Spaces:
Sleeping
Sleeping
Example biotech workspace.
Browse files- examples/Bio demo +461 -0
- examples/drug_target_data_sample.csv +6 -0
examples/Bio demo
ADDED
@@ -0,0 +1,461 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
{
|
2 |
+
"env": "LynxKite Graph Analytics",
|
3 |
+
"nodes": [
|
4 |
+
{
|
5 |
+
"id": "Import CSV 1",
|
6 |
+
"type": "basic",
|
7 |
+
"data": {
|
8 |
+
"title": "Import CSV",
|
9 |
+
"params": {
|
10 |
+
"columns": "<from file>",
|
11 |
+
"separator": "<auto>",
|
12 |
+
"filename": "examples/drug_target_data_sample.csv"
|
13 |
+
},
|
14 |
+
"display": null,
|
15 |
+
"error": null,
|
16 |
+
"collapsed": null,
|
17 |
+
"meta": {
|
18 |
+
"outputs": {
|
19 |
+
"output": {
|
20 |
+
"position": "right",
|
21 |
+
"name": "output",
|
22 |
+
"type": {
|
23 |
+
"type": "None"
|
24 |
+
}
|
25 |
+
}
|
26 |
+
},
|
27 |
+
"params": {
|
28 |
+
"filename": {
|
29 |
+
"type": {
|
30 |
+
"type": "<class 'str'>"
|
31 |
+
},
|
32 |
+
"default": null,
|
33 |
+
"name": "filename"
|
34 |
+
},
|
35 |
+
"columns": {
|
36 |
+
"default": "<from file>",
|
37 |
+
"name": "columns",
|
38 |
+
"type": {
|
39 |
+
"type": "<class 'str'>"
|
40 |
+
}
|
41 |
+
},
|
42 |
+
"separator": {
|
43 |
+
"name": "separator",
|
44 |
+
"default": "<auto>",
|
45 |
+
"type": {
|
46 |
+
"type": "<class 'str'>"
|
47 |
+
}
|
48 |
+
}
|
49 |
+
},
|
50 |
+
"inputs": {},
|
51 |
+
"type": "basic",
|
52 |
+
"name": "Import CSV"
|
53 |
+
},
|
54 |
+
"__execution_delay": 0.0
|
55 |
+
},
|
56 |
+
"position": {
|
57 |
+
"x": -91.52295913245543,
|
58 |
+
"y": 933.9762681038399
|
59 |
+
},
|
60 |
+
"width": 200.0,
|
61 |
+
"height": 200.0
|
62 |
+
},
|
63 |
+
{
|
64 |
+
"id": "Parse SMILES 1",
|
65 |
+
"type": "basic",
|
66 |
+
"data": {
|
67 |
+
"title": "Parse SMILES",
|
68 |
+
"params": {
|
69 |
+
"table": "df",
|
70 |
+
"save_as": "mols",
|
71 |
+
"smiles_column": "SMILES"
|
72 |
+
},
|
73 |
+
"display": null,
|
74 |
+
"error": null,
|
75 |
+
"meta": {
|
76 |
+
"name": "Parse SMILES",
|
77 |
+
"params": {
|
78 |
+
"table": {
|
79 |
+
"type": {
|
80 |
+
"type": "<class 'str'>"
|
81 |
+
},
|
82 |
+
"default": "df",
|
83 |
+
"name": "table"
|
84 |
+
},
|
85 |
+
"smiles_column": {
|
86 |
+
"type": {
|
87 |
+
"type": "<class 'str'>"
|
88 |
+
},
|
89 |
+
"name": "smiles_column",
|
90 |
+
"default": "SMILES"
|
91 |
+
},
|
92 |
+
"save_as": {
|
93 |
+
"type": {
|
94 |
+
"type": "<class 'str'>"
|
95 |
+
},
|
96 |
+
"name": "save_as",
|
97 |
+
"default": "mols"
|
98 |
+
}
|
99 |
+
},
|
100 |
+
"inputs": {
|
101 |
+
"bundle": {
|
102 |
+
"name": "bundle",
|
103 |
+
"type": {
|
104 |
+
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
|
105 |
+
},
|
106 |
+
"position": "left"
|
107 |
+
}
|
108 |
+
},
|
