|
371 |
+
|
372 |
+
FullArgSpec = namedtuple('FullArgSpec',
|
373 |
+
['args', 'varargs', 'varkw', 'defaults',
|
374 |
+
'kwonlyargs', 'kwonlydefaults', 'annotations'])
|
375 |
+
|
376 |
+
|
377 |
+
def getfullargspec_no_self(func):
|
378 |
+
"""inspect.getfullargspec replacement using inspect.signature.
|
379 |
+
|
380 |
+
If func is a bound method, do not list the 'self' parameter.
|
381 |
+
|
382 |
+
Parameters
|
383 |
+
----------
|
384 |
+
func : callable
|
385 |
+
A callable to inspect
|
386 |
+
|
387 |
+
Returns
|
388 |
+
-------
|
389 |
+
fullargspec : FullArgSpec(args, varargs, varkw, defaults, kwonlyargs,
|
390 |
+
kwonlydefaults, annotations)
|
391 |
+
|
392 |
+
NOTE: if the first argument of `func` is self, it is *not*, I repeat
|
393 |
+
*not*, included in fullargspec.args.
|
394 |
+
This is done for consistency between inspect.getargspec() under
|
395 |
+
Python 2.x, and inspect.signature() under Python 3.x.
|
396 |
+
|
397 |
+
"""
|
398 |
+
sig = inspect.signature(func)
|
399 |
+
args = [
|
400 |
+
p.name for p in sig.parameters.values()
|
401 |
+
if p.kind in [inspect.Parameter.POSITIONAL_OR_KEYWORD,
|
402 |
+
inspect.Parameter.POSITIONAL_ONLY]
|
403 |
+
]
|
404 |
+
varargs = [
|
405 |
+
p.name for p in sig.parameters.values()
|
406 |
+
if p.kind == inspect.Parameter.VAR_POSITIONAL
|
407 |
+
]
|
408 |
+
varargs = varargs[0] if varargs else None
|
409 |
+
varkw = [
|
410 |
+
p.name for p in sig.parameters.values()
|
411 |
+
if p.kind == inspect.Parameter.VAR_KEYWORD
|
412 |
+
]
|
413 |
+
varkw = varkw[0] if varkw else None
|
414 |
+
defaults = tuple(
|
415 |
+
p.default for p in sig.parameters.values()
|
416 |
+
if (p.kind == inspect.Parameter.POSITIONAL_OR_KEYWORD and
|
417 |
+
p.default is not p.empty)
|
418 |
+
) or None
|
419 |
+
kwonlyargs = [
|
420 |
+
p.name for p in sig.parameters.values()
|
421 |
+
if p.kind == inspect.Parameter.KEYWORD_ONLY
|
422 |
+
]
|
423 |
+
kwdefaults = {p.name: p.default for p in sig.parameters.values()
|
424 |
+
if p.kind == inspect.Parameter.KEYWORD_ONLY and
|
425 |
+
p.default is not p.empty}
|
426 |
+
annotations = {p.name: p.annotation for p in sig.parameters.values()
|
427 |
+
if p.annotation is not p.empty}
|
428 |
+
return FullArgSpec(args, varargs, varkw, defaults, kwonlyargs,
|
429 |
+
kwdefaults or None, annotations)
|
430 |
+
|
431 |
+
|
432 |
+
class _FunctionWrapper:
|
433 |
+
"""
|
434 |
+
Object to wrap user's function, allowing picklability
|
435 |
+
"""
|
436 |
+
def __init__(self, f, args):
|
437 |
+
self.f = f
|
438 |
+
self.args = [] if args is None else args
|
439 |
+
|
440 |
+
def __call__(self, x):
|
441 |
+
return self.f(x, *self.args)
|
442 |
+
|
443 |
+
|
444 |
+
class MapWrapper:
|
445 |
+
"""
|
446 |
+
Parallelisation wrapper for working with map-like callables, such as
|
447 |
+
`multiprocessing.Pool.map`.
|
448 |
+
|
449 |
+
Parameters
|
450 |
+
----------
|
451 |
+
pool : int or map-like callable
|
452 |
+
If `pool` is an integer, then it specifies the number of threads to
|
453 |
+
use for parallelization. If ``int(pool) == 1``, then no parallel
|
454 |
+
processing is used and the map builtin is used.
|
455 |
+
If ``pool == -1``, then the pool will utilize all available CPUs.
|
456 |
+
If `pool` is a map-like callable that follows the same
|
457 |
+
calling sequence as the built-in map function, then this callable is
|
458 |
+
used for parallelization.
|
459 |
+
"""
|
460 |
+
def __init__(self, pool=1):
|
461 |
+
self.pool = None
|
462 |
+
self._mapfunc = map
|
463 |
+
self._own_pool = False
|
464 |
+
|
465 |
+
if callable(pool):
|
466 |
+
self.pool = pool
|
467 |
+
self._mapfunc = self.pool
|
468 |
+
else:
|
469 |
+
from multiprocessing import Pool
|
470 |
+
# user supplies a number
|
471 |
+
if int(pool) == -1:
|
472 |
+
# use as many processors as possible
|
473 |
+
self.pool = Pool()
|
474 |
+
self._mapfunc = self.pool.map
|
475 |
+
self._own_pool = True
|
476 |
+
elif int(pool) == 1:
|
477 |
+
pass
|
478 |
+
elif int(pool) > 1:
|
479 |
+
# use the number of processors requested
|
480 |
+
self.pool = Pool(processes=int(pool))
|
481 |
+
self._mapfunc = self.pool.map
|
482 |
+
self._own_pool = True
|
483 |
+
else:
|
484 |
+
raise RuntimeError("Number of workers specified must be -1,"
|
485 |
+
" an int >= 1, or an object with a 'map' "
|
486 |
+
"method")
|
487 |
+
|
488 |
+
def __enter__(self):
|
489 |
+
return self
|
490 |
+
|
491 |
+
def terminate(self):
|
492 |
+
if self._own_pool:
|
493 |
+
self.pool.terminate()
|
494 |
+
|
495 |
+
def join(self):
|
496 |
+
if self._own_pool:
|
497 |
+
self.pool.join()
|
498 |
+
|
499 |
+
def close(self):
|
500 |
+
if self._own_pool:
|
501 |
+
self.pool.close()
|
502 |
+
|
503 |
+
def __exit__(self, exc_type, exc_value, traceback):
|
504 |
+
if self._own_pool:
|
505 |
+
self.pool.close()
|
506 |
+
self.pool.terminate()
|
507 |
+
|
508 |
+
def __call__(self, func, iterable):
|
509 |
+
# only accept one iterable because that's all Pool.map accepts
|
510 |
+
try:
|
511 |
+
return self._mapfunc(func, iterable)
|
512 |
+
except TypeError as e:
|
513 |
+
# wrong number of arguments
|
514 |
+
raise TypeError("The map-like callable must be of the"
|
515 |
+
" form f(func, iterable)") from e
|
516 |
+
|
517 |
+
|
518 |
+
def rng_integers(gen, low, high=None, size=None, dtype='int64',
|
519 |
+
endpoint=False):
|
520 |
+
"""
|
521 |
+
Return random integers from low (inclusive) to high (exclusive), or if
|
522 |
+
endpoint=True, low (inclusive) to high (inclusive). Replaces
|
523 |
+
`RandomState.randint` (with endpoint=False) and
|
524 |
+
`RandomState.random_integers` (with endpoint=True).
|
525 |
+
|
526 |
+
Return random integers from the "discrete uniform" distribution of the
|
527 |
+
specified dtype. If high is None (the default), then results are from
|
528 |
+
0 to low.
|
529 |
+
|
530 |
+
Parameters
|
531 |
+
----------
|
532 |
+
gen : {None, np.random.RandomState, np.random.Generator}
|
533 |
+
Random number generator. If None, then the np.random.RandomState
|
534 |
+
singleton is used.
|
535 |
+
low : int or array-like of ints
|
536 |
+
Lowest (signed) integers to be drawn from the distribution (unless
|
537 |
+
high=None, in which case this parameter is 0 and this value is used
|
538 |
+
for high).
|
539 |
+
high : int or array-like of ints
|
540 |
+
If provided, one above the largest (signed) integer to be drawn from
|
541 |
+
the distribution (see above for behavior if high=None). If array-like,
|
542 |
+
must contain integer values.
|
543 |
+
size : array-like of ints, optional
|
544 |
+
Output shape. If the given shape is, e.g., (m, n, k), then m * n * k
|
545 |
+
samples are drawn. Default is None, in which case a single value is
|
546 |
+
returned.
|
547 |
+
dtype : {str, dtype}, optional
|
548 |
+
Desired dtype of the result. All dtypes are determined by their name,
|
549 |
+
i.e., 'int64', 'int', etc, so byteorder is not available and a specific
|
550 |
+
precision may have different C types depending on the platform.
|
551 |
+
The default value is 'int64'.
|
552 |
+
endpoint : bool, optional
|
553 |
+
If True, sample from the interval [low, high] instead of the default
|
554 |
+
[low, high) Defaults to False.
