Example biotech workspace.

examples/Bio demo

@@ -0,0 +1,461 @@
+{
+  "env": "LynxKite Graph Analytics",
+  "nodes": [
+    {
+      "id": "Import CSV 1",
+      "type": "basic",
+      "data": {
+        "title": "Import CSV",
+        "params": {
+          "columns": "<from file>",
+          "separator": "<auto>",
+          "filename": "examples/drug_target_data_sample.csv"
+        },
+        "display": null,
+        "error": null,
+        "collapsed": null,
+        "meta": {
+          "outputs": {
+            "output": {
+              "position": "right",
+              "name": "output",
+              "type": {
+                "type": "None"
+              }
+            }
+          },
+          "params": {
+            "filename": {
+              "type": {
+                "type": "<class 'str'>"
+              },
+              "default": null,
+              "name": "filename"
+            },
+            "columns": {
+              "default": "<from file>",
+              "name": "columns",
+              "type": {
+                "type": "<class 'str'>"
+              }
+            },
+            "separator": {
+              "name": "separator",
+              "default": "<auto>",
+              "type": {
+                "type": "<class 'str'>"
+              }
+            }
+          },
+          "inputs": {},
+          "type": "basic",
+          "name": "Import CSV"
+        },
+        "__execution_delay": 0.0
+      },
+      "position": {
+        "x": -91.52295913245543,
+        "y": 933.9762681038399
+      },
+      "width": 200.0,
+      "height": 200.0
+    },
+    {
+      "id": "Parse SMILES 1",
+      "type": "basic",
+      "data": {
+        "title": "Parse SMILES",
+        "params": {
+          "table": "df",
+          "save_as": "mols",
+          "smiles_column": "SMILES"
+        },
+        "display": null,
+        "error": null,
+        "meta": {
+          "name": "Parse SMILES",
+          "params": {
+            "table": {
+              "type": {
+                "type": "<class 'str'>"
+              },
+              "default": "df",
+              "name": "table"
+            },
+            "smiles_column": {
+              "type": {
+                "type": "<class 'str'>"
+              },
+              "name": "smiles_column",
+              "default": "SMILES"
+            },
+            "save_as": {
+              "type": {
+                "type": "<class 'str'>"
+              },
+              "name": "save_as",
+              "default": "mols"
+            }
+          },
+          "inputs": {
+            "bundle": {
+              "name": "bundle",
+              "type": {
+                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
+              },
+              "position": "left"
+            }
+          },
+          "outputs": {
+            "output": {
+              "position": "right",
+              "name": "output",
+              "type": {
+                "type": "None"
+              }
+            }
+          },
+          "type": "basic"
+        }
+      },
+      "position": {
+        "x": 381.1847590729871,
+        "y": 945.0
+      },
+      "height": 200.0,
+      "width": 200.0
+    },
+    {
+      "id": "Graph from molecule similarity 1",
+      "type": "basic",
+      "data": {
+        "title": "Graph from molecule similarity",
+        "params": {
+          "table": "df",
+          "mols_column": "mols",
+          "average_degree": "3"
+        },
+        "display": null,
+        "error": null,
+        "collapsed": null,
+        "meta": {
+          "params": {
+            "mols_column": {
+              "name": "mols_column",
+              "default": "mols",
+              "type": {
+                "type": "<class 'str'>"
+              }
+            },
+            "table": {
+              "type": {
+                "type": "<class 'str'>"
+              },
+              "default": "df",
+              "name": "table"
+            },
+            "average_degree": {
+              "name": "average_degree",
+              "default": 10.0,
+              "type": {
+                "type": "<class 'int'>"
+              }
+            }
+          },
+          "inputs": {
+            "bundle": {
+              "position": "left",
+              "type": {
+                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
+              },
+              "name": "bundle"
+            }
+          },
+          "outputs": {
+            "output": {
+              "type": {
+                "type": "None"
+              },
+              "position": "right",
+              "name": "output"
+            }
+          },
+          "name": "Graph from molecule similarity",
+          "type": "basic"
+        },
+        "__execution_delay": 0.0
+      },
+      "position": {
+        "x": 926.4337192214458,
+        "y": 1014.4451876264845
+      },
+      "height": 200.0,
+      "width": 200.0
+    },
+    {
+      "id": "Visualize graph 1",
+      "type": "visualization",
+      "data": {
