file_name
large_stringlengths
4
140
prefix
large_stringlengths
0
39k
suffix
large_stringlengths
0
36.1k
middle
large_stringlengths
0
29.4k
fim_type
large_stringclasses
4 values
kubernetes.go
// Copyright (c) 2017 Pulcy. // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. package kubernetes import ( "encoding/json" "fmt" "io/ioutil" "net" "net/http" "net/url" "os" "strconv" "sync" "github.com/juju/errgo" "github.com/op/go-logging" "github.com/spf13/pflag" k8s "github.com/YakLabs/k8s-client" k8s_http "github.com/YakLabs/k8s-client/http" api "github.com/pulcy/prometheus-conf-api" "github.com/pulcy/prometheus-conf/service" "github.com/pulcy/prometheus-conf/util" ) var ( maskAny = errgo.MaskFunc(errgo.Any) ) const ( logName = "kubernetes" metricsAnnotation = "j2.pulcy.com/metrics" maxRecentErrors = 30 ) type k8sPlugin struct { LogLevel string ETCDTLSConfig service.TLSConfig KubeletTLSConfig service.TLSConfig log *logging.Logger client k8s.Client lastUpdate *k8sUpdate recentErrors int nodeExporterPort int } type k8sUpdate struct { log *logging.Logger nodeExporterPort int nodes []k8s.Node services []k8s.Service etcdTLSConfig service.TLSConfig kubeletTLSConfig service.TLSConfig } func init() { service.RegisterPlugin("kubernetes", &k8sPlugin{ log: logging.MustGetLogger(logName), }) } // Configure the command line flags needed by the plugin. func (p *k8sPlugin) Setup(flagSet *pflag.FlagSet) { flagSet.StringVar(&p.ETCDTLSConfig.CAFile, "kubernetes-etcd-ca-file", "", "CA certificate used by ETCD") flagSet.StringVar(&p.ETCDTLSConfig.CertFile, "kubernetes-etcd-cert-file", "", "Public key file used by ETCD") flagSet.StringVar(&p.ETCDTLSConfig.KeyFile, "kubernetes-etcd-key-file", "", "Private key file used by ETCD") flagSet.StringVar(&p.KubeletTLSConfig.CAFile, "kubelet-ca-file", "", "CA certificate used by Kubelet") flagSet.StringVar(&p.KubeletTLSConfig.CertFile, "kubelet-cert-file", "", "Public key file used by Kubelet") flagSet.StringVar(&p.KubeletTLSConfig.KeyFile, "kubelet-key-file", "", "Private key file used by Kubelet") flagSet.StringVar(&p.LogLevel, "kubernetes-log-level", "", "Log level of kubernetes plugin") } // Start the plugin. Send a value on the given channel to trigger an update of the configuration. func (p *k8sPlugin) Start(config service.ServiceConfig, trigger chan string) error { if err := util.SetLogLevel(p.LogLevel, config.LogLevel, logName); err != nil { return maskAny(err) } // Setup kubernetes client p.nodeExporterPort = config.NodeExporterPort c, err := k8s_http.NewInCluster() if err != nil { p.log.Infof("No kubernetes available: %v", err) return nil } p.client = c // Watch nodes for changes go func() { for { nodeEvents := make(chan k8s.NodeWatchEvent) go func() { for evt := range nodeEvents { if evt.Type() == k8s.WatchEventTypeAdded || evt.Type() == k8s.WatchEventTypeDeleted { p.log.Debugf("got node event of type %s", evt.Type()) trigger <- fmt.Sprintf("node-%s", evt.Type()) } } }() if err := p.client.WatchNodes(nil, nodeEvents); err != nil { p.log.Errorf("failed to watch nodes: %#v", err) } } }() // Watch services for changes go func() { for { serviceEvents := make(chan k8s.ServiceWatchEvent) go func() { for evt := range serviceEvents { p.log.Debugf("got service event of type %s", evt.Type()) trigger <- fmt.Sprintf("service-%s", evt.Type()) } }() if err := p.client.WatchServices("", nil, serviceEvents); err != nil { p.log.Errorf("failed to watch services: %#v", err) } } }() // No custom triggers here, just update once in a while. return nil } func (p *k8sPlugin)
() (service.PluginUpdate, error) { if p.client == nil { return nil, nil } // Get nodes p.log.Debugf("fetching kubernetes nodes") nodes, nodesErr := p.client.ListNodes(nil) // Get services p.log.Debugf("fetching kubernetes services") services, servicesErr := p.client.ListServices("", nil) if nodesErr != nil || servicesErr != nil { if nodesErr != nil { p.log.Warningf("Failed to fetch kubernetes nodes: %#v (using previous ones)", nodesErr) } if servicesErr != nil { p.log.Warningf("Failed to fetch kubernetes services: %#v (using previous ones)", servicesErr) } p.recentErrors++ if p.recentErrors > maxRecentErrors { p.log.Warningf("Too many recent kubernetes errors, restarting") os.Exit(1) } return p.lastUpdate, nil } else { p.recentErrors = 0 update := &k8sUpdate{ log: p.log, nodeExporterPort: p.nodeExporterPort, nodes: nodes.Items, services: services.Items, etcdTLSConfig: p.ETCDTLSConfig, kubeletTLSConfig: p.KubeletTLSConfig, } p.lastUpdate = update return update, nil } } // Extract data from fleet to create node_exporter targets func (p *k8sUpdate) CreateNodes() ([]service.ScrapeConfig, error) { // Build scrape config list scNode := service.StaticConfig{} scNode.Label("source", "node") scEtcd := service.StaticConfig{} scEtcd.Label("source", "etcd") for _, node := range p.nodes { for _, addr := range node.Status.Addresses { if addr.Type == "InternalIP" { ip := addr.Address p.log.Debugf("found kubernetes node %s", ip) scNode.Targets = append(scNode.Targets, fmt.Sprintf("%s:%d", ip, p.nodeExporterPort)) if node.Labels["core"] == "true" { scEtcd.Targets = append(scEtcd.Targets, fmt.Sprintf("%s:2379", ip)) } } } } scrapeConfigNode := service.ScrapeConfig{ JobName: "node", StaticConfigs: []service.StaticConfig{scNode}, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, }, } scrapeConfigETCD := service.ScrapeConfig{ JobName: "etcd", StaticConfigs: []service.StaticConfig{scEtcd}, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ Action: "labeldrop", Regex: "etcd_debugging.*", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, }, } if p.etcdTLSConfig.IsConfigured() { scrapeConfigETCD.Scheme = "https" scrapeConfigETCD.TLSConfig = &service.TLSConfig{ CAFile: p.etcdTLSConfig.CAFile, CertFile: p.etcdTLSConfig.CertFile, KeyFile: p.etcdTLSConfig.KeyFile, InsecureSkipVerify: true, } } scrapeConfigK8sNodes := service.ScrapeConfig{ JobName: "kubernetes-nodes", ScrapeInterval: "5m", KubernetesConfigs: []service.KubernetesSDConfig{ service.KubernetesSDConfig{ Role: "node", }, }, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ Action: "labelmap", Regex: "__meta_kubernetes_node_label_(.+)", }, }, } if p.kubeletTLSConfig.IsConfigured() { scrapeConfigK8sNodes.Scheme = "https" scrapeConfigK8sNodes.TLSConfig = &service.TLSConfig{ CAFile: p.kubeletTLSConfig.CAFile, CertFile: p.kubeletTLSConfig.CertFile, KeyFile: p.kubeletTLSConfig.KeyFile, InsecureSkipVerify: true, } } scrapeConfigK8sEndpoinds := service.ScrapeConfig{ JobName: "kubernetes-endpoints", KubernetesConfigs: []service.KubernetesSDConfig{ service.KubernetesSDConfig{ Role: "endpoints", }, }, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_scrape"}, Action: "keep", Regex: "true", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_scheme"}, Action: "replace", TargetLabel: "__scheme__", Regex: "(https?)", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_path"}, Action: "replace", TargetLabel: "__metrics_path__", Regex: "(.+)", }, service.RelabelConfig{ SourceLabels: []string{"__address__", "__meta_kubernetes_service_annotation_prometheus_io_port"}, Action: "replace", TargetLabel: "__address__", Regex: `(.+)(?::\d+);(\d+)`, Replacement: "$1:$2", }, service.RelabelConfig{ Action: "labelmap", Regex: "__meta_kubernetes_service_label_(.+)", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_namespace"}, Action: "replace", TargetLabel: "kubernetes_namespace", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_pod_name"}, Action: "replace", TargetLabel: "kubernetes_pod_name", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, service.RelabelConfig{ SourceLabels: []string{"j2_job_name"}, Action: "replace", TargetLabel: "job", }, service.RelabelConfig{ SourceLabels: []string{"j2_taskgroup_name"}, Action: "replace", TargetLabel: "taskgroup", }, }, } return []service.ScrapeConfig{scrapeConfigNode, scrapeConfigETCD, scrapeConfigK8sNodes, scrapeConfigK8sEndpoinds}, nil } // CreateRules creates all rules this plugin is aware of. // The returns string list should contain the content of the various rules. func (p *k8sUpdate) CreateRules() ([]string, error) { // Build URL list var urls []string for _, svc := range p.services { ann, ok := svc.Annotations[metricsAnnotation] if !ok || ann == "" { continue } var metricsRecords []api.MetricsServiceRecord if err := json.Unmarshal([]byte(ann), &metricsRecords); err != nil { p.log.Errorf("Failed to unmarshal metrics annotation in service '%s.%s': %#v", svc.Namespace, svc.Name, err) continue } // Get service IP if svc.Spec.Type != k8s.ServiceTypeClusterIP { p.log.Errorf("Cannot put metrics rules in services of type other than ClusterIP ('%s.%s')", svc.Namespace, svc.Name) continue } clusterIP := svc.Spec.ClusterIP // Collect URLs for _, m := range metricsRecords { if m.RulesPath == "" { continue } u := url.URL{ Scheme: "http", Host: net.JoinHostPort(clusterIP, strconv.Itoa(m.ServicePort)), Path: m.RulesPath, } urls = append(urls, u.String()) } } if len(urls) == 0 { return nil, nil } // Fetch rules from URLs rulesChan := make(chan string, len(urls)) wg := sync.WaitGroup{} for _, url := range urls { wg.Add(1) go func(url string) { defer wg.Done() p.log.Debugf("fetching rules from %s", url) resp, err := http.Get(url) if err != nil { p.log.Errorf("Failed to fetch rule from '%s': %#v", url, err) return } if resp.StatusCode < 200 || resp.StatusCode >= 300 { p.log.Errorf("Failed to fetch rule from '%s': Status %d", url, resp.StatusCode) return } defer resp.Body.Close() raw, err := ioutil.ReadAll(resp.Body) if err != nil { p.log.Errorf("Failed to read rule from '%s': %#v", url, err) return } rulesChan <- string(raw) p.log.Debugf("done fetching rules from %s", url) }(url) } wg.Wait() close(rulesChan) var result []string for rule := range rulesChan { result = append(result, rule) } p.log.Debugf("Found %d rules", len(result)) return result, nil }
Update
identifier_name
kubernetes.go
// Copyright (c) 2017 Pulcy. // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. package kubernetes import ( "encoding/json" "fmt" "io/ioutil" "net" "net/http" "net/url" "os" "strconv" "sync" "github.com/juju/errgo" "github.com/op/go-logging" "github.com/spf13/pflag" k8s "github.com/YakLabs/k8s-client" k8s_http "github.com/YakLabs/k8s-client/http" api "github.com/pulcy/prometheus-conf-api" "github.com/pulcy/prometheus-conf/service" "github.com/pulcy/prometheus-conf/util" ) var ( maskAny = errgo.MaskFunc(errgo.Any) ) const ( logName = "kubernetes" metricsAnnotation = "j2.pulcy.com/metrics" maxRecentErrors = 30 ) type k8sPlugin struct { LogLevel string ETCDTLSConfig service.TLSConfig KubeletTLSConfig service.TLSConfig log *logging.Logger client k8s.Client lastUpdate *k8sUpdate recentErrors int nodeExporterPort int } type k8sUpdate struct { log *logging.Logger nodeExporterPort int nodes []k8s.Node services []k8s.Service etcdTLSConfig service.TLSConfig kubeletTLSConfig service.TLSConfig } func init() { service.RegisterPlugin("kubernetes", &k8sPlugin{ log: logging.MustGetLogger(logName), }) }
flagSet.StringVar(&p.ETCDTLSConfig.KeyFile, "kubernetes-etcd-key-file", "", "Private key file used by ETCD") flagSet.StringVar(&p.KubeletTLSConfig.CAFile, "kubelet-ca-file", "", "CA certificate used by Kubelet") flagSet.StringVar(&p.KubeletTLSConfig.CertFile, "kubelet-cert-file", "", "Public key file used by Kubelet") flagSet.StringVar(&p.KubeletTLSConfig.KeyFile, "kubelet-key-file", "", "Private key file used by Kubelet") flagSet.StringVar(&p.LogLevel, "kubernetes-log-level", "", "Log level of kubernetes plugin") } // Start the plugin. Send a value on the given channel to trigger an update of the configuration. func (p *k8sPlugin) Start(config service.ServiceConfig, trigger chan string) error { if err := util.SetLogLevel(p.LogLevel, config.LogLevel, logName); err != nil { return maskAny(err) } // Setup kubernetes client p.nodeExporterPort = config.NodeExporterPort c, err := k8s_http.NewInCluster() if err != nil { p.log.Infof("No kubernetes available: %v", err) return nil } p.client = c // Watch nodes for changes go func() { for { nodeEvents := make(chan k8s.NodeWatchEvent) go func() { for evt := range nodeEvents { if evt.Type() == k8s.WatchEventTypeAdded || evt.Type() == k8s.WatchEventTypeDeleted { p.log.Debugf("got node event of type %s", evt.Type()) trigger <- fmt.Sprintf("node-%s", evt.Type()) } } }() if err := p.client.WatchNodes(nil, nodeEvents); err != nil { p.log.Errorf("failed to watch nodes: %#v", err) } } }() // Watch services for changes go func() { for { serviceEvents := make(chan k8s.ServiceWatchEvent) go func() { for evt := range serviceEvents { p.log.Debugf("got service event of type %s", evt.Type()) trigger <- fmt.Sprintf("service-%s", evt.Type()) } }() if err := p.client.WatchServices("", nil, serviceEvents); err != nil { p.log.Errorf("failed to watch services: %#v", err) } } }() // No custom triggers here, just update once in a while. return nil } func (p *k8sPlugin) Update() (service.PluginUpdate, error) { if p.client == nil { return nil, nil } // Get nodes p.log.Debugf("fetching kubernetes nodes") nodes, nodesErr := p.client.ListNodes(nil) // Get services p.log.Debugf("fetching kubernetes services") services, servicesErr := p.client.ListServices("", nil) if nodesErr != nil || servicesErr != nil { if nodesErr != nil { p.log.Warningf("Failed to fetch kubernetes nodes: %#v (using previous ones)", nodesErr) } if servicesErr != nil { p.log.Warningf("Failed to fetch kubernetes services: %#v (using previous ones)", servicesErr) } p.recentErrors++ if p.recentErrors > maxRecentErrors { p.log.Warningf("Too many recent kubernetes errors, restarting") os.Exit(1) } return p.lastUpdate, nil } else { p.recentErrors = 0 update := &k8sUpdate{ log: p.log, nodeExporterPort: p.nodeExporterPort, nodes: nodes.Items, services: services.Items, etcdTLSConfig: p.ETCDTLSConfig, kubeletTLSConfig: p.KubeletTLSConfig, } p.lastUpdate = update return update, nil } } // Extract data from fleet to create node_exporter targets func (p *k8sUpdate) CreateNodes() ([]service.ScrapeConfig, error) { // Build scrape config list scNode := service.StaticConfig{} scNode.Label("source", "node") scEtcd := service.StaticConfig{} scEtcd.Label("source", "etcd") for _, node := range p.nodes { for _, addr := range node.Status.Addresses { if addr.Type == "InternalIP" { ip := addr.Address p.log.Debugf("found kubernetes node %s", ip) scNode.Targets = append(scNode.Targets, fmt.Sprintf("%s:%d", ip, p.nodeExporterPort)) if node.Labels["core"] == "true" { scEtcd.Targets = append(scEtcd.Targets, fmt.Sprintf("%s:2379", ip)) } } } } scrapeConfigNode := service.ScrapeConfig{ JobName: "node", StaticConfigs: []service.StaticConfig{scNode}, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, }, } scrapeConfigETCD := service.ScrapeConfig{ JobName: "etcd", StaticConfigs: []service.StaticConfig{scEtcd}, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ Action: "labeldrop", Regex: "etcd_debugging.*", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, }, } if p.etcdTLSConfig.IsConfigured() { scrapeConfigETCD.Scheme = "https" scrapeConfigETCD.TLSConfig = &service.TLSConfig{ CAFile: p.etcdTLSConfig.CAFile, CertFile: p.etcdTLSConfig.CertFile, KeyFile: p.etcdTLSConfig.KeyFile, InsecureSkipVerify: true, } } scrapeConfigK8sNodes := service.ScrapeConfig{ JobName: "kubernetes-nodes", ScrapeInterval: "5m", KubernetesConfigs: []service.KubernetesSDConfig{ service.KubernetesSDConfig{ Role: "node", }, }, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ Action: "labelmap", Regex: "__meta_kubernetes_node_label_(.+)", }, }, } if p.kubeletTLSConfig.IsConfigured() { scrapeConfigK8sNodes.Scheme = "https" scrapeConfigK8sNodes.TLSConfig = &service.TLSConfig{ CAFile: p.kubeletTLSConfig.CAFile, CertFile: p.kubeletTLSConfig.CertFile, KeyFile: p.kubeletTLSConfig.KeyFile, InsecureSkipVerify: true, } } scrapeConfigK8sEndpoinds := service.ScrapeConfig{ JobName: "kubernetes-endpoints", KubernetesConfigs: []service.KubernetesSDConfig{ service.KubernetesSDConfig{ Role: "endpoints", }, }, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_scrape"}, Action: "keep", Regex: "true", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_scheme"}, Action: "replace", TargetLabel: "__scheme__", Regex: "(https?)", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_path"}, Action: "replace", TargetLabel: "__metrics_path__", Regex: "(.+)", }, service.RelabelConfig{ SourceLabels: []string{"__address__", "__meta_kubernetes_service_annotation_prometheus_io_port"}, Action: "replace", TargetLabel: "__address__", Regex: `(.+)(?::\d+);(\d+)`, Replacement: "$1:$2", }, service.RelabelConfig{ Action: "labelmap", Regex: "__meta_kubernetes_service_label_(.+)", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_namespace"}, Action: "replace", TargetLabel: "kubernetes_namespace", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_pod_name"}, Action: "replace", TargetLabel: "kubernetes_pod_name", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, service.RelabelConfig{ SourceLabels: []string{"j2_job_name"}, Action: "replace", TargetLabel: "job", }, service.RelabelConfig{ SourceLabels: []string{"j2_taskgroup_name"}, Action: "replace", TargetLabel: "taskgroup", }, }, } return []service.ScrapeConfig{scrapeConfigNode, scrapeConfigETCD, scrapeConfigK8sNodes, scrapeConfigK8sEndpoinds}, nil } // CreateRules creates all rules this plugin is aware of. // The returns string list should contain the content of the various rules. func (p *k8sUpdate) CreateRules() ([]string, error) { // Build URL list var urls []string for _, svc := range p.services { ann, ok := svc.Annotations[metricsAnnotation] if !ok || ann == "" { continue } var metricsRecords []api.MetricsServiceRecord if err := json.Unmarshal([]byte(ann), &metricsRecords); err != nil { p.log.Errorf("Failed to unmarshal metrics annotation in service '%s.%s': %#v", svc.Namespace, svc.Name, err) continue } // Get service IP if svc.Spec.Type != k8s.ServiceTypeClusterIP { p.log.Errorf("Cannot put metrics rules in services of type other than ClusterIP ('%s.%s')", svc.Namespace, svc.Name) continue } clusterIP := svc.Spec.ClusterIP // Collect URLs for _, m := range metricsRecords { if m.RulesPath == "" { continue } u := url.URL{ Scheme: "http", Host: net.JoinHostPort(clusterIP, strconv.Itoa(m.ServicePort)), Path: m.RulesPath, } urls = append(urls, u.String()) } } if len(urls) == 0 { return nil, nil } // Fetch rules from URLs rulesChan := make(chan string, len(urls)) wg := sync.WaitGroup{} for _, url := range urls { wg.Add(1) go func(url string) { defer wg.Done() p.log.Debugf("fetching rules from %s", url) resp, err := http.Get(url) if err != nil { p.log.Errorf("Failed to fetch rule from '%s': %#v", url, err) return } if resp.StatusCode < 200 || resp.StatusCode >= 300 { p.log.Errorf("Failed to fetch rule from '%s': Status %d", url, resp.StatusCode) return } defer resp.Body.Close() raw, err := ioutil.ReadAll(resp.Body) if err != nil { p.log.Errorf("Failed to read rule from '%s': %#v", url, err) return } rulesChan <- string(raw) p.log.Debugf("done fetching rules from %s", url) }(url) } wg.Wait() close(rulesChan) var result []string for rule := range rulesChan { result = append(result, rule) } p.log.Debugf("Found %d rules", len(result)) return result, nil }
// Configure the command line flags needed by the plugin. func (p *k8sPlugin) Setup(flagSet *pflag.FlagSet) { flagSet.StringVar(&p.ETCDTLSConfig.CAFile, "kubernetes-etcd-ca-file", "", "CA certificate used by ETCD") flagSet.StringVar(&p.ETCDTLSConfig.CertFile, "kubernetes-etcd-cert-file", "", "Public key file used by ETCD")
random_line_split
kubernetes.go
// Copyright (c) 2017 Pulcy. // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. package kubernetes import ( "encoding/json" "fmt" "io/ioutil" "net" "net/http" "net/url" "os" "strconv" "sync" "github.com/juju/errgo" "github.com/op/go-logging" "github.com/spf13/pflag" k8s "github.com/YakLabs/k8s-client" k8s_http "github.com/YakLabs/k8s-client/http" api "github.com/pulcy/prometheus-conf-api" "github.com/pulcy/prometheus-conf/service" "github.com/pulcy/prometheus-conf/util" ) var ( maskAny = errgo.MaskFunc(errgo.Any) ) const ( logName = "kubernetes" metricsAnnotation = "j2.pulcy.com/metrics" maxRecentErrors = 30 ) type k8sPlugin struct { LogLevel string ETCDTLSConfig service.TLSConfig KubeletTLSConfig service.TLSConfig log *logging.Logger client k8s.Client lastUpdate *k8sUpdate recentErrors int nodeExporterPort int } type k8sUpdate struct { log *logging.Logger nodeExporterPort int nodes []k8s.Node services []k8s.Service etcdTLSConfig service.TLSConfig kubeletTLSConfig service.TLSConfig } func init() { service.RegisterPlugin("kubernetes", &k8sPlugin{ log: logging.MustGetLogger(logName), }) } // Configure the command line flags needed by the plugin. func (p *k8sPlugin) Setup(flagSet *pflag.FlagSet)
// Start the plugin. Send a value on the given channel to trigger an update of the configuration. func (p *k8sPlugin) Start(config service.ServiceConfig, trigger chan string) error { if err := util.SetLogLevel(p.LogLevel, config.LogLevel, logName); err != nil { return maskAny(err) } // Setup kubernetes client p.nodeExporterPort = config.NodeExporterPort c, err := k8s_http.NewInCluster() if err != nil { p.log.Infof("No kubernetes available: %v", err) return nil } p.client = c // Watch nodes for changes go func() { for { nodeEvents := make(chan k8s.NodeWatchEvent) go func() { for evt := range nodeEvents { if evt.Type() == k8s.WatchEventTypeAdded || evt.Type() == k8s.WatchEventTypeDeleted { p.log.Debugf("got node event of type %s", evt.Type()) trigger <- fmt.Sprintf("node-%s", evt.Type()) } } }() if err := p.client.WatchNodes(nil, nodeEvents); err != nil { p.log.Errorf("failed to watch nodes: %#v", err) } } }() // Watch services for changes go func() { for { serviceEvents := make(chan k8s.ServiceWatchEvent) go func() { for evt := range serviceEvents { p.log.Debugf("got service event of type %s", evt.Type()) trigger <- fmt.Sprintf("service-%s", evt.Type()) } }() if err := p.client.WatchServices("", nil, serviceEvents); err != nil { p.log.Errorf("failed to watch services: %#v", err) } } }() // No custom triggers here, just update once in a while. return nil } func (p *k8sPlugin) Update() (service.PluginUpdate, error) { if p.client == nil { return nil, nil } // Get nodes p.log.Debugf("fetching kubernetes nodes") nodes, nodesErr := p.client.ListNodes(nil) // Get services p.log.Debugf("fetching kubernetes services") services, servicesErr := p.client.ListServices("", nil) if nodesErr != nil || servicesErr != nil { if nodesErr != nil { p.log.Warningf("Failed to fetch kubernetes nodes: %#v (using previous ones)", nodesErr) } if servicesErr != nil { p.log.Warningf("Failed to fetch kubernetes services: %#v (using previous ones)", servicesErr) } p.recentErrors++ if p.recentErrors > maxRecentErrors { p.log.Warningf("Too many recent kubernetes errors, restarting") os.Exit(1) } return p.lastUpdate, nil } else { p.recentErrors = 0 update := &k8sUpdate{ log: p.log, nodeExporterPort: p.nodeExporterPort, nodes: nodes.Items, services: services.Items, etcdTLSConfig: p.ETCDTLSConfig, kubeletTLSConfig: p.KubeletTLSConfig, } p.lastUpdate = update return update, nil } } // Extract data from fleet to create node_exporter targets func (p *k8sUpdate) CreateNodes() ([]service.ScrapeConfig, error) { // Build scrape config list scNode := service.StaticConfig{} scNode.Label("source", "node") scEtcd := service.StaticConfig{} scEtcd.Label("source", "etcd") for _, node := range p.nodes { for _, addr := range node.Status.Addresses { if addr.Type == "InternalIP" { ip := addr.Address p.log.Debugf("found kubernetes node %s", ip) scNode.Targets = append(scNode.Targets, fmt.Sprintf("%s:%d", ip, p.nodeExporterPort)) if node.Labels["core"] == "true" { scEtcd.Targets = append(scEtcd.Targets, fmt.Sprintf("%s:2379", ip)) } } } } scrapeConfigNode := service.ScrapeConfig{ JobName: "node", StaticConfigs: []service.StaticConfig{scNode}, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, }, } scrapeConfigETCD := service.ScrapeConfig{ JobName: "etcd", StaticConfigs: []service.StaticConfig{scEtcd}, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ Action: "labeldrop", Regex: "etcd_debugging.*", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, }, } if p.etcdTLSConfig.IsConfigured() { scrapeConfigETCD.Scheme = "https" scrapeConfigETCD.TLSConfig = &service.TLSConfig{ CAFile: p.etcdTLSConfig.CAFile, CertFile: p.etcdTLSConfig.CertFile, KeyFile: p.etcdTLSConfig.KeyFile, InsecureSkipVerify: true, } } scrapeConfigK8sNodes := service.ScrapeConfig{ JobName: "kubernetes-nodes", ScrapeInterval: "5m", KubernetesConfigs: []service.KubernetesSDConfig{ service.KubernetesSDConfig{ Role: "node", }, }, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ Action: "labelmap", Regex: "__meta_kubernetes_node_label_(.+)", }, }, } if p.kubeletTLSConfig.IsConfigured() { scrapeConfigK8sNodes.Scheme = "https" scrapeConfigK8sNodes.TLSConfig = &service.TLSConfig{ CAFile: p.kubeletTLSConfig.CAFile, CertFile: p.kubeletTLSConfig.CertFile, KeyFile: p.kubeletTLSConfig.KeyFile, InsecureSkipVerify: true, } } scrapeConfigK8sEndpoinds := service.ScrapeConfig{ JobName: "kubernetes-endpoints", KubernetesConfigs: []service.KubernetesSDConfig{ service.KubernetesSDConfig{ Role: "endpoints", }, }, RelabelConfigs: []service.RelabelConfig{ service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_scrape"}, Action: "keep", Regex: "true", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_scheme"}, Action: "replace", TargetLabel: "__scheme__", Regex: "(https?)", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_service_annotation_prometheus_io_path"}, Action: "replace", TargetLabel: "__metrics_path__", Regex: "(.+)", }, service.RelabelConfig{ SourceLabels: []string{"__address__", "__meta_kubernetes_service_annotation_prometheus_io_port"}, Action: "replace", TargetLabel: "__address__", Regex: `(.+)(?::\d+);(\d+)`, Replacement: "$1:$2", }, service.RelabelConfig{ Action: "labelmap", Regex: "__meta_kubernetes_service_label_(.+)", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_namespace"}, Action: "replace", TargetLabel: "kubernetes_namespace", }, service.RelabelConfig{ SourceLabels: []string{"__meta_kubernetes_pod_name"}, Action: "replace", TargetLabel: "kubernetes_pod_name", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "instance", Regex: `(.+)(?::)(\d+)`, Replacement: "$1", }, service.RelabelConfig{ SourceLabels: []string{"__address__"}, Action: "replace", TargetLabel: "port", Regex: `(.+)(?::)(\d+)`, Replacement: "$2", }, service.RelabelConfig{ SourceLabels: []string{"j2_job_name"}, Action: "replace", TargetLabel: "job", }, service.RelabelConfig{ SourceLabels: []string{"j2_taskgroup_name"}, Action: "replace", TargetLabel: "taskgroup", }, }, } return []service.ScrapeConfig{scrapeConfigNode, scrapeConfigETCD, scrapeConfigK8sNodes, scrapeConfigK8sEndpoinds}, nil } // CreateRules creates all rules this plugin is aware of. // The returns string list should contain the content of the various rules. func (p *k8sUpdate) CreateRules() ([]string, error) { // Build URL list var urls []string for _, svc := range p.services { ann, ok := svc.Annotations[metricsAnnotation] if !ok || ann == "" { continue } var metricsRecords []api.MetricsServiceRecord if err := json.Unmarshal([]byte(ann), &metricsRecords); err != nil { p.log.Errorf("Failed to unmarshal metrics annotation in service '%s.%s': %#v", svc.Namespace, svc.Name, err) continue } // Get service IP if svc.Spec.Type != k8s.ServiceTypeClusterIP { p.log.Errorf("Cannot put metrics rules in services of type other than ClusterIP ('%s.%s')", svc.Namespace, svc.Name) continue } clusterIP := svc.Spec.ClusterIP // Collect URLs for _, m := range metricsRecords { if m.RulesPath == "" { continue } u := url.URL{ Scheme: "http", Host: net.JoinHostPort(clusterIP, strconv.Itoa(m.ServicePort)), Path: m.RulesPath, } urls = append(urls, u.String()) } } if len(urls) == 0 { return nil, nil } // Fetch rules from URLs rulesChan := make(chan string, len(urls)) wg := sync.WaitGroup{} for _, url := range urls { wg.Add(1) go func(url string) { defer wg.Done() p.log.Debugf("fetching rules from %s", url) resp, err := http.Get(url) if err != nil { p.log.Errorf("Failed to fetch rule from '%s': %#v", url, err) return } if resp.StatusCode < 200 || resp.StatusCode >= 300 { p.log.Errorf("Failed to fetch rule from '%s': Status %d", url, resp.StatusCode) return } defer resp.Body.Close() raw, err := ioutil.ReadAll(resp.Body) if err != nil { p.log.Errorf("Failed to read rule from '%s': %#v", url, err) return } rulesChan <- string(raw) p.log.Debugf("done fetching rules from %s", url) }(url) } wg.Wait() close(rulesChan) var result []string for rule := range rulesChan { result = append(result, rule) } p.log.Debugf("Found %d rules", len(result)) return result, nil }
{ flagSet.StringVar(&p.ETCDTLSConfig.CAFile, "kubernetes-etcd-ca-file", "", "CA certificate used by ETCD") flagSet.StringVar(&p.ETCDTLSConfig.CertFile, "kubernetes-etcd-cert-file", "", "Public key file used by ETCD") flagSet.StringVar(&p.ETCDTLSConfig.KeyFile, "kubernetes-etcd-key-file", "", "Private key file used by ETCD") flagSet.StringVar(&p.KubeletTLSConfig.CAFile, "kubelet-ca-file", "", "CA certificate used by Kubelet") flagSet.StringVar(&p.KubeletTLSConfig.CertFile, "kubelet-cert-file", "", "Public key file used by Kubelet") flagSet.StringVar(&p.KubeletTLSConfig.KeyFile, "kubelet-key-file", "", "Private key file used by Kubelet") flagSet.StringVar(&p.LogLevel, "kubernetes-log-level", "", "Log level of kubernetes plugin") }
identifier_body
tracing.py
import re import uuid import contextlib from datetime import datetime import sentry_sdk from sentry_sdk.utils import capture_internal_exceptions, logger, to_string from sentry_sdk._compat import PY2 from sentry_sdk._types import MYPY if PY2: from collections import Mapping else: from collections.abc import Mapping if MYPY: import typing from typing import Generator from typing import Optional from typing import Any from typing import Dict from typing import List from typing import Tuple _traceparent_header_format_re = re.compile( "^[ \t]*" # whitespace "([0-9a-f]{32})?" # trace_id "-?([0-9a-f]{16})?" # span_id "-?([01])?" # sampled "[ \t]*$" # whitespace ) class EnvironHeaders(Mapping): # type: ignore def __init__( self, environ, # type: typing.Mapping[str, str] prefix="HTTP_", # type: str ): # type: (...) -> None self.environ = environ self.prefix = prefix def __getitem__(self, key): # type: (str) -> Optional[Any] return self.environ[self.prefix + key.replace("-", "_").upper()] def __len__(self): # type: () -> int return sum(1 for _ in iter(self)) def __iter__(self): # type: () -> Generator[str, None, None] for k in self.environ: if not isinstance(k, str): continue k = k.replace("-", "_").upper() if not k.startswith(self.prefix): continue yield k[len(self.prefix) :] class _SpanRecorder(object): __slots__ = ("maxlen", "finished_spans", "open_span_count") def __init__(self, maxlen): # type: (int) -> None self.maxlen = maxlen self.open_span_count = 0 # type: int self.finished_spans = [] # type: List[Span] def start_span(self, span): # type: (Span) -> None # This is just so that we don't run out of memory while recording a lot # of spans. At some point we just stop and flush out the start of the # trace tree (i.e. the first n spans with the smallest # start_timestamp). self.open_span_count += 1 if self.open_span_count > self.maxlen: span._span_recorder = None def finish_span(self, span): # type: (Span) -> None self.finished_spans.append(span) class Span(object): __slots__ = ( "trace_id", "span_id", "parent_span_id", "same_process_as_parent", "sampled", "transaction", "op", "description", "start_timestamp", "timestamp", "_tags", "_data", "_span_recorder", "hub", "_context_manager_state", ) def __init__( self, trace_id=None, # type: Optional[str] span_id=None, # type: Optional[str] parent_span_id=None, # type: Optional[str] same_process_as_parent=True, # type: bool sampled=None, # type: Optional[bool] transaction=None, # type: Optional[str] op=None, # type: Optional[str] description=None, # type: Optional[str] hub=None, # type: Optional[sentry_sdk.Hub] ): # type: (...) -> None self.trace_id = trace_id or uuid.uuid4().hex self.span_id = span_id or uuid.uuid4().hex[16:] self.parent_span_id = parent_span_id self.same_process_as_parent = same_process_as_parent self.sampled = sampled self.transaction = transaction self.op = op self.description = description self.hub = hub self._tags = {} # type: Dict[str, str] self._data = {} # type: Dict[str, Any] self.start_timestamp = datetime.utcnow() #: End timestamp of span self.timestamp = None # type: Optional[datetime] self._span_recorder = None # type: Optional[_SpanRecorder] def init_finished_spans(self, maxlen): # type: (int) -> None if self._span_recorder is None: self._span_recorder = _SpanRecorder(maxlen) self._span_recorder.start_span(self) def __repr__(self): # type: () -> str return ( "<%s(transaction=%r, trace_id=%r, span_id=%r, parent_span_id=%r, sampled=%r)>" % ( self.__class__.__name__, self.transaction, self.trace_id, self.span_id, self.parent_span_id, self.sampled, ) ) def __enter__(self): # type: () -> Span hub = self.hub or sentry_sdk.Hub.current _, scope = hub._stack[-1] old_span = scope.span scope.span = self self._context_manager_state = (hub, scope, old_span) return self def __exit__(self, ty, value, tb): # type: (Optional[Any], Optional[Any], Optional[Any]) -> None if value is not None: self._tags.setdefault("status", "internal_error") hub, scope, old_span = self._context_manager_state del self._context_manager_state self.finish(hub) scope.span = old_span def new_span(self, **kwargs): # type: (**Any) -> Span rv = type(self)( trace_id=self.trace_id, span_id=None, parent_span_id=self.span_id, sampled=self.sampled, **kwargs ) rv._span_recorder = self._span_recorder return rv @classmethod def continue_from_environ(cls, environ): # type: (typing.Mapping[str, str]) -> Span return cls.continue_from_headers(EnvironHeaders(environ)) @classmethod def continue_from_headers(cls, headers): # type: (typing.Mapping[str, str]) -> Span parent = cls.from_traceparent(headers.get("sentry-trace")) if parent is None: return cls() parent.same_process_as_parent = False return parent def iter_headers(self): # type: () -> Generator[Tuple[str, str], None, None] yield "sentry-trace", self.to_traceparent() @classmethod def from_traceparent(cls, traceparent): # type: (Optional[str]) -> Optional[Span] if not traceparent: return None if traceparent.startswith("00-") and traceparent.endswith("-00"): traceparent = traceparent[3:-3] match = _traceparent_header_format_re.match(str(traceparent)) if match is None: return None trace_id, span_id, sampled_str = match.groups() if trace_id is not None: trace_id = "{:032x}".format(int(trace_id, 16)) if span_id is not None: span_id = "{:016x}".format(int(span_id, 16)) if sampled_str: sampled = sampled_str != "0" # type: Optional[bool] else: sampled = None return cls(trace_id=trace_id, parent_span_id=span_id, sampled=sampled) def to_traceparent(self): # type: () -> str sampled = "" if self.sampled is True: sampled = "1" if self.sampled is False: sampled = "0" return "%s-%s-%s" % (self.trace_id, self.span_id, sampled) def to_legacy_traceparent(self): # type: () -> str return "00-%s-%s-00" % (self.trace_id, self.span_id) def set_tag(self, key, value): # type: (str, Any) -> None
def set_data(self, key, value): # type: (str, Any) -> None self._data[key] = value def set_status(self, value): # type: (str) -> None self.set_tag("status", value) def set_http_status(self, http_status): # type: (int) -> None self.set_tag("http.status_code", http_status) if http_status < 400: self.set_status("ok") elif 400 <= http_status < 500: if http_status == 403: self.set_status("permission_denied") elif http_status == 404: self.set_status("not_found") elif http_status == 429: self.set_status("resource_exhausted") elif http_status == 413: self.set_status("failed_precondition") elif http_status == 401: self.set_status("unauthenticated") elif http_status == 409: self.set_status("already_exists") else: self.set_status("invalid_argument") elif 500 <= http_status < 600: if http_status == 504: self.set_status("deadline_exceeded") elif http_status == 501: self.set_status("unimplemented") elif http_status == 503: self.set_status("unavailable") else: self.set_status("internal_error") else: self.set_status("unknown_error") def is_success(self): # type: () -> bool return self._tags.get("status") == "ok" def finish(self, hub=None): # type: (Optional[sentry_sdk.Hub]) -> Optional[str] hub = hub or self.hub or sentry_sdk.Hub.current if self.timestamp is not None: # This transaction is already finished, so we should not flush it again. return None self.timestamp = datetime.utcnow() _maybe_create_breadcrumbs_from_span(hub, self) if self._span_recorder is None: return None self._span_recorder.finish_span(self) if self.transaction is None: # If this has no transaction set we assume there's a parent # transaction for this span that would be flushed out eventually. return None client = hub.client if client is None: # We have no client and therefore nowhere to send this transaction # event. return None if not self.sampled: # At this point a `sampled = None` should have already been # resolved to a concrete decision. If `sampled` is `None`, it's # likely that somebody used `with sentry_sdk.Hub.start_span(..)` on a # non-transaction span and later decided to make it a transaction. if self.sampled is None: logger.warning("Discarding transaction Span without sampling decision") return None return hub.capture_event( { "type": "transaction", "transaction": self.transaction, "contexts": {"trace": self.get_trace_context()}, "tags": self._tags, "timestamp": self.timestamp, "start_timestamp": self.start_timestamp, "spans": [ s.to_json(client) for s in self._span_recorder.finished_spans if s is not self ], } ) def to_json(self, client): # type: (Optional[sentry_sdk.Client]) -> Dict[str, Any] rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "same_process_as_parent": self.same_process_as_parent, "op": self.op, "description": self.description, "start_timestamp": self.start_timestamp, "timestamp": self.timestamp, } # type: Dict[str, Any] transaction = self.transaction if transaction: rv["transaction"] = transaction tags = self._tags if tags: rv["tags"] = tags data = self._data if data: rv["data"] = data return rv def get_trace_context(self): # type: () -> Any rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "op": self.op, "description": self.description, } if "status" in self._tags: rv["status"] = self._tags["status"] return rv def _format_sql(cursor, sql): # type: (Any, str) -> Optional[str] real_sql = None # If we're using psycopg2, it could be that we're # looking at a query that uses Composed objects. Use psycopg2's mogrify # function to format the query. We lose per-parameter trimming but gain # accuracy in formatting. try: if hasattr(cursor, "mogrify"): real_sql = cursor.mogrify(sql) if isinstance(real_sql, bytes): real_sql = real_sql.decode(cursor.connection.encoding) except Exception: real_sql = None return real_sql or to_string(sql) @contextlib.contextmanager def record_sql_queries( hub, # type: sentry_sdk.Hub cursor, # type: Any query, # type: Any params_list, # type: Any paramstyle, # type: Optional[str] executemany, # type: bool ): # type: (...) -> Generator[Span, None, None] # TODO: Bring back capturing of params by default if hub.client and hub.client.options["_experiments"].get( "record_sql_params", False ): if not params_list or params_list == [None]: params_list = None if paramstyle == "pyformat": paramstyle = "format" else: params_list = None paramstyle = None query = _format_sql(cursor, query) data = {} if params_list is not None: data["db.params"] = params_list if paramstyle is not None: data["db.paramstyle"] = paramstyle if executemany: data["db.executemany"] = True with capture_internal_exceptions(): hub.add_breadcrumb(message=query, category="query", data=data) with hub.start_span(op="db", description=query) as span: for k, v in data.items(): span.set_data(k, v) yield span def _maybe_create_breadcrumbs_from_span(hub, span): # type: (sentry_sdk.Hub, Span) -> None if span.op == "redis": hub.add_breadcrumb( message=span.description, type="redis", category="redis", data=span._tags ) elif span.op == "http": hub.add_breadcrumb(type="http", category="httplib", data=span._data) elif span.op == "subprocess": hub.add_breadcrumb( type="subprocess", category="subprocess", message=span.description, data=span._data, )
self._tags[key] = value
identifier_body
tracing.py
import re import uuid import contextlib from datetime import datetime import sentry_sdk from sentry_sdk.utils import capture_internal_exceptions, logger, to_string from sentry_sdk._compat import PY2 from sentry_sdk._types import MYPY if PY2: from collections import Mapping else: from collections.abc import Mapping if MYPY: import typing from typing import Generator from typing import Optional from typing import Any from typing import Dict from typing import List from typing import Tuple _traceparent_header_format_re = re.compile( "^[ \t]*" # whitespace "([0-9a-f]{32})?" # trace_id "-?([0-9a-f]{16})?" # span_id "-?([01])?" # sampled "[ \t]*$" # whitespace ) class EnvironHeaders(Mapping): # type: ignore def __init__( self, environ, # type: typing.Mapping[str, str] prefix="HTTP_", # type: str ): # type: (...) -> None self.environ = environ self.prefix = prefix def __getitem__(self, key): # type: (str) -> Optional[Any] return self.environ[self.prefix + key.replace("-", "_").upper()] def __len__(self): # type: () -> int return sum(1 for _ in iter(self)) def __iter__(self): # type: () -> Generator[str, None, None] for k in self.environ: if not isinstance(k, str): continue k = k.replace("-", "_").upper() if not k.startswith(self.prefix): continue yield k[len(self.prefix) :] class _SpanRecorder(object): __slots__ = ("maxlen", "finished_spans", "open_span_count") def __init__(self, maxlen): # type: (int) -> None self.maxlen = maxlen self.open_span_count = 0 # type: int self.finished_spans = [] # type: List[Span] def start_span(self, span): # type: (Span) -> None # This is just so that we don't run out of memory while recording a lot # of spans. At some point we just stop and flush out the start of the # trace tree (i.e. the first n spans with the smallest # start_timestamp). self.open_span_count += 1 if self.open_span_count > self.maxlen: span._span_recorder = None def finish_span(self, span): # type: (Span) -> None self.finished_spans.append(span) class Span(object): __slots__ = ( "trace_id", "span_id", "parent_span_id", "same_process_as_parent", "sampled", "transaction", "op", "description", "start_timestamp", "timestamp", "_tags", "_data", "_span_recorder", "hub", "_context_manager_state", ) def __init__( self, trace_id=None, # type: Optional[str] span_id=None, # type: Optional[str] parent_span_id=None, # type: Optional[str] same_process_as_parent=True, # type: bool sampled=None, # type: Optional[bool] transaction=None, # type: Optional[str] op=None, # type: Optional[str] description=None, # type: Optional[str] hub=None, # type: Optional[sentry_sdk.Hub] ): # type: (...) -> None self.trace_id = trace_id or uuid.uuid4().hex self.span_id = span_id or uuid.uuid4().hex[16:] self.parent_span_id = parent_span_id self.same_process_as_parent = same_process_as_parent self.sampled = sampled self.transaction = transaction self.op = op self.description = description self.hub = hub self._tags = {} # type: Dict[str, str] self._data = {} # type: Dict[str, Any] self.start_timestamp = datetime.utcnow() #: End timestamp of span self.timestamp = None # type: Optional[datetime] self._span_recorder = None # type: Optional[_SpanRecorder] def init_finished_spans(self, maxlen): # type: (int) -> None if self._span_recorder is None: self._span_recorder = _SpanRecorder(maxlen) self._span_recorder.start_span(self) def __repr__(self): # type: () -> str return ( "<%s(transaction=%r, trace_id=%r, span_id=%r, parent_span_id=%r, sampled=%r)>" % ( self.__class__.__name__, self.transaction, self.trace_id, self.span_id, self.parent_span_id, self.sampled, ) ) def __enter__(self): # type: () -> Span hub = self.hub or sentry_sdk.Hub.current _, scope = hub._stack[-1] old_span = scope.span scope.span = self self._context_manager_state = (hub, scope, old_span) return self def __exit__(self, ty, value, tb): # type: (Optional[Any], Optional[Any], Optional[Any]) -> None if value is not None: self._tags.setdefault("status", "internal_error") hub, scope, old_span = self._context_manager_state del self._context_manager_state self.finish(hub) scope.span = old_span def new_span(self, **kwargs): # type: (**Any) -> Span rv = type(self)( trace_id=self.trace_id, span_id=None, parent_span_id=self.span_id, sampled=self.sampled, **kwargs ) rv._span_recorder = self._span_recorder return rv @classmethod def continue_from_environ(cls, environ): # type: (typing.Mapping[str, str]) -> Span return cls.continue_from_headers(EnvironHeaders(environ)) @classmethod def continue_from_headers(cls, headers): # type: (typing.Mapping[str, str]) -> Span parent = cls.from_traceparent(headers.get("sentry-trace")) if parent is None: return cls() parent.same_process_as_parent = False return parent def iter_headers(self): # type: () -> Generator[Tuple[str, str], None, None] yield "sentry-trace", self.to_traceparent() @classmethod def from_traceparent(cls, traceparent): # type: (Optional[str]) -> Optional[Span] if not traceparent: return None if traceparent.startswith("00-") and traceparent.endswith("-00"): traceparent = traceparent[3:-3] match = _traceparent_header_format_re.match(str(traceparent)) if match is None: return None trace_id, span_id, sampled_str = match.groups() if trace_id is not None: trace_id = "{:032x}".format(int(trace_id, 16)) if span_id is not None: span_id = "{:016x}".format(int(span_id, 16)) if sampled_str: sampled = sampled_str != "0" # type: Optional[bool] else: sampled = None return cls(trace_id=trace_id, parent_span_id=span_id, sampled=sampled) def to_traceparent(self): # type: () -> str sampled = "" if self.sampled is True: sampled = "1" if self.sampled is False: sampled = "0" return "%s-%s-%s" % (self.trace_id, self.span_id, sampled) def to_legacy_traceparent(self): # type: () -> str return "00-%s-%s-00" % (self.trace_id, self.span_id) def set_tag(self, key, value): # type: (str, Any) -> None self._tags[key] = value def set_data(self, key, value): # type: (str, Any) -> None self._data[key] = value def set_status(self, value): # type: (str) -> None self.set_tag("status", value) def set_http_status(self, http_status): # type: (int) -> None self.set_tag("http.status_code", http_status) if http_status < 400: self.set_status("ok") elif 400 <= http_status < 500: if http_status == 403: self.set_status("permission_denied") elif http_status == 404: self.set_status("not_found") elif http_status == 429: self.set_status("resource_exhausted") elif http_status == 413: self.set_status("failed_precondition") elif http_status == 401: self.set_status("unauthenticated") elif http_status == 409: self.set_status("already_exists") else: self.set_status("invalid_argument") elif 500 <= http_status < 600: if http_status == 504: self.set_status("deadline_exceeded") elif http_status == 501: self.set_status("unimplemented") elif http_status == 503: self.set_status("unavailable") else: self.set_status("internal_error") else: self.set_status("unknown_error") def is_success(self): # type: () -> bool return self._tags.get("status") == "ok" def finish(self, hub=None): # type: (Optional[sentry_sdk.Hub]) -> Optional[str] hub = hub or self.hub or sentry_sdk.Hub.current if self.timestamp is not None: # This transaction is already finished, so we should not flush it again. return None self.timestamp = datetime.utcnow() _maybe_create_breadcrumbs_from_span(hub, self) if self._span_recorder is None: return None self._span_recorder.finish_span(self) if self.transaction is None: # If this has no transaction set we assume there's a parent # transaction for this span that would be flushed out eventually. return None client = hub.client if client is None: # We have no client and therefore nowhere to send this transaction # event. return None if not self.sampled: # At this point a `sampled = None` should have already been # resolved to a concrete decision. If `sampled` is `None`, it's # likely that somebody used `with sentry_sdk.Hub.start_span(..)` on a # non-transaction span and later decided to make it a transaction. if self.sampled is None: logger.warning("Discarding transaction Span without sampling decision") return None return hub.capture_event( { "type": "transaction", "transaction": self.transaction, "contexts": {"trace": self.get_trace_context()}, "tags": self._tags, "timestamp": self.timestamp, "start_timestamp": self.start_timestamp, "spans": [ s.to_json(client) for s in self._span_recorder.finished_spans if s is not self ], } ) def to_json(self, client): # type: (Optional[sentry_sdk.Client]) -> Dict[str, Any] rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "same_process_as_parent": self.same_process_as_parent, "op": self.op, "description": self.description, "start_timestamp": self.start_timestamp, "timestamp": self.timestamp, } # type: Dict[str, Any] transaction = self.transaction if transaction: rv["transaction"] = transaction tags = self._tags if tags: rv["tags"] = tags data = self._data if data: rv["data"] = data return rv def get_trace_context(self): # type: () -> Any rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "op": self.op, "description": self.description, } if "status" in self._tags: rv["status"] = self._tags["status"] return rv def _format_sql(cursor, sql): # type: (Any, str) -> Optional[str] real_sql = None # If we're using psycopg2, it could be that we're # looking at a query that uses Composed objects. Use psycopg2's mogrify # function to format the query. We lose per-parameter trimming but gain # accuracy in formatting. try: if hasattr(cursor, "mogrify"): real_sql = cursor.mogrify(sql) if isinstance(real_sql, bytes): real_sql = real_sql.decode(cursor.connection.encoding) except Exception: real_sql = None return real_sql or to_string(sql) @contextlib.contextmanager def record_sql_queries( hub, # type: sentry_sdk.Hub cursor, # type: Any query, # type: Any params_list, # type: Any paramstyle, # type: Optional[str] executemany, # type: bool ): # type: (...) -> Generator[Span, None, None] # TODO: Bring back capturing of params by default if hub.client and hub.client.options["_experiments"].get( "record_sql_params", False ): if not params_list or params_list == [None]: params_list = None if paramstyle == "pyformat": paramstyle = "format" else:
query = _format_sql(cursor, query) data = {} if params_list is not None: data["db.params"] = params_list if paramstyle is not None: data["db.paramstyle"] = paramstyle if executemany: data["db.executemany"] = True with capture_internal_exceptions(): hub.add_breadcrumb(message=query, category="query", data=data) with hub.start_span(op="db", description=query) as span: for k, v in data.items(): span.set_data(k, v) yield span def _maybe_create_breadcrumbs_from_span(hub, span): # type: (sentry_sdk.Hub, Span) -> None if span.op == "redis": hub.add_breadcrumb( message=span.description, type="redis", category="redis", data=span._tags ) elif span.op == "http": hub.add_breadcrumb(type="http", category="httplib", data=span._data) elif span.op == "subprocess": hub.add_breadcrumb( type="subprocess", category="subprocess", message=span.description, data=span._data, )
params_list = None paramstyle = None
conditional_block
tracing.py
import re import uuid import contextlib from datetime import datetime import sentry_sdk from sentry_sdk.utils import capture_internal_exceptions, logger, to_string from sentry_sdk._compat import PY2 from sentry_sdk._types import MYPY if PY2: from collections import Mapping else: from collections.abc import Mapping if MYPY: import typing from typing import Generator from typing import Optional from typing import Any from typing import Dict from typing import List from typing import Tuple _traceparent_header_format_re = re.compile( "^[ \t]*" # whitespace "([0-9a-f]{32})?" # trace_id "-?([0-9a-f]{16})?" # span_id "-?([01])?" # sampled "[ \t]*$" # whitespace ) class EnvironHeaders(Mapping): # type: ignore def __init__( self, environ, # type: typing.Mapping[str, str] prefix="HTTP_", # type: str
self.prefix = prefix def __getitem__(self, key): # type: (str) -> Optional[Any] return self.environ[self.prefix + key.replace("-", "_").upper()] def __len__(self): # type: () -> int return sum(1 for _ in iter(self)) def __iter__(self): # type: () -> Generator[str, None, None] for k in self.environ: if not isinstance(k, str): continue k = k.replace("-", "_").upper() if not k.startswith(self.prefix): continue yield k[len(self.prefix) :] class _SpanRecorder(object): __slots__ = ("maxlen", "finished_spans", "open_span_count") def __init__(self, maxlen): # type: (int) -> None self.maxlen = maxlen self.open_span_count = 0 # type: int self.finished_spans = [] # type: List[Span] def start_span(self, span): # type: (Span) -> None # This is just so that we don't run out of memory while recording a lot # of spans. At some point we just stop and flush out the start of the # trace tree (i.e. the first n spans with the smallest # start_timestamp). self.open_span_count += 1 if self.open_span_count > self.maxlen: span._span_recorder = None def finish_span(self, span): # type: (Span) -> None self.finished_spans.append(span) class Span(object): __slots__ = ( "trace_id", "span_id", "parent_span_id", "same_process_as_parent", "sampled", "transaction", "op", "description", "start_timestamp", "timestamp", "_tags", "_data", "_span_recorder", "hub", "_context_manager_state", ) def __init__( self, trace_id=None, # type: Optional[str] span_id=None, # type: Optional[str] parent_span_id=None, # type: Optional[str] same_process_as_parent=True, # type: bool sampled=None, # type: Optional[bool] transaction=None, # type: Optional[str] op=None, # type: Optional[str] description=None, # type: Optional[str] hub=None, # type: Optional[sentry_sdk.Hub] ): # type: (...) -> None self.trace_id = trace_id or uuid.uuid4().hex self.span_id = span_id or uuid.uuid4().hex[16:] self.parent_span_id = parent_span_id self.same_process_as_parent = same_process_as_parent self.sampled = sampled self.transaction = transaction self.op = op self.description = description self.hub = hub self._tags = {} # type: Dict[str, str] self._data = {} # type: Dict[str, Any] self.start_timestamp = datetime.utcnow() #: End timestamp of span self.timestamp = None # type: Optional[datetime] self._span_recorder = None # type: Optional[_SpanRecorder] def init_finished_spans(self, maxlen): # type: (int) -> None if self._span_recorder is None: self._span_recorder = _SpanRecorder(maxlen) self._span_recorder.start_span(self) def __repr__(self): # type: () -> str return ( "<%s(transaction=%r, trace_id=%r, span_id=%r, parent_span_id=%r, sampled=%r)>" % ( self.__class__.__name__, self.transaction, self.trace_id, self.span_id, self.parent_span_id, self.sampled, ) ) def __enter__(self): # type: () -> Span hub = self.hub or sentry_sdk.Hub.current _, scope = hub._stack[-1] old_span = scope.span scope.span = self self._context_manager_state = (hub, scope, old_span) return self def __exit__(self, ty, value, tb): # type: (Optional[Any], Optional[Any], Optional[Any]) -> None if value is not None: self._tags.setdefault("status", "internal_error") hub, scope, old_span = self._context_manager_state del self._context_manager_state self.finish(hub) scope.span = old_span def new_span(self, **kwargs): # type: (**Any) -> Span rv = type(self)( trace_id=self.trace_id, span_id=None, parent_span_id=self.span_id, sampled=self.sampled, **kwargs ) rv._span_recorder = self._span_recorder return rv @classmethod def continue_from_environ(cls, environ): # type: (typing.Mapping[str, str]) -> Span return cls.continue_from_headers(EnvironHeaders(environ)) @classmethod def continue_from_headers(cls, headers): # type: (typing.Mapping[str, str]) -> Span parent = cls.from_traceparent(headers.get("sentry-trace")) if parent is None: return cls() parent.same_process_as_parent = False return parent def iter_headers(self): # type: () -> Generator[Tuple[str, str], None, None] yield "sentry-trace", self.to_traceparent() @classmethod def from_traceparent(cls, traceparent): # type: (Optional[str]) -> Optional[Span] if not traceparent: return None if traceparent.startswith("00-") and traceparent.endswith("-00"): traceparent = traceparent[3:-3] match = _traceparent_header_format_re.match(str(traceparent)) if match is None: return None trace_id, span_id, sampled_str = match.groups() if trace_id is not None: trace_id = "{:032x}".format(int(trace_id, 16)) if span_id is not None: span_id = "{:016x}".format(int(span_id, 16)) if sampled_str: sampled = sampled_str != "0" # type: Optional[bool] else: sampled = None return cls(trace_id=trace_id, parent_span_id=span_id, sampled=sampled) def to_traceparent(self): # type: () -> str sampled = "" if self.sampled is True: sampled = "1" if self.sampled is False: sampled = "0" return "%s-%s-%s" % (self.trace_id, self.span_id, sampled) def to_legacy_traceparent(self): # type: () -> str return "00-%s-%s-00" % (self.trace_id, self.span_id) def set_tag(self, key, value): # type: (str, Any) -> None self._tags[key] = value def set_data(self, key, value): # type: (str, Any) -> None self._data[key] = value def set_status(self, value): # type: (str) -> None self.set_tag("status", value) def set_http_status(self, http_status): # type: (int) -> None self.set_tag("http.status_code", http_status) if http_status < 400: self.set_status("ok") elif 400 <= http_status < 500: if http_status == 403: self.set_status("permission_denied") elif http_status == 404: self.set_status("not_found") elif http_status == 429: self.set_status("resource_exhausted") elif http_status == 413: self.set_status("failed_precondition") elif http_status == 401: self.set_status("unauthenticated") elif http_status == 409: self.set_status("already_exists") else: self.set_status("invalid_argument") elif 500 <= http_status < 600: if http_status == 504: self.set_status("deadline_exceeded") elif http_status == 501: self.set_status("unimplemented") elif http_status == 503: self.set_status("unavailable") else: self.set_status("internal_error") else: self.set_status("unknown_error") def is_success(self): # type: () -> bool return self._tags.get("status") == "ok" def finish(self, hub=None): # type: (Optional[sentry_sdk.Hub]) -> Optional[str] hub = hub or self.hub or sentry_sdk.Hub.current if self.timestamp is not None: # This transaction is already finished, so we should not flush it again. return None self.timestamp = datetime.utcnow() _maybe_create_breadcrumbs_from_span(hub, self) if self._span_recorder is None: return None self._span_recorder.finish_span(self) if self.transaction is None: # If this has no transaction set we assume there's a parent # transaction for this span that would be flushed out eventually. return None client = hub.client if client is None: # We have no client and therefore nowhere to send this transaction # event. return None if not self.sampled: # At this point a `sampled = None` should have already been # resolved to a concrete decision. If `sampled` is `None`, it's # likely that somebody used `with sentry_sdk.Hub.start_span(..)` on a # non-transaction span and later decided to make it a transaction. if self.sampled is None: logger.warning("Discarding transaction Span without sampling decision") return None return hub.capture_event( { "type": "transaction", "transaction": self.transaction, "contexts": {"trace": self.get_trace_context()}, "tags": self._tags, "timestamp": self.timestamp, "start_timestamp": self.start_timestamp, "spans": [ s.to_json(client) for s in self._span_recorder.finished_spans if s is not self ], } ) def to_json(self, client): # type: (Optional[sentry_sdk.Client]) -> Dict[str, Any] rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "same_process_as_parent": self.same_process_as_parent, "op": self.op, "description": self.description, "start_timestamp": self.start_timestamp, "timestamp": self.timestamp, } # type: Dict[str, Any] transaction = self.transaction if transaction: rv["transaction"] = transaction tags = self._tags if tags: rv["tags"] = tags data = self._data if data: rv["data"] = data return rv def get_trace_context(self): # type: () -> Any rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "op": self.op, "description": self.description, } if "status" in self._tags: rv["status"] = self._tags["status"] return rv def _format_sql(cursor, sql): # type: (Any, str) -> Optional[str] real_sql = None # If we're using psycopg2, it could be that we're # looking at a query that uses Composed objects. Use psycopg2's mogrify # function to format the query. We lose per-parameter trimming but gain # accuracy in formatting. try: if hasattr(cursor, "mogrify"): real_sql = cursor.mogrify(sql) if isinstance(real_sql, bytes): real_sql = real_sql.decode(cursor.connection.encoding) except Exception: real_sql = None return real_sql or to_string(sql) @contextlib.contextmanager def record_sql_queries( hub, # type: sentry_sdk.Hub cursor, # type: Any query, # type: Any params_list, # type: Any paramstyle, # type: Optional[str] executemany, # type: bool ): # type: (...) -> Generator[Span, None, None] # TODO: Bring back capturing of params by default if hub.client and hub.client.options["_experiments"].get( "record_sql_params", False ): if not params_list or params_list == [None]: params_list = None if paramstyle == "pyformat": paramstyle = "format" else: params_list = None paramstyle = None query = _format_sql(cursor, query) data = {} if params_list is not None: data["db.params"] = params_list if paramstyle is not None: data["db.paramstyle"] = paramstyle if executemany: data["db.executemany"] = True with capture_internal_exceptions(): hub.add_breadcrumb(message=query, category="query", data=data) with hub.start_span(op="db", description=query) as span: for k, v in data.items(): span.set_data(k, v) yield span def _maybe_create_breadcrumbs_from_span(hub, span): # type: (sentry_sdk.Hub, Span) -> None if span.op == "redis": hub.add_breadcrumb( message=span.description, type="redis", category="redis", data=span._tags ) elif span.op == "http": hub.add_breadcrumb(type="http", category="httplib", data=span._data) elif span.op == "subprocess": hub.add_breadcrumb( type="subprocess", category="subprocess", message=span.description, data=span._data, )
): # type: (...) -> None self.environ = environ
random_line_split
tracing.py