|
555 |
+
|
556 |
+
Returns
|
557 |
+
-------
|
558 |
+
out: int or ndarray of ints
|
559 |
+
size-shaped array of random integers from the appropriate distribution,
|
560 |
+
or a single such random int if size not provided.
|
561 |
+
"""
|
562 |
+
if isinstance(gen, Generator):
|
563 |
+
return gen.integers(low, high=high, size=size, dtype=dtype,
|
564 |
+
endpoint=endpoint)
|
565 |
+
else:
|
566 |
+
if gen is None:
|
567 |
+
# default is RandomState singleton used by np.random.
|
568 |
+
gen = np.random.mtrand._rand
|
569 |
+
if endpoint:
|
570 |
+
# inclusive of endpoint
|
571 |
+
# remember that low and high can be arrays, so don't modify in
|
572 |
+
# place
|
573 |
+
if high is None:
|
574 |
+
return gen.randint(low + 1, size=size, dtype=dtype)
|
575 |
+
if high is not None:
|
576 |
+
return gen.randint(low, high=high + 1, size=size, dtype=dtype)
|
577 |
+
|
578 |
+
# exclusive
|
579 |
+
return gen.randint(low, high=high, size=size, dtype=dtype)
|
580 |
+
|
581 |
+
|
582 |
+
@contextmanager
|
583 |
+
def _fixed_default_rng(seed=1638083107694713882823079058616272161):
|
584 |
+
"""Context with a fixed np.random.default_rng seed."""
|
585 |
+
orig_fun = np.random.default_rng
|
586 |
+
np.random.default_rng = lambda seed=seed: orig_fun(seed)
|
587 |
+
try:
|
588 |
+
yield
|
589 |
+
finally:
|
590 |
+
np.random.default_rng = orig_fun
|
591 |
+
|
592 |
+
|
593 |
+
def _rng_html_rewrite(func):
|
594 |
+
"""Rewrite the HTML rendering of ``np.random.default_rng``.
|
595 |
+
|
596 |
+
This is intended to decorate
|
597 |
+
``numpydoc.docscrape_sphinx.SphinxDocString._str_examples``.
|
598 |
+
|
599 |
+
Examples are only run by Sphinx when there are plot involved. Even so,
|
600 |
+
it does not change the result values getting printed.
|
601 |
+
"""
|
602 |
+
# hexadecimal or number seed, case-insensitive
|
603 |
+
pattern = re.compile(r'np.random.default_rng\((0x[0-9A-F]+|\d+)\)', re.I)
|
604 |
+
|
605 |
+
def _wrapped(*args, **kwargs):
|
606 |
+
res = func(*args, **kwargs)
|
607 |
+
lines = [
|
608 |
+
re.sub(pattern, 'np.random.default_rng()', line)
|
609 |
+
for line in res
|
610 |
+
]
|
611 |
+
return lines
|
612 |
+
|
613 |
+
return _wrapped
|
614 |
+
|
615 |
+
|
616 |
+
def _argmin(a, keepdims=False, axis=None):
|
617 |
+
"""
|
618 |
+
argmin with a `keepdims` parameter.
|
619 |
+
|
620 |
+
See https://github.com/numpy/numpy/issues/8710
|
621 |
+
|
622 |
+
If axis is not None, a.shape[axis] must be greater than 0.
|
623 |
+
"""
|
624 |
+
res = np.argmin(a, axis=axis)
|
625 |
+
if keepdims and axis is not None:
|
626 |
+
res = np.expand_dims(res, axis=axis)
|
627 |
+
return res
|
628 |
+
|
629 |
+
|
630 |
+
def _first_nonnan(a, axis):
|
631 |
+
"""
|
632 |
+
Return the first non-nan value along the given axis.
|
633 |
+
|
634 |
+
If a slice is all nan, nan is returned for that slice.
|
635 |
+
|
636 |
+
The shape of the return value corresponds to ``keepdims=True``.
|
637 |
+
|
638 |
+
Examples
|
639 |
+
--------
|
640 |
+
>>> import numpy as np
|
641 |
+
>>> nan = np.nan
|
642 |
+
>>> a = np.array([[ 3., 3., nan, 3.],
|
643 |
+
[ 1., nan, 2., 4.],
|
644 |
+
[nan, nan, 9., -1.],
|
645 |
+
[nan, 5., 4., 3.],
|
646 |
+
[ 2., 2., 2., 2.],
|
647 |
+
[nan, nan, nan, nan]])
|
648 |
+
>>> _first_nonnan(a, axis=0)
|
649 |
+
array([[3., 3., 2., 3.]])
|
650 |
+
>>> _first_nonnan(a, axis=1)
|
651 |
+
array([[ 3.],
|
652 |
+
[ 1.],
|
653 |
+
[ 9.],
|
654 |
+
[ 5.],
|
655 |
+
[ 2.],
|
656 |
+
[nan]])
|
657 |
+
"""
|
658 |
+
k = _argmin(np.isnan(a), axis=axis, keepdims=True)
|
659 |
+
return np.take_along_axis(a, k, axis=axis)
|
660 |
+
|
661 |
+
|
662 |
+
def _nan_allsame(a, axis, keepdims=False):
|
663 |
+
"""
|
664 |
+
Determine if the values along an axis are all the same.
|
665 |
+
|
666 |
+
nan values are ignored.
|
667 |
+
|
668 |
+
`a` must be a numpy array.
|
669 |
+
|
670 |
+
`axis` is assumed to be normalized; that is, 0 <= axis < a.ndim.
|
671 |
+
|
672 |
+
For an axis of length 0, the result is True. That is, we adopt the
|
673 |
+
convention that ``allsame([])`` is True. (There are no values in the
|
674 |
+
input that are different.)
|
675 |
+
|
676 |
+
`True` is returned for slices that are all nan--not because all the
|
677 |
+
values are the same, but because this is equivalent to ``allsame([])``.
|
678 |
+
|
679 |
+
Examples
|
680 |
+
--------
|
681 |
+
>>> from numpy import nan, array
|
682 |
+
>>> a = array([[ 3., 3., nan, 3.],
|
683 |
+
... [ 1., nan, 2., 4.],
|
684 |
+
... [nan, nan, 9., -1.],
|
685 |
+
... [nan, 5., 4., 3.],
|
686 |
+
... [ 2., 2., 2., 2.],
|
687 |
+
... [nan, nan, nan, nan]])
|
688 |
+
>>> _nan_allsame(a, axis=1, keepdims=True)
|
689 |
+
array([[ True],
|
690 |
+
[False],
|
691 |
+
[False],
|
692 |
+
[False],
|
693 |
+
[ True],
|
694 |
+
[ True]])
|
695 |
+
"""
|
696 |
+
if axis is None:
|
697 |
+
if a.size == 0:
|
698 |
+
return True
|
699 |
+
a = a.ravel()
|
700 |
+
axis = 0
|
701 |
+
else:
|
702 |
+
shp = a.shape
|
703 |
+
if shp[axis] == 0:
|
704 |
+
shp = shp[:axis] + (1,)*keepdims + shp[axis + 1:]
|
705 |
+
return np.full(shp, fill_value=True, dtype=bool)
|
706 |
+
a0 = _first_nonnan(a, axis=axis)
|
707 |
+
return ((a0 == a) | np.isnan(a)).all(axis=axis, keepdims=keepdims)
|
708 |
+
|
709 |
+
|
710 |
+
def _contains_nan(a, nan_policy='propagate', policies=None, *, xp=None):
|
711 |
+
if xp is None:
|
712 |
+
xp = array_namespace(a)
|
713 |
+
not_numpy = not is_numpy(xp)
|
714 |
+
|
715 |
+
if policies is None:
|
716 |
+
policies = {'propagate', 'raise', 'omit'}
|
717 |
+
if nan_policy not in policies:
|
718 |
+
raise ValueError(f"nan_policy must be one of {set(policies)}.")
|
719 |
+
|
720 |
+
inexact = (xp.isdtype(a.dtype, "real floating")
|
721 |
+
or xp.isdtype(a.dtype, "complex floating"))
|
722 |
+
if xp_size(a) == 0:
|
723 |
+
contains_nan = False
|
724 |
+
elif inexact:
|
725 |
+
# Faster and less memory-intensive than xp.any(xp.isnan(a))
|
726 |
+
contains_nan = xp.isnan(xp.max(a))
|
727 |
+
elif is_numpy(xp) and np.issubdtype(a.dtype, object):
|
728 |
+
contains_nan = False
|
729 |
+
for el in a.ravel():
|
730 |
+
# isnan doesn't work on non-numeric elements
|
731 |
+
if np.issubdtype(type(el), np.number) and np.isnan(el):
|
732 |
+
contains_nan = True
|
733 |
+
break
|
734 |
+
else:
|
735 |
+
# Only `object` and `inexact` arrays can have NaNs
|
736 |
+
contains_nan = False
|
737 |
+
|
738 |
+
if contains_nan and nan_policy == 'raise':
|
739 |
+
raise ValueError("The input contains nan values")
|
740 |
+
|
741 |
+
if not_numpy and contains_nan and nan_policy=='omit':
|
742 |
+
message = "`nan_policy='omit' is incompatible with non-NumPy arrays."
