|
|
|
import streamlit as st |
|
import numpy as np |
|
import pandas as pd |
|
import torch |
|
import torch.nn as nn |
|
import torch.nn.functional as F |
|
from sklearn.metrics import accuracy_score, roc_auc_score |
|
from rdkit import Chem |
|
from rdkit.Chem import rdMolDescriptors |
|
from rdkit.Chem.rdFingerprintGenerator import GetMorganGenerator |
|
from torch_geometric.data import Data |
|
from torch_geometric.nn import GCNConv, global_mean_pool |
|
from torch_geometric.loader import DataLoader |
|
import plotly.express as px |
|
from rdkit.Chem import Draw |
|
from torch_geometric.data import Batch |
|
from rdkit.Chem import Descriptors |
|
|
|
|
|
import time |
|
|
|
|
|
|
|
class ToxicityNet(nn.Module): |
|
def __init__(self): |
|
super().__init__() |
|
self.model = nn.Sequential( |
|
nn.Linear(1024, 512), nn.ReLU(), |
|
nn.Dropout(0.3), nn.Linear(512, 128), |
|
nn.ReLU(), nn.Linear(128, 1) |
|
) |
|
|
|
def forward(self, x): |
|
return self.model(x) |
|
|
|
class RichGCNModel(nn.Module): |
|
def __init__(self): |
|
super().__init__() |
|
self.conv1 = GCNConv(10, 64) |
|
self.bn1 = nn.BatchNorm1d(64) |
|
self.conv2 = GCNConv(64, 128) |
|
self.bn2 = nn.BatchNorm1d(128) |
|
self.dropout = nn.Dropout(0.2) |
|
self.fc1 = nn.Linear(128, 64) |
|
self.fc2 = nn.Linear(64, 1) |
|
|
|
def forward(self, data): |
|
x, edge_index, batch = data.x, data.edge_index, data.batch |
|
x = F.relu(self.bn1(self.conv1(x, edge_index))) |
|
x = F.relu(self.bn2(self.conv2(x, edge_index))) |
|
x = global_mean_pool(x, batch) |
|
x = self.dropout(x) |
|
x = F.relu(self.fc1(x)) |
|
return self.fc2(x) |
|
|
|
|
|
st.set_page_config(layout="wide", page_title="Drug Toxicity Predictor") |
|
st.title("π§ͺ Drug Toxicity Prediction Dashboard") |
|
|
|
|
|
|
|
fp_model = ToxicityNet() |
|
gcn_model = RichGCNModel() |
|
fp_loaded = gcn_loaded = False |
|
|
|
|
|
msg_fp = st.empty() |
|
with msg_fp.container(): |
|
with st.spinner("π¦ Loading fingerprint model..."): |
|
time.sleep(6) |
|
try: |
|
fp_model.load_state_dict(torch.load("tox_model.pt", map_location=torch.device("cpu"))) |
|
fp_model.eval() |
|
fp_loaded = True |
|
st.success("β
Fingerprint model loaded.") |
|
except Exception as e: |
|
st.warning(f"β οΈ Fingerprint model not loaded: {e}") |
|
time.sleep(1) |
|
msg_fp.empty() |
|
|
|
|
|
msg_gcn = st.empty() |
|
with msg_gcn.container(): |
|
with st.spinner("π¦ Loading GCN model..."): |
|
time.sleep(2) |
|
try: |
|
gcn_model.load_state_dict(torch.load("gcn_model.pt", map_location=torch.device("cpu"))) |
|
gcn_model.eval() |
|
gcn_loaded = True |
|
st.success("β
GCN model loaded.") |
|
except Exception as e: |
|
st.warning(f"β οΈ GCN model not loaded: {e}") |
|
time.sleep(1) |
|
msg_gcn.empty() |
|
|
|
|
|
msg_threshold = st.empty() |
|
with msg_threshold.container(): |
|
with st.spinner("π Loading best threshold..."): |