import re import uuid import contextlib from datetime import datetime import sentry_sdk from sentry_sdk.utils import capture_internal_exceptions, logger, to_string from sentry_sdk._compat import PY2 from sentry_sdk._types import MYPY if PY2: from collections import Mapping else: from collections.abc import Mapping if MYPY: import typing from typing import Generator from typing import Optional from typing import Any from typing import Dict from typing import List from typing import Tuple _traceparent_header_format_re = re.compile( "^[ \t]*" # whitespace "([0-9a-f]{32})?" # trace_id "-?([0-9a-f]{16})?" # span_id "-?([01])?" # sampled "[ \t]*$" # whitespace ) class EnvironHeaders(Mapping): # type: ignore def __init__( self, environ, # type: typing.Mapping[str, str] prefix="HTTP_", # type: str ): # type: (...) -> None self.environ = environ self.prefix = prefix def __getitem__(self, key): # type: (str) -> Optional[Any] return self.environ[self.prefix + key.replace("-", "_").upper()] def __len__(self): # type: () -> int return sum(1 for _ in iter(self)) def __iter__(self): # type: () -> Generator[str, None, None] for k in self.environ: if not isinstance(k, str): continue k = k.replace("-", "_").upper() if not k.startswith(self.prefix): continue yield k[len(self.prefix) :] class _SpanRecorder(object): __slots__ = ("maxlen", "finished_spans", "open_span_count") def __init__(self, maxlen): # type: (int) -> None self.maxlen = maxlen self.open_span_count = 0 # type: int self.finished_spans = [] # type: List[Span] def start_span(self, span): # type: (Span) -> None # This is just so that we don't run out of memory while recording a lot # of spans. At some point we just stop and flush out the start of the # trace tree (i.e. the first n spans with the smallest # start_timestamp). self.open_span_count += 1 if self.open_span_count > self.maxlen: span._span_recorder = None def finish_span(self, span): # type: (Span) -> None self.finished_spans.append(span) class Span(object): __slots__ = ( "trace_id", "span_id", "parent_span_id", "same_process_as_parent", "sampled", "transaction", "op", "description", "start_timestamp", "timestamp", "_tags", "_data", "_span_recorder", "hub", "_context_manager_state", ) def __init__( self, trace_id=None, # type: Optional[str] span_id=None, # type: Optional[str] parent_span_id=None, # type: Optional[str] same_process_as_parent=True, # type: bool sampled=None, # type: Optional[bool] transaction=None, # type: Optional[str] op=None, # type: Optional[str] description=None, # type: Optional[str] hub=None, # type: Optional[sentry_sdk.Hub] ): # type: (...) -> None self.trace_id = trace_id or uuid.uuid4().hex self.span_id = span_id or uuid.uuid4().hex[16:] self.parent_span_id = parent_span_id self.same_process_as_parent = same_process_as_parent self.sampled = sampled self.transaction = transaction self.op = op self.description = description self.hub = hub self._tags = {} # type: Dict[str, str] self._data = {} # type: Dict[str, Any] self.start_timestamp = datetime.utcnow() #: End timestamp of span self.timestamp = None # type: Optional[datetime] self._span_recorder = None # type: Optional[_SpanRecorder] def init_finished_spans(self, maxlen): # type: (int) -> None if self._span_recorder is None: self._span_recorder = _SpanRecorder(maxlen) self._span_recorder.start_span(self) def __repr__(self): # type: () -> str return ( "<%s(transaction=%r, trace_id=%r, span_id=%r, parent_span_id=%r, sampled=%r)>" % ( self.__class__.__name__, self.transaction, self.trace_id, self.span_id, self.parent_span_id, self.sampled, ) ) def
(self): # type: () -> Span hub = self.hub or sentry_sdk.Hub.current _, scope = hub._stack[-1] old_span = scope.span scope.span = self self._context_manager_state = (hub, scope, old_span) return self def __exit__(self, ty, value, tb): # type: (Optional[Any], Optional[Any], Optional[Any]) -> None if value is not None: self._tags.setdefault("status", "internal_error") hub, scope, old_span = self._context_manager_state del self._context_manager_state self.finish(hub) scope.span = old_span def new_span(self, **kwargs): # type: (**Any) -> Span rv = type(self)( trace_id=self.trace_id, span_id=None, parent_span_id=self.span_id, sampled=self.sampled, **kwargs ) rv._span_recorder = self._span_recorder return rv @classmethod def continue_from_environ(cls, environ): # type: (typing.Mapping[str, str]) -> Span return cls.continue_from_headers(EnvironHeaders(environ)) @classmethod def continue_from_headers(cls, headers): # type: (typing.Mapping[str, str]) -> Span parent = cls.from_traceparent(headers.get("sentry-trace")) if parent is None: return cls() parent.same_process_as_parent = False return parent def iter_headers(self): # type: () -> Generator[Tuple[str, str], None, None] yield "sentry-trace", self.to_traceparent() @classmethod def from_traceparent(cls, traceparent): # type: (Optional[str]) -> Optional[Span] if not traceparent: return None if traceparent.startswith("00-") and traceparent.endswith("-00"): traceparent = traceparent[3:-3] match = _traceparent_header_format_re.match(str(traceparent)) if match is None: return None trace_id, span_id, sampled_str = match.groups() if trace_id is not None: trace_id = "{:032x}".format(int(trace_id, 16)) if span_id is not None: span_id = "{:016x}".format(int(span_id, 16)) if sampled_str: sampled = sampled_str != "0" # type: Optional[bool] else: sampled = None return cls(trace_id=trace_id, parent_span_id=span_id, sampled=sampled) def to_traceparent(self): # type: () -> str sampled = "" if self.sampled is True: sampled = "1" if self.sampled is False: sampled = "0" return "%s-%s-%s" % (self.trace_id, self.span_id, sampled) def to_legacy_traceparent(self): # type: () -> str return "00-%s-%s-00" % (self.trace_id, self.span_id) def set_tag(self, key, value): # type: (str, Any) -> None self._tags[key] = value def set_data(self, key, value): # type: (str, Any) -> None self._data[key] = value def set_status(self, value): # type: (str) -> None self.set_tag("status", value) def set_http_status(self, http_status): # type: (int) -> None self.set_tag("http.status_code", http_status) if http_status < 400: self.set_status("ok") elif 400 <= http_status < 500: if http_status == 403: self.set_status("permission_denied") elif http_status == 404: self.set_status("not_found") elif http_status == 429: self.set_status("resource_exhausted") elif http_status == 413: self.set_status("failed_precondition") elif http_status == 401: self.set_status("unauthenticated") elif http_status == 409: self.set_status("already_exists") else: self.set_status("invalid_argument") elif 500 <= http_status < 600: if http_status == 504: self.set_status("deadline_exceeded") elif http_status == 501: self.set_status("unimplemented") elif http_status == 503: self.set_status("unavailable") else: self.set_status("internal_error") else: self.set_status("unknown_error") def is_success(self): # type: () -> bool return self._tags.get("status") == "ok" def finish(self, hub=None): # type: (Optional[sentry_sdk.Hub]) -> Optional[str] hub = hub or self.hub or sentry_sdk.Hub.current if self.timestamp is not None: # This transaction is already finished, so we should not flush it again. return None self.timestamp = datetime.utcnow() _maybe_create_breadcrumbs_from_span(hub, self) if self._span_recorder is None: return None self._span_recorder.finish_span(self) if self.transaction is None: # If this has no transaction set we assume there's a parent # transaction for this span that would be flushed out eventually. return None client = hub.client if client is None: # We have no client and therefore nowhere to send this transaction # event. return None if not self.sampled: # At this point a `sampled = None` should have already been # resolved to a concrete decision. If `sampled` is `None`, it's # likely that somebody used `with sentry_sdk.Hub.start_span(..)` on a # non-transaction span and later decided to make it a transaction. if self.sampled is None: logger.warning("Discarding transaction Span without sampling decision") return None return hub.capture_event( { "type": "transaction", "transaction": self.transaction, "contexts": {"trace": self.get_trace_context()}, "tags": self._tags, "timestamp": self.timestamp, "start_timestamp": self.start_timestamp, "spans": [ s.to_json(client) for s in self._span_recorder.finished_spans if s is not self ], } ) def to_json(self, client): # type: (Optional[sentry_sdk.Client]) -> Dict[str, Any] rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "same_process_as_parent": self.same_process_as_parent, "op": self.op, "description": self.description, "start_timestamp": self.start_timestamp, "timestamp": self.timestamp, } # type: Dict[str, Any] transaction = self.transaction if transaction: rv["transaction"] = transaction tags = self._tags if tags: rv["tags"] = tags data = self._data if data: rv["data"] = data return rv def get_trace_context(self): # type: () -> Any rv = { "trace_id": self.trace_id, "span_id": self.span_id, "parent_span_id": self.parent_span_id, "op": self.op, "description": self.description, } if "status" in self._tags: rv["status"] = self._tags["status"] return rv def _format_sql(cursor, sql): # type: (Any, str) -> Optional[str] real_sql = None # If we're using psycopg2, it could be that we're # looking at a query that uses Composed objects. Use psycopg2's mogrify # function to format the query. We lose per-parameter trimming but gain # accuracy in formatting. try: if hasattr(cursor, "mogrify"): real_sql = cursor.mogrify(sql) if isinstance(real_sql, bytes): real_sql = real_sql.decode(cursor.connection.encoding) except Exception: real_sql = None return real_sql or to_string(sql) @contextlib.contextmanager def record_sql_queries( hub, # type: sentry_sdk.Hub cursor, # type: Any query, # type: Any params_list, # type: Any paramstyle, # type: Optional[str] executemany, # type: bool ): # type: (...) -> Generator[Span, None, None] # TODO: Bring back capturing of params by default if hub.client and hub.client.options["_experiments"].get( "record_sql_params", False ): if not params_list or params_list == [None]: params_list = None if paramstyle == "pyformat": paramstyle = "format" else: params_list = None paramstyle = None query = _format_sql(cursor, query) data = {} if params_list is not None: data["db.params"] = params_list if paramstyle is not None: data["db.paramstyle"] = paramstyle if executemany: data["db.executemany"] = True with capture_internal_exceptions(): hub.add_breadcrumb(message=query, category="query", data=data) with hub.start_span(op="db", description=query) as span: for k, v in data.items(): span.set_data(k, v) yield span def _maybe_create_breadcrumbs_from_span(hub, span): # type: (sentry_sdk.Hub, Span) -> None if span.op == "redis": hub.add_breadcrumb( message=span.description, type="redis", category="redis", data=span._tags ) elif span.op == "http": hub.add_breadcrumb(type="http", category="httplib", data=span._data) elif span.op == "subprocess": hub.add_breadcrumb( type="subprocess", category="subprocess", message=span.description, data=span._data, )
__enter__
identifier_name
main.rs
#![feature(plugin, decl_macro, custom_derive, type_ascription)] // Compiler plugins #![plugin(rocket_codegen)] // rocket code generator extern crate rocket; extern crate rabe; extern crate serde; extern crate serde_json; extern crate rustc_serialize; extern crate blake2_rfc; extern crate rocket_simpleauth; extern crate rand; #[macro_use] extern crate rocket_contrib; #[macro_use] extern crate serde_derive; #[macro_use] extern crate diesel; use std::error::*; use std::fs::*; use std::sync::{Once, ONCE_INIT}; use rand::Rng; use rand::os::OsRng; use rocket_contrib::{Json}; use rocket::response::status::BadRequest; use rocket::http::*; use rocket::request::FromRequest; use rocket::request::Request; use rocket::outcome::Outcome; use diesel::*; use std::str; use std::str::FromStr; use std::env; use rabe::schemes::bsw; use blake2_rfc::blake2b::*; pub mod schema; // Change the alias to `Box<error::Error>`. type BoxedResult<T> = std::result::Result<T, Box<Error>>; enum SCHEMES { bsw } impl FromStr for SCHEMES { type Err = (); fn from_str(s: &str) -> Result<SCHEMES, ()> { match s { "bsw" => Ok(SCHEMES::bsw), _ => Err(()), } } } // ---------------------------------------------------- // Internal structs follow // ---------------------------------------------------- struct ApiKey(String); impl<'t, 'r> FromRequest<'t, 'r> for ApiKey { type Error = (); fn from_request(request: &'t Request<'r>) -> Outcome<ApiKey, (Status,()), ()> { let keys: Vec<_> = request.headers().get("Authorization").collect(); if keys.len() != 1 { return Outcome::Failure((Status::BadRequest, ())); } println!("Got API key {}", keys[0]); let key = keys[0]; if !is_valid(keys[0].to_string()) { // return Outcome::Forward(()); return Outcome::Failure((Status::Unauthorized, ())); } return Outcome::Success(ApiKey(key.to_string())); } } // ----------------------------------------------------- // Message formats follow // ----------------------------------------------------- #[derive(Serialize, Deserialize)] struct Message { contents: String } #[derive(Serialize, Deserialize)] struct SetupMsg { scheme: String, attributes: Vec<String> } #[derive(Serialize, Deserialize)] struct KeyGenMsg { attributes: Vec<String>, scheme: String, } #[derive(Serialize, Deserialize)] struct EncMessage { plaintext :String, policy : String, // A json serialized policy that is understood by the scheme assigned to the session session_id : String // Session ID unique per (user,scheme) } #[derive(Serialize, Deserialize)] struct DecMessage { ct: String, session_id: String, // Session ID unique per (user,scheme) username: String, password: String } #[derive(Serialize, Deserialize)] struct ListAttrMsg { username : String, password : String } #[derive(Serialize, Deserialize)] struct User { username: String, password: String, attributes: Vec<String>, random_session_id: String // Reference to session } // ----------------------------------------------------- // REST APIs follow // ----------------------------------------------------- #[post(path="/encrypt", format="application/json", data="<d>")] fn encrypt(d:Json<EncMessage>) -> Result<Json<String>, BadRequest<String>> { // Get active session (panics if not available) let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &d.session_id).unwrap(); // Get key material needed for encryption let key_material: Vec<String> = serde_json::from_str(&session.key_material.as_str()).unwrap(); let pk_string : &String = &key_material[0]; let plaintext: &Vec<u8> = &d.plaintext.as_bytes().to_vec(); let pk : bsw::CpAbePublicKey = serde_json::from_str(pk_string.as_str()).unwrap(); // TODO NotNice: need to convert to scheme-specific type here. Should be generic trait w/ function "KeyMaterial.get_public_key()" println!("plaintext {:?}", plaintext); println!("policy {:?}", &d.policy); let res = bsw::encrypt(&pk, &d.policy, plaintext).unwrap(); Ok(Json(serde_json::to_string_pretty(&res).unwrap())) } #[post(path="/decrypt", format="application/json", data="<d>")] fn decrypt(d:Json<DecMessage>) -> Result<Json<String>, BadRequest<String>> { println!("Decryption demanded with ciphertext {}", &d.ct); // Get session from DB and extract key material needed for decryption let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &d.session_id).unwrap(); let users: Vec<schema::User> = _db_get_users_by_apikey(&conn, &session.random_session_id); println!("Users {:?}", users.len()); let user: schema::User = users.into_iter().take_while(|u| u.username.eq(&d.username)).next().unwrap(); let key_material: String = user.key_material; match session.scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { let ct: bsw::CpAbeCiphertext = serde_json::from_str(&d.ct).unwrap(); let sk: bsw::CpAbeSecretKey = serde_json::from_str(&key_material).unwrap(); // Decrypt ciphertext let res = bsw::decrypt(&sk, &ct).unwrap(); let s = match str::from_utf8(&res) { Ok(v) => v, Err(e) => panic!("Invalid UTF-8 sequence: {}", e), }; Ok(Json(s.to_string())) }, Err(_) => Err(BadRequest(Some(format!("Unsupported scheme {} of session {}", session.scheme, session.random_session_id)))) } } #[post(path="/add_user", format="application/json", data="<d>")] fn
(d:Json<User>) -> Result<(), BadRequest<String>> { let ref username: String = d.username; let ref passwd: String = d.password; let ref random_session_id = d.random_session_id; let salt: i32 = 1234; // TODO use random salt when storing hashed user passwords println!("Adding user {} {} {} {}", &username, &passwd, salt, random_session_id); // Create keys for the user let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &random_session_id).unwrap(); let scheme: String = session.scheme; match scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { let master_key_material: Vec<String> = serde_json::from_str(&session.key_material).unwrap(); let master_pk: bsw::CpAbePublicKey = serde_json::from_str(&master_key_material[0]).unwrap(); let master_mk: bsw::CpAbeMasterKey = serde_json::from_str(&master_key_material[1]).unwrap(); let user_sk: bsw::CpAbeSecretKey = bsw::keygen(&master_pk, &master_mk, &d.attributes).unwrap(); match db_add_user(&conn, &username, &passwd, salt, &d.attributes, &serde_json::to_string(&user_sk).unwrap(), random_session_id) { Err(e) => {println!("Nope! {}", e); return Err(BadRequest(Some(format!("Failure adding userpk failure: {}", e))))}, Ok(_r) => return Ok(()) } }, Err(_) => { return Err(BadRequest(Some(format!("Scheme {} not supported", scheme)))); } } } #[post(path="/list_attrs", format="application/json", data="<d>")] fn list_attrs(d:Json<ListAttrMsg>, key: ApiKey) -> Result<(String), BadRequest<String>> { let conn: MysqlConnection = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &key.0).unwrap(); return Ok(session.key_material); } #[post(path="/setup", format="application/json", data="<d>")] fn setup(d:Json<SetupMsg>) -> Result<(String), BadRequest<String>> { let param: SetupMsg = d.into_inner(); let conn: MysqlConnection = db_connect(); let attributes: String = serde_json::to_string(&param.attributes).unwrap(); // Setup of a new session. Create keys first let key_gen_params = KeyGenMsg { attributes: param.attributes, scheme: "bsw".to_string() }; println!("Creating key for {} attributes", key_gen_params.attributes.len()); let key_material: Vec<String> = match _keygen(key_gen_params) { // TODO NotNice: keygen returns a vector of strings. Instead it should return some Box<KeyMaterial> with functions like get_public_key() etc. Ok(material) => material, Err(e) => { return Err(BadRequest(Some(format!("Failure to create keys {}",e)))); } }; // Write new session to database and return its id let session = db_create_session(&conn, &String::from("bsw"), &key_material, &attributes); return Ok(session.unwrap()); } fn _keygen(param: KeyGenMsg) -> Result<Vec<String>, String> { let scheme: String = param.scheme; match scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { // Generating mk let (pk, mk): (bsw::CpAbePublicKey,bsw::CpAbeMasterKey) = bsw::setup(); let mut _attributes = param.attributes; //Generating attribute keys let res:bsw::CpAbeSecretKey = bsw::keygen(&pk, &mk, &_attributes).unwrap(); Ok(vec![serde_json::to_string(&pk).unwrap(), serde_json::to_string(&mk).unwrap(), serde_json::to_string(&res).unwrap()]) }, Err(e) => Err("Unsupported scheme".to_string()) } } // ------------------------------------------------------------ // Internal methods follow // ------------------------------------------------------------ fn db_connect() -> MysqlConnection { let database_url : String = env::var("DATABASE_URL").expect("DATABASE_URL must be set"); MysqlConnection::establish(&database_url).expect(&format!("Error connecting to {}", database_url)) // TODO Replace MysqlConnection with more generic "Connection"? } /// Adds a user to database. fn db_add_user(conn: &MysqlConnection, username: &String, passwd: &String, salt: i32, attributes: &Vec<String>, key_material: &String, random_session_id: &String) -> Result<usize, String> { use schema::users; use schema::sessions; // Get primary key from sessions table let session: schema::Session = match sessions::table.filter(sessions::random_session_id.eq(random_session_id)).first::<schema::Session>(conn) { Ok(s) => s, Err(_e) => {return Err(format!("No session with random id {} present. Cannot add user.", random_session_id)); } }; match users::table .filter(users::username.eq(username.to_string())) .filter(users::session_id.eq(session.id)) .first::<schema::User>(conn) { Ok(_u) => return Err("User already exists for this session".to_string()), Err(_e) => {} }; let user = schema::NewUser { username: username.to_string(), password: passwd.to_string(), // TODO store salted hash of pwd. attributes: serde_json::to_string(attributes).unwrap(), key_material: key_material.to_string(), salt: salt, session_id: session.id }; match diesel::insert_into(users::table) .values(&user) .execute(conn) { Ok(id) => Ok(id), Err(_e) => Err("Could not insert user".to_string()) } } fn db_create_session(conn: &MysqlConnection, scheme: &String, key_material: &Vec<String>, attributes: &String) -> Result<String, String> { use schema::sessions; println!("Got scheme {}", scheme); match scheme.parse::<SCHEMES>() { Ok(_scheme) => { let session_id: String = OsRng::new().unwrap().next_u64().to_string(); let session = schema::NewSession { is_initialized: false, scheme: scheme.to_string(), random_session_id: session_id.clone(), key_material: serde_json::to_string(key_material).unwrap(), attributes: attributes.to_string() }; println!("Key material is {}", session.key_material); // Return auto-gen'd session id match diesel::insert_into(sessions::table) .values(&session) .execute(conn) { Ok(_usize) => Ok(session_id), Err(_e) => Err("Could not insert into sessions".to_string()) } } Err(_) => Err("Invalid scheme".to_string()) } } fn db_get_session_by_api_key(conn: &MysqlConnection, api_key: &String) -> Result<schema::Session, diesel::result::Error> { use schema::sessions; sessions::table.filter(sessions::random_session_id.eq(api_key)) .first::<schema::Session>(conn) } fn _db_get_user_by_username<'a>(conn: &MysqlConnection, user: &'a String) -> Option<schema::User> { use schema::users; match users::table.filter(users::username.eq(user)) .first::<schema::User>(conn) { Ok(u) => Some(u), Err(_) => None } } fn _db_get_users_by_apikey<'a>(conn: &MysqlConnection, api_key: &String) -> Vec<schema::User> { use schema::sessions; use schema::users; users::table .inner_join(sessions::table) .filter(sessions::random_session_id.eq(api_key)) .get_results::<(schema::User, schema::Session)>(conn) .expect("Could not load users by API key {}") .into_iter().map(|(user, _session)| user).collect() } /// TODO Use to create salted hashed passwords fn _to_db_passwd(plain_password: String, salt: i32) -> Blake2bResult { let salted_pwd = plain_password + &salt.to_string(); let res = blake2b(64, &[], salted_pwd.as_bytes()); return res; } fn rocket() -> rocket::Rocket { rocket::ignite().mount("/", routes![setup, list_attrs, encrypt, decrypt, add_user]) } fn main() { rocket().launch(); } /// Returns true if `key` is a valid API key string. fn is_valid(api_key: String) -> bool { use schema::users; use schema::sessions; let k : String = match api_key.starts_with("Bearer ") { true => api_key.replace("Bearer ", ""), false => api_key }; let conn = db_connect(); match users::table .inner_join(sessions::table) .filter(users::session_id.eq(sessions::id)) .filter(sessions::random_session_id.eq(k)) .count() .get_result::<i64>(&conn) { Ok(_) => return true, Err(_e) => return false } } // ----------------------------------------------- // Tests follow // ----------------------------------------------- #[cfg(test)] mod tests { use super::rocket; use rocket::local::Client; use rocket::http::Status; use super::*; #[test] fn test_db_user() { let con = db_connect(); // make sure we have a session to test with let session_id: String = db_create_session(&con, &String::from("bsw"), &vec!["".to_string()], &"".to_string()).unwrap(); // Write user into db let user: String = "bla".to_string(); let passwd: String = "blubb".to_string(); let key_material: String = "".to_string(); let attributes: Vec<String>= vec!("".to_string()); let salt: i32 = 1234; let result: usize = db_add_user(&con, &user, &passwd, salt, &attributes, &key_material, &session_id).unwrap(); assert!(result > 0); // Check that it is there let u: schema::User = _db_get_user_by_username(&con, &user).unwrap(); assert_eq!(u.username, user); } #[test] fn test_db_session() { let con = db_connect(); // Create a user let user: String = "bla".to_string(); let passwd: String = "blubb".to_string(); let salt: i32 = 1234; // Setup of a new session. Create keys let key_gen_parms = KeyGenMsg { attributes: vec!["attribute_1".to_string(), "attribute_2".to_string()], scheme: "bsw".to_string() }; let key_material: Vec<String> = _keygen(key_gen_parms).unwrap(); let attributes: Vec<String> = vec!(String::from("")); let scheme: String = "bsw".to_string(); let session_id: String = db_create_session(&con, &scheme, &key_material, &serde_json::to_string(&attributes).unwrap()).expect("Could not create session"); println!("Got session id {}", session_id); db_add_user(&con, &user, &passwd, salt, &attributes, &serde_json::to_string(&key_material).unwrap(), &session_id).expect("Failure adding user"); } #[test] fn test_setup() { let client = Client::new(rocket()).expect("valid rocket instance"); println!("Have rocket"); // Set up scheme let setup_msg: SetupMsg = SetupMsg { scheme: "bsw".to_string(), attributes: vec!("attribute_1".to_string(), "attribute_2".to_string()) }; let mut response = client.post("/setup") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&setup_msg)).expect("Setting up bsw")) .dispatch(); assert_eq!(response.status(), Status::Ok); let session_id: String = response.body_string().unwrap(); println!("SETUP RETURNED {}", &session_id); // Create user let user = User { random_session_id: session_id, username : String::from("admin"), password : String::from("admin"), attributes: vec!("attribute_1".to_string()) }; let response_add: rocket::local::LocalResponse = client.post("/add_user") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&user)).expect("Attribute serialization")) .dispatch(); //assert_eq!(response_add.status(), Status::Ok); } #[test] fn test_encrypt_decrypt() { let client = Client::new(rocket()).expect("valid rocket instance"); // Set up scheme let setup_msg: SetupMsg = SetupMsg { scheme: "bsw".to_string(), attributes: vec!("attribute_1".to_string(), "attribute_2".to_string()) }; let mut response = client.post("/setup") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&setup_msg)).expect("Setting up bsw")) .dispatch(); assert_eq!(response.status(), Status::Ok); let session_id : &String = &response.body_string().unwrap(); println!("Setup returned SessionID {}",session_id); // Create user let user = User { random_session_id: session_id.to_string(), username : String::from("admin"), password : String::from("admin"), attributes: vec!("attribute_1".to_string()) }; let _response_add = client.post("/add_user") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&user)).expect("Attribute serialization")) .dispatch(); // Encrypt some text for a policy let policy:String = String::from(r#"{"OR": [{"ATT": "attribute_1"}, {"ATT": "attribute_2"}]}"#); let msg : EncMessage = EncMessage { plaintext : "Encrypt me".into(), policy : policy, session_id : session_id.clone() }; let mut resp_enc = client.post("/encrypt") .header(ContentType::JSON) .body(serde_json::to_string(&msg).expect("Encryption")) .dispatch(); assert_eq!(resp_enc.status(), Status::Ok); let ct:String = resp_enc.body_string().unwrap(); let ct_json = serde_json::from_str(&ct).unwrap(); // Decrypt again let c : DecMessage = DecMessage { ct: ct_json, session_id: session_id.clone(), username: String::from("admin"), password: String::from("admin") }; let mut resp_dec = client.post("/decrypt") .header(ContentType::JSON) .body(serde_json::to_string(&c).unwrap()) .dispatch(); let pt_hex: String = resp_dec.body_string().unwrap(); println!("HEX: {}", pt_hex); let mut pt: String = serde_json::from_str(&pt_hex).expect("From json"); pt = pt.trim().to_string(); println!("RESULT: {}", pt); assert_eq!(pt, "Encrypt me"); } }
add_user
identifier_name
main.rs
#![feature(plugin, decl_macro, custom_derive, type_ascription)] // Compiler plugins #![plugin(rocket_codegen)] // rocket code generator extern crate rocket; extern crate rabe; extern crate serde; extern crate serde_json; extern crate rustc_serialize; extern crate blake2_rfc; extern crate rocket_simpleauth; extern crate rand; #[macro_use] extern crate rocket_contrib; #[macro_use] extern crate serde_derive; #[macro_use] extern crate diesel; use std::error::*; use std::fs::*; use std::sync::{Once, ONCE_INIT}; use rand::Rng; use rand::os::OsRng; use rocket_contrib::{Json}; use rocket::response::status::BadRequest; use rocket::http::*; use rocket::request::FromRequest; use rocket::request::Request; use rocket::outcome::Outcome; use diesel::*; use std::str; use std::str::FromStr; use std::env; use rabe::schemes::bsw; use blake2_rfc::blake2b::*; pub mod schema; // Change the alias to `Box<error::Error>`. type BoxedResult<T> = std::result::Result<T, Box<Error>>; enum SCHEMES { bsw } impl FromStr for SCHEMES { type Err = (); fn from_str(s: &str) -> Result<SCHEMES, ()> { match s { "bsw" => Ok(SCHEMES::bsw), _ => Err(()), } } } // ---------------------------------------------------- // Internal structs follow // ---------------------------------------------------- struct ApiKey(String); impl<'t, 'r> FromRequest<'t, 'r> for ApiKey { type Error = (); fn from_request(request: &'t Request<'r>) -> Outcome<ApiKey, (Status,()), ()> { let keys: Vec<_> = request.headers().get("Authorization").collect(); if keys.len() != 1 { return Outcome::Failure((Status::BadRequest, ())); } println!("Got API key {}", keys[0]); let key = keys[0]; if !is_valid(keys[0].to_string()) { // return Outcome::Forward(()); return Outcome::Failure((Status::Unauthorized, ())); } return Outcome::Success(ApiKey(key.to_string())); } } // ----------------------------------------------------- // Message formats follow // ----------------------------------------------------- #[derive(Serialize, Deserialize)] struct Message { contents: String } #[derive(Serialize, Deserialize)] struct SetupMsg { scheme: String, attributes: Vec<String> } #[derive(Serialize, Deserialize)] struct KeyGenMsg { attributes: Vec<String>, scheme: String, } #[derive(Serialize, Deserialize)] struct EncMessage { plaintext :String, policy : String, // A json serialized policy that is understood by the scheme assigned to the session session_id : String // Session ID unique per (user,scheme) } #[derive(Serialize, Deserialize)] struct DecMessage { ct: String, session_id: String, // Session ID unique per (user,scheme) username: String, password: String } #[derive(Serialize, Deserialize)] struct ListAttrMsg { username : String, password : String } #[derive(Serialize, Deserialize)] struct User { username: String, password: String, attributes: Vec<String>, random_session_id: String // Reference to session } // ----------------------------------------------------- // REST APIs follow // ----------------------------------------------------- #[post(path="/encrypt", format="application/json", data="<d>")] fn encrypt(d:Json<EncMessage>) -> Result<Json<String>, BadRequest<String>> { // Get active session (panics if not available) let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &d.session_id).unwrap(); // Get key material needed for encryption let key_material: Vec<String> = serde_json::from_str(&session.key_material.as_str()).unwrap(); let pk_string : &String = &key_material[0]; let plaintext: &Vec<u8> = &d.plaintext.as_bytes().to_vec(); let pk : bsw::CpAbePublicKey = serde_json::from_str(pk_string.as_str()).unwrap(); // TODO NotNice: need to convert to scheme-specific type here. Should be generic trait w/ function "KeyMaterial.get_public_key()" println!("plaintext {:?}", plaintext); println!("policy {:?}", &d.policy); let res = bsw::encrypt(&pk, &d.policy, plaintext).unwrap(); Ok(Json(serde_json::to_string_pretty(&res).unwrap())) } #[post(path="/decrypt", format="application/json", data="<d>")] fn decrypt(d:Json<DecMessage>) -> Result<Json<String>, BadRequest<String>> { println!("Decryption demanded with ciphertext {}", &d.ct); // Get session from DB and extract key material needed for decryption let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &d.session_id).unwrap(); let users: Vec<schema::User> = _db_get_users_by_apikey(&conn, &session.random_session_id); println!("Users {:?}", users.len()); let user: schema::User = users.into_iter().take_while(|u| u.username.eq(&d.username)).next().unwrap(); let key_material: String = user.key_material; match session.scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { let ct: bsw::CpAbeCiphertext = serde_json::from_str(&d.ct).unwrap(); let sk: bsw::CpAbeSecretKey = serde_json::from_str(&key_material).unwrap(); // Decrypt ciphertext let res = bsw::decrypt(&sk, &ct).unwrap(); let s = match str::from_utf8(&res) { Ok(v) => v, Err(e) => panic!("Invalid UTF-8 sequence: {}", e), }; Ok(Json(s.to_string())) }, Err(_) => Err(BadRequest(Some(format!("Unsupported scheme {} of session {}", session.scheme, session.random_session_id)))) } } #[post(path="/add_user", format="application/json", data="<d>")] fn add_user(d:Json<User>) -> Result<(), BadRequest<String>> { let ref username: String = d.username; let ref passwd: String = d.password; let ref random_session_id = d.random_session_id; let salt: i32 = 1234; // TODO use random salt when storing hashed user passwords println!("Adding user {} {} {} {}", &username, &passwd, salt, random_session_id); // Create keys for the user let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &random_session_id).unwrap(); let scheme: String = session.scheme; match scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { let master_key_material: Vec<String> = serde_json::from_str(&session.key_material).unwrap(); let master_pk: bsw::CpAbePublicKey = serde_json::from_str(&master_key_material[0]).unwrap(); let master_mk: bsw::CpAbeMasterKey = serde_json::from_str(&master_key_material[1]).unwrap(); let user_sk: bsw::CpAbeSecretKey = bsw::keygen(&master_pk, &master_mk, &d.attributes).unwrap(); match db_add_user(&conn, &username, &passwd, salt, &d.attributes, &serde_json::to_string(&user_sk).unwrap(), random_session_id) { Err(e) => {println!("Nope! {}", e); return Err(BadRequest(Some(format!("Failure adding userpk failure: {}", e))))}, Ok(_r) => return Ok(()) } }, Err(_) => { return Err(BadRequest(Some(format!("Scheme {} not supported", scheme)))); } } } #[post(path="/list_attrs", format="application/json", data="<d>")] fn list_attrs(d:Json<ListAttrMsg>, key: ApiKey) -> Result<(String), BadRequest<String>> { let conn: MysqlConnection = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &key.0).unwrap(); return Ok(session.key_material); } #[post(path="/setup", format="application/json", data="<d>")] fn setup(d:Json<SetupMsg>) -> Result<(String), BadRequest<String>> { let param: SetupMsg = d.into_inner(); let conn: MysqlConnection = db_connect(); let attributes: String = serde_json::to_string(&param.attributes).unwrap(); // Setup of a new session. Create keys first let key_gen_params = KeyGenMsg { attributes: param.attributes, scheme: "bsw".to_string() }; println!("Creating key for {} attributes", key_gen_params.attributes.len()); let key_material: Vec<String> = match _keygen(key_gen_params) { // TODO NotNice: keygen returns a vector of strings. Instead it should return some Box<KeyMaterial> with functions like get_public_key() etc. Ok(material) => material, Err(e) => { return Err(BadRequest(Some(format!("Failure to create keys {}",e)))); } }; // Write new session to database and return its id let session = db_create_session(&conn, &String::from("bsw"), &key_material, &attributes); return Ok(session.unwrap()); } fn _keygen(param: KeyGenMsg) -> Result<Vec<String>, String> { let scheme: String = param.scheme; match scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { // Generating mk let (pk, mk): (bsw::CpAbePublicKey,bsw::CpAbeMasterKey) = bsw::setup(); let mut _attributes = param.attributes; //Generating attribute keys let res:bsw::CpAbeSecretKey = bsw::keygen(&pk, &mk, &_attributes).unwrap(); Ok(vec![serde_json::to_string(&pk).unwrap(), serde_json::to_string(&mk).unwrap(), serde_json::to_string(&res).unwrap()]) }, Err(e) => Err("Unsupported scheme".to_string()) } } // ------------------------------------------------------------ // Internal methods follow // ------------------------------------------------------------ fn db_connect() -> MysqlConnection { let database_url : String = env::var("DATABASE_URL").expect("DATABASE_URL must be set"); MysqlConnection::establish(&database_url).expect(&format!("Error connecting to {}", database_url)) // TODO Replace MysqlConnection with more generic "Connection"? } /// Adds a user to database. fn db_add_user(conn: &MysqlConnection, username: &String, passwd: &String, salt: i32, attributes: &Vec<String>, key_material: &String, random_session_id: &String) -> Result<usize, String> { use schema::users; use schema::sessions; // Get primary key from sessions table let session: schema::Session = match sessions::table.filter(sessions::random_session_id.eq(random_session_id)).first::<schema::Session>(conn) { Ok(s) => s, Err(_e) => {return Err(format!("No session with random id {} present. Cannot add user.", random_session_id)); } }; match users::table .filter(users::username.eq(username.to_string())) .filter(users::session_id.eq(session.id)) .first::<schema::User>(conn) { Ok(_u) => return Err("User already exists for this session".to_string()), Err(_e) => {} }; let user = schema::NewUser { username: username.to_string(), password: passwd.to_string(), // TODO store salted hash of pwd. attributes: serde_json::to_string(attributes).unwrap(), key_material: key_material.to_string(), salt: salt, session_id: session.id }; match diesel::insert_into(users::table) .values(&user) .execute(conn) { Ok(id) => Ok(id), Err(_e) => Err("Could not insert user".to_string()) } } fn db_create_session(conn: &MysqlConnection, scheme: &String, key_material: &Vec<String>, attributes: &String) -> Result<String, String>
fn db_get_session_by_api_key(conn: &MysqlConnection, api_key: &String) -> Result<schema::Session, diesel::result::Error> { use schema::sessions; sessions::table.filter(sessions::random_session_id.eq(api_key)) .first::<schema::Session>(conn) } fn _db_get_user_by_username<'a>(conn: &MysqlConnection, user: &'a String) -> Option<schema::User> { use schema::users; match users::table.filter(users::username.eq(user)) .first::<schema::User>(conn) { Ok(u) => Some(u), Err(_) => None } } fn _db_get_users_by_apikey<'a>(conn: &MysqlConnection, api_key: &String) -> Vec<schema::User> { use schema::sessions; use schema::users; users::table .inner_join(sessions::table) .filter(sessions::random_session_id.eq(api_key)) .get_results::<(schema::User, schema::Session)>(conn) .expect("Could not load users by API key {}") .into_iter().map(|(user, _session)| user).collect() } /// TODO Use to create salted hashed passwords fn _to_db_passwd(plain_password: String, salt: i32) -> Blake2bResult { let salted_pwd = plain_password + &salt.to_string(); let res = blake2b(64, &[], salted_pwd.as_bytes()); return res; } fn rocket() -> rocket::Rocket { rocket::ignite().mount("/", routes![setup, list_attrs, encrypt, decrypt, add_user]) } fn main() { rocket().launch(); } /// Returns true if `key` is a valid API key string. fn is_valid(api_key: String) -> bool { use schema::users; use schema::sessions; let k : String = match api_key.starts_with("Bearer ") { true => api_key.replace("Bearer ", ""), false => api_key }; let conn = db_connect(); match users::table .inner_join(sessions::table) .filter(users::session_id.eq(sessions::id)) .filter(sessions::random_session_id.eq(k)) .count() .get_result::<i64>(&conn) { Ok(_) => return true, Err(_e) => return false } } // ----------------------------------------------- // Tests follow // ----------------------------------------------- #[cfg(test)] mod tests { use super::rocket; use rocket::local::Client; use rocket::http::Status; use super::*; #[test] fn test_db_user() { let con = db_connect(); // make sure we have a session to test with let session_id: String = db_create_session(&con, &String::from("bsw"), &vec!["".to_string()], &"".to_string()).unwrap(); // Write user into db let user: String = "bla".to_string(); let passwd: String = "blubb".to_string(); let key_material: String = "".to_string(); let attributes: Vec<String>= vec!("".to_string()); let salt: i32 = 1234; let result: usize = db_add_user(&con, &user, &passwd, salt, &attributes, &key_material, &session_id).unwrap(); assert!(result > 0); // Check that it is there let u: schema::User = _db_get_user_by_username(&con, &user).unwrap(); assert_eq!(u.username, user); } #[test] fn test_db_session() { let con = db_connect(); // Create a user let user: String = "bla".to_string(); let passwd: String = "blubb".to_string(); let salt: i32 = 1234; // Setup of a new session. Create keys let key_gen_parms = KeyGenMsg { attributes: vec!["attribute_1".to_string(), "attribute_2".to_string()], scheme: "bsw".to_string() }; let key_material: Vec<String> = _keygen(key_gen_parms).unwrap(); let attributes: Vec<String> = vec!(String::from("")); let scheme: String = "bsw".to_string(); let session_id: String = db_create_session(&con, &scheme, &key_material, &serde_json::to_string(&attributes).unwrap()).expect("Could not create session"); println!("Got session id {}", session_id); db_add_user(&con, &user, &passwd, salt, &attributes, &serde_json::to_string(&key_material).unwrap(), &session_id).expect("Failure adding user"); } #[test] fn test_setup() { let client = Client::new(rocket()).expect("valid rocket instance"); println!("Have rocket"); // Set up scheme let setup_msg: SetupMsg = SetupMsg { scheme: "bsw".to_string(), attributes: vec!("attribute_1".to_string(), "attribute_2".to_string()) }; let mut response = client.post("/setup") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&setup_msg)).expect("Setting up bsw")) .dispatch(); assert_eq!(response.status(), Status::Ok); let session_id: String = response.body_string().unwrap(); println!("SETUP RETURNED {}", &session_id); // Create user let user = User { random_session_id: session_id, username : String::from("admin"), password : String::from("admin"), attributes: vec!("attribute_1".to_string()) }; let response_add: rocket::local::LocalResponse = client.post("/add_user") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&user)).expect("Attribute serialization")) .dispatch(); //assert_eq!(response_add.status(), Status::Ok); } #[test] fn test_encrypt_decrypt() { let client = Client::new(rocket()).expect("valid rocket instance"); // Set up scheme let setup_msg: SetupMsg = SetupMsg { scheme: "bsw".to_string(), attributes: vec!("attribute_1".to_string(), "attribute_2".to_string()) }; let mut response = client.post("/setup") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&setup_msg)).expect("Setting up bsw")) .dispatch(); assert_eq!(response.status(), Status::Ok); let session_id : &String = &response.body_string().unwrap(); println!("Setup returned SessionID {}",session_id); // Create user let user = User { random_session_id: session_id.to_string(), username : String::from("admin"), password : String::from("admin"), attributes: vec!("attribute_1".to_string()) }; let _response_add = client.post("/add_user") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&user)).expect("Attribute serialization")) .dispatch(); // Encrypt some text for a policy let policy:String = String::from(r#"{"OR": [{"ATT": "attribute_1"}, {"ATT": "attribute_2"}]}"#); let msg : EncMessage = EncMessage { plaintext : "Encrypt me".into(), policy : policy, session_id : session_id.clone() }; let mut resp_enc = client.post("/encrypt") .header(ContentType::JSON) .body(serde_json::to_string(&msg).expect("Encryption")) .dispatch(); assert_eq!(resp_enc.status(), Status::Ok); let ct:String = resp_enc.body_string().unwrap(); let ct_json = serde_json::from_str(&ct).unwrap(); // Decrypt again let c : DecMessage = DecMessage { ct: ct_json, session_id: session_id.clone(), username: String::from("admin"), password: String::from("admin") }; let mut resp_dec = client.post("/decrypt") .header(ContentType::JSON) .body(serde_json::to_string(&c).unwrap()) .dispatch(); let pt_hex: String = resp_dec.body_string().unwrap(); println!("HEX: {}", pt_hex); let mut pt: String = serde_json::from_str(&pt_hex).expect("From json"); pt = pt.trim().to_string(); println!("RESULT: {}", pt); assert_eq!(pt, "Encrypt me"); } }
{ use schema::sessions; println!("Got scheme {}", scheme); match scheme.parse::<SCHEMES>() { Ok(_scheme) => { let session_id: String = OsRng::new().unwrap().next_u64().to_string(); let session = schema::NewSession { is_initialized: false, scheme: scheme.to_string(), random_session_id: session_id.clone(), key_material: serde_json::to_string(key_material).unwrap(), attributes: attributes.to_string() }; println!("Key material is {}", session.key_material); // Return auto-gen'd session id match diesel::insert_into(sessions::table) .values(&session) .execute(conn) { Ok(_usize) => Ok(session_id), Err(_e) => Err("Could not insert into sessions".to_string()) } } Err(_) => Err("Invalid scheme".to_string()) } }
identifier_body
main.rs
#![feature(plugin, decl_macro, custom_derive, type_ascription)] // Compiler plugins #![plugin(rocket_codegen)] // rocket code generator extern crate rocket; extern crate rabe; extern crate serde; extern crate serde_json; extern crate rustc_serialize; extern crate blake2_rfc; extern crate rocket_simpleauth; extern crate rand; #[macro_use] extern crate rocket_contrib; #[macro_use] extern crate serde_derive; #[macro_use] extern crate diesel; use std::error::*; use std::fs::*; use std::sync::{Once, ONCE_INIT}; use rand::Rng; use rand::os::OsRng; use rocket_contrib::{Json}; use rocket::response::status::BadRequest; use rocket::http::*; use rocket::request::FromRequest; use rocket::request::Request; use rocket::outcome::Outcome; use diesel::*; use std::str; use std::str::FromStr; use std::env; use rabe::schemes::bsw; use blake2_rfc::blake2b::*; pub mod schema; // Change the alias to `Box<error::Error>`. type BoxedResult<T> = std::result::Result<T, Box<Error>>; enum SCHEMES { bsw } impl FromStr for SCHEMES { type Err = (); fn from_str(s: &str) -> Result<SCHEMES, ()> { match s { "bsw" => Ok(SCHEMES::bsw), _ => Err(()), } } } // ---------------------------------------------------- // Internal structs follow // ---------------------------------------------------- struct ApiKey(String); impl<'t, 'r> FromRequest<'t, 'r> for ApiKey { type Error = (); fn from_request(request: &'t Request<'r>) -> Outcome<ApiKey, (Status,()), ()> { let keys: Vec<_> = request.headers().get("Authorization").collect(); if keys.len() != 1 { return Outcome::Failure((Status::BadRequest, ())); } println!("Got API key {}", keys[0]); let key = keys[0]; if !is_valid(keys[0].to_string()) { // return Outcome::Forward(());
} // ----------------------------------------------------- // Message formats follow // ----------------------------------------------------- #[derive(Serialize, Deserialize)] struct Message { contents: String } #[derive(Serialize, Deserialize)] struct SetupMsg { scheme: String, attributes: Vec<String> } #[derive(Serialize, Deserialize)] struct KeyGenMsg { attributes: Vec<String>, scheme: String, } #[derive(Serialize, Deserialize)] struct EncMessage { plaintext :String, policy : String, // A json serialized policy that is understood by the scheme assigned to the session session_id : String // Session ID unique per (user,scheme) } #[derive(Serialize, Deserialize)] struct DecMessage { ct: String, session_id: String, // Session ID unique per (user,scheme) username: String, password: String } #[derive(Serialize, Deserialize)] struct ListAttrMsg { username : String, password : String } #[derive(Serialize, Deserialize)] struct User { username: String, password: String, attributes: Vec<String>, random_session_id: String // Reference to session } // ----------------------------------------------------- // REST APIs follow // ----------------------------------------------------- #[post(path="/encrypt", format="application/json", data="<d>")] fn encrypt(d:Json<EncMessage>) -> Result<Json<String>, BadRequest<String>> { // Get active session (panics if not available) let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &d.session_id).unwrap(); // Get key material needed for encryption let key_material: Vec<String> = serde_json::from_str(&session.key_material.as_str()).unwrap(); let pk_string : &String = &key_material[0]; let plaintext: &Vec<u8> = &d.plaintext.as_bytes().to_vec(); let pk : bsw::CpAbePublicKey = serde_json::from_str(pk_string.as_str()).unwrap(); // TODO NotNice: need to convert to scheme-specific type here. Should be generic trait w/ function "KeyMaterial.get_public_key()" println!("plaintext {:?}", plaintext); println!("policy {:?}", &d.policy); let res = bsw::encrypt(&pk, &d.policy, plaintext).unwrap(); Ok(Json(serde_json::to_string_pretty(&res).unwrap())) } #[post(path="/decrypt", format="application/json", data="<d>")] fn decrypt(d:Json<DecMessage>) -> Result<Json<String>, BadRequest<String>> { println!("Decryption demanded with ciphertext {}", &d.ct); // Get session from DB and extract key material needed for decryption let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &d.session_id).unwrap(); let users: Vec<schema::User> = _db_get_users_by_apikey(&conn, &session.random_session_id); println!("Users {:?}", users.len()); let user: schema::User = users.into_iter().take_while(|u| u.username.eq(&d.username)).next().unwrap(); let key_material: String = user.key_material; match session.scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { let ct: bsw::CpAbeCiphertext = serde_json::from_str(&d.ct).unwrap(); let sk: bsw::CpAbeSecretKey = serde_json::from_str(&key_material).unwrap(); // Decrypt ciphertext let res = bsw::decrypt(&sk, &ct).unwrap(); let s = match str::from_utf8(&res) { Ok(v) => v, Err(e) => panic!("Invalid UTF-8 sequence: {}", e), }; Ok(Json(s.to_string())) }, Err(_) => Err(BadRequest(Some(format!("Unsupported scheme {} of session {}", session.scheme, session.random_session_id)))) } } #[post(path="/add_user", format="application/json", data="<d>")] fn add_user(d:Json<User>) -> Result<(), BadRequest<String>> { let ref username: String = d.username; let ref passwd: String = d.password; let ref random_session_id = d.random_session_id; let salt: i32 = 1234; // TODO use random salt when storing hashed user passwords println!("Adding user {} {} {} {}", &username, &passwd, salt, random_session_id); // Create keys for the user let conn = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &random_session_id).unwrap(); let scheme: String = session.scheme; match scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { let master_key_material: Vec<String> = serde_json::from_str(&session.key_material).unwrap(); let master_pk: bsw::CpAbePublicKey = serde_json::from_str(&master_key_material[0]).unwrap(); let master_mk: bsw::CpAbeMasterKey = serde_json::from_str(&master_key_material[1]).unwrap(); let user_sk: bsw::CpAbeSecretKey = bsw::keygen(&master_pk, &master_mk, &d.attributes).unwrap(); match db_add_user(&conn, &username, &passwd, salt, &d.attributes, &serde_json::to_string(&user_sk).unwrap(), random_session_id) { Err(e) => {println!("Nope! {}", e); return Err(BadRequest(Some(format!("Failure adding userpk failure: {}", e))))}, Ok(_r) => return Ok(()) } }, Err(_) => { return Err(BadRequest(Some(format!("Scheme {} not supported", scheme)))); } } } #[post(path="/list_attrs", format="application/json", data="<d>")] fn list_attrs(d:Json<ListAttrMsg>, key: ApiKey) -> Result<(String), BadRequest<String>> { let conn: MysqlConnection = db_connect(); let session: schema::Session = db_get_session_by_api_key(&conn, &key.0).unwrap(); return Ok(session.key_material); } #[post(path="/setup", format="application/json", data="<d>")] fn setup(d:Json<SetupMsg>) -> Result<(String), BadRequest<String>> { let param: SetupMsg = d.into_inner(); let conn: MysqlConnection = db_connect(); let attributes: String = serde_json::to_string(&param.attributes).unwrap(); // Setup of a new session. Create keys first let key_gen_params = KeyGenMsg { attributes: param.attributes, scheme: "bsw".to_string() }; println!("Creating key for {} attributes", key_gen_params.attributes.len()); let key_material: Vec<String> = match _keygen(key_gen_params) { // TODO NotNice: keygen returns a vector of strings. Instead it should return some Box<KeyMaterial> with functions like get_public_key() etc. Ok(material) => material, Err(e) => { return Err(BadRequest(Some(format!("Failure to create keys {}",e)))); } }; // Write new session to database and return its id let session = db_create_session(&conn, &String::from("bsw"), &key_material, &attributes); return Ok(session.unwrap()); } fn _keygen(param: KeyGenMsg) -> Result<Vec<String>, String> { let scheme: String = param.scheme; match scheme.parse::<SCHEMES>() { Ok(SCHEMES::bsw) => { // Generating mk let (pk, mk): (bsw::CpAbePublicKey,bsw::CpAbeMasterKey) = bsw::setup(); let mut _attributes = param.attributes; //Generating attribute keys let res:bsw::CpAbeSecretKey = bsw::keygen(&pk, &mk, &_attributes).unwrap(); Ok(vec![serde_json::to_string(&pk).unwrap(), serde_json::to_string(&mk).unwrap(), serde_json::to_string(&res).unwrap()]) }, Err(e) => Err("Unsupported scheme".to_string()) } } // ------------------------------------------------------------ // Internal methods follow // ------------------------------------------------------------ fn db_connect() -> MysqlConnection { let database_url : String = env::var("DATABASE_URL").expect("DATABASE_URL must be set"); MysqlConnection::establish(&database_url).expect(&format!("Error connecting to {}", database_url)) // TODO Replace MysqlConnection with more generic "Connection"? } /// Adds a user to database. fn db_add_user(conn: &MysqlConnection, username: &String, passwd: &String, salt: i32, attributes: &Vec<String>, key_material: &String, random_session_id: &String) -> Result<usize, String> { use schema::users; use schema::sessions; // Get primary key from sessions table let session: schema::Session = match sessions::table.filter(sessions::random_session_id.eq(random_session_id)).first::<schema::Session>(conn) { Ok(s) => s, Err(_e) => {return Err(format!("No session with random id {} present. Cannot add user.", random_session_id)); } }; match users::table .filter(users::username.eq(username.to_string())) .filter(users::session_id.eq(session.id)) .first::<schema::User>(conn) { Ok(_u) => return Err("User already exists for this session".to_string()), Err(_e) => {} }; let user = schema::NewUser { username: username.to_string(), password: passwd.to_string(), // TODO store salted hash of pwd. attributes: serde_json::to_string(attributes).unwrap(), key_material: key_material.to_string(), salt: salt, session_id: session.id }; match diesel::insert_into(users::table) .values(&user) .execute(conn) { Ok(id) => Ok(id), Err(_e) => Err("Could not insert user".to_string()) } } fn db_create_session(conn: &MysqlConnection, scheme: &String, key_material: &Vec<String>, attributes: &String) -> Result<String, String> { use schema::sessions; println!("Got scheme {}", scheme); match scheme.parse::<SCHEMES>() { Ok(_scheme) => { let session_id: String = OsRng::new().unwrap().next_u64().to_string(); let session = schema::NewSession { is_initialized: false, scheme: scheme.to_string(), random_session_id: session_id.clone(), key_material: serde_json::to_string(key_material).unwrap(), attributes: attributes.to_string() }; println!("Key material is {}", session.key_material); // Return auto-gen'd session id match diesel::insert_into(sessions::table) .values(&session) .execute(conn) { Ok(_usize) => Ok(session_id), Err(_e) => Err("Could not insert into sessions".to_string()) } } Err(_) => Err("Invalid scheme".to_string()) } } fn db_get_session_by_api_key(conn: &MysqlConnection, api_key: &String) -> Result<schema::Session, diesel::result::Error> { use schema::sessions; sessions::table.filter(sessions::random_session_id.eq(api_key)) .first::<schema::Session>(conn) } fn _db_get_user_by_username<'a>(conn: &MysqlConnection, user: &'a String) -> Option<schema::User> { use schema::users; match users::table.filter(users::username.eq(user)) .first::<schema::User>(conn) { Ok(u) => Some(u), Err(_) => None } } fn _db_get_users_by_apikey<'a>(conn: &MysqlConnection, api_key: &String) -> Vec<schema::User> { use schema::sessions; use schema::users; users::table .inner_join(sessions::table) .filter(sessions::random_session_id.eq(api_key)) .get_results::<(schema::User, schema::Session)>(conn) .expect("Could not load users by API key {}") .into_iter().map(|(user, _session)| user).collect() } /// TODO Use to create salted hashed passwords fn _to_db_passwd(plain_password: String, salt: i32) -> Blake2bResult { let salted_pwd = plain_password + &salt.to_string(); let res = blake2b(64, &[], salted_pwd.as_bytes()); return res; } fn rocket() -> rocket::Rocket { rocket::ignite().mount("/", routes![setup, list_attrs, encrypt, decrypt, add_user]) } fn main() { rocket().launch(); } /// Returns true if `key` is a valid API key string. fn is_valid(api_key: String) -> bool { use schema::users; use schema::sessions; let k : String = match api_key.starts_with("Bearer ") { true => api_key.replace("Bearer ", ""), false => api_key }; let conn = db_connect(); match users::table .inner_join(sessions::table) .filter(users::session_id.eq(sessions::id)) .filter(sessions::random_session_id.eq(k)) .count() .get_result::<i64>(&conn) { Ok(_) => return true, Err(_e) => return false } } // ----------------------------------------------- // Tests follow // ----------------------------------------------- #[cfg(test)] mod tests { use super::rocket; use rocket::local::Client; use rocket::http::Status; use super::*; #[test] fn test_db_user() { let con = db_connect(); // make sure we have a session to test with let session_id: String = db_create_session(&con, &String::from("bsw"), &vec!["".to_string()], &"".to_string()).unwrap(); // Write user into db let user: String = "bla".to_string(); let passwd: String = "blubb".to_string(); let key_material: String = "".to_string(); let attributes: Vec<String>= vec!("".to_string()); let salt: i32 = 1234; let result: usize = db_add_user(&con, &user, &passwd, salt, &attributes, &key_material, &session_id).unwrap(); assert!(result > 0); // Check that it is there let u: schema::User = _db_get_user_by_username(&con, &user).unwrap(); assert_eq!(u.username, user); } #[test] fn test_db_session() { let con = db_connect(); // Create a user let user: String = "bla".to_string(); let passwd: String = "blubb".to_string(); let salt: i32 = 1234; // Setup of a new session. Create keys let key_gen_parms = KeyGenMsg { attributes: vec!["attribute_1".to_string(), "attribute_2".to_string()], scheme: "bsw".to_string() }; let key_material: Vec<String> = _keygen(key_gen_parms).unwrap(); let attributes: Vec<String> = vec!(String::from("")); let scheme: String = "bsw".to_string(); let session_id: String = db_create_session(&con, &scheme, &key_material, &serde_json::to_string(&attributes).unwrap()).expect("Could not create session"); println!("Got session id {}", session_id); db_add_user(&con, &user, &passwd, salt, &attributes, &serde_json::to_string(&key_material).unwrap(), &session_id).expect("Failure adding user"); } #[test] fn test_setup() { let client = Client::new(rocket()).expect("valid rocket instance"); println!("Have rocket"); // Set up scheme let setup_msg: SetupMsg = SetupMsg { scheme: "bsw".to_string(), attributes: vec!("attribute_1".to_string(), "attribute_2".to_string()) }; let mut response = client.post("/setup") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&setup_msg)).expect("Setting up bsw")) .dispatch(); assert_eq!(response.status(), Status::Ok); let session_id: String = response.body_string().unwrap(); println!("SETUP RETURNED {}", &session_id); // Create user let user = User { random_session_id: session_id, username : String::from("admin"), password : String::from("admin"), attributes: vec!("attribute_1".to_string()) }; let response_add: rocket::local::LocalResponse = client.post("/add_user") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&user)).expect("Attribute serialization")) .dispatch(); //assert_eq!(response_add.status(), Status::Ok); } #[test] fn test_encrypt_decrypt() { let client = Client::new(rocket()).expect("valid rocket instance"); // Set up scheme let setup_msg: SetupMsg = SetupMsg { scheme: "bsw".to_string(), attributes: vec!("attribute_1".to_string(), "attribute_2".to_string()) }; let mut response = client.post("/setup") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&setup_msg)).expect("Setting up bsw")) .dispatch(); assert_eq!(response.status(), Status::Ok); let session_id : &String = &response.body_string().unwrap(); println!("Setup returned SessionID {}",session_id); // Create user let user = User { random_session_id: session_id.to_string(), username : String::from("admin"), password : String::from("admin"), attributes: vec!("attribute_1".to_string()) }; let _response_add = client.post("/add_user") .header(ContentType::JSON) .body(serde_json::to_string(&json!(&user)).expect("Attribute serialization")) .dispatch(); // Encrypt some text for a policy let policy:String = String::from(r#"{"OR": [{"ATT": "attribute_1"}, {"ATT": "attribute_2"}]}"#); let msg : EncMessage = EncMessage { plaintext : "Encrypt me".into(), policy : policy, session_id : session_id.clone() }; let mut resp_enc = client.post("/encrypt") .header(ContentType::JSON) .body(serde_json::to_string(&msg).expect("Encryption")) .dispatch(); assert_eq!(resp_enc.status(), Status::Ok); let ct:String = resp_enc.body_string().unwrap(); let ct_json = serde_json::from_str(&ct).unwrap(); // Decrypt again let c : DecMessage = DecMessage { ct: ct_json, session_id: session_id.clone(), username: String::from("admin"), password: String::from("admin") }; let mut resp_dec = client.post("/decrypt") .header(ContentType::JSON) .body(serde_json::to_string(&c).unwrap()) .dispatch(); let pt_hex: String = resp_dec.body_string().unwrap(); println!("HEX: {}", pt_hex); let mut pt: String = serde_json::from_str(&pt_hex).expect("From json"); pt = pt.trim().to_string(); println!("RESULT: {}", pt); assert_eq!(pt, "Encrypt me"); } }
return Outcome::Failure((Status::Unauthorized, ())); } return Outcome::Success(ApiKey(key.to_string())); }
random_line_split
network_listener.py