|
743 |
+
raise ValueError(message)
|
744 |
+
|
745 |
+
return contains_nan, nan_policy
|
746 |
+
|
747 |
+
|
748 |
+
def _rename_parameter(old_name, new_name, dep_version=None):
|
749 |
+
"""
|
750 |
+
Generate decorator for backward-compatible keyword renaming.
|
751 |
+
|
752 |
+
Apply the decorator generated by `_rename_parameter` to functions with a
|
753 |
+
recently renamed parameter to maintain backward-compatibility.
|
754 |
+
|
755 |
+
After decoration, the function behaves as follows:
|
756 |
+
If only the new parameter is passed into the function, behave as usual.
|
757 |
+
If only the old parameter is passed into the function (as a keyword), raise
|
758 |
+
a DeprecationWarning if `dep_version` is provided, and behave as usual
|
759 |
+
otherwise.
|
760 |
+
If both old and new parameters are passed into the function, raise a
|
761 |
+
DeprecationWarning if `dep_version` is provided, and raise the appropriate
|
762 |
+
TypeError (function got multiple values for argument).
|
763 |
+
|
764 |
+
Parameters
|
765 |
+
----------
|
766 |
+
old_name : str
|
767 |
+
Old name of parameter
|
768 |
+
new_name : str
|
769 |
+
New name of parameter
|
770 |
+
dep_version : str, optional
|
771 |
+
Version of SciPy in which old parameter was deprecated in the format
|
772 |
+
'X.Y.Z'. If supplied, the deprecation message will indicate that
|
773 |
+
support for the old parameter will be removed in version 'X.Y+2.Z'
|
774 |
+
|
775 |
+
Notes
|
776 |
+
-----
|
777 |
+
Untested with functions that accept *args. Probably won't work as written.
|
778 |
+
|
779 |
+
"""
|
780 |
+
def decorator(fun):
|
781 |
+
@functools.wraps(fun)
|
782 |
+
def wrapper(*args, **kwargs):
|
783 |
+
if old_name in kwargs:
|
784 |
+
if dep_version:
|
785 |
+
end_version = dep_version.split('.')
|
786 |
+
end_version[1] = str(int(end_version[1]) + 2)
|
787 |
+
end_version = '.'.join(end_version)
|
788 |
+
message = (f"Use of keyword argument `{old_name}` is "
|
789 |
+
f"deprecated and replaced by `{new_name}`. "
|
790 |
+
f"Support for `{old_name}` will be removed "
|
791 |
+
f"in SciPy {end_version}.")
|
792 |
+
warnings.warn(message, DeprecationWarning, stacklevel=2)
|
793 |
+
if new_name in kwargs:
|
794 |
+
message = (f"{fun.__name__}() got multiple values for "
|
795 |
+
f"argument now known as `{new_name}`")
|
796 |
+
raise TypeError(message)
|
797 |
+
kwargs[new_name] = kwargs.pop(old_name)
|
798 |
+
return fun(*args, **kwargs)
|
799 |
+
return wrapper
|
800 |
+
return decorator
|
801 |
+
|
802 |
+
|
803 |
+
def _rng_spawn(rng, n_children):
|
804 |
+
# spawns independent RNGs from a parent RNG
|
805 |
+
bg = rng._bit_generator
|
806 |
+
ss = bg._seed_seq
|
807 |
+
child_rngs = [np.random.Generator(type(bg)(child_ss))
|
808 |
+
for child_ss in ss.spawn(n_children)]
|
809 |
+
return child_rngs
|
810 |
+
|
811 |
+
|
812 |
+
def _get_nan(*data, xp=None):
|
813 |
+
xp = array_namespace(*data) if xp is None else xp
|
814 |
+
# Get NaN of appropriate dtype for data
|
815 |
+
data = [xp.asarray(item) for item in data]
|
816 |
+
try:
|
817 |
+
min_float = getattr(xp, 'float16', xp.float32)
|
818 |
+
dtype = xp.result_type(*data, min_float) # must be at least a float
|
819 |
+
except DTypePromotionError:
|
820 |
+
# fallback to float64
|
821 |
+
dtype = xp.float64
|
822 |
+
return xp.asarray(xp.nan, dtype=dtype)[()]
|
823 |
+
|
824 |
+
|
825 |
+
def normalize_axis_index(axis, ndim):
|
826 |
+
# Check if `axis` is in the correct range and normalize it
|
827 |
+
if axis < -ndim or axis >= ndim:
|
828 |
+
msg = f"axis {axis} is out of bounds for array of dimension {ndim}"
|
829 |
+
raise AxisError(msg)
|
830 |
+
|
831 |
+
if axis < 0:
|
832 |
+
axis = axis + ndim
|
833 |
+
return axis
|
834 |
+
|
835 |
+
|
836 |
+
def _call_callback_maybe_halt(callback, res):
|
837 |
+
"""Call wrapped callback; return True if algorithm should stop.
|
838 |
+
|
839 |
+
Parameters
|
840 |
+
----------
|
841 |
+
callback : callable or None
|
842 |
+
A user-provided callback wrapped with `_wrap_callback`
|
843 |
+
res : OptimizeResult
|
844 |
+
Information about the current iterate
|
845 |
+
|
846 |
+
Returns
|
847 |
+
-------
|
848 |
+
halt : bool
|
849 |
+
True if minimization should stop
|
850 |
+
|
851 |
+
"""
|
852 |
+
if callback is None:
|
853 |
+
return False
|
854 |
+
try:
|
855 |
+
callback(res)
|
856 |
+
return False
|
857 |
+
except StopIteration:
|
858 |
+
callback.stop_iteration = True
|
859 |
+
return True
|
860 |
+
|
861 |
+
|
862 |
+
class _RichResult(dict):
|
863 |
+
""" Container for multiple outputs with pretty-printing """
|
864 |
+
def __getattr__(self, name):
|
865 |
+
try:
|
866 |
+
return self[name]
|
867 |
+
except KeyError as e:
|
868 |
+
raise AttributeError(name) from e
|
869 |
+
|
870 |
+
__setattr__ = dict.__setitem__ # type: ignore[assignment]
|
871 |
+
__delattr__ = dict.__delitem__ # type: ignore[assignment]
|
872 |
+
|
873 |
+
def __repr__(self):
|
874 |
+
order_keys = ['message', 'success', 'status', 'fun', 'funl', 'x', 'xl',
|
875 |
+
'col_ind', 'nit', 'lower', 'upper', 'eqlin', 'ineqlin',
|
876 |
+
'converged', 'flag', 'function_calls', 'iterations',
|
877 |
+
'root']
|
878 |
+
order_keys = getattr(self, '_order_keys', order_keys)
|
879 |
+
# 'slack', 'con' are redundant with residuals
|
880 |
+
# 'crossover_nit' is probably not interesting to most users
|
881 |
+
omit_keys = {'slack', 'con', 'crossover_nit', '_order_keys'}
|
882 |
+
|
883 |
+
def key(item):
|
884 |
+
try:
|
885 |
+
return order_keys.index(item[0].lower())
|
886 |
+
except ValueError: # item not in list
|
887 |
+
return np.inf
|
888 |
+
|
889 |
+
def omit_redundant(items):
|
890 |
+
for item in items:
|
891 |
+
if item[0] in omit_keys:
|
892 |
+
continue
|
893 |
+
yield item
|
894 |
+
|
895 |
+
def item_sorter(d):
|
896 |
+
return sorted(omit_redundant(d.items()), key=key)
|
897 |
+
|
898 |
+
if self.keys():
|
899 |
+
return _dict_formatter(self, sorter=item_sorter)
|
900 |
+
else:
|
901 |
+
return self.__class__.__name__ + "()"
|
902 |
+
|
903 |
+
def __dir__(self):
|
904 |
+
return list(self.keys())
|
905 |
+
|
906 |
+
|
907 |
+
def _indenter(s, n=0):
|
908 |
+
"""
|
909 |
+
Ensures that lines after the first are indented by the specified amount
|
910 |
+
"""
|
911 |
+
split = s.split("\n")
|
912 |
+
indent = " "*n
|
913 |
+
return ("\n" + indent).join(split)
|
914 |
+
|
915 |
+
|
916 |
+
def _float_formatter_10(x):
|
917 |
+
"""
|
918 |
+
Returns a string representation of a float with exactly ten characters
|
919 |
+
"""
|
920 |
+
if np.isposinf(x):
|
921 |
+
return " inf"
|
922 |
+
elif np.isneginf(x):
|
923 |
+
return " -inf"
|
924 |
+
elif np.isnan(x):
|
925 |
+
return " nan"
|
926 |
+
return np.format_float_scientific(x, precision=3, pad_left=2, unique=False)
|
927 |
+
|
928 |
+
|
929 |
+
def _dict_formatter(d, n=0, mplus=1, sorter=None):
|
930 |
+
"""
|
931 |
+
Pretty printer for dictionaries
|
932 |
+
|
933 |
+
`n` keeps track of the starting indentation;
|
934 |
+
lines are indented by this much after a line break.