109 |
+
"outputs": {
|
110 |
+
"output": {
|
111 |
+
"position": "right",
|
112 |
+
"name": "output",
|
113 |
+
"type": {
|
114 |
+
"type": "None"
|
115 |
+
}
|
116 |
+
}
|
117 |
+
},
|
118 |
+
"type": "basic"
|
119 |
+
}
|
120 |
+
},
|
121 |
+
"position": {
|
122 |
+
"x": 381.1847590729871,
|
123 |
+
"y": 945.0
|
124 |
+
},
|
125 |
+
"height": 200.0,
|
126 |
+
"width": 200.0
|
127 |
+
},
|
128 |
+
{
|
129 |
+
"id": "Graph from molecule similarity 1",
|
130 |
+
"type": "basic",
|
131 |
+
"data": {
|
132 |
+
"title": "Graph from molecule similarity",
|
133 |
+
"params": {
|
134 |
+
"table": "df",
|
135 |
+
"mols_column": "mols",
|
136 |
+
"average_degree": "3"
|
137 |
+
},
|
138 |
+
"display": null,
|
139 |
+
"error": null,
|
140 |
+
"collapsed": null,
|
141 |
+
"meta": {
|
142 |
+
"params": {
|
143 |
+
"mols_column": {
|
144 |
+
"name": "mols_column",
|
145 |
+
"default": "mols",
|
146 |
+
"type": {
|
147 |
+
"type": "<class 'str'>"
|
148 |
+
}
|
149 |
+
},
|
150 |
+
"table": {
|
151 |
+
"type": {
|
152 |
+
"type": "<class 'str'>"
|
153 |
+
},
|
154 |
+
"default": "df",
|
155 |
+
"name": "table"
|
156 |
+
},
|
157 |
+
"average_degree": {
|
158 |
+
"name": "average_degree",
|
159 |
+
"default": 10.0,
|
160 |
+
"type": {
|
161 |
+
"type": "<class 'int'>"
|
162 |
+
}
|
163 |
+
}
|
164 |
+
},
|
165 |
+
"inputs": {
|
166 |
+
"bundle": {
|
167 |
+
"position": "left",
|
168 |
+
"type": {
|
169 |
+
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
|
170 |
+
},
|
171 |
+
"name": "bundle"
|
172 |
+
}
|
173 |
+
},
|
174 |
+
"outputs": {
|
175 |
+
"output": {
|
176 |
+
"type": {
|
177 |
+
"type": "None"
|
178 |
+
},
|
179 |
+
"position": "right",
|
180 |
+
"name": "output"
|
181 |
+
}
|
182 |
+
},
|
183 |
+
"name": "Graph from molecule similarity",
|
184 |
+
"type": "basic"
|
185 |
+
},
|
186 |
+
"__execution_delay": 0.0
|
187 |
+
},
|
188 |
+
"position": {
|
189 |
+
"x": 926.4337192214458,
|
190 |
+
"y": 1014.4451876264845
|
191 |
+
},
|
192 |
+
"height": 200.0,
|
193 |
+
"width": 200.0
|
194 |
+
},
|
195 |
+
{
|
196 |
+
"id": "Visualize graph 1",
|
197 |
+
"type": "visualization",
|
198 |
+
"data": {
|
199 |
+
"title": "Visualize graph",
|
200 |
+
"params": {
|
201 |
+
"color_edges_by": "similarity",
|
202 |
+
"color_nodes_by": "ORGANISM",
|
203 |
+
"label_by": "DRUG_NAME"
|
204 |
+
},
|
205 |
+
"display": {
|
206 |
+
"animationDuration": 500,
|
207 |
+
"animationEasingUpdate": "quinticInOut",
|
208 |
+
"tooltip": {
|
209 |
+
"show": true
|
210 |
+
},
|
211 |
+
"series": [
|
212 |
+
{
|
213 |
+
"type": "graph",
|
214 |
+
"lineStyle": {
|
215 |
+
"color": "gray",
|
216 |
+
"curveness": 0.3
|
217 |
+
},
|
218 |
+
"emphasis": {
|
219 |
+
"focus": "adjacency",
|
220 |
+