# -*- coding: utf-8 -*- from operator import attrgetter import logging import StringIO import struct import dpkt from netifaces import interfaces, ifaddresses, AF_INET from sniff import PcapWrapper import http ACK = dpkt.tcp.TH_ACK SYN = dpkt.tcp.TH_SYN FIN = dpkt.tcp.TH_FIN RST = dpkt.tcp.TH_RST PUSH = dpkt.tcp.TH_PUSH def ipaddr_string(addr): return '.'.join(str(octet) for octet in struct.unpack('B' * len(addr), addr)) class NetworkFileListener(object): def __init__(self, interface=None, mime_types=None): self.pc = None self.on_file_complete = None self.packet_streams = {} self.local_ips = self.detect_local_ips() logging.info("Local IP Addresses: %s" % ', '.join(self.local_ips)) self.interface = interface self.mime_types = mime_types def detect_local_ips(self): """Determine all of the local ip addresses for this machine This allows us to flag traffic as inbound or outbound. """ result = set() for ifaceName in interfaces(): try: address = [i['addr'] for i in ifaddresses(ifaceName)[AF_INET]] except: pass result.add(address[0]) return tuple(result) def start(self): if self.pc is not None: raise Exception('Already listening.') self.pc = PcapWrapper(self.interface, filters='tcp') try: self.pc.loop(self._on_packet) except KeyboardInterrupt: pass if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_packet(self, pkt): try: self._handle_packet(pkt) except Exception as e: logging.exception(e) def _parse_tcp_packet(self, data): if len(data) == 0 or data is None: return None if data.startswith('GET') or data.startswith('POST'): return None try: return dpkt.http.Reqsponse(data) except: pass return None def _handle_packet(self, pkt): eth = dpkt.ethernet.Ethernet(pkt) ip = eth.data tcp = ip.data data = tcp.data is_outbound = ipaddr_string(ip.dst) not in self.local_ips direction = 'outbound' if is_outbound else 'inbound' connection_hash = hash_packet(eth, outbound=is_outbound) if ipaddr_string(ip.src) in self.local_ips and ipaddr_string(ip.dst) in self.local_ips: # ignore packets that exist only on this computer return # lets first check if this is a http request instead of a response if data.startswith('GET') or data.startswith('POST'): if is_outbound: # ignore inbound http request _msg = 'Detected an %s HTTP Request from %s to %s' logging.debug(_msg % (direction, ipaddr_string(ip.src), ipaddr_string(ip.dst))) self._handle_request(connection_hash, tcp) elif not is_outbound: stream = self.packet_streams.get(connection_hash) if stream is not None: self._handle_response(stream, tcp) def _handle_request(self, connection_hash, tcp_pkt): if http.has_complete_headers(tcp_pkt.data): req = http.parse_request(tcp_pkt.data) logging.debug('Request URL: %s' % req['host'] + req['path']) logging.debug('Storing stream %s.' % connection_hash) self.packet_streams[connection_hash] = TcpStream(connection_hash) def _delete_stream(self, stream): if stream.id in self.packet_streams: del self.packet_streams[stream.id] def _handle_response(self, stream, tcp_pkt): had_headers = (stream.headers is not None) stream.add_packet(tcp_pkt) if not had_headers and stream.headers is not None: # this will happen the first packet that contain http header if self.mime_types is not None: mime_type = stream.headers.get('content-type', '').split(';')[0].strip() if mime_type not in self.mime_types: logging.debug('Ignoring mime_type %s' % mime_type) self._delete_stream(stream) return if stream.is_finished: if stream.id not in self.packet_streams: # probably just a retransmission return self._delete_stream(stream) if stream.is_valid: self._on_request_complete(stream) else: _msg = "Stream was invalid at %.1f%% with %i bytes loaded" logging.error(_msg % (stream.progress * 100, stream.http_bytes_loaded)) if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_request_complete(self, stream): headers = stream.headers if headers is not None: mime_type = headers.get('content-type') _msg = "Successfully observed a file with %i bytes and mime-type %s" logging.info(_msg % (stream.http_content_length, stream.headers.get('content-type', ''))) f = RawFile(stream.content, mime_type) self._on_file_complete(f) def _on_file_complete(self, f): if self.on_file_complete is not None:
def iter_packets(iterable): """Sorts an iterable of packets and removes the duplicates""" prev = None for i in sorted(iterable, key=attrgetter('seq')): if prev is None or prev.seq != i.seq: prev = i yield i def hash_packet(eth, outbound=False): """Hashes a packet to determine the tcp stream it is part of """ ip = eth.data tcp = ip.data return '%s:%i' % (ipaddr_string(ip.dst if outbound else ip.src), tcp.sport if outbound else tcp.dport ) def parse_flags(flags): result = [] for flag, name in ((ACK, 'ACK'), (SYN, 'SYN'), (PUSH, 'PUSH'), (RST, 'RST')): if flags & flag: result.append(name) return result class RawFile(object): def __init__(self, content, mime_type): self.content = content self.mime_type = mime_type class TcpStream(object): def __init__(self, id): self.id = id self.buffer = {} self.packets = None self.base_seq = None self.next_seq = None self.header_data = '' self.headers = None self.is_http = None self.is_finished = False self.is_valid = True self.http_content_length = None self.http_bytes_loaded = 0 def add_packet(self, packet): if self.is_finished: return #vals = [] #for k in ('ack', 'dport', 'flags', 'off', 'off_x2', 'seq', 'sport', 'sum', 'urp', 'win'): # vals.append('%s=%s' % (k, getattr(packet, k))) #vals.append(parse_flags(packet.flags)) if self.base_seq is None: # we do not yet know the first seq if packet.data.startswith('HTTP'): self.is_http = True self._on_first_packet(packet) else: self.buffer[packet.seq] = packet else: if packet.seq == self.next_seq: # the exact next packet self._on_next_packet(packet) elif packet.seq < self.next_seq: # retransmission pass else: #out of order packet self.buffer[packet.seq] = packet # if the buffer grows to be > than 2K assume something went wrong if len(self.buffer) > 2000: self.is_finished = True self.is_valid = False logging.error("Packet buffer filled up") def rel_seq(self, packet): return packet.seq - self.base_seq @property def content(self): return self.packets @property def progress(self): if self.http_content_length is None: return 0 if self.http_content_length in (0, self.http_bytes_loaded): return 1 return float(self.http_bytes_loaded) / float(self.http_content_length) def _on_first_packet(self, packet): # check if this is actually the first packet if self.base_seq is None: self.base_seq = packet.seq self.next_seq = packet.seq self._on_next_packet(packet) def _on_next_packet(self, packet): self._append_packet(packet) self._check_buffer() def _check_buffer(self): """Looks in the buffer to see if we have the next packet, if so append it and continue till there are no packets left. """ count = 0 for packet in self.remove_buffered_packets(): self._append_packet(packet) count += 1 if count > 0: logging.debug('Removed %i items from the buffer, %i left.' % (count, len(self.buffer))) def remove_buffered_packets(self): """Iterates over next packets in the buffer and removes them""" seq = self.next_seq while True: p = self.buffer.pop(seq, None) if p is None: break else: seq += len(p.data) yield p def _append_packet(self, packet): """Appends a packet to the end of the list of received packets and processes it""" self.next_seq += len(packet.data) if self.headers is not None: if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(packet.data) self.http_bytes_loaded += len(packet.data) else: self.header_data += packet.data # check if we have enough packets for the entire http header if self.is_http and self.headers is None: if http.has_complete_headers(self.header_data): resp = http.parse_response(self.header_data) self.header_data = None if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(resp['body']) self.headers = resp['headers'] self.http_bytes_loaded = len(resp['body']) self._on_http_headers() # check if we have finished the request if self.http_content_length is not None: if self.http_content_length == self.http_bytes_loaded: self.is_finished = True elif self.http_content_length < self.http_bytes_loaded: logging.error("Received data was longer than the content length header") self.is_valid = False self.is_finished = True self._handle_ordered_packet(packet) def _on_last_packet(self, packet): self.is_finished = True def _handle_ordered_packet(self, packet): """This will eventually provide a way for a callback receive packets in order""" pass def _on_http_headers(self): content_length = self.headers.get('content-length', None) if content_length is not None: content_length = int(content_length) self.http_content_length = content_length
self.on_file_complete(f)
conditional_block
network_listener.py
# -*- coding: utf-8 -*- from operator import attrgetter import logging import StringIO import struct import dpkt from netifaces import interfaces, ifaddresses, AF_INET from sniff import PcapWrapper import http ACK = dpkt.tcp.TH_ACK SYN = dpkt.tcp.TH_SYN FIN = dpkt.tcp.TH_FIN RST = dpkt.tcp.TH_RST PUSH = dpkt.tcp.TH_PUSH def ipaddr_string(addr): return '.'.join(str(octet) for octet in struct.unpack('B' * len(addr), addr)) class NetworkFileListener(object): def __init__(self, interface=None, mime_types=None): self.pc = None self.on_file_complete = None self.packet_streams = {} self.local_ips = self.detect_local_ips() logging.info("Local IP Addresses: %s" % ', '.join(self.local_ips)) self.interface = interface self.mime_types = mime_types def detect_local_ips(self): """Determine all of the local ip addresses for this machine This allows us to flag traffic as inbound or outbound. """ result = set() for ifaceName in interfaces(): try: address = [i['addr'] for i in ifaddresses(ifaceName)[AF_INET]] except: pass result.add(address[0]) return tuple(result) def start(self): if self.pc is not None: raise Exception('Already listening.') self.pc = PcapWrapper(self.interface, filters='tcp') try: self.pc.loop(self._on_packet) except KeyboardInterrupt: pass if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_packet(self, pkt): try: self._handle_packet(pkt) except Exception as e: logging.exception(e) def _parse_tcp_packet(self, data): if len(data) == 0 or data is None: return None if data.startswith('GET') or data.startswith('POST'): return None try: return dpkt.http.Reqsponse(data) except: pass return None def _handle_packet(self, pkt): eth = dpkt.ethernet.Ethernet(pkt) ip = eth.data tcp = ip.data data = tcp.data is_outbound = ipaddr_string(ip.dst) not in self.local_ips direction = 'outbound' if is_outbound else 'inbound' connection_hash = hash_packet(eth, outbound=is_outbound) if ipaddr_string(ip.src) in self.local_ips and ipaddr_string(ip.dst) in self.local_ips: # ignore packets that exist only on this computer return # lets first check if this is a http request instead of a response if data.startswith('GET') or data.startswith('POST'): if is_outbound: # ignore inbound http request _msg = 'Detected an %s HTTP Request from %s to %s' logging.debug(_msg % (direction, ipaddr_string(ip.src), ipaddr_string(ip.dst))) self._handle_request(connection_hash, tcp) elif not is_outbound: stream = self.packet_streams.get(connection_hash) if stream is not None: self._handle_response(stream, tcp) def _handle_request(self, connection_hash, tcp_pkt): if http.has_complete_headers(tcp_pkt.data): req = http.parse_request(tcp_pkt.data) logging.debug('Request URL: %s' % req['host'] + req['path']) logging.debug('Storing stream %s.' % connection_hash) self.packet_streams[connection_hash] = TcpStream(connection_hash) def _delete_stream(self, stream): if stream.id in self.packet_streams: del self.packet_streams[stream.id] def _handle_response(self, stream, tcp_pkt): had_headers = (stream.headers is not None) stream.add_packet(tcp_pkt) if not had_headers and stream.headers is not None: # this will happen the first packet that contain http header if self.mime_types is not None: mime_type = stream.headers.get('content-type', '').split(';')[0].strip() if mime_type not in self.mime_types: logging.debug('Ignoring mime_type %s' % mime_type) self._delete_stream(stream) return if stream.is_finished: if stream.id not in self.packet_streams: # probably just a retransmission return self._delete_stream(stream) if stream.is_valid: self._on_request_complete(stream) else: _msg = "Stream was invalid at %.1f%% with %i bytes loaded" logging.error(_msg % (stream.progress * 100, stream.http_bytes_loaded)) if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_request_complete(self, stream): headers = stream.headers if headers is not None: mime_type = headers.get('content-type') _msg = "Successfully observed a file with %i bytes and mime-type %s" logging.info(_msg % (stream.http_content_length, stream.headers.get('content-type', ''))) f = RawFile(stream.content, mime_type) self._on_file_complete(f) def _on_file_complete(self, f): if self.on_file_complete is not None: self.on_file_complete(f) def iter_packets(iterable): """Sorts an iterable of packets and removes the duplicates""" prev = None for i in sorted(iterable, key=attrgetter('seq')): if prev is None or prev.seq != i.seq: prev = i yield i def hash_packet(eth, outbound=False): """Hashes a packet to determine the tcp stream it is part of """ ip = eth.data tcp = ip.data return '%s:%i' % (ipaddr_string(ip.dst if outbound else ip.src), tcp.sport if outbound else tcp.dport ) def parse_flags(flags):
class RawFile(object): def __init__(self, content, mime_type): self.content = content self.mime_type = mime_type class TcpStream(object): def __init__(self, id): self.id = id self.buffer = {} self.packets = None self.base_seq = None self.next_seq = None self.header_data = '' self.headers = None self.is_http = None self.is_finished = False self.is_valid = True self.http_content_length = None self.http_bytes_loaded = 0 def add_packet(self, packet): if self.is_finished: return #vals = [] #for k in ('ack', 'dport', 'flags', 'off', 'off_x2', 'seq', 'sport', 'sum', 'urp', 'win'): # vals.append('%s=%s' % (k, getattr(packet, k))) #vals.append(parse_flags(packet.flags)) if self.base_seq is None: # we do not yet know the first seq if packet.data.startswith('HTTP'): self.is_http = True self._on_first_packet(packet) else: self.buffer[packet.seq] = packet else: if packet.seq == self.next_seq: # the exact next packet self._on_next_packet(packet) elif packet.seq < self.next_seq: # retransmission pass else: #out of order packet self.buffer[packet.seq] = packet # if the buffer grows to be > than 2K assume something went wrong if len(self.buffer) > 2000: self.is_finished = True self.is_valid = False logging.error("Packet buffer filled up") def rel_seq(self, packet): return packet.seq - self.base_seq @property def content(self): return self.packets @property def progress(self): if self.http_content_length is None: return 0 if self.http_content_length in (0, self.http_bytes_loaded): return 1 return float(self.http_bytes_loaded) / float(self.http_content_length) def _on_first_packet(self, packet): # check if this is actually the first packet if self.base_seq is None: self.base_seq = packet.seq self.next_seq = packet.seq self._on_next_packet(packet) def _on_next_packet(self, packet): self._append_packet(packet) self._check_buffer() def _check_buffer(self): """Looks in the buffer to see if we have the next packet, if so append it and continue till there are no packets left. """ count = 0 for packet in self.remove_buffered_packets(): self._append_packet(packet) count += 1 if count > 0: logging.debug('Removed %i items from the buffer, %i left.' % (count, len(self.buffer))) def remove_buffered_packets(self): """Iterates over next packets in the buffer and removes them""" seq = self.next_seq while True: p = self.buffer.pop(seq, None) if p is None: break else: seq += len(p.data) yield p def _append_packet(self, packet): """Appends a packet to the end of the list of received packets and processes it""" self.next_seq += len(packet.data) if self.headers is not None: if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(packet.data) self.http_bytes_loaded += len(packet.data) else: self.header_data += packet.data # check if we have enough packets for the entire http header if self.is_http and self.headers is None: if http.has_complete_headers(self.header_data): resp = http.parse_response(self.header_data) self.header_data = None if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(resp['body']) self.headers = resp['headers'] self.http_bytes_loaded = len(resp['body']) self._on_http_headers() # check if we have finished the request if self.http_content_length is not None: if self.http_content_length == self.http_bytes_loaded: self.is_finished = True elif self.http_content_length < self.http_bytes_loaded: logging.error("Received data was longer than the content length header") self.is_valid = False self.is_finished = True self._handle_ordered_packet(packet) def _on_last_packet(self, packet): self.is_finished = True def _handle_ordered_packet(self, packet): """This will eventually provide a way for a callback receive packets in order""" pass def _on_http_headers(self): content_length = self.headers.get('content-length', None) if content_length is not None: content_length = int(content_length) self.http_content_length = content_length
result = [] for flag, name in ((ACK, 'ACK'), (SYN, 'SYN'), (PUSH, 'PUSH'), (RST, 'RST')): if flags & flag: result.append(name) return result
identifier_body
network_listener.py
# -*- coding: utf-8 -*- from operator import attrgetter import logging import StringIO import struct import dpkt from netifaces import interfaces, ifaddresses, AF_INET from sniff import PcapWrapper import http ACK = dpkt.tcp.TH_ACK SYN = dpkt.tcp.TH_SYN FIN = dpkt.tcp.TH_FIN RST = dpkt.tcp.TH_RST PUSH = dpkt.tcp.TH_PUSH def ipaddr_string(addr): return '.'.join(str(octet) for octet in struct.unpack('B' * len(addr), addr)) class NetworkFileListener(object): def __init__(self, interface=None, mime_types=None): self.pc = None self.on_file_complete = None self.packet_streams = {} self.local_ips = self.detect_local_ips() logging.info("Local IP Addresses: %s" % ', '.join(self.local_ips)) self.interface = interface self.mime_types = mime_types def detect_local_ips(self): """Determine all of the local ip addresses for this machine This allows us to flag traffic as inbound or outbound. """ result = set() for ifaceName in interfaces(): try: address = [i['addr'] for i in ifaddresses(ifaceName)[AF_INET]] except: pass result.add(address[0]) return tuple(result) def start(self): if self.pc is not None: raise Exception('Already listening.') self.pc = PcapWrapper(self.interface, filters='tcp') try: self.pc.loop(self._on_packet) except KeyboardInterrupt: pass if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_packet(self, pkt): try: self._handle_packet(pkt) except Exception as e: logging.exception(e) def _parse_tcp_packet(self, data): if len(data) == 0 or data is None: return None if data.startswith('GET') or data.startswith('POST'): return None try: return dpkt.http.Reqsponse(data) except: pass return None def _handle_packet(self, pkt): eth = dpkt.ethernet.Ethernet(pkt) ip = eth.data tcp = ip.data data = tcp.data is_outbound = ipaddr_string(ip.dst) not in self.local_ips direction = 'outbound' if is_outbound else 'inbound' connection_hash = hash_packet(eth, outbound=is_outbound) if ipaddr_string(ip.src) in self.local_ips and ipaddr_string(ip.dst) in self.local_ips: # ignore packets that exist only on this computer return # lets first check if this is a http request instead of a response if data.startswith('GET') or data.startswith('POST'): if is_outbound: # ignore inbound http request _msg = 'Detected an %s HTTP Request from %s to %s' logging.debug(_msg % (direction, ipaddr_string(ip.src), ipaddr_string(ip.dst))) self._handle_request(connection_hash, tcp) elif not is_outbound: stream = self.packet_streams.get(connection_hash) if stream is not None: self._handle_response(stream, tcp) def _handle_request(self, connection_hash, tcp_pkt): if http.has_complete_headers(tcp_pkt.data): req = http.parse_request(tcp_pkt.data) logging.debug('Request URL: %s' % req['host'] + req['path']) logging.debug('Storing stream %s.' % connection_hash) self.packet_streams[connection_hash] = TcpStream(connection_hash) def
(self, stream): if stream.id in self.packet_streams: del self.packet_streams[stream.id] def _handle_response(self, stream, tcp_pkt): had_headers = (stream.headers is not None) stream.add_packet(tcp_pkt) if not had_headers and stream.headers is not None: # this will happen the first packet that contain http header if self.mime_types is not None: mime_type = stream.headers.get('content-type', '').split(';')[0].strip() if mime_type not in self.mime_types: logging.debug('Ignoring mime_type %s' % mime_type) self._delete_stream(stream) return if stream.is_finished: if stream.id not in self.packet_streams: # probably just a retransmission return self._delete_stream(stream) if stream.is_valid: self._on_request_complete(stream) else: _msg = "Stream was invalid at %.1f%% with %i bytes loaded" logging.error(_msg % (stream.progress * 100, stream.http_bytes_loaded)) if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_request_complete(self, stream): headers = stream.headers if headers is not None: mime_type = headers.get('content-type') _msg = "Successfully observed a file with %i bytes and mime-type %s" logging.info(_msg % (stream.http_content_length, stream.headers.get('content-type', ''))) f = RawFile(stream.content, mime_type) self._on_file_complete(f) def _on_file_complete(self, f): if self.on_file_complete is not None: self.on_file_complete(f) def iter_packets(iterable): """Sorts an iterable of packets and removes the duplicates""" prev = None for i in sorted(iterable, key=attrgetter('seq')): if prev is None or prev.seq != i.seq: prev = i yield i def hash_packet(eth, outbound=False): """Hashes a packet to determine the tcp stream it is part of """ ip = eth.data tcp = ip.data return '%s:%i' % (ipaddr_string(ip.dst if outbound else ip.src), tcp.sport if outbound else tcp.dport ) def parse_flags(flags): result = [] for flag, name in ((ACK, 'ACK'), (SYN, 'SYN'), (PUSH, 'PUSH'), (RST, 'RST')): if flags & flag: result.append(name) return result class RawFile(object): def __init__(self, content, mime_type): self.content = content self.mime_type = mime_type class TcpStream(object): def __init__(self, id): self.id = id self.buffer = {} self.packets = None self.base_seq = None self.next_seq = None self.header_data = '' self.headers = None self.is_http = None self.is_finished = False self.is_valid = True self.http_content_length = None self.http_bytes_loaded = 0 def add_packet(self, packet): if self.is_finished: return #vals = [] #for k in ('ack', 'dport', 'flags', 'off', 'off_x2', 'seq', 'sport', 'sum', 'urp', 'win'): # vals.append('%s=%s' % (k, getattr(packet, k))) #vals.append(parse_flags(packet.flags)) if self.base_seq is None: # we do not yet know the first seq if packet.data.startswith('HTTP'): self.is_http = True self._on_first_packet(packet) else: self.buffer[packet.seq] = packet else: if packet.seq == self.next_seq: # the exact next packet self._on_next_packet(packet) elif packet.seq < self.next_seq: # retransmission pass else: #out of order packet self.buffer[packet.seq] = packet # if the buffer grows to be > than 2K assume something went wrong if len(self.buffer) > 2000: self.is_finished = True self.is_valid = False logging.error("Packet buffer filled up") def rel_seq(self, packet): return packet.seq - self.base_seq @property def content(self): return self.packets @property def progress(self): if self.http_content_length is None: return 0 if self.http_content_length in (0, self.http_bytes_loaded): return 1 return float(self.http_bytes_loaded) / float(self.http_content_length) def _on_first_packet(self, packet): # check if this is actually the first packet if self.base_seq is None: self.base_seq = packet.seq self.next_seq = packet.seq self._on_next_packet(packet) def _on_next_packet(self, packet): self._append_packet(packet) self._check_buffer() def _check_buffer(self): """Looks in the buffer to see if we have the next packet, if so append it and continue till there are no packets left. """ count = 0 for packet in self.remove_buffered_packets(): self._append_packet(packet) count += 1 if count > 0: logging.debug('Removed %i items from the buffer, %i left.' % (count, len(self.buffer))) def remove_buffered_packets(self): """Iterates over next packets in the buffer and removes them""" seq = self.next_seq while True: p = self.buffer.pop(seq, None) if p is None: break else: seq += len(p.data) yield p def _append_packet(self, packet): """Appends a packet to the end of the list of received packets and processes it""" self.next_seq += len(packet.data) if self.headers is not None: if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(packet.data) self.http_bytes_loaded += len(packet.data) else: self.header_data += packet.data # check if we have enough packets for the entire http header if self.is_http and self.headers is None: if http.has_complete_headers(self.header_data): resp = http.parse_response(self.header_data) self.header_data = None if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(resp['body']) self.headers = resp['headers'] self.http_bytes_loaded = len(resp['body']) self._on_http_headers() # check if we have finished the request if self.http_content_length is not None: if self.http_content_length == self.http_bytes_loaded: self.is_finished = True elif self.http_content_length < self.http_bytes_loaded: logging.error("Received data was longer than the content length header") self.is_valid = False self.is_finished = True self._handle_ordered_packet(packet) def _on_last_packet(self, packet): self.is_finished = True def _handle_ordered_packet(self, packet): """This will eventually provide a way for a callback receive packets in order""" pass def _on_http_headers(self): content_length = self.headers.get('content-length', None) if content_length is not None: content_length = int(content_length) self.http_content_length = content_length
_delete_stream
identifier_name
network_listener.py
# -*- coding: utf-8 -*- from operator import attrgetter import logging import StringIO import struct import dpkt from netifaces import interfaces, ifaddresses, AF_INET from sniff import PcapWrapper import http ACK = dpkt.tcp.TH_ACK SYN = dpkt.tcp.TH_SYN FIN = dpkt.tcp.TH_FIN RST = dpkt.tcp.TH_RST PUSH = dpkt.tcp.TH_PUSH def ipaddr_string(addr): return '.'.join(str(octet) for octet in struct.unpack('B' * len(addr), addr)) class NetworkFileListener(object): def __init__(self, interface=None, mime_types=None): self.pc = None self.on_file_complete = None self.packet_streams = {} self.local_ips = self.detect_local_ips() logging.info("Local IP Addresses: %s" % ', '.join(self.local_ips)) self.interface = interface self.mime_types = mime_types def detect_local_ips(self): """Determine all of the local ip addresses for this machine This allows us to flag traffic as inbound or outbound. """ result = set() for ifaceName in interfaces(): try: address = [i['addr'] for i in ifaddresses(ifaceName)[AF_INET]] except: pass result.add(address[0]) return tuple(result) def start(self): if self.pc is not None: raise Exception('Already listening.') self.pc = PcapWrapper(self.interface, filters='tcp') try: self.pc.loop(self._on_packet) except KeyboardInterrupt: pass if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_packet(self, pkt): try: self._handle_packet(pkt) except Exception as e: logging.exception(e) def _parse_tcp_packet(self, data): if len(data) == 0 or data is None: return None if data.startswith('GET') or data.startswith('POST'): return None try: return dpkt.http.Reqsponse(data) except: pass return None def _handle_packet(self, pkt): eth = dpkt.ethernet.Ethernet(pkt) ip = eth.data tcp = ip.data data = tcp.data is_outbound = ipaddr_string(ip.dst) not in self.local_ips direction = 'outbound' if is_outbound else 'inbound' connection_hash = hash_packet(eth, outbound=is_outbound) if ipaddr_string(ip.src) in self.local_ips and ipaddr_string(ip.dst) in self.local_ips: # ignore packets that exist only on this computer return # lets first check if this is a http request instead of a response if data.startswith('GET') or data.startswith('POST'): if is_outbound: # ignore inbound http request _msg = 'Detected an %s HTTP Request from %s to %s' logging.debug(_msg % (direction, ipaddr_string(ip.src), ipaddr_string(ip.dst))) self._handle_request(connection_hash, tcp) elif not is_outbound: stream = self.packet_streams.get(connection_hash) if stream is not None: self._handle_response(stream, tcp) def _handle_request(self, connection_hash, tcp_pkt): if http.has_complete_headers(tcp_pkt.data): req = http.parse_request(tcp_pkt.data) logging.debug('Request URL: %s' % req['host'] + req['path']) logging.debug('Storing stream %s.' % connection_hash) self.packet_streams[connection_hash] = TcpStream(connection_hash) def _delete_stream(self, stream): if stream.id in self.packet_streams: del self.packet_streams[stream.id] def _handle_response(self, stream, tcp_pkt): had_headers = (stream.headers is not None) stream.add_packet(tcp_pkt) if not had_headers and stream.headers is not None: # this will happen the first packet that contain http header if self.mime_types is not None: mime_type = stream.headers.get('content-type', '').split(';')[0].strip() if mime_type not in self.mime_types: logging.debug('Ignoring mime_type %s' % mime_type) self._delete_stream(stream) return if stream.is_finished: if stream.id not in self.packet_streams: # probably just a retransmission return self._delete_stream(stream) if stream.is_valid: self._on_request_complete(stream) else: _msg = "Stream was invalid at %.1f%% with %i bytes loaded" logging.error(_msg % (stream.progress * 100, stream.http_bytes_loaded)) if self.pc.human_stats is not None: logging.info(self.pc.human_stats) def _on_request_complete(self, stream): headers = stream.headers if headers is not None: mime_type = headers.get('content-type') _msg = "Successfully observed a file with %i bytes and mime-type %s" logging.info(_msg % (stream.http_content_length, stream.headers.get('content-type', ''))) f = RawFile(stream.content, mime_type) self._on_file_complete(f) def _on_file_complete(self, f): if self.on_file_complete is not None: self.on_file_complete(f) def iter_packets(iterable): """Sorts an iterable of packets and removes the duplicates""" prev = None for i in sorted(iterable, key=attrgetter('seq')): if prev is None or prev.seq != i.seq: prev = i yield i def hash_packet(eth, outbound=False): """Hashes a packet to determine the tcp stream it is part of """ ip = eth.data tcp = ip.data return '%s:%i' % (ipaddr_string(ip.dst if outbound else ip.src), tcp.sport if outbound else tcp.dport ) def parse_flags(flags): result = [] for flag, name in ((ACK, 'ACK'), (SYN, 'SYN'), (PUSH, 'PUSH'), (RST, 'RST')): if flags & flag: result.append(name) return result class RawFile(object): def __init__(self, content, mime_type): self.content = content self.mime_type = mime_type class TcpStream(object): def __init__(self, id): self.id = id self.buffer = {} self.packets = None self.base_seq = None self.next_seq = None self.header_data = '' self.headers = None self.is_http = None self.is_finished = False self.is_valid = True self.http_content_length = None self.http_bytes_loaded = 0 def add_packet(self, packet): if self.is_finished: return #vals = [] #for k in ('ack', 'dport', 'flags', 'off', 'off_x2', 'seq', 'sport', 'sum', 'urp', 'win'): # vals.append('%s=%s' % (k, getattr(packet, k))) #vals.append(parse_flags(packet.flags)) if self.base_seq is None: # we do not yet know the first seq if packet.data.startswith('HTTP'): self.is_http = True self._on_first_packet(packet) else: self.buffer[packet.seq] = packet else: if packet.seq == self.next_seq: # the exact next packet self._on_next_packet(packet) elif packet.seq < self.next_seq: # retransmission pass else: #out of order packet self.buffer[packet.seq] = packet # if the buffer grows to be > than 2K assume something went wrong if len(self.buffer) > 2000: self.is_finished = True self.is_valid = False logging.error("Packet buffer filled up")
@property def content(self): return self.packets @property def progress(self): if self.http_content_length is None: return 0 if self.http_content_length in (0, self.http_bytes_loaded): return 1 return float(self.http_bytes_loaded) / float(self.http_content_length) def _on_first_packet(self, packet): # check if this is actually the first packet if self.base_seq is None: self.base_seq = packet.seq self.next_seq = packet.seq self._on_next_packet(packet) def _on_next_packet(self, packet): self._append_packet(packet) self._check_buffer() def _check_buffer(self): """Looks in the buffer to see if we have the next packet, if so append it and continue till there are no packets left. """ count = 0 for packet in self.remove_buffered_packets(): self._append_packet(packet) count += 1 if count > 0: logging.debug('Removed %i items from the buffer, %i left.' % (count, len(self.buffer))) def remove_buffered_packets(self): """Iterates over next packets in the buffer and removes them""" seq = self.next_seq while True: p = self.buffer.pop(seq, None) if p is None: break else: seq += len(p.data) yield p def _append_packet(self, packet): """Appends a packet to the end of the list of received packets and processes it""" self.next_seq += len(packet.data) if self.headers is not None: if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(packet.data) self.http_bytes_loaded += len(packet.data) else: self.header_data += packet.data # check if we have enough packets for the entire http header if self.is_http and self.headers is None: if http.has_complete_headers(self.header_data): resp = http.parse_response(self.header_data) self.header_data = None if self.packets is None: self.packets = StringIO.StringIO() self.packets.write(resp['body']) self.headers = resp['headers'] self.http_bytes_loaded = len(resp['body']) self._on_http_headers() # check if we have finished the request if self.http_content_length is not None: if self.http_content_length == self.http_bytes_loaded: self.is_finished = True elif self.http_content_length < self.http_bytes_loaded: logging.error("Received data was longer than the content length header") self.is_valid = False self.is_finished = True self._handle_ordered_packet(packet) def _on_last_packet(self, packet): self.is_finished = True def _handle_ordered_packet(self, packet): """This will eventually provide a way for a callback receive packets in order""" pass def _on_http_headers(self): content_length = self.headers.get('content-length', None) if content_length is not None: content_length = int(content_length) self.http_content_length = content_length
def rel_seq(self, packet): return packet.seq - self.base_seq
random_line_split
wpa_controller.go
// Unless explicitly stated otherwise all files in this repository are licensed // under the Apache License Version 2.0. // This product includes software developed at Datadog (https://www.datadoghq.com/). // Copyright 2016-present Datadog, Inc. //go:build kubeapiserver package apiserver import ( "context" "math" "time" dynamic_client "k8s.io/client-go/dynamic" dynamic_informer "k8s.io/client-go/dynamic/dynamicinformer" apis_v1alpha1 "github.com/DataDog/watermarkpodautoscaler/api/v1alpha1" "github.com/cenkalti/backoff" corev1 "k8s.io/api/core/v1" apierrors "k8s.io/apimachinery/pkg/api/errors" v1 "k8s.io/apimachinery/pkg/apis/meta/v1" "k8s.io/apimachinery/pkg/util/wait" "k8s.io/client-go/tools/cache" "k8s.io/client-go/util/workqueue" "github.com/DataDog/datadog-agent/pkg/clusteragent/custommetrics" "github.com/DataDog/datadog-agent/pkg/errors" "github.com/DataDog/datadog-agent/pkg/util/kubernetes/autoscalers" "github.com/DataDog/datadog-agent/pkg/util/log" ) const ( crdCheckInitialInterval = time.Second * 5 crdCheckMaxInterval = 5 * time.Minute crdCheckMultiplier = 2.0 crdCheckMaxElapsedTime = 0 ) var gvrWPA = apis_v1alpha1.GroupVersion.WithResource("watermarkpodautoscalers") // RunWPA starts the controller to process events about Watermark Pod Autoscalers func (h *AutoscalersController) RunWPA(stopCh <-chan struct{}, wpaClient dynamic_client.Interface, wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) { waitForWPACRD(wpaClient) // mutate the Autoscaler controller to embed an informer against the WPAs if err := h.enableWPA(wpaInformerFactory); err != nil { log.Errorf("impossible to enable WPQ: %v", err) return } defer h.WPAqueue.ShutDown() log.Infof("Starting WPA Controller ... ") defer log.Infof("Stopping WPA Controller") wpaInformerFactory.Start(stopCh) if !cache.WaitForCacheSync(stopCh, h.wpaListerSynced) { return } wait.Until(h.workerWPA, time.Second, stopCh) } type checkAPI func() error func tryCheckWPACRD(check checkAPI) error { if err := check(); err != nil { // Check if this is a known problem of missing CRD registration if isWPACRDNotFoundError(err) { return err } // In all other cases return a permanent error to prevent from retrying log.Errorf("WPA CRD check failed: not retryable: %s", err) return backoff.Permanent(err) } log.Info("WPA CRD check successful") return nil } func notifyCheckWPACRD() backoff.Notify { attempt := 0 return func(err error, delay time.Duration) { attempt++ mins := int(delay.Minutes()) secs := int(math.Mod(delay.Seconds(), 60)) log.Warnf("WPA CRD missing (attempt=%d): will retry in %dm%ds", attempt, mins, secs) } } func isWPACRDNotFoundError(err error) bool { status, ok := err.(*apierrors.StatusError) if !ok { return false } reason := status.Status().Reason details := status.Status().Details return reason == v1.StatusReasonNotFound && details.Group == apis_v1alpha1.SchemeGroupVersion.Group && details.Kind == "watermarkpodautoscalers" } func checkWPACRD(wpaClient dynamic_client.Interface) backoff.Operation { check := func() error { _, err := wpaClient.Resource(gvrWPA).List(context.TODO(), v1.ListOptions{}) return err } return func() error { return tryCheckWPACRD(check) } } func waitForWPACRD(wpaClient dynamic_client.Interface) { exp := &backoff.ExponentialBackOff{ InitialInterval: crdCheckInitialInterval, RandomizationFactor: 0, Multiplier: crdCheckMultiplier, MaxInterval: crdCheckMaxInterval, MaxElapsedTime: crdCheckMaxElapsedTime, Clock: backoff.SystemClock, } exp.Reset() _ = backoff.RetryNotify(checkWPACRD(wpaClient), exp, notifyCheckWPACRD()) } // enableWPA adds the handlers to the AutoscalersController to support WPAs func (h *AutoscalersController) enableWPA(wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) error { log.Info("Enabling WPA controller") genericInformer := wpaInformerFactory.ForResource(gvrWPA) h.WPAqueue = workqueue.NewNamedRateLimitingQueue(workqueue.DefaultItemBasedRateLimiter(), "wpa-autoscalers") h.wpaLister = genericInformer.Lister() h.wpaListerSynced = genericInformer.Informer().HasSynced if _, err := genericInformer.Informer().AddEventHandler( cache.ResourceEventHandlerFuncs{ AddFunc: h.addWPAutoscaler, UpdateFunc: h.updateWPAutoscaler, DeleteFunc: h.deleteWPAutoscaler, }, ); err != nil { return err } h.mu.Lock() defer h.mu.Unlock() h.wpaEnabled = true return nil } func (h *AutoscalersController)
() bool { h.mu.Lock() defer h.mu.Unlock() return h.wpaEnabled } func (h *AutoscalersController) workerWPA() { for h.processNextWPA() { } } func (h *AutoscalersController) processNextWPA() bool { key, quit := h.WPAqueue.Get() if quit { log.Error("WPA controller HPAqueue is shutting down, stopping processing") return false } log.Tracef("Processing %s", key) defer h.WPAqueue.Done(key) err := h.syncWPA(key) h.handleErr(err, key) // Debug output for unit tests only if h.autoscalers != nil { h.autoscalers <- key } return true } func (h *AutoscalersController) syncWPA(key interface{}) error { h.mu.Lock() defer h.mu.Unlock() ns, name, err := cache.SplitMetaNamespaceKey(key.(string)) if err != nil { log.Errorf("Could not split the key: %v", err) return err } wpaCachedObj, err := h.wpaLister.ByNamespace(ns).Get(name) if err != nil { log.Errorf("Could not retrieve key %s from cache: %v", key, err) return err } wpaCached := &apis_v1alpha1.WatermarkPodAutoscaler{} err = UnstructuredIntoWPA(wpaCachedObj, wpaCached) if err != nil { log.Errorf("Could not cast wpa %s retrieved from cache to wpa structure: %v", key, err) return err } switch { case errors.IsNotFound(err): log.Infof("WatermarkPodAutoscaler %v has been deleted but was not caught in the EventHandler. GC will cleanup.", key) case err != nil: log.Errorf("Unable to retrieve WatermarkPodAutoscaler %v from store: %v", key, err) default: if wpaCached == nil { log.Errorf("Could not parse empty wpa %s/%s from local store", ns, name) return ErrIsEmpty } emList := autoscalers.InspectWPA(wpaCached) if len(emList) == 0 { return nil } newMetrics := h.hpaProc.ProcessEMList(emList) h.toStore.m.Lock() for metric, value := range newMetrics { // We should only insert placeholders in the local cache. h.toStore.data[metric] = value } h.toStore.m.Unlock() log.Tracef("Local batch cache of WPA is %v", h.toStore.data) } return err } func (h *AutoscalersController) addWPAutoscaler(obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } log.Debugf("Adding WPA %s/%s", newAutoscaler.Namespace, newAutoscaler.Name) h.EventRecorder.Event(newAutoscaler.DeepCopyObject(), corev1.EventTypeNormal, autoscalerNowHandleMsgEvent, "") h.enqueueWPA(newAutoscaler) } func (h *AutoscalersController) updateWPAutoscaler(old, obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } oldAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, oldAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) h.enqueueWPA(newAutoscaler) // We still want to enqueue the newAutoscaler to get the new change return } if !autoscalers.AutoscalerMetricsUpdate(newAutoscaler.GetObjectMeta(), oldAutoscaler.GetObjectMeta()) { log.Tracef("Update received for the %s/%s, without a relevant change to the configuration", newAutoscaler.Namespace, newAutoscaler.Name) return } // Need to delete the old object from the local cache. If the labels have changed, the syncAutoscaler would not override the old key. toDelete := autoscalers.InspectWPA(oldAutoscaler) h.deleteFromLocalStore(toDelete) log.Tracef("Processing update event for wpa %s/%s with configuration: %s", newAutoscaler.Namespace, newAutoscaler.Name, newAutoscaler.Annotations) h.enqueueWPA(newAutoscaler) } // Processing the Delete Events in the Eventhandler as obj is deleted from the local store thereafter. // Only here can we retrieve the content of the WPA to properly process and delete it. // FIXME we could have an update in the WPAqueue while processing the deletion, we should make // sure we process them in order instead. For now, the gc logic allows us to recover. func (h *AutoscalersController) deleteWPAutoscaler(obj interface{}) { h.mu.Lock() defer h.mu.Unlock() toDelete := &custommetrics.MetricsBundle{} deletedWPA := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, deletedWPA); err == nil { toDelete.External = autoscalers.InspectWPA(deletedWPA) h.deleteFromLocalStore(toDelete.External) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) if !h.isLeaderFunc() { return } log.Infof("Deleting entries of metrics from Ref %s/%s in the Global Store", deletedWPA.Namespace, deletedWPA.Name) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) } return } tombstone, ok := obj.(cache.DeletedFinalStateUnknown) if !ok { log.Errorf("Could not get object from tombstone %#v", obj) return } if err := UnstructuredIntoWPA(tombstone, deletedWPA); err != nil { log.Errorf("Tombstone contained object that is not an Autoscaler: %#v", obj) return } log.Debugf("Deleting Metrics from WPA %s/%s", deletedWPA.Namespace, deletedWPA.Name) toDelete.External = autoscalers.InspectWPA(deletedWPA) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) h.deleteFromLocalStore(toDelete.External) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) return } }
isWPAEnabled
identifier_name
wpa_controller.go
// Unless explicitly stated otherwise all files in this repository are licensed // under the Apache License Version 2.0. // This product includes software developed at Datadog (https://www.datadoghq.com/). // Copyright 2016-present Datadog, Inc. //go:build kubeapiserver package apiserver import ( "context" "math" "time" dynamic_client "k8s.io/client-go/dynamic" dynamic_informer "k8s.io/client-go/dynamic/dynamicinformer" apis_v1alpha1 "github.com/DataDog/watermarkpodautoscaler/api/v1alpha1" "github.com/cenkalti/backoff" corev1 "k8s.io/api/core/v1" apierrors "k8s.io/apimachinery/pkg/api/errors" v1 "k8s.io/apimachinery/pkg/apis/meta/v1" "k8s.io/apimachinery/pkg/util/wait" "k8s.io/client-go/tools/cache" "k8s.io/client-go/util/workqueue" "github.com/DataDog/datadog-agent/pkg/clusteragent/custommetrics" "github.com/DataDog/datadog-agent/pkg/errors" "github.com/DataDog/datadog-agent/pkg/util/kubernetes/autoscalers" "github.com/DataDog/datadog-agent/pkg/util/log" ) const ( crdCheckInitialInterval = time.Second * 5 crdCheckMaxInterval = 5 * time.Minute crdCheckMultiplier = 2.0 crdCheckMaxElapsedTime = 0 ) var gvrWPA = apis_v1alpha1.GroupVersion.WithResource("watermarkpodautoscalers") // RunWPA starts the controller to process events about Watermark Pod Autoscalers func (h *AutoscalersController) RunWPA(stopCh <-chan struct{}, wpaClient dynamic_client.Interface, wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) { waitForWPACRD(wpaClient) // mutate the Autoscaler controller to embed an informer against the WPAs if err := h.enableWPA(wpaInformerFactory); err != nil { log.Errorf("impossible to enable WPQ: %v", err) return } defer h.WPAqueue.ShutDown() log.Infof("Starting WPA Controller ... ") defer log.Infof("Stopping WPA Controller") wpaInformerFactory.Start(stopCh) if !cache.WaitForCacheSync(stopCh, h.wpaListerSynced) { return } wait.Until(h.workerWPA, time.Second, stopCh) } type checkAPI func() error func tryCheckWPACRD(check checkAPI) error { if err := check(); err != nil { // Check if this is a known problem of missing CRD registration if isWPACRDNotFoundError(err) { return err } // In all other cases return a permanent error to prevent from retrying log.Errorf("WPA CRD check failed: not retryable: %s", err) return backoff.Permanent(err) } log.Info("WPA CRD check successful") return nil } func notifyCheckWPACRD() backoff.Notify { attempt := 0 return func(err error, delay time.Duration) { attempt++ mins := int(delay.Minutes()) secs := int(math.Mod(delay.Seconds(), 60)) log.Warnf("WPA CRD missing (attempt=%d): will retry in %dm%ds", attempt, mins, secs) } } func isWPACRDNotFoundError(err error) bool { status, ok := err.(*apierrors.StatusError) if !ok { return false } reason := status.Status().Reason details := status.Status().Details return reason == v1.StatusReasonNotFound && details.Group == apis_v1alpha1.SchemeGroupVersion.Group && details.Kind == "watermarkpodautoscalers" } func checkWPACRD(wpaClient dynamic_client.Interface) backoff.Operation { check := func() error { _, err := wpaClient.Resource(gvrWPA).List(context.TODO(), v1.ListOptions{}) return err } return func() error { return tryCheckWPACRD(check) } } func waitForWPACRD(wpaClient dynamic_client.Interface)
// enableWPA adds the handlers to the AutoscalersController to support WPAs func (h *AutoscalersController) enableWPA(wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) error { log.Info("Enabling WPA controller") genericInformer := wpaInformerFactory.ForResource(gvrWPA) h.WPAqueue = workqueue.NewNamedRateLimitingQueue(workqueue.DefaultItemBasedRateLimiter(), "wpa-autoscalers") h.wpaLister = genericInformer.Lister() h.wpaListerSynced = genericInformer.Informer().HasSynced if _, err := genericInformer.Informer().AddEventHandler( cache.ResourceEventHandlerFuncs{ AddFunc: h.addWPAutoscaler, UpdateFunc: h.updateWPAutoscaler, DeleteFunc: h.deleteWPAutoscaler, }, ); err != nil { return err } h.mu.Lock() defer h.mu.Unlock() h.wpaEnabled = true return nil } func (h *AutoscalersController) isWPAEnabled() bool { h.mu.Lock() defer h.mu.Unlock() return h.wpaEnabled } func (h *AutoscalersController) workerWPA() { for h.processNextWPA() { } } func (h *AutoscalersController) processNextWPA() bool { key, quit := h.WPAqueue.Get() if quit { log.Error("WPA controller HPAqueue is shutting down, stopping processing") return false } log.Tracef("Processing %s", key) defer h.WPAqueue.Done(key) err := h.syncWPA(key) h.handleErr(err, key) // Debug output for unit tests only if h.autoscalers != nil { h.autoscalers <- key } return true } func (h *AutoscalersController) syncWPA(key interface{}) error { h.mu.Lock() defer h.mu.Unlock() ns, name, err := cache.SplitMetaNamespaceKey(key.(string)) if err != nil { log.Errorf("Could not split the key: %v", err) return err } wpaCachedObj, err := h.wpaLister.ByNamespace(ns).Get(name) if err != nil { log.Errorf("Could not retrieve key %s from cache: %v", key, err) return err } wpaCached := &apis_v1alpha1.WatermarkPodAutoscaler{} err = UnstructuredIntoWPA(wpaCachedObj, wpaCached) if err != nil { log.Errorf("Could not cast wpa %s retrieved from cache to wpa structure: %v", key, err) return err } switch { case errors.IsNotFound(err): log.Infof("WatermarkPodAutoscaler %v has been deleted but was not caught in the EventHandler. GC will cleanup.", key) case err != nil: log.Errorf("Unable to retrieve WatermarkPodAutoscaler %v from store: %v", key, err) default: if wpaCached == nil { log.Errorf("Could not parse empty wpa %s/%s from local store", ns, name) return ErrIsEmpty } emList := autoscalers.InspectWPA(wpaCached) if len(emList) == 0 { return nil } newMetrics := h.hpaProc.ProcessEMList(emList) h.toStore.m.Lock() for metric, value := range newMetrics { // We should only insert placeholders in the local cache. h.toStore.data[metric] = value } h.toStore.m.Unlock() log.Tracef("Local batch cache of WPA is %v", h.toStore.data) } return err } func (h *AutoscalersController) addWPAutoscaler(obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } log.Debugf("Adding WPA %s/%s", newAutoscaler.Namespace, newAutoscaler.Name) h.EventRecorder.Event(newAutoscaler.DeepCopyObject(), corev1.EventTypeNormal, autoscalerNowHandleMsgEvent, "") h.enqueueWPA(newAutoscaler) } func (h *AutoscalersController) updateWPAutoscaler(old, obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } oldAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, oldAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) h.enqueueWPA(newAutoscaler) // We still want to enqueue the newAutoscaler to get the new change return } if !autoscalers.AutoscalerMetricsUpdate(newAutoscaler.GetObjectMeta(), oldAutoscaler.GetObjectMeta()) { log.Tracef("Update received for the %s/%s, without a relevant change to the configuration", newAutoscaler.Namespace, newAutoscaler.Name) return } // Need to delete the old object from the local cache. If the labels have changed, the syncAutoscaler would not override the old key. toDelete := autoscalers.InspectWPA(oldAutoscaler) h.deleteFromLocalStore(toDelete) log.Tracef("Processing update event for wpa %s/%s with configuration: %s", newAutoscaler.Namespace, newAutoscaler.Name, newAutoscaler.Annotations) h.enqueueWPA(newAutoscaler) } // Processing the Delete Events in the Eventhandler as obj is deleted from the local store thereafter. // Only here can we retrieve the content of the WPA to properly process and delete it. // FIXME we could have an update in the WPAqueue while processing the deletion, we should make // sure we process them in order instead. For now, the gc logic allows us to recover. func (h *AutoscalersController) deleteWPAutoscaler(obj interface{}) { h.mu.Lock() defer h.mu.Unlock() toDelete := &custommetrics.MetricsBundle{} deletedWPA := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, deletedWPA); err == nil { toDelete.External = autoscalers.InspectWPA(deletedWPA) h.deleteFromLocalStore(toDelete.External) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) if !h.isLeaderFunc() { return } log.Infof("Deleting entries of metrics from Ref %s/%s in the Global Store", deletedWPA.Namespace, deletedWPA.Name) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) } return } tombstone, ok := obj.(cache.DeletedFinalStateUnknown) if !ok { log.Errorf("Could not get object from tombstone %#v", obj) return } if err := UnstructuredIntoWPA(tombstone, deletedWPA); err != nil { log.Errorf("Tombstone contained object that is not an Autoscaler: %#v", obj) return } log.Debugf("Deleting Metrics from WPA %s/%s", deletedWPA.Namespace, deletedWPA.Name) toDelete.External = autoscalers.InspectWPA(deletedWPA) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) h.deleteFromLocalStore(toDelete.External) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) return } }
{ exp := &backoff.ExponentialBackOff{ InitialInterval: crdCheckInitialInterval, RandomizationFactor: 0, Multiplier: crdCheckMultiplier, MaxInterval: crdCheckMaxInterval, MaxElapsedTime: crdCheckMaxElapsedTime, Clock: backoff.SystemClock, } exp.Reset() _ = backoff.RetryNotify(checkWPACRD(wpaClient), exp, notifyCheckWPACRD()) }
identifier_body
wpa_controller.go
// Unless explicitly stated otherwise all files in this repository are licensed // under the Apache License Version 2.0. // This product includes software developed at Datadog (https://www.datadoghq.com/). // Copyright 2016-present Datadog, Inc. //go:build kubeapiserver package apiserver import ( "context" "math" "time" dynamic_client "k8s.io/client-go/dynamic" dynamic_informer "k8s.io/client-go/dynamic/dynamicinformer" apis_v1alpha1 "github.com/DataDog/watermarkpodautoscaler/api/v1alpha1" "github.com/cenkalti/backoff" corev1 "k8s.io/api/core/v1" apierrors "k8s.io/apimachinery/pkg/api/errors" v1 "k8s.io/apimachinery/pkg/apis/meta/v1" "k8s.io/apimachinery/pkg/util/wait" "k8s.io/client-go/tools/cache" "k8s.io/client-go/util/workqueue" "github.com/DataDog/datadog-agent/pkg/clusteragent/custommetrics" "github.com/DataDog/datadog-agent/pkg/errors" "github.com/DataDog/datadog-agent/pkg/util/kubernetes/autoscalers" "github.com/DataDog/datadog-agent/pkg/util/log" ) const ( crdCheckInitialInterval = time.Second * 5 crdCheckMaxInterval = 5 * time.Minute crdCheckMultiplier = 2.0 crdCheckMaxElapsedTime = 0 ) var gvrWPA = apis_v1alpha1.GroupVersion.WithResource("watermarkpodautoscalers") // RunWPA starts the controller to process events about Watermark Pod Autoscalers func (h *AutoscalersController) RunWPA(stopCh <-chan struct{}, wpaClient dynamic_client.Interface, wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) { waitForWPACRD(wpaClient) // mutate the Autoscaler controller to embed an informer against the WPAs if err := h.enableWPA(wpaInformerFactory); err != nil { log.Errorf("impossible to enable WPQ: %v", err) return } defer h.WPAqueue.ShutDown() log.Infof("Starting WPA Controller ... ") defer log.Infof("Stopping WPA Controller") wpaInformerFactory.Start(stopCh) if !cache.WaitForCacheSync(stopCh, h.wpaListerSynced) { return } wait.Until(h.workerWPA, time.Second, stopCh) } type checkAPI func() error func tryCheckWPACRD(check checkAPI) error { if err := check(); err != nil { // Check if this is a known problem of missing CRD registration if isWPACRDNotFoundError(err) { return err } // In all other cases return a permanent error to prevent from retrying log.Errorf("WPA CRD check failed: not retryable: %s", err) return backoff.Permanent(err) } log.Info("WPA CRD check successful") return nil } func notifyCheckWPACRD() backoff.Notify { attempt := 0 return func(err error, delay time.Duration) { attempt++ mins := int(delay.Minutes()) secs := int(math.Mod(delay.Seconds(), 60)) log.Warnf("WPA CRD missing (attempt=%d): will retry in %dm%ds", attempt, mins, secs) } } func isWPACRDNotFoundError(err error) bool { status, ok := err.(*apierrors.StatusError) if !ok { return false } reason := status.Status().Reason
details.Kind == "watermarkpodautoscalers" } func checkWPACRD(wpaClient dynamic_client.Interface) backoff.Operation { check := func() error { _, err := wpaClient.Resource(gvrWPA).List(context.TODO(), v1.ListOptions{}) return err } return func() error { return tryCheckWPACRD(check) } } func waitForWPACRD(wpaClient dynamic_client.Interface) { exp := &backoff.ExponentialBackOff{ InitialInterval: crdCheckInitialInterval, RandomizationFactor: 0, Multiplier: crdCheckMultiplier, MaxInterval: crdCheckMaxInterval, MaxElapsedTime: crdCheckMaxElapsedTime, Clock: backoff.SystemClock, } exp.Reset() _ = backoff.RetryNotify(checkWPACRD(wpaClient), exp, notifyCheckWPACRD()) } // enableWPA adds the handlers to the AutoscalersController to support WPAs func (h *AutoscalersController) enableWPA(wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) error { log.Info("Enabling WPA controller") genericInformer := wpaInformerFactory.ForResource(gvrWPA) h.WPAqueue = workqueue.NewNamedRateLimitingQueue(workqueue.DefaultItemBasedRateLimiter(), "wpa-autoscalers") h.wpaLister = genericInformer.Lister() h.wpaListerSynced = genericInformer.Informer().HasSynced if _, err := genericInformer.Informer().AddEventHandler( cache.ResourceEventHandlerFuncs{ AddFunc: h.addWPAutoscaler, UpdateFunc: h.updateWPAutoscaler, DeleteFunc: h.deleteWPAutoscaler, }, ); err != nil { return err } h.mu.Lock() defer h.mu.Unlock() h.wpaEnabled = true return nil } func (h *AutoscalersController) isWPAEnabled() bool { h.mu.Lock() defer h.mu.Unlock() return h.wpaEnabled } func (h *AutoscalersController) workerWPA() { for h.processNextWPA() { } } func (h *AutoscalersController) processNextWPA() bool { key, quit := h.WPAqueue.Get() if quit { log.Error("WPA controller HPAqueue is shutting down, stopping processing") return false } log.Tracef("Processing %s", key) defer h.WPAqueue.Done(key) err := h.syncWPA(key) h.handleErr(err, key) // Debug output for unit tests only if h.autoscalers != nil { h.autoscalers <- key } return true } func (h *AutoscalersController) syncWPA(key interface{}) error { h.mu.Lock() defer h.mu.Unlock() ns, name, err := cache.SplitMetaNamespaceKey(key.(string)) if err != nil { log.Errorf("Could not split the key: %v", err) return err } wpaCachedObj, err := h.wpaLister.ByNamespace(ns).Get(name) if err != nil { log.Errorf("Could not retrieve key %s from cache: %v", key, err) return err } wpaCached := &apis_v1alpha1.WatermarkPodAutoscaler{} err = UnstructuredIntoWPA(wpaCachedObj, wpaCached) if err != nil { log.Errorf("Could not cast wpa %s retrieved from cache to wpa structure: %v", key, err) return err } switch { case errors.IsNotFound(err): log.Infof("WatermarkPodAutoscaler %v has been deleted but was not caught in the EventHandler. GC will cleanup.", key) case err != nil: log.Errorf("Unable to retrieve WatermarkPodAutoscaler %v from store: %v", key, err) default: if wpaCached == nil { log.Errorf("Could not parse empty wpa %s/%s from local store", ns, name) return ErrIsEmpty } emList := autoscalers.InspectWPA(wpaCached) if len(emList) == 0 { return nil } newMetrics := h.hpaProc.ProcessEMList(emList) h.toStore.m.Lock() for metric, value := range newMetrics { // We should only insert placeholders in the local cache. h.toStore.data[metric] = value } h.toStore.m.Unlock() log.Tracef("Local batch cache of WPA is %v", h.toStore.data) } return err } func (h *AutoscalersController) addWPAutoscaler(obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } log.Debugf("Adding WPA %s/%s", newAutoscaler.Namespace, newAutoscaler.Name) h.EventRecorder.Event(newAutoscaler.DeepCopyObject(), corev1.EventTypeNormal, autoscalerNowHandleMsgEvent, "") h.enqueueWPA(newAutoscaler) } func (h *AutoscalersController) updateWPAutoscaler(old, obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } oldAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, oldAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) h.enqueueWPA(newAutoscaler) // We still want to enqueue the newAutoscaler to get the new change return } if !autoscalers.AutoscalerMetricsUpdate(newAutoscaler.GetObjectMeta(), oldAutoscaler.GetObjectMeta()) { log.Tracef("Update received for the %s/%s, without a relevant change to the configuration", newAutoscaler.Namespace, newAutoscaler.Name) return } // Need to delete the old object from the local cache. If the labels have changed, the syncAutoscaler would not override the old key. toDelete := autoscalers.InspectWPA(oldAutoscaler) h.deleteFromLocalStore(toDelete) log.Tracef("Processing update event for wpa %s/%s with configuration: %s", newAutoscaler.Namespace, newAutoscaler.Name, newAutoscaler.Annotations) h.enqueueWPA(newAutoscaler) } // Processing the Delete Events in the Eventhandler as obj is deleted from the local store thereafter. // Only here can we retrieve the content of the WPA to properly process and delete it. // FIXME we could have an update in the WPAqueue while processing the deletion, we should make // sure we process them in order instead. For now, the gc logic allows us to recover. func (h *AutoscalersController) deleteWPAutoscaler(obj interface{}) { h.mu.Lock() defer h.mu.Unlock() toDelete := &custommetrics.MetricsBundle{} deletedWPA := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, deletedWPA); err == nil { toDelete.External = autoscalers.InspectWPA(deletedWPA) h.deleteFromLocalStore(toDelete.External) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) if !h.isLeaderFunc() { return } log.Infof("Deleting entries of metrics from Ref %s/%s in the Global Store", deletedWPA.Namespace, deletedWPA.Name) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) } return } tombstone, ok := obj.(cache.DeletedFinalStateUnknown) if !ok { log.Errorf("Could not get object from tombstone %#v", obj) return } if err := UnstructuredIntoWPA(tombstone, deletedWPA); err != nil { log.Errorf("Tombstone contained object that is not an Autoscaler: %#v", obj) return } log.Debugf("Deleting Metrics from WPA %s/%s", deletedWPA.Namespace, deletedWPA.Name) toDelete.External = autoscalers.InspectWPA(deletedWPA) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) h.deleteFromLocalStore(toDelete.External) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) return } }
details := status.Status().Details return reason == v1.StatusReasonNotFound && details.Group == apis_v1alpha1.SchemeGroupVersion.Group &&
random_line_split
wpa_controller.go