|
935 |
+
`mplus` is additional left padding applied to keys
|
936 |
+
"""
|
937 |
+
if isinstance(d, dict):
|
938 |
+
m = max(map(len, list(d.keys()))) + mplus # width to print keys
|
939 |
+
s = '\n'.join([k.rjust(m) + ': ' + # right justified, width m
|
940 |
+
_indenter(_dict_formatter(v, m+n+2, 0, sorter), m+2)
|
941 |
+
for k, v in sorter(d)]) # +2 for ': '
|
942 |
+
else:
|
943 |
+
# By default, NumPy arrays print with linewidth=76. `n` is
|
944 |
+
# the indent at which a line begins printing, so it is subtracted
|
945 |
+
# from the default to avoid exceeding 76 characters total.
|
946 |
+
# `edgeitems` is the number of elements to include before and after
|
947 |
+
# ellipses when arrays are not shown in full.
|
948 |
+
# `threshold` is the maximum number of elements for which an
|
949 |
+
# array is shown in full.
|
950 |
+
# These values tend to work well for use with OptimizeResult.
|
951 |
+
with np.printoptions(linewidth=76-n, edgeitems=2, threshold=12,
|
952 |
+
formatter={'float_kind': _float_formatter_10}):
|
953 |
+
s = str(d)
|
954 |
+
return s
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/decorator.py
ADDED
@@ -0,0 +1,399 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
# ######################### LICENSE ############################ #
|
2 |
+
|
3 |
+
# Copyright (c) 2005-2015, Michele Simionato
|
4 |
+
# All rights reserved.
|
5 |
+
|
6 |
+
# Redistribution and use in source and binary forms, with or without
|
7 |
+
# modification, are permitted provided that the following conditions are
|
8 |
+
# met:
|
9 |
+
|
10 |
+
# Redistributions of source code must retain the above copyright
|
11 |
+
# notice, this list of conditions and the following disclaimer.
|
12 |
+
# Redistributions in bytecode form must reproduce the above copyright
|
13 |
+
# notice, this list of conditions and the following disclaimer in
|
14 |
+
# the documentation and/or other materials provided with the
|
15 |
+
# distribution.
|
16 |
+
|
17 |
+
# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
|
18 |
+
# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
|
19 |
+
# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
|
20 |
+
# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
|
21 |
+
# HOLDERS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
|
22 |
+
# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
|
23 |
+
# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS
|
24 |
+
# OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
|
25 |
+
# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR
|
26 |
+
# TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE
|
27 |
+
# USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH
|
28 |
+
# DAMAGE.
|
29 |
+
|
30 |
+
"""
|
31 |
+
Decorator module, see https://pypi.python.org/pypi/decorator
|
32 |
+
for the documentation.
|
33 |
+
"""
|
34 |
+
import re
|
35 |
+
import sys
|
36 |
+
import inspect
|
37 |
+
import operator
|
38 |
+
import itertools
|
39 |
+
import collections
|
40 |
+
|
41 |
+
from inspect import getfullargspec
|
42 |
+
|
43 |
+
__version__ = '4.0.5'
|
44 |
+
|
45 |
+
|
46 |
+
def get_init(cls):
|
47 |
+
return cls.__init__
|
48 |
+
|
49 |
+
|
50 |
+
# getargspec has been deprecated in Python 3.5
|
51 |
+
ArgSpec = collections.namedtuple(
|
52 |
+
'ArgSpec', 'args varargs varkw defaults')
|
53 |
+
|
54 |
+
|
55 |
+
def getargspec(f):
|
56 |
+
"""A replacement for inspect.getargspec"""
|
57 |
+
spec = getfullargspec(f)
|
58 |
+
return ArgSpec(spec.args, spec.varargs, spec.varkw, spec.defaults)
|
59 |
+
|
60 |
+
|
61 |
+
DEF = re.compile(r'\s*def\s*([_\w][_\w\d]*)\s*\(')
|
62 |
+
|
63 |
+
|
64 |
+
# basic functionality
|
65 |
+
class FunctionMaker:
|
66 |
+
"""
|
67 |
+
An object with the ability to create functions with a given signature.
|
68 |
+
It has attributes name, doc, module, signature, defaults, dict, and
|
69 |
+
methods update and make.
|
70 |
+
"""
|
71 |
+
|
72 |
+
# Atomic get-and-increment provided by the GIL
|
73 |
+
_compile_count = itertools.count()
|
74 |
+
|
75 |
+
def __init__(self, func=None, name=None, signature=None,
|
76 |
+
defaults=None, doc=None, module=None, funcdict=None):
|
77 |
+
self.shortsignature = signature
|
78 |
+
if func:
|
79 |
+
# func can be a class or a callable, but not an instance method
|
80 |
+
self.name = func.__name__
|
81 |
+
if self.name == '<lambda>': # small hack for lambda functions
|
82 |
+
self.name = '_lambda_'
|
83 |
+
self.doc = func.__doc__
|
84 |
+
self.module = func.__module__
|
85 |
+
if inspect.isfunction(func):
|
86 |
+
argspec = getfullargspec(func)
|
87 |
+
self.annotations = getattr(func, '__annotations__', {})
|
88 |
+
for a in ('args', 'varargs', 'varkw', 'defaults', 'kwonlyargs',
|
89 |
+
'kwonlydefaults'):
|
90 |
+
setattr(self, a, getattr(argspec, a))
|
91 |
+
for i, arg in enumerate(self.args):
|
92 |
+
setattr(self, 'arg%d' % i, arg)
|
93 |
+
allargs = list(self.args)
|
94 |
+
allshortargs = list(self.args)
|
95 |
+
if self.varargs:
|
96 |
+
allargs.append('*' + self.varargs)
|
97 |
+
allshortargs.append('*' + self.varargs)
|
98 |
+
elif self.kwonlyargs:
|
99 |
+
allargs.append('*') # single star syntax
|
100 |
+
for a in self.kwonlyargs:
|
101 |
+
allargs.append('%s=None' % a)
|
102 |
+
allshortargs.append(f'{a}={a}')
|
103 |
+
if self.varkw:
|
104 |
+
allargs.append('**' + self.varkw)
|
105 |
+
allshortargs.append('**' + self.varkw)
|
106 |
+
self.signature = ', '.join(allargs)
|
107 |
+
self.shortsignature = ', '.join(allshortargs)
|
108 |
+
self.dict = func.__dict__.copy()
|
109 |
+
# func=None happens when decorating a caller
|
110 |
+
if name:
|
111 |
+
self.name = name
|
112 |
+
if signature is not None:
|
113 |
+
self.signature = signature
|
114 |
+
if defaults:
|
115 |
+
self.defaults = defaults
|
116 |
+
if doc:
|
117 |
+
self.doc = doc
|
118 |
+
if module:
|
119 |
+
self.module = module
|
120 |
+
if funcdict:
|
121 |
+
self.dict = funcdict
|
122 |
+
# check existence required attributes
|
123 |
+
assert hasattr(self, 'name')
|
124 |
+
if not hasattr(self, 'signature'):
|
125 |
+
raise TypeError('You are decorating a non-function: %s' % func)
|
126 |
+
|
127 |
+
def update(self, func, **kw):
|
128 |
+
"Update the signature of func with the data in self"
|
129 |
+
func.__name__ = self.name
|
130 |
+
func.__doc__ = getattr(self, 'doc', None)
|
131 |
+
func.__dict__ = getattr(self, 'dict', {})
|
132 |
+
func.__defaults__ = getattr(self, 'defaults', ())
|
133 |
+
func.__kwdefaults__ = getattr(self, 'kwonlydefaults', None)
|
134 |
+
func.__annotations__ = getattr(self, 'annotations', None)
|
135 |
+
try:
|
136 |
+
frame = sys._getframe(3)
|
137 |
+
except AttributeError: # for IronPython and similar implementations
|
138 |
+
callermodule = '?'
|
139 |
+
else:
|
140 |
+
callermodule = frame.f_globals.get('__name__', '?')
|
141 |
+
func.__module__ = getattr(self, 'module', callermodule)
|
142 |
+
func.__dict__.update(kw)
|
143 |
+
|
144 |
+
def make(self, src_templ, evaldict=None, addsource=False, **attrs):
|
145 |
+
"Make a new function from a given template and update the signature"
|
146 |
+
src = src_templ % vars(self) # expand name and signature
|
147 |
+
evaldict = evaldict or {}
|
148 |
+
mo = DEF.match(src)
|
149 |
+
if mo is None:
|
150 |
+
raise SyntaxError('not a valid function template\n%s' % src)
|
151 |
+
name = mo.group(1) # extract the function name
|
152 |
+
names = set([name] + [arg.strip(' *') for arg in
|
153 |
+
self.shortsignature.split(',')])
|
154 |
+
for n in names:
|
155 |
+
if n in ('_func_', '_call_'):
|
156 |
+
raise NameError(f'{n} is overridden in\n{src}')
|
157 |
+
if not src.endswith('\n'): # add a newline just for safety
|
158 |
+
src += '\n' # this is needed in old versions of Python
|
159 |
+
|
160 |
+
# Ensure each generated function has a unique filename for profilers
|
161 |
+
# (such as cProfile) that depend on the tuple of (<filename>,
|
162 |
+
# <definition line>, <function name>) being unique.
|
163 |
+
filename = '<decorator-gen-%d>' % (next(self._compile_count),)
|
164 |
+
try:
|
165 |
+
code = compile(src, filename, 'single')
|
166 |
+
exec(code, evaldict)
|
167 |
+
except: # noqa: E722
|
168 |
+
print('Error in generated code:', file=sys.stderr)
|
169 |
+
print(src, file=sys.stderr)
|
170 |
+
raise
|
171 |
+
func = evaldict[name]
|
172 |
+
if addsource:
|
173 |
+
attrs['__source__'] = src
|
174 |
+
self.update(func, **attrs)
|
175 |
+
return func
|
176 |
+
|
177 |
+
@classmethod
|
178 |
+
def create(cls, obj, body, evaldict, defaults=None,
|
179 |
+
doc=None, module=None, addsource=True, **attrs):
|
180 |
+
"""
|
181 |
+
Create a function from the strings name, signature, and body.