|
time.sleep(2) |
|
try: |
|
best_threshold = float(np.load("gcn_best_threshold.npy")) |
|
except Exception as e: |
|
best_threshold = 0.5 |
|
st.warning(f"β οΈ Using default threshold (0.5) for GCN model. Reason: {e}") |
|
st.success("β
All models loaded. Dashboard is ready!") |
|
time.sleep(2) |
|
msg_threshold.empty() |
|
|
|
|
|
|
|
|
|
|
|
fp_gen = GetMorganGenerator(radius=2, fpSize=1024) |
|
|
|
def get_molecule_info(mol): |
|
return { |
|
"Formula": Chem.rdMolDescriptors.CalcMolFormula(mol), |
|
"Weight": round(Descriptors.MolWt(mol), 2), |
|
"Atoms": mol.GetNumAtoms(), |
|
"Bonds": mol.GetNumBonds() |
|
} |
|
|
|
|
|
|
|
def predict_gcn(smiles): |
|
graph = smiles_to_graph(smiles) |
|
if graph is None: |
|
return None, None |
|
batch = Batch.from_data_list([graph]) |
|
with torch.no_grad(): |
|
out = gcn_model(batch) |
|
prob = torch.sigmoid(out).item() |
|
return ("Toxic" if prob > best_threshold else "Non-toxic"), prob |
|
|
|
|
|
def atom_feats(atom): |
|
return [ |
|
atom.GetAtomicNum(), |
|
atom.GetDegree(), |
|
atom.GetFormalCharge(), |
|
atom.GetNumExplicitHs(), |
|
atom.GetNumImplicitHs(), |
|
atom.GetIsAromatic(), |
|
atom.GetMass(), |
|
int(atom.IsInRing()), |
|
int(atom.GetChiralTag()), |
|
int(atom.GetHybridization()) |
|
] |
|
|
|
def smiles_to_graph(smiles, label=None): |
|
mol = Chem.MolFromSmiles(smiles) |
|
if mol is None or mol.GetNumAtoms() == 0: |
|
return None |
|
|
|
atoms = [atom_feats(a) for a in mol.GetAtoms()] |
|
if not atoms: |
|
return None |
|
|
|
edges = [] |
|
for b in mol.GetBonds(): |
|
i, j = b.GetBeginAtomIdx(), b.GetEndAtomIdx() |
|
edges += [[i, j], [j, i]] |
|
|
|
|
|
if len(edges) == 0: |
|
edges = [[0, 0]] |
|
|
|
edge_index = torch.tensor(edges, dtype=torch.long).t().contiguous() |
|
x = torch.tensor(atoms, dtype=torch.float) |
|
batch = torch.zeros(x.size(0), dtype=torch.long) |
|
|
|
data = Data(x=x, edge_index=edge_index, batch=batch) |
|
if label is not None: |
|
data.y = torch.tensor([label], dtype=torch.float) |
|
return data |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
df = pd.read_csv("tox21.csv")[['smiles', 'SR-HSE']].dropna() |
|
df = df[df['SR-HSE'].isin([0, 1])].reset_index(drop=True) |
|
|
|
|
|
def is_valid_graph(smi): |
|
mol = Chem.MolFromSmiles(smi) |
|
return mol is not None and smiles_to_graph(smi) is not None |
|
|
|
df = df[df['smiles'].apply(is_valid_graph)].reset_index(drop=True) |
|
|
|
|
|
|
|
|
|
def create_graph_dataset(smiles_list, labels): |
|
data_list = [] |
|
for smi, label in zip(smiles_list, labels): |
|
data = smiles_to_graph(smi, label) |
|
if data: |
|
data_list.append(data) |
|
return data_list |
|
|
|
graph_data = create_graph_dataset(df['smiles'], df['SR-HSE']) |
|
test_loader = DataLoader(graph_data, batch_size=32) |
|
|
|
|
|
def plot_distribution(df, model_type, input_prob=None): |
|