// Unless explicitly stated otherwise all files in this repository are licensed // under the Apache License Version 2.0. // This product includes software developed at Datadog (https://www.datadoghq.com/). // Copyright 2016-present Datadog, Inc. //go:build kubeapiserver package apiserver import ( "context" "math" "time" dynamic_client "k8s.io/client-go/dynamic" dynamic_informer "k8s.io/client-go/dynamic/dynamicinformer" apis_v1alpha1 "github.com/DataDog/watermarkpodautoscaler/api/v1alpha1" "github.com/cenkalti/backoff" corev1 "k8s.io/api/core/v1" apierrors "k8s.io/apimachinery/pkg/api/errors" v1 "k8s.io/apimachinery/pkg/apis/meta/v1" "k8s.io/apimachinery/pkg/util/wait" "k8s.io/client-go/tools/cache" "k8s.io/client-go/util/workqueue" "github.com/DataDog/datadog-agent/pkg/clusteragent/custommetrics" "github.com/DataDog/datadog-agent/pkg/errors" "github.com/DataDog/datadog-agent/pkg/util/kubernetes/autoscalers" "github.com/DataDog/datadog-agent/pkg/util/log" ) const ( crdCheckInitialInterval = time.Second * 5 crdCheckMaxInterval = 5 * time.Minute crdCheckMultiplier = 2.0 crdCheckMaxElapsedTime = 0 ) var gvrWPA = apis_v1alpha1.GroupVersion.WithResource("watermarkpodautoscalers") // RunWPA starts the controller to process events about Watermark Pod Autoscalers func (h *AutoscalersController) RunWPA(stopCh <-chan struct{}, wpaClient dynamic_client.Interface, wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) { waitForWPACRD(wpaClient) // mutate the Autoscaler controller to embed an informer against the WPAs if err := h.enableWPA(wpaInformerFactory); err != nil { log.Errorf("impossible to enable WPQ: %v", err) return } defer h.WPAqueue.ShutDown() log.Infof("Starting WPA Controller ... ") defer log.Infof("Stopping WPA Controller") wpaInformerFactory.Start(stopCh) if !cache.WaitForCacheSync(stopCh, h.wpaListerSynced) { return } wait.Until(h.workerWPA, time.Second, stopCh) } type checkAPI func() error func tryCheckWPACRD(check checkAPI) error { if err := check(); err != nil { // Check if this is a known problem of missing CRD registration if isWPACRDNotFoundError(err) { return err } // In all other cases return a permanent error to prevent from retrying log.Errorf("WPA CRD check failed: not retryable: %s", err) return backoff.Permanent(err) } log.Info("WPA CRD check successful") return nil } func notifyCheckWPACRD() backoff.Notify { attempt := 0 return func(err error, delay time.Duration) { attempt++ mins := int(delay.Minutes()) secs := int(math.Mod(delay.Seconds(), 60)) log.Warnf("WPA CRD missing (attempt=%d): will retry in %dm%ds", attempt, mins, secs) } } func isWPACRDNotFoundError(err error) bool { status, ok := err.(*apierrors.StatusError) if !ok { return false } reason := status.Status().Reason details := status.Status().Details return reason == v1.StatusReasonNotFound && details.Group == apis_v1alpha1.SchemeGroupVersion.Group && details.Kind == "watermarkpodautoscalers" } func checkWPACRD(wpaClient dynamic_client.Interface) backoff.Operation { check := func() error { _, err := wpaClient.Resource(gvrWPA).List(context.TODO(), v1.ListOptions{}) return err } return func() error { return tryCheckWPACRD(check) } } func waitForWPACRD(wpaClient dynamic_client.Interface) { exp := &backoff.ExponentialBackOff{ InitialInterval: crdCheckInitialInterval, RandomizationFactor: 0, Multiplier: crdCheckMultiplier, MaxInterval: crdCheckMaxInterval, MaxElapsedTime: crdCheckMaxElapsedTime, Clock: backoff.SystemClock, } exp.Reset() _ = backoff.RetryNotify(checkWPACRD(wpaClient), exp, notifyCheckWPACRD()) } // enableWPA adds the handlers to the AutoscalersController to support WPAs func (h *AutoscalersController) enableWPA(wpaInformerFactory dynamic_informer.DynamicSharedInformerFactory) error { log.Info("Enabling WPA controller") genericInformer := wpaInformerFactory.ForResource(gvrWPA) h.WPAqueue = workqueue.NewNamedRateLimitingQueue(workqueue.DefaultItemBasedRateLimiter(), "wpa-autoscalers") h.wpaLister = genericInformer.Lister() h.wpaListerSynced = genericInformer.Informer().HasSynced if _, err := genericInformer.Informer().AddEventHandler( cache.ResourceEventHandlerFuncs{ AddFunc: h.addWPAutoscaler, UpdateFunc: h.updateWPAutoscaler, DeleteFunc: h.deleteWPAutoscaler, }, ); err != nil { return err } h.mu.Lock() defer h.mu.Unlock() h.wpaEnabled = true return nil } func (h *AutoscalersController) isWPAEnabled() bool { h.mu.Lock() defer h.mu.Unlock() return h.wpaEnabled } func (h *AutoscalersController) workerWPA() { for h.processNextWPA() { } } func (h *AutoscalersController) processNextWPA() bool { key, quit := h.WPAqueue.Get() if quit { log.Error("WPA controller HPAqueue is shutting down, stopping processing") return false } log.Tracef("Processing %s", key) defer h.WPAqueue.Done(key) err := h.syncWPA(key) h.handleErr(err, key) // Debug output for unit tests only if h.autoscalers != nil { h.autoscalers <- key } return true } func (h *AutoscalersController) syncWPA(key interface{}) error { h.mu.Lock() defer h.mu.Unlock() ns, name, err := cache.SplitMetaNamespaceKey(key.(string)) if err != nil { log.Errorf("Could not split the key: %v", err) return err } wpaCachedObj, err := h.wpaLister.ByNamespace(ns).Get(name) if err != nil { log.Errorf("Could not retrieve key %s from cache: %v", key, err) return err } wpaCached := &apis_v1alpha1.WatermarkPodAutoscaler{} err = UnstructuredIntoWPA(wpaCachedObj, wpaCached) if err != nil { log.Errorf("Could not cast wpa %s retrieved from cache to wpa structure: %v", key, err) return err } switch { case errors.IsNotFound(err): log.Infof("WatermarkPodAutoscaler %v has been deleted but was not caught in the EventHandler. GC will cleanup.", key) case err != nil: log.Errorf("Unable to retrieve WatermarkPodAutoscaler %v from store: %v", key, err) default: if wpaCached == nil { log.Errorf("Could not parse empty wpa %s/%s from local store", ns, name) return ErrIsEmpty } emList := autoscalers.InspectWPA(wpaCached) if len(emList) == 0 { return nil } newMetrics := h.hpaProc.ProcessEMList(emList) h.toStore.m.Lock() for metric, value := range newMetrics { // We should only insert placeholders in the local cache. h.toStore.data[metric] = value } h.toStore.m.Unlock() log.Tracef("Local batch cache of WPA is %v", h.toStore.data) } return err } func (h *AutoscalersController) addWPAutoscaler(obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } log.Debugf("Adding WPA %s/%s", newAutoscaler.Namespace, newAutoscaler.Name) h.EventRecorder.Event(newAutoscaler.DeepCopyObject(), corev1.EventTypeNormal, autoscalerNowHandleMsgEvent, "") h.enqueueWPA(newAutoscaler) } func (h *AutoscalersController) updateWPAutoscaler(old, obj interface{}) { newAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, newAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) return } oldAutoscaler := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, oldAutoscaler); err != nil { log.Errorf("Unable to cast obj %s to a WPA: %v", obj, err) h.enqueueWPA(newAutoscaler) // We still want to enqueue the newAutoscaler to get the new change return } if !autoscalers.AutoscalerMetricsUpdate(newAutoscaler.GetObjectMeta(), oldAutoscaler.GetObjectMeta()) { log.Tracef("Update received for the %s/%s, without a relevant change to the configuration", newAutoscaler.Namespace, newAutoscaler.Name) return } // Need to delete the old object from the local cache. If the labels have changed, the syncAutoscaler would not override the old key. toDelete := autoscalers.InspectWPA(oldAutoscaler) h.deleteFromLocalStore(toDelete) log.Tracef("Processing update event for wpa %s/%s with configuration: %s", newAutoscaler.Namespace, newAutoscaler.Name, newAutoscaler.Annotations) h.enqueueWPA(newAutoscaler) } // Processing the Delete Events in the Eventhandler as obj is deleted from the local store thereafter. // Only here can we retrieve the content of the WPA to properly process and delete it. // FIXME we could have an update in the WPAqueue while processing the deletion, we should make // sure we process them in order instead. For now, the gc logic allows us to recover. func (h *AutoscalersController) deleteWPAutoscaler(obj interface{}) { h.mu.Lock() defer h.mu.Unlock() toDelete := &custommetrics.MetricsBundle{} deletedWPA := &apis_v1alpha1.WatermarkPodAutoscaler{} if err := UnstructuredIntoWPA(obj, deletedWPA); err == nil { toDelete.External = autoscalers.InspectWPA(deletedWPA) h.deleteFromLocalStore(toDelete.External) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) if !h.isLeaderFunc() { return } log.Infof("Deleting entries of metrics from Ref %s/%s in the Global Store", deletedWPA.Namespace, deletedWPA.Name) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) } return } tombstone, ok := obj.(cache.DeletedFinalStateUnknown) if !ok
if err := UnstructuredIntoWPA(tombstone, deletedWPA); err != nil { log.Errorf("Tombstone contained object that is not an Autoscaler: %#v", obj) return } log.Debugf("Deleting Metrics from WPA %s/%s", deletedWPA.Namespace, deletedWPA.Name) toDelete.External = autoscalers.InspectWPA(deletedWPA) log.Debugf("Deleting %s/%s from the local cache", deletedWPA.Namespace, deletedWPA.Name) h.deleteFromLocalStore(toDelete.External) if err := h.store.DeleteExternalMetricValues(toDelete); err != nil { h.enqueueWPA(deletedWPA) return } }
{ log.Errorf("Could not get object from tombstone %#v", obj) return }
conditional_block
splash.go
package splash import ( "bytes" "encoding/base64" "encoding/json" "errors" "fmt" "io" "io/ioutil" "log" "net/http" neturl "net/url" "os" "strings" "time" "github.com/pquerna/cachecontrol/cacheobject" "github.com/spf13/viper" "github.com/slotix/dataflowkit/errs" ) var logger *log.Logger func init() { viper.AutomaticEnv() // read in environment variables that match logger = log.New(os.Stdout, "splash: ", log.Lshortfile) } type splashConn struct { host string //splash server address //password string //Splash parameters: timeout int resourceTimeout int wait float64 } //NewSplashConn creates new connection to Splash Server func NewSplashConn(host string, timeout, resourceTimeout int, wait float64) splashConn { return splashConn{
} //GenerateSplashURL Generates Splash URL and return error func (s *splashConn) GenerateSplashURL(req Request) string { /* //"Set-Cookie" from response headers should be sent when accessing for the same domain second time cookie := `PHPSESSID=ef75e2737a14b06a2749d0b73840354f; path=/; domain=.acer-a500.ru; HttpOnly dle_user_id=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_password=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_hash=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_forum_sessions=ef75e2737a14b06a2749d0b73840354f; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly forum_last=1496801580; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly` //cookie := "" req.Cookies, err = generateCookie(cookie) if err != nil { logger.Println(err) } //logger.Println(req.Cookies) //--------- */ //req.Params = `"auth_key=880ea6a14ea49e853634fbdc5015a024&referer=http%3A%2F%2Fdiesel.elcat.kg%2F&ips_username=dm_&ips_password=asfwwe!444D&rememberMe=1"` var LUAScript string if isRobotsTxt(req.URL) { LUAScript = robotsLUA } else { LUAScript = baseLUA } splashURL := fmt.Sprintf( "http://%s/execute?url=%s&timeout=%d&resource_timeout=%d&wait=%.1f&cookies=%s&formdata=%s&lua_source=%s", s.host, neturl.QueryEscape(req.URL), s.timeout, s.resourceTimeout, s.wait, neturl.QueryEscape(req.Cookies), neturl.QueryEscape(paramsToLuaTable(req.Params)), neturl.QueryEscape(LUAScript)) return splashURL } //GetResponse result is passed to caching middleware //to provide a RFC7234 compliant HTTP cache func GetResponse(req Request) (*Response, error) { sConn := NewSplashConn( viper.GetString("SPLASH"), viper.GetInt("SPLASH_TIMEOUT"), viper.GetInt("SPLASH_RESOURCE_TIMEOUT"), viper.GetFloat64("SPLASH_WAIT"), ) splashURL := sConn.GenerateSplashURL(req) client := &http.Client{} request, err := http.NewRequest("GET", splashURL, nil) //req.SetBasicAuth(s.user, s.password) resp, err := client.Do(request) if resp != nil { defer resp.Body.Close() } if err != nil { return nil, err } res, err := ioutil.ReadAll(resp.Body) if err != nil { return nil, err } //response from Splash service. statusCode := resp.StatusCode if statusCode != 200 { switch statusCode { case 504: return nil, &errs.GatewayTimeout{} default: return nil, fmt.Errorf(string(res)) } } var sResponse Response if err := json.Unmarshal(res, &sResponse); err != nil { logger.Println("Json Unmarshall error", err) } //if response status code is not 200 if sResponse.Error != "" { switch sResponse.Error { case "http404": return nil, &errs.NotFound{sResponse.URL} case "http403": return nil, &errs.Forbidden{sResponse.URL} case "network3": return nil, &errs.InvalidHost{sResponse.URL} default: return nil, &errs.Error{sResponse.Error} } //return nil, fmt.Errorf("%s", sResponse.Error) } // Sometimes no response, request returned by Splash. // gc (garbage collection) method should be called to clear WebKit caches and then // GetResponse again. See more at https://github.com/scrapinghub/splash/issues/613 if sResponse.Response == nil || sResponse.Request == nil && sResponse.HTML != "" { var response *Response gcResponse, err := gc(viper.GetString("SPLASH")) if err == nil && gcResponse.Status == "ok" { response, err = GetResponse(req) if err != nil { return nil, err } } return response, nil } if !sResponse.Response.Ok { if sResponse.Response.Status == 0 { err = fmt.Errorf("%s", //sResponse.Error) sResponse.Response.StatusText) } else { err = fmt.Errorf("%d. %s", sResponse.Response.Status, sResponse.Response.StatusText) } return nil, err } //if cacheable ? rv := sResponse.cacheable() //logger.Println(rv.OutReasons) //logger.Println(rv.OutWarnings) //logger.Println(rv.OutExpirationTime) if len(rv.OutReasons) == 0 { sResponse.Cacheable = true } return &sResponse, nil } func (r *Response) GetContent() (io.ReadCloser, error) { if r == nil { return nil, errors.New("empty response") } if isRobotsTxt(r.Request.URL) { decoded, err := base64.StdEncoding.DecodeString(r.Response.Content.Text) if err != nil { logger.Println("decode error:", err) return nil, err } readCloser := ioutil.NopCloser(bytes.NewReader(decoded)) return readCloser, nil } readCloser := ioutil.NopCloser(strings.NewReader(r.HTML)) return readCloser, nil } //cacheable check if resource is cacheable func (r *Response) cacheable() (rv cacheobject.ObjectResults) { respHeader := r.Response.Headers.(http.Header) reqHeader := r.Request.Headers.(http.Header) // respHeader := r.Response.castHeaders() // reqHeader := r.Request.castHeaders() reqDir, err := cacheobject.ParseRequestCacheControl(reqHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } resDir, err := cacheobject.ParseResponseCacheControl(respHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } //logger.Println(respHeader) expiresHeader, _ := http.ParseTime(respHeader.Get("Expires")) dateHeader, _ := http.ParseTime(respHeader.Get("Date")) lastModifiedHeader, _ := http.ParseTime(respHeader.Get("Last-Modified")) obj := cacheobject.Object{ // CacheIsPrivate: false, RespDirectives: resDir, RespHeaders: respHeader, RespStatusCode: r.Response.Status, RespExpiresHeader: expiresHeader, RespDateHeader: dateHeader, RespLastModifiedHeader: lastModifiedHeader, ReqDirectives: reqDir, ReqHeaders: reqHeader, ReqMethod: r.Request.Method, NowUTC: time.Now().UTC(), } rv = cacheobject.ObjectResults{} cacheobject.CachableObject(&obj, &rv) cacheobject.ExpirationObject(&obj, &rv) //Check if it is cacheable expTime := rv.OutExpirationTime.Unix() if rv.OutExpirationTime.IsZero() { expTime = 0 } r.CacheExpirationTime = expTime debug := false if debug { if rv.OutErr != nil { logger.Println("Errors: ", rv.OutErr) } if rv.OutReasons != nil { logger.Println("Reasons to not cache: ", rv.OutReasons) } if rv.OutWarnings != nil { logger.Println("Warning headers to add: ", rv.OutWarnings) } logger.Println("Expiration: ", rv.OutExpirationTime.String()) } return rv } //Fetch content from url through Splash server https://github.com/scrapinghub/splash/ func Fetch(req Request) (io.ReadCloser, error) { //logger.Println(splashURL) response, err := GetResponse(req) if err != nil { return nil, err } logger.Println(err) content, err := response.GetContent() if err == nil { return content, nil } return nil, err } func (r Request) GetURL() string { return r.URL } func isRobotsTxt(url string) bool { if strings.HasSuffix(url, "robots.txt") { return true } return false } //http://choly.ca/post/go-json-marshalling/ //UnmarshalJSON convert headers to http.Header type func (r *Response) UnmarshalJSON(data []byte) error { type Alias Response aux := &struct { Headers interface{} `json:"headers"` *Alias }{ Alias: (*Alias)(r), } if err := json.Unmarshal(data, &aux); err != nil { return err } if r.Request != nil { r.Request.Headers = castHeaders(r.Request.Headers) } if r.Response != nil { r.Response.Headers = castHeaders(r.Response.Headers) } return nil } //castHeaders serves for casting headers returned by Splash to standard http.Header type func castHeaders(splashHeaders interface{}) (header http.Header) { header = make(map[string][]string) switch splashHeaders.(type) { case []interface{}: for _, h := range splashHeaders.([]interface{}) { //var str []string str := []string{} v, ok := h.(map[string]interface{})["value"].(string) if ok { str = append(str, v) header[h.(map[string]interface{})["name"].(string)] = str } } return header case map[string]interface{}: for k, v := range splashHeaders.(map[string]interface{}) { var str []string for _, vv := range v.([]interface{}) { str = append(str, vv.(string)) } header[k] = str } return header default: return nil } } //Splash splash:history() may return empty list as it cannot retrieve cached results //in case request the same page twice. So the only solution for the moment is to call //http://localhost:8050/_gc if an error occures. It runs the Python garbage collector //and clears internal WebKit caches. See more at https://github.com/scrapinghub/splash/issues/613 func gc(host string) (*gcResponse, error) { client := &http.Client{} gcURL := fmt.Sprintf("http://%s/_gc", host) req, err := http.NewRequest("POST", gcURL, nil) if err != nil { return nil, err } resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var gc gcResponse err = json.Unmarshal(buf.Bytes(), &gc) if err != nil { return nil, err } return &gc, nil } //Ping returns status and maxrss from _ping endpoint func Ping(host string) (*PingResponse, error) { client := &http.Client{} pingURL := fmt.Sprintf("http://%s/_ping", host) req, err := http.NewRequest("GET", pingURL, nil) if err != nil { return nil, err } //req.SetBasicAuth(userName, userPass) resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var p PingResponse err = json.Unmarshal(buf.Bytes(), &p) if err != nil { return nil, err } return &p, nil }
host: host, timeout: timeout, resourceTimeout: resourceTimeout, wait: wait, }
random_line_split
splash.go
package splash import ( "bytes" "encoding/base64" "encoding/json" "errors" "fmt" "io" "io/ioutil" "log" "net/http" neturl "net/url" "os" "strings" "time" "github.com/pquerna/cachecontrol/cacheobject" "github.com/spf13/viper" "github.com/slotix/dataflowkit/errs" ) var logger *log.Logger func init() { viper.AutomaticEnv() // read in environment variables that match logger = log.New(os.Stdout, "splash: ", log.Lshortfile) } type splashConn struct { host string //splash server address //password string //Splash parameters: timeout int resourceTimeout int wait float64 } //NewSplashConn creates new connection to Splash Server func NewSplashConn(host string, timeout, resourceTimeout int, wait float64) splashConn { return splashConn{ host: host, timeout: timeout, resourceTimeout: resourceTimeout, wait: wait, } } //GenerateSplashURL Generates Splash URL and return error func (s *splashConn) GenerateSplashURL(req Request) string { /* //"Set-Cookie" from response headers should be sent when accessing for the same domain second time cookie := `PHPSESSID=ef75e2737a14b06a2749d0b73840354f; path=/; domain=.acer-a500.ru; HttpOnly dle_user_id=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_password=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_hash=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_forum_sessions=ef75e2737a14b06a2749d0b73840354f; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly forum_last=1496801580; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly` //cookie := "" req.Cookies, err = generateCookie(cookie) if err != nil { logger.Println(err) } //logger.Println(req.Cookies) //--------- */ //req.Params = `"auth_key=880ea6a14ea49e853634fbdc5015a024&referer=http%3A%2F%2Fdiesel.elcat.kg%2F&ips_username=dm_&ips_password=asfwwe!444D&rememberMe=1"` var LUAScript string if isRobotsTxt(req.URL) { LUAScript = robotsLUA } else { LUAScript = baseLUA } splashURL := fmt.Sprintf( "http://%s/execute?url=%s&timeout=%d&resource_timeout=%d&wait=%.1f&cookies=%s&formdata=%s&lua_source=%s", s.host, neturl.QueryEscape(req.URL), s.timeout, s.resourceTimeout, s.wait, neturl.QueryEscape(req.Cookies), neturl.QueryEscape(paramsToLuaTable(req.Params)), neturl.QueryEscape(LUAScript)) return splashURL } //GetResponse result is passed to caching middleware //to provide a RFC7234 compliant HTTP cache func GetResponse(req Request) (*Response, error) { sConn := NewSplashConn( viper.GetString("SPLASH"), viper.GetInt("SPLASH_TIMEOUT"), viper.GetInt("SPLASH_RESOURCE_TIMEOUT"), viper.GetFloat64("SPLASH_WAIT"), ) splashURL := sConn.GenerateSplashURL(req) client := &http.Client{} request, err := http.NewRequest("GET", splashURL, nil) //req.SetBasicAuth(s.user, s.password) resp, err := client.Do(request) if resp != nil { defer resp.Body.Close() } if err != nil { return nil, err } res, err := ioutil.ReadAll(resp.Body) if err != nil { return nil, err } //response from Splash service. statusCode := resp.StatusCode if statusCode != 200 { switch statusCode { case 504: return nil, &errs.GatewayTimeout{} default: return nil, fmt.Errorf(string(res)) } } var sResponse Response if err := json.Unmarshal(res, &sResponse); err != nil { logger.Println("Json Unmarshall error", err) } //if response status code is not 200 if sResponse.Error != "" { switch sResponse.Error { case "http404": return nil, &errs.NotFound{sResponse.URL} case "http403": return nil, &errs.Forbidden{sResponse.URL} case "network3": return nil, &errs.InvalidHost{sResponse.URL} default: return nil, &errs.Error{sResponse.Error} } //return nil, fmt.Errorf("%s", sResponse.Error) } // Sometimes no response, request returned by Splash. // gc (garbage collection) method should be called to clear WebKit caches and then // GetResponse again. See more at https://github.com/scrapinghub/splash/issues/613 if sResponse.Response == nil || sResponse.Request == nil && sResponse.HTML != "" { var response *Response gcResponse, err := gc(viper.GetString("SPLASH")) if err == nil && gcResponse.Status == "ok" { response, err = GetResponse(req) if err != nil { return nil, err } } return response, nil } if !sResponse.Response.Ok { if sResponse.Response.Status == 0 { err = fmt.Errorf("%s", //sResponse.Error) sResponse.Response.StatusText) } else { err = fmt.Errorf("%d. %s", sResponse.Response.Status, sResponse.Response.StatusText) } return nil, err } //if cacheable ? rv := sResponse.cacheable() //logger.Println(rv.OutReasons) //logger.Println(rv.OutWarnings) //logger.Println(rv.OutExpirationTime) if len(rv.OutReasons) == 0 { sResponse.Cacheable = true } return &sResponse, nil } func (r *Response)
() (io.ReadCloser, error) { if r == nil { return nil, errors.New("empty response") } if isRobotsTxt(r.Request.URL) { decoded, err := base64.StdEncoding.DecodeString(r.Response.Content.Text) if err != nil { logger.Println("decode error:", err) return nil, err } readCloser := ioutil.NopCloser(bytes.NewReader(decoded)) return readCloser, nil } readCloser := ioutil.NopCloser(strings.NewReader(r.HTML)) return readCloser, nil } //cacheable check if resource is cacheable func (r *Response) cacheable() (rv cacheobject.ObjectResults) { respHeader := r.Response.Headers.(http.Header) reqHeader := r.Request.Headers.(http.Header) // respHeader := r.Response.castHeaders() // reqHeader := r.Request.castHeaders() reqDir, err := cacheobject.ParseRequestCacheControl(reqHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } resDir, err := cacheobject.ParseResponseCacheControl(respHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } //logger.Println(respHeader) expiresHeader, _ := http.ParseTime(respHeader.Get("Expires")) dateHeader, _ := http.ParseTime(respHeader.Get("Date")) lastModifiedHeader, _ := http.ParseTime(respHeader.Get("Last-Modified")) obj := cacheobject.Object{ // CacheIsPrivate: false, RespDirectives: resDir, RespHeaders: respHeader, RespStatusCode: r.Response.Status, RespExpiresHeader: expiresHeader, RespDateHeader: dateHeader, RespLastModifiedHeader: lastModifiedHeader, ReqDirectives: reqDir, ReqHeaders: reqHeader, ReqMethod: r.Request.Method, NowUTC: time.Now().UTC(), } rv = cacheobject.ObjectResults{} cacheobject.CachableObject(&obj, &rv) cacheobject.ExpirationObject(&obj, &rv) //Check if it is cacheable expTime := rv.OutExpirationTime.Unix() if rv.OutExpirationTime.IsZero() { expTime = 0 } r.CacheExpirationTime = expTime debug := false if debug { if rv.OutErr != nil { logger.Println("Errors: ", rv.OutErr) } if rv.OutReasons != nil { logger.Println("Reasons to not cache: ", rv.OutReasons) } if rv.OutWarnings != nil { logger.Println("Warning headers to add: ", rv.OutWarnings) } logger.Println("Expiration: ", rv.OutExpirationTime.String()) } return rv } //Fetch content from url through Splash server https://github.com/scrapinghub/splash/ func Fetch(req Request) (io.ReadCloser, error) { //logger.Println(splashURL) response, err := GetResponse(req) if err != nil { return nil, err } logger.Println(err) content, err := response.GetContent() if err == nil { return content, nil } return nil, err } func (r Request) GetURL() string { return r.URL } func isRobotsTxt(url string) bool { if strings.HasSuffix(url, "robots.txt") { return true } return false } //http://choly.ca/post/go-json-marshalling/ //UnmarshalJSON convert headers to http.Header type func (r *Response) UnmarshalJSON(data []byte) error { type Alias Response aux := &struct { Headers interface{} `json:"headers"` *Alias }{ Alias: (*Alias)(r), } if err := json.Unmarshal(data, &aux); err != nil { return err } if r.Request != nil { r.Request.Headers = castHeaders(r.Request.Headers) } if r.Response != nil { r.Response.Headers = castHeaders(r.Response.Headers) } return nil } //castHeaders serves for casting headers returned by Splash to standard http.Header type func castHeaders(splashHeaders interface{}) (header http.Header) { header = make(map[string][]string) switch splashHeaders.(type) { case []interface{}: for _, h := range splashHeaders.([]interface{}) { //var str []string str := []string{} v, ok := h.(map[string]interface{})["value"].(string) if ok { str = append(str, v) header[h.(map[string]interface{})["name"].(string)] = str } } return header case map[string]interface{}: for k, v := range splashHeaders.(map[string]interface{}) { var str []string for _, vv := range v.([]interface{}) { str = append(str, vv.(string)) } header[k] = str } return header default: return nil } } //Splash splash:history() may return empty list as it cannot retrieve cached results //in case request the same page twice. So the only solution for the moment is to call //http://localhost:8050/_gc if an error occures. It runs the Python garbage collector //and clears internal WebKit caches. See more at https://github.com/scrapinghub/splash/issues/613 func gc(host string) (*gcResponse, error) { client := &http.Client{} gcURL := fmt.Sprintf("http://%s/_gc", host) req, err := http.NewRequest("POST", gcURL, nil) if err != nil { return nil, err } resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var gc gcResponse err = json.Unmarshal(buf.Bytes(), &gc) if err != nil { return nil, err } return &gc, nil } //Ping returns status and maxrss from _ping endpoint func Ping(host string) (*PingResponse, error) { client := &http.Client{} pingURL := fmt.Sprintf("http://%s/_ping", host) req, err := http.NewRequest("GET", pingURL, nil) if err != nil { return nil, err } //req.SetBasicAuth(userName, userPass) resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var p PingResponse err = json.Unmarshal(buf.Bytes(), &p) if err != nil { return nil, err } return &p, nil }
GetContent
identifier_name
splash.go
package splash import ( "bytes" "encoding/base64" "encoding/json" "errors" "fmt" "io" "io/ioutil" "log" "net/http" neturl "net/url" "os" "strings" "time" "github.com/pquerna/cachecontrol/cacheobject" "github.com/spf13/viper" "github.com/slotix/dataflowkit/errs" ) var logger *log.Logger func init() { viper.AutomaticEnv() // read in environment variables that match logger = log.New(os.Stdout, "splash: ", log.Lshortfile) } type splashConn struct { host string //splash server address //password string //Splash parameters: timeout int resourceTimeout int wait float64 } //NewSplashConn creates new connection to Splash Server func NewSplashConn(host string, timeout, resourceTimeout int, wait float64) splashConn { return splashConn{ host: host, timeout: timeout, resourceTimeout: resourceTimeout, wait: wait, } } //GenerateSplashURL Generates Splash URL and return error func (s *splashConn) GenerateSplashURL(req Request) string { /* //"Set-Cookie" from response headers should be sent when accessing for the same domain second time cookie := `PHPSESSID=ef75e2737a14b06a2749d0b73840354f; path=/; domain=.acer-a500.ru; HttpOnly dle_user_id=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_password=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_hash=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_forum_sessions=ef75e2737a14b06a2749d0b73840354f; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly forum_last=1496801580; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly` //cookie := "" req.Cookies, err = generateCookie(cookie) if err != nil { logger.Println(err) } //logger.Println(req.Cookies) //--------- */ //req.Params = `"auth_key=880ea6a14ea49e853634fbdc5015a024&referer=http%3A%2F%2Fdiesel.elcat.kg%2F&ips_username=dm_&ips_password=asfwwe!444D&rememberMe=1"` var LUAScript string if isRobotsTxt(req.URL)
else { LUAScript = baseLUA } splashURL := fmt.Sprintf( "http://%s/execute?url=%s&timeout=%d&resource_timeout=%d&wait=%.1f&cookies=%s&formdata=%s&lua_source=%s", s.host, neturl.QueryEscape(req.URL), s.timeout, s.resourceTimeout, s.wait, neturl.QueryEscape(req.Cookies), neturl.QueryEscape(paramsToLuaTable(req.Params)), neturl.QueryEscape(LUAScript)) return splashURL } //GetResponse result is passed to caching middleware //to provide a RFC7234 compliant HTTP cache func GetResponse(req Request) (*Response, error) { sConn := NewSplashConn( viper.GetString("SPLASH"), viper.GetInt("SPLASH_TIMEOUT"), viper.GetInt("SPLASH_RESOURCE_TIMEOUT"), viper.GetFloat64("SPLASH_WAIT"), ) splashURL := sConn.GenerateSplashURL(req) client := &http.Client{} request, err := http.NewRequest("GET", splashURL, nil) //req.SetBasicAuth(s.user, s.password) resp, err := client.Do(request) if resp != nil { defer resp.Body.Close() } if err != nil { return nil, err } res, err := ioutil.ReadAll(resp.Body) if err != nil { return nil, err } //response from Splash service. statusCode := resp.StatusCode if statusCode != 200 { switch statusCode { case 504: return nil, &errs.GatewayTimeout{} default: return nil, fmt.Errorf(string(res)) } } var sResponse Response if err := json.Unmarshal(res, &sResponse); err != nil { logger.Println("Json Unmarshall error", err) } //if response status code is not 200 if sResponse.Error != "" { switch sResponse.Error { case "http404": return nil, &errs.NotFound{sResponse.URL} case "http403": return nil, &errs.Forbidden{sResponse.URL} case "network3": return nil, &errs.InvalidHost{sResponse.URL} default: return nil, &errs.Error{sResponse.Error} } //return nil, fmt.Errorf("%s", sResponse.Error) } // Sometimes no response, request returned by Splash. // gc (garbage collection) method should be called to clear WebKit caches and then // GetResponse again. See more at https://github.com/scrapinghub/splash/issues/613 if sResponse.Response == nil || sResponse.Request == nil && sResponse.HTML != "" { var response *Response gcResponse, err := gc(viper.GetString("SPLASH")) if err == nil && gcResponse.Status == "ok" { response, err = GetResponse(req) if err != nil { return nil, err } } return response, nil } if !sResponse.Response.Ok { if sResponse.Response.Status == 0 { err = fmt.Errorf("%s", //sResponse.Error) sResponse.Response.StatusText) } else { err = fmt.Errorf("%d. %s", sResponse.Response.Status, sResponse.Response.StatusText) } return nil, err } //if cacheable ? rv := sResponse.cacheable() //logger.Println(rv.OutReasons) //logger.Println(rv.OutWarnings) //logger.Println(rv.OutExpirationTime) if len(rv.OutReasons) == 0 { sResponse.Cacheable = true } return &sResponse, nil } func (r *Response) GetContent() (io.ReadCloser, error) { if r == nil { return nil, errors.New("empty response") } if isRobotsTxt(r.Request.URL) { decoded, err := base64.StdEncoding.DecodeString(r.Response.Content.Text) if err != nil { logger.Println("decode error:", err) return nil, err } readCloser := ioutil.NopCloser(bytes.NewReader(decoded)) return readCloser, nil } readCloser := ioutil.NopCloser(strings.NewReader(r.HTML)) return readCloser, nil } //cacheable check if resource is cacheable func (r *Response) cacheable() (rv cacheobject.ObjectResults) { respHeader := r.Response.Headers.(http.Header) reqHeader := r.Request.Headers.(http.Header) // respHeader := r.Response.castHeaders() // reqHeader := r.Request.castHeaders() reqDir, err := cacheobject.ParseRequestCacheControl(reqHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } resDir, err := cacheobject.ParseResponseCacheControl(respHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } //logger.Println(respHeader) expiresHeader, _ := http.ParseTime(respHeader.Get("Expires")) dateHeader, _ := http.ParseTime(respHeader.Get("Date")) lastModifiedHeader, _ := http.ParseTime(respHeader.Get("Last-Modified")) obj := cacheobject.Object{ // CacheIsPrivate: false, RespDirectives: resDir, RespHeaders: respHeader, RespStatusCode: r.Response.Status, RespExpiresHeader: expiresHeader, RespDateHeader: dateHeader, RespLastModifiedHeader: lastModifiedHeader, ReqDirectives: reqDir, ReqHeaders: reqHeader, ReqMethod: r.Request.Method, NowUTC: time.Now().UTC(), } rv = cacheobject.ObjectResults{} cacheobject.CachableObject(&obj, &rv) cacheobject.ExpirationObject(&obj, &rv) //Check if it is cacheable expTime := rv.OutExpirationTime.Unix() if rv.OutExpirationTime.IsZero() { expTime = 0 } r.CacheExpirationTime = expTime debug := false if debug { if rv.OutErr != nil { logger.Println("Errors: ", rv.OutErr) } if rv.OutReasons != nil { logger.Println("Reasons to not cache: ", rv.OutReasons) } if rv.OutWarnings != nil { logger.Println("Warning headers to add: ", rv.OutWarnings) } logger.Println("Expiration: ", rv.OutExpirationTime.String()) } return rv } //Fetch content from url through Splash server https://github.com/scrapinghub/splash/ func Fetch(req Request) (io.ReadCloser, error) { //logger.Println(splashURL) response, err := GetResponse(req) if err != nil { return nil, err } logger.Println(err) content, err := response.GetContent() if err == nil { return content, nil } return nil, err } func (r Request) GetURL() string { return r.URL } func isRobotsTxt(url string) bool { if strings.HasSuffix(url, "robots.txt") { return true } return false } //http://choly.ca/post/go-json-marshalling/ //UnmarshalJSON convert headers to http.Header type func (r *Response) UnmarshalJSON(data []byte) error { type Alias Response aux := &struct { Headers interface{} `json:"headers"` *Alias }{ Alias: (*Alias)(r), } if err := json.Unmarshal(data, &aux); err != nil { return err } if r.Request != nil { r.Request.Headers = castHeaders(r.Request.Headers) } if r.Response != nil { r.Response.Headers = castHeaders(r.Response.Headers) } return nil } //castHeaders serves for casting headers returned by Splash to standard http.Header type func castHeaders(splashHeaders interface{}) (header http.Header) { header = make(map[string][]string) switch splashHeaders.(type) { case []interface{}: for _, h := range splashHeaders.([]interface{}) { //var str []string str := []string{} v, ok := h.(map[string]interface{})["value"].(string) if ok { str = append(str, v) header[h.(map[string]interface{})["name"].(string)] = str } } return header case map[string]interface{}: for k, v := range splashHeaders.(map[string]interface{}) { var str []string for _, vv := range v.([]interface{}) { str = append(str, vv.(string)) } header[k] = str } return header default: return nil } } //Splash splash:history() may return empty list as it cannot retrieve cached results //in case request the same page twice. So the only solution for the moment is to call //http://localhost:8050/_gc if an error occures. It runs the Python garbage collector //and clears internal WebKit caches. See more at https://github.com/scrapinghub/splash/issues/613 func gc(host string) (*gcResponse, error) { client := &http.Client{} gcURL := fmt.Sprintf("http://%s/_gc", host) req, err := http.NewRequest("POST", gcURL, nil) if err != nil { return nil, err } resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var gc gcResponse err = json.Unmarshal(buf.Bytes(), &gc) if err != nil { return nil, err } return &gc, nil } //Ping returns status and maxrss from _ping endpoint func Ping(host string) (*PingResponse, error) { client := &http.Client{} pingURL := fmt.Sprintf("http://%s/_ping", host) req, err := http.NewRequest("GET", pingURL, nil) if err != nil { return nil, err } //req.SetBasicAuth(userName, userPass) resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var p PingResponse err = json.Unmarshal(buf.Bytes(), &p) if err != nil { return nil, err } return &p, nil }
{ LUAScript = robotsLUA }
conditional_block
splash.go
package splash import ( "bytes" "encoding/base64" "encoding/json" "errors" "fmt" "io" "io/ioutil" "log" "net/http" neturl "net/url" "os" "strings" "time" "github.com/pquerna/cachecontrol/cacheobject" "github.com/spf13/viper" "github.com/slotix/dataflowkit/errs" ) var logger *log.Logger func init() { viper.AutomaticEnv() // read in environment variables that match logger = log.New(os.Stdout, "splash: ", log.Lshortfile) } type splashConn struct { host string //splash server address //password string //Splash parameters: timeout int resourceTimeout int wait float64 } //NewSplashConn creates new connection to Splash Server func NewSplashConn(host string, timeout, resourceTimeout int, wait float64) splashConn { return splashConn{ host: host, timeout: timeout, resourceTimeout: resourceTimeout, wait: wait, } } //GenerateSplashURL Generates Splash URL and return error func (s *splashConn) GenerateSplashURL(req Request) string { /* //"Set-Cookie" from response headers should be sent when accessing for the same domain second time cookie := `PHPSESSID=ef75e2737a14b06a2749d0b73840354f; path=/; domain=.acer-a500.ru; HttpOnly dle_user_id=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_password=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_hash=deleted; expires=Thu, 01-Jan-1970 00:00:01 GMT; Max-Age=0; path=/; domain=.acer-a500.ru; httponly dle_forum_sessions=ef75e2737a14b06a2749d0b73840354f; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly forum_last=1496801580; expires=Wed, 06-Jun-2018 19:13:00 GMT; Max-Age=31536000; path=/; domain=.acer-a500.ru; httponly` //cookie := "" req.Cookies, err = generateCookie(cookie) if err != nil { logger.Println(err) } //logger.Println(req.Cookies) //--------- */ //req.Params = `"auth_key=880ea6a14ea49e853634fbdc5015a024&referer=http%3A%2F%2Fdiesel.elcat.kg%2F&ips_username=dm_&ips_password=asfwwe!444D&rememberMe=1"` var LUAScript string if isRobotsTxt(req.URL) { LUAScript = robotsLUA } else { LUAScript = baseLUA } splashURL := fmt.Sprintf( "http://%s/execute?url=%s&timeout=%d&resource_timeout=%d&wait=%.1f&cookies=%s&formdata=%s&lua_source=%s", s.host, neturl.QueryEscape(req.URL), s.timeout, s.resourceTimeout, s.wait, neturl.QueryEscape(req.Cookies), neturl.QueryEscape(paramsToLuaTable(req.Params)), neturl.QueryEscape(LUAScript)) return splashURL } //GetResponse result is passed to caching middleware //to provide a RFC7234 compliant HTTP cache func GetResponse(req Request) (*Response, error) { sConn := NewSplashConn( viper.GetString("SPLASH"), viper.GetInt("SPLASH_TIMEOUT"), viper.GetInt("SPLASH_RESOURCE_TIMEOUT"), viper.GetFloat64("SPLASH_WAIT"), ) splashURL := sConn.GenerateSplashURL(req) client := &http.Client{} request, err := http.NewRequest("GET", splashURL, nil) //req.SetBasicAuth(s.user, s.password) resp, err := client.Do(request) if resp != nil { defer resp.Body.Close() } if err != nil { return nil, err } res, err := ioutil.ReadAll(resp.Body) if err != nil { return nil, err } //response from Splash service. statusCode := resp.StatusCode if statusCode != 200 { switch statusCode { case 504: return nil, &errs.GatewayTimeout{} default: return nil, fmt.Errorf(string(res)) } } var sResponse Response if err := json.Unmarshal(res, &sResponse); err != nil { logger.Println("Json Unmarshall error", err) } //if response status code is not 200 if sResponse.Error != "" { switch sResponse.Error { case "http404": return nil, &errs.NotFound{sResponse.URL} case "http403": return nil, &errs.Forbidden{sResponse.URL} case "network3": return nil, &errs.InvalidHost{sResponse.URL} default: return nil, &errs.Error{sResponse.Error} } //return nil, fmt.Errorf("%s", sResponse.Error) } // Sometimes no response, request returned by Splash. // gc (garbage collection) method should be called to clear WebKit caches and then // GetResponse again. See more at https://github.com/scrapinghub/splash/issues/613 if sResponse.Response == nil || sResponse.Request == nil && sResponse.HTML != "" { var response *Response gcResponse, err := gc(viper.GetString("SPLASH")) if err == nil && gcResponse.Status == "ok" { response, err = GetResponse(req) if err != nil { return nil, err } } return response, nil } if !sResponse.Response.Ok { if sResponse.Response.Status == 0 { err = fmt.Errorf("%s", //sResponse.Error) sResponse.Response.StatusText) } else { err = fmt.Errorf("%d. %s", sResponse.Response.Status, sResponse.Response.StatusText) } return nil, err } //if cacheable ? rv := sResponse.cacheable() //logger.Println(rv.OutReasons) //logger.Println(rv.OutWarnings) //logger.Println(rv.OutExpirationTime) if len(rv.OutReasons) == 0 { sResponse.Cacheable = true } return &sResponse, nil } func (r *Response) GetContent() (io.ReadCloser, error) { if r == nil { return nil, errors.New("empty response") } if isRobotsTxt(r.Request.URL) { decoded, err := base64.StdEncoding.DecodeString(r.Response.Content.Text) if err != nil { logger.Println("decode error:", err) return nil, err } readCloser := ioutil.NopCloser(bytes.NewReader(decoded)) return readCloser, nil } readCloser := ioutil.NopCloser(strings.NewReader(r.HTML)) return readCloser, nil } //cacheable check if resource is cacheable func (r *Response) cacheable() (rv cacheobject.ObjectResults)
//Fetch content from url through Splash server https://github.com/scrapinghub/splash/ func Fetch(req Request) (io.ReadCloser, error) { //logger.Println(splashURL) response, err := GetResponse(req) if err != nil { return nil, err } logger.Println(err) content, err := response.GetContent() if err == nil { return content, nil } return nil, err } func (r Request) GetURL() string { return r.URL } func isRobotsTxt(url string) bool { if strings.HasSuffix(url, "robots.txt") { return true } return false } //http://choly.ca/post/go-json-marshalling/ //UnmarshalJSON convert headers to http.Header type func (r *Response) UnmarshalJSON(data []byte) error { type Alias Response aux := &struct { Headers interface{} `json:"headers"` *Alias }{ Alias: (*Alias)(r), } if err := json.Unmarshal(data, &aux); err != nil { return err } if r.Request != nil { r.Request.Headers = castHeaders(r.Request.Headers) } if r.Response != nil { r.Response.Headers = castHeaders(r.Response.Headers) } return nil } //castHeaders serves for casting headers returned by Splash to standard http.Header type func castHeaders(splashHeaders interface{}) (header http.Header) { header = make(map[string][]string) switch splashHeaders.(type) { case []interface{}: for _, h := range splashHeaders.([]interface{}) { //var str []string str := []string{} v, ok := h.(map[string]interface{})["value"].(string) if ok { str = append(str, v) header[h.(map[string]interface{})["name"].(string)] = str } } return header case map[string]interface{}: for k, v := range splashHeaders.(map[string]interface{}) { var str []string for _, vv := range v.([]interface{}) { str = append(str, vv.(string)) } header[k] = str } return header default: return nil } } //Splash splash:history() may return empty list as it cannot retrieve cached results //in case request the same page twice. So the only solution for the moment is to call //http://localhost:8050/_gc if an error occures. It runs the Python garbage collector //and clears internal WebKit caches. See more at https://github.com/scrapinghub/splash/issues/613 func gc(host string) (*gcResponse, error) { client := &http.Client{} gcURL := fmt.Sprintf("http://%s/_gc", host) req, err := http.NewRequest("POST", gcURL, nil) if err != nil { return nil, err } resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var gc gcResponse err = json.Unmarshal(buf.Bytes(), &gc) if err != nil { return nil, err } return &gc, nil } //Ping returns status and maxrss from _ping endpoint func Ping(host string) (*PingResponse, error) { client := &http.Client{} pingURL := fmt.Sprintf("http://%s/_ping", host) req, err := http.NewRequest("GET", pingURL, nil) if err != nil { return nil, err } //req.SetBasicAuth(userName, userPass) resp, err := client.Do(req) if err != nil { return nil, err } defer resp.Body.Close() buf := new(bytes.Buffer) buf.ReadFrom(resp.Body) var p PingResponse err = json.Unmarshal(buf.Bytes(), &p) if err != nil { return nil, err } return &p, nil }
{ respHeader := r.Response.Headers.(http.Header) reqHeader := r.Request.Headers.(http.Header) // respHeader := r.Response.castHeaders() // reqHeader := r.Request.castHeaders() reqDir, err := cacheobject.ParseRequestCacheControl(reqHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } resDir, err := cacheobject.ParseResponseCacheControl(respHeader.Get("Cache-Control")) if err != nil { logger.Printf(err.Error()) } //logger.Println(respHeader) expiresHeader, _ := http.ParseTime(respHeader.Get("Expires")) dateHeader, _ := http.ParseTime(respHeader.Get("Date")) lastModifiedHeader, _ := http.ParseTime(respHeader.Get("Last-Modified")) obj := cacheobject.Object{ // CacheIsPrivate: false, RespDirectives: resDir, RespHeaders: respHeader, RespStatusCode: r.Response.Status, RespExpiresHeader: expiresHeader, RespDateHeader: dateHeader, RespLastModifiedHeader: lastModifiedHeader, ReqDirectives: reqDir, ReqHeaders: reqHeader, ReqMethod: r.Request.Method, NowUTC: time.Now().UTC(), } rv = cacheobject.ObjectResults{} cacheobject.CachableObject(&obj, &rv) cacheobject.ExpirationObject(&obj, &rv) //Check if it is cacheable expTime := rv.OutExpirationTime.Unix() if rv.OutExpirationTime.IsZero() { expTime = 0 } r.CacheExpirationTime = expTime debug := false if debug { if rv.OutErr != nil { logger.Println("Errors: ", rv.OutErr) } if rv.OutReasons != nil { logger.Println("Reasons to not cache: ", rv.OutReasons) } if rv.OutWarnings != nil { logger.Println("Warning headers to add: ", rv.OutWarnings) } logger.Println("Expiration: ", rv.OutExpirationTime.String()) } return rv }
identifier_body
main.go
package main import ( "context" "crypto/rand" "crypto/sha1" "encoding/hex" "encoding/json" "errors" "fmt" "io/ioutil" "log" "net/http" "os" "regexp" "strconv" "strings" "time" "github.com/andygrunwald/go-gerrit" "github.com/google/go-github/github" "github.com/gregjones/httpcache" git "github.com/libgit2/git2go/v31" "golang.org/x/oauth2" ) var isDryRun bool = true const BOT_IDENT_TAG = "::SDKBOT/PR" func RedactEmail(email string) string { parts := strings.Split(email, "@") if len(parts) != 2 { return "REDACTION FAILED" } user := parts[0] domain := parts[1] userAllow := float32(len(user)) * 0.6 domainAllow := float32(len(domain)) * 0.7 userAllowSide := int(userAllow / 2) domainAllowSide := int(domainAllow / 2) userRightStart := len(user) - userAllowSide domainRightStart := len(domain) - domainAllowSide user = user[0:userAllowSide] + strings.Repeat("*", userRightStart-userAllowSide) + user[userRightStart:] domain = domain[0:domainAllowSide] + strings.Repeat("*", domainRightStart-domainAllowSide) + domain[domainRightStart:] return user + "@" + domain } func RandomChangeId() string { b := make([]byte, sha1.Size) rand.Read(b) encData := sha1.Sum(b) return "I" + hex.EncodeToString(encData[:]) } type subError struct { msg string err error } func (e subError) Error() string { if e.err != nil { return e.msg + ": " + e.err.Error() } else { return e.msg } } func makeErr(msg string, err error) error { return subError{msg, err} } func SquashHead(repo *git.Repository, squashCount int, mergeCommitTitle, changeId string) error { log.Printf("Generating squash commit for `HEAD~0` to `HEAD~%d`", squashCount) headRef, err := repo.Head() if err != nil { return makeErr("failed to get head reference", err) } topCommitId := headRef.Target() topCommit, err := repo.LookupCommit(topCommitId) if err != nil { return makeErr("failed to locate head commit", nil) } var baseCommit *git.Commit var squashCommits []*git.Commit { curCommit := topCommit for i := 0; i < squashCount; i++ { squashCommits = append(squashCommits, curCommit) curCommit = curCommit.Parent(0) } baseCommit = curCommit } log.Printf("Base Commit is `%s`", baseCommit.Id().String()) var newCommitAuthor *git.Signature var newCommitCommitter *git.Signature var newCommitMsg string if len(squashCommits) == 1 { newCommitAuthor = squashCommits[0].Author() newCommitCommitter = squashCommits[0].Committer() newCommitMsg = strings.TrimSpace(squashCommits[0].Message()) + "\n" } else { newCommitMsg = "" newCommitMsg += mergeCommitTitle + "\n\n" for i := 0; i < len(squashCommits); i++ { curCommit := squashCommits[i] newCommitMsg += "----\n" newCommitMsg += strings.TrimSpace(curCommit.Message()) + "\n" newCommitAuthor = curCommit.Author() newCommitCommitter = curCommit.Committer() } } newCommitMsg += "\nChange-Id: " + changeId err = repo.ResetToCommit(baseCommit, git.ResetSoft, nil) if err != nil { return makeErr("failed to reset to base commit", err) } idx, err := repo.Index() if err != nil { return makeErr("failed to retrieve repo index", err) } err = idx.Write() if err != nil { return makeErr("failed to write squash index", err) } newCommitTreeId, err := idx.WriteTree() if err != nil { return makeErr("failed to write squash tree", err) } newCommitTree, err := repo.LookupTree(newCommitTreeId) if err != nil { return makeErr("failed to find created squash tree", err) } log.Printf("Generated new commit message:\n%s", newCommitMsg) _, err = repo.CreateCommit("HEAD", newCommitAuthor, newCommitCommitter, newCommitMsg, newCommitTree, baseCommit) if err != nil { return makeErr("failed to generate squash commit", err) } return nil } type CsStateInfo struct { ChangeNum int ChangeId string Status string CurrentSha1 string } func GetChangesetState(owner, repo string, prnum int) (*CsStateInfo, error) { log.Printf("Retrieving change set for %s/%s/%d", owner, repo, prnum) path := fmt.Sprintf("github.com/%s/%s/pull/%d", owner, repo, prnum) changes, _, err := gerritClient.Changes.QueryChanges(&gerrit.QueryChangeOptions{ QueryOptions: gerrit.QueryOptions{ Query: []string{path}, }, ChangeOptions: gerrit.ChangeOptions{ AdditionalFields: []string{"messages"}, }, }) if err != nil { return nil, makeErr("failed to gerrit query for changes", err) } var foundChangeset *gerrit.ChangeInfo for i := 0; i < len(*changes); i++ { change := &(*changes)[i] for j := 0; j < len(change.Messages); j++ { if !strings.Contains(change.Messages[j].Message, BOT_IDENT_TAG) { continue } if strings.Contains(change.Messages[j].Message, path) { if foundChangeset != nil { return nil, makeErr("found multiple possible changesets", nil) } foundChangeset = change break } } } if foundChangeset == nil { return nil, nil } commitMatcher, err := regexp.Compile("commit:([0-9a-zA-Z]+)") if err != nil { return nil, makeErr("failed to compile commit sha1 finding regexp", err) } var latestSha1 string for i := 0; i < len(foundChangeset.Messages); i++ { commitMatches := commitMatcher.FindStringSubmatch(foundChangeset.Messages[i].Message) if len(commitMatches) == 2 { latestSha1 = commitMatches[1] } } return &CsStateInfo{ ChangeNum: foundChangeset.Number, ChangeId: foundChangeset.ChangeID, Status: foundChangeset.Status, CurrentSha1: latestSha1, }, nil } type RepoInfo struct { Owner string Name string Repo string } var botOwners []string var githubClient *github.Client var githubUser string var githubToken string var gerritClient *gerrit.Client var gerritHost string var gerritUser string var gerritPass string var gerritPublicKey string var gerritPrivateKey string var gerritClaGroupName string var allRepos []RepoInfo func gerritGitCredentialsHandler(url string, username_from_url string, allowed_types git.CredType) (*git.Cred, error) { creds, err := git.NewCredSshKey(gerritUser, gerritPublicKey, gerritPrivateKey, "") return creds, err } func initGerritClient() error { client, err := gerrit.NewClient("https://"+gerritHost+"/", nil) if err != nil { return makeErr("failed to create gerrit client", err) } client.Authentication.SetBasicAuth(gerritUser, gerritPass) gerritClient = client return nil } func initGitHubClient() error { tx := httpcache.NewMemoryCacheTransport() tc := &http.Client{ Transport: &oauth2.Transport{ Source: oauth2.StaticTokenSource( &oauth2.Token{AccessToken: githubToken}, ), Base: tx, }, } githubClient = github.NewClient(tc) return nil } type PrStateInfo struct { CurrentState string LastUpdatedTime time.Time CurrentSha1 string NumOfCommits int } func IsGitHubUserBot(user *github.User) bool { if user == nil || user.Login == nil { return false } if *user.Login == githubUser { return true } return false } func IsGitHubUserBotOwner(user *github.User) bool { if user == nil || user.Login == nil { return false } for i := 0; i < len(botOwners); i++ { if *user.Login == botOwners[i] { return true } } return IsGitHubUserBot(user) } const ( BOTSTATE_NEW = "" BOTSTATE_NO_CLA = "no_cla" BOTSTATE_CREATED = "created" BOTSTATE_UPDATED = "updated" BOTSTATE_ABANDONED = "abandoned" BOTSTATE_MERGED = "merged" BOTSTATE_TIMEOUT = "timeout" ) func GetPullRequestState(owner, repo string, prnum int) (*PrStateInfo, error) { var parseableStateNames = []string{ BOTSTATE_NO_CLA, BOTSTATE_CREATED, BOTSTATE_UPDATED, BOTSTATE_ABANDONED, BOTSTATE_MERGED, BOTSTATE_TIMEOUT, // backwards compatibility names "pushed", "too_many_commits", "closed", } log.Printf("Retrieving PR state for %s/%s/%d", owner, repo, prnum) info, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return nil, makeErr("failed to retieve pull request info", err) } comments, _, err := githubClient.Issues.ListComments(context.Background(), owner, repo, prnum, nil) if err != nil { return nil, makeErr("failed to retrieve pull request comments", err) } var lastStateTime time.Time var lastStateName string var lastUpdatedTime time.Time for i := 0; i < len(comments); i++ { if comments[i].CreatedAt.After(lastUpdatedTime) || comments[i].UpdatedAt.After(lastUpdatedTime) { lastUpdatedTime = *comments[i].UpdatedAt } if !IsGitHubUserBotOwner(comments[i].User) { continue } for j := 0; j < len(parseableStateNames); j++ { if strings.Contains(*comments[i].Body, BOT_IDENT_TAG+":"+parseableStateNames[j]) { if comments[i].CreatedAt.After(lastStateTime) { lastStateName = parseableStateNames[j] lastStateTime = *comments[i].CreatedAt } } } } // For backwards compat... if lastStateName == "too_many_commits" { lastStateName = BOTSTATE_NEW } else if lastStateName == "pushed" { lastStateName = BOTSTATE_UPDATED } else if lastStateName == "closed" { lastStateName = BOTSTATE_ABANDONED } if lastUpdatedTime.IsZero() { lastUpdatedTime = time.Now() } return &PrStateInfo{ CurrentState: lastStateName, LastUpdatedTime: lastUpdatedTime, CurrentSha1: *info.Head.SHA, NumOfCommits: *info.Commits, }, nil } func VerifyEmailCla(email string) (bool, error) { log.Printf("Verifying CLA signed for `%s`", email) if email == "" { return false, makeErr("you must specify a non-empty email", nil) } groups, _, err := gerritClient.Accounts.ListGroups(email) if err != nil { if strings.Contains(err.Error(), "Not Found") { log.Printf("Email was not found on Gerrit") return false, nil } log.Printf("An error occured trying to locate the user on Gerrit") return false, makeErr("failed to retrieve gerrit user groups", err) } hasClaGroup := false for i := 0; i < len(*groups); i++ { if (*groups)[i].Name == gerritClaGroupName { hasClaGroup = true } } if hasClaGroup { log.Printf("The user was located and has signed the CLA") } else { log.Printf("The user was located, but they did not sign the CLA") } return hasClaGroup, nil } func VerifyPrAuthorClas(owner, repo string, prnum int) (bool, []string, error) { log.Printf("Verifying CLA signed for PR %s/%s/%d", owner, repo, prnum) commits, _, err := githubClient.PullRequests.ListCommits(context.Background(), owner, repo, prnum, nil) if err != nil { return false, nil, makeErr("failed to retrieve pull request commits", err) } authorEmailMap := make(map[string]bool) for i := 0; i < len(commits); i++ { authorEmail := *commits[i].Commit.Author.Email authorEmailMap[authorEmail] = false } var emails []string for authorEmail := range authorEmailMap { emails = append(emails, authorEmail) } allSigned := true for authorEmail := range authorEmailMap { signed, err := VerifyEmailCla(authorEmail) if err != nil { return false, emails, err } if !signed { allSigned = false } } return allSigned, emails, nil } func SendPrStateCommentAndClose(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment and close for '%s' due to dry run.", state) return nil } newState := "closed" _, _, err := githubClient.PullRequests.Edit(context.Background(), owner, repo, prnum, &github.PullRequest{ State: &newState, }) if err != nil { return makeErr("failed to close pull request", err) } return SendPrStateComment(owner, repo, prnum, message, state, is_first) } func SendPrStateComment(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment for '%s' due to dry run.", state) return nil } var messageBody string if is_first { messageBody += "Thanks for the pull request!! To ensure quality review, Couchbase employs" messageBody += " a [code review system](http://review.couchbase.org/) based on" messageBody += " [Gerrit](https://www.gerritcodereview.com/) to manage the workflow of changes" messageBody += " in addition to tracking our contributor agreements.\n\n" } messageBody += strings.TrimSpace(message) messageBody += "\n\n" + BOT_IDENT_TAG + ":" + state _, _, err := githubClient.Issues.CreateComment(context.Background(), owner, repo, prnum, &github.IssueComment{ Body: &messageBody, }) if err != nil { return makeErr("failed to comment on pull request", err) } return nil } func SendClaText(owner, repo string, prnum int, state *PrStateInfo, emails []string) error { log.Printf("Sending no_cla for %s/%s/%d", owner, repo, prnum) message := "To get this change in and collaborate in code review, please register on Gerrit" message += " and accept our CLA. The easiest way to do this is to follow the link below," message += " sign in with your GitHub account and then follow through the steps provided" message += " on that page to sign an 'Individual' agreement:" message += " http://review.couchbase.org/#/settings/new-agreement." message += "\n\n" message += "Keep in mind that the emails we are seeing on the commits are: " for i, email := range emails { if i != 0 { message += ", " } message += "`" + RedactEmail(email) + "`" } message += "\n\n" message += "Note: Please contact us if you have any issues registering with Gerrit!" message += " If you have not signed our CLA within 7 days, the Pull Request will be" message += " automatically closed." return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_NO_CLA, state.CurrentState == BOTSTATE_NEW) } func SendPushedText(owner, repo string, prnum int, state *PrStateInfo, changeNum int) error { log.Printf("Sending pushed for %s/%s/%d", owner, repo, prnum) message := "Your changes (commit: " + state.CurrentSha1 + ") have been pushed to the Couchbase Review Site:\n" message += "http://review.couchbase.org/" + strconv.FormatInt(int64(changeNum), 10) if state.NumOfCommits > 1 { message += "\n\n" message += "Note: As your pull request contains multiple commits, we have" message += " performed an automatic squash of these commits into a single" message += " change-set. If this is not the desired behaviour, please" message += " consider submitting a pull request per discreet feature." } if state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_UPDATED, false) } else { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_CREATED, state.CurrentState == BOTSTATE_NEW) } } func ClosePrForTimeout(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to timeout for %s/%s/%d", owner, repo, prnum) message := "Unfortunately it has been 7 days and we are still unable to confirm that you" message += " have signed our CLA. We sincerely appreciate your submission and hope that" message += " you will register and resubmit this Pull Request in the future!" return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_TIMEOUT, state.CurrentState == BOTSTATE_NEW) } func ClosePrForMerge(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit merge for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was merged." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_MERGED, state.CurrentState == BOTSTATE_NEW) } func ClosePrForAbandon(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit abandon for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was abandoned." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_ABANDONED, state.CurrentState == BOTSTATE_NEW) } func GetGerritRepo(owner, repo string) string { return repo } func TransferPrToGerrit(owner, repo string, prnum int, prstate *PrStateInfo) error { log.Printf("Attempting to gerrit transfer PR %s/%s/%d %v", owner, repo, prnum, prstate) csstate, err := GetChangesetState(owner, repo, prnum) if err != nil { return err } if csstate != nil { if csstate.Status == "ABANDONED" { return ClosePrForAbandon(owner, repo, prnum, prstate) } if csstate.Status == "MERGED" { return ClosePrForMerge(owner, repo, prnum, prstate) } if csstate.CurrentSha1 == prstate.CurrentSha1 { // Already up to date! log.Printf("Nothing to do, already up to date.") return nil } } thisChangeId := RandomChangeId() if csstate != nil { thisChangeId = csstate.ChangeId } pr, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return makeErr("failed to request pull request data", err) } gitRepoPath := "/tmp/gtest" os.RemoveAll(gitRepoPath) gitRepo, err := git.Clone(*pr.Head.Repo.CloneURL, gitRepoPath, &git.CloneOptions{ CheckoutBranch: *pr.Head.Ref, }) if err != nil { return makeErr("failed to clone repository head", err) } err = SquashHead(gitRepo, *pr.Commits, *pr.Title, thisChangeId) if err != nil { return err } log.Printf("Generated squash commit with ChangeId `%s`", thisChangeId) if isDryRun { log.Printf("Skipping remote push and comment due to dry run.") return nil } reviewRemote, err := gitRepo.Remotes.Create("review", "ssh://"+gerritUser+"@"+gerritHost+":29418/"+GetGerritRepo(owner, repo)) if err != nil { return makeErr("failed to add gerrit as a remote", err) } log.Printf("Assigned remote.") statusText := "" err = reviewRemote.Push([]string{"HEAD:refs/for/master"}, &git.PushOptions{ RemoteCallbacks: git.RemoteCallbacks{ PushUpdateReferenceCallback: func(refname, status string) git.ErrorCode { statusText = status return 0 }, CredentialsCallback: gerritGitCredentialsHandler, CertificateCheckCallback: func(cert *git.Certificate, valid bool, hostname string) git.ErrorCode { return 0 }, }, }) if err != nil { return makeErr("failed to push to gerrit", err) } log.Printf("Successfully pushed to Gerrit with status `%s`", statusText) if statusText != "" { if statusText == "no new changes" && prstate != nil && (prstate.CurrentState == BOTSTATE_CREATED || prstate.CurrentState == BOTSTATE_UPDATED) { // Nothing changed return nil } return makeErr("failed to upload to gerrit", errors.New(statusText)) } var reviewMessage string reviewMessage += fmt.Sprintf("Change-Set generated from https://github.com/%s/%s/pull/%d (commit:%s).", owner, repo, prnum, *pr.Head.SHA) reviewMessage += "\n" + BOT_IDENT_TAG _, _, err = gerritClient.Changes.SetReview(thisChangeId, "current", &gerrit.ReviewInput{ Message: reviewMessage, }) if err != nil { return makeErr("failed to publish comment to gerrit", err) } if csstate == nil { csstate, err = GetChangesetState(owner, repo, prnum) if err != nil { return makeErr("failed to retrieve updated change from gerrit", err) } if csstate == nil { return makeErr("could not locate pushed change on gerrit", err) } } err = SendPushedText(owner, repo, prnum, prstate, csstate.ChangeNum) if err != nil { return err } return nil } func ProcessPullRequest(owner, repo string, prnum int, noCheckCla bool) error { state, err := GetPullRequestState(owner, repo, prnum) if err != nil { return err } if state.CurrentState == BOTSTATE_ABANDONED || state.CurrentState == BOTSTATE_TIMEOUT || state.CurrentState == BOTSTATE_MERGED { // That's odd... This ticket should not even be open... // Let's do nothing in case someone intentionally reopened it. return nil } if state.CurrentState == BOTSTATE_NEW || state.CurrentState == BOTSTATE_NO_CLA || state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { // Check CLA allSigned, authorEmails, err := VerifyPrAuthorClas(owner, repo, prnum) if err != nil { return err } if noCheckCla { log.Printf("Skipping no_cla warning for this pull request.") allSigned = true } if !allSigned { if state.CurrentState == BOTSTATE_NO_CLA { // If we already sent the no_cla message, lets not do it again, // instead we should check if this is now timed out... if time.Now().After(state.LastUpdatedTime.Add(10 * 24 * time.Hour)) { return ClosePrForTimeout(owner, repo, prnum, state) } log.Printf("Skipping this pull request as no_cla was already sent.") return nil } return SendClaText(owner, repo, prnum, state, authorEmails) } else { // Need to do normal process return TransferPrToGerrit(owner, repo, prnum, state) } } return makeErr("unexpected pull request state", nil) } func ProcessProject(owner, repo string) error { log.Printf("Processing project %s/%s", owner, repo) prs, _, err := githubClient.PullRequests.List(context.Background(), owner, repo, &github.PullRequestListOptions{ State: "open", }) if err != nil { return makeErr("failed to list all pull requests", err) } for i := 0; i < len(prs); i++ { prNum := *prs[i].Number log.Printf("Processing pull request %d", prNum) err := ProcessPullRequest(owner, repo, prNum, false) if err != nil