+        "title": "Visualize graph",
+        "params": {
+          "color_edges_by": "similarity",
+          "color_nodes_by": "ORGANISM",
+          "label_by": "DRUG_NAME"
+        },
+        "display": {
+          "animationDuration": 500,
+          "animationEasingUpdate": "quinticInOut",
+          "tooltip": {
+            "show": true
+          },
+          "series": [
+            {
+              "type": "graph",
+              "lineStyle": {
+                "color": "gray",
+                "curveness": 0.3
+              },
+              "emphasis": {
+                "focus": "adjacency",
+                "lineStyle": {
+                  "width": 10
+                }
+              },
+              "label": {
+                "position": "top",
+                "formatter": "{b}"
+              },
+              "data": [
+                {
+                  "id": "0",
+                  "x": 0.10802749422637721,
+                  "y": 0.08231702235365293,
+                  "symbolSize": 22.360679774997894,
+                  "itemStyle": {
+                    "color": "#a6cee3"
+                  },
+                  "label": {
+                    "show": true
+                  },
+                  "name": "phencyclidine",
+                  "value": "Torpedo californica"
+                },
+                {
+                  "id": "1",
+                  "x": -0.21409593978467548,
+                  "y": -0.41899519488061593,
+                  "symbolSize": 22.360679774997894,
+                  "itemStyle": {
+                    "color": "#1f78b4"
+                  },
+                  "label": {
+                    "show": true
+                  },
+                  "name": "triazolam",
+                  "value": "Homo sapiens"
+                },
+                {
+                  "id": "2",
+                  "x": -0.026230797767347148,
+                  "y": 0.7208227030460969,
+                  "symbolSize": 22.360679774997894,
+                  "itemStyle": {
+                    "color": "#1f78b4"
+                  },
+                  "label": {
+                    "show": true
+                  },
+                  "name": "gentian violet",
+                  "value": "Homo sapiens"
+                },
+                {
+                  "id": "3",
+                  "x": -0.8677007566744104,
+                  "y": -0.1866160281519609,
+                  "symbolSize": 22.360679774997894,
+                  "itemStyle": {
+                    "color": "#1f78b4"
+                  },
+                  "label": {
+                    "show": true
+                  },
+                  "name": "ipratropium",
+                  "value": "Homo sapiens"
+                },
+                {
+                  "id": "4",
+                  "x": 1.0,
+                  "y": -0.19752850236718,
+                  "symbolSize": 22.360679774997894,
+                  "itemStyle": {
+                    "color": "#1f78b4"
+                  },
+                  "label": {
+                    "show": true
+                  },
+                  "name": "deoxycholic acid",
+                  "value": "Homo sapiens"
+                }
+              ],
+              "links": [
+                {
+                  "source": "3",
+                  "target": "4",
+                  "lineStyle": {
+                    "color": "#440154"
+                  },
+                  "value": 0.8481012658227848
+                },
+                {
+                  "source": "0",
+                  "target": "1",
+                  "lineStyle": {
+                    "color": "#3a538b"
+                  },
+                  "value": 0.8813559322033898
+                },
+                {
+                  "source": "0",
+                  "target": "4",
+                  "lineStyle": {
+                    "color": "#3a538b"
+                  },
+                  "value": 0.8813559322033898
+                },
+                {
+                  "source": "0",
+                  "target": "3",
+                  "lineStyle": {
+                    "color": "#26818e"
+                  },
+                  "value": 0.9047619047619048
+                },
+                {
+                  "source": "1",
+                  "target": "2",
+                  "lineStyle": {
+                    "color": "#23898d"
+                  },
+                  "value": 0.9090909090909091
+                },
+                {
+                  "source": "1",
+                  "target": "3",
+                  "lineStyle": {
+                    "color": "#1ea087"
+                  },
+                  "value": 0.921875
+                },
+                {
+                  "source": "0",
+                  "target": "2",
+                  "lineStyle": {
+                    "color": "#3ebc73"
+                  },
+                  "value": 0.9375
+                },
+                {
+                  "source": "1",
+                  "target": "4",
+                  "lineStyle": {