col = 'fp_prob' if model_type == 'fp' else 'gcn_prob' |
|
df_plot = df[df[col].notna()].copy() |
|
df_plot["Label"] = df_plot["SR-HSE"].map({0: "Non-toxic", 1: "Toxic"}) |
|
fig = px.histogram(df_plot, x=col, color="Label", nbins=30, barmode="overlay", |
|
color_discrete_map={"Non-toxic": "green", "Toxic": "red"}, |
|
title=f"{model_type.upper()} Model - Test Set Distribution") |
|
if input_prob: |
|
fig.add_vline(x=input_prob, line_dash="dash", line_color="yellow", annotation_text="Your Input") |
|
return fig |
|
|
|
|
|
@st.cache_data(show_spinner="Generating predictions...") |
|
|
|
def predict_fp(smiles): |
|
try: |
|
mol = Chem.MolFromSmiles(smiles) |
|
if mol is None: |
|
return "Invalid SMILES", 0.0 |
|
fp = fp_gen.GetFingerprint(mol) |
|
fp_array = np.array(fp).reshape(1, -1) |
|
with torch.no_grad(): |
|
logits = fp_model(torch.tensor(fp_array).float()) |
|
prob = torch.sigmoid(logits).item() |
|
return ("Toxic" if prob > 0.5 else "Non-toxic"), prob |
|
except Exception as e: |
|
return f"Error: {str(e)}", 0.0 |
|
|
|
def get_predictions(model_type='fp'): |
|
preds = [] |
|
for smi in df['smiles']: |
|
try: |
|
p = predict_fp(smi)[1] if model_type == 'fp' else predict_gcn(smi)[1] |
|
preds.append(p) |
|
except: |
|
preds.append(None) |
|
return preds |
|
|
|
df['fp_prob'] = get_predictions('fp') if fp_loaded else None |
|
df['gcn_prob'] = get_predictions('gcn') if gcn_loaded else None |
|
|
|
|
|
def evaluate_gcn_test_set(model, test_loader): |
|
model.eval() |
|
all_preds, all_labels = [], [] |
|
with torch.no_grad(): |
|
for batch in test_loader: |
|
batch = batch.to("cpu") |
|
out = model(batch) |
|
probs = torch.sigmoid(out) |
|
all_preds.extend(probs.cpu().numpy()) |
|
all_labels.extend(batch.y.cpu().numpy()) |
|
acc = accuracy_score(all_labels, (np.array(all_preds) > 0.5).astype(int)) |
|
roc = roc_auc_score(all_labels, all_preds) |
|
|
|
df_eval = pd.DataFrame({ |
|
"Predicted Probability": all_preds, |
|
"Label": ["Non-toxic" if i == 0 else "Toxic" for i in all_labels] |
|
}) |
|
|
|
fig = px.histogram(df_eval, x="Predicted Probability", color="Label", |
|
nbins=30, barmode="overlay", |
|
color_discrete_map={"Non-toxic": "green", "Toxic": "red"}, |
|
title="GCN Test Set - Probability Distribution") |
|
fig.update_layout(bargap=0.1) |
|
|
|
st.success(f"β
Accuracy: `{acc:.4f}`, ROC-AUC: `{roc:.4f}`") |
|
st.plotly_chart(fig, use_container_width=True) |
|
|
|
|
|
tab1, tab2 = st.tabs(["π¬ Fingerprint Model", "𧬠GCN Model"]) |
|
|
|
with tab1: |
|
st.subheader("Fingerprint-based Prediction") |
|
with st.form("fp_form"): |
|
smiles_fp = st.text_input("Enter SMILES", "CCO") |
|
show_debug_fp = st.checkbox("π Show Debug Info (raw score/logit)", key="fp_debug") |
|
predict_btn = st.form_submit_button("π Predict") |
|
|
|
if predict_btn: |
|
with st.spinner("Predicting..."): |
|