} log.Printf("Processed project %s/%s", owner, repo) return nil } func ProcessAllProjects() error { log.Printf("Processing all projects") for i := 0; i < len(allRepos); i++ { thisRepo := allRepos[i] err := ProcessProject(thisRepo.Owner, thisRepo.Name) if err != nil { return err } } log.Printf("Processed all projects") return nil } func initClients() error { _, err := os.Stat(gerritPrivateKey) if err != nil { return makeErr("failed to locate gerrit private key", err) } _, err = os.Stat(gerritPublicKey) if err != nil { return makeErr("failed to locate gerrit public key", err) } err = initGerritClient() if err != nil { return err } err = initGitHubClient() if err != nil { return err } return nil } func readConfig() error { configBytes, err := ioutil.ReadFile("./config.json") if err != nil { return makeErr("failed to read config file at `./config.json`", err) } var configData struct { DryRun bool GitHub struct { User string Token string Owners []string } Gerrit struct { Host string User string Pass string Keys struct { Public string Private string } ClaGroupName string } Repos []struct { Owner string Name string Repo string } } err = json.Unmarshal(configBytes, &configData) if err != nil { return makeErr("failed to parse config file", err) } isDryRun = configData.DryRun botOwners = configData.GitHub.Owners githubUser = configData.GitHub.User githubToken = configData.GitHub.Token gerritHost = configData.Gerrit.Host gerritUser = configData.Gerrit.User gerritPass = configData.Gerrit.Pass gerritPublicKey = configData.Gerrit.Keys.Public gerritPrivateKey = configData.Gerrit.Keys.Private gerritClaGroupName = configData.Gerrit.ClaGroupName allRepos = nil for i := 0; i < len(configData.Repos); i++ { allRepos = append(allRepos, RepoInfo{ Owner: configData.Repos[i].Owner, Name: configData.Repos[i].Name, Repo: configData.Repos[i].Repo, }) } return nil } func githubHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received GitHub webhook") var data github.WebHookPayload decoder := json.NewDecoder(r.Body) err := decoder.Decode(&data) if err != nil { log.Printf("Failed to parse GitHub data %+v", err) return } fmt.Fprintf(w, "success") if data.Repo == nil || data.Repo.Owner == nil { // No repository data in the webhook return } if data.Sender != nil && IsGitHubUserBot(data.Sender) { // Ignore hooks triggered by the bot itself. return } ownerName := *data.Repo.Owner.Login repoName := *data.Repo.Name go func() { err := ProcessProject(ownerName, repoName) if err != nil { log.Printf("githubHttpHandler error: %+v\n", err) } }() } func gerritHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Gerrit webhook") fmt.Fprintf(w, "success") go func() { err := ProcessAllProjects() if err != nil { log.Printf("gerritHttpHandler error: %+v\n", err) } }() } func forceCheckHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Check request") fmt.Fprintf(w, "Running!") go func() { err := ProcessAllProjects() if err != nil { log.Printf("forceCheckHttpHandler error: %+v\n", err) } }() } func forceTransferHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Transfer request") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { err = ProcessPullRequest(owner, repo, prnumParsed, true) } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } fmt.Fprintf(w, "success") } func checkClaHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Check CLA Request") var target string var err error var res bool email := r.FormValue("email") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") if email != "" { target = email res, err = VerifyEmailCla(email) } else if owner != "" && repo != "" { prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { target = fmt.Sprintf("github.com/%s/%s/%d", owner, repo, prnumParsed) res, _, err = VerifyPrAuthorClas(owner, repo, prnumParsed) } } else { fmt.Fprintf(w, "You must specify either an email or owner/repo/prnum.") return } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } resText := "NOT SIGNED" if res { resText = "signed" } fmt.Fprintf(w, "CLA Status for `%s` is: %s\n", target, resText) } func proxyRepoStats(w http.ResponseWriter, r *http.Request) { log.Printf("Received Proxy Repo Stats Request") owner := r.FormValue("owner") repo := r.FormValue("repo") clones, _, err := githubClient.Repositories.ListTrafficClones(context.Background(), owner, repo, &github.TrafficBreakdownOptions{ Per: "day", }) if err != nil { fmt.Fprintf(w, "Error: %s", err) return } jsonWriter := json.NewEncoder(w) jsonWriter.Encode(clones) } func rootHttpHandler(w http.ResponseWriter, r *http.Request) { fmt.Fprintf(w, "This is just a bot...") } func main() { log.Printf("Reading configuration...") err := readConfig() if err != nil { log.Printf("Failed to initalize configuration:") log.Printf("%+v", err) return } log.Printf("Initializing API clients...") err = initClients() if err != nil { log.Printf("Failed to initalize clients:") log.Printf("%+v", err) return } log.Printf("Starting web server on :4455...") http.HandleFunc("/", rootHttpHandler) http.HandleFunc("/github", githubHttpHandler) http.HandleFunc("/gerrit", gerritHttpHandler) http.HandleFunc("/forcecheck", forceCheckHttpHandler) http.HandleFunc("/forcetransfer", forceTransferHandler) http.HandleFunc("/checkcla", checkClaHttpHandler) http.HandleFunc("/repostats", proxyRepoStats) err = http.ListenAndServe(":4455", nil) if err != nil { log.Printf("Failed to start http listening.") log.Printf("%+v", err) return } /* ownerName := "couchbase" repoName := "couchnode" prNum := 0 if prNum > 0 { err = ProcessPullRequest(ownerName, repoName, prNum) } else { err = ProcessProject(ownerName, repoName) } if err != nil { log.Printf("An error occured during processing:") log.Printf("%+v", err) } */ }
{ return err }
conditional_block
main.go
package main import ( "context" "crypto/rand" "crypto/sha1" "encoding/hex" "encoding/json" "errors" "fmt" "io/ioutil" "log" "net/http" "os" "regexp" "strconv" "strings" "time" "github.com/andygrunwald/go-gerrit" "github.com/google/go-github/github" "github.com/gregjones/httpcache" git "github.com/libgit2/git2go/v31" "golang.org/x/oauth2" ) var isDryRun bool = true const BOT_IDENT_TAG = "::SDKBOT/PR" func RedactEmail(email string) string { parts := strings.Split(email, "@") if len(parts) != 2 { return "REDACTION FAILED" } user := parts[0] domain := parts[1] userAllow := float32(len(user)) * 0.6 domainAllow := float32(len(domain)) * 0.7 userAllowSide := int(userAllow / 2) domainAllowSide := int(domainAllow / 2) userRightStart := len(user) - userAllowSide domainRightStart := len(domain) - domainAllowSide user = user[0:userAllowSide] + strings.Repeat("*", userRightStart-userAllowSide) + user[userRightStart:] domain = domain[0:domainAllowSide] + strings.Repeat("*", domainRightStart-domainAllowSide) + domain[domainRightStart:] return user + "@" + domain } func RandomChangeId() string
type subError struct { msg string err error } func (e subError) Error() string { if e.err != nil { return e.msg + ": " + e.err.Error() } else { return e.msg } } func makeErr(msg string, err error) error { return subError{msg, err} } func SquashHead(repo *git.Repository, squashCount int, mergeCommitTitle, changeId string) error { log.Printf("Generating squash commit for `HEAD~0` to `HEAD~%d`", squashCount) headRef, err := repo.Head() if err != nil { return makeErr("failed to get head reference", err) } topCommitId := headRef.Target() topCommit, err := repo.LookupCommit(topCommitId) if err != nil { return makeErr("failed to locate head commit", nil) } var baseCommit *git.Commit var squashCommits []*git.Commit { curCommit := topCommit for i := 0; i < squashCount; i++ { squashCommits = append(squashCommits, curCommit) curCommit = curCommit.Parent(0) } baseCommit = curCommit } log.Printf("Base Commit is `%s`", baseCommit.Id().String()) var newCommitAuthor *git.Signature var newCommitCommitter *git.Signature var newCommitMsg string if len(squashCommits) == 1 { newCommitAuthor = squashCommits[0].Author() newCommitCommitter = squashCommits[0].Committer() newCommitMsg = strings.TrimSpace(squashCommits[0].Message()) + "\n" } else { newCommitMsg = "" newCommitMsg += mergeCommitTitle + "\n\n" for i := 0; i < len(squashCommits); i++ { curCommit := squashCommits[i] newCommitMsg += "----\n" newCommitMsg += strings.TrimSpace(curCommit.Message()) + "\n" newCommitAuthor = curCommit.Author() newCommitCommitter = curCommit.Committer() } } newCommitMsg += "\nChange-Id: " + changeId err = repo.ResetToCommit(baseCommit, git.ResetSoft, nil) if err != nil { return makeErr("failed to reset to base commit", err) } idx, err := repo.Index() if err != nil { return makeErr("failed to retrieve repo index", err) } err = idx.Write() if err != nil { return makeErr("failed to write squash index", err) } newCommitTreeId, err := idx.WriteTree() if err != nil { return makeErr("failed to write squash tree", err) } newCommitTree, err := repo.LookupTree(newCommitTreeId) if err != nil { return makeErr("failed to find created squash tree", err) } log.Printf("Generated new commit message:\n%s", newCommitMsg) _, err = repo.CreateCommit("HEAD", newCommitAuthor, newCommitCommitter, newCommitMsg, newCommitTree, baseCommit) if err != nil { return makeErr("failed to generate squash commit", err) } return nil } type CsStateInfo struct { ChangeNum int ChangeId string Status string CurrentSha1 string } func GetChangesetState(owner, repo string, prnum int) (*CsStateInfo, error) { log.Printf("Retrieving change set for %s/%s/%d", owner, repo, prnum) path := fmt.Sprintf("github.com/%s/%s/pull/%d", owner, repo, prnum) changes, _, err := gerritClient.Changes.QueryChanges(&gerrit.QueryChangeOptions{ QueryOptions: gerrit.QueryOptions{ Query: []string{path}, }, ChangeOptions: gerrit.ChangeOptions{ AdditionalFields: []string{"messages"}, }, }) if err != nil { return nil, makeErr("failed to gerrit query for changes", err) } var foundChangeset *gerrit.ChangeInfo for i := 0; i < len(*changes); i++ { change := &(*changes)[i] for j := 0; j < len(change.Messages); j++ { if !strings.Contains(change.Messages[j].Message, BOT_IDENT_TAG) { continue } if strings.Contains(change.Messages[j].Message, path) { if foundChangeset != nil { return nil, makeErr("found multiple possible changesets", nil) } foundChangeset = change break } } } if foundChangeset == nil { return nil, nil } commitMatcher, err := regexp.Compile("commit:([0-9a-zA-Z]+)") if err != nil { return nil, makeErr("failed to compile commit sha1 finding regexp", err) } var latestSha1 string for i := 0; i < len(foundChangeset.Messages); i++ { commitMatches := commitMatcher.FindStringSubmatch(foundChangeset.Messages[i].Message) if len(commitMatches) == 2 { latestSha1 = commitMatches[1] } } return &CsStateInfo{ ChangeNum: foundChangeset.Number, ChangeId: foundChangeset.ChangeID, Status: foundChangeset.Status, CurrentSha1: latestSha1, }, nil } type RepoInfo struct { Owner string Name string Repo string } var botOwners []string var githubClient *github.Client var githubUser string var githubToken string var gerritClient *gerrit.Client var gerritHost string var gerritUser string var gerritPass string var gerritPublicKey string var gerritPrivateKey string var gerritClaGroupName string var allRepos []RepoInfo func gerritGitCredentialsHandler(url string, username_from_url string, allowed_types git.CredType) (*git.Cred, error) { creds, err := git.NewCredSshKey(gerritUser, gerritPublicKey, gerritPrivateKey, "") return creds, err } func initGerritClient() error { client, err := gerrit.NewClient("https://"+gerritHost+"/", nil) if err != nil { return makeErr("failed to create gerrit client", err) } client.Authentication.SetBasicAuth(gerritUser, gerritPass) gerritClient = client return nil } func initGitHubClient() error { tx := httpcache.NewMemoryCacheTransport() tc := &http.Client{ Transport: &oauth2.Transport{ Source: oauth2.StaticTokenSource( &oauth2.Token{AccessToken: githubToken}, ), Base: tx, }, } githubClient = github.NewClient(tc) return nil } type PrStateInfo struct { CurrentState string LastUpdatedTime time.Time CurrentSha1 string NumOfCommits int } func IsGitHubUserBot(user *github.User) bool { if user == nil || user.Login == nil { return false } if *user.Login == githubUser { return true } return false } func IsGitHubUserBotOwner(user *github.User) bool { if user == nil || user.Login == nil { return false } for i := 0; i < len(botOwners); i++ { if *user.Login == botOwners[i] { return true } } return IsGitHubUserBot(user) } const ( BOTSTATE_NEW = "" BOTSTATE_NO_CLA = "no_cla" BOTSTATE_CREATED = "created" BOTSTATE_UPDATED = "updated" BOTSTATE_ABANDONED = "abandoned" BOTSTATE_MERGED = "merged" BOTSTATE_TIMEOUT = "timeout" ) func GetPullRequestState(owner, repo string, prnum int) (*PrStateInfo, error) { var parseableStateNames = []string{ BOTSTATE_NO_CLA, BOTSTATE_CREATED, BOTSTATE_UPDATED, BOTSTATE_ABANDONED, BOTSTATE_MERGED, BOTSTATE_TIMEOUT, // backwards compatibility names "pushed", "too_many_commits", "closed", } log.Printf("Retrieving PR state for %s/%s/%d", owner, repo, prnum) info, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return nil, makeErr("failed to retieve pull request info", err) } comments, _, err := githubClient.Issues.ListComments(context.Background(), owner, repo, prnum, nil) if err != nil { return nil, makeErr("failed to retrieve pull request comments", err) } var lastStateTime time.Time var lastStateName string var lastUpdatedTime time.Time for i := 0; i < len(comments); i++ { if comments[i].CreatedAt.After(lastUpdatedTime) || comments[i].UpdatedAt.After(lastUpdatedTime) { lastUpdatedTime = *comments[i].UpdatedAt } if !IsGitHubUserBotOwner(comments[i].User) { continue } for j := 0; j < len(parseableStateNames); j++ { if strings.Contains(*comments[i].Body, BOT_IDENT_TAG+":"+parseableStateNames[j]) { if comments[i].CreatedAt.After(lastStateTime) { lastStateName = parseableStateNames[j] lastStateTime = *comments[i].CreatedAt } } } } // For backwards compat... if lastStateName == "too_many_commits" { lastStateName = BOTSTATE_NEW } else if lastStateName == "pushed" { lastStateName = BOTSTATE_UPDATED } else if lastStateName == "closed" { lastStateName = BOTSTATE_ABANDONED } if lastUpdatedTime.IsZero() { lastUpdatedTime = time.Now() } return &PrStateInfo{ CurrentState: lastStateName, LastUpdatedTime: lastUpdatedTime, CurrentSha1: *info.Head.SHA, NumOfCommits: *info.Commits, }, nil } func VerifyEmailCla(email string) (bool, error) { log.Printf("Verifying CLA signed for `%s`", email) if email == "" { return false, makeErr("you must specify a non-empty email", nil) } groups, _, err := gerritClient.Accounts.ListGroups(email) if err != nil { if strings.Contains(err.Error(), "Not Found") { log.Printf("Email was not found on Gerrit") return false, nil } log.Printf("An error occured trying to locate the user on Gerrit") return false, makeErr("failed to retrieve gerrit user groups", err) } hasClaGroup := false for i := 0; i < len(*groups); i++ { if (*groups)[i].Name == gerritClaGroupName { hasClaGroup = true } } if hasClaGroup { log.Printf("The user was located and has signed the CLA") } else { log.Printf("The user was located, but they did not sign the CLA") } return hasClaGroup, nil } func VerifyPrAuthorClas(owner, repo string, prnum int) (bool, []string, error) { log.Printf("Verifying CLA signed for PR %s/%s/%d", owner, repo, prnum) commits, _, err := githubClient.PullRequests.ListCommits(context.Background(), owner, repo, prnum, nil) if err != nil { return false, nil, makeErr("failed to retrieve pull request commits", err) } authorEmailMap := make(map[string]bool) for i := 0; i < len(commits); i++ { authorEmail := *commits[i].Commit.Author.Email authorEmailMap[authorEmail] = false } var emails []string for authorEmail := range authorEmailMap { emails = append(emails, authorEmail) } allSigned := true for authorEmail := range authorEmailMap { signed, err := VerifyEmailCla(authorEmail) if err != nil { return false, emails, err } if !signed { allSigned = false } } return allSigned, emails, nil } func SendPrStateCommentAndClose(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment and close for '%s' due to dry run.", state) return nil } newState := "closed" _, _, err := githubClient.PullRequests.Edit(context.Background(), owner, repo, prnum, &github.PullRequest{ State: &newState, }) if err != nil { return makeErr("failed to close pull request", err) } return SendPrStateComment(owner, repo, prnum, message, state, is_first) } func SendPrStateComment(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment for '%s' due to dry run.", state) return nil } var messageBody string if is_first { messageBody += "Thanks for the pull request!! To ensure quality review, Couchbase employs" messageBody += " a [code review system](http://review.couchbase.org/) based on" messageBody += " [Gerrit](https://www.gerritcodereview.com/) to manage the workflow of changes" messageBody += " in addition to tracking our contributor agreements.\n\n" } messageBody += strings.TrimSpace(message) messageBody += "\n\n" + BOT_IDENT_TAG + ":" + state _, _, err := githubClient.Issues.CreateComment(context.Background(), owner, repo, prnum, &github.IssueComment{ Body: &messageBody, }) if err != nil { return makeErr("failed to comment on pull request", err) } return nil } func SendClaText(owner, repo string, prnum int, state *PrStateInfo, emails []string) error { log.Printf("Sending no_cla for %s/%s/%d", owner, repo, prnum) message := "To get this change in and collaborate in code review, please register on Gerrit" message += " and accept our CLA. The easiest way to do this is to follow the link below," message += " sign in with your GitHub account and then follow through the steps provided" message += " on that page to sign an 'Individual' agreement:" message += " http://review.couchbase.org/#/settings/new-agreement." message += "\n\n" message += "Keep in mind that the emails we are seeing on the commits are: " for i, email := range emails { if i != 0 { message += ", " } message += "`" + RedactEmail(email) + "`" } message += "\n\n" message += "Note: Please contact us if you have any issues registering with Gerrit!" message += " If you have not signed our CLA within 7 days, the Pull Request will be" message += " automatically closed." return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_NO_CLA, state.CurrentState == BOTSTATE_NEW) } func SendPushedText(owner, repo string, prnum int, state *PrStateInfo, changeNum int) error { log.Printf("Sending pushed for %s/%s/%d", owner, repo, prnum) message := "Your changes (commit: " + state.CurrentSha1 + ") have been pushed to the Couchbase Review Site:\n" message += "http://review.couchbase.org/" + strconv.FormatInt(int64(changeNum), 10) if state.NumOfCommits > 1 { message += "\n\n" message += "Note: As your pull request contains multiple commits, we have" message += " performed an automatic squash of these commits into a single" message += " change-set. If this is not the desired behaviour, please" message += " consider submitting a pull request per discreet feature." } if state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_UPDATED, false) } else { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_CREATED, state.CurrentState == BOTSTATE_NEW) } } func ClosePrForTimeout(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to timeout for %s/%s/%d", owner, repo, prnum) message := "Unfortunately it has been 7 days and we are still unable to confirm that you" message += " have signed our CLA. We sincerely appreciate your submission and hope that" message += " you will register and resubmit this Pull Request in the future!" return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_TIMEOUT, state.CurrentState == BOTSTATE_NEW) } func ClosePrForMerge(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit merge for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was merged." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_MERGED, state.CurrentState == BOTSTATE_NEW) } func ClosePrForAbandon(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit abandon for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was abandoned." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_ABANDONED, state.CurrentState == BOTSTATE_NEW) } func GetGerritRepo(owner, repo string) string { return repo } func TransferPrToGerrit(owner, repo string, prnum int, prstate *PrStateInfo) error { log.Printf("Attempting to gerrit transfer PR %s/%s/%d %v", owner, repo, prnum, prstate) csstate, err := GetChangesetState(owner, repo, prnum) if err != nil { return err } if csstate != nil { if csstate.Status == "ABANDONED" { return ClosePrForAbandon(owner, repo, prnum, prstate) } if csstate.Status == "MERGED" { return ClosePrForMerge(owner, repo, prnum, prstate) } if csstate.CurrentSha1 == prstate.CurrentSha1 { // Already up to date! log.Printf("Nothing to do, already up to date.") return nil } } thisChangeId := RandomChangeId() if csstate != nil { thisChangeId = csstate.ChangeId } pr, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return makeErr("failed to request pull request data", err) } gitRepoPath := "/tmp/gtest" os.RemoveAll(gitRepoPath) gitRepo, err := git.Clone(*pr.Head.Repo.CloneURL, gitRepoPath, &git.CloneOptions{ CheckoutBranch: *pr.Head.Ref, }) if err != nil { return makeErr("failed to clone repository head", err) } err = SquashHead(gitRepo, *pr.Commits, *pr.Title, thisChangeId) if err != nil { return err } log.Printf("Generated squash commit with ChangeId `%s`", thisChangeId) if isDryRun { log.Printf("Skipping remote push and comment due to dry run.") return nil } reviewRemote, err := gitRepo.Remotes.Create("review", "ssh://"+gerritUser+"@"+gerritHost+":29418/"+GetGerritRepo(owner, repo)) if err != nil { return makeErr("failed to add gerrit as a remote", err) } log.Printf("Assigned remote.") statusText := "" err = reviewRemote.Push([]string{"HEAD:refs/for/master"}, &git.PushOptions{ RemoteCallbacks: git.RemoteCallbacks{ PushUpdateReferenceCallback: func(refname, status string) git.ErrorCode { statusText = status return 0 }, CredentialsCallback: gerritGitCredentialsHandler, CertificateCheckCallback: func(cert *git.Certificate, valid bool, hostname string) git.ErrorCode { return 0 }, }, }) if err != nil { return makeErr("failed to push to gerrit", err) } log.Printf("Successfully pushed to Gerrit with status `%s`", statusText) if statusText != "" { if statusText == "no new changes" && prstate != nil && (prstate.CurrentState == BOTSTATE_CREATED || prstate.CurrentState == BOTSTATE_UPDATED) { // Nothing changed return nil } return makeErr("failed to upload to gerrit", errors.New(statusText)) } var reviewMessage string reviewMessage += fmt.Sprintf("Change-Set generated from https://github.com/%s/%s/pull/%d (commit:%s).", owner, repo, prnum, *pr.Head.SHA) reviewMessage += "\n" + BOT_IDENT_TAG _, _, err = gerritClient.Changes.SetReview(thisChangeId, "current", &gerrit.ReviewInput{ Message: reviewMessage, }) if err != nil { return makeErr("failed to publish comment to gerrit", err) } if csstate == nil { csstate, err = GetChangesetState(owner, repo, prnum) if err != nil { return makeErr("failed to retrieve updated change from gerrit", err) } if csstate == nil { return makeErr("could not locate pushed change on gerrit", err) } } err = SendPushedText(owner, repo, prnum, prstate, csstate.ChangeNum) if err != nil { return err } return nil } func ProcessPullRequest(owner, repo string, prnum int, noCheckCla bool) error { state, err := GetPullRequestState(owner, repo, prnum) if err != nil { return err } if state.CurrentState == BOTSTATE_ABANDONED || state.CurrentState == BOTSTATE_TIMEOUT || state.CurrentState == BOTSTATE_MERGED { // That's odd... This ticket should not even be open... // Let's do nothing in case someone intentionally reopened it. return nil } if state.CurrentState == BOTSTATE_NEW || state.CurrentState == BOTSTATE_NO_CLA || state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { // Check CLA allSigned, authorEmails, err := VerifyPrAuthorClas(owner, repo, prnum) if err != nil { return err } if noCheckCla { log.Printf("Skipping no_cla warning for this pull request.") allSigned = true } if !allSigned { if state.CurrentState == BOTSTATE_NO_CLA { // If we already sent the no_cla message, lets not do it again, // instead we should check if this is now timed out... if time.Now().After(state.LastUpdatedTime.Add(10 * 24 * time.Hour)) { return ClosePrForTimeout(owner, repo, prnum, state) } log.Printf("Skipping this pull request as no_cla was already sent.") return nil } return SendClaText(owner, repo, prnum, state, authorEmails) } else { // Need to do normal process return TransferPrToGerrit(owner, repo, prnum, state) } } return makeErr("unexpected pull request state", nil) } func ProcessProject(owner, repo string) error { log.Printf("Processing project %s/%s", owner, repo) prs, _, err := githubClient.PullRequests.List(context.Background(), owner, repo, &github.PullRequestListOptions{ State: "open", }) if err != nil { return makeErr("failed to list all pull requests", err) } for i := 0; i < len(prs); i++ { prNum := *prs[i].Number log.Printf("Processing pull request %d", prNum) err := ProcessPullRequest(owner, repo, prNum, false) if err != nil { return err } } log.Printf("Processed project %s/%s", owner, repo) return nil } func ProcessAllProjects() error { log.Printf("Processing all projects") for i := 0; i < len(allRepos); i++ { thisRepo := allRepos[i] err := ProcessProject(thisRepo.Owner, thisRepo.Name) if err != nil { return err } } log.Printf("Processed all projects") return nil } func initClients() error { _, err := os.Stat(gerritPrivateKey) if err != nil { return makeErr("failed to locate gerrit private key", err) } _, err = os.Stat(gerritPublicKey) if err != nil { return makeErr("failed to locate gerrit public key", err) } err = initGerritClient() if err != nil { return err } err = initGitHubClient() if err != nil { return err } return nil } func readConfig() error { configBytes, err := ioutil.ReadFile("./config.json") if err != nil { return makeErr("failed to read config file at `./config.json`", err) } var configData struct { DryRun bool GitHub struct { User string Token string Owners []string } Gerrit struct { Host string User string Pass string Keys struct { Public string Private string } ClaGroupName string } Repos []struct { Owner string Name string Repo string } } err = json.Unmarshal(configBytes, &configData) if err != nil { return makeErr("failed to parse config file", err) } isDryRun = configData.DryRun botOwners = configData.GitHub.Owners githubUser = configData.GitHub.User githubToken = configData.GitHub.Token gerritHost = configData.Gerrit.Host gerritUser = configData.Gerrit.User gerritPass = configData.Gerrit.Pass gerritPublicKey = configData.Gerrit.Keys.Public gerritPrivateKey = configData.Gerrit.Keys.Private gerritClaGroupName = configData.Gerrit.ClaGroupName allRepos = nil for i := 0; i < len(configData.Repos); i++ { allRepos = append(allRepos, RepoInfo{ Owner: configData.Repos[i].Owner, Name: configData.Repos[i].Name, Repo: configData.Repos[i].Repo, }) } return nil } func githubHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received GitHub webhook") var data github.WebHookPayload decoder := json.NewDecoder(r.Body) err := decoder.Decode(&data) if err != nil { log.Printf("Failed to parse GitHub data %+v", err) return } fmt.Fprintf(w, "success") if data.Repo == nil || data.Repo.Owner == nil { // No repository data in the webhook return } if data.Sender != nil && IsGitHubUserBot(data.Sender) { // Ignore hooks triggered by the bot itself. return } ownerName := *data.Repo.Owner.Login repoName := *data.Repo.Name go func() { err := ProcessProject(ownerName, repoName) if err != nil { log.Printf("githubHttpHandler error: %+v\n", err) } }() } func gerritHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Gerrit webhook") fmt.Fprintf(w, "success") go func() { err := ProcessAllProjects() if err != nil { log.Printf("gerritHttpHandler error: %+v\n", err) } }() } func forceCheckHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Check request") fmt.Fprintf(w, "Running!") go func() { err := ProcessAllProjects() if err != nil { log.Printf("forceCheckHttpHandler error: %+v\n", err) } }() } func forceTransferHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Transfer request") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { err = ProcessPullRequest(owner, repo, prnumParsed, true) } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } fmt.Fprintf(w, "success") } func checkClaHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Check CLA Request") var target string var err error var res bool email := r.FormValue("email") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") if email != "" { target = email res, err = VerifyEmailCla(email) } else if owner != "" && repo != "" { prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { target = fmt.Sprintf("github.com/%s/%s/%d", owner, repo, prnumParsed) res, _, err = VerifyPrAuthorClas(owner, repo, prnumParsed) } } else { fmt.Fprintf(w, "You must specify either an email or owner/repo/prnum.") return } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } resText := "NOT SIGNED" if res { resText = "signed" } fmt.Fprintf(w, "CLA Status for `%s` is: %s\n", target, resText) } func proxyRepoStats(w http.ResponseWriter, r *http.Request) { log.Printf("Received Proxy Repo Stats Request") owner := r.FormValue("owner") repo := r.FormValue("repo") clones, _, err := githubClient.Repositories.ListTrafficClones(context.Background(), owner, repo, &github.TrafficBreakdownOptions{ Per: "day", }) if err != nil { fmt.Fprintf(w, "Error: %s", err) return } jsonWriter := json.NewEncoder(w) jsonWriter.Encode(clones) } func rootHttpHandler(w http.ResponseWriter, r *http.Request) { fmt.Fprintf(w, "This is just a bot...") } func main() { log.Printf("Reading configuration...") err := readConfig() if err != nil { log.Printf("Failed to initalize configuration:") log.Printf("%+v", err) return } log.Printf("Initializing API clients...") err = initClients() if err != nil { log.Printf("Failed to initalize clients:") log.Printf("%+v", err) return } log.Printf("Starting web server on :4455...") http.HandleFunc("/", rootHttpHandler) http.HandleFunc("/github", githubHttpHandler) http.HandleFunc("/gerrit", gerritHttpHandler) http.HandleFunc("/forcecheck", forceCheckHttpHandler) http.HandleFunc("/forcetransfer", forceTransferHandler) http.HandleFunc("/checkcla", checkClaHttpHandler) http.HandleFunc("/repostats", proxyRepoStats) err = http.ListenAndServe(":4455", nil) if err != nil { log.Printf("Failed to start http listening.") log.Printf("%+v", err) return } /* ownerName := "couchbase" repoName := "couchnode" prNum := 0 if prNum > 0 { err = ProcessPullRequest(ownerName, repoName, prNum) } else { err = ProcessProject(ownerName, repoName) } if err != nil { log.Printf("An error occured during processing:") log.Printf("%+v", err) } */ }
{ b := make([]byte, sha1.Size) rand.Read(b) encData := sha1.Sum(b) return "I" + hex.EncodeToString(encData[:]) }
identifier_body
main.go
package main import ( "context" "crypto/rand" "crypto/sha1" "encoding/hex" "encoding/json" "errors" "fmt" "io/ioutil" "log" "net/http" "os" "regexp" "strconv" "strings" "time" "github.com/andygrunwald/go-gerrit" "github.com/google/go-github/github" "github.com/gregjones/httpcache" git "github.com/libgit2/git2go/v31" "golang.org/x/oauth2" ) var isDryRun bool = true const BOT_IDENT_TAG = "::SDKBOT/PR" func RedactEmail(email string) string { parts := strings.Split(email, "@") if len(parts) != 2 { return "REDACTION FAILED" } user := parts[0] domain := parts[1] userAllow := float32(len(user)) * 0.6 domainAllow := float32(len(domain)) * 0.7 userAllowSide := int(userAllow / 2) domainAllowSide := int(domainAllow / 2) userRightStart := len(user) - userAllowSide domainRightStart := len(domain) - domainAllowSide user = user[0:userAllowSide] + strings.Repeat("*", userRightStart-userAllowSide) + user[userRightStart:] domain = domain[0:domainAllowSide] + strings.Repeat("*", domainRightStart-domainAllowSide) + domain[domainRightStart:] return user + "@" + domain } func RandomChangeId() string { b := make([]byte, sha1.Size) rand.Read(b) encData := sha1.Sum(b) return "I" + hex.EncodeToString(encData[:]) } type subError struct { msg string err error } func (e subError) Error() string { if e.err != nil { return e.msg + ": " + e.err.Error() } else { return e.msg } } func makeErr(msg string, err error) error { return subError{msg, err} } func SquashHead(repo *git.Repository, squashCount int, mergeCommitTitle, changeId string) error { log.Printf("Generating squash commit for `HEAD~0` to `HEAD~%d`", squashCount) headRef, err := repo.Head() if err != nil { return makeErr("failed to get head reference", err) } topCommitId := headRef.Target() topCommit, err := repo.LookupCommit(topCommitId) if err != nil { return makeErr("failed to locate head commit", nil) } var baseCommit *git.Commit var squashCommits []*git.Commit { curCommit := topCommit for i := 0; i < squashCount; i++ { squashCommits = append(squashCommits, curCommit) curCommit = curCommit.Parent(0) } baseCommit = curCommit } log.Printf("Base Commit is `%s`", baseCommit.Id().String()) var newCommitAuthor *git.Signature var newCommitCommitter *git.Signature var newCommitMsg string if len(squashCommits) == 1 { newCommitAuthor = squashCommits[0].Author() newCommitCommitter = squashCommits[0].Committer() newCommitMsg = strings.TrimSpace(squashCommits[0].Message()) + "\n" } else { newCommitMsg = "" newCommitMsg += mergeCommitTitle + "\n\n" for i := 0; i < len(squashCommits); i++ { curCommit := squashCommits[i] newCommitMsg += "----\n" newCommitMsg += strings.TrimSpace(curCommit.Message()) + "\n" newCommitAuthor = curCommit.Author() newCommitCommitter = curCommit.Committer() } } newCommitMsg += "\nChange-Id: " + changeId err = repo.ResetToCommit(baseCommit, git.ResetSoft, nil) if err != nil { return makeErr("failed to reset to base commit", err) } idx, err := repo.Index() if err != nil { return makeErr("failed to retrieve repo index", err) } err = idx.Write() if err != nil { return makeErr("failed to write squash index", err) } newCommitTreeId, err := idx.WriteTree() if err != nil { return makeErr("failed to write squash tree", err) } newCommitTree, err := repo.LookupTree(newCommitTreeId) if err != nil { return makeErr("failed to find created squash tree", err) } log.Printf("Generated new commit message:\n%s", newCommitMsg) _, err = repo.CreateCommit("HEAD", newCommitAuthor, newCommitCommitter, newCommitMsg, newCommitTree, baseCommit) if err != nil { return makeErr("failed to generate squash commit", err) } return nil } type CsStateInfo struct { ChangeNum int ChangeId string Status string CurrentSha1 string } func GetChangesetState(owner, repo string, prnum int) (*CsStateInfo, error) { log.Printf("Retrieving change set for %s/%s/%d", owner, repo, prnum) path := fmt.Sprintf("github.com/%s/%s/pull/%d", owner, repo, prnum) changes, _, err := gerritClient.Changes.QueryChanges(&gerrit.QueryChangeOptions{ QueryOptions: gerrit.QueryOptions{ Query: []string{path}, }, ChangeOptions: gerrit.ChangeOptions{ AdditionalFields: []string{"messages"}, }, }) if err != nil { return nil, makeErr("failed to gerrit query for changes", err) } var foundChangeset *gerrit.ChangeInfo for i := 0; i < len(*changes); i++ { change := &(*changes)[i] for j := 0; j < len(change.Messages); j++ { if !strings.Contains(change.Messages[j].Message, BOT_IDENT_TAG) { continue } if strings.Contains(change.Messages[j].Message, path) { if foundChangeset != nil { return nil, makeErr("found multiple possible changesets", nil) } foundChangeset = change break } } } if foundChangeset == nil { return nil, nil } commitMatcher, err := regexp.Compile("commit:([0-9a-zA-Z]+)") if err != nil { return nil, makeErr("failed to compile commit sha1 finding regexp", err) } var latestSha1 string for i := 0; i < len(foundChangeset.Messages); i++ { commitMatches := commitMatcher.FindStringSubmatch(foundChangeset.Messages[i].Message) if len(commitMatches) == 2 { latestSha1 = commitMatches[1] } } return &CsStateInfo{ ChangeNum: foundChangeset.Number, ChangeId: foundChangeset.ChangeID, Status: foundChangeset.Status, CurrentSha1: latestSha1, }, nil } type RepoInfo struct { Owner string Name string Repo string } var botOwners []string var githubClient *github.Client var githubUser string var githubToken string var gerritClient *gerrit.Client var gerritHost string var gerritUser string var gerritPass string var gerritPublicKey string var gerritPrivateKey string var gerritClaGroupName string var allRepos []RepoInfo func gerritGitCredentialsHandler(url string, username_from_url string, allowed_types git.CredType) (*git.Cred, error) { creds, err := git.NewCredSshKey(gerritUser, gerritPublicKey, gerritPrivateKey, "") return creds, err } func initGerritClient() error { client, err := gerrit.NewClient("https://"+gerritHost+"/", nil) if err != nil { return makeErr("failed to create gerrit client", err) } client.Authentication.SetBasicAuth(gerritUser, gerritPass) gerritClient = client return nil } func initGitHubClient() error { tx := httpcache.NewMemoryCacheTransport() tc := &http.Client{ Transport: &oauth2.Transport{ Source: oauth2.StaticTokenSource( &oauth2.Token{AccessToken: githubToken}, ), Base: tx, }, } githubClient = github.NewClient(tc) return nil } type PrStateInfo struct { CurrentState string LastUpdatedTime time.Time CurrentSha1 string NumOfCommits int } func IsGitHubUserBot(user *github.User) bool { if user == nil || user.Login == nil { return false } if *user.Login == githubUser { return true } return false } func IsGitHubUserBotOwner(user *github.User) bool { if user == nil || user.Login == nil { return false } for i := 0; i < len(botOwners); i++ { if *user.Login == botOwners[i] { return true } } return IsGitHubUserBot(user) } const ( BOTSTATE_NEW = "" BOTSTATE_NO_CLA = "no_cla" BOTSTATE_CREATED = "created" BOTSTATE_UPDATED = "updated" BOTSTATE_ABANDONED = "abandoned" BOTSTATE_MERGED = "merged" BOTSTATE_TIMEOUT = "timeout" ) func GetPullRequestState(owner, repo string, prnum int) (*PrStateInfo, error) { var parseableStateNames = []string{ BOTSTATE_NO_CLA, BOTSTATE_CREATED, BOTSTATE_UPDATED, BOTSTATE_ABANDONED, BOTSTATE_MERGED, BOTSTATE_TIMEOUT, // backwards compatibility names "pushed", "too_many_commits", "closed", } log.Printf("Retrieving PR state for %s/%s/%d", owner, repo, prnum) info, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return nil, makeErr("failed to retieve pull request info", err) } comments, _, err := githubClient.Issues.ListComments(context.Background(), owner, repo, prnum, nil) if err != nil { return nil, makeErr("failed to retrieve pull request comments", err) } var lastStateTime time.Time var lastStateName string var lastUpdatedTime time.Time for i := 0; i < len(comments); i++ { if comments[i].CreatedAt.After(lastUpdatedTime) || comments[i].UpdatedAt.After(lastUpdatedTime) { lastUpdatedTime = *comments[i].UpdatedAt } if !IsGitHubUserBotOwner(comments[i].User) { continue } for j := 0; j < len(parseableStateNames); j++ { if strings.Contains(*comments[i].Body, BOT_IDENT_TAG+":"+parseableStateNames[j]) { if comments[i].CreatedAt.After(lastStateTime) { lastStateName = parseableStateNames[j] lastStateTime = *comments[i].CreatedAt } } } } // For backwards compat... if lastStateName == "too_many_commits" { lastStateName = BOTSTATE_NEW } else if lastStateName == "pushed" { lastStateName = BOTSTATE_UPDATED } else if lastStateName == "closed" { lastStateName = BOTSTATE_ABANDONED } if lastUpdatedTime.IsZero() { lastUpdatedTime = time.Now() } return &PrStateInfo{ CurrentState: lastStateName, LastUpdatedTime: lastUpdatedTime, CurrentSha1: *info.Head.SHA, NumOfCommits: *info.Commits, }, nil } func VerifyEmailCla(email string) (bool, error) { log.Printf("Verifying CLA signed for `%s`", email) if email == "" { return false, makeErr("you must specify a non-empty email", nil) } groups, _, err := gerritClient.Accounts.ListGroups(email) if err != nil { if strings.Contains(err.Error(), "Not Found") { log.Printf("Email was not found on Gerrit") return false, nil } log.Printf("An error occured trying to locate the user on Gerrit") return false, makeErr("failed to retrieve gerrit user groups", err) } hasClaGroup := false for i := 0; i < len(*groups); i++ { if (*groups)[i].Name == gerritClaGroupName { hasClaGroup = true } } if hasClaGroup { log.Printf("The user was located and has signed the CLA") } else { log.Printf("The user was located, but they did not sign the CLA") } return hasClaGroup, nil } func VerifyPrAuthorClas(owner, repo string, prnum int) (bool, []string, error) { log.Printf("Verifying CLA signed for PR %s/%s/%d", owner, repo, prnum) commits, _, err := githubClient.PullRequests.ListCommits(context.Background(), owner, repo, prnum, nil) if err != nil { return false, nil, makeErr("failed to retrieve pull request commits", err) } authorEmailMap := make(map[string]bool) for i := 0; i < len(commits); i++ { authorEmail := *commits[i].Commit.Author.Email authorEmailMap[authorEmail] = false } var emails []string for authorEmail := range authorEmailMap { emails = append(emails, authorEmail) } allSigned := true for authorEmail := range authorEmailMap { signed, err := VerifyEmailCla(authorEmail) if err != nil { return false, emails, err } if !signed { allSigned = false } } return allSigned, emails, nil } func SendPrStateCommentAndClose(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment and close for '%s' due to dry run.", state) return nil }
_, _, err := githubClient.PullRequests.Edit(context.Background(), owner, repo, prnum, &github.PullRequest{ State: &newState, }) if err != nil { return makeErr("failed to close pull request", err) } return SendPrStateComment(owner, repo, prnum, message, state, is_first) } func SendPrStateComment(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment for '%s' due to dry run.", state) return nil } var messageBody string if is_first { messageBody += "Thanks for the pull request!! To ensure quality review, Couchbase employs" messageBody += " a [code review system](http://review.couchbase.org/) based on" messageBody += " [Gerrit](https://www.gerritcodereview.com/) to manage the workflow of changes" messageBody += " in addition to tracking our contributor agreements.\n\n" } messageBody += strings.TrimSpace(message) messageBody += "\n\n" + BOT_IDENT_TAG + ":" + state _, _, err := githubClient.Issues.CreateComment(context.Background(), owner, repo, prnum, &github.IssueComment{ Body: &messageBody, }) if err != nil { return makeErr("failed to comment on pull request", err) } return nil } func SendClaText(owner, repo string, prnum int, state *PrStateInfo, emails []string) error { log.Printf("Sending no_cla for %s/%s/%d", owner, repo, prnum) message := "To get this change in and collaborate in code review, please register on Gerrit" message += " and accept our CLA. The easiest way to do this is to follow the link below," message += " sign in with your GitHub account and then follow through the steps provided" message += " on that page to sign an 'Individual' agreement:" message += " http://review.couchbase.org/#/settings/new-agreement." message += "\n\n" message += "Keep in mind that the emails we are seeing on the commits are: " for i, email := range emails { if i != 0 { message += ", " } message += "`" + RedactEmail(email) + "`" } message += "\n\n" message += "Note: Please contact us if you have any issues registering with Gerrit!" message += " If you have not signed our CLA within 7 days, the Pull Request will be" message += " automatically closed." return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_NO_CLA, state.CurrentState == BOTSTATE_NEW) } func SendPushedText(owner, repo string, prnum int, state *PrStateInfo, changeNum int) error { log.Printf("Sending pushed for %s/%s/%d", owner, repo, prnum) message := "Your changes (commit: " + state.CurrentSha1 + ") have been pushed to the Couchbase Review Site:\n" message += "http://review.couchbase.org/" + strconv.FormatInt(int64(changeNum), 10) if state.NumOfCommits > 1 { message += "\n\n" message += "Note: As your pull request contains multiple commits, we have" message += " performed an automatic squash of these commits into a single" message += " change-set. If this is not the desired behaviour, please" message += " consider submitting a pull request per discreet feature." } if state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_UPDATED, false) } else { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_CREATED, state.CurrentState == BOTSTATE_NEW) } } func ClosePrForTimeout(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to timeout for %s/%s/%d", owner, repo, prnum) message := "Unfortunately it has been 7 days and we are still unable to confirm that you" message += " have signed our CLA. We sincerely appreciate your submission and hope that" message += " you will register and resubmit this Pull Request in the future!" return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_TIMEOUT, state.CurrentState == BOTSTATE_NEW) } func ClosePrForMerge(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit merge for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was merged." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_MERGED, state.CurrentState == BOTSTATE_NEW) } func ClosePrForAbandon(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit abandon for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was abandoned." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_ABANDONED, state.CurrentState == BOTSTATE_NEW) } func GetGerritRepo(owner, repo string) string { return repo } func TransferPrToGerrit(owner, repo string, prnum int, prstate *PrStateInfo) error { log.Printf("Attempting to gerrit transfer PR %s/%s/%d %v", owner, repo, prnum, prstate) csstate, err := GetChangesetState(owner, repo, prnum) if err != nil { return err } if csstate != nil { if csstate.Status == "ABANDONED" { return ClosePrForAbandon(owner, repo, prnum, prstate) } if csstate.Status == "MERGED" { return ClosePrForMerge(owner, repo, prnum, prstate) } if csstate.CurrentSha1 == prstate.CurrentSha1 { // Already up to date! log.Printf("Nothing to do, already up to date.") return nil } } thisChangeId := RandomChangeId() if csstate != nil { thisChangeId = csstate.ChangeId } pr, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return makeErr("failed to request pull request data", err) } gitRepoPath := "/tmp/gtest" os.RemoveAll(gitRepoPath) gitRepo, err := git.Clone(*pr.Head.Repo.CloneURL, gitRepoPath, &git.CloneOptions{ CheckoutBranch: *pr.Head.Ref, }) if err != nil { return makeErr("failed to clone repository head", err) } err = SquashHead(gitRepo, *pr.Commits, *pr.Title, thisChangeId) if err != nil { return err } log.Printf("Generated squash commit with ChangeId `%s`", thisChangeId) if isDryRun { log.Printf("Skipping remote push and comment due to dry run.") return nil } reviewRemote, err := gitRepo.Remotes.Create("review", "ssh://"+gerritUser+"@"+gerritHost+":29418/"+GetGerritRepo(owner, repo)) if err != nil { return makeErr("failed to add gerrit as a remote", err) } log.Printf("Assigned remote.") statusText := "" err = reviewRemote.Push([]string{"HEAD:refs/for/master"}, &git.PushOptions{ RemoteCallbacks: git.RemoteCallbacks{ PushUpdateReferenceCallback: func(refname, status string) git.ErrorCode { statusText = status return 0 }, CredentialsCallback: gerritGitCredentialsHandler, CertificateCheckCallback: func(cert *git.Certificate, valid bool, hostname string) git.ErrorCode { return 0 }, }, }) if err != nil { return makeErr("failed to push to gerrit", err) } log.Printf("Successfully pushed to Gerrit with status `%s`", statusText) if statusText != "" { if statusText == "no new changes" && prstate != nil && (prstate.CurrentState == BOTSTATE_CREATED || prstate.CurrentState == BOTSTATE_UPDATED) { // Nothing changed return nil } return makeErr("failed to upload to gerrit", errors.New(statusText)) } var reviewMessage string reviewMessage += fmt.Sprintf("Change-Set generated from https://github.com/%s/%s/pull/%d (commit:%s).", owner, repo, prnum, *pr.Head.SHA) reviewMessage += "\n" + BOT_IDENT_TAG _, _, err = gerritClient.Changes.SetReview(thisChangeId, "current", &gerrit.ReviewInput{ Message: reviewMessage, }) if err != nil { return makeErr("failed to publish comment to gerrit", err) } if csstate == nil { csstate, err = GetChangesetState(owner, repo, prnum) if err != nil { return makeErr("failed to retrieve updated change from gerrit", err) } if csstate == nil { return makeErr("could not locate pushed change on gerrit", err) } } err = SendPushedText(owner, repo, prnum, prstate, csstate.ChangeNum) if err != nil { return err } return nil } func ProcessPullRequest(owner, repo string, prnum int, noCheckCla bool) error { state, err := GetPullRequestState(owner, repo, prnum) if err != nil { return err } if state.CurrentState == BOTSTATE_ABANDONED || state.CurrentState == BOTSTATE_TIMEOUT || state.CurrentState == BOTSTATE_MERGED { // That's odd... This ticket should not even be open... // Let's do nothing in case someone intentionally reopened it. return nil } if state.CurrentState == BOTSTATE_NEW || state.CurrentState == BOTSTATE_NO_CLA || state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { // Check CLA allSigned, authorEmails, err := VerifyPrAuthorClas(owner, repo, prnum) if err != nil { return err } if noCheckCla { log.Printf("Skipping no_cla warning for this pull request.") allSigned = true } if !allSigned { if state.CurrentState == BOTSTATE_NO_CLA { // If we already sent the no_cla message, lets not do it again, // instead we should check if this is now timed out... if time.Now().After(state.LastUpdatedTime.Add(10 * 24 * time.Hour)) { return ClosePrForTimeout(owner, repo, prnum, state) } log.Printf("Skipping this pull request as no_cla was already sent.") return nil } return SendClaText(owner, repo, prnum, state, authorEmails) } else { // Need to do normal process return TransferPrToGerrit(owner, repo, prnum, state) } } return makeErr("unexpected pull request state", nil) } func ProcessProject(owner, repo string) error { log.Printf("Processing project %s/%s", owner, repo) prs, _, err := githubClient.PullRequests.List(context.Background(), owner, repo, &github.PullRequestListOptions{ State: "open", }) if err != nil { return makeErr("failed to list all pull requests", err) } for i := 0; i < len(prs); i++ { prNum := *prs[i].Number log.Printf("Processing pull request %d", prNum) err := ProcessPullRequest(owner, repo, prNum, false) if err != nil { return err } } log.Printf("Processed project %s/%s", owner, repo) return nil } func ProcessAllProjects() error { log.Printf("Processing all projects") for i := 0; i < len(allRepos); i++ { thisRepo := allRepos[i] err := ProcessProject(thisRepo.Owner, thisRepo.Name) if err != nil { return err } } log.Printf("Processed all projects") return nil } func initClients() error { _, err := os.Stat(gerritPrivateKey) if err != nil { return makeErr("failed to locate gerrit private key", err) } _, err = os.Stat(gerritPublicKey) if err != nil { return makeErr("failed to locate gerrit public key", err) } err = initGerritClient() if err != nil { return err } err = initGitHubClient() if err != nil { return err } return nil } func readConfig() error { configBytes, err := ioutil.ReadFile("./config.json") if err != nil { return makeErr("failed to read config file at `./config.json`", err) } var configData struct { DryRun bool GitHub struct { User string Token string Owners []string } Gerrit struct { Host string User string Pass string Keys struct { Public string Private string } ClaGroupName string } Repos []struct { Owner string Name string Repo string } } err = json.Unmarshal(configBytes, &configData) if err != nil { return makeErr("failed to parse config file", err) } isDryRun = configData.DryRun botOwners = configData.GitHub.Owners githubUser = configData.GitHub.User githubToken = configData.GitHub.Token gerritHost = configData.Gerrit.Host gerritUser = configData.Gerrit.User gerritPass = configData.Gerrit.Pass gerritPublicKey = configData.Gerrit.Keys.Public gerritPrivateKey = configData.Gerrit.Keys.Private gerritClaGroupName = configData.Gerrit.ClaGroupName allRepos = nil for i := 0; i < len(configData.Repos); i++ { allRepos = append(allRepos, RepoInfo{ Owner: configData.Repos[i].Owner, Name: configData.Repos[i].Name, Repo: configData.Repos[i].Repo, }) } return nil } func githubHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received GitHub webhook") var data github.WebHookPayload decoder := json.NewDecoder(r.Body) err := decoder.Decode(&data) if err != nil { log.Printf("Failed to parse GitHub data %+v", err) return } fmt.Fprintf(w, "success") if data.Repo == nil || data.Repo.Owner == nil { // No repository data in the webhook return } if data.Sender != nil && IsGitHubUserBot(data.Sender) { // Ignore hooks triggered by the bot itself. return } ownerName := *data.Repo.Owner.Login repoName := *data.Repo.Name go func() { err := ProcessProject(ownerName, repoName) if err != nil { log.Printf("githubHttpHandler error: %+v\n", err) } }() } func gerritHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Gerrit webhook") fmt.Fprintf(w, "success") go func() { err := ProcessAllProjects() if err != nil { log.Printf("gerritHttpHandler error: %+v\n", err) } }() } func forceCheckHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Check request") fmt.Fprintf(w, "Running!") go func() { err := ProcessAllProjects() if err != nil { log.Printf("forceCheckHttpHandler error: %+v\n", err) } }() } func forceTransferHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Transfer request") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { err = ProcessPullRequest(owner, repo, prnumParsed, true) } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } fmt.Fprintf(w, "success") } func checkClaHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Check CLA Request") var target string var err error var res bool email := r.FormValue("email") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") if email != "" { target = email res, err = VerifyEmailCla(email) } else if owner != "" && repo != "" { prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { target = fmt.Sprintf("github.com/%s/%s/%d", owner, repo, prnumParsed) res, _, err = VerifyPrAuthorClas(owner, repo, prnumParsed) } } else { fmt.Fprintf(w, "You must specify either an email or owner/repo/prnum.") return } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } resText := "NOT SIGNED" if res { resText = "signed" } fmt.Fprintf(w, "CLA Status for `%s` is: %s\n", target, resText) } func proxyRepoStats(w http.ResponseWriter, r *http.Request) { log.Printf("Received Proxy Repo Stats Request") owner := r.FormValue("owner") repo := r.FormValue("repo") clones, _, err := githubClient.Repositories.ListTrafficClones(context.Background(), owner, repo, &github.TrafficBreakdownOptions{ Per: "day", }) if err != nil { fmt.Fprintf(w, "Error: %s", err) return } jsonWriter := json.NewEncoder(w) jsonWriter.Encode(clones) } func rootHttpHandler(w http.ResponseWriter, r *http.Request) { fmt.Fprintf(w, "This is just a bot...") } func main() { log.Printf("Reading configuration...") err := readConfig() if err != nil { log.Printf("Failed to initalize configuration:") log.Printf("%+v", err) return } log.Printf("Initializing API clients...") err = initClients() if err != nil { log.Printf("Failed to initalize clients:") log.Printf("%+v", err) return } log.Printf("Starting web server on :4455...") http.HandleFunc("/", rootHttpHandler) http.HandleFunc("/github", githubHttpHandler) http.HandleFunc("/gerrit", gerritHttpHandler) http.HandleFunc("/forcecheck", forceCheckHttpHandler) http.HandleFunc("/forcetransfer", forceTransferHandler) http.HandleFunc("/checkcla", checkClaHttpHandler) http.HandleFunc("/repostats", proxyRepoStats) err = http.ListenAndServe(":4455", nil) if err != nil { log.Printf("Failed to start http listening.") log.Printf("%+v", err) return } /* ownerName := "couchbase" repoName := "couchnode" prNum := 0 if prNum > 0 { err = ProcessPullRequest(ownerName, repoName, prNum) } else { err = ProcessProject(ownerName, repoName) } if err != nil { log.Printf("An error occured during processing:") log.Printf("%+v", err) } */ }
newState := "closed"
random_line_split
main.go
package main import ( "context" "crypto/rand" "crypto/sha1" "encoding/hex" "encoding/json" "errors" "fmt" "io/ioutil" "log" "net/http" "os" "regexp" "strconv" "strings" "time" "github.com/andygrunwald/go-gerrit" "github.com/google/go-github/github" "github.com/gregjones/httpcache" git "github.com/libgit2/git2go/v31" "golang.org/x/oauth2" ) var isDryRun bool = true const BOT_IDENT_TAG = "::SDKBOT/PR" func RedactEmail(email string) string { parts := strings.Split(email, "@") if len(parts) != 2 { return "REDACTION FAILED" } user := parts[0] domain := parts[1] userAllow := float32(len(user)) * 0.6 domainAllow := float32(len(domain)) * 0.7 userAllowSide := int(userAllow / 2) domainAllowSide := int(domainAllow / 2) userRightStart := len(user) - userAllowSide domainRightStart := len(domain) - domainAllowSide user = user[0:userAllowSide] + strings.Repeat("*", userRightStart-userAllowSide) + user[userRightStart:] domain = domain[0:domainAllowSide] + strings.Repeat("*", domainRightStart-domainAllowSide) + domain[domainRightStart:] return user + "@" + domain } func RandomChangeId() string { b := make([]byte, sha1.Size) rand.Read(b) encData := sha1.Sum(b) return "I" + hex.EncodeToString(encData[:]) } type subError struct { msg string err error } func (e subError) Error() string { if e.err != nil { return e.msg + ": " + e.err.Error() } else { return e.msg } } func makeErr(msg string, err error) error { return subError{msg, err} } func SquashHead(repo *git.Repository, squashCount int, mergeCommitTitle, changeId string) error { log.Printf("Generating squash commit for `HEAD~0` to `HEAD~%d`", squashCount) headRef, err := repo.Head() if err != nil { return makeErr("failed to get head reference", err) } topCommitId := headRef.Target() topCommit, err := repo.LookupCommit(topCommitId) if err != nil { return makeErr("failed to locate head commit", nil) } var baseCommit *git.Commit var squashCommits []*git.Commit { curCommit := topCommit for i := 0; i < squashCount; i++ { squashCommits = append(squashCommits, curCommit) curCommit = curCommit.Parent(0) } baseCommit = curCommit } log.Printf("Base Commit is `%s`", baseCommit.Id().String()) var newCommitAuthor *git.Signature var newCommitCommitter *git.Signature var newCommitMsg string if len(squashCommits) == 1 { newCommitAuthor = squashCommits[0].Author() newCommitCommitter = squashCommits[0].Committer() newCommitMsg = strings.TrimSpace(squashCommits[0].Message()) + "\n" } else { newCommitMsg = "" newCommitMsg += mergeCommitTitle + "\n\n" for i := 0; i < len(squashCommits); i++ { curCommit := squashCommits[i] newCommitMsg += "----\n" newCommitMsg += strings.TrimSpace(curCommit.Message()) + "\n" newCommitAuthor = curCommit.Author() newCommitCommitter = curCommit.Committer() } } newCommitMsg += "\nChange-Id: " + changeId err = repo.ResetToCommit(baseCommit, git.ResetSoft, nil) if err != nil { return makeErr("failed to reset to base commit", err) } idx, err := repo.Index() if err != nil { return makeErr("failed to retrieve repo index", err) } err = idx.Write() if err != nil { return makeErr("failed to write squash index", err) } newCommitTreeId, err := idx.WriteTree() if err != nil { return makeErr("failed to write squash tree", err) } newCommitTree, err := repo.LookupTree(newCommitTreeId) if err != nil { return makeErr("failed to find created squash tree", err) } log.Printf("Generated new commit message:\n%s", newCommitMsg) _, err = repo.CreateCommit("HEAD", newCommitAuthor, newCommitCommitter, newCommitMsg, newCommitTree, baseCommit) if err != nil { return makeErr("failed to generate squash commit", err) } return nil } type CsStateInfo struct { ChangeNum int ChangeId string Status string CurrentSha1 string } func GetChangesetState(owner, repo string, prnum int) (*CsStateInfo, error) { log.Printf("Retrieving change set for %s/%s/%d", owner, repo, prnum) path := fmt.Sprintf("github.com/%s/%s/pull/%d", owner, repo, prnum) changes, _, err := gerritClient.Changes.QueryChanges(&gerrit.QueryChangeOptions{ QueryOptions: gerrit.QueryOptions{ Query: []string{path}, }, ChangeOptions: gerrit.ChangeOptions{ AdditionalFields: []string{"messages"}, }, }) if err != nil { return nil, makeErr("failed to gerrit query for changes", err) } var foundChangeset *gerrit.ChangeInfo for i := 0; i < len(*changes); i++ { change := &(*changes)[i] for j := 0; j < len(change.Messages); j++ { if !strings.Contains(change.Messages[j].Message, BOT_IDENT_TAG) { continue } if strings.Contains(change.Messages[j].Message, path) { if foundChangeset != nil { return nil, makeErr("found multiple possible changesets", nil) } foundChangeset = change break } } } if foundChangeset == nil { return nil, nil } commitMatcher, err := regexp.Compile("commit:([0-9a-zA-Z]+)") if err != nil { return nil, makeErr("failed to compile commit sha1 finding regexp", err) } var latestSha1 string for i := 0; i < len(foundChangeset.Messages); i++ { commitMatches := commitMatcher.FindStringSubmatch(foundChangeset.Messages[i].Message) if len(commitMatches) == 2 { latestSha1 = commitMatches[1] } } return &CsStateInfo{ ChangeNum: foundChangeset.Number, ChangeId: foundChangeset.ChangeID, Status: foundChangeset.Status, CurrentSha1: latestSha1, }, nil } type RepoInfo struct { Owner string Name string Repo string } var botOwners []string var githubClient *github.Client var githubUser string var githubToken string var gerritClient *gerrit.Client var gerritHost string var gerritUser string var gerritPass string var gerritPublicKey string var gerritPrivateKey string var gerritClaGroupName string var allRepos []RepoInfo func gerritGitCredentialsHandler(url string, username_from_url string, allowed_types git.CredType) (*git.Cred, error) { creds, err := git.NewCredSshKey(gerritUser, gerritPublicKey, gerritPrivateKey, "") return creds, err } func initGerritClient() error { client, err := gerrit.NewClient("https://"+gerritHost+"/", nil) if err != nil { return makeErr("failed to create gerrit client", err) } client.Authentication.SetBasicAuth(gerritUser, gerritPass) gerritClient = client return nil } func initGitHubClient() error { tx := httpcache.NewMemoryCacheTransport() tc := &http.Client{ Transport: &oauth2.Transport{ Source: oauth2.StaticTokenSource( &oauth2.Token{AccessToken: githubToken}, ), Base: tx, }, } githubClient = github.NewClient(tc) return nil } type PrStateInfo struct { CurrentState string LastUpdatedTime time.Time CurrentSha1 string NumOfCommits int } func IsGitHubUserBot(user *github.User) bool { if user == nil || user.Login == nil { return false } if *user.Login == githubUser { return true } return false } func