"lineStyle": {
|
221 |
+
"width": 10
|
222 |
+
}
|
223 |
+
},
|
224 |
+
"label": {
|
225 |
+
"position": "top",
|
226 |
+
"formatter": "{b}"
|
227 |
+
},
|
228 |
+
"data": [
|
229 |
+
{
|
230 |
+
"id": "0",
|
231 |
+
"x": 0.10802749422637721,
|
232 |
+
"y": 0.08231702235365293,
|
233 |
+
"symbolSize": 22.360679774997894,
|
234 |
+
"itemStyle": {
|
235 |
+
"color": "#a6cee3"
|
236 |
+
},
|
237 |
+
"label": {
|
238 |
+
"show": true
|
239 |
+
},
|
240 |
+
"name": "phencyclidine",
|
241 |
+
"value": "Torpedo californica"
|
242 |
+
},
|
243 |
+
{
|
244 |
+
"id": "1",
|
245 |
+
"x": -0.21409593978467548,
|
246 |
+
"y": -0.41899519488061593,
|
247 |
+
"symbolSize": 22.360679774997894,
|
248 |
+
"itemStyle": {
|
249 |
+
"color": "#1f78b4"
|
250 |
+
},
|
251 |
+
"label": {
|
252 |
+
"show": true
|
253 |
+
},
|
254 |
+
"name": "triazolam",
|
255 |
+
"value": "Homo sapiens"
|
256 |
+
},
|
257 |
+
{
|
258 |
+
"id": "2",
|
259 |
+
"x": -0.026230797767347148,
|
260 |
+
"y": 0.7208227030460969,
|
261 |
+
"symbolSize": 22.360679774997894,
|
262 |
+
"itemStyle": {
|
263 |
+
"color": "#1f78b4"
|
264 |
+
},
|
265 |
+
"label": {
|
266 |
+
"show": true
|
267 |
+
},
|
268 |
+
"name": "gentian violet",
|
269 |
+
"value": "Homo sapiens"
|
270 |
+
},
|
271 |
+
{
|
272 |
+
"id": "3",
|
273 |
+
"x": -0.8677007566744104,
|
274 |
+
"y": -0.1866160281519609,
|
275 |
+
"symbolSize": 22.360679774997894,
|
276 |
+
"itemStyle": {
|
277 |
+
"color": "#1f78b4"
|
278 |
+
},
|
279 |
+
"label": {
|
280 |
+
"show": true
|
281 |
+
},
|
282 |
+
"name": "ipratropium",
|
283 |
+
"value": "Homo sapiens"
|
284 |
+
},
|
285 |
+
{
|
286 |
+
"id": "4",
|
287 |
+
"x": 1.0,
|
288 |
+
"y": -0.19752850236718,
|
289 |
+
"symbolSize": 22.360679774997894,
|
290 |
+
"itemStyle": {
|
291 |
+
"color": "#1f78b4"
|
292 |
+
},
|
293 |
+
"label": {
|
294 |
+
"show": true
|
295 |
+
},
|
296 |
+
"name": "deoxycholic acid",
|
297 |
+
"value": "Homo sapiens"
|
298 |
+
}
|
299 |
+
],
|
300 |
+
"links": [
|
301 |
+
{
|
302 |
+
"source": "3",
|
303 |
+
"target": "4",
|
304 |
+
"lineStyle": {
|
305 |
+
"color": "#440154"
|
306 |
+
},
|
307 |
+
"value": 0.8481012658227848
|
308 |
+
},
|
309 |
+
{
|
310 |
+
"source": "0",
|
311 |
+
"target": "1",
|
312 |
+
"lineStyle": {
|
313 |
+
"color": "#3a538b"
|
314 |
+
},
|
315 |
+
"value": 0.8813559322033898
|
316 |
+
},
|
317 |
+
{
|
318 |
+
"source": "0",
|
319 |
+
"target": "4",
|
320 |
+
"lineStyle": {
|
321 |
+
"color": "#3a538b"
|
322 |
+
},
|
323 |
+
"value": 0.8813559322033898
|
324 |
+
},
|
325 |
+
{
|
326 |
+
"source": "0",
|
327 |
+
"target": "3",
|
328 |
+
"lineStyle": {
|
329 |
+
"color": "#26818e"
|
330 |
+
},
|
331 |
+
"value": 0.9047619047619048
|
332 |
+
},
|
333 |
+
{
|
334 |
+
"source": "1",