mol = Chem.MolFromSmiles(smiles_fp) |
|
if mol: |
|
fp = fp_gen.GetFingerprint(mol) |
|
arr = np.array(fp).reshape(1, -1) |
|
tensor = torch.tensor(arr).float() |
|
with torch.no_grad(): |
|
output = fp_model(tensor) |
|
prob = torch.sigmoid(output).item() |
|
raw_score = output.item() |
|
label = "Toxic" if prob > 0.5 else "Non-toxic" |
|
color = "red" if label == "Toxic" else "green" |
|
|
|
st.markdown(f"<h4>π§Ύ Prediction: <span style='color:{color}'>{label}</span> β <code>{prob:.3f}</code></h4>", unsafe_allow_html=True) |
|
|
|
if show_debug_fp: |
|
st.code(f"π Raw Logit: {raw_score:.4f}", language='text') |
|
st.markdown("#### Fingerprint Vector (First 20 bits)") |
|
st.code(str(arr[0][:20]) + " ...", language="text") |
|
|
|
st.image(Draw.MolToImage(mol), caption="Molecular Structure", width=250) |
|
|
|
info = get_molecule_info(mol) |
|
st.markdown("### Molecule Info:") |
|
for k, v in info.items(): |
|
st.markdown(f"**{k}:** {v}") |
|
|
|
st.plotly_chart(plot_distribution(df, 'fp', prob), use_container_width=True) |
|
else: |
|
st.error("β Invalid SMILES input. Please check your string.") |
|
|
|
with st.expander("π Example SMILES to Try"): |
|
st.markdown(""" |
|
- `CCO` (Ethanol) |
|
- `CC(=O)O` (Acetic Acid) |
|
- `c1ccccc1` (Benzene) |
|
- `CCN(CC)CC` (Triethylamine) |
|
- `C1=CC=CN=C1` (Pyridine) |
|
""") |
|
|
|
with st.expander("π§ͺ Top 5 Toxic Predictions from Test Set (Fingerprint Model)"): |
|
if 'fp_prob' in df: |
|
top_toxic_fp = df[df['fp_prob'] > 0.5].sort_values('fp_prob', ascending=False) |
|
|
|
def is_valid_fp(smi): |
|
return Chem.MolFromSmiles(smi) is not None |
|
|
|
top_toxic_fp = top_toxic_fp[top_toxic_fp['smiles'].apply(is_valid_fp)].head(5) |
|
|
|
if not top_toxic_fp.empty: |
|
st.table(top_toxic_fp[['smiles', 'fp_prob']].rename(columns={'fp_prob': 'Predicted Probability'})) |
|
else: |
|
st.info("No valid top fingerprint predictions available.") |
|
else: |
|
st.info("Fingerprint model predictions not available.") |
|
|
|
|
|
with tab2: |
|
st.subheader("Graph Neural Network Prediction") |
|
|
|
SUPPORTED_ATOMS = {1, 6, 7, 8, 9, 16, 17, 35, 53} |
|
|
|
def is_supported(mol): |
|
return all(atom.GetAtomicNum() in SUPPORTED_ATOMS for atom in mol.GetAtoms()) |
|
|
|
with st.form("gcn_form"): |
|
smiles_gcn = st.text_input("Enter SMILES", "c1ccccc1", key="gcn_smiles") |
|
show_debug = st.checkbox("π Show Debug Info (raw score/logit)") |
|
gcn_btn = st.form_submit_button("π Predict") |
|
|
|
if gcn_btn: |
|
with st.spinner("Predicting..."): |
|
mol = Chem.MolFromSmiles(smiles_gcn) |
|
|
|
if mol is None: |
|
st.error("β Invalid SMILES: could not parse molecule.") |
|
elif not is_supported(mol): |
|
st.error("β οΈ This molecule contains unsupported atoms (e.g. Sn, P, etc.). GCN model only supports common organic elements.") |
|
else: |
|
graph = smiles_to_graph(smiles_gcn) |
|