(user *github.User) bool { if user == nil || user.Login == nil { return false } for i := 0; i < len(botOwners); i++ { if *user.Login == botOwners[i] { return true } } return IsGitHubUserBot(user) } const ( BOTSTATE_NEW = "" BOTSTATE_NO_CLA = "no_cla" BOTSTATE_CREATED = "created" BOTSTATE_UPDATED = "updated" BOTSTATE_ABANDONED = "abandoned" BOTSTATE_MERGED = "merged" BOTSTATE_TIMEOUT = "timeout" ) func GetPullRequestState(owner, repo string, prnum int) (*PrStateInfo, error) { var parseableStateNames = []string{ BOTSTATE_NO_CLA, BOTSTATE_CREATED, BOTSTATE_UPDATED, BOTSTATE_ABANDONED, BOTSTATE_MERGED, BOTSTATE_TIMEOUT, // backwards compatibility names "pushed", "too_many_commits", "closed", } log.Printf("Retrieving PR state for %s/%s/%d", owner, repo, prnum) info, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return nil, makeErr("failed to retieve pull request info", err) } comments, _, err := githubClient.Issues.ListComments(context.Background(), owner, repo, prnum, nil) if err != nil { return nil, makeErr("failed to retrieve pull request comments", err) } var lastStateTime time.Time var lastStateName string var lastUpdatedTime time.Time for i := 0; i < len(comments); i++ { if comments[i].CreatedAt.After(lastUpdatedTime) || comments[i].UpdatedAt.After(lastUpdatedTime) { lastUpdatedTime = *comments[i].UpdatedAt } if !IsGitHubUserBotOwner(comments[i].User) { continue } for j := 0; j < len(parseableStateNames); j++ { if strings.Contains(*comments[i].Body, BOT_IDENT_TAG+":"+parseableStateNames[j]) { if comments[i].CreatedAt.After(lastStateTime) { lastStateName = parseableStateNames[j] lastStateTime = *comments[i].CreatedAt } } } } // For backwards compat... if lastStateName == "too_many_commits" { lastStateName = BOTSTATE_NEW } else if lastStateName == "pushed" { lastStateName = BOTSTATE_UPDATED } else if lastStateName == "closed" { lastStateName = BOTSTATE_ABANDONED } if lastUpdatedTime.IsZero() { lastUpdatedTime = time.Now() } return &PrStateInfo{ CurrentState: lastStateName, LastUpdatedTime: lastUpdatedTime, CurrentSha1: *info.Head.SHA, NumOfCommits: *info.Commits, }, nil } func VerifyEmailCla(email string) (bool, error) { log.Printf("Verifying CLA signed for `%s`", email) if email == "" { return false, makeErr("you must specify a non-empty email", nil) } groups, _, err := gerritClient.Accounts.ListGroups(email) if err != nil { if strings.Contains(err.Error(), "Not Found") { log.Printf("Email was not found on Gerrit") return false, nil } log.Printf("An error occured trying to locate the user on Gerrit") return false, makeErr("failed to retrieve gerrit user groups", err) } hasClaGroup := false for i := 0; i < len(*groups); i++ { if (*groups)[i].Name == gerritClaGroupName { hasClaGroup = true } } if hasClaGroup { log.Printf("The user was located and has signed the CLA") } else { log.Printf("The user was located, but they did not sign the CLA") } return hasClaGroup, nil } func VerifyPrAuthorClas(owner, repo string, prnum int) (bool, []string, error) { log.Printf("Verifying CLA signed for PR %s/%s/%d", owner, repo, prnum) commits, _, err := githubClient.PullRequests.ListCommits(context.Background(), owner, repo, prnum, nil) if err != nil { return false, nil, makeErr("failed to retrieve pull request commits", err) } authorEmailMap := make(map[string]bool) for i := 0; i < len(commits); i++ { authorEmail := *commits[i].Commit.Author.Email authorEmailMap[authorEmail] = false } var emails []string for authorEmail := range authorEmailMap { emails = append(emails, authorEmail) } allSigned := true for authorEmail := range authorEmailMap { signed, err := VerifyEmailCla(authorEmail) if err != nil { return false, emails, err } if !signed { allSigned = false } } return allSigned, emails, nil } func SendPrStateCommentAndClose(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment and close for '%s' due to dry run.", state) return nil } newState := "closed" _, _, err := githubClient.PullRequests.Edit(context.Background(), owner, repo, prnum, &github.PullRequest{ State: &newState, }) if err != nil { return makeErr("failed to close pull request", err) } return SendPrStateComment(owner, repo, prnum, message, state, is_first) } func SendPrStateComment(owner, repo string, prnum int, message, state string, is_first bool) error { if isDryRun { log.Printf("Skipping pr comment for '%s' due to dry run.", state) return nil } var messageBody string if is_first { messageBody += "Thanks for the pull request!! To ensure quality review, Couchbase employs" messageBody += " a [code review system](http://review.couchbase.org/) based on" messageBody += " [Gerrit](https://www.gerritcodereview.com/) to manage the workflow of changes" messageBody += " in addition to tracking our contributor agreements.\n\n" } messageBody += strings.TrimSpace(message) messageBody += "\n\n" + BOT_IDENT_TAG + ":" + state _, _, err := githubClient.Issues.CreateComment(context.Background(), owner, repo, prnum, &github.IssueComment{ Body: &messageBody, }) if err != nil { return makeErr("failed to comment on pull request", err) } return nil } func SendClaText(owner, repo string, prnum int, state *PrStateInfo, emails []string) error { log.Printf("Sending no_cla for %s/%s/%d", owner, repo, prnum) message := "To get this change in and collaborate in code review, please register on Gerrit" message += " and accept our CLA. The easiest way to do this is to follow the link below," message += " sign in with your GitHub account and then follow through the steps provided" message += " on that page to sign an 'Individual' agreement:" message += " http://review.couchbase.org/#/settings/new-agreement." message += "\n\n" message += "Keep in mind that the emails we are seeing on the commits are: " for i, email := range emails { if i != 0 { message += ", " } message += "`" + RedactEmail(email) + "`" } message += "\n\n" message += "Note: Please contact us if you have any issues registering with Gerrit!" message += " If you have not signed our CLA within 7 days, the Pull Request will be" message += " automatically closed." return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_NO_CLA, state.CurrentState == BOTSTATE_NEW) } func SendPushedText(owner, repo string, prnum int, state *PrStateInfo, changeNum int) error { log.Printf("Sending pushed for %s/%s/%d", owner, repo, prnum) message := "Your changes (commit: " + state.CurrentSha1 + ") have been pushed to the Couchbase Review Site:\n" message += "http://review.couchbase.org/" + strconv.FormatInt(int64(changeNum), 10) if state.NumOfCommits > 1 { message += "\n\n" message += "Note: As your pull request contains multiple commits, we have" message += " performed an automatic squash of these commits into a single" message += " change-set. If this is not the desired behaviour, please" message += " consider submitting a pull request per discreet feature." } if state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_UPDATED, false) } else { return SendPrStateComment(owner, repo, prnum, message, BOTSTATE_CREATED, state.CurrentState == BOTSTATE_NEW) } } func ClosePrForTimeout(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to timeout for %s/%s/%d", owner, repo, prnum) message := "Unfortunately it has been 7 days and we are still unable to confirm that you" message += " have signed our CLA. We sincerely appreciate your submission and hope that" message += " you will register and resubmit this Pull Request in the future!" return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_TIMEOUT, state.CurrentState == BOTSTATE_NEW) } func ClosePrForMerge(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit merge for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was merged." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_MERGED, state.CurrentState == BOTSTATE_NEW) } func ClosePrForAbandon(owner, repo string, prnum int, state *PrStateInfo) error { log.Printf("Closing due to gerrit abandon for %s/%s/%d", owner, repo, prnum) message := "This Pull Request has been closed as the associated Gerrit change was abandoned." return SendPrStateCommentAndClose(owner, repo, prnum, message, BOTSTATE_ABANDONED, state.CurrentState == BOTSTATE_NEW) } func GetGerritRepo(owner, repo string) string { return repo } func TransferPrToGerrit(owner, repo string, prnum int, prstate *PrStateInfo) error { log.Printf("Attempting to gerrit transfer PR %s/%s/%d %v", owner, repo, prnum, prstate) csstate, err := GetChangesetState(owner, repo, prnum) if err != nil { return err } if csstate != nil { if csstate.Status == "ABANDONED" { return ClosePrForAbandon(owner, repo, prnum, prstate) } if csstate.Status == "MERGED" { return ClosePrForMerge(owner, repo, prnum, prstate) } if csstate.CurrentSha1 == prstate.CurrentSha1 { // Already up to date! log.Printf("Nothing to do, already up to date.") return nil } } thisChangeId := RandomChangeId() if csstate != nil { thisChangeId = csstate.ChangeId } pr, _, err := githubClient.PullRequests.Get(context.Background(), owner, repo, prnum) if err != nil { return makeErr("failed to request pull request data", err) } gitRepoPath := "/tmp/gtest" os.RemoveAll(gitRepoPath) gitRepo, err := git.Clone(*pr.Head.Repo.CloneURL, gitRepoPath, &git.CloneOptions{ CheckoutBranch: *pr.Head.Ref, }) if err != nil { return makeErr("failed to clone repository head", err) } err = SquashHead(gitRepo, *pr.Commits, *pr.Title, thisChangeId) if err != nil { return err } log.Printf("Generated squash commit with ChangeId `%s`", thisChangeId) if isDryRun { log.Printf("Skipping remote push and comment due to dry run.") return nil } reviewRemote, err := gitRepo.Remotes.Create("review", "ssh://"+gerritUser+"@"+gerritHost+":29418/"+GetGerritRepo(owner, repo)) if err != nil { return makeErr("failed to add gerrit as a remote", err) } log.Printf("Assigned remote.") statusText := "" err = reviewRemote.Push([]string{"HEAD:refs/for/master"}, &git.PushOptions{ RemoteCallbacks: git.RemoteCallbacks{ PushUpdateReferenceCallback: func(refname, status string) git.ErrorCode { statusText = status return 0 }, CredentialsCallback: gerritGitCredentialsHandler, CertificateCheckCallback: func(cert *git.Certificate, valid bool, hostname string) git.ErrorCode { return 0 }, }, }) if err != nil { return makeErr("failed to push to gerrit", err) } log.Printf("Successfully pushed to Gerrit with status `%s`", statusText) if statusText != "" { if statusText == "no new changes" && prstate != nil && (prstate.CurrentState == BOTSTATE_CREATED || prstate.CurrentState == BOTSTATE_UPDATED) { // Nothing changed return nil } return makeErr("failed to upload to gerrit", errors.New(statusText)) } var reviewMessage string reviewMessage += fmt.Sprintf("Change-Set generated from https://github.com/%s/%s/pull/%d (commit:%s).", owner, repo, prnum, *pr.Head.SHA) reviewMessage += "\n" + BOT_IDENT_TAG _, _, err = gerritClient.Changes.SetReview(thisChangeId, "current", &gerrit.ReviewInput{ Message: reviewMessage, }) if err != nil { return makeErr("failed to publish comment to gerrit", err) } if csstate == nil { csstate, err = GetChangesetState(owner, repo, prnum) if err != nil { return makeErr("failed to retrieve updated change from gerrit", err) } if csstate == nil { return makeErr("could not locate pushed change on gerrit", err) } } err = SendPushedText(owner, repo, prnum, prstate, csstate.ChangeNum) if err != nil { return err } return nil } func ProcessPullRequest(owner, repo string, prnum int, noCheckCla bool) error { state, err := GetPullRequestState(owner, repo, prnum) if err != nil { return err } if state.CurrentState == BOTSTATE_ABANDONED || state.CurrentState == BOTSTATE_TIMEOUT || state.CurrentState == BOTSTATE_MERGED { // That's odd... This ticket should not even be open... // Let's do nothing in case someone intentionally reopened it. return nil } if state.CurrentState == BOTSTATE_NEW || state.CurrentState == BOTSTATE_NO_CLA || state.CurrentState == BOTSTATE_CREATED || state.CurrentState == BOTSTATE_UPDATED { // Check CLA allSigned, authorEmails, err := VerifyPrAuthorClas(owner, repo, prnum) if err != nil { return err } if noCheckCla { log.Printf("Skipping no_cla warning for this pull request.") allSigned = true } if !allSigned { if state.CurrentState == BOTSTATE_NO_CLA { // If we already sent the no_cla message, lets not do it again, // instead we should check if this is now timed out... if time.Now().After(state.LastUpdatedTime.Add(10 * 24 * time.Hour)) { return ClosePrForTimeout(owner, repo, prnum, state) } log.Printf("Skipping this pull request as no_cla was already sent.") return nil } return SendClaText(owner, repo, prnum, state, authorEmails) } else { // Need to do normal process return TransferPrToGerrit(owner, repo, prnum, state) } } return makeErr("unexpected pull request state", nil) } func ProcessProject(owner, repo string) error { log.Printf("Processing project %s/%s", owner, repo) prs, _, err := githubClient.PullRequests.List(context.Background(), owner, repo, &github.PullRequestListOptions{ State: "open", }) if err != nil { return makeErr("failed to list all pull requests", err) } for i := 0; i < len(prs); i++ { prNum := *prs[i].Number log.Printf("Processing pull request %d", prNum) err := ProcessPullRequest(owner, repo, prNum, false) if err != nil { return err } } log.Printf("Processed project %s/%s", owner, repo) return nil } func ProcessAllProjects() error { log.Printf("Processing all projects") for i := 0; i < len(allRepos); i++ { thisRepo := allRepos[i] err := ProcessProject(thisRepo.Owner, thisRepo.Name) if err != nil { return err } } log.Printf("Processed all projects") return nil } func initClients() error { _, err := os.Stat(gerritPrivateKey) if err != nil { return makeErr("failed to locate gerrit private key", err) } _, err = os.Stat(gerritPublicKey) if err != nil { return makeErr("failed to locate gerrit public key", err) } err = initGerritClient() if err != nil { return err } err = initGitHubClient() if err != nil { return err } return nil } func readConfig() error { configBytes, err := ioutil.ReadFile("./config.json") if err != nil { return makeErr("failed to read config file at `./config.json`", err) } var configData struct { DryRun bool GitHub struct { User string Token string Owners []string } Gerrit struct { Host string User string Pass string Keys struct { Public string Private string } ClaGroupName string } Repos []struct { Owner string Name string Repo string } } err = json.Unmarshal(configBytes, &configData) if err != nil { return makeErr("failed to parse config file", err) } isDryRun = configData.DryRun botOwners = configData.GitHub.Owners githubUser = configData.GitHub.User githubToken = configData.GitHub.Token gerritHost = configData.Gerrit.Host gerritUser = configData.Gerrit.User gerritPass = configData.Gerrit.Pass gerritPublicKey = configData.Gerrit.Keys.Public gerritPrivateKey = configData.Gerrit.Keys.Private gerritClaGroupName = configData.Gerrit.ClaGroupName allRepos = nil for i := 0; i < len(configData.Repos); i++ { allRepos = append(allRepos, RepoInfo{ Owner: configData.Repos[i].Owner, Name: configData.Repos[i].Name, Repo: configData.Repos[i].Repo, }) } return nil } func githubHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received GitHub webhook") var data github.WebHookPayload decoder := json.NewDecoder(r.Body) err := decoder.Decode(&data) if err != nil { log.Printf("Failed to parse GitHub data %+v", err) return } fmt.Fprintf(w, "success") if data.Repo == nil || data.Repo.Owner == nil { // No repository data in the webhook return } if data.Sender != nil && IsGitHubUserBot(data.Sender) { // Ignore hooks triggered by the bot itself. return } ownerName := *data.Repo.Owner.Login repoName := *data.Repo.Name go func() { err := ProcessProject(ownerName, repoName) if err != nil { log.Printf("githubHttpHandler error: %+v\n", err) } }() } func gerritHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Gerrit webhook") fmt.Fprintf(w, "success") go func() { err := ProcessAllProjects() if err != nil { log.Printf("gerritHttpHandler error: %+v\n", err) } }() } func forceCheckHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Check request") fmt.Fprintf(w, "Running!") go func() { err := ProcessAllProjects() if err != nil { log.Printf("forceCheckHttpHandler error: %+v\n", err) } }() } func forceTransferHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Force Transfer request") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { err = ProcessPullRequest(owner, repo, prnumParsed, true) } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } fmt.Fprintf(w, "success") } func checkClaHttpHandler(w http.ResponseWriter, r *http.Request) { log.Printf("Received Check CLA Request") var target string var err error var res bool email := r.FormValue("email") owner := r.FormValue("owner") repo := r.FormValue("repo") prnum := r.FormValue("prnum") if email != "" { target = email res, err = VerifyEmailCla(email) } else if owner != "" && repo != "" { prnumParsed, err := strconv.Atoi(prnum) if err != nil { err = makeErr("You specified an invalid numeric `prnum` value", err) } else { target = fmt.Sprintf("github.com/%s/%s/%d", owner, repo, prnumParsed) res, _, err = VerifyPrAuthorClas(owner, repo, prnumParsed) } } else { fmt.Fprintf(w, "You must specify either an email or owner/repo/prnum.") return } if err != nil { fmt.Fprintf(w, "Error: %s\n", err) return } resText := "NOT SIGNED" if res { resText = "signed" } fmt.Fprintf(w, "CLA Status for `%s` is: %s\n", target, resText) } func proxyRepoStats(w http.ResponseWriter, r *http.Request) { log.Printf("Received Proxy Repo Stats Request") owner := r.FormValue("owner") repo := r.FormValue("repo") clones, _, err := githubClient.Repositories.ListTrafficClones(context.Background(), owner, repo, &github.TrafficBreakdownOptions{ Per: "day", }) if err != nil { fmt.Fprintf(w, "Error: %s", err) return } jsonWriter := json.NewEncoder(w) jsonWriter.Encode(clones) } func rootHttpHandler(w http.ResponseWriter, r *http.Request) { fmt.Fprintf(w, "This is just a bot...") } func main() { log.Printf("Reading configuration...") err := readConfig() if err != nil { log.Printf("Failed to initalize configuration:") log.Printf("%+v", err) return } log.Printf("Initializing API clients...") err = initClients() if err != nil { log.Printf("Failed to initalize clients:") log.Printf("%+v", err) return } log.Printf("Starting web server on :4455...") http.HandleFunc("/", rootHttpHandler) http.HandleFunc("/github", githubHttpHandler) http.HandleFunc("/gerrit", gerritHttpHandler) http.HandleFunc("/forcecheck", forceCheckHttpHandler) http.HandleFunc("/forcetransfer", forceTransferHandler) http.HandleFunc("/checkcla", checkClaHttpHandler) http.HandleFunc("/repostats", proxyRepoStats) err = http.ListenAndServe(":4455", nil) if err != nil { log.Printf("Failed to start http listening.") log.Printf("%+v", err) return } /* ownerName := "couchbase" repoName := "couchnode" prNum := 0 if prNum > 0 { err = ProcessPullRequest(ownerName, repoName, prNum) } else { err = ProcessProject(ownerName, repoName) } if err != nil { log.Printf("An error occured during processing:") log.Printf("%+v", err) } */ }
IsGitHubUserBotOwner
identifier_name
tvlist.js
'use strict'; /** * @class TVList * @constructor * @author Roman Stoian */ function TVList(parent) {
// extending TVList.prototype = Object.create(CScrollList.prototype); TVList.prototype.constructor = TVList; /** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetBreadCrumb = function ( component ) { this.bcrumb = component; }; /** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetSearchBar = function ( component ) { this.sbar = component; }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function(item){ // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); // check file type if regular file var type_ok = item.data.type === self.filterType || self.filterType === MEDIA_TYPE_NONE || item.data.type === MEDIA_TYPE_BACK; // hide not matching items self.Hidden(item, !(text_ok && type_ok)); }); }; /** * Finds the first appropriate item * @param {string} value * @return {Node} */ TVList.prototype.FirstMatch = function ( value ) { // preparing var items; if ( value === '' ) { return null; } items = this.handleInner.children; // all list items // iterate all items till all items are found for ( var i = 0; i < items.length; i++ ) { // floating pointer depends on direction var item = items[i]; // check file name if regular file if ( item.data.type !== MEDIA_TYPE_BACK && item.data.name && item.data.name.toLowerCase().indexOf(value.toLowerCase()) !== -1 ) { return item; } } return null; }; /** * Create new item and put it in the list * @param {string} obj item label * @param {Object} attrs set of item data parameters * @param {Object} states set of additional parameters (stared) * @return {Node} */ TVList.prototype.Add = function (obj, attrs, states) { var self = this, number; // is it necessary to filter if ( this.filterText) { // || this.filterType !== MEDIA_TYPE_NONE // check file name if regular file var text_ok = attrs.type === MEDIA_TYPE_BACK || (obj.name && obj.name.toLowerCase().indexOf(this.filterText.toLowerCase()) !== -1); // check file type if regular file var type_ok = attrs.type === this.filterType || this.filterType === MEDIA_TYPE_NONE || attrs.type === MEDIA_TYPE_BACK; // hide not matching items if ( !(text_ok && type_ok) ) { return null; } } if (this.mtypes.indexOf(attrs.type) === -1) { this.mtypes.push(attrs.type); } // html prepare var body = element('div', {className: 'data'}, obj.name); var star = element('div', {className: 'star'}); if (obj.number) { number = element('div', {className: 'number'}, obj.number); } else { number = element('div', {className: 'number'}); number.style.background = 'url("' + PATH_IMG_PUBLIC + 'media/type_' + attrs.type + '.png") no-repeat center'; } var timeshift = element('div', {className: obj.tsOn? 'timeshift tsOn' : 'timeshift'}); // decoration // make sure name is set if (!attrs.name) { attrs.name = obj.name; } // actual filling var item = CScrollList.prototype.Add.call(this, [number, body, timeshift, star], { star: star, data: attrs, // handlers onclick: function () { // open or enter the item this.self.Open(this.data); return false; }, oncontextmenu: EMULATION ? null : function () { // mark/unmark the item self.parent.actionF2(false); return false; } }); if(obj.number){ item.domNumber = number; } // mark as favourite if (states && states.stared) { item.self.SetStar(item, true); } return item; }; /** * Set inner item flags and decoration * @param {Node} item the element to be processed * @param {boolean} state flag of the operation (true if change is made) */ TVList.prototype.SetStar = function (item, state) { if (item.stared === state) { return; } this.SetState(item, 'stared', state); if (state !== false) { item.star.style.background = 'url("' + PATH_IMG_PUBLIC + 'ico_fav_s.png") no-repeat right'; } else { item.star.style.background = 'none'; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, state !== false ? true : false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, state !== false ? false : true); }; /** * Hook method on focus item change * @param {Node} item the new focused item */ TVList.prototype.onFocus = function (item) { var self = this; if ( MediaPlayer.ts_inProgress ) { if (MediaPlayer.tsExitCheck('focus', item)) { return true; } } clearTimeout(this.timer.OnFocusPlay); if ( item.data.markable ) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); } if (item.data.type === MEDIA_TYPE_STREAM) { if (!this.states.marked || this.states.marked.length === 0) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, item.stared); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, !item.stared); } else { echo(this.states.marked[0].data,'this.states.marked'); } } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); } self.parent.clearEPG(); this.timer.OnFocusPlay = setTimeout(function () { if ( item.data.type === MEDIA_TYPE_BACK ){ if(self.filterText){ self.parent.domInfoTitle.innerHTML = _('Contains the list of items corresponding to the given filter request'); } else { self.parent.domInfoTitle.innerHTML = self.parentItem.name?self.parentItem.name:''; } } else { self.parent.initEPGNow(); self.parent.domInfoTitle.innerHTML = item.data.name?item.data.name:''; } if (item.data.type === MEDIA_TYPE_STREAM) { self.prevChannel = self.lastChannel; self.lastChannel = self.parentItem.data[item.data.index]; self.parent.domURL.innerHTML = (self.parentItem.data[item.data.index].sol && self.parentItem.data[item.data.index].sol !==''?self.parentItem.data[item.data.index].sol+' ':'')+self.parentItem.data[item.data.index].url; if ( MediaPlayer.obj !== self.parentItem.data[item.data.index] ) { MediaPlayer.preparePlayer(self.parentItem.data[item.data.index], self.parent, true, false, true); } if ( self.parent.pvr.arr.length ) { self.parent.pvr.check(true); } } else { self.lastChannel = null; self.parent.domURL.innerHTML = ''; MediaPlayer.end(); } }, 500); return false; }; /** * Reset and clear all items * This will make the component ready for a new filling. */ TVList.prototype.Clear = function () { CScrollList.prototype.Clear.call(this); this.parent.domURL.innerHTML = ''; this.parent.domInfoTitle.innerHTML = ''; this.filterType = MEDIA_TYPE_NONE; this.mtypes = []; }; /** * Move one level up */ TVList.prototype.Back = function () { var self = this; // there are some levels if ( this.path.length > 1 ) { // exiting from favs and there are some changes // normal exit this.path.pop(); self.lastChannel = null; if ( this.bcrumb ) { this.bcrumb.Pop(); } // render the previous level this.Build(this.path[this.path.length-1]); // apply specific button visibility setTimeout(function(){ self.onFocus(self.Current()); }, 0); // go up return this.LEVEL_CHANGE_UP; } // stay here return this.LEVEL_CHANGE_NONE; }; /** * Go to channel by number * @param {number} number */ TVList.prototype.goToChannel = function (number) { if (this.handle.children.length > number && number > this.channelStart) { this.Focused(this.handle.children[number+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); this.SetPosition(this.activeItem); } }; /** * Enter the item or open it * @param {Object} data media item inner data */ TVList.prototype.Open = function (data, noPlay) { // render the list echo(data,'data Open'); var levelChange = this.Build(data, noPlay); // level changed if ( levelChange !== this.LEVEL_CHANGE_NONE ) { // reset tray filter icon if ( this.parent.Tray.iconFilter.parentNode === this.parent.Tray.handleInner ) { this.parent.Tray.handleInner.removeChild(this.parent.Tray.iconFilter); } // and hide at all if not necessary this.parent.Tray.Show(globalBuffer.size() > 0, false); // particular direction if ( levelChange === this.LEVEL_CHANGE_DOWN ) { // build breadcrumbs if ( this.filterText ) { // filter if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/ico_filter.png', this.filterText); } } else { // default // build breadcrumbs if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/type_'+data.type+'.png', data.name ? data.name : ''); } } // save this step this.path.push(data); // sef focus to the first item this.Activate(true); if( data.data && data.data.length ){ this.onFocus(this.activeItem); } } else { // go up if ( !this.Reposition(this.parentItem) ){ this.Activate(true); } } // current level item this.parentItem = this.path[this.path.length-1]; } return levelChange; }; /** * Open root, clear all breadcrumbs, search options */ TVList.prototype.Reset = function () { this.parentItem = null; this.path = []; this.Clear(); // linked components if ( this.bcrumb ) { this.bcrumb.Reset(); } if ( this.sbar ) { this.sbar.Reset(); } }; /** * Renders the given media item by executing associated action * @param {Object} data media item inner data */ TVList.prototype.Build = function (data, noPlay) { var levelChange = this.LEVEL_CHANGE_NONE; // apply filter parameter from the current node this.filterText = data.filterText ? data.filterText : ''; // get item associated open action and execute if ( data && data.type && typeof this.openAction[data.type] === 'function' ) { levelChange = this.openAction[data.type].call(this, data, noPlay); } else { // wrong item type new CModalAlert(this.parent, _('Error'), _('Unknown type of selected item'), _('Close')); } return levelChange; }; /** * Clear the list and fill it again (will try to refocus) * @param {boolean} [refocus=true] if true then try to set focus to the previous focused element */ TVList.prototype.Refresh = function (refocus) { var data = {data : null}; // some media item is opened at the moment if ( this.parentItem !== null ) { // get current focused item this.Build(this.parentItem); if ( refocus !== false) { if ( this.activeItem ) { data = this.activeItem; } else { data = this.FirstMatch(this.filterText); } } // refill // find it in the new list if necessary if ( data && data.data ) { this.Reposition(data.data); } else { this.Reposition(data); } } }; /** * refresh list index in dom objects */ TVList.prototype.RefreshIndex = function () { this.channelStart = this.parentItem.type === MEDIA_TYPE_GROUP? 0 : -1; var i = 0, j = 1, items = this.handleInner.children, delta = 0; if ( this.parentItem !== null && items.length ) { delta = items[0].data.type === MEDIA_TYPE_BACK? 1: 0; for(i = delta; i < items.length; i++){ items[i].data.index = i - delta; if(items[i].data.type === MEDIA_TYPE_GROUP){ this.channelStart = i; } else { items[i].data.number = j; items[i].domNumber.innerHTML = j; j++; } } } else { this.Refresh(true); } }; /** * Moves the cursor to the given element * @param {Object} data * @return {boolean} operation status */ TVList.prototype.Reposition = function (data) { var change = false; if ( data ) { for ( var item, i = 0, l = this.Length(); i < l; i++ ) { item = this.handleInner.children[i]; // url and type match if (data.index === item.data.index || (data.data && !data.index && data.data.index === item.data.index)) { change = this.Focused(item, true); this.SetPosition(this.activeItem); // focus handle bug fix (even items per page problem) if(!change){ this.onFocus(item); } return change; } } } return false; }; /** * Handle checked state for the given item according to the file type. * Mark only items available for marking. * @param {Node} item the element to be processed * @param {boolean} state flag of the state * @return {boolean} operation status */ TVList.prototype.Marked = function (item, state) { // item exists and only allowed types if (item && item.data && item.data.markable) { // parent marking return CScrollList.prototype.Marked.call(this, item, state); } return false; }; /** * Show/hide file items according to the specified filter options * @param {string} text filter file name option */ TVList.prototype.SetFilterText = function (text) { echo('enter to SetFilterText : ' + this.filterText); // set global (case conversion for future string comparison speedup) this.filterText = text.toLowerCase(); // apply filter this.Filter(); }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function (item) { // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); self.Hidden(item, !text_ok); }); }; /** * Return all appropriate items available for actions (either marked or current with suitable type) * @return {Array} list of found Nodes */ TVList.prototype.ActiveItems = function () { // get all marked items var items = this.states.marked ? this.states.marked.slice() : []; // no marked, check current and its type if (items.length === 0 && this.activeItem && this.activeItem.data.markable) { items.push(this.activeItem); } return items; }; /** * Create group of channels */ TVList.prototype.createGroup = function (name, data, toDelete, deleteList) { var obj = {}, dataMap = []; var map = this.parentItem.data.map(function(item){return item.type === MEDIA_TYPE_GROUP?item.name:null;}); var toAdd = map.indexOf(name); echo(toDelete,'toDelete'); if(toAdd === -1){ obj.name = name; obj.type = MEDIA_TYPE_GROUP; obj.data = []; this.parentItem.data.splice(this.channelStart + 1, 0, obj); } else { dataMap = data.map(function(item){if(item.type === MEDIA_TYPE_GROUP){return item.name;}}); for(var i=0; i<dataMap.length; i++){ if(map.indexOf(dataMap[i]) !== -1){ new CModalAlert(currCPage,_('Error'),_('Copying error')); return false; } } obj = this.parentItem.data[toAdd]; } var ansvCode = this.addChannelsToList(obj.data, JSON.parse(JSON.stringify(data)), false, true); if(ansvCode !== 0){ this.parent.actionFileDelete(toDelete,deleteList); } this.Refresh(false); if(toAdd === -1){ this.Focused(this.handle.children[this.channelStart+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } else { this.Focused(this.handle.children[toAdd+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } if (this.isActive) { this.Activate(); } return true; }; /** * Add channels to group * @param {Array} list - group to add * @param {Array} data - channels array * @param {boolean} [refocus] - need refocus * @param {boolean} [noRefresh] - don't refresh list * @return {boolean} need checked list */ TVList.prototype.addChannelsToList = function (list, data, refocus, noRefresh) { echo(list,'ADD TO LIST'); echo(data,'ADD DATA'); var needCheck = false, tempList = [], channelStart = -1; var map = this.path.map(function(item){return item.data;}); var mapList = list.map(function(item){return item.type;}); channelStart = mapList.lastIndexOf(MEDIA_TYPE_GROUP); if (data){ for (var i = 0; i < data.length; i++) { if ( data[i].type === MEDIA_TYPE_GROUP && map.indexOf(data[i].data) !== -1 ){ new CModalAlert(this.parent,_('Error'),_('Copying error')); return 0; } } for ( i = 0; i < data.length; i++ ) { var needAdd = true; for (var j = 0; j < list.length; j++) { if (list[j].name === data[i].name && list[j].type === data[i].type && (list[j].url === data[i].url || list[j].sol +' '+ list[j].url === data[i].url || list[j].url === data[i].sol +' '+ data[i].url)) { needAdd = false; break; } } if (needAdd) { if(data[i].type === MEDIA_TYPE_GROUP){ channelStart++; list.splice(channelStart, 0, data[i]); } else { list.push(data[i]); } needCheck = true; } } } if(needCheck){ tempList = list.slice(); tempList = IPTVChannels.checkTS_data(tempList,true); list = tempList.a; } this.parent.needSave = true; if( !noRefresh ){ this.Refresh(refocus); } return needCheck; };
// parent constructor CScrollList.call(this, parent); /** * link to the object for limited scopes * @type {TVList} */ var self = this; /** * link to the BreadCrumb component * @type {CBreadCrumb} */ this.bcrumb = null; /** * link to the BreadCrumb component * @type {CSearchBar} */ this.sbar = null; /** * type filter for file listing * @type Number */ this.filterType = MEDIA_TYPE_NONE; /** * data filter for file listing * @type String */ this.filterText = ''; /** * hierarchy change flag: no change * @type {number} */ this.LEVEL_CHANGE_NONE = 0; /** * hierarchy change flag: go level up * @type {number} */ this.LEVEL_CHANGE_UP = -1; /** * hierarchy change flag: go level deeper * @type {number} */ this.LEVEL_CHANGE_DOWN = 1; /** * list of all media types on the current level * @type {Array} */ this.mtypes = []; /** * list of media objects data * full chain from the root * @type {[Object]} */ this.path = []; /** * current media object opened * @type {Object} */ this.parentItem = {}; this.timer = {}; this.prevChannel = null; this.lastChannel = null; /** * list of action mapped to the media types * @type {[Function]} */ this.openAction = {}; this.openAction[MEDIA_TYPE_BACK] = function(){ var st = this.Back(); return st; }; this.openAction[MEDIA_TYPE_TV_ROOT] = function () { var j = 0; var item = null; this.channelStart = -1; this.Clear(); if ( this.filterText) { this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); this.channelStart++; } if (this.data.length > 0) { for (var i = 0; i < this.data.length; i++) { if (this.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: this.data[i].name}, {name: this.data[i].name, index: i, markable: true, data: this.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: this.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && this.data[i].tsOn}, {name: this.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(this.data[i].sol? this.data[i].sol + ' ' : '') + this.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop'; } else { if ( this.filterText) { self.parent.domURL.innerHTML = ''; self.parent.domInfoTitle.innerHTML = ''; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop defImage'; } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_GROUP] = function (data) { var item = null; this.Clear(); this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); var j = 0; this.channelStart = -1; if (data.data.length > 0) { for (var i = 0; i < data.data.length; i++) { if (data.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: data.data[i].name}, {name: data.data[i].name, index: i, markable: true, data: data.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: data.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && data.data[i].tsOn}, {name: data.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(data.data[i].sol? data.data[i].sol + ' ' : '') + data.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_STREAM] = function (data, noPlay) { if (MediaPlayer.obj !== self.parentItem.data[data.index] && !noPlay) { MediaPlayer.preparePlayer(self.parentItem.data[data.index], this.parent, true, true, true); } else { if (MediaPlayer.ts_inProgress) { if ( environment.ts_icon ){ MediaPlayer.domTSIndicator.style.display = 'block'; } MediaPlayer.runner.start(); } MediaPlayer.Show(true, this.parent); MediaPlayer.showInfo(true); MediaPlayer.timer.showInfo = setTimeout(function () { MediaPlayer.showInfo(false); }, 3000); } return this.LEVEL_CHANGE_NONE; }; }
identifier_body
tvlist.js
'use strict'; /** * @class TVList * @constructor * @author Roman Stoian */ function TVList(parent) { // parent constructor CScrollList.call(this, parent); /** * link to the object for limited scopes * @type {TVList} */ var self = this; /** * link to the BreadCrumb component * @type {CBreadCrumb} */ this.bcrumb = null; /** * link to the BreadCrumb component * @type {CSearchBar} */ this.sbar = null; /** * type filter for file listing * @type Number */ this.filterType = MEDIA_TYPE_NONE; /** * data filter for file listing * @type String */ this.filterText = ''; /** * hierarchy change flag: no change * @type {number} */ this.LEVEL_CHANGE_NONE = 0; /** * hierarchy change flag: go level up * @type {number} */ this.LEVEL_CHANGE_UP = -1; /** * hierarchy change flag: go level deeper * @type {number} */ this.LEVEL_CHANGE_DOWN = 1; /** * list of all media types on the current level * @type {Array} */ this.mtypes = []; /** * list of media objects data * full chain from the root * @type {[Object]} */ this.path = []; /** * current media object opened * @type {Object} */ this.parentItem = {}; this.timer = {}; this.prevChannel = null; this.lastChannel = null; /** * list of action mapped to the media types * @type {[Function]} */ this.openAction = {}; this.openAction[MEDIA_TYPE_BACK] = function(){ var st = this.Back(); return st; }; this.openAction[MEDIA_TYPE_TV_ROOT] = function () { var j = 0; var item = null; this.channelStart = -1; this.Clear(); if ( this.filterText) { this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); this.channelStart++; } if (this.data.length > 0) { for (var i = 0; i < this.data.length; i++) { if (this.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: this.data[i].name}, {name: this.data[i].name, index: i, markable: true, data: this.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: this.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && this.data[i].tsOn}, {name: this.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(this.data[i].sol? this.data[i].sol + ' ' : '') + this.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop'; } else { if ( this.filterText) { self.parent.domURL.innerHTML = ''; self.parent.domInfoTitle.innerHTML = ''; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop defImage'; } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_GROUP] = function (data) { var item = null; this.Clear(); this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); var j = 0; this.channelStart = -1; if (data.data.length > 0) { for (var i = 0; i < data.data.length; i++) { if (data.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: data.data[i].name}, {name: data.data[i].name, index: i, markable: true, data: data.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: data.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && data.data[i].tsOn}, {name: data.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(data.data[i].sol? data.data[i].sol + ' ' : '') + data.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_STREAM] = function (data, noPlay) { if (MediaPlayer.obj !== self.parentItem.data[data.index] && !noPlay) { MediaPlayer.preparePlayer(self.parentItem.data[data.index], this.parent, true, true, true); } else { if (MediaPlayer.ts_inProgress) { if ( environment.ts_icon ){ MediaPlayer.domTSIndicator.style.display = 'block'; } MediaPlayer.runner.start(); } MediaPlayer.Show(true, this.parent); MediaPlayer.showInfo(true); MediaPlayer.timer.showInfo = setTimeout(function () { MediaPlayer.showInfo(false); }, 3000); } return this.LEVEL_CHANGE_NONE; }; } // extending
/** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetBreadCrumb = function ( component ) { this.bcrumb = component; }; /** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetSearchBar = function ( component ) { this.sbar = component; }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function(item){ // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); // check file type if regular file var type_ok = item.data.type === self.filterType || self.filterType === MEDIA_TYPE_NONE || item.data.type === MEDIA_TYPE_BACK; // hide not matching items self.Hidden(item, !(text_ok && type_ok)); }); }; /** * Finds the first appropriate item * @param {string} value * @return {Node} */ TVList.prototype.FirstMatch = function ( value ) { // preparing var items; if ( value === '' ) { return null; } items = this.handleInner.children; // all list items // iterate all items till all items are found for ( var i = 0; i < items.length; i++ ) { // floating pointer depends on direction var item = items[i]; // check file name if regular file if ( item.data.type !== MEDIA_TYPE_BACK && item.data.name && item.data.name.toLowerCase().indexOf(value.toLowerCase()) !== -1 ) { return item; } } return null; }; /** * Create new item and put it in the list * @param {string} obj item label * @param {Object} attrs set of item data parameters * @param {Object} states set of additional parameters (stared) * @return {Node} */ TVList.prototype.Add = function (obj, attrs, states) { var self = this, number; // is it necessary to filter if ( this.filterText) { // || this.filterType !== MEDIA_TYPE_NONE // check file name if regular file var text_ok = attrs.type === MEDIA_TYPE_BACK || (obj.name && obj.name.toLowerCase().indexOf(this.filterText.toLowerCase()) !== -1); // check file type if regular file var type_ok = attrs.type === this.filterType || this.filterType === MEDIA_TYPE_NONE || attrs.type === MEDIA_TYPE_BACK; // hide not matching items if ( !(text_ok && type_ok) ) { return null; } } if (this.mtypes.indexOf(attrs.type) === -1) { this.mtypes.push(attrs.type); } // html prepare var body = element('div', {className: 'data'}, obj.name); var star = element('div', {className: 'star'}); if (obj.number) { number = element('div', {className: 'number'}, obj.number); } else { number = element('div', {className: 'number'}); number.style.background = 'url("' + PATH_IMG_PUBLIC + 'media/type_' + attrs.type + '.png") no-repeat center'; } var timeshift = element('div', {className: obj.tsOn? 'timeshift tsOn' : 'timeshift'}); // decoration // make sure name is set if (!attrs.name) { attrs.name = obj.name; } // actual filling var item = CScrollList.prototype.Add.call(this, [number, body, timeshift, star], { star: star, data: attrs, // handlers onclick: function () { // open or enter the item this.self.Open(this.data); return false; }, oncontextmenu: EMULATION ? null : function () { // mark/unmark the item self.parent.actionF2(false); return false; } }); if(obj.number){ item.domNumber = number; } // mark as favourite if (states && states.stared) { item.self.SetStar(item, true); } return item; }; /** * Set inner item flags and decoration * @param {Node} item the element to be processed * @param {boolean} state flag of the operation (true if change is made) */ TVList.prototype.SetStar = function (item, state) { if (item.stared === state) { return; } this.SetState(item, 'stared', state); if (state !== false) { item.star.style.background = 'url("' + PATH_IMG_PUBLIC + 'ico_fav_s.png") no-repeat right'; } else { item.star.style.background = 'none'; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, state !== false ? true : false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, state !== false ? false : true); }; /** * Hook method on focus item change * @param {Node} item the new focused item */ TVList.prototype.onFocus = function (item) { var self = this; if ( MediaPlayer.ts_inProgress ) { if (MediaPlayer.tsExitCheck('focus', item)) { return true; } } clearTimeout(this.timer.OnFocusPlay); if ( item.data.markable ) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); } if (item.data.type === MEDIA_TYPE_STREAM) { if (!this.states.marked || this.states.marked.length === 0) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, item.stared); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, !item.stared); } else { echo(this.states.marked[0].data,'this.states.marked'); } } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); } self.parent.clearEPG(); this.timer.OnFocusPlay = setTimeout(function () { if ( item.data.type === MEDIA_TYPE_BACK ){ if(self.filterText){ self.parent.domInfoTitle.innerHTML = _('Contains the list of items corresponding to the given filter request'); } else { self.parent.domInfoTitle.innerHTML = self.parentItem.name?self.parentItem.name:''; } } else { self.parent.initEPGNow(); self.parent.domInfoTitle.innerHTML = item.data.name?item.data.name:''; } if (item.data.type === MEDIA_TYPE_STREAM) { self.prevChannel = self.lastChannel; self.lastChannel = self.parentItem.data[item.data.index]; self.parent.domURL.innerHTML = (self.parentItem.data[item.data.index].sol && self.parentItem.data[item.data.index].sol !==''?self.parentItem.data[item.data.index].sol+' ':'')+self.parentItem.data[item.data.index].url; if ( MediaPlayer.obj !== self.parentItem.data[item.data.index] ) { MediaPlayer.preparePlayer(self.parentItem.data[item.data.index], self.parent, true, false, true); } if ( self.parent.pvr.arr.length ) { self.parent.pvr.check(true); } } else { self.lastChannel = null; self.parent.domURL.innerHTML = ''; MediaPlayer.end(); } }, 500); return false; }; /** * Reset and clear all items * This will make the component ready for a new filling. */ TVList.prototype.Clear = function () { CScrollList.prototype.Clear.call(this); this.parent.domURL.innerHTML = ''; this.parent.domInfoTitle.innerHTML = ''; this.filterType = MEDIA_TYPE_NONE; this.mtypes = []; }; /** * Move one level up */ TVList.prototype.Back = function () { var self = this; // there are some levels if ( this.path.length > 1 ) { // exiting from favs and there are some changes // normal exit this.path.pop(); self.lastChannel = null; if ( this.bcrumb ) { this.bcrumb.Pop(); } // render the previous level this.Build(this.path[this.path.length-1]); // apply specific button visibility setTimeout(function(){ self.onFocus(self.Current()); }, 0); // go up return this.LEVEL_CHANGE_UP; } // stay here return this.LEVEL_CHANGE_NONE; }; /** * Go to channel by number * @param {number} number */ TVList.prototype.goToChannel = function (number) { if (this.handle.children.length > number && number > this.channelStart) { this.Focused(this.handle.children[number+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); this.SetPosition(this.activeItem); } }; /** * Enter the item or open it * @param {Object} data media item inner data */ TVList.prototype.Open = function (data, noPlay) { // render the list echo(data,'data Open'); var levelChange = this.Build(data, noPlay); // level changed if ( levelChange !== this.LEVEL_CHANGE_NONE ) { // reset tray filter icon if ( this.parent.Tray.iconFilter.parentNode === this.parent.Tray.handleInner ) { this.parent.Tray.handleInner.removeChild(this.parent.Tray.iconFilter); } // and hide at all if not necessary this.parent.Tray.Show(globalBuffer.size() > 0, false); // particular direction if ( levelChange === this.LEVEL_CHANGE_DOWN ) { // build breadcrumbs if ( this.filterText ) { // filter if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/ico_filter.png', this.filterText); } } else { // default // build breadcrumbs if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/type_'+data.type+'.png', data.name ? data.name : ''); } } // save this step this.path.push(data); // sef focus to the first item this.Activate(true); if( data.data && data.data.length ){ this.onFocus(this.activeItem); } } else { // go up if ( !this.Reposition(this.parentItem) ){ this.Activate(true); } } // current level item this.parentItem = this.path[this.path.length-1]; } return levelChange; }; /** * Open root, clear all breadcrumbs, search options */ TVList.prototype.Reset = function () { this.parentItem = null; this.path = []; this.Clear(); // linked components if ( this.bcrumb ) { this.bcrumb.Reset(); } if ( this.sbar ) { this.sbar.Reset(); } }; /** * Renders the given media item by executing associated action * @param {Object} data media item inner data */ TVList.prototype.Build = function (data, noPlay) { var levelChange = this.LEVEL_CHANGE_NONE; // apply filter parameter from the current node this.filterText = data.filterText ? data.filterText : ''; // get item associated open action and execute if ( data && data.type && typeof this.openAction[data.type] === 'function' ) { levelChange = this.openAction[data.type].call(this, data, noPlay); } else { // wrong item type new CModalAlert(this.parent, _('Error'), _('Unknown type of selected item'), _('Close')); } return levelChange; }; /** * Clear the list and fill it again (will try to refocus) * @param {boolean} [refocus=true] if true then try to set focus to the previous focused element */ TVList.prototype.Refresh = function (refocus) { var data = {data : null}; // some media item is opened at the moment if ( this.parentItem !== null ) { // get current focused item this.Build(this.parentItem); if ( refocus !== false) { if ( this.activeItem ) { data = this.activeItem; } else { data = this.FirstMatch(this.filterText); } } // refill // find it in the new list if necessary if ( data && data.data ) { this.Reposition(data.data); } else { this.Reposition(data); } } }; /** * refresh list index in dom objects */ TVList.prototype.RefreshIndex = function () { this.channelStart = this.parentItem.type === MEDIA_TYPE_GROUP? 0 : -1; var i = 0, j = 1, items = this.handleInner.children, delta = 0; if ( this.parentItem !== null && items.length ) { delta = items[0].data.type === MEDIA_TYPE_BACK? 1: 0; for(i = delta; i < items.length; i++){ items[i].data.index = i - delta; if(items[i].data.type === MEDIA_TYPE_GROUP){ this.channelStart = i; } else { items[i].data.number = j; items[i].domNumber.innerHTML = j; j++; } } } else { this.Refresh(true); } }; /** * Moves the cursor to the given element * @param {Object} data * @return {boolean} operation status */ TVList.prototype.Reposition = function (data) { var change = false; if ( data ) { for ( var item, i = 0, l = this.Length(); i < l; i++ ) { item = this.handleInner.children[i]; // url and type match if (data.index === item.data.index || (data.data && !data.index && data.data.index === item.data.index)) { change = this.Focused(item, true); this.SetPosition(this.activeItem); // focus handle bug fix (even items per page problem) if(!change){ this.onFocus(item); } return change; } } } return false; }; /** * Handle checked state for the given item according to the file type. * Mark only items available for marking. * @param {Node} item the element to be processed * @param {boolean} state flag of the state * @return {boolean} operation status */ TVList.prototype.Marked = function (item, state) { // item exists and only allowed types if (item && item.data && item.data.markable) { // parent marking return CScrollList.prototype.Marked.call(this, item, state); } return false; }; /** * Show/hide file items according to the specified filter options * @param {string} text filter file name option */ TVList.prototype.SetFilterText = function (text) { echo('enter to SetFilterText : ' + this.filterText); // set global (case conversion for future string comparison speedup) this.filterText = text.toLowerCase(); // apply filter this.Filter(); }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function (item) { // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); self.Hidden(item, !text_ok); }); }; /** * Return all appropriate items available for actions (either marked or current with suitable type) * @return {Array} list of found Nodes */ TVList.prototype.ActiveItems = function () { // get all marked items var items = this.states.marked ? this.states.marked.slice() : []; // no marked, check current and its type if (items.length === 0 && this.activeItem && this.activeItem.data.markable) { items.push(this.activeItem); } return items; }; /** * Create group of channels */ TVList.prototype.createGroup = function (name, data, toDelete, deleteList) { var obj = {}, dataMap = []; var map = this.parentItem.data.map(function(item){return item.type === MEDIA_TYPE_GROUP?item.name:null;}); var toAdd = map.indexOf(name); echo(toDelete,'toDelete'); if(toAdd === -1){ obj.name = name; obj.type = MEDIA_TYPE_GROUP; obj.data = []; this.parentItem.data.splice(this.channelStart + 1, 0, obj); } else { dataMap = data.map(function(item){if(item.type === MEDIA_TYPE_GROUP){return item.name;}}); for(var i=0; i<dataMap.length; i++){ if(map.indexOf(dataMap[i]) !== -1){ new CModalAlert(currCPage,_('Error'),_('Copying error')); return false; } } obj = this.parentItem.data[toAdd]; } var ansvCode = this.addChannelsToList(obj.data, JSON.parse(JSON.stringify(data)), false, true); if(ansvCode !== 0){ this.parent.actionFileDelete(toDelete,deleteList); } this.Refresh(false); if(toAdd === -1){ this.Focused(this.handle.children[this.channelStart+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } else { this.Focused(this.handle.children[toAdd+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } if (this.isActive) { this.Activate(); } return true; }; /** * Add channels to group * @param {Array} list - group to add * @param {Array} data - channels array * @param {boolean} [refocus] - need refocus * @param {boolean} [noRefresh] - don't refresh list * @return {boolean} need checked list */ TVList.prototype.addChannelsToList = function (list, data, refocus, noRefresh) { echo(list,'ADD TO LIST'); echo(data,'ADD DATA'); var needCheck = false, tempList = [], channelStart = -1; var map = this.path.map(function(item){return item.data;}); var mapList = list.map(function(item){return item.type;}); channelStart = mapList.lastIndexOf(MEDIA_TYPE_GROUP); if (data){ for (var i = 0; i < data.length; i++) { if ( data[i].type === MEDIA_TYPE_GROUP && map.indexOf(data[i].data) !== -1 ){ new CModalAlert(this.parent,_('Error'),_('Copying error')); return 0; } } for ( i = 0; i < data.length; i++ ) { var needAdd = true; for (var j = 0; j < list.length; j++) { if (list[j].name === data[i].name && list[j].type === data[i].type && (list[j].url === data[i].url || list[j].sol +' '+ list[j].url === data[i].url || list[j].url === data[i].sol +' '+ data[i].url)) { needAdd = false; break; } } if (needAdd) { if(data[i].type === MEDIA_TYPE_GROUP){ channelStart++; list.splice(channelStart, 0, data[i]); } else { list.push(data[i]); } needCheck = true; } } } if(needCheck){ tempList = list.slice(); tempList = IPTVChannels.checkTS_data(tempList,true); list = tempList.a; } this.parent.needSave = true; if( !noRefresh ){ this.Refresh(refocus); } return needCheck; };
TVList.prototype = Object.create(CScrollList.prototype); TVList.prototype.constructor = TVList;
random_line_split
tvlist.js
'use strict'; /** * @class TVList * @constructor * @author Roman Stoian */ function TV