+                    "color": "#4fc369"
+                  },
+                  "value": 0.9420289855072463
+                },
+                {
+                  "source": "2",
+                  "target": "4",
+                  "lineStyle": {
+                    "color": "#9fd938"
+                  },
+                  "value": 0.9589041095890412
+                },
+                {
+                  "source": "2",
+                  "target": "3",
+                  "lineStyle": {
+                    "color": "#fde724"
+                  },
+                  "value": 0.9775280898876404
+                }
+              ]
+            }
+          ]
+        },
+        "error": null,
+        "__execution_delay": 0.0,
+        "meta": {
+          "inputs": {
+            "graph": {
+              "name": "graph",
+              "position": "left",
+              "type": {
+                "type": "<class 'lynxkite_graph_analytics.lynxkite_ops.Bundle'>"
+              }
+            }
+          },
+          "outputs": {},
+          "type": "visualization",
+          "params": {
+            "color_edges_by": {
+              "name": "color_edges_by",
+              "default": null,
+              "type": {
+                "format": "edge attribute"
+              }
+            },
+            "color_nodes_by": {
+              "default": null,
+              "type": {
+                "format": "node attribute"
+              },
+              "name": "color_nodes_by"
+            },
+            "label_by": {
+              "name": "label_by",
+              "default": null,
+              "type": {
+                "format": "node attribute"
+              }
+            }
+          },
+          "position": {
+            "x": 883.0,
+            "y": 167.0
+          },
+          "name": "Visualize graph"
+        },
+        "collapsed": null
+      },
+      "position": {
+        "x": 1530.0,
+        "y": 915.0
+      },
+      "width": 407.0,
+      "height": 314.0
+    }
+  ],
+  "edges": [
+    {
+      "id": "Import CSV 1 Parse SMILES 1",
+      "source": "Import CSV 1",
+      "target": "Parse SMILES 1",
+      "sourceHandle": "output",
+      "targetHandle": "bundle"
+    },
+    {
+      "id": "Parse SMILES 1 Graph from molecule similarity 1",
+      "source": "Parse SMILES 1",
+      "target": "Graph from molecule similarity 1",
+      "sourceHandle": "output",
+      "targetHandle": "bundle"
+    },
+    {
+      "id": "Graph from molecule similarity 1 Visualize graph 1",
+      "source": "Graph from molecule similarity 1",
+      "target": "Visualize graph 1",
+      "sourceHandle": "output",
+      "targetHandle": "graph"
+    }
+  ]
+}

examples/drug_target_data_sample.csv

@@ -0,0 +1,6 @@
+Unnamed: 0,DRUG_NAME,STRUCT_ID,TARGET_NAME,TARGET_CLASS,ACCESSION,GENE,SWISSPROT,ACT_VALUE,ACT_UNIT,ACT_TYPE,ACT_COMMENT,ACT_SOURCE,RELATION,MOA,MOA_SOURCE,ACT_SOURCE_URL,MOA_SOURCE_URL,ACTION_TYPE,TDL,ORGANISM,SMILES,InChI,InChIKey,INN
+9737,phencyclidine,2121,Acetylcholine receptor subunit alpha,Ion channel,P02710,CHRNA1,ACHA_TORCA,6.66,,IC50,Displacement of [3H]PCP from nAChR in Torpedo nobiliana electric organs membranes in presence of 100 uM carbachol by scintillation counting method,CHEMBL,=,,,,,,,Torpedo californica,C1CCN(CC1)C1(CCCCC1)C1=CC=CC=C1,"InChI=1S/C17H25N/c1-4-10-16(11-5-1)17(12-6-2-7-13-17)18-14-8-3-9-15-18/h1,4-5,10-11H,2-3,6-9,12-15H2",JTJMJGYZQZDUJJ-UHFFFAOYSA-N,phencyclidine
+12934,triazolam,2729,GABA A receptor alpha-3/beta-2/gamma-2,Ion channel,P18507|P34903|P47870,GABRG2|GABRA3|GABRB2,GBRG2_HUMAN|GBRA3_HUMAN|GBRB2_HUMAN,8.876,,Ki,,WOMBAT-PK,=,1.0,CHEMBL,,https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL646,POSITIVE ALLOSTERIC MODULATOR,Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin|Tclin,Homo sapiens,CC1=NN=C2CN=C(C3=CC(Cl)=CC=C3N12)C1=C(Cl)C=CC=C1,"InChI=1S/C17H12Cl2N4/c1-10-21-22-16-9-20-17(12-4-2-3-5-14(12)19)13-8-11(18)6-7-15(13)23(10)16/h2-8H,9H2,1H3",JOFWLTCLBGQGBO-UHFFFAOYSA-N,triazolam
+15266,gentian violet,4138,D(2) dopamine receptor,GPCR,P14416,DRD2,DRD2_HUMAN,5.975,,Ki,DRUGMATRIX: Dopamine D2L radioligand binding (ligand: [3H] Spiperone),DRUG MATRIX,=,,,,,,Tclin,Homo sapiens,CN(C)C1=CC=C(C=C1)C(C1=CC=C(C=C1)N(C)C)=C1C=CC(C=C1)=[N+](C)C,"InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1",LGLFFNDHMLKUMI-UHFFFAOYSA-N,gentian violet
+6488,ipratropium,1475,Muscarinic acetylcholine receptor M1,GPCR,P11229,CHRM1,ACM1_HUMAN,9.31,,Ki,,WOMBAT-PK,=,,,,,,Tclin,Homo sapiens,CC(C)[N+]1(C)[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(CO)C1=CC=CC=C1,"InChI=1S/C20H30NO3/c1-14(2)21(3)16-9-10-17(21)12-18(11-16)24-20(23)19(13-22)15-7-5-4-6-8-15/h4-8,14,16-19,22H,9-13H2,1-3H3/q+1/t16-,17+,18+,19?,21?",OEXHQOGQTVQTAT-BHIXFJMTSA-N,ipratropium
+17453,deoxycholic acid,4988,G-protein coupled bile acid receptor 1,GPCR,Q8TDU6,GPBAR1,GPBAR_HUMAN,6.2,,EC50,,IUPHAR,=,,,,,AGONIST,Tchem,Homo sapiens,C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C,"InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1",KXGVEGMKQFWNSR-LLQZFEROSA-N,deoxycholic acid