|
182 |
+
evaldict is the evaluation dictionary. If addsource is true, an
|
183 |
+
attribute __source__ is added to the result. The attributes attrs
|
184 |
+
are added, if any.
|
185 |
+
"""
|
186 |
+
if isinstance(obj, str): # "name(signature)"
|
187 |
+
name, rest = obj.strip().split('(', 1)
|
188 |
+
signature = rest[:-1] # strip a right parens
|
189 |
+
func = None
|
190 |
+
else: # a function
|
191 |
+
name = None
|
192 |
+
signature = None
|
193 |
+
func = obj
|
194 |
+
self = cls(func, name, signature, defaults, doc, module)
|
195 |
+
ibody = '\n'.join(' ' + line for line in body.splitlines())
|
196 |
+
return self.make('def %(name)s(%(signature)s):\n' + ibody,
|
197 |
+
evaldict, addsource, **attrs)
|
198 |
+
|
199 |
+
|
200 |
+
def decorate(func, caller):
|
201 |
+
"""
|
202 |
+
decorate(func, caller) decorates a function using a caller.
|
203 |
+
"""
|
204 |
+
evaldict = func.__globals__.copy()
|
205 |
+
evaldict['_call_'] = caller
|
206 |
+
evaldict['_func_'] = func
|
207 |
+
fun = FunctionMaker.create(
|
208 |
+
func, "return _call_(_func_, %(shortsignature)s)",
|
209 |
+
evaldict, __wrapped__=func)
|
210 |
+
if hasattr(func, '__qualname__'):
|
211 |
+
fun.__qualname__ = func.__qualname__
|
212 |
+
return fun
|
213 |
+
|
214 |
+
|
215 |
+
def decorator(caller, _func=None):
|
216 |
+
"""decorator(caller) converts a caller function into a decorator"""
|
217 |
+
if _func is not None: # return a decorated function
|
218 |
+
# this is obsolete behavior; you should use decorate instead
|
219 |
+
return decorate(_func, caller)
|
220 |
+
# else return a decorator function
|
221 |
+
if inspect.isclass(caller):
|
222 |
+
name = caller.__name__.lower()
|
223 |
+
callerfunc = get_init(caller)
|
224 |
+
doc = (f'decorator({caller.__name__}) converts functions/generators into '
|
225 |
+
f'factories of {caller.__name__} objects')
|
226 |
+
elif inspect.isfunction(caller):
|
227 |
+
if caller.__name__ == '<lambda>':
|
228 |
+
name = '_lambda_'
|
229 |
+
else:
|
230 |
+
name = caller.__name__
|
231 |
+
callerfunc = caller
|
232 |
+
doc = caller.__doc__
|
233 |
+
else: # assume caller is an object with a __call__ method
|
234 |
+
name = caller.__class__.__name__.lower()
|
235 |
+
callerfunc = caller.__call__.__func__
|
236 |
+
doc = caller.__call__.__doc__
|
237 |
+
evaldict = callerfunc.__globals__.copy()
|
238 |
+
evaldict['_call_'] = caller
|
239 |
+
evaldict['_decorate_'] = decorate
|
240 |
+
return FunctionMaker.create(
|
241 |
+
'%s(func)' % name, 'return _decorate_(func, _call_)',
|
242 |
+
evaldict, doc=doc, module=caller.__module__,
|
243 |
+
__wrapped__=caller)
|
244 |
+
|
245 |
+
|
246 |
+
# ####################### contextmanager ####################### #
|
247 |
+
|
248 |
+
try: # Python >= 3.2
|
249 |
+
from contextlib import _GeneratorContextManager
|
250 |
+
except ImportError: # Python >= 2.5
|
251 |
+
from contextlib import GeneratorContextManager as _GeneratorContextManager
|
252 |
+
|
253 |
+
|
254 |
+
class ContextManager(_GeneratorContextManager):
|
255 |
+
def __call__(self, func):
|
256 |
+
"""Context manager decorator"""
|
257 |
+
return FunctionMaker.create(
|
258 |
+
func, "with _self_: return _func_(%(shortsignature)s)",
|
259 |
+
dict(_self_=self, _func_=func), __wrapped__=func)
|
260 |
+
|
261 |
+
|
262 |
+
init = getfullargspec(_GeneratorContextManager.__init__)
|
263 |
+
n_args = len(init.args)
|
264 |
+
if n_args == 2 and not init.varargs: # (self, genobj) Python 2.7
|
265 |
+
def __init__(self, g, *a, **k):
|
266 |
+
return _GeneratorContextManager.__init__(self, g(*a, **k))
|
267 |
+
ContextManager.__init__ = __init__
|
268 |
+
elif n_args == 2 and init.varargs: # (self, gen, *a, **k) Python 3.4
|
269 |
+
pass
|
270 |
+
elif n_args == 4: # (self, gen, args, kwds) Python 3.5
|
271 |
+
def __init__(self, g, *a, **k):
|
272 |
+
return _GeneratorContextManager.__init__(self, g, a, k)
|
273 |
+
ContextManager.__init__ = __init__
|
274 |
+
|
275 |
+
contextmanager = decorator(ContextManager)
|
276 |
+
|
277 |
+
|
278 |
+
# ############################ dispatch_on ############################ #
|
279 |
+
|
280 |
+
def append(a, vancestors):
|
281 |
+
"""
|
282 |
+
Append ``a`` to the list of the virtual ancestors, unless it is already
|
283 |
+
included.
|
284 |
+
"""
|
285 |
+
add = True
|
286 |
+
for j, va in enumerate(vancestors):
|
287 |
+
if issubclass(va, a):
|
288 |
+
add = False
|
289 |
+
break
|
290 |
+
if issubclass(a, va):
|
291 |
+
vancestors[j] = a
|
292 |
+
add = False
|
293 |
+
if add:
|
294 |
+
vancestors.append(a)
|
295 |
+
|
296 |
+
|
297 |
+
# inspired from simplegeneric by P.J. Eby and functools.singledispatch
|
298 |
+
def dispatch_on(*dispatch_args):
|
299 |
+
"""
|
300 |
+
Factory of decorators turning a function into a generic function
|
301 |
+
dispatching on the given arguments.