arent) { // parent constructor CScrollList.call(this, parent); /** * link to the object for limited scopes * @type {TVList} */ var self = this; /** * link to the BreadCrumb component * @type {CBreadCrumb} */ this.bcrumb = null; /** * link to the BreadCrumb component * @type {CSearchBar} */ this.sbar = null; /** * type filter for file listing * @type Number */ this.filterType = MEDIA_TYPE_NONE; /** * data filter for file listing * @type String */ this.filterText = ''; /** * hierarchy change flag: no change * @type {number} */ this.LEVEL_CHANGE_NONE = 0; /** * hierarchy change flag: go level up * @type {number} */ this.LEVEL_CHANGE_UP = -1; /** * hierarchy change flag: go level deeper * @type {number} */ this.LEVEL_CHANGE_DOWN = 1; /** * list of all media types on the current level * @type {Array} */ this.mtypes = []; /** * list of media objects data * full chain from the root * @type {[Object]} */ this.path = []; /** * current media object opened * @type {Object} */ this.parentItem = {}; this.timer = {}; this.prevChannel = null; this.lastChannel = null; /** * list of action mapped to the media types * @type {[Function]} */ this.openAction = {}; this.openAction[MEDIA_TYPE_BACK] = function(){ var st = this.Back(); return st; }; this.openAction[MEDIA_TYPE_TV_ROOT] = function () { var j = 0; var item = null; this.channelStart = -1; this.Clear(); if ( this.filterText) { this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); this.channelStart++; } if (this.data.length > 0) { for (var i = 0; i < this.data.length; i++) { if (this.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: this.data[i].name}, {name: this.data[i].name, index: i, markable: true, data: this.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: this.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && this.data[i].tsOn}, {name: this.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(this.data[i].sol? this.data[i].sol + ' ' : '') + this.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop'; } else { if ( this.filterText) { self.parent.domURL.innerHTML = ''; self.parent.domInfoTitle.innerHTML = ''; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop defImage'; } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_GROUP] = function (data) { var item = null; this.Clear(); this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); var j = 0; this.channelStart = -1; if (data.data.length > 0) { for (var i = 0; i < data.data.length; i++) { if (data.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: data.data[i].name}, {name: data.data[i].name, index: i, markable: true, data: data.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: data.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && data.data[i].tsOn}, {name: data.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(data.data[i].sol? data.data[i].sol + ' ' : '') + data.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_STREAM] = function (data, noPlay) { if (MediaPlayer.obj !== self.parentItem.data[data.index] && !noPlay) { MediaPlayer.preparePlayer(self.parentItem.data[data.index], this.parent, true, true, true); } else { if (MediaPlayer.ts_inProgress) { if ( environment.ts_icon ){ MediaPlayer.domTSIndicator.style.display = 'block'; } MediaPlayer.runner.start(); } MediaPlayer.Show(true, this.parent); MediaPlayer.showInfo(true); MediaPlayer.timer.showInfo = setTimeout(function () { MediaPlayer.showInfo(false); }, 3000); } return this.LEVEL_CHANGE_NONE; }; } // extending TVList.prototype = Object.create(CScrollList.prototype); TVList.prototype.constructor = TVList; /** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetBreadCrumb = function ( component ) { this.bcrumb = component; }; /** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetSearchBar = function ( component ) { this.sbar = component; }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function(item){ // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); // check file type if regular file var type_ok = item.data.type === self.filterType || self.filterType === MEDIA_TYPE_NONE || item.data.type === MEDIA_TYPE_BACK; // hide not matching items self.Hidden(item, !(text_ok && type_ok)); }); }; /** * Finds the first appropriate item * @param {string} value * @return {Node} */ TVList.prototype.FirstMatch = function ( value ) { // preparing var items; if ( value === '' ) { return null; } items = this.handleInner.children; // all list items // iterate all items till all items are found for ( var i = 0; i < items.length; i++ ) { // floating pointer depends on direction var item = items[i]; // check file name if regular file if ( item.data.type !== MEDIA_TYPE_BACK && item.data.name && item.data.name.toLowerCase().indexOf(value.toLowerCase()) !== -1 ) { return item; } } return null; }; /** * Create new item and put it in the list * @param {string} obj item label * @param {Object} attrs set of item data parameters * @param {Object} states set of additional parameters (stared) * @return {Node} */ TVList.prototype.Add = function (obj, attrs, states) { var self = this, number; // is it necessary to filter if ( this.filterText) { // || this.filterType !== MEDIA_TYPE_NONE // check file name if regular file var text_ok = attrs.type === MEDIA_TYPE_BACK || (obj.name && obj.name.toLowerCase().indexOf(this.filterText.toLowerCase()) !== -1); // check file type if regular file var type_ok = attrs.type === this.filterType || this.filterType === MEDIA_TYPE_NONE || attrs.type === MEDIA_TYPE_BACK; // hide not matching items if ( !(text_ok && type_ok) ) { return null; } } if (this.mtypes.indexOf(attrs.type) === -1) { this.mtypes.push(attrs.type); } // html prepare var body = element('div', {className: 'data'}, obj.name); var star = element('div', {className: 'star'}); if (obj.number) { number = element('div', {className: 'number'}, obj.number); } else { number = element('div', {className: 'number'}); number.style.background = 'url("' + PATH_IMG_PUBLIC + 'media/type_' + attrs.type + '.png") no-repeat center'; } var timeshift = element('div', {className: obj.tsOn? 'timeshift tsOn' : 'timeshift'}); // decoration // make sure name is set if (!attrs.name) { attrs.name = obj.name; } // actual filling var item = CScrollList.prototype.Add.call(this, [number, body, timeshift, star], { star: star, data: attrs, // handlers onclick: function () { // open or enter the item this.self.Open(this.data); return false; }, oncontextmenu: EMULATION ? null : function () { // mark/unmark the item self.parent.actionF2(false); return false; } }); if(obj.number){ item.domNumber = number; } // mark as favourite if (states && states.stared) { item.self.SetStar(item, true); } return item; }; /** * Set inner item flags and decoration * @param {Node} item the element to be processed * @param {boolean} state flag of the operation (true if change is made) */ TVList.prototype.SetStar = function (item, state) { if (item.stared === state) { return; } this.SetState(item, 'stared', state); if (state !== false) { item.star.style.background = 'url("' + PATH_IMG_PUBLIC + 'ico_fav_s.png") no-repeat right'; } else { item.star.style.background = 'none'; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, state !== false ? true : false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, state !== false ? false : true); }; /** * Hook method on focus item change * @param {Node} item the new focused item */ TVList.prototype.onFocus = function (item) { var self = this; if ( MediaPlayer.ts_inProgress ) { if (MediaPlayer.tsExitCheck('focus', item)) { return true; } } clearTimeout(this.timer.OnFocusPlay); if ( item.data.markable ) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); } if (item.data.type === MEDIA_TYPE_STREAM) { if (!this.states.marked || this.states.marked.length === 0) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, item.stared); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, !item.stared); } else { echo(this.states.marked[0].data,'this.states.marked'); } } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); } self.parent.clearEPG(); this.timer.OnFocusPlay = setTimeout(function () { if ( item.data.type === MEDIA_TYPE_BACK ){ if(self.filterText){ self.parent.domInfoTitle.innerHTML = _('Contains the list of items corresponding to the given filter request'); } else { self.parent.domInfoTitle.innerHTML = self.parentItem.name?self.parentItem.name:''; } } else { self.parent.initEPGNow(); self.parent.domInfoTitle.innerHTML = item.data.name?item.data.name:''; } if (item.data.type === MEDIA_TYPE_STREAM) { self.prevChannel = self.lastChannel; self.lastChannel = self.parentItem.data[item.data.index]; self.parent.domURL.innerHTML = (self.parentItem.data[item.data.index].sol && self.parentItem.data[item.data.index].sol !==''?self.parentItem.data[item.data.index].sol+' ':'')+self.parentItem.data[item.data.index].url; if ( MediaPlayer.obj !== self.parentItem.data[item.data.index] ) { MediaPlayer.preparePlayer(self.parentItem.data[item.data.index], self.parent, true, false, true); } if ( self.parent.pvr.arr.length ) { self.parent.pvr.check(true); } } else { self.lastChannel = null; self.parent.domURL.innerHTML = ''; MediaPlayer.end(); } }, 500); return false; }; /** * Reset and clear all items * This will make the component ready for a new filling. */ TVList.prototype.Clear = function () { CScrollList.prototype.Clear.call(this); this.parent.domURL.innerHTML = ''; this.parent.domInfoTitle.innerHTML = ''; this.filterType = MEDIA_TYPE_NONE; this.mtypes = []; }; /** * Move one level up */ TVList.prototype.Back = function () { var self = this; // there are some levels if ( this.path.length > 1 ) { // exiting from favs and there are some changes // normal exit this.path.pop(); self.lastChannel = null; if ( this.bcrumb ) { this.bcrumb.Pop(); } // render the previous level this.Build(this.path[this.path.length-1]); // apply specific button visibility setTimeout(function(){ self.onFocus(self.Current()); }, 0); // go up return this.LEVEL_CHANGE_UP; } // stay here return this.LEVEL_CHANGE_NONE; }; /** * Go to channel by number * @param {number} number */ TVList.prototype.goToChannel = function (number) { if (this.handle.children.length > number && number > this.channelStart) { this.Focused(this.handle.children[number+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); this.SetPosition(this.activeItem); } }; /** * Enter the item or open it * @param {Object} data media item inner data */ TVList.prototype.Open = function (data, noPlay) { // render the list echo(data,'data Open'); var levelChange = this.Build(data, noPlay); // level changed if ( levelChange !== this.LEVEL_CHANGE_NONE ) { // reset tray filter icon if ( this.parent.Tray.iconFilter.parentNode === this.parent.Tray.handleInner ) { this.parent.Tray.handleInner.removeChild(this.parent.Tray.iconFilter); } // and hide at all if not necessary this.parent.Tray.Show(globalBuffer.size() > 0, false); // particular direction if ( levelChange === this.LEVEL_CHANGE_DOWN ) { // build breadcrumbs if ( this.filterText ) { // filter if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/ico_filter.png', this.filterText); } } else { // default // build breadcrumbs if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/type_'+data.type+'.png', data.name ? data.name : ''); } } // save this step this.path.push(data); // sef focus to the first item this.Activate(true); if( data.data && data.data.length ){ this.onFocus(this.activeItem); } } else { // go up if ( !this.Reposition(this.parentItem) ){ this.Activate(true); } } // current level item this.parentItem = this.path[this.path.length-1]; } return levelChange; }; /** * Open root, clear all breadcrumbs, search options */ TVList.prototype.Reset = function () { this.parentItem = null; this.path = []; this.Clear(); // linked components if ( this.bcrumb ) { this.bcrumb.Reset(); } if ( this.sbar ) { this.sbar.Reset(); } }; /** * Renders the given media item by executing associated action * @param {Object} data media item inner data */ TVList.prototype.Build = function (data, noPlay) { var levelChange = this.LEVEL_CHANGE_NONE; // apply filter parameter from the current node this.filterText = data.filterText ? data.filterText : ''; // get item associated open action and execute if ( data && data.type && typeof this.openAction[data.type] === 'function' ) { levelChange = this.openAction[data.type].call(this, data, noPlay); } else { // wrong item type new CModalAlert(this.parent, _('Error'), _('Unknown type of selected item'), _('Close')); } return levelChange; }; /** * Clear the list and fill it again (will try to refocus) * @param {boolean} [refocus=true] if true then try to set focus to the previous focused element */ TVList.prototype.Refresh = function (refocus) { var data = {data : null}; // some media item is opened at the moment if ( this.parentItem !== null ) { // get current focused item this.Build(this.parentItem); if ( refocus !== false) { if ( this.activeItem ) { data = this.activeItem; } else { data = this.FirstMatch(this.filterText); } } // refill // find it in the new list if necessary if ( data && data.data ) { this.Reposition(data.data); } else { this.Reposition(data); } } }; /** * refresh list index in dom objects */ TVList.prototype.RefreshIndex = function () { this.channelStart = this.parentItem.type === MEDIA_TYPE_GROUP? 0 : -1; var i = 0, j = 1, items = this.handleInner.children, delta = 0; if ( this.parentItem !== null && items.length ) { delta = items[0].data.type === MEDIA_TYPE_BACK? 1: 0; for(i = delta; i < items.length; i++){ items[i].data.index = i - delta; if(items[i].data.type === MEDIA_TYPE_GROUP){ this.channelStart = i; } else { items[i].data.number = j; items[i].domNumber.innerHTML = j; j++; } } } else { this.Refresh(true); } }; /** * Moves the cursor to the given element * @param {Object} data * @return {boolean} operation status */ TVList.prototype.Reposition = function (data) { var change = false; if ( data ) { for ( var item, i = 0, l = this.Length(); i < l; i++ ) { item = this.handleInner.children[i]; // url and type match if (data.index === item.data.index || (data.data && !data.index && data.data.index === item.data.index)) { change = this.Focused(item, true); this.SetPosition(this.activeItem); // focus handle bug fix (even items per page problem) if(!change){ this.onFocus(item); } return change; } } } return false; }; /** * Handle checked state for the given item according to the file type. * Mark only items available for marking. * @param {Node} item the element to be processed * @param {boolean} state flag of the state * @return {boolean} operation status */ TVList.prototype.Marked = function (item, state) { // item exists and only allowed types if (item && item.data && item.data.markable) { // parent marking return CScrollList.prototype.Marked.call(this, item, state); } return false; }; /** * Show/hide file items according to the specified filter options * @param {string} text filter file name option */ TVList.prototype.SetFilterText = function (text) { echo('enter to SetFilterText : ' + this.filterText); // set global (case conversion for future string comparison speedup) this.filterText = text.toLowerCase(); // apply filter this.Filter(); }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function (item) { // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); self.Hidden(item, !text_ok); }); }; /** * Return all appropriate items available for actions (either marked or current with suitable type) * @return {Array} list of found Nodes */ TVList.prototype.ActiveItems = function () { // get all marked items var items = this.states.marked ? this.states.marked.slice() : []; // no marked, check current and its type if (items.length === 0 && this.activeItem && this.activeItem.data.markable) { items.push(this.activeItem); } return items; }; /** * Create group of channels */ TVList.prototype.createGroup = function (name, data, toDelete, deleteList) { var obj = {}, dataMap = []; var map = this.parentItem.data.map(function(item){return item.type === MEDIA_TYPE_GROUP?item.name:null;}); var toAdd = map.indexOf(name); echo(toDelete,'toDelete'); if(toAdd === -1){ obj.name = name; obj.type = MEDIA_TYPE_GROUP; obj.data = []; this.parentItem.data.splice(this.channelStart + 1, 0, obj); } else { dataMap = data.map(function(item){if(item.type === MEDIA_TYPE_GROUP){return item.name;}}); for(var i=0; i<dataMap.length; i++){ if(map.indexOf(dataMap[i]) !== -1){ new CModalAlert(currCPage,_('Error'),_('Copying error')); return false; } } obj = this.parentItem.data[toAdd]; } var ansvCode = this.addChannelsToList(obj.data, JSON.parse(JSON.stringify(data)), false, true); if(ansvCode !== 0){ this.parent.actionFileDelete(toDelete,deleteList); } this.Refresh(false); if(toAdd === -1){ this.Focused(this.handle.children[this.channelStart+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } else { this.Focused(this.handle.children[toAdd+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } if (this.isActive) { this.Activate(); } return true; }; /** * Add channels to group * @param {Array} list - group to add * @param {Array} data - channels array * @param {boolean} [refocus] - need refocus * @param {boolean} [noRefresh] - don't refresh list * @return {boolean} need checked list */ TVList.prototype.addChannelsToList = function (list, data, refocus, noRefresh) { echo(list,'ADD TO LIST'); echo(data,'ADD DATA'); var needCheck = false, tempList = [], channelStart = -1; var map = this.path.map(function(item){return item.data;}); var mapList = list.map(function(item){return item.type;}); channelStart = mapList.lastIndexOf(MEDIA_TYPE_GROUP); if (data){ for (var i = 0; i < data.length; i++) { if ( data[i].type === MEDIA_TYPE_GROUP && map.indexOf(data[i].data) !== -1 ){ new CModalAlert(this.parent,_('Error'),_('Copying error')); return 0; } } for ( i = 0; i < data.length; i++ ) { var needAdd = true; for (var j = 0; j < list.length; j++) { if (list[j].name === data[i].name && list[j].type === data[i].type && (list[j].url === data[i].url || list[j].sol +' '+ list[j].url === data[i].url || list[j].url === data[i].sol +' '+ data[i].url)) { needAdd = false; break; } } if (needAdd) { if(data[i].type === MEDIA_TYPE_GROUP){ channelStart++; list.splice(channelStart, 0, data[i]); } else { list.push(data[i]); } needCheck = true; } } } if(needCheck){ tempList = list.slice(); tempList = IPTVChannels.checkTS_data(tempList,true); list = tempList.a; } this.parent.needSave = true; if( !noRefresh ){ this.Refresh(refocus); } return needCheck; };
List(p
identifier_name
tvlist.js
'use strict'; /** * @class TVList * @constructor * @author Roman Stoian */ function TVList(parent) { // parent constructor CScrollList.call(this, parent); /** * link to the object for limited scopes * @type {TVList} */ var self = this; /** * link to the BreadCrumb component * @type {CBreadCrumb} */ this.bcrumb = null; /** * link to the BreadCrumb component * @type {CSearchBar} */ this.sbar = null; /** * type filter for file listing * @type Number */ this.filterType = MEDIA_TYPE_NONE; /** * data filter for file listing * @type String */ this.filterText = ''; /** * hierarchy change flag: no change * @type {number} */ this.LEVEL_CHANGE_NONE = 0; /** * hierarchy change flag: go level up * @type {number} */ this.LEVEL_CHANGE_UP = -1; /** * hierarchy change flag: go level deeper * @type {number} */ this.LEVEL_CHANGE_DOWN = 1; /** * list of all media types on the current level * @type {Array} */ this.mtypes = []; /** * list of media objects data * full chain from the root * @type {[Object]} */ this.path = []; /** * current media object opened * @type {Object} */ this.parentItem = {}; this.timer = {}; this.prevChannel = null; this.lastChannel = null; /** * list of action mapped to the media types * @type {[Function]} */ this.openAction = {}; this.openAction[MEDIA_TYPE_BACK] = function(){ var st = this.Back(); return st; }; this.openAction[MEDIA_TYPE_TV_ROOT] = function () { var j = 0; var item = null; this.channelStart = -1; this.Clear(); if ( this.filterText) { this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); this.channelStart++; } if (this.data.length > 0) { for (var i = 0; i < this.data.length; i++) { if (this.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: this.data[i].name}, {name: this.data[i].name, index: i, markable: true, data: this.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: this.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && this.data[i].tsOn}, {name: this.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(this.data[i].sol? this.data[i].sol + ' ' : '') + this.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop'; } else { if ( this.filterText) { self.parent.domURL.innerHTML = ''; self.parent.domInfoTitle.innerHTML = ''; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); this.parent.handle.querySelector('.content').querySelector('.crop').className = 'crop defImage'; } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_GROUP] = function (data) { var item = null; this.Clear(); this.Add({name: '..'}, {type: MEDIA_TYPE_BACK}); var j = 0; this.channelStart = -1; if (data.data.length > 0) { for (var i = 0; i < data.data.length; i++) { if (data.data[i].type === MEDIA_TYPE_GROUP) { item = this.Add({name: data.data[i].name}, {name: data.data[i].name, index: i, markable: true, data: data.data[i].data, type: MEDIA_TYPE_GROUP}); if(item){ this.channelStart = i; } } else { item = this.Add({name: data.data[i].name, number: j+1, tsOn: configuration.mayTimeShift && data.data[i].tsOn}, {name: data.data[i].name, markable: true, index: i, number: j+1, type: MEDIA_TYPE_STREAM}, {stared: FAVORITES_NEW[(data.data[i].sol? data.data[i].sol + ' ' : '') + data.data[i].url] ? true : false}); if(item){ j++; } } } self.parent.domInfoTitle.innerHTML = self.data[0].name?self.data[0].name:''; } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF1, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); } return this.LEVEL_CHANGE_DOWN; }; this.openAction[MEDIA_TYPE_STREAM] = function (data, noPlay) { if (MediaPlayer.obj !== self.parentItem.data[data.index] && !noPlay) { MediaPlayer.preparePlayer(self.parentItem.data[data.index], this.parent, true, true, true); } else { if (MediaPlayer.ts_inProgress) { if ( environment.ts_icon ){ MediaPlayer.domTSIndicator.style.display = 'block'; } MediaPlayer.runner.start(); } MediaPlayer.Show(true, this.parent); MediaPlayer.showInfo(true); MediaPlayer.timer.showInfo = setTimeout(function () { MediaPlayer.showInfo(false); }, 3000); } return this.LEVEL_CHANGE_NONE; }; } // extending TVList.prototype = Object.create(CScrollList.prototype); TVList.prototype.constructor = TVList; /** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetBreadCrumb = function ( component ) { this.bcrumb = component; }; /** * Setter for linked component * @param {CBase} component associated object */ TVList.prototype.SetSearchBar = function ( component ) { this.sbar = component; }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function(item){ // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); // check file type if regular file var type_ok = item.data.type === self.filterType || self.filterType === MEDIA_TYPE_NONE || item.data.type === MEDIA_TYPE_BACK; // hide not matching items self.Hidden(item, !(text_ok && type_ok)); }); }; /** * Finds the first appropriate item * @param {string} value * @return {Node} */ TVList.prototype.FirstMatch = function ( value ) { // preparing var items; if ( value === '' ) { return null; } items = this.handleInner.children; // all list items // iterate all items till all items are found for ( var i = 0; i < items.length; i++ ) { // floating pointer depends on direction var item = items[i]; // check file name if regular file if ( item.data.type !== MEDIA_TYPE_BACK && item.data.name && item.data.name.toLowerCase().indexOf(value.toLowerCase()) !== -1 ) { return item; } } return null; }; /** * Create new item and put it in the list * @param {string} obj item label * @param {Object} attrs set of item data parameters * @param {Object} states set of additional parameters (stared) * @return {Node} */ TVList.prototype.Add = function (obj, attrs, states) { var self = this, number; // is it necessary to filter if ( this.filterText) { // || this.filterType !== MEDIA_TYPE_NONE // check file name if regular file var text_ok = attrs.type === MEDIA_TYPE_BACK || (obj.name && obj.name.toLowerCase().indexOf(this.filterText.toLowerCase()) !== -1); // check file type if regular file var type_ok = attrs.type === this.filterType || this.filterType === MEDIA_TYPE_NONE || attrs.type === MEDIA_TYPE_BACK; // hide not matching items if ( !(text_ok && type_ok) ) { return null; } } if (this.mtypes.indexOf(attrs.type) === -1) { this.mtypes.push(attrs.type); } // html prepare var body = element('div', {className: 'data'}, obj.name); var star = element('div', {className: 'star'}); if (obj.number) { number = element('div', {className: 'number'}, obj.number); } else { number = element('div', {className: 'number'}); number.style.background = 'url("' + PATH_IMG_PUBLIC + 'media/type_' + attrs.type + '.png") no-repeat center'; } var timeshift = element('div', {className: obj.tsOn? 'timeshift tsOn' : 'timeshift'}); // decoration // make sure name is set if (!attrs.name) { attrs.name = obj.name; } // actual filling var item = CScrollList.prototype.Add.call(this, [number, body, timeshift, star], { star: star, data: attrs, // handlers onclick: function () { // open or enter the item this.self.Open(this.data); return false; }, oncontextmenu: EMULATION ? null : function () { // mark/unmark the item self.parent.actionF2(false); return false; } }); if(obj.number){ item.domNumber = number; } // mark as favourite if (states && states.stared) { item.self.SetStar(item, true); } return item; }; /** * Set inner item flags and decoration * @param {Node} item the element to be processed * @param {boolean} state flag of the operation (true if change is made) */ TVList.prototype.SetStar = function (item, state) { if (item.stared === state) { return; } this.SetState(item, 'stared', state); if (state !== false) { item.star.style.background = 'url("' + PATH_IMG_PUBLIC + 'ico_fav_s.png") no-repeat right'; } else { item.star.style.background = 'none'; } this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, state !== false ? true : false); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, state !== false ? false : true); }; /** * Hook method on focus item change * @param {Node} item the new focused item */ TVList.prototype.onFocus = function (item) { var self = this; if ( MediaPlayer.ts_inProgress ) { if (MediaPlayer.tsExitCheck('focus', item)) { return true; } } clearTimeout(this.timer.OnFocusPlay); if ( item.data.markable ) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, false); } else { this.parent.BPanel.Hidden(this.parent.BPanel.btnF2, true); } if (item.data.type === MEDIA_TYPE_STREAM) { if (!this.states.marked || this.states.marked.length === 0) { this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, item.stared); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, !item.stared); } else { echo(this.states.marked[0].data,'this.states.marked'); } } else {
self.parent.clearEPG(); this.timer.OnFocusPlay = setTimeout(function () { if ( item.data.type === MEDIA_TYPE_BACK ){ if(self.filterText){ self.parent.domInfoTitle.innerHTML = _('Contains the list of items corresponding to the given filter request'); } else { self.parent.domInfoTitle.innerHTML = self.parentItem.name?self.parentItem.name:''; } } else { self.parent.initEPGNow(); self.parent.domInfoTitle.innerHTML = item.data.name?item.data.name:''; } if (item.data.type === MEDIA_TYPE_STREAM) { self.prevChannel = self.lastChannel; self.lastChannel = self.parentItem.data[item.data.index]; self.parent.domURL.innerHTML = (self.parentItem.data[item.data.index].sol && self.parentItem.data[item.data.index].sol !==''?self.parentItem.data[item.data.index].sol+' ':'')+self.parentItem.data[item.data.index].url; if ( MediaPlayer.obj !== self.parentItem.data[item.data.index] ) { MediaPlayer.preparePlayer(self.parentItem.data[item.data.index], self.parent, true, false, true); } if ( self.parent.pvr.arr.length ) { self.parent.pvr.check(true); } } else { self.lastChannel = null; self.parent.domURL.innerHTML = ''; MediaPlayer.end(); } }, 500); return false; }; /** * Reset and clear all items * This will make the component ready for a new filling. */ TVList.prototype.Clear = function () { CScrollList.prototype.Clear.call(this); this.parent.domURL.innerHTML = ''; this.parent.domInfoTitle.innerHTML = ''; this.filterType = MEDIA_TYPE_NONE; this.mtypes = []; }; /** * Move one level up */ TVList.prototype.Back = function () { var self = this; // there are some levels if ( this.path.length > 1 ) { // exiting from favs and there are some changes // normal exit this.path.pop(); self.lastChannel = null; if ( this.bcrumb ) { this.bcrumb.Pop(); } // render the previous level this.Build(this.path[this.path.length-1]); // apply specific button visibility setTimeout(function(){ self.onFocus(self.Current()); }, 0); // go up return this.LEVEL_CHANGE_UP; } // stay here return this.LEVEL_CHANGE_NONE; }; /** * Go to channel by number * @param {number} number */ TVList.prototype.goToChannel = function (number) { if (this.handle.children.length > number && number > this.channelStart) { this.Focused(this.handle.children[number+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); this.SetPosition(this.activeItem); } }; /** * Enter the item or open it * @param {Object} data media item inner data */ TVList.prototype.Open = function (data, noPlay) { // render the list echo(data,'data Open'); var levelChange = this.Build(data, noPlay); // level changed if ( levelChange !== this.LEVEL_CHANGE_NONE ) { // reset tray filter icon if ( this.parent.Tray.iconFilter.parentNode === this.parent.Tray.handleInner ) { this.parent.Tray.handleInner.removeChild(this.parent.Tray.iconFilter); } // and hide at all if not necessary this.parent.Tray.Show(globalBuffer.size() > 0, false); // particular direction if ( levelChange === this.LEVEL_CHANGE_DOWN ) { // build breadcrumbs if ( this.filterText ) { // filter if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/ico_filter.png', this.filterText); } } else { // default // build breadcrumbs if ( this.bcrumb ) { this.bcrumb.Push('/', 'media/type_'+data.type+'.png', data.name ? data.name : ''); } } // save this step this.path.push(data); // sef focus to the first item this.Activate(true); if( data.data && data.data.length ){ this.onFocus(this.activeItem); } } else { // go up if ( !this.Reposition(this.parentItem) ){ this.Activate(true); } } // current level item this.parentItem = this.path[this.path.length-1]; } return levelChange; }; /** * Open root, clear all breadcrumbs, search options */ TVList.prototype.Reset = function () { this.parentItem = null; this.path = []; this.Clear(); // linked components if ( this.bcrumb ) { this.bcrumb.Reset(); } if ( this.sbar ) { this.sbar.Reset(); } }; /** * Renders the given media item by executing associated action * @param {Object} data media item inner data */ TVList.prototype.Build = function (data, noPlay) { var levelChange = this.LEVEL_CHANGE_NONE; // apply filter parameter from the current node this.filterText = data.filterText ? data.filterText : ''; // get item associated open action and execute if ( data && data.type && typeof this.openAction[data.type] === 'function' ) { levelChange = this.openAction[data.type].call(this, data, noPlay); } else { // wrong item type new CModalAlert(this.parent, _('Error'), _('Unknown type of selected item'), _('Close')); } return levelChange; }; /** * Clear the list and fill it again (will try to refocus) * @param {boolean} [refocus=true] if true then try to set focus to the previous focused element */ TVList.prototype.Refresh = function (refocus) { var data = {data : null}; // some media item is opened at the moment if ( this.parentItem !== null ) { // get current focused item this.Build(this.parentItem); if ( refocus !== false) { if ( this.activeItem ) { data = this.activeItem; } else { data = this.FirstMatch(this.filterText); } } // refill // find it in the new list if necessary if ( data && data.data ) { this.Reposition(data.data); } else { this.Reposition(data); } } }; /** * refresh list index in dom objects */ TVList.prototype.RefreshIndex = function () { this.channelStart = this.parentItem.type === MEDIA_TYPE_GROUP? 0 : -1; var i = 0, j = 1, items = this.handleInner.children, delta = 0; if ( this.parentItem !== null && items.length ) { delta = items[0].data.type === MEDIA_TYPE_BACK? 1: 0; for(i = delta; i < items.length; i++){ items[i].data.index = i - delta; if(items[i].data.type === MEDIA_TYPE_GROUP){ this.channelStart = i; } else { items[i].data.number = j; items[i].domNumber.innerHTML = j; j++; } } } else { this.Refresh(true); } }; /** * Moves the cursor to the given element * @param {Object} data * @return {boolean} operation status */ TVList.prototype.Reposition = function (data) { var change = false; if ( data ) { for ( var item, i = 0, l = this.Length(); i < l; i++ ) { item = this.handleInner.children[i]; // url and type match if (data.index === item.data.index || (data.data && !data.index && data.data.index === item.data.index)) { change = this.Focused(item, true); this.SetPosition(this.activeItem); // focus handle bug fix (even items per page problem) if(!change){ this.onFocus(item); } return change; } } } return false; }; /** * Handle checked state for the given item according to the file type. * Mark only items available for marking. * @param {Node} item the element to be processed * @param {boolean} state flag of the state * @return {boolean} operation status */ TVList.prototype.Marked = function (item, state) { // item exists and only allowed types if (item && item.data && item.data.markable) { // parent marking return CScrollList.prototype.Marked.call(this, item, state); } return false; }; /** * Show/hide file items according to the specified filter options * @param {string} text filter file name option */ TVList.prototype.SetFilterText = function (text) { echo('enter to SetFilterText : ' + this.filterText); // set global (case conversion for future string comparison speedup) this.filterText = text.toLowerCase(); // apply filter this.Filter(); }; /** * Shows/hides items depending on the given filter string match * unmarks all hidden items */ TVList.prototype.Filter = function () { // link to the object for limited scopes var self = this; // check all items this.Each(function (item) { // check file name if regular file var text_ok = item.data.type === MEDIA_TYPE_BACK || (item.data.name && item.data.name.toLowerCase().indexOf(self.filterText) !== -1); self.Hidden(item, !text_ok); }); }; /** * Return all appropriate items available for actions (either marked or current with suitable type) * @return {Array} list of found Nodes */ TVList.prototype.ActiveItems = function () { // get all marked items var items = this.states.marked ? this.states.marked.slice() : []; // no marked, check current and its type if (items.length === 0 && this.activeItem && this.activeItem.data.markable) { items.push(this.activeItem); } return items; }; /** * Create group of channels */ TVList.prototype.createGroup = function (name, data, toDelete, deleteList) { var obj = {}, dataMap = []; var map = this.parentItem.data.map(function(item){return item.type === MEDIA_TYPE_GROUP?item.name:null;}); var toAdd = map.indexOf(name); echo(toDelete,'toDelete'); if(toAdd === -1){ obj.name = name; obj.type = MEDIA_TYPE_GROUP; obj.data = []; this.parentItem.data.splice(this.channelStart + 1, 0, obj); } else { dataMap = data.map(function(item){if(item.type === MEDIA_TYPE_GROUP){return item.name;}}); for(var i=0; i<dataMap.length; i++){ if(map.indexOf(dataMap[i]) !== -1){ new CModalAlert(currCPage,_('Error'),_('Copying error')); return false; } } obj = this.parentItem.data[toAdd]; } var ansvCode = this.addChannelsToList(obj.data, JSON.parse(JSON.stringify(data)), false, true); if(ansvCode !== 0){ this.parent.actionFileDelete(toDelete,deleteList); } this.Refresh(false); if(toAdd === -1){ this.Focused(this.handle.children[this.channelStart+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } else { this.Focused(this.handle.children[toAdd+(this.handle.children[0].data.type === MEDIA_TYPE_BACK? 1:0)], true); } if (this.isActive) { this.Activate(); } return true; }; /** * Add channels to group * @param {Array} list - group to add * @param {Array} data - channels array * @param {boolean} [refocus] - need refocus * @param {boolean} [noRefresh] - don't refresh list * @return {boolean} need checked list */ TVList.prototype.addChannelsToList = function (list, data, refocus, noRefresh) { echo(list,'ADD TO LIST'); echo(data,'ADD DATA'); var needCheck = false, tempList = [], channelStart = -1; var map = this.path.map(function(item){return item.data;}); var mapList = list.map(function(item){return item.type;}); channelStart = mapList.lastIndexOf(MEDIA_TYPE_GROUP); if (data){ for (var i = 0; i < data.length; i++) { if ( data[i].type === MEDIA_TYPE_GROUP && map.indexOf(data[i].data) !== -1 ){ new CModalAlert(this.parent,_('Error'),_('Copying error')); return 0; } } for ( i = 0; i < data.length; i++ ) { var needAdd = true; for (var j = 0; j < list.length; j++) { if (list[j].name === data[i].name && list[j].type === data[i].type && (list[j].url === data[i].url || list[j].sol +' '+ list[j].url === data[i].url || list[j].url === data[i].sol +' '+ data[i].url)) { needAdd = false; break; } } if (needAdd) { if(data[i].type === MEDIA_TYPE_GROUP){ channelStart++; list.splice(channelStart, 0, data[i]); } else { list.push(data[i]); } needCheck = true; } } } if(needCheck){ tempList = list.slice(); tempList = IPTVChannels.checkTS_data(tempList,true); list = tempList.a; } this.parent.needSave = true; if( !noRefresh ){ this.Refresh(refocus); } return needCheck; };
this.parent.BPanel.Hidden(this.parent.BPanel.btnF3add, true); this.parent.BPanel.Hidden(this.parent.BPanel.btnF3del, true); }
conditional_block
server.rs
// Copyright (c) 2019 Parity Technologies (UK) Ltd. // // Licensed under the Apache License, Version 2.0 // <LICENSE-APACHE or http://www.apache.org/licenses/LICENSE-2.0> or the MIT // license <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your // option. All files in the project carrying such notice may not be copied, // modified, or distributed except according to those terms. //! Websocket server [handshake]. //! //! [handshake]: https://tools.ietf.org/html/rfc6455#section-4 use super::{ append_extensions, configure_extensions, expect_ascii_header, with_first_header, Error, WebSocketKey, MAX_NUM_HEADERS, SEC_WEBSOCKET_EXTENSIONS, SEC_WEBSOCKET_PROTOCOL, }; use crate::connection::{self, Mode}; use crate::extension::Extension; use bytes::BytesMut; use futures::prelude::*; use std::{mem, str}; // Most HTTP servers default to 8KB limit on headers const MAX_HEADERS_SIZE: usize = 8 * 1024; const BLOCK_SIZE: usize = 8 * 1024; /// Websocket handshake server. #[derive(Debug)] pub struct Server<'a, T> { socket: T, /// Protocols the server supports. protocols: Vec<&'a str>, /// Extensions the server supports. extensions: Vec<Box<dyn Extension + Send>>, /// Encoding/decoding buffer. buffer: BytesMut, } impl<'a, T: AsyncRead + AsyncWrite + Unpin> Server<'a, T> { /// Create a new server handshake. pub fn new(socket: T) -> Self { Server { socket, protocols: Vec::new(), extensions: Vec::new(), buffer: BytesMut::new() } } /// Override the buffer to use for request/response handling. pub fn set_buffer(&mut self, b: BytesMut) -> &mut Self { self.buffer = b; self } /// Extract the buffer. pub fn take_buffer(&mut self) -> BytesMut { mem::take(&mut self.buffer) } /// Add a protocol the server supports. pub fn add_protocol(&mut self, p: &'a str) -> &mut Self { self.protocols.push(p); self } /// Add an extension the server supports. pub fn add_extension(&mut self, e: Box<dyn Extension + Send>) -> &mut Self { self.extensions.push(e); self } /// Get back all extensions. pub fn drain_extensions(&mut self) -> impl Iterator<Item = Box<dyn Extension + Send>> + '_ { self.extensions.drain(..) } /// Await an incoming client handshake request. pub async fn receive_request(&mut self) -> Result<ClientRequest<'_>, Error> { self.buffer.clear(); let mut skip = 0; loop { crate::read(&mut self.socket, &mut self.buffer, BLOCK_SIZE).await?; let limit = std::cmp::min(self.buffer.len(), MAX_HEADERS_SIZE); // We don't expect body, so can search for the CRLF headers tail from // the end of the buffer. if self.buffer[skip..limit].windows(4).rev().any(|w| w == b"\r\n\r\n") { break; } // Give up if we've reached the limit. We could emit a specific error here, // but httparse will produce meaningful error for us regardless. if limit == MAX_HEADERS_SIZE { break; } // Skip bytes that did not contain CRLF in the next iteration. // If we only read a partial CRLF sequence, we would miss it if we skipped the full buffer // length, hence backing off the full 4 bytes. skip = self.buffer.len().saturating_sub(4); } self.decode_request() } /// Respond to the client. pub async fn send_response(&mut self, r: &Response<'_>) -> Result<(), Error> { self.buffer.clear(); self.encode_response(r); self.socket.write_all(&self.buffer).await?; self.socket.flush().await?; self.buffer.clear(); Ok(()) } /// Turn this handshake into a [`connection::Builder`]. pub fn into_builder(mut self) -> connection::Builder<T> { let mut builder = connection::Builder::new(self.socket, Mode::Server); builder.set_buffer(self.buffer); builder.add_extensions(self.extensions.drain(..)); builder } /// Get out the inner socket of the server. pub fn into_inner(self) -> T {
let mut header_buf = [httparse::EMPTY_HEADER; MAX_NUM_HEADERS]; let mut request = httparse::Request::new(&mut header_buf); match request.parse(self.buffer.as_ref()) { Ok(httparse::Status::Complete(_)) => (), Ok(httparse::Status::Partial) => return Err(Error::IncompleteHttpRequest), Err(e) => return Err(Error::Http(Box::new(e))), }; if request.method != Some("GET") { return Err(Error::InvalidRequestMethod); } if request.version != Some(1) { return Err(Error::UnsupportedHttpVersion); } let host = with_first_header(&request.headers, "Host", Ok)?; expect_ascii_header(request.headers, "Upgrade", "websocket")?; expect_ascii_header(request.headers, "Connection", "upgrade")?; expect_ascii_header(request.headers, "Sec-WebSocket-Version", "13")?; let origin = request.headers.iter().find_map( |h| { if h.name.eq_ignore_ascii_case("Origin") { Some(h.value) } else { None } }, ); let headers = RequestHeaders { host, origin }; let ws_key = with_first_header(&request.headers, "Sec-WebSocket-Key", |k| { WebSocketKey::try_from(k).map_err(|_| Error::SecWebSocketKeyInvalidLength(k.len())) })?; for h in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_EXTENSIONS)) { configure_extensions(&mut self.extensions, std::str::from_utf8(h.value)?)? } let mut protocols = Vec::new(); for p in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_PROTOCOL)) { if let Some(&p) = self.protocols.iter().find(|x| x.as_bytes() == p.value) { protocols.push(p) } } let path = request.path.unwrap_or("/"); Ok(ClientRequest { ws_key, protocols, path, headers }) } // Encode server handshake response. fn encode_response(&mut self, response: &Response<'_>) { match response { Response::Accept { key, protocol } => { let accept_value = super::generate_accept_key(&key); self.buffer.extend_from_slice( concat![ "HTTP/1.1 101 Switching Protocols", "\r\nServer: soketto-", env!("CARGO_PKG_VERSION"), "\r\nUpgrade: websocket", "\r\nConnection: upgrade", "\r\nSec-WebSocket-Accept: ", ] .as_bytes(), ); self.buffer.extend_from_slice(&accept_value); if let Some(p) = protocol { self.buffer.extend_from_slice(b"\r\nSec-WebSocket-Protocol: "); self.buffer.extend_from_slice(p.as_bytes()) } append_extensions(self.extensions.iter().filter(|e| e.is_enabled()), &mut self.buffer); self.buffer.extend_from_slice(b"\r\n\r\n") } Response::Reject { status_code } => { self.buffer.extend_from_slice(b"HTTP/1.1 "); let (_, reason) = if let Ok(i) = STATUSCODES.binary_search_by_key(status_code, |(n, _)| *n) { STATUSCODES[i] } else { (500, "500 Internal Server Error") }; self.buffer.extend_from_slice(reason.as_bytes()); self.buffer.extend_from_slice(b"\r\n\r\n") } } } } /// Handshake request received from the client. #[derive(Debug)] pub struct ClientRequest<'a> { ws_key: WebSocketKey, protocols: Vec<&'a str>, path: &'a str, headers: RequestHeaders<'a>, } /// Select HTTP headers sent by the client. #[derive(Debug, Copy, Clone)] pub struct RequestHeaders<'a> { /// The [`Host`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Host) header. pub host: &'a [u8], /// The [`Origin`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Origin) header, if provided. pub origin: Option<&'a [u8]>, } impl<'a> ClientRequest<'a> { /// The `Sec-WebSocket-Key` header nonce value. pub fn key(&self) -> WebSocketKey { self.ws_key } /// The protocols the client is proposing. pub fn protocols(&self) -> impl Iterator<Item = &str> { self.protocols.iter().cloned() } /// The path the client is requesting. pub fn path(&self) -> &str { self.path } /// Select HTTP headers sent by the client. pub fn headers(&self) -> RequestHeaders { self.headers } } /// Handshake response the server sends back to the client. #[derive(Debug)] pub enum Response<'a> { /// The server accepts the handshake request. Accept { key: WebSocketKey, protocol: Option<&'a str> }, /// The server rejects the handshake request. Reject { status_code: u16 }, } /// Known status codes and their reason phrases. const STATUSCODES: &[(u16, &str)] = &[ (100, "100 Continue"), (101, "101 Switching Protocols"), (102, "102 Processing"), (200, "200 OK"), (201, "201 Created"), (202, "202 Accepted"), (203, "203 Non Authoritative Information"), (204, "204 No Content"), (205, "205 Reset Content"), (206, "206 Partial Content"), (207, "207 Multi-Status"), (208, "208 Already Reported"), (226, "226 IM Used"), (300, "300 Multiple Choices"), (301, "301 Moved Permanently"), (302, "302 Found"), (303, "303 See Other"), (304, "304 Not Modified"), (305, "305 Use Proxy"), (307, "307 Temporary Redirect"), (308, "308 Permanent Redirect"), (400, "400 Bad Request"), (401, "401 Unauthorized"), (402, "402 Payment Required"), (403, "403 Forbidden"), (404, "404 Not Found"), (405, "405 Method Not Allowed"), (406, "406 Not Acceptable"), (407, "407 Proxy Authentication Required"), (408, "408 Request Timeout"), (409, "409 Conflict"), (410, "410 Gone"), (411, "411 Length Required"), (412, "412 Precondition Failed"), (413, "413 Payload Too Large"), (414, "414 URI Too Long"), (415, "415 Unsupported Media Type"), (416, "416 Range Not Satisfiable"), (417, "417 Expectation Failed"), (418, "418 I'm a teapot"), (421, "421 Misdirected Request"), (422, "422 Unprocessable Entity"), (423, "423 Locked"), (424, "424 Failed Dependency"), (426, "426 Upgrade Required"), (428, "428 Precondition Required"), (429, "429 Too Many Requests"), (431, "431 Request Header Fields Too Large"), (451, "451 Unavailable For Legal Reasons"), (500, "500 Internal Server Error"), (501, "501 Not Implemented"), (502, "502 Bad Gateway"), (503, "503 Service Unavailable"), (504, "504 Gateway Timeout"), (505, "505 HTTP Version Not Supported"), (506, "506 Variant Also Negotiates"), (507, "507 Insufficient Storage"), (508, "508 Loop Detected"), (510, "510 Not Extended"), (511, "511 Network Authentication Required"), ];
self.socket } // Decode client handshake request. fn decode_request(&mut self) -> Result<ClientRequest, Error> {
random_line_split
server.rs
// Copyright (c) 2019 Parity Technologies (UK) Ltd. // // Licensed under the Apache License, Version 2.0 // <LICENSE-APACHE or http://www.apache.org/licenses/LICENSE-2.0> or the MIT // license <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your // option. All files in the project carrying such notice may not be copied, // modified, or distributed except according to those terms. //! Websocket server [handshake]. //! //! [handshake]: https://tools.ietf.org/html/rfc6455#section-4 use super::{ append_extensions, configure_extensions, expect_ascii_header, with_first_header, Error, WebSocketKey, MAX_NUM_HEADERS, SEC_WEBSOCKET_EXTENSIONS, SEC_WEBSOCKET_PROTOCOL, }; use crate::connection::{self, Mode}; use crate::extension::Extension; use bytes::BytesMut; use futures::prelude::*; use std::{mem, str}; // Most HTTP servers default to 8KB limit on headers const MAX_HEADERS_SIZE: usize = 8 * 1024; const BLOCK_SIZE: usize = 8 * 1024; /// Websocket handshake server. #[derive(Debug)] pub struct Server<'a, T> { socket: T, /// Protocols the server supports. protocols: Vec<&'a str>, /// Extensions the server supports. extensions: Vec<Box<dyn Extension + Send>>, /// Encoding/decoding buffer. buffer: BytesMut, } impl<'a, T: AsyncRead + AsyncWrite + Unpin> Server<'a, T> { /// Create a new server handshake. pub fn new(socket: T) -> Self { Server { socket, protocols: Vec::new(), extensions: Vec::new(), buffer: BytesMut::new() } } /// Override the buffer to use for request/response handling. pub fn set_buffer(&mut self, b: BytesMut) -> &mut Self { self.buffer = b; self } /// Extract the buffer. pub fn take_buffer(&mut self) -> BytesMut { mem::take(&mut self.buffer) } /// Add a protocol the server supports. pub fn add_protocol(&mut self, p: &'a str) -> &mut Self { self.protocols.push(p); self } /// Add an extension the server supports. pub fn add_extension(&mut self, e: Box<dyn Extension + Send>) -> &mut Self { self.extensions.push(e); self } /// Get back all extensions. pub fn drain_extensions(&mut self) -> impl Iterator<Item = Box<dyn Extension + Send>> + '_ { self.extensions.drain(..) } /// Await an incoming client handshake request. pub async fn receive_request(&mut self) -> Result<ClientRequest<'_>, Error> { self.buffer.clear(); let mut skip = 0; loop { crate::read(&mut self.socket, &mut self.buffer, BLOCK_SIZE).await?; let limit = std::cmp::min(self.buffer.len(), MAX_HEADERS_SIZE); // We don't expect body, so can search for the CRLF headers tail from // the end of the buffer. if self.buffer[skip..limit].windows(4).rev().any(|w| w == b"\r\n\r\n") { break; } // Give up if we've reached the limit. We could emit a specific error here, // but httparse will produce meaningful error for us regardless. if limit == MAX_HEADERS_SIZE { break; } // Skip bytes that did not contain CRLF in the next iteration. // If we only read a partial CRLF sequence, we would miss it if we skipped the full buffer // length, hence backing off the full 4 bytes. skip = self.buffer.len().saturating_sub(4); } self.decode_request() } /// Respond to the client. pub async fn send_response(&mut self, r: &Response<'_>) -> Result<(), Error> { self.buffer.clear(); self.encode_response(r); self.socket.write_all(&self.buffer).await?; self.socket.flush().await?; self.buffer.clear(); Ok(()) } /// Turn this handshake into a [`connection::Builder`]. pub fn into_builder(mut self) -> connection::Builder<T> { let mut builder = connection::Builder::new(self.socket, Mode::Server); builder.set_buffer(self.buffer); builder.add_extensions(self.extensions.drain(..)); builder } /// Get out the inner socket of the server. pub fn into_inner(self) -> T { self.socket } // Decode client handshake request. fn decode_request(&mut self) -> Result<ClientRequest, Error> { let mut header_buf = [httparse::EMPTY_HEADER; MAX_NUM_HEADERS]; let mut request = httparse::Request::new(&mut header_buf); match request.parse(self.buffer.as_ref()) { Ok(httparse::Status::Complete(_)) => (), Ok(httparse::Status::Partial) => return Err(Error::IncompleteHttpRequest), Err(e) => return Err(Error::Http(Box::new(e))), }; if request.method != Some("GET") { return Err(Error::InvalidRequestMethod); } if request.version != Some(1) { return Err(Error::UnsupportedHttpVersion); } let host = with_first_header(&request.headers, "Host", Ok)?; expect_ascii_header(request.headers, "Upgrade", "websocket")?; expect_ascii_header(request.headers, "Connection", "upgrade")?; expect_ascii_header(request.headers, "Sec-WebSocket-Version", "13")?; let origin = request.headers.iter().find_map( |h| { if h.name.eq_ignore_ascii_case("Origin") { Some(h.value) } else { None } }, ); let headers = RequestHeaders { host, origin }; let ws_key = with_first_header(&request.headers, "Sec-WebSocket-Key", |k| { WebSocketKey::try_from(k).map_err(|_| Error::SecWebSocketKeyInvalidLength(k.len())) })?; for h in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_EXTENSIONS)) { configure_extensions(&mut self.extensions, std::str::from_utf8(h.value)?)? } let mut protocols = Vec::new(); for p in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_PROTOCOL)) { if let Some(&p) = self.protocols.iter().find(|x| x.as_bytes() == p.value)
} let path = request.path.unwrap_or("/"); Ok(ClientRequest { ws_key, protocols, path, headers }) } // Encode server handshake response. fn encode_response(&mut self, response: &Response<'_>) { match response { Response::Accept { key, protocol } => { let accept_value = super::generate_accept_key(&key); self.buffer.extend_from_slice( concat![ "HTTP/1.1 101 Switching Protocols", "\r\nServer: soketto-", env!("CARGO_PKG_VERSION"), "\r\nUpgrade: websocket", "\r\nConnection: upgrade", "\r\nSec-WebSocket-Accept: ", ] .as_bytes(), ); self.buffer.extend_from_slice(&accept_value); if let Some(p) = protocol { self.buffer.extend_from_slice(b"\r\nSec-WebSocket-Protocol: "); self.buffer.extend_from_slice(p.as_bytes()) } append_extensions(self.extensions.iter().filter(|e| e.is_enabled()), &mut self.buffer); self.buffer.extend_from_slice(b"\r\n\r\n") } Response::Reject { status_code } => { self.buffer.extend_from_slice(b"HTTP/1.1 "); let (_, reason) = if let Ok(i) = STATUSCODES.binary_search_by_key(status_code, |(n, _)| *n) { STATUSCODES[i] } else { (500, "500 Internal Server Error") }; self.buffer.extend_from_slice(reason.as_bytes()); self.buffer.extend_from_slice(b"\r\n\r\n") } } } } /// Handshake request received from the client. #[derive(Debug)] pub struct ClientRequest<'a> { ws_key: WebSocketKey, protocols: Vec<&'a str>, path: &'a str, headers: RequestHeaders<'a>, } /// Select HTTP headers sent by the client. #[derive(Debug, Copy, Clone)] pub struct RequestHeaders<'a> { /// The [`Host`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Host) header. pub host: &'a [u8], /// The [`Origin`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Origin) header, if provided. pub origin: Option<&'a [u8]>, } impl<'a> ClientRequest<'a> { /// The `Sec-WebSocket-Key` header nonce value. pub fn key(&self) -> WebSocketKey { self.ws_key } /// The protocols the client is proposing. pub fn protocols(&self) -> impl Iterator<Item = &str> { self.protocols.iter().cloned() } /// The path the client is requesting. pub fn path(&self) -> &str { self.path } /// Select HTTP headers sent by the client. pub fn headers(&self) -> RequestHeaders { self.headers } } /// Handshake response the server sends back to the client. #[derive(Debug)] pub enum Response<'a> { /// The server accepts the handshake request. Accept { key: WebSocketKey, protocol: Option<&'a str> }, /// The server rejects the handshake request. Reject { status_code: u16 }, } /// Known status codes and their reason phrases. const STATUSCODES: &[(u16, &str)] = &[ (100, "100 Continue"), (101, "101 Switching Protocols"), (102, "102 Processing"), (200, "200 OK"), (201, "201 Created"), (202, "202 Accepted"), (203, "203 Non Authoritative Information"), (204, "204 No Content"), (205, "205 Reset Content"), (206, "206 Partial Content"), (207, "207 Multi-Status"), (208, "208 Already Reported"), (226, "226 IM Used"), (300, "300 Multiple Choices"), (301, "301 Moved Permanently"), (302, "302 Found"), (303, "303 See Other"), (304, "304 Not Modified"), (305, "305 Use Proxy"), (307, "307 Temporary Redirect"), (308, "308 Permanent Redirect"), (400, "400 Bad Request"), (401, "401 Unauthorized"), (402, "402 Payment Required"), (403, "403 Forbidden"), (404, "404 Not Found"), (405, "405 Method Not Allowed"), (406, "406 Not Acceptable"), (407, "407 Proxy Authentication Required"), (408, "408 Request Timeout"), (409, "409 Conflict"), (410, "410 Gone"), (411, "411 Length Required"), (412, "412 Precondition Failed"), (413, "413 Payload Too Large"), (414, "414 URI Too Long"), (415, "415 Unsupported Media Type"), (416, "416 Range Not Satisfiable"), (417, "417 Expectation Failed"), (418, "418 I'm a teapot"), (421, "421 Misdirected Request"), (422, "422 Unprocessable Entity"), (423, "423 Locked"), (424, "424 Failed Dependency"), (426, "426 Upgrade Required"), (428, "428 Precondition Required"), (429, "429 Too Many Requests"), (431, "431 Request Header Fields Too Large"), (451, "451 Unavailable For Legal Reasons"), (500, "500 Internal Server Error"), (501, "501 Not Implemented"), (502, "502 Bad Gateway"), (503, "503 Service Unavailable"), (504, "504 Gateway Timeout"), (505, "505 HTTP Version Not Supported"), (506, "506 Variant Also Negotiates"), (507, "507 Insufficient Storage"), (508, "508 Loop Detected"), (510, "510 Not Extended"), (511, "511 Network Authentication Required"), ];
{ protocols.push(p) }
conditional_block
server.rs
// Copyright (c) 2019 Parity Technologies (UK) Ltd. // // Licensed under the Apache License, Version 2.0 // <LICENSE-APACHE or http://www.apache.org/licenses/LICENSE-2.0> or the MIT // license <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your // option. All files in the project carrying such notice may not be copied, // modified, or distributed except according to those terms. //! Websocket server [handshake]. //! //! [handshake]: https://tools.ietf.org/html/rfc6455#section-4 use super::{ append_extensions, configure_extensions, expect_ascii_header, with_first_header, Error, WebSocketKey, MAX_NUM_HEADERS, SEC_WEBSOCKET_EXTENSIONS, SEC_WEBSOCKET_PROTOCOL, }; use crate::connection::{self, Mode}; use crate::extension::Extension; use bytes::BytesMut; use futures::prelude::*; use std::{mem, str}; // Most HTTP servers default to 8KB limit on headers const MAX_HEADERS_SIZE: usize = 8 * 1024; const BLOCK_SIZE: usize = 8 * 1024; /// Websocket handshake server. #[derive(Debug)] pub struct Server<'a, T> { socket: T, /// Protocols the server supports. protocols: Vec<&'a str>, /// Extensions the server supports. extensions: Vec<Box<dyn Extension + Send>>, /// Encoding/decoding buffer. buffer: BytesMut, } impl<'a, T: AsyncRead + AsyncWrite + Unpin> Server<'a, T> { /// Create a new server handshake. pub fn new(socket: T) -> Self { Server { socket, protocols: Vec::new(), extensions: Vec::new(), buffer: BytesMut::new() } } /// Override the buffer to use for request/response handling. pub fn set_buffer(&mut self, b: BytesMut) -> &mut Self { self.buffer = b; self } /// Extract the buffer. pub fn take_buffer(&mut self) -> BytesMut { mem::take(&mut self.buffer) } /// Add a protocol the server supports. pub fn add_protocol(&mut self, p: &'a str) -> &mut Self { self.protocols.push(p); self } /// Add an extension the server supports. pub fn add_extension(&mut self, e: Box<dyn Extension + Send>) -> &mut Self { self.extensions.push(e); self } /// Get back all extensions. pub fn drain_extensions(&mut self) -> impl Iterator<Item = Box<dyn Extension + Send>> + '_
/// Await an incoming client handshake request. pub async fn receive_request(&mut self) -> Result<ClientRequest<'_>, Error> { self.buffer.clear(); let mut skip = 0; loop { crate::read(&mut self.socket, &mut self.buffer, BLOCK_SIZE).await?; let limit = std::cmp::min(self.buffer.len(), MAX_HEADERS_SIZE); // We don't expect body, so can search for the CRLF headers tail from // the end of the buffer. if self.buffer[skip..limit].windows(4).rev().any(|w| w == b"\r\n\r\n") { break; } // Give up if we've reached the limit. We could emit a specific error here, // but httparse will produce meaningful error for us regardless. if limit == MAX_HEADERS_SIZE { break; } // Skip bytes that did not contain CRLF in the next iteration. // If we only read a partial CRLF sequence, we would miss it if we skipped the full buffer // length, hence backing off the full 4 bytes. skip = self.buffer.len().saturating_sub(4); } self.decode_request() } /// Respond to the client. pub async fn send_response(&mut self, r: &Response<'_>) -> Result<(), Error> { self.buffer.clear(); self.encode_response(r); self.socket.write_all(&self.buffer).await?; self.socket.flush().await?; self.buffer.clear(); Ok(()) } /// Turn this handshake into a [`connection::Builder`]. pub fn into_builder(mut self) -> connection::Builder<T> { let mut builder = connection::Builder::new(self.socket, Mode::Server); builder.set_buffer(self.buffer); builder.add_extensions(self.extensions.drain(..)); builder } /// Get out the inner socket of the server. pub fn into_inner(self) -> T { self.socket } // Decode client handshake request. fn decode_request(&mut self) -> Result<ClientRequest, Error> { let mut header_buf = [httparse::EMPTY_HEADER; MAX_NUM_HEADERS]; let mut request = httparse::Request::new(&mut header_buf); match request.parse(self.buffer.as_ref()) { Ok(httparse::Status::Complete(_)) => (), Ok(httparse::Status::Partial) => return Err(Error::IncompleteHttpRequest), Err(e) => return Err(Error::Http(Box::new(e))), }; if request.method != Some("GET") { return Err(Error::InvalidRequestMethod); } if request.version != Some(1) { return Err(Error::UnsupportedHttpVersion); } let host = with_first_header(&request.headers, "Host", Ok)?; expect_ascii_header(request.headers, "Upgrade", "websocket")?; expect_ascii_header(request.headers, "Connection", "upgrade")?; expect_ascii_header(request.headers, "Sec-WebSocket-Version", "13")?; let origin = request.headers.iter().find_map( |h| { if h.name.eq_ignore_ascii_case("Origin") { Some(h.value) } else { None } }, ); let headers = RequestHeaders { host, origin }; let ws_key = with_first_header(&request.headers, "Sec-WebSocket-Key", |k| { WebSocketKey::try_from(k).map_err(|_| Error::SecWebSocketKeyInvalidLength(k.len())) })?; for h in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_EXTENSIONS)) { configure_extensions(&mut self.extensions, std::str::from_utf8(h.value)?)? } let mut protocols = Vec::new(); for p in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_PROTOCOL)) { if let Some(&p) = self.protocols.iter().find(|x| x.as_bytes() == p.value) { protocols.push(p) } } let path = request.path.unwrap_or("/"); Ok(ClientRequest { ws_key, protocols, path, headers }) } // Encode server handshake response. fn encode_response(&mut self, response: &Response<'_>) { match response { Response::Accept { key, protocol } => { let accept_value = super::generate_accept_key(&key); self.buffer.extend_from_slice( concat![ "HTTP/1.1 101 Switching Protocols", "\r\nServer: soketto-", env!("CARGO_PKG_VERSION"), "\r\nUpgrade: websocket", "\r\nConnection: upgrade", "\r\nSec-WebSocket-Accept: ", ] .as_bytes(), ); self.buffer.extend_from_slice(&accept_value); if let Some(p) = protocol { self.buffer.extend_from_slice(b"\r\nSec-WebSocket-Protocol: "); self.buffer.extend_from_slice(p.as_bytes()) } append_extensions(self.extensions.iter().filter(|e| e.is_enabled()), &mut self.buffer); self.buffer.extend_from_slice(b"\r\n\r\n") } Response::Reject { status_code } => { self.buffer.extend_from_slice(b"HTTP/1.1 "); let (_, reason) = if let Ok(i) = STATUSCODES.binary_search_by_key(status_code, |(n, _)| *n) { STATUSCODES[i] } else { (500, "500 Internal Server Error") }; self.buffer.extend_from_slice(reason.as_bytes()); self.buffer.extend_from_slice(b"\r\n\r\n") } } } } /// Handshake request received from the client. #[derive(Debug)] pub struct ClientRequest<'a> { ws_key: WebSocketKey, protocols: Vec<&'a str>, path: &'a str, headers: RequestHeaders<'a>, } /// Select HTTP headers sent by the client. #[derive(Debug, Copy, Clone)] pub struct RequestHeaders<'a> { /// The [`Host`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Host) header. pub host: &'a [u8], /// The [`Origin`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Origin) header, if provided. pub origin: Option<&'a [u8]>, } impl<'a> ClientRequest<'a> { /// The `Sec-WebSocket-Key` header nonce value. pub fn key(&self) -> WebSocketKey { self.ws_key } /// The protocols the client is proposing. pub fn protocols(&self) -> impl Iterator<Item = &str> { self.protocols.iter().cloned() } /// The path the client is requesting. pub fn path(&self) -> &str { self.path } /// Select HTTP headers sent by the client. pub fn headers(&self) -> RequestHeaders { self.headers } } /// Handshake response the server sends back to the client. #[derive(Debug)] pub enum Response<'a> { /// The server accepts the handshake request. Accept { key: WebSocketKey, protocol: Option<&'a str> }, /// The server rejects the handshake request. Reject { status_code: u16 }, } /// Known status codes and their reason phrases. const STATUSCODES: &[(u16, &str)] = &[ (100, "100 Continue"), (101, "101 Switching Protocols"), (102, "102 Processing"), (200, "200 OK"), (201, "201 Created"), (202, "202 Accepted"), (203, "203 Non Authoritative Information"), (204, "204 No Content"), (205, "205 Reset Content"), (206, "206 Partial Content"), (207, "207 Multi-Status"), (208, "208 Already Reported"), (226, "226 IM Used"), (300, "300 Multiple Choices"), (301, "301 Moved Permanently"), (302, "302 Found"), (303, "303 See Other"), (304, "304 Not Modified"), (305, "305 Use Proxy"), (307, "307 Temporary Redirect"), (308, "308 Permanent Redirect"), (400, "400 Bad Request"), (401, "401 Unauthorized"), (402, "402 Payment Required"), (403, "403 Forbidden"), (404, "404 Not Found"), (405, "405 Method Not Allowed"), (406, "406 Not Acceptable"), (407, "407 Proxy Authentication Required"), (408, "408 Request Timeout"), (409, "409 Conflict"), (410, "410 Gone"), (411, "411 Length Required"), (412, "412 Precondition Failed"), (413, "413 Payload Too Large"), (414, "414 URI Too Long"), (415, "415 Unsupported Media Type"), (416, "416 Range Not Satisfiable"), (417, "417 Expectation Failed"), (418, "418 I'm a teapot"), (421, "421 Misdirected Request"), (422, "422 Unprocessable Entity"), (423, "423 Locked"), (424, "424 Failed Dependency"), (426, "426 Upgrade Required"), (428, "428 Precondition Required"), (429, "429 Too Many Requests"), (431, "431 Request Header Fields Too Large"), (451, "451 Unavailable For Legal Reasons"), (500, "500 Internal Server Error"), (501, "501 Not Implemented"), (502, "502 Bad Gateway"), (503, "503 Service Unavailable"), (504, "504 Gateway Timeout"), (505, "505 HTTP Version Not Supported"), (506, "506 Variant Also Negotiates"), (507, "507 Insufficient Storage"), (508, "508 Loop Detected"), (510, "510 Not Extended"), (511, "511 Network Authentication Required"), ];
{ self.extensions.drain(..) }
identifier_body
server.rs
// Copyright (c) 2019 Parity Technologies (UK) Ltd. // // Licensed under the Apache License, Version 2.0 // <LICENSE-APACHE or http://www.apache.org/licenses/LICENSE-2.0> or the MIT // license <LICENSE-MIT or http://opensource.org/licenses/MIT>, at your // option. All files in the project carrying such notice may not be copied, // modified, or distributed except according to those terms. //! Websocket server [handshake]. //! //! [handshake]: https://tools.ietf.org/html/rfc6455#section-4 use super::{ append_extensions, configure_extensions, expect_ascii_header, with_first_header, Error, WebSocketKey, MAX_NUM_HEADERS, SEC_WEBSOCKET_EXTENSIONS, SEC_WEBSOCKET_PROTOCOL, }; use crate::connection::{self, Mode}; use crate::extension::Extension; use bytes::BytesMut; use futures::prelude::*; use std::{mem, str}; // Most HTTP servers default to 8KB limit on headers const MAX_HEADERS_SIZE: usize = 8 * 1024; const BLOCK_SIZE: usize = 8 * 1024; /// Websocket handshake server. #[derive(Debug)] pub struct