|
335 |
+
"target": "2",
|
336 |
+
"lineStyle": {
|
337 |
+
"color": "#23898d"
|
338 |
+
},
|
339 |
+
"value": 0.9090909090909091
|
340 |
+
},
|
341 |
+
{
|
342 |
+
"source": "1",
|
343 |
+
"target": "3",
|
344 |
+
"lineStyle": {
|
345 |
+
"color": "#1ea087"
|
346 |
+
},
|
347 |
+
"value": 0.921875
|
348 |
+
},
|
349 |
+
{
|
350 |
+
"source": "0",
|
351 |
+
"target": "2",
|
352 |
+
"lineStyle": {
|
353 |
+
"color": "#3ebc73"
|
354 |
+
},
|
355 |
+
"value": 0.9375
|
356 |
+
},
|
357 |
+
{
|
358 |
+
"source": "1",
|
359 |
+
"target": "4",
|
360 |
+
"lineStyle": {
|
361 |
+
"color": "#4fc369"
|
362 |
+
},
|
363 |
+
"value": 0.9420289855072463
|
364 |
+
},
|
365 |
+
{
|
366 |
+
"source": "2",
|
367 |
+
"target": "4",
|
368 |
+
"lineStyle": {
|
369 |
+
"color": "#9fd938"
|
370 |
+
},
|
371 |
+
"value": 0.9589041095890412
|
372 |
+
},
|
373 |
+
{
|
374 |
+
"source": "2",
|
375 |
+
"target": "3",
|
376 |
+
"lineStyle": {
|
377 |
+
"color": "#fde724"
|
378 |
+
},
|
379 |
+
"value": 0.9775280898876404
|
380 |
+
}
|
381 |
+
]
|
382 |
+
}
|
383 |
+
]
|
384 |
+
},
|
385 |
+
"error": null,
|
386 |
+
"__execution_delay": 0.0,
|
387 |
+
"meta": {
|
388 |
+
"inputs": {
|
389 |
+
"graph": {
|
390 |
+
"name": "graph",
|
391 |
+
"position": "left",
|
392 |
+
"type": {
|
393 |
+
"type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
|
394 |
+
}
|
395 |
+
}
|
396 |
+
},
|
397 |
+
"outputs": {},
|
398 |
+
"type": "visualization",
|
399 |
+
"params": {
|
400 |
+
"color_edges_by": {
|
401 |
+
"name": "color_edges_by",
|
402 |
+
"default": null,
|
403 |
+
"type": {
|
404 |
+
"format": "edge attribute"
|
405 |
+
}
|
406 |
+
},
|
407 |
+
"color_nodes_by": {
|
408 |
+
"default": null,
|
409 |
+
"type": {
|
410 |
+
"format": "node attribute"
|
411 |
+
},
|
412 |
+
"name": "color_nodes_by"
|
413 |
+
},
|
414 |
+
"label_by": {
|
415 |
+
"name": "label_by",
|
416 |
+
"default": null,
|
417 |
+
"type": {
|
418 |
+
"format": "node attribute"
|
419 |
+
}
|
420 |
+
}
|
421 |
+
},
|
422 |
+
"position": {
|
423 |
+
"x": 883.0,
|
424 |
+
"y": 167.0
|
425 |
+
},
|
426 |
+
"name": "Visualize graph"
|
427 |
+
},
|
428 |
+
"collapsed": null
|
429 |
+
},
|
430 |
+
"position": {
|
431 |
+
"x": 1530.0,
|
432 |
+
"y": 915.0
|
433 |
+
},
|
434 |
+
"width": 407.0,
|
435 |
+
"height": 314.0
|
436 |
+
}
|
437 |
+
],
|
438 |
+
"edges": [
|
439 |
+
{
|
440 |
+
"id": "Import CSV 1 Parse SMILES 1",
|
441 |
+
"source": "Import CSV 1",
|
442 |
+
"target": "Parse SMILES 1",
|
443 |
+
"sourceHandle": "output",
|
444 |
+
"targetHandle": "bundle"
|
445 |
+
},
|
446 |
+
{
|
447 |
+
"id": "Parse SMILES 1 Graph from molecule similarity 1",
|
448 |
+
"source": "Parse SMILES 1",
|
449 |
+
"target": "Graph from molecule similarity 1",