|
302 |
+
"""
|
303 |
+
assert dispatch_args, 'No dispatch args passed'
|
304 |
+
dispatch_str = '(%s,)' % ', '.join(dispatch_args)
|
305 |
+
|
306 |
+
def check(arguments, wrong=operator.ne, msg=''):
|
307 |
+
"""Make sure one passes the expected number of arguments"""
|
308 |
+
if wrong(len(arguments), len(dispatch_args)):
|
309 |
+
raise TypeError('Expected %d arguments, got %d%s' %
|
310 |
+
(len(dispatch_args), len(arguments), msg))
|
311 |
+
|
312 |
+
def gen_func_dec(func):
|
313 |
+
"""Decorator turning a function into a generic function"""
|
314 |
+
|
315 |
+
# first check the dispatch arguments
|
316 |
+
argset = set(getfullargspec(func).args)
|
317 |
+
if not set(dispatch_args) <= argset:
|
318 |
+
raise NameError('Unknown dispatch arguments %s' % dispatch_str)
|
319 |
+
|
320 |
+
typemap = {}
|
321 |
+
|
322 |
+
def vancestors(*types):
|
323 |
+
"""
|
324 |
+
Get a list of sets of virtual ancestors for the given types
|
325 |
+
"""
|
326 |
+
check(types)
|
327 |
+
ras = [[] for _ in range(len(dispatch_args))]
|
328 |
+
for types_ in typemap:
|
329 |
+
for t, type_, ra in zip(types, types_, ras):
|
330 |
+
if issubclass(t, type_) and type_ not in t.__mro__:
|
331 |
+
append(type_, ra)
|
332 |
+
return [set(ra) for ra in ras]
|
333 |
+
|
334 |
+
def ancestors(*types):
|
335 |
+
"""
|
336 |
+
Get a list of virtual MROs, one for each type
|
337 |
+
"""
|
338 |
+
check(types)
|
339 |
+
lists = []
|
340 |
+
for t, vas in zip(types, vancestors(*types)):
|
341 |
+
n_vas = len(vas)
|
342 |
+
if n_vas > 1:
|
343 |
+
raise RuntimeError(
|
344 |
+
f'Ambiguous dispatch for {t}: {vas}')
|
345 |
+
elif n_vas == 1:
|
346 |
+
va, = vas
|
347 |
+
mro = type('t', (t, va), {}).__mro__[1:]
|
348 |
+
else:
|
349 |
+
mro = t.__mro__
|
350 |
+
lists.append(mro[:-1]) # discard t and object
|
351 |
+
return lists
|
352 |
+
|
353 |
+
def register(*types):
|
354 |
+
"""
|
355 |
+
Decorator to register an implementation for the given types
|
356 |
+
"""
|
357 |
+
check(types)
|
358 |
+
|
359 |
+
def dec(f):
|
360 |
+
check(getfullargspec(f).args, operator.lt, ' in ' + f.__name__)
|
361 |
+
typemap[types] = f
|
362 |
+
return f
|
363 |
+
return dec
|
364 |
+
|
365 |
+
def dispatch_info(*types):
|
366 |
+
"""
|
367 |
+
An utility to introspect the dispatch algorithm
|
368 |
+
"""
|
369 |
+
check(types)
|
370 |
+
lst = [tuple(a.__name__ for a in anc)
|
371 |
+
for anc in itertools.product(*ancestors(*types))]
|
372 |
+
return lst
|
373 |
+
|
374 |
+
def _dispatch(dispatch_args, *args, **kw):
|
375 |
+
types = tuple(type(arg) for arg in dispatch_args)
|
376 |
+
try: # fast path
|
377 |
+
f = typemap[types]
|
378 |
+
except KeyError:
|
379 |
+
pass
|
380 |
+
else:
|
381 |
+
return f(*args, **kw)
|
382 |
+
combinations = itertools.product(*ancestors(*types))
|
383 |
+
next(combinations) # the first one has been already tried
|
384 |
+
for types_ in combinations:
|
385 |
+
f = typemap.get(types_)
|
386 |
+
if f is not None:
|
387 |
+
return f(*args, **kw)
|
388 |
+
|
389 |
+
# else call the default implementation
|
390 |
+
return func(*args, **kw)
|
391 |
+
|
392 |
+
return FunctionMaker.create(
|
393 |
+
func, 'return _f_(%s, %%(shortsignature)s)' % dispatch_str,
|
394 |
+
dict(_f_=_dispatch), register=register, default=func,
|
395 |
+
typemap=typemap, vancestors=vancestors, ancestors=ancestors,
|
396 |
+
dispatch_info=dispatch_info, __wrapped__=func)
|
397 |
+
|
398 |
+
gen_func_dec.__name__ = 'dispatch_on' + dispatch_str
|
399 |
+
return gen_func_dec
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/deprecation.py
ADDED
@@ -0,0 +1,239 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
from inspect import Parameter, signature
|
2 |
+
import functools
|
3 |
+
import warnings
|
4 |
+
from importlib import import_module
|
5 |
+
|
6 |
+
|
7 |
+
__all__ = ["_deprecated"]
|
8 |
+
|
9 |
+
|
10 |
+
# Object to use as default value for arguments to be deprecated. This should
|
11 |
+
# be used over 'None' as the user could parse 'None' as a positional argument
|
12 |
+
_NoValue = object()
|
13 |
+
|
14 |
+
def _sub_module_deprecation(*, sub_package, module, private_modules, all,
|
15 |
+
attribute, correct_module=None):
|
16 |
+
"""Helper function for deprecating modules that are public but were
|
17 |
+
intended to be private.
|
18 |
+
|
19 |
+
Parameters
|
20 |
+
----------
|
21 |
+
sub_package : str
|
22 |
+
Subpackage the module belongs to eg. stats
|
23 |
+
module : str
|
24 |
+
Public but intended private module to deprecate
|
25 |
+
private_modules : list
|
26 |
+
Private replacement(s) for `module`; should contain the
|
27 |
+
content of ``all``, possibly spread over several modules.
|
28 |
+
all : list
|
29 |
+
``__all__`` belonging to `module`
|
30 |
+
attribute : str
|
31 |
+
The attribute in `module` being accessed
|
32 |
+
correct_module : str, optional
|
33 |
+
Module in `sub_package` that `attribute` should be imported from.
|
34 |
+
Default is that `attribute` should be imported from ``scipy.sub_package``.
|
35 |
+
"""
|
36 |
+
if correct_module is not None:
|
37 |
+
correct_import = f"scipy.{sub_package}.{correct_module}"
|
38 |
+
else:
|
39 |
+
correct_import = f"scipy.{sub_package}"
|
40 |
+
|
41 |
+
if attribute not in all:
|
42 |
+
raise AttributeError(
|
43 |
+
f"`scipy.{sub_package}.{module}` has no attribute `{attribute}`; "
|
44 |
+
f"furthermore, `scipy.{sub_package}.{module}` is deprecated "
|
45 |
+
f"and will be removed in SciPy 2.0.0."
|
46 |
+
)
|
47 |
+
|
48 |
+
attr = getattr(import_module(correct_import), attribute, None)
|
49 |
+
|
50 |
+
if attr is not None:
|
51 |
+
message = (
|
52 |
+
f"Please import `{attribute}` from the `{correct_import}` namespace; "
|
53 |
+
f"the `scipy.{sub_package}.{module}` namespace is deprecated "
|
54 |
+
f"and will be removed in SciPy 2.0.0."
|
55 |
+
)
|
56 |
+
else:
|
57 |
+
message = (
|
58 |
+
f"`scipy.{sub_package}.{module}.{attribute}` is deprecated along with "
|
59 |
+
f"the `scipy.{sub_package}.{module}` namespace. "
|
60 |
+
f"`scipy.{sub_package}.{module}.{attribute}` will be removed "
|
61 |
+
f"in SciPy 1.14.0, and the `scipy.{sub_package}.{module}` namespace "
|
62 |
+
f"will be removed in SciPy 2.0.0."
|
63 |
+
)
|
64 |
+
|
65 |
+
warnings.warn(message, category=DeprecationWarning, stacklevel=3)
|
66 |
+
|
67 |
+
for module in private_modules:
|
68 |
+
try:
|
69 |
+
return getattr(import_module(f"scipy.{sub_package}.{module}"), attribute)
|
70 |
+
except AttributeError as e:
|
71 |
+
# still raise an error if the attribute isn't in any of the expected
|
72 |
+
# private modules
|
73 |
+
if module == private_modules[-1]:
|
74 |
+
raise e
|
75 |
+
continue
|
76 |
+
|
77 |
+
|
78 |
+
def _deprecated(msg, stacklevel=2):
|
79 |
+
"""Deprecate a function by emitting a warning on use."""
|
80 |
+
def wrap(fun):
|
81 |
+
if isinstance(fun, type):
|
82 |
+
warnings.warn(
|
83 |
+
f"Trying to deprecate class {fun!r}",
|
84 |
+
category=RuntimeWarning, stacklevel=2)
|
85 |
+
return fun
|
86 |
+
|
87 |
+
@functools.wraps(fun)
|
88 |
+
def call(*args, **kwargs):
|
89 |
+
warnings.warn(msg, category=DeprecationWarning,
|
90 |
+
stacklevel=stacklevel)
|
91 |
+
return fun(*args, **kwargs)
|
92 |
+
call.__doc__ = fun.__doc__
|
93 |
+
return call
|
94 |
+
|
95 |
+
return wrap
|
96 |
+
|
97 |
+
|
98 |
+
class _DeprecationHelperStr:
|
99 |
+
"""
|
100 |
+
Helper class used by deprecate_cython_api
|
101 |
+
"""
|
102 |
+
def __init__(self, content, message):
|
103 |
+
self._content = content
|
104 |
+
self._message = message
|
105 |
+
|
106 |
+
def __hash__(self):
|
107 |
+
return hash(self._content)
|
108 |
+
|
109 |
+
def __eq__(self, other):
|
110 |
+
res = (self._content == other)
|
111 |
+
if res:
|
112 |
+
warnings.warn(self._message, category=DeprecationWarning,
|
113 |
+
stacklevel=2)
|
114 |
+
return res
|
115 |
+
|
116 |
+
|
117 |
+
def deprecate_cython_api(module, routine_name, new_name=None, message=None):
|
118 |
+
"""
|
119 |
+
Deprecate an exported cdef function in a public Cython API module.
|
120 |
+
|
121 |
+
Only functions can be deprecated; typedefs etc. cannot.
|
122 |
+
|
123 |
+
Parameters
|
124 |
+
----------
|
125 |
+
module : module
|
126 |
+
Public Cython API module (e.g. scipy.linalg.cython_blas).
|
127 |
+
routine_name : str
|
128 |
+
Name of the routine to deprecate. May also be a fused-type
|
129 |
+
routine (in which case its all specializations are deprecated).
|
130 |
+
new_name : str
|
131 |
+
New name to include in the deprecation warning message
|
132 |
+
message : str
|
133 |
+
Additional text in the deprecation warning message
|
134 |
+
|
135 |
+
Examples
|
136 |
+
--------
|
137 |
+
Usually, this function would be used in the top-level of the
|
138 |
+
module ``.pyx`` file:
|
139 |
+
|
140 |
+
>>> from scipy._lib.deprecation import deprecate_cython_api
|
141 |
+
>>> import scipy.linalg.cython_blas as mod
|
142 |
+
>>> deprecate_cython_api(mod, "dgemm", "dgemm_new",
|
143 |
+
... message="Deprecated in Scipy 1.5.0")
|
144 |
+
>>> del deprecate_cython_api, mod
|
145 |
+
|
146 |
+
After this, Cython modules that use the deprecated function emit a
|
147 |
+
deprecation warning when they are imported.