if graph is None: |
|
st.error("β SMILES is valid but could not be converted to graph. Possibly malformed structure.") |
|
else: |
|
batch = Batch.from_data_list([graph]) |
|
with torch.no_grad(): |
|
out = gcn_model(batch) |
|
prob = torch.sigmoid(out).item() |
|
raw_score = out.item() |
|
label = "Toxic" if prob > best_threshold else "Non-toxic" |
|
color = "red" if label == "Toxic" else "green" |
|
|
|
st.markdown(f"<h4>π§Ύ GCN Prediction: <span style='color:{color}'>{label}</span> β <code>{prob:.3f}</code></h4>", unsafe_allow_html=True) |
|
|
|
if show_debug: |
|
st.code(f"π Raw Logit: {raw_score:.4f}", language='text') |
|
|
|
st.image(Draw.MolToImage(mol), caption="Molecular Structure", width=250) |
|
|
|
def get_molecule_info(mol): |
|
return { |
|
"Molecular Weight": round(Chem.Descriptors.MolWt(mol), 2), |
|
"LogP": round(Chem.Crippen.MolLogP(mol), 2), |
|
"Num H-Bond Donors": Chem.Lipinski.NumHDonors(mol), |
|
"Num H-Bond Acceptors": Chem.Lipinski.NumHAcceptors(mol), |
|
"TPSA": round(Chem.rdMolDescriptors.CalcTPSA(mol), 2), |
|
"Num Rotatable Bonds": Chem.Lipinski.NumRotatableBonds(mol) |
|
} |
|
|
|
info = get_molecule_info(mol) |
|
st.markdown("### Molecule Info:") |
|
for k, v in info.items(): |
|
st.markdown(f"**{k}:** {v}") |
|
|
|
st.plotly_chart(plot_distribution(df, 'gcn', prob), use_container_width=True) |
|
|
|
with st.expander("π Example SMILES to Try"): |
|
st.markdown(""" |
|
- `c1ccccc1` (Benzene) |
|
- `C1=CC=CC=C1O` (Phenol) |
|
- `CC(=O)OC1=CC=CC=C1C(=O)O` (Aspirin) |
|
- `NCC(O)=O` (Glycine) |
|
- `C1CCC(CC1)NC(=O)C2=CC=CC=C2` (Cyclohexylbenzamide) |
|
""") |
|
|
|
with st.expander("π₯ Download GCN Model Predictions"): |
|
if 'gcn_prob' in df: |
|
def is_valid_gcn(smi): |
|
mol = Chem.MolFromSmiles(smi) |
|
return mol is not None and is_supported(mol) and smiles_to_graph(smi) is not None |
|
|
|
df_valid = df[df['smiles'].apply(is_valid_gcn)].copy() |
|
csv_gcn = df_valid[['smiles', 'gcn_prob', 'SR-HSE']].dropna().to_csv(index=False) |
|
st.download_button("Download CSV", csv_gcn, "gcn_predictions.csv", "text/csv") |
|
else: |
|
st.info("Predictions not available yet.") |
|
|
|
with st.expander("π§ͺ Top 5 Toxic Predictions from Test Set"): |
|
if 'gcn_prob' in df: |
|
def is_valid_gcn(smi): |
|
mol = Chem.MolFromSmiles(smi) |
|
return mol is not None and is_supported(mol) and smiles_to_graph(smi) is not None |
|
|
|
top_toxic = df[df['gcn_prob'] > best_threshold].copy() |
|
top_toxic = top_toxic[top_toxic['smiles'].apply(is_valid_gcn)] |
|
top_toxic = top_toxic.sort_values('gcn_prob', ascending=False).head(5) |
|
|
|
if not top_toxic.empty: |
|
st.table(top_toxic[['smiles', 'gcn_prob']].rename(columns={'gcn_prob': 'Predicted Probability'})) |
|
else: |
|
st.info("No valid top predictions available.") |
|
else: |
|
st.info("GCN model predictions not available.") |
|
|
|
|