|
450 |
+
"sourceHandle": "output",
|
451 |
+
"targetHandle": "bundle"
|
452 |
+
},
|
453 |
+
{
|
454 |
+
"id": "Graph from molecule similarity 1 Visualize graph 1",
|
455 |
+
"source": "Graph from molecule similarity 1",
|
456 |
+
"target": "Visualize graph 1",
|
457 |
+
"sourceHandle": "output",
|
458 |
+
"targetHandle": "graph"
|
459 |
+
}
|
460 |
+
]
|
461 |
+
}
|
examples/drug_target_data_sample.csv
ADDED
@@ -0,0 +1,6 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
1 |
+
Unnamed: 0,DRUG_NAME,STRUCT_ID,TARGET_NAME,TARGET_CLASS,ACCESSION,GENE,SWISSPROT,ACT_VALUE,ACT_UNIT,ACT_TYPE,ACT_COMMENT,ACT_SOURCE,RELATION,MOA,MOA_SOURCE,ACT_SOURCE_URL,MOA_SOURCE_URL,ACTION_TYPE,TDL,ORGANISM,SMILES,InChI,InChIKey,INN
|
2 |
+
9737,phencyclidine,2121,Acetylcholine receptor subunit alpha,Ion channel,P02710,CHRNA1,ACHA_TORCA,6.66,,IC50,Displacement of [3H]PCP from nAChR in Torpedo nobiliana electric organs membranes in presence of 100 uM carbachol by scintillation counting method,CHEMBL,=,,,,,,,Torpedo californica,C1CCN(CC1)C1(CCCCC1)C1=CC=CC=C1,"InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2",JTJMJGYZQZDUJJ-UHFFFAOYSA-N,phencyclidine
|
3 |
+
12934,triazolam,2729,GABA A receptor alpha-3/beta-2/gamma-2,Ion channel,P18507|P34903|P47870,GABRG2|GABRA3|GABRB2,GBRG2_HUMAN|GBRA3_HUMAN|GBRB2_HUMAN,8.876,,Ki,,WOMBAT-PK,=,1.0,CHEMBL,,https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL646,POSITIVE ALLOSTERIC MODULATOR,Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin,Homo sapiens,CC1=NN=C2CN=C(C3=CC(Cl)=CC=C3N12)C1=C(Cl)C=CC=C1,"InChI=1S/C17H12Cl2N4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3",JOFWLTCLBGQGBO-UHFFFAOYSA-N,triazolam
|
4 |
+
15266,gentian violet,4138,D(2) dopamine receptor,GPCR,P14416,DRD2,DRD2_HUMAN,5.975,,Ki,DRUGMATRIX: Dopamine D2L radioligand binding (ligand: [3H] Spiperone),DRUG MATRIX,=,,,,,,Tclin,Homo sapiens,CN(C)C1=CC=C(C=C1)C(C1=CC=C(C=C1)N(C)C)=C1C=CC(C=C1)=[N+](C)C,"InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1",LGLFFNDHMLKUMI-UHFFFAOYSA-N,gentian violet
|
5 |
+
6488,ipratropium,1475,Muscarinic acetylcholine receptor M1,GPCR,P11229,CHRM1,ACM1_HUMAN,9.31,,Ki,,WOMBAT-PK,=,,,,,,Tclin,Homo sapiens,CC(C)[N+]1(C)[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)C1=CC=CC=C1,"InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1/t16-,17+,18+,19?,21?",OEXHQOGQTVQTAT-BHIXFJMTSA-N,ipratropium
|
6 |
+
17453,deoxycholic acid,4988,G-protein coupled bile acid receptor 1,GPCR,Q8TDU6,GPBAR1,GPBAR_HUMAN,6.2,,EC50,,IUPHAR,=,,,,,AGONIST,Tchem,Homo sapiens,C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C,"InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1",KXGVEGMKQFWNSR-LLQZFEROSA-N,deoxycholic acid
|