|
148 |
+
|
149 |
+
"""
|
150 |
+
old_name = f"{module.__name__}.{routine_name}"
|
151 |
+
|
152 |
+
if new_name is None:
|
153 |
+
depdoc = "`%s` is deprecated!" % old_name
|
154 |
+
else:
|
155 |
+
depdoc = f"`{old_name}` is deprecated, use `{new_name}` instead!"
|
156 |
+
|
157 |
+
if message is not None:
|
158 |
+
depdoc += "\n" + message
|
159 |
+
|
160 |
+
d = module.__pyx_capi__
|
161 |
+
|
162 |
+
# Check if the function is a fused-type function with a mangled name
|
163 |
+
j = 0
|
164 |
+
has_fused = False
|
165 |
+
while True:
|
166 |
+
fused_name = f"__pyx_fuse_{j}{routine_name}"
|
167 |
+
if fused_name in d:
|
168 |
+
has_fused = True
|
169 |
+
d[_DeprecationHelperStr(fused_name, depdoc)] = d.pop(fused_name)
|
170 |
+
j += 1
|
171 |
+
else:
|
172 |
+
break
|
173 |
+
|
174 |
+
# If not, apply deprecation to the named routine
|
175 |
+
if not has_fused:
|
176 |
+
d[_DeprecationHelperStr(routine_name, depdoc)] = d.pop(routine_name)
|
177 |
+
|
178 |
+
|
179 |
+
# taken from scikit-learn, see
|
180 |
+
# https://github.com/scikit-learn/scikit-learn/blob/1.3.0/sklearn/utils/validation.py#L38
|
181 |
+
def _deprecate_positional_args(func=None, *, version=None):
|
182 |
+
"""Decorator for methods that issues warnings for positional arguments.
|
183 |
+
|
184 |
+
Using the keyword-only argument syntax in pep 3102, arguments after the
|
185 |
+
* will issue a warning when passed as a positional argument.
|
186 |
+
|
187 |
+
Parameters
|
188 |
+
----------
|
189 |
+
func : callable, default=None
|
190 |
+
Function to check arguments on.
|
191 |
+
version : callable, default=None
|
192 |
+
The version when positional arguments will result in error.
|
193 |
+
"""
|
194 |
+
if version is None:
|
195 |
+
msg = "Need to specify a version where signature will be changed"
|
196 |
+
raise ValueError(msg)
|
197 |
+
|
198 |
+
def _inner_deprecate_positional_args(f):
|
199 |
+
sig = signature(f)
|
200 |
+
kwonly_args = []
|
201 |
+
all_args = []
|
202 |
+
|
203 |
+
for name, param in sig.parameters.items():
|
204 |
+
if param.kind == Parameter.POSITIONAL_OR_KEYWORD:
|
205 |
+
all_args.append(name)
|
206 |
+
elif param.kind == Parameter.KEYWORD_ONLY:
|
207 |
+
kwonly_args.append(name)
|
208 |
+
|
209 |
+
@functools.wraps(f)
|
210 |
+
def inner_f(*args, **kwargs):
|
211 |
+
extra_args = len(args) - len(all_args)
|
212 |
+
if extra_args <= 0:
|
213 |
+
return f(*args, **kwargs)
|
214 |
+
|
215 |
+
# extra_args > 0
|
216 |
+
args_msg = [
|
217 |
+
f"{name}={arg}"
|
218 |
+
for name, arg in zip(kwonly_args[:extra_args], args[-extra_args:])
|
219 |
+
]
|
220 |
+
args_msg = ", ".join(args_msg)
|
221 |
+
warnings.warn(
|
222 |
+
(
|
223 |
+
f"You are passing {args_msg} as a positional argument. "
|
224 |
+
"Please change your invocation to use keyword arguments. "
|
225 |
+
f"From SciPy {version}, passing these as positional "
|
226 |
+
"arguments will result in an error."
|
227 |
+
),
|
228 |
+
DeprecationWarning,
|
229 |
+
stacklevel=2,
|
230 |
+
)
|
231 |
+
kwargs.update(zip(sig.parameters, args))
|
232 |
+
return f(**kwargs)
|
233 |
+
|
234 |
+
return inner_f
|
235 |
+
|
236 |
+
if func is not None:
|
237 |
+
return _inner_deprecate_positional_args(func)
|
238 |
+
|
239 |
+
return _inner_deprecate_positional_args
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/doccer.py
ADDED
@@ -0,0 +1,275 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
''' Utilities to allow inserting docstring fragments for common
|
2 |
+
parameters into function and method docstrings'''
|
3 |
+
|
4 |
+
import sys
|
5 |
+
|
6 |
+
__all__ = [
|
7 |
+
'docformat', 'inherit_docstring_from', 'indentcount_lines',
|
8 |
+
'filldoc', 'unindent_dict', 'unindent_string', 'extend_notes_in_docstring',
|
9 |
+
'replace_notes_in_docstring', 'doc_replace'
|
10 |
+
]
|
11 |
+
|
12 |
+
|
13 |
+
def docformat(docstring, docdict=None):
|
14 |
+
''' Fill a function docstring from variables in dictionary
|
15 |
+
|
16 |
+
Adapt the indent of the inserted docs
|
17 |
+
|
18 |
+
Parameters
|
19 |
+
----------
|
20 |
+
docstring : string
|
21 |
+
docstring from function, possibly with dict formatting strings
|
22 |
+
docdict : dict, optional
|
23 |
+
dictionary with keys that match the dict formatting strings
|
24 |
+
and values that are docstring fragments to be inserted. The
|
25 |
+
indentation of the inserted docstrings is set to match the
|
26 |
+
minimum indentation of the ``docstring`` by adding this
|
27 |
+
indentation to all lines of the inserted string, except the
|
28 |
+
first.
|
29 |
+
|
30 |
+
Returns
|
31 |
+
-------
|
32 |
+
outstring : string
|
33 |
+
string with requested ``docdict`` strings inserted
|
34 |
+
|
35 |
+
Examples
|
36 |
+
--------
|
37 |
+
>>> docformat(' Test string with %(value)s', {'value':'inserted value'})
|
38 |
+
' Test string with inserted value'
|
39 |
+
>>> docstring = 'First line\\n Second line\\n %(value)s'
|
40 |
+
>>> inserted_string = "indented\\nstring"
|
41 |
+
>>> docdict = {'value': inserted_string}
|
42 |
+
>>> docformat(docstring, docdict)
|
43 |
+
'First line\\n Second line\\n indented\\n string'
|
44 |
+
'''
|
45 |
+
if not docstring:
|
46 |
+
return docstring
|
47 |
+
if docdict is None:
|
48 |
+
docdict = {}
|
49 |
+
if not docdict:
|
50 |
+
return docstring
|
51 |
+
lines = docstring.expandtabs().splitlines()
|
52 |
+
# Find the minimum indent of the main docstring, after first line
|
53 |
+
if len(lines) < 2:
|
54 |
+
icount = 0
|
55 |
+
else:
|
56 |
+
icount = indentcount_lines(lines[1:])
|
57 |
+
indent = ' ' * icount
|
58 |
+
# Insert this indent to dictionary docstrings
|
59 |
+
indented = {}
|
60 |
+
for name, dstr in docdict.items():
|
61 |
+
lines = dstr.expandtabs().splitlines()
|
62 |
+
try:
|
63 |
+
newlines = [lines[0]]
|
64 |
+
for line in lines[1:]:
|
65 |
+
newlines.append(indent+line)
|
66 |
+
indented[name] = '\n'.join(newlines)
|
67 |
+
except IndexError:
|
68 |
+
indented[name] = dstr
|
69 |
+
return docstring % indented
|
70 |
+
|
71 |
+
|
72 |
+
def inherit_docstring_from(cls):
|
73 |
+
"""
|
74 |
+
This decorator modifies the decorated function's docstring by
|
75 |
+
replacing occurrences of '%(super)s' with the docstring of the
|
76 |
+
method of the same name from the class `cls`.
|
77 |
+
|
78 |
+
If the decorated method has no docstring, it is simply given the
|
79 |
+
docstring of `cls`s method.
|
80 |
+
|
81 |
+
Parameters
|
82 |
+
----------
|
83 |
+
cls : Python class or instance
|
84 |
+
A class with a method with the same name as the decorated method.
|
85 |
+
The docstring of the method in this class replaces '%(super)s' in the
|
86 |
+
docstring of the decorated method.
|
87 |
+
|
88 |
+
Returns
|
89 |
+
-------
|
90 |
+
f : function
|
91 |
+
The decorator function that modifies the __doc__ attribute
|
92 |
+
of its argument.
|
93 |
+
|
94 |
+
Examples
|
95 |
+
--------
|
96 |
+
In the following, the docstring for Bar.func created using the
|
97 |
+
docstring of `Foo.func`.