<'a, T> { socket: T, /// Protocols the server supports. protocols: Vec<&'a str>, /// Extensions the server supports. extensions: Vec<Box<dyn Extension + Send>>, /// Encoding/decoding buffer. buffer: BytesMut, } impl<'a, T: AsyncRead + AsyncWrite + Unpin> Server<'a, T> { /// Create a new server handshake. pub fn new(socket: T) -> Self { Server { socket, protocols: Vec::new(), extensions: Vec::new(), buffer: BytesMut::new() } } /// Override the buffer to use for request/response handling. pub fn set_buffer(&mut self, b: BytesMut) -> &mut Self { self.buffer = b; self } /// Extract the buffer. pub fn take_buffer(&mut self) -> BytesMut { mem::take(&mut self.buffer) } /// Add a protocol the server supports. pub fn add_protocol(&mut self, p: &'a str) -> &mut Self { self.protocols.push(p); self } /// Add an extension the server supports. pub fn add_extension(&mut self, e: Box<dyn Extension + Send>) -> &mut Self { self.extensions.push(e); self } /// Get back all extensions. pub fn drain_extensions(&mut self) -> impl Iterator<Item = Box<dyn Extension + Send>> + '_ { self.extensions.drain(..) } /// Await an incoming client handshake request. pub async fn receive_request(&mut self) -> Result<ClientRequest<'_>, Error> { self.buffer.clear(); let mut skip = 0; loop { crate::read(&mut self.socket, &mut self.buffer, BLOCK_SIZE).await?; let limit = std::cmp::min(self.buffer.len(), MAX_HEADERS_SIZE); // We don't expect body, so can search for the CRLF headers tail from // the end of the buffer. if self.buffer[skip..limit].windows(4).rev().any(|w| w == b"\r\n\r\n") { break; } // Give up if we've reached the limit. We could emit a specific error here, // but httparse will produce meaningful error for us regardless. if limit == MAX_HEADERS_SIZE { break; } // Skip bytes that did not contain CRLF in the next iteration. // If we only read a partial CRLF sequence, we would miss it if we skipped the full buffer // length, hence backing off the full 4 bytes. skip = self.buffer.len().saturating_sub(4); } self.decode_request() } /// Respond to the client. pub async fn send_response(&mut self, r: &Response<'_>) -> Result<(), Error> { self.buffer.clear(); self.encode_response(r); self.socket.write_all(&self.buffer).await?; self.socket.flush().await?; self.buffer.clear(); Ok(()) } /// Turn this handshake into a [`connection::Builder`]. pub fn into_builder(mut self) -> connection::Builder<T> { let mut builder = connection::Builder::new(self.socket, Mode::Server); builder.set_buffer(self.buffer); builder.add_extensions(self.extensions.drain(..)); builder } /// Get out the inner socket of the server. pub fn into_inner(self) -> T { self.socket } // Decode client handshake request. fn decode_request(&mut self) -> Result<ClientRequest, Error> { let mut header_buf = [httparse::EMPTY_HEADER; MAX_NUM_HEADERS]; let mut request = httparse::Request::new(&mut header_buf); match request.parse(self.buffer.as_ref()) { Ok(httparse::Status::Complete(_)) => (), Ok(httparse::Status::Partial) => return Err(Error::IncompleteHttpRequest), Err(e) => return Err(Error::Http(Box::new(e))), }; if request.method != Some("GET") { return Err(Error::InvalidRequestMethod); } if request.version != Some(1) { return Err(Error::UnsupportedHttpVersion); } let host = with_first_header(&request.headers, "Host", Ok)?; expect_ascii_header(request.headers, "Upgrade", "websocket")?; expect_ascii_header(request.headers, "Connection", "upgrade")?; expect_ascii_header(request.headers, "Sec-WebSocket-Version", "13")?; let origin = request.headers.iter().find_map( |h| { if h.name.eq_ignore_ascii_case("Origin") { Some(h.value) } else { None } }, ); let headers = RequestHeaders { host, origin }; let ws_key = with_first_header(&request.headers, "Sec-WebSocket-Key", |k| { WebSocketKey::try_from(k).map_err(|_| Error::SecWebSocketKeyInvalidLength(k.len())) })?; for h in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_EXTENSIONS)) { configure_extensions(&mut self.extensions, std::str::from_utf8(h.value)?)? } let mut protocols = Vec::new(); for p in request.headers.iter().filter(|h| h.name.eq_ignore_ascii_case(SEC_WEBSOCKET_PROTOCOL)) { if let Some(&p) = self.protocols.iter().find(|x| x.as_bytes() == p.value) { protocols.push(p) } } let path = request.path.unwrap_or("/"); Ok(ClientRequest { ws_key, protocols, path, headers }) } // Encode server handshake response. fn encode_response(&mut self, response: &Response<'_>) { match response { Response::Accept { key, protocol } => { let accept_value = super::generate_accept_key(&key); self.buffer.extend_from_slice( concat![ "HTTP/1.1 101 Switching Protocols", "\r\nServer: soketto-", env!("CARGO_PKG_VERSION"), "\r\nUpgrade: websocket", "\r\nConnection: upgrade", "\r\nSec-WebSocket-Accept: ", ] .as_bytes(), ); self.buffer.extend_from_slice(&accept_value); if let Some(p) = protocol { self.buffer.extend_from_slice(b"\r\nSec-WebSocket-Protocol: "); self.buffer.extend_from_slice(p.as_bytes()) } append_extensions(self.extensions.iter().filter(|e| e.is_enabled()), &mut self.buffer); self.buffer.extend_from_slice(b"\r\n\r\n") } Response::Reject { status_code } => { self.buffer.extend_from_slice(b"HTTP/1.1 "); let (_, reason) = if let Ok(i) = STATUSCODES.binary_search_by_key(status_code, |(n, _)| *n) { STATUSCODES[i] } else { (500, "500 Internal Server Error") }; self.buffer.extend_from_slice(reason.as_bytes()); self.buffer.extend_from_slice(b"\r\n\r\n") } } } } /// Handshake request received from the client. #[derive(Debug)] pub struct ClientRequest<'a> { ws_key: WebSocketKey, protocols: Vec<&'a str>, path: &'a str, headers: RequestHeaders<'a>, } /// Select HTTP headers sent by the client. #[derive(Debug, Copy, Clone)] pub struct RequestHeaders<'a> { /// The [`Host`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Host) header. pub host: &'a [u8], /// The [`Origin`](https://developer.mozilla.org/en-US/docs/Web/HTTP/Headers/Origin) header, if provided. pub origin: Option<&'a [u8]>, } impl<'a> ClientRequest<'a> { /// The `Sec-WebSocket-Key` header nonce value. pub fn key(&self) -> WebSocketKey { self.ws_key } /// The protocols the client is proposing. pub fn protocols(&self) -> impl Iterator<Item = &str> { self.protocols.iter().cloned() } /// The path the client is requesting. pub fn path(&self) -> &str { self.path } /// Select HTTP headers sent by the client. pub fn headers(&self) -> RequestHeaders { self.headers } } /// Handshake response the server sends back to the client. #[derive(Debug)] pub enum Response<'a> { /// The server accepts the handshake request. Accept { key: WebSocketKey, protocol: Option<&'a str> }, /// The server rejects the handshake request. Reject { status_code: u16 }, } /// Known status codes and their reason phrases. const STATUSCODES: &[(u16, &str)] = &[ (100, "100 Continue"), (101, "101 Switching Protocols"), (102, "102 Processing"), (200, "200 OK"), (201, "201 Created"), (202, "202 Accepted"), (203, "203 Non Authoritative Information"), (204, "204 No Content"), (205, "205 Reset Content"), (206, "206 Partial Content"), (207, "207 Multi-Status"), (208, "208 Already Reported"), (226, "226 IM Used"), (300, "300 Multiple Choices"), (301, "301 Moved Permanently"), (302, "302 Found"), (303, "303 See Other"), (304, "304 Not Modified"), (305, "305 Use Proxy"), (307, "307 Temporary Redirect"), (308, "308 Permanent Redirect"), (400, "400 Bad Request"), (401, "401 Unauthorized"), (402, "402 Payment Required"), (403, "403 Forbidden"), (404, "404 Not Found"), (405, "405 Method Not Allowed"), (406, "406 Not Acceptable"), (407, "407 Proxy Authentication Required"), (408, "408 Request Timeout"), (409, "409 Conflict"), (410, "410 Gone"), (411, "411 Length Required"), (412, "412 Precondition Failed"), (413, "413 Payload Too Large"), (414, "414 URI Too Long"), (415, "415 Unsupported Media Type"), (416, "416 Range Not Satisfiable"), (417, "417 Expectation Failed"), (418, "418 I'm a teapot"), (421, "421 Misdirected Request"), (422, "422 Unprocessable Entity"), (423, "423 Locked"), (424, "424 Failed Dependency"), (426, "426 Upgrade Required"), (428, "428 Precondition Required"), (429, "429 Too Many Requests"), (431, "431 Request Header Fields Too Large"), (451, "451 Unavailable For Legal Reasons"), (500, "500 Internal Server Error"), (501, "501 Not Implemented"), (502, "502 Bad Gateway"), (503, "503 Service Unavailable"), (504, "504 Gateway Timeout"), (505, "505 HTTP Version Not Supported"), (506, "506 Variant Also Negotiates"), (507, "507 Insufficient Storage"), (508, "508 Loop Detected"), (510, "510 Not Extended"), (511, "511 Network Authentication Required"), ];
Server
identifier_name
utils.py
import datetime import functools import json import logging import os import shutil import subprocess import sys import time import pymongo import pandas as pd import pymysql import schedule from raven import Client from sqlalchemy import create_engine from config import MONGOURL, MYSQLHOST, MYSQLUSER, MYSQLPASSWORD, MYSQLPORT, MYSQLDB, MYSQLTABLE, SENTRY_DSN logger = logging.getLogger("main_log") db = pymongo.MongoClient(MONGOURL) coll = db.stock.mins sentry = Client(SENTRY_DSN) def all_codes_now(): codes = coll.find().distinct("code") return codes # 12332 12359 果然每天的 codes 数量不一样 def write_codes_to_file(codes): """如果codes不是经常有新增的 查询一次写入文件 下次需要的时候直接从文件中读取要比数据库 distinct 查询要快""" with open("codes.json", "w") as f: json.dump(codes, f) def wirte_code_date_to_file(dt1, dt2, date_int_str): """ 将指定 code 制定时间内的增量 写入文件 :param dt1: :param dt2: :param date_int_str: :return: """ f = open("codes.json", "r") codes = json.load(f) f.close() file_path = os.path.join(os.getcwd(), "exportdir/" + date_int_str) os.makedirs(file_path, exist_ok=True) for code in codes: q = '{{code:"{0}",time: {{$gte:ISODate("{1}"), $lte:ISODate("{2}")}}}}'.format(code, dt1, dt2) file_name = os.path.join(file_path, code) command = "mongoexport -d stock -c mins -q '{}' --fieldFile mins_fields.txt --type=csv --out {}.csv".format(q, file_name) # print(command) log_file = open("export_log.log", "a+") subprocess.call(command, shell=True, stderr=log_file) def merge_csv(folder_path, savefile_path, savefile_name): """ 将多个 csv 文件合并成一个 :param folder_path: :param savefile_path: :param savefile_name: :return: """ # 修改当前工作目录 os.chdir(folder_path) # 将该文件夹下的所有文件名存入一个列表 file_list = os.listdir() # 读取第一个CSV文件并包含表头 df = pd.read_csv(os.path.join(folder_path, file_list[0])) # 创建要保存的文件夹 os.makedirs(savefile_path, exist_ok=True) # 将读取的第一个CSV文件写入合并后的文件保存 save_file = os.path.join(savefile_path, savefile_name) df.to_csv(save_file) # 循环遍历列表中各个CSV文件名,并追加到合并后的文件 count = 0 try: for i in range(1, len(file_list)): # print(os.path.join(Folder_Path, file_list[i])) df = pd.read_csv(os.path.join(folder_path, file_list[i])) # print(df) # print(df.shape[0]) count += df.shape[0] # print() # print() df.to_csv(save_file, encoding="utf-8", index=False, header=False, mode='a+') except Exception: pass return count def csv_to_mysql(load_sql, host, user, password): """ This function load a csv file to MySQL table according to the load_sql statement. :param load_sql: :param host: :param user: :param password: :return: """ try: con = pymysql.connect(host=host, user=user, password=password, autocommit=True, local_infile=1) print('Connected to DB: {}'.format(host)) # Create cursor and execute Load SQL cursor = con.cursor() cursor.execute(load_sql) print('Succuessfully loaded the table from csv.') con.close() except Exception as e: print('Error: {}'.format(str(e))) sys.exit(1) def gen_times(): """ 确定拉取的边界时间 一般情况 :return: """ dt1 = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(datetime.date.today(), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y%m%d") return dt1, dt2, date_int_str def gen_temp_times(start, end): """ 需要补充数据的特殊情况 end 是先对当前已经过去的时间 :param start: :param end: :return: """ while start.date() <= end.date(): dt1 = datetime.datetime.combine(start, datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(start + datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(start, datetime.time.min).strftime("%Y%m%d") yield dt1, dt2, date_int_str start += datetime.timedelta(days=1) # def gen_mongo_count(dt1, dt2): # """ # 计算在dt1 和 dt2之间的增量数量 理论上是一天的增量 # :param dt1: # :param dt2: # :return: # """ # # { # # "_id": ObjectId("59ce1e1d6e6dc7768c7140dc"), # # "code": "SH900955", # # "time": ISODate("1999-07-26T09:59:00Z"), # # "open": 0.462, # # "close": 0.462, # # "low": 0.462, # # "high": 0.462, # # "volume": 0, # # "amount": 0 # # } # # 现将 dt1 和 dt2 进行转换 # ret = coll.find({"time": {"$gte": dt1, "$lte": dt2}}).count_documents # return ret def gene(dt1, dt2, date_int_str): """整个生成逻辑""" logger.info(f"dt1:{dt1}") logger.info(f"dt2:{dt2}") mysqlhost = MYSQLHOST user = MYSQLUSER password = MYSQLPASSWORD mysqlport = MYSQLPORT mysqldb = MYSQLDB mysqltable = MYSQLTABLE export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) save_file_path = os.path.join(os.getcwd(), "savedir") save_file_name = date_int_str + ".csv" # 生成截止到当前的全种类列表 codes = all_codes_now() # 将其以重写的方式存入 codes.json 文件 write_codes_to_file(codes) # 将 codes 读出到内存 同时将每一个code的增量写入文件 wirte_code_date_to_file(dt1, dt2, date_int_str) # 将 csv 文件进行合并 并且计算被导入的增量数量 count = merge_csv(folder_path, save_file_path, save_file_name) logger.info(f"由csv文件计算出的当天需要进行增量的数据量为 {count}") sentry.captureMessage(f"需要进行增量的数据量为 {count}") # 检查与 mongo 中的增量结果是否一致 # 这个查询也比较耗时 先不检查了 # mongo_count = gen_mongo_count(dt1, dt2) if count: # 将合并后的 csv 导入 mysql save_file = os.path.join(save_file_path, save_file_name) load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ REPLACE INTO TABLE {mysqldb}.{mysqltable} \ FIELDS TERMINATED BY ',' \ ENCLOSED BY '"' \ IGNORE 1 LINES;""" csv_to_mysql(load_sql, mysqlhost, user, password) # 检查 csv 中的数目和数据库中查询出的数量是否一致 query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= {date_int_str}""" mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ {mysqlport}/{mysqldb}?charset=gbk" DATACENTER = create_engine(mysql_string) sql_count = DATACENTER.execute(query_sql).first()[0] if sql_count != count: raise RuntimeError("数据量不一致,请检查!") # 合并后删除原始的 csv 文件 shutil.rmtree(folder_path, ignore_errors=True) logger.info(f"任务完成 删除当日过程 csv 文件 ") def catch_exceptions(cancel_on_failure=False): def catch_exceptions_decorator(job_func): @functools.wraps(job_func) def wrapper(*args, **kwargs): try: return job_func(*args, **kwargs) except: import traceback logger.warning(traceback.format_exc()) sentry.captureException(exc_info=True) if cancel_on_failure: # print(schedule.CancelJob) # schedule.cancel_job() return schedule.CancelJob return wrapper return catch_exceptions_decorator @catch_exceptions def main(): import_date_str = (datetime.datetime.today() - datetime.timedelta(days=1)).strftime("%Y-%m-%d") logger.info(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") sentry.captureMessage(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") dt1, dt2, date_int_str = gen_times() gene(dt1, dt2, date_int_str) if __name__ == "__main__": # test gen times # res = gen_times() # print(res) # test gen temp times # start = datetime.datetime(2019, 7, 8, 12, 34, 56) # end = datetime.datetime(2019, 7, 18, 12, 34, 56) # generator = gen_temp_times(start, end) # for data in generator: # print(data) # """ # ('2019-07-08T00:00:00Z', '2019-07-09T00:00:00Z', '20190708') # ('2019-07-09T00:00:00Z', '2019-07-10T00:00:00Z', '20190709') # ('2019-07-10T00:00:00Z', '2019-07-11T00:00:00Z', '20190710') # ('2019-07-11T00:00:00Z', '2019-07-12T00:00:00Z', '20190711') # ('2019-07-12T00:00:00Z', '2019-07-13T00:00:00Z', '20190712') # ('2019-07-13T00:00:00Z', '2019-07-14T00:00:00Z', '20190713') # ('2019-07-14T00:00:00Z', '2019-07-15T00:00:00Z', '20190714') # ('2019-07-15T00:00:00Z', '2019-07-16T00:00:00Z', '20190715') # ('2019-07-16T00:00:00Z', '2019-07-17T00:00:00Z', '20190716') # ('2019-07-17T00:00:00Z', '2019-07-18T00:00:00Z', '20190717')
# """ # test gen all codes from mongo today # t1 = time.time() # all_codes_now() # print(time.time() - t1) # 61s # test wirte code to a file # t1 = time.time() # now_codes = all_codes_now() # write_codes_to_file(now_codes) # print(time.time() - t1) # 55s # 写入分散的 csv 文件 dt1, dt2, date_int_str = gen_times() # t1 = time.time() # wirte_code_date_to_file(dt1, dt2, date_int_str) # t2 = time.time() # print((t2 - t1)/60, "min") # 79min # test gen momngo count # mongo_count = gen_mongo_count(dt1, dt2) # print(mongo_count) # test merge csv # dt1, dt2, date_int_str = gen_times() export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) # save_file_path = os.path.join(os.getcwd(), "savedir") # save_file_name = date_int_str + ".csv" # # t1 = time.time() # count = merge_csv(folder_path, save_file_path, save_file_name) # t2 = time.time() # print(t2 - t1) # 时间在 1 min 左右 # print(count) # 1309440 # test csv to mysql # 将合并后的 csv 导入 mysql # t1 = time.time() # mysqlhost = MYSQLHOST # user = MYSQLUSER # password = MYSQLPASSWORD # mysqlport = MYSQLPORT # mysqldb = MYSQLDB # mysqltable = MYSQLTABLE # save_file = os.path.join(save_file_path, save_file_name) # load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ # REPLACE INTO TABLE {mysqldb}.{mysqltable} \ # FIELDS TERMINATED BY ',' \ # ENCLOSED BY '"' \ # IGNORE 1 LINES;""" # # csv_to_mysql(load_sql, mysqlhost, user, password) # print(time.time() - t1) # 97s # # # 检查 csv 中的数目和数据库中查询出的数量是否一致 # query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= '{dt1[:10]}' and time <= '{dt2[:10]}';""" # mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ # {mysqlport}/{mysqldb}?charset=gbk" # print(query_sql) # DATACENTER = create_engine(mysql_string) # sql_count = DATACENTER.execute(query_sql).first()[0] # print(sql_count) # 1309440 # 测试删除合并后的文件夹 # shutil.rmtree(folder_path, ignore_errors=True) pass
# ('2019-07-18T00:00:00Z', '2019-07-19T00:00:00Z', '20190718')
random_line_split
utils.py
import datetime import functools import json import logging import os import shutil import subprocess import sys import time import pymongo import pandas as pd import pymysql import schedule from raven import Client from sqlalchemy import create_engine from config import MONGOURL, MYSQLHOST, MYSQLUSER, MYSQLPASSWORD, MYSQLPORT, MYSQLDB, MYSQLTABLE, SENTRY_DSN logger = logging.getLogger("main_log") db = pymongo.MongoClient(MONGOURL) coll = db.stock.mins sentry = Client(SENTRY_DSN) def all_codes_now(): codes = coll.find().distinct("code") return codes # 12332 12359 果然每天的 codes 数量不一样 def write_codes_to_file(codes): """如果codes不是经常有新增的 查询一次写入文件 下次需要的时候直接从文件中读取要比数据库 distinct 查询要快""" with open("codes.json", "w") as f: json.dump(codes, f) def wirte_code_date_to_file(dt1, dt2, date_int_str): """ 将指定 code 制定时间内的增量 写入文件 :param dt1: :param dt2: :param date_int_str: :return: """ f = open("codes.json", "r") codes = json.load(f) f.close() file_path = os.path.join(os.getcwd(), "exportdir/" + date_int_str) os.makedirs(file_path, exist_ok=True) for code in codes: q = '{{code:"{0}",time: {{$gte:ISODate("{1}"), $lte:ISODate("{2}")}}}}'.format(code, dt1, dt2) file_name = os.path.join(file_path, code) command = "mongoexport -d stock -c mins -q '{}' --fieldFile mins_fields.txt --type=csv --out {}.csv".format(q, file_name) # print(command) log_file = open("export_log.log", "a+") subprocess.call(command, shell=True, stderr=log_file) def merge_csv(folder_path, savefile_path, savefile_name): """ 将多个 csv 文件合并成一个 :param folder_path: :param savefile_path: :param savefile_name: :return: """ # 修改当前工作目录 os.chdir(folder_path) # 将该文件夹下的所有文件名存入一个列表 file_list = os.listdir() # 读取第一个CSV文件并包含表头 df = pd.read_csv(os.path.join(folder_path, file_list[0])) # 创建要保存的文件夹 os.makedirs(savefile_path, exist_ok=True) # 将读取的第一个CSV文件写入合并后的文件保存 save_file = os.path.join(savefile_path, savefile_name) df.to_csv(save_file) # 循环遍历列表中各个CSV文件名,并追加到合并后的文件 count = 0 try: for i in range(1, len(file_list)): # print(os.path.join(Folder_Path, file_list[i])) df = pd.read_csv(os.path.join(folder_path, file_list[i])) # print(df) # print(df.shape[0]) count += df.shape[0] # print() # print() df.to_csv(save_file, encoding="utf-8", index=False, header=False, mode='a+') except Exception: pass return count def csv_to_mysql(load_sql, host, user, password): """ This function load a csv file to MySQL table according to the load_sql statement. :param load_sql: :param host: :param user: :param password: :return: """ try: con = pymysql.connect(host=host, user=user, password=password,
datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y%m%d") return dt1, dt2, date_int_str def gen_temp_times(start, end): """ 需要补充数据的特殊情况 end 是先对当前已经过去的时间 :param start: :param end: :return: """ while start.date() <= end.date(): dt1 = datetime.datetime.combine(start, datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(start + datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(start, datetime.time.min).strftime("%Y%m%d") yield dt1, dt2, date_int_str start += datetime.timedelta(days=1) # def gen_mongo_count(dt1, dt2): # """ # 计算在dt1 和 dt2之间的增量数量 理论上是一天的增量 # :param dt1: # :param dt2: # :return: # """ # # { # # "_id": ObjectId("59ce1e1d6e6dc7768c7140dc"), # # "code": "SH900955", # # "time": ISODate("1999-07-26T09:59:00Z"), # # "open": 0.462, # # "close": 0.462, # # "low": 0.462, # # "high": 0.462, # # "volume": 0, # # "amount": 0 # # } # # 现将 dt1 和 dt2 进行转换 # ret = coll.find({"time": {"$gte": dt1, "$lte": dt2}}).count_documents # return ret def gene(dt1, dt2, date_int_str): """整个生成逻辑""" logger.info(f"dt1:{dt1}") logger.info(f"dt2:{dt2}") mysqlhost = MYSQLHOST user = MYSQLUSER password = MYSQLPASSWORD mysqlport = MYSQLPORT mysqldb = MYSQLDB mysqltable = MYSQLTABLE export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) save_file_path = os.path.join(os.getcwd(), "savedir") save_file_name = date_int_str + ".csv" # 生成截止到当前的全种类列表 codes = all_codes_now() # 将其以重写的方式存入 codes.json 文件 write_codes_to_file(codes) # 将 codes 读出到内存 同时将每一个code的增量写入文件 wirte_code_date_to_file(dt1, dt2, date_int_str) # 将 csv 文件进行合并 并且计算被导入的增量数量 count = merge_csv(folder_path, save_file_path, save_file_name) logger.info(f"由csv文件计算出的当天需要进行增量的数据量为 {count}") sentry.captureMessage(f"需要进行增量的数据量为 {count}") # 检查与 mongo 中的增量结果是否一致 # 这个查询也比较耗时 先不检查了 # mongo_count = gen_mongo_count(dt1, dt2) if count: # 将合并后的 csv 导入 mysql save_file = os.path.join(save_file_path, save_file_name) load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ REPLACE INTO TABLE {mysqldb}.{mysqltable} \ FIELDS TERMINATED BY ',' \ ENCLOSED BY '"' \ IGNORE 1 LINES;""" csv_to_mysql(load_sql, mysqlhost, user, password) # 检查 csv 中的数目和数据库中查询出的数量是否一致 query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= {date_int_str}""" mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ {mysqlport}/{mysqldb}?charset=gbk" DATACENTER = create_engine(mysql_string) sql_count = DATACENTER.execute(query_sql).first()[0] if sql_count != count: raise RuntimeError("数据量不一致,请检查!") # 合并后删除原始的 csv 文件 shutil.rmtree(folder_path, ignore_errors=True) logger.info(f"任务完成 删除当日过程 csv 文件 ") def catch_exceptions(cancel_on_failure=False): def catch_exceptions_decorator(job_func): @functools.wraps(job_func) def wrapper(*args, **kwargs): try: return job_func(*args, **kwargs) except: import traceback logger.warning(traceback.format_exc()) sentry.captureException(exc_info=True) if cancel_on_failure: # print(schedule.CancelJob) # schedule.cancel_job() return schedule.CancelJob return wrapper return catch_exceptions_decorator @catch_exceptions def main(): import_date_str = (datetime.datetime.today() - datetime.timedelta(days=1)).strftime("%Y-%m-%d") logger.info(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") sentry.captureMessage(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") dt1, dt2, date_int_str = gen_times() gene(dt1, dt2, date_int_str) if __name__ == "__main__": # test gen times # res = gen_times() # print(res) # test gen temp times # start = datetime.datetime(2019, 7, 8, 12, 34, 56) # end = datetime.datetime(2019, 7, 18, 12, 34, 56) # generator = gen_temp_times(start, end) # for data in generator: # print(data) # """ # ('2019-07-08T00:00:00Z', '2019-07-09T00:00:00Z', '20190708') # ('2019-07-09T00:00:00Z', '2019-07-10T00:00:00Z', '20190709') # ('2019-07-10T00:00:00Z', '2019-07-11T00:00:00Z', '20190710') # ('2019-07-11T00:00:00Z', '2019-07-12T00:00:00Z', '20190711') # ('2019-07-12T00:00:00Z', '2019-07-13T00:00:00Z', '20190712') # ('2019-07-13T00:00:00Z', '2019-07-14T00:00:00Z', '20190713') # ('2019-07-14T00:00:00Z', '2019-07-15T00:00:00Z', '20190714') # ('2019-07-15T00:00:00Z', '2019-07-16T00:00:00Z', '20190715') # ('2019-07-16T00:00:00Z', '2019-07-17T00:00:00Z', '20190716') # ('2019-07-17T00:00:00Z', '2019-07-18T00:00:00Z', '20190717') # ('2019-07-18T00:00:00Z', '2019-07-19T00:00:00Z', '20190718') # """ # test gen all codes from mongo today # t1 = time.time() # all_codes_now() # print(time.time() - t1) # 61s # test wirte code to a file # t1 = time.time() # now_codes = all_codes_now() # write_codes_to_file(now_codes) # print(time.time() - t1) # 55s # 写入分散的 csv 文件 dt1, dt2, date_int_str = gen_times() # t1 = time.time() # wirte_code_date_to_file(dt1, dt2, date_int_str) # t2 = time.time() # print((t2 - t1)/60, "min") # 79min # test gen momngo count # mongo_count = gen_mongo_count(dt1, dt2) # print(mongo_count) # test merge csv # dt1, dt2, date_int_str = gen_times() export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) # save_file_path = os.path.join(os.getcwd(), "savedir") # save_file_name = date_int_str + ".csv" # # t1 = time.time() # count = merge_csv(folder_path, save_file_path, save_file_name) # t2 = time.time() # print(t2 - t1) # 时间在 1 min 左右 # print(count) # 1309440 # test csv to mysql # 将合并后的 csv 导入 mysql # t1 = time.time() # mysqlhost = MYSQLHOST # user = MYSQLUSER # password = MYSQLPASSWORD # mysqlport = MYSQLPORT # mysqldb = MYSQLDB # mysqltable = MYSQLTABLE # save_file = os.path.join(save_file_path, save_file_name) # load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ # REPLACE INTO TABLE {mysqldb}.{mysqltable} \ # FIELDS TERMINATED BY ',' \ # ENCLOSED BY '"' \ # IGNORE 1 LINES;""" # # csv_to_mysql(load_sql, mysqlhost, user, password) # print(time.time() - t1) # 97s # # # 检查 csv 中的数目和数据库中查询出的数量是否一致 # query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= '{dt1[:10]}' and time <= '{dt2[:10]}';""" # mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ # {mysqlport}/{mysqldb}?charset=gbk" # print(query_sql) # DATACENTER = create_engine(mysql_string) # sql_count = DATACENTER.execute(query_sql).first()[0] # print(sql_count) # 1309440 # 测试删除合并后的文件夹 # shutil.rmtree(folder_path, ignore_errors=True) pass
autocommit=True, local_infile=1) print('Connected to DB: {}'.format(host)) # Create cursor and execute Load SQL cursor = con.cursor() cursor.execute(load_sql) print('Succuessfully loaded the table from csv.') con.close() except Exception as e: print('Error: {}'.format(str(e))) sys.exit(1) def gen_times(): """ 确定拉取的边界时间 一般情况 :return: """ dt1 = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(datetime.date.today(),
identifier_body
utils.py
import datetime import functools import json import logging import os import shutil import subprocess import sys import time import pymongo import pandas as pd import pymysql import schedule from raven import Client from sqlalchemy import create_engine from config import MONGOURL, MYSQLHOST, MYSQLUSER, MYSQLPASSWORD, MYSQLPORT, MYSQLDB, MYSQLTABLE, SENTRY_DSN logger = logging.getLogger("main_log") db = pymongo.MongoClient(MONGOURL) coll = db.stock.mins sentry = Client(SENTRY_DSN) def all_codes_now(): codes = coll.find().distinct("code") return codes # 12332 12359 果然每天的 codes 数量不一样 def write_codes_to_file(codes): """如果codes不是经常有新增的 查询一次写入文件 下次需要的时候直接从文件中读取要比数据库 distinct 查询要快""" with open("codes.json", "w") as f: json.dump(codes, f) def wirte_code_date_to_file(dt1, dt2, date_int_str): """ 将指定 code 制定时间内的增量 写入文件 :param dt1: :param dt2: :param date_int_str: :return: """ f = open("codes.json", "r") codes = json.load(f) f.close() file_path = os.path.join(os.getcwd(), "exportdir/" + date_int_str) os.makedirs(file_path, exist_ok=True) for code in codes: q = '{{code:"{0}",time: {{$gte:ISODate("{1}"), $lte:ISODate("{2}")}}}}'.format(code, dt1, dt2) file_name = os.path.join(file_path, code) command = "mongoexport -d stock -c mins -q '{}' --fieldFile mins_fields.txt --type=csv --out {}.csv".format(q, file_name) # print(command) log_file = open("export_log.log", "a+") subprocess.call(command, shell=True, stderr=log_file) def merge_csv(folder_path, savefile_path, savefile_name): """ 将多个 csv 文件合并成一个 :param folder_path: :param savefile_path: :param savefile_name: :return: """ # 修改当前工作目录 os.chdir(folder_path) # 将该文件夹下的所有文件名存入一个列表 file_list = os.listdir() # 读取第一个CSV文件并包含表头 df = pd.read_csv(os.path.join(folder_path, file_list[0])) # 创建要保存的文件夹 os.makedirs(savefile_path, exist_ok=True) # 将读取的第一个CSV文件写入合并后的文件保存 save_file = os.path.join(savefile_path, savefile_name) df.to_csv(save_file) # 循环遍历列表中各个CSV文件名,并追加到合并后的文件 count = 0 try: for i in range(1, len(file_list)): # print(os.path.join(Folder_Path, file_list[i])) df = pd.read_csv(os.path.join(folder_path, file_list[i])) # print(df) # print(df.shape[0]) count += df.shape[0] # print() # print() df.to_csv(save_file, encoding="utf-8", index=False, header=False, mode='a+') except Exception: pass return count def csv_to_mysql(load_sql, host, user, password): """ This function load a csv file to MySQL table according to the load_sql statement. :param load_sql: :param host: :param user: :param password: :return: """ try: con = pymysql.connect(host=host, user=user, password=password, autocommit=True, local_infile=1) print('Connected to DB: {}'.format(host)) # Create cursor and execute Load SQL cursor = con.cursor() cursor.execute(load_sql) print('Succuessfully loaded the table from csv.') con.close() except Exception as e: print('Error: {}'.format(str(e))) sys.exit(1) def gen_times(): """ 确定拉取的边界时间 一般情况 :return: """ dt1 = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(datetime.date.today(), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y%m%d") return dt1, dt2, date_int_str def gen_temp_times(start, end): """ 需要补充数据的特殊情况 end 是先对当前已经过去的时间 :param start: :param end: :return: """ while start.date() <= end.date(): dt1 = datetime.datetime.combine(start, datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(start + datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(start, datetime.time.min).strftime("%Y%m%d") yield dt1, dt2, date_int_str start += d
# "volume": 0, # # "amount": 0 # # } # # 现将 dt1 和 dt2 进行转换 # ret = coll.find({"time": {"$gte": dt1, "$lte": dt2}}).count_documents # return ret def gene(dt1, dt2, date_int_str): """整个生成逻辑""" logger.info(f"dt1:{dt1}") logger.info(f"dt2:{dt2}") mysqlhost = MYSQLHOST user = MYSQLUSER password = MYSQLPASSWORD mysqlport = MYSQLPORT mysqldb = MYSQLDB mysqltable = MYSQLTABLE export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) save_file_path = os.path.join(os.getcwd(), "savedir") save_file_name = date_int_str + ".csv" # 生成截止到当前的全种类列表 codes = all_codes_now() # 将其以重写的方式存入 codes.json 文件 write_codes_to_file(codes) # 将 codes 读出到内存 同时将每一个code的增量写入文件 wirte_code_date_to_file(dt1, dt2, date_int_str) # 将 csv 文件进行合并 并且计算被导入的增量数量 count = merge_csv(folder_path, save_file_path, save_file_name) logger.info(f"由csv文件计算出的当天需要进行增量的数据量为 {count}") sentry.captureMessage(f"需要进行增量的数据量为 {count}") # 检查与 mongo 中的增量结果是否一致 # 这个查询也比较耗时 先不检查了 # mongo_count = gen_mongo_count(dt1, dt2) if count: # 将合并后的 csv 导入 mysql save_file = os.path.join(save_file_path, save_file_name) load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ REPLACE INTO TABLE {mysqldb}.{mysqltable} \ FIELDS TERMINATED BY ',' \ ENCLOSED BY '"' \ IGNORE 1 LINES;""" csv_to_mysql(load_sql, mysqlhost, user, password) # 检查 csv 中的数目和数据库中查询出的数量是否一致 query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= {date_int_str}""" mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ {mysqlport}/{mysqldb}?charset=gbk" DATACENTER = create_engine(mysql_string) sql_count = DATACENTER.execute(query_sql).first()[0] if sql_count != count: raise RuntimeError("数据量不一致,请检查!") # 合并后删除原始的 csv 文件 shutil.rmtree(folder_path, ignore_errors=True) logger.info(f"任务完成 删除当日过程 csv 文件 ") def catch_exceptions(cancel_on_failure=False): def catch_exceptions_decorator(job_func): @functools.wraps(job_func) def wrapper(*args, **kwargs): try: return job_func(*args, **kwargs) except: import traceback logger.warning(traceback.format_exc()) sentry.captureException(exc_info=True) if cancel_on_failure: # print(schedule.CancelJob) # schedule.cancel_job() return schedule.CancelJob return wrapper return catch_exceptions_decorator @catch_exceptions def main(): import_date_str = (datetime.datetime.today() - datetime.timedelta(days=1)).strftime("%Y-%m-%d") logger.info(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") sentry.captureMessage(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") dt1, dt2, date_int_str = gen_times() gene(dt1, dt2, date_int_str) if __name__ == "__main__": # test gen times # res = gen_times() # print(res) # test gen temp times # start = datetime.datetime(2019, 7, 8, 12, 34, 56) # end = datetime.datetime(2019, 7, 18, 12, 34, 56) # generator = gen_temp_times(start, end) # for data in generator: # print(data) # """ # ('2019-07-08T00:00:00Z', '2019-07-09T00:00:00Z', '20190708') # ('2019-07-09T00:00:00Z', '2019-07-10T00:00:00Z', '20190709') # ('2019-07-10T00:00:00Z', '2019-07-11T00:00:00Z', '20190710') # ('2019-07-11T00:00:00Z', '2019-07-12T00:00:00Z', '20190711') # ('2019-07-12T00:00:00Z', '2019-07-13T00:00:00Z', '20190712') # ('2019-07-13T00:00:00Z', '2019-07-14T00:00:00Z', '20190713') # ('2019-07-14T00:00:00Z', '2019-07-15T00:00:00Z', '20190714') # ('2019-07-15T00:00:00Z', '2019-07-16T00:00:00Z', '20190715') # ('2019-07-16T00:00:00Z', '2019-07-17T00:00:00Z', '20190716') # ('2019-07-17T00:00:00Z', '2019-07-18T00:00:00Z', '20190717') # ('2019-07-18T00:00:00Z', '2019-07-19T00:00:00Z', '20190718') # """ # test gen all codes from mongo today # t1 = time.time() # all_codes_now() # print(time.time() - t1) # 61s # test wirte code to a file # t1 = time.time() # now_codes = all_codes_now() # write_codes_to_file(now_codes) # print(time.time() - t1) # 55s # 写入分散的 csv 文件 dt1, dt2, date_int_str = gen_times() # t1 = time.time() # wirte_code_date_to_file(dt1, dt2, date_int_str) # t2 = time.time() # print((t2 - t1)/60, "min") # 79min # test gen momngo count # mongo_count = gen_mongo_count(dt1, dt2) # print(mongo_count) # test merge csv # dt1, dt2, date_int_str = gen_times() export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) # save_file_path = os.path.join(os.getcwd(), "savedir") # save_file_name = date_int_str + ".csv" # # t1 = time.time() # count = merge_csv(folder_path, save_file_path, save_file_name) # t2 = time.time() # print(t2 - t1) # 时间在 1 min 左右 # print(count) # 1309440 # test csv to mysql # 将合并后的 csv 导入 mysql # t1 = time.time() # mysqlhost = MYSQLHOST # user = MYSQLUSER # password = MYSQLPASSWORD # mysqlport = MYSQLPORT # mysqldb = MYSQLDB # mysqltable = MYSQLTABLE # save_file = os.path.join(save_file_path, save_file_name) # load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ # REPLACE INTO TABLE {mysqldb}.{mysqltable} \ # FIELDS TERMINATED BY ',' \ # ENCLOSED BY '"' \ # IGNORE 1 LINES;""" # # csv_to_mysql(load_sql, mysqlhost, user, password) # print(time.time() - t1) # 97s # # # 检查 csv 中的数目和数据库中查询出的数量是否一致 # query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= '{dt1[:10]}' and time <= '{dt2[:10]}';""" # mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ # {mysqlport}/{mysqldb}?charset=gbk" # print(query_sql) # DATACENTER = create_engine(mysql_string) # sql_count = DATACENTER.execute(query_sql).first()[0] # print(sql_count) # 1309440 # 测试删除合并后的文件夹 # shutil.rmtree(folder_path, ignore_errors=True) pass
atetime.timedelta(days=1) # def gen_mongo_count(dt1, dt2): # """ # 计算在dt1 和 dt2之间的增量数量 理论上是一天的增量 # :param dt1: # :param dt2: # :return: # """ # # { # # "_id": ObjectId("59ce1e1d6e6dc7768c7140dc"), # # "code": "SH900955", # # "time": ISODate("1999-07-26T09:59:00Z"), # # "open": 0.462, # # "close": 0.462, # # "low": 0.462, # # "high": 0.462, #
conditional_block
utils.py
import datetime import functools import json import logging import os import shutil import subprocess import sys import time import pymongo import pandas as pd import pymysql import schedule from raven import Client from sqlalchemy import create_engine from config import MONGOURL, MYSQLHOST, MYSQLUSER, MYSQLPASSWORD, MYSQLPORT, MYSQLDB, MYSQLTABLE, SENTRY_DSN logger = logging.getLogger("main_log") db = pymongo.MongoClient(MONGOURL) coll = db.stock.mins sentry = Client(SENTRY_DSN) def all_codes_now(): codes = coll.find().distinct("code") return codes # 12332 12359 果然每天的 codes 数量不一样 def write_codes_to_file(codes): """如果codes不是经常有新增的 查询一次写入文件 下次需要的时候直接从文件中读取要比数据库 distinct 查询要快""" with open("codes.json", "w") as f: json.dump(codes, f) def wirte_code_date_to_file(dt1, dt2, date_int_str): """ 将指定 code 制定时间内的增量 写入文件 :param dt1: :param dt2: :param date_int_str: :return: """ f = open("codes.json", "r") codes = json.load(f) f.close() file_path = os.path.join(os.getcwd(), "exportdir/" + date_int_str) os.makedirs(file_path, exist_ok=True) for code in codes: q = '{{code:"{0}",time: {{$gte:ISODate("{1}"), $lte:ISODate("{2}")}}}}'.format(code, dt1, dt2) file_name = os.path.join(file_path, code) command = "mongoexport -d stock -c mins -q '{}' --fieldFile mins_fields.txt --type=csv --out {}.csv".format(q, file_name) # print(command) log_file = open("export_log.log", "a+") subprocess.call(command, shell=True, stderr=log_file) def merge_csv(folder_path, savefile_path, savefile_name): """ 将多个 csv 文件合并成一个 :param folder_path: :param savefile_path:
savefile_name: :return: """ # 修改当前工作目录 os.chdir(folder_path) # 将该文件夹下的所有文件名存入一个列表 file_list = os.listdir() # 读取第一个CSV文件并包含表头 df = pd.read_csv(os.path.join(folder_path, file_list[0])) # 创建要保存的文件夹 os.makedirs(savefile_path, exist_ok=True) # 将读取的第一个CSV文件写入合并后的文件保存 save_file = os.path.join(savefile_path, savefile_name) df.to_csv(save_file) # 循环遍历列表中各个CSV文件名,并追加到合并后的文件 count = 0 try: for i in range(1, len(file_list)): # print(os.path.join(Folder_Path, file_list[i])) df = pd.read_csv(os.path.join(folder_path, file_list[i])) # print(df) # print(df.shape[0]) count += df.shape[0] # print() # print() df.to_csv(save_file, encoding="utf-8", index=False, header=False, mode='a+') except Exception: pass return count def csv_to_mysql(load_sql, host, user, password): """ This function load a csv file to MySQL table according to the load_sql statement. :param load_sql: :param host: :param user: :param password: :return: """ try: con = pymysql.connect(host=host, user=user, password=password, autocommit=True, local_infile=1) print('Connected to DB: {}'.format(host)) # Create cursor and execute Load SQL cursor = con.cursor() cursor.execute(load_sql) print('Succuessfully loaded the table from csv.') con.close() except Exception as e: print('Error: {}'.format(str(e))) sys.exit(1) def gen_times(): """ 确定拉取的边界时间 一般情况 :return: """ dt1 = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(datetime.date.today(), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(datetime.date.today() - datetime.timedelta(days=1), datetime.time.min).strftime("%Y%m%d") return dt1, dt2, date_int_str def gen_temp_times(start, end): """ 需要补充数据的特殊情况 end 是先对当前已经过去的时间 :param start: :param end: :return: """ while start.date() <= end.date(): dt1 = datetime.datetime.combine(start, datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") dt2 = datetime.datetime.combine(start + datetime.timedelta(days=1), datetime.time.min).strftime("%Y-%m-%dT%H:%M:%SZ") date_int_str = datetime.datetime.combine(start, datetime.time.min).strftime("%Y%m%d") yield dt1, dt2, date_int_str start += datetime.timedelta(days=1) # def gen_mongo_count(dt1, dt2): # """ # 计算在dt1 和 dt2之间的增量数量 理论上是一天的增量 # :param dt1: # :param dt2: # :return: # """ # # { # # "_id": ObjectId("59ce1e1d6e6dc7768c7140dc"), # # "code": "SH900955", # # "time": ISODate("1999-07-26T09:59:00Z"), # # "open": 0.462, # # "close": 0.462, # # "low": 0.462, # # "high": 0.462, # # "volume": 0, # # "amount": 0 # # } # # 现将 dt1 和 dt2 进行转换 # ret = coll.find({"time": {"$gte": dt1, "$lte": dt2}}).count_documents # return ret def gene(dt1, dt2, date_int_str): """整个生成逻辑""" logger.info(f"dt1:{dt1}") logger.info(f"dt2:{dt2}") mysqlhost = MYSQLHOST user = MYSQLUSER password = MYSQLPASSWORD mysqlport = MYSQLPORT mysqldb = MYSQLDB mysqltable = MYSQLTABLE export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) save_file_path = os.path.join(os.getcwd(), "savedir") save_file_name = date_int_str + ".csv" # 生成截止到当前的全种类列表 codes = all_codes_now() # 将其以重写的方式存入 codes.json 文件 write_codes_to_file(codes) # 将 codes 读出到内存 同时将每一个code的增量写入文件 wirte_code_date_to_file(dt1, dt2, date_int_str) # 将 csv 文件进行合并 并且计算被导入的增量数量 count = merge_csv(folder_path, save_file_path, save_file_name) logger.info(f"由csv文件计算出的当天需要进行增量的数据量为 {count}") sentry.captureMessage(f"需要进行增量的数据量为 {count}") # 检查与 mongo 中的增量结果是否一致 # 这个查询也比较耗时 先不检查了 # mongo_count = gen_mongo_count(dt1, dt2) if count: # 将合并后的 csv 导入 mysql save_file = os.path.join(save_file_path, save_file_name) load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ REPLACE INTO TABLE {mysqldb}.{mysqltable} \ FIELDS TERMINATED BY ',' \ ENCLOSED BY '"' \ IGNORE 1 LINES;""" csv_to_mysql(load_sql, mysqlhost, user, password) # 检查 csv 中的数目和数据库中查询出的数量是否一致 query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= {date_int_str}""" mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ {mysqlport}/{mysqldb}?charset=gbk" DATACENTER = create_engine(mysql_string) sql_count = DATACENTER.execute(query_sql).first()[0] if sql_count != count: raise RuntimeError("数据量不一致,请检查!") # 合并后删除原始的 csv 文件 shutil.rmtree(folder_path, ignore_errors=True) logger.info(f"任务完成 删除当日过程 csv 文件 ") def catch_exceptions(cancel_on_failure=False): def catch_exceptions_decorator(job_func): @functools.wraps(job_func) def wrapper(*args, **kwargs): try: return job_func(*args, **kwargs) except: import traceback logger.warning(traceback.format_exc()) sentry.captureException(exc_info=True) if cancel_on_failure: # print(schedule.CancelJob) # schedule.cancel_job() return schedule.CancelJob return wrapper return catch_exceptions_decorator @catch_exceptions def main(): import_date_str = (datetime.datetime.today() - datetime.timedelta(days=1)).strftime("%Y-%m-%d") logger.info(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") sentry.captureMessage(f"现在是 {datetime.datetime.today()}, 开始增量 stock.mins 在 " f"{import_date_str} 全天的增量数据到 mysql 数据库") dt1, dt2, date_int_str = gen_times() gene(dt1, dt2, date_int_str) if __name__ == "__main__": # test gen times # res = gen_times() # print(res) # test gen temp times # start = datetime.datetime(2019, 7, 8, 12, 34, 56) # end = datetime.datetime(2019, 7, 18, 12, 34, 56) # generator = gen_temp_times(start, end) # for data in generator: # print(data) # """ # ('2019-07-08T00:00:00Z', '2019-07-09T00:00:00Z', '20190708') # ('2019-07-09T00:00:00Z', '2019-07-10T00:00:00Z', '20190709') # ('2019-07-10T00:00:00Z', '2019-07-11T00:00:00Z', '20190710') # ('2019-07-11T00:00:00Z', '2019-07-12T00:00:00Z', '20190711') # ('2019-07-12T00:00:00Z', '2019-07-13T00:00:00Z', '20190712') # ('2019-07-13T00:00:00Z', '2019-07-14T00:00:00Z', '20190713') # ('2019-07-14T00:00:00Z', '2019-07-15T00:00:00Z', '20190714') # ('2019-07-15T00:00:00Z', '2019-07-16T00:00:00Z', '20190715') # ('2019-07-16T00:00:00Z', '2019-07-17T00:00:00Z', '20190716') # ('2019-07-17T00:00:00Z', '2019-07-18T00:00:00Z', '20190717') # ('2019-07-18T00:00:00Z', '2019-07-19T00:00:00Z', '20190718') # """ # test gen all codes from mongo today # t1 = time.time() # all_codes_now() # print(time.time() - t1) # 61s # test wirte code to a file # t1 = time.time() # now_codes = all_codes_now() # write_codes_to_file(now_codes) # print(time.time() - t1) # 55s # 写入分散的 csv 文件 dt1, dt2, date_int_str = gen_times() # t1 = time.time() # wirte_code_date_to_file(dt1, dt2, date_int_str) # t2 = time.time() # print((t2 - t1)/60, "min") # 79min # test gen momngo count # mongo_count = gen_mongo_count(dt1, dt2) # print(mongo_count) # test merge csv # dt1, dt2, date_int_str = gen_times() export_path = os.path.join(os.getcwd(), "exportdir") folder_path = os.path.join(export_path, date_int_str) # save_file_path = os.path.join(os.getcwd(), "savedir") # save_file_name = date_int_str + ".csv" # # t1 = time.time() # count = merge_csv(folder_path, save_file_path, save_file_name) # t2 = time.time() # print(t2 - t1) # 时间在 1 min 左右 # print(count) # 1309440 # test csv to mysql # 将合并后的 csv 导入 mysql # t1 = time.time() # mysqlhost = MYSQLHOST # user = MYSQLUSER # password = MYSQLPASSWORD # mysqlport = MYSQLPORT # mysqldb = MYSQLDB # mysqltable = MYSQLTABLE # save_file = os.path.join(save_file_path, save_file_name) # load_sql = f"""LOAD DATA LOCAL INFILE '{save_file}' \ # REPLACE INTO TABLE {mysqldb}.{mysqltable} \ # FIELDS TERMINATED BY ',' \ # ENCLOSED BY '"' \ # IGNORE 1 LINES;""" # # csv_to_mysql(load_sql, mysqlhost, user, password) # print(time.time() - t1) # 97s # # # 检查 csv 中的数目和数据库中查询出的数量是否一致 # query_sql = f"""select count(1) from {mysqldb}.{mysqltable} where time >= '{dt1[:10]}' and time <= '{dt2[:10]}';""" # mysql_string = f"mysql+pymysql://{user}:{password}@{mysqlhost}:\ # {mysqlport}/{mysqldb}?charset=gbk" # print(query_sql) # DATACENTER = create_engine(mysql_string) # sql_count = DATACENTER.execute(query_sql).first()[0] # print(sql_count) # 1309440 # 测试删除合并后的文件夹 # shutil.rmtree(folder_path, ignore_errors=True) pass
:param
identifier_name
vga_buffer.rs
use core::fmt; use volatile::Volatile; use spin::Mutex; #[allow(dead_code)] // prevents compiler warnings that some enumerations are never used #[derive(Debug, Clone, Copy, PartialEq, Eq)] // enables copy semantics for the type: makes printable & comparable #[repr(u8)] // makes each enum variant be stored as a u8 pub enum Color { Black = 0, Blue = 1, Green = 2, Cyan = 3, Red = 4, Magenta = 5, Brown = 6, LightGray = 7, DarkGray = 8, LightBlue = 9,
LightRed = 12, Pink = 13, Yellow = 14, White = 15, } // used to represent a full VGA color code (foreground & background) #[derive(Debug, Clone, Copy, PartialEq, Eq)] struct ColorCode(u8); // creates a type which is essentially an alias for a single byte impl ColorCode { // creates a single byte detailing the fore and background colors (based on VGA specifications) fn new(foreground: Color, background: Color) -> ColorCode { ColorCode((background as u8) << 4 | (foreground as u8)) } } #[derive(Debug, Clone, Copy, PartialEq, Eq)] // ensures struct's field laid out exactly like a C struct since VGA depends on the order of the two bytes #[repr(C)] struct ScreenChar { ascii_character: u8, // VGA byte representing ascii char color_code: ColorCode, // VGA byte representing char's color } // VGA typical buffer sizes const BUFFER_HEIGHT: usize = 25; // number of lines const BUFFER_WIDTH: usize = 80; // number of chars in line struct Buffer { // Volatile crate keeps rust compiler from optimizing and removing writes // since writes are never read and are going to the VGA buffer memory (a side-effect) // and not just writing to RAM chars: [[Volatile<ScreenChar>; BUFFER_WIDTH]; BUFFER_HEIGHT], } // To actually write to screen: always writes to last line & shift lines up when a line is full (or on \n) pub struct Writer { column_position: usize, // keeps track of current position in last row color_code: ColorCode, // current fore & background colors buffer: &'static mut Buffer, // reference to VGA buffer: 'static lifetime specifies reference is valid for whole program run time (VGA buffer) } impl Writer { // writes a single byte to the screen at current location pub fn write_byte(&mut self, byte: u8) { match byte { b'\n' => self.new_line(), byte => { if self.column_position >= BUFFER_WIDTH { self.new_line(); } let row = BUFFER_HEIGHT - 1; let col = self.column_position; let color_code = self.color_code; self.buffer.chars[row][col].write(ScreenChar { ascii_character: byte, color_code: color_code, }); self.column_position += 1; } } } // accepts a string to be written only writing valid ascii chars pub fn write_string(&mut self, s: &str) { for byte in s.bytes() { match byte { // printable ASCII byte or newline 0x20...0x7e | b'\n' => self.write_byte(byte), // not part of printable ASCII range _ => self.write_byte(0xfe), } } } fn new_line(&mut self) { // range notation is exclusive of upper end. // top line of screen is 0 and is shifted off screen for row in 1..BUFFER_HEIGHT { for col in 0..BUFFER_WIDTH { let char = self.buffer.chars[row][col].read(); self.buffer.chars[row-1][col].write(char); } } // clears last line of output for new input, otherwise if string being written // is not long enough all previous characters will not be overwritten self.clear_row(BUFFER_HEIGHT - 1); self.column_position = 0; } // clears row by overwriting characters with spaces fn clear_row(&mut self, row: usize) { let blank = ScreenChar { ascii_character: b' ', color_code: self.color_code, }; for col in 0..BUFFER_WIDTH { self.buffer.chars[row][col].write(blank); } } } // Provides support for Rust's formatting macros allowing easy printing // of different types like integers or floats. // Results in: Write! / Writeln! macro support impl fmt::Write for Writer { // The only required method of the fmt::Write trait fn write_str(&mut self, s: &str) -> fmt::Result { self.write_string(s); Ok(()) } } // Provides a static Writer object which utilizes non-const functions // Requires locking to provide interior mutability: since it utilizes &mut self for writing // it requires mutability, but its mutibility is not provided to users, therefore it is interior // mutability. The Mutex allows safe usage internally. lazy_static! { pub static ref WRITER: Mutex<Writer> = Mutex::new(Writer { column_position: 0, color_code: ColorCode::new(Color::Yellow, Color::Black), // provides a direct mutable reference to the VGA memory-mapped I/O address // allowing reading and writing. We deem this safe as this address always corresponds to // VGA, and therefore it is acceptable and required to wrap in an unsafe block buffer: unsafe { &mut *(0xb8000 as *mut Buffer) }, }); } // Defines the print! macro #[macro_export] macro_rules! print { ($($arg:tt)*) => ($crate::vga_buffer::print(format_args!($($arg)*))); } // Defines the println! macro #[macro_export] macro_rules! println { () => (print!("\n")); ($fmt:expr) => (print!(concat!($fmt, "\n"))); ($fmt:expr, $($arg:tt)*) => (print!(concat!($fmt, "\n"), $($arg)*)); } pub fn print(args: fmt::Arguments) { use core::fmt::Write; // imports write_fmt method from the Write trait WRITER.lock().write_fmt(args).unwrap(); } #[cfg(test)] mod test { use super::*; // import all items of parent module: vga_buffer // Specifies what char represents an empty cell in VGA buffer during testing fn empty_char() -> ScreenChar { ScreenChar { ascii_character: b' ', color_code: ColorCode::new(Color::Green, Color::Brown), } } fn construct_buffer() -> Buffer { // bypasses array construction requiring that contained type is Copy // ScreenChar satisfies this, but the Volatile wrapper does not use array_init::array_init; Buffer { // Provides array initialization without non-Copy types. // parameter of array_init is a closure. The single parameter to the closure is unused and therefore unimportant // otherwise it could be used to perform calculations on value before creating the array. // array_init utilizes type's size to create the required number of indices. In this case // the number of columns and rows are defined in the Buffer struct // "The width & height are deduced by type inference" chars: array_init(|_| array_init(|_| Volatile::new(empty_char()))), } } fn construct_writer() -> Writer { use std::boxed::Box; let buffer = construct_buffer(); Writer { column_position: 0, color_code: ColorCode::new(Color::Blue, Color::Magenta), // transforms the created buffer into a &'static mut to satisfy buffer property's type buffer: Box::leak(Box::new(buffer)), } } #[test] // tells test framework this is a test function fn write_byte() { let mut writer = construct_writer(); writer.write_byte(b'X'); writer.write_byte(b'Y'); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 1 && j == 0 { assert_eq!(screen_char.ascii_character, b'X'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 1 && j == 1 { assert_eq!(screen_char.ascii_character, b'Y'); assert_eq!(screen_char.color_code, writer.color_code); } else { assert_eq!(screen_char, empty_char()); } } } } #[test] fn write_formatted() { use core::fmt::Write; let mut writer = construct_writer(); writeln!(&mut writer, "a").unwrap(); writeln!(&mut writer, "b{}", "c").unwrap(); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 3 && j == 0 { assert_eq!(screen_char.ascii_character, b'a'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 0 { assert_eq!(screen_char.ascii_character, b'b'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 1 { assert_eq!(screen_char.ascii_character, b'c'); assert_eq!(screen_char.color_code, writer.color_code); } else if i >= BUFFER_HEIGHT - 2 { // ensures empty lines are shifted in on a new line and have correct color code assert_eq!(screen_char.ascii_character, b' '); assert_eq!(screen_char.color_code, writer.color_code); } else { assert_eq!(screen_char, empty_char()); } } } } }
LightGreen = 10, LightCyan = 11,
random_line_split
vga_buffer.rs
use core::fmt; use volatile::Volatile; use spin::Mutex; #[allow(dead_code)] // prevents compiler warnings that some enumerations are never used #[derive(Debug, Clone, Copy, PartialEq, Eq)] // enables copy semantics for the type: makes printable & comparable #[repr(u8)] // makes each enum variant be stored as a u8 pub enum Color { Black = 0, Blue = 1, Green = 2, Cyan = 3, Red = 4, Magenta = 5, Brown = 6, LightGray = 7, DarkGray = 8, LightBlue = 9, LightGreen = 10, LightCyan = 11, LightRed = 12, Pink = 13, Yellow = 14, White = 15, } // used to represent a full VGA color code (foreground & background) #[derive(Debug, Clone, Copy, PartialEq, Eq)] struct ColorCode(u8); // creates a type which is essentially an alias for a single byte impl ColorCode { // creates a single byte detailing the fore and background colors (based on VGA specifications) fn new(foreground: Color, background: Color) -> ColorCode { ColorCode((background as u8) << 4 | (foreground as u8)) } } #[derive(Debug, Clone, Copy, PartialEq, Eq)] // ensures struct's field laid out exactly like a C struct since VGA depends on the order of the two bytes #[repr(C)] struct ScreenChar { ascii_character: u8, // VGA byte representing ascii char color_code: ColorCode, // VGA byte representing char's color } // VGA typical buffer sizes const BUFFER_HEIGHT: usize = 25; // number of lines const BUFFER_WIDTH: usize = 80; // number of chars in line struct Buffer { // Volatile crate keeps rust compiler from optimizing and removing writes // since writes are never read and are going to the VGA buffer memory (a side-effect) // and not just writing to RAM chars: [[Volatile<ScreenChar>; BUFFER_WIDTH]; BUFFER_HEIGHT], } // To actually write to screen: always writes to last line & shift lines up when a line is full (or on \n) pub struct Writer { column_position: usize, // keeps track of current position in last row color_code: ColorCode, // current fore & background colors buffer: &'static mut Buffer, // reference to VGA buffer: 'static lifetime specifies reference is valid for whole program run time (VGA buffer) } impl Writer { // writes a single byte to the screen at current location pub fn write_byte(&mut self, byte: u8) { match byte { b'\n' => self.new_line(), byte => { if self.column_position >= BUFFER_WIDTH { self.new_line(); } let row = BUFFER_HEIGHT - 1; let col = self.column_position; let color_code = self.color_code; self.buffer.chars[row][col].write(ScreenChar { ascii_character: byte, color_code: color_code, }); self.column_position += 1; } } } // accepts a string to be written only writing valid ascii chars pub fn write_string(&mut self, s: &str) { for byte in s.bytes() { match byte { // printable ASCII byte or newline 0x20...0x7e | b'\n' => self.write_byte(byte), // not part of printable ASCII range _ => self.write_byte(0xfe), } } } fn new_line(&mut self) { // range notation is exclusive of upper end. // top line of screen is 0 and is shifted off screen for row in 1..BUFFER_HEIGHT { for col in 0..BUFFER_WIDTH { let char = self.buffer.chars[row][col].read(); self.buffer.chars[row-1][col].write(char); } } // clears last line of output for new input, otherwise if string being written // is not long enough all previous characters will not be overwritten self.clear_row(BUFFER_HEIGHT - 1); self.column_position = 0; } // clears row by overwriting characters with spaces fn clear_row(&mut self, row: usize) { let blank = ScreenChar { ascii_character: b' ', color_code: self.color_code, }; for col in 0..BUFFER_WIDTH { self.buffer.chars[row][col].write(blank); } } } // Provides support for Rust's formatting macros allowing easy printing // of different types like integers or floats. // Results in: Write! / Writeln! macro support impl fmt::Write for Writer { // The only required method of the fmt::Write trait fn write_str(&mut self, s: &str) -> fmt::Result { self.write_string(s); Ok(()) } } // Provides a static Writer object which utilizes non-const functions // Requires locking to provide interior mutability: since it utilizes &mut self for writing // it requires mutability, but its mutibility is not provided to users, therefore it is interior // mutability. The Mutex allows safe usage internally. lazy_static! { pub static ref WRITER: Mutex<Writer> = Mutex::new(Writer { column_position: 0, color_code: ColorCode::new(Color::Yellow, Color::Black), // provides a direct mutable reference to the VGA memory-mapped I/O address // allowing reading and writing. We deem this safe as this address always corresponds to // VGA, and therefore it is acceptable and required to wrap in an unsafe block buffer: unsafe { &mut *(0xb8000 as *mut Buffer) }, }); } // Defines the print! macro #[macro_export] macro_rules! print { ($($arg:tt)*) => ($crate::vga_buffer::print(format_args!($($arg)*))); } // Defines the println! macro #[macro_export] macro_rules! println { () => (print!("\n")); ($fmt:expr) => (print!(concat!($fmt, "\n"))); ($fmt:expr, $($arg:tt)*) => (print!(concat!($fmt, "\n"), $($arg)*)); } pub fn print(args: fmt::Arguments) { use core::fmt::Write; // imports write_fmt method from the Write trait WRITER.lock().write_fmt(args).unwrap(); } #[cfg(test)] mod test { use super::*; // import all items of parent module: vga_buffer // Specifies what char represents an empty cell in VGA buffer during testing fn empty_char() -> ScreenChar { ScreenChar { ascii_character: b' ', color_code: ColorCode::new(Color::Green, Color::Brown), } } fn construct_buffer() -> Buffer { // bypasses array construction requiring that contained type is Copy // ScreenChar satisfies this, but the Volatile wrapper does not use array_init::array_init; Buffer { // Provides array initialization without non-Copy types. // parameter of array_init is a closure. The single parameter to the closure is unused and therefore unimportant // otherwise it could be used to perform calculations on value before creating the array. // array_init utilizes type's size to create the required number of indices. In this case // the number of columns and rows are defined in the Buffer struct // "The width & height are deduced by type inference" chars: array_init(|_| array_init(|_| Volatile::new(empty_char()))), } } fn construct_writer() -> Writer { use std::boxed::Box; let buffer = construct_buffer(); Writer { column_position: 0, color_code: ColorCode::new(Color::Blue, Color::Magenta), // transforms the created buffer into a &'static mut to satisfy buffer property's type buffer: Box::leak(Box::new(buffer)), } } #[test] // tells test framework this is a test function fn write_byte() { let mut writer = construct_writer(); writer.write_byte(b'X'); writer.write_byte(b'Y'); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 1 && j == 0 { assert_eq!(screen_char.ascii_character, b'X'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 1 && j == 1 { assert_eq!(screen_char.ascii_character, b'Y'); assert_eq!(screen_char.color_code, writer.color_code); } else { assert_eq!(screen_char, empty_char()); } } } } #[test] fn write_formatted() { use core::fmt::Write; let mut writer = construct_writer(); writeln!(&mut writer, "a").unwrap(); writeln!(&mut writer, "b{}", "c").unwrap(); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 3 && j == 0 { assert_eq!(screen_char.ascii_character, b'a'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 0 { assert_eq!(screen_char.ascii_character, b'b'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 1 { assert_eq!(screen_char.ascii_character, b'c'); assert_eq!(screen_char.color_code, writer.color_code); } else if i >= BUFFER_HEIGHT - 2
else { assert_eq!(screen_char, empty_char()); } } } } }
{ // ensures empty lines are shifted in on a new line and have correct color code assert_eq!(screen_char.ascii_character, b' '); assert_eq!(screen_char.color_code, writer.color_code); }
conditional_block
vga_buffer.rs
use core::fmt; use volatile::Volatile; use spin::Mutex; #[allow(dead_code)] // prevents compiler warnings that some enumerations are never used #[derive(Debug, Clone, Copy, PartialEq, Eq)] // enables copy semantics for the type: makes printable & comparable #[repr(u8)] // makes each enum variant be stored as a u8 pub enum
{ Black = 0, Blue = 1, Green = 2, Cyan = 3, Red = 4, Magenta = 5, Brown = 6, LightGray = 7, DarkGray = 8, LightBlue = 9, LightGreen = 10, LightCyan = 11, LightRed = 12, Pink = 13, Yellow = 14, White = 15, } // used to represent a full VGA color code (foreground & background) #[derive(Debug, Clone, Copy, PartialEq, Eq)] struct ColorCode(u8); // creates a type which is essentially an alias for a single byte impl ColorCode { // creates a single byte detailing the fore and background colors (based on VGA specifications) fn new(foreground: Color, background: Color) -> ColorCode { ColorCode((background as u8) << 4 | (foreground as u8)) } } #[derive(Debug, Clone, Copy, PartialEq, Eq)] // ensures struct's field laid out exactly like a C struct since VGA depends on the order of the two bytes #[repr(C)] struct ScreenChar { ascii_character: u8, // VGA byte representing ascii char color_code: ColorCode, // VGA byte representing char's color } // VGA typical buffer sizes const BUFFER_HEIGHT: usize = 25; // number of lines const BUFFER_WIDTH: usize = 80; // number of chars in line struct Buffer { // Volatile crate keeps rust compiler from optimizing and removing writes // since writes are never read and are going to the VGA buffer memory (a side-effect) // and not just writing to RAM chars: [[Volatile<ScreenChar>; BUFFER_WIDTH]; BUFFER_HEIGHT], } // To actually write to screen: always writes to last line & shift lines up when a line is full (or on \n) pub struct Writer { column_position: usize, // keeps track of current position in last row color_code: ColorCode, // current fore & background colors buffer: &'static mut Buffer, // reference to VGA buffer: 'static lifetime specifies reference is valid for whole program run time (VGA buffer) } impl Writer { // writes a single byte to the screen at current location pub fn write_byte(&mut self, byte: u8) { match byte { b'\n' => self.new_line(), byte => { if self.column_position >= BUFFER_WIDTH { self.new_line(); } let row = BUFFER_HEIGHT - 1; let col = self.column_position; let color_code = self.color_code; self.buffer.chars[row][col].write(ScreenChar { ascii_character: byte, color_code: color_code, }); self.column_position += 1; } } } // accepts a string to be written only writing valid ascii chars pub fn write_string(&mut self, s: &str) { for byte in s.bytes() { match byte { // printable ASCII byte or newline 0x20...0x7e | b'\n' => self.write_byte(byte), // not part of printable ASCII range _ => self.write_byte(0xfe), } } } fn new_line(&mut self) { // range notation is exclusive of upper end. // top line of screen is 0 and is shifted off screen for row in 1..BUFFER_HEIGHT { for col in 0..BUFFER_WIDTH { let char = self.buffer.chars[row][col].read(); self.buffer.chars[row-1][col].write(char); } } // clears last line of output for new input, otherwise if string being written // is not long enough all previous characters will not be overwritten self.clear_row(BUFFER