|
98 |
+
|
99 |
+
>>> class Foo:
|
100 |
+
... def func(self):
|
101 |
+
... '''Do something useful.'''
|
102 |
+
... return
|
103 |
+
...
|
104 |
+
>>> class Bar(Foo):
|
105 |
+
... @inherit_docstring_from(Foo)
|
106 |
+
... def func(self):
|
107 |
+
... '''%(super)s
|
108 |
+
... Do it fast.
|
109 |
+
... '''
|
110 |
+
... return
|
111 |
+
...
|
112 |
+
>>> b = Bar()
|
113 |
+
>>> b.func.__doc__
|
114 |
+
'Do something useful.\n Do it fast.\n '
|
115 |
+
|
116 |
+
"""
|
117 |
+
def _doc(func):
|
118 |
+
cls_docstring = getattr(cls, func.__name__).__doc__
|
119 |
+
func_docstring = func.__doc__
|
120 |
+
if func_docstring is None:
|
121 |
+
func.__doc__ = cls_docstring
|
122 |
+
else:
|
123 |
+
new_docstring = func_docstring % dict(super=cls_docstring)
|
124 |
+
func.__doc__ = new_docstring
|
125 |
+
return func
|
126 |
+
return _doc
|
127 |
+
|
128 |
+
|
129 |
+
def extend_notes_in_docstring(cls, notes):
|
130 |
+
"""
|
131 |
+
This decorator replaces the decorated function's docstring
|
132 |
+
with the docstring from corresponding method in `cls`.
|
133 |
+
It extends the 'Notes' section of that docstring to include
|
134 |
+
the given `notes`.
|
135 |
+
"""
|
136 |
+
def _doc(func):
|
137 |
+
cls_docstring = getattr(cls, func.__name__).__doc__
|
138 |
+
# If python is called with -OO option,
|
139 |
+
# there is no docstring
|
140 |
+
if cls_docstring is None:
|
141 |
+
return func
|
142 |
+
end_of_notes = cls_docstring.find(' References\n')
|
143 |
+
if end_of_notes == -1:
|
144 |
+
end_of_notes = cls_docstring.find(' Examples\n')
|
145 |
+
if end_of_notes == -1:
|
146 |
+
end_of_notes = len(cls_docstring)
|
147 |
+
func.__doc__ = (cls_docstring[:end_of_notes] + notes +
|
148 |
+
cls_docstring[end_of_notes:])
|
149 |
+
return func
|
150 |
+
return _doc
|
151 |
+
|
152 |
+
|
153 |
+
def replace_notes_in_docstring(cls, notes):
|
154 |
+
"""
|
155 |
+
This decorator replaces the decorated function's docstring
|
156 |
+
with the docstring from corresponding method in `cls`.
|
157 |
+
It replaces the 'Notes' section of that docstring with
|
158 |
+
the given `notes`.
|
159 |
+
"""
|
160 |
+
def _doc(func):
|
161 |
+
cls_docstring = getattr(cls, func.__name__).__doc__
|
162 |
+
notes_header = ' Notes\n -----\n'
|
163 |
+
# If python is called with -OO option,
|
164 |
+
# there is no docstring
|
165 |
+
if cls_docstring is None:
|
166 |
+
return func
|
167 |
+
start_of_notes = cls_docstring.find(notes_header)
|
168 |
+
end_of_notes = cls_docstring.find(' References\n')
|
169 |
+
if end_of_notes == -1:
|
170 |
+
end_of_notes = cls_docstring.find(' Examples\n')
|
171 |
+
if end_of_notes == -1:
|
172 |
+
end_of_notes = len(cls_docstring)
|
173 |
+
func.__doc__ = (cls_docstring[:start_of_notes + len(notes_header)] +
|
174 |
+
notes +
|
175 |
+
cls_docstring[end_of_notes:])
|
176 |
+
return func
|
177 |
+
return _doc
|
178 |
+
|
179 |
+
|
180 |
+
def indentcount_lines(lines):
|
181 |
+
''' Minimum indent for all lines in line list
|
182 |
+
|
183 |
+
>>> lines = [' one', ' two', ' three']
|
184 |
+
>>> indentcount_lines(lines)
|
185 |
+
1
|
186 |
+
>>> lines = []
|
187 |
+
>>> indentcount_lines(lines)
|
188 |
+
0
|
189 |
+
>>> lines = [' one']
|
190 |
+
>>> indentcount_lines(lines)
|
191 |
+
1
|
192 |
+
>>> indentcount_lines([' '])
|
193 |
+
0
|
194 |
+
'''
|
195 |
+
indentno = sys.maxsize
|
196 |
+
for line in lines:
|
197 |
+
stripped = line.lstrip()
|
198 |
+
if stripped:
|
199 |
+
indentno = min(indentno, len(line) - len(stripped))
|
200 |
+
if indentno == sys.maxsize:
|
201 |
+
return 0
|
202 |
+
return indentno
|
203 |
+
|
204 |
+
|
205 |
+
def filldoc(docdict, unindent_params=True):
|
206 |
+
''' Return docstring decorator using docdict variable dictionary
|
207 |
+
|
208 |
+
Parameters
|
209 |
+
----------
|
210 |
+
docdict : dictionary
|
211 |
+
dictionary containing name, docstring fragment pairs
|
212 |
+
unindent_params : {False, True}, boolean, optional
|
213 |
+
If True, strip common indentation from all parameters in
|
214 |
+
docdict
|
215 |
+
|
216 |
+
Returns
|
217 |
+
-------
|
218 |
+
decfunc : function
|
219 |
+
decorator that applies dictionary to input function docstring
|
220 |
+
|
221 |
+
'''
|
222 |
+
if unindent_params:
|
223 |
+
docdict = unindent_dict(docdict)
|
224 |
+
|
225 |
+
def decorate(f):
|
226 |
+
f.__doc__ = docformat(f.__doc__, docdict)
|
227 |
+
return f
|
228 |
+
return decorate
|
229 |
+
|
230 |
+
|
231 |
+
def unindent_dict(docdict):
|
232 |
+
''' Unindent all strings in a docdict '''
|
233 |
+
can_dict = {}
|
234 |
+
for name, dstr in docdict.items():
|
235 |
+
can_dict[name] = unindent_string(dstr)
|
236 |
+
return can_dict
|
237 |
+
|
238 |
+
|
239 |
+
def unindent_string(docstring):
|
240 |
+
''' Set docstring to minimum indent for all lines, including first
|
241 |
+
|
242 |
+
>>> unindent_string(' two')
|
243 |
+
'two'
|
244 |
+
>>> unindent_string(' two\\n three')
|
245 |
+
'two\\n three'
|
246 |
+
'''
|
247 |
+
lines = docstring.expandtabs().splitlines()
|
248 |
+
icount = indentcount_lines(lines)
|
249 |
+
if icount == 0:
|
250 |
+
return docstring
|
251 |
+
return '\n'.join([line[icount:] for line in lines])
|
252 |
+
|
253 |
+
|
254 |
+
def doc_replace(obj, oldval, newval):
|
255 |
+
"""Decorator to take the docstring from obj, with oldval replaced by newval
|
256 |
+
|
257 |
+
Equivalent to ``func.__doc__ = obj.__doc__.replace(oldval, newval)``
|
258 |
+
|
259 |
+
Parameters
|
260 |
+
----------
|
261 |
+
obj : object
|
262 |
+
The object to take the docstring from.
|
263 |
+
oldval : string
|
264 |
+
The string to replace from the original docstring.
|
265 |
+
newval : string
|
266 |
+
The string to replace ``oldval`` with.
|
267 |
+
"""
|
268 |
+
# __doc__ may be None for optimized Python (-OO)
|
269 |
+
doc = (obj.__doc__ or '').replace(oldval, newval)
|
270 |
+
|
271 |
+
def inner(func):
|
272 |
+
func.__doc__ = doc
|
273 |
+
return func
|
274 |
+
|
275 |
+
return inner
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/messagestream.cpython-310-x86_64-linux-gnu.so
ADDED
Binary file (85.8 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__init__.py
ADDED
File without changes
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/__init__.cpython-310.pyc
ADDED
Binary file (214 Bytes). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__gcutils.cpython-310.pyc
ADDED
Binary file (3.64 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__pep440.cpython-310.pyc
ADDED
Binary file (2.37 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__testutils.cpython-310.pyc
ADDED
Binary file (1.01 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__threadsafety.cpython-310.pyc
ADDED
Binary file (1.8 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test__util.cpython-310.pyc
ADDED
Binary file (14.2 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_array_api.cpython-310.pyc
ADDED
Binary file (4.29 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_bunch.cpython-310.pyc
ADDED
Binary file (7.02 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_ccallback.cpython-310.pyc
ADDED
Binary file (6.6 kB). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_deprecation.cpython-310.pyc
ADDED
Binary file (661 Bytes). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_import_cycles.cpython-310.pyc
ADDED
Binary file (861 Bytes). View file
|
|
emissary-ml/llm-scripts/fine-tuning/llama3/venv/lib/python3.10/site-packages/scipy/_lib/tests/__pycache__/test_public_api.cpython-310.pyc
ADDED
Binary file (9.65 kB). View file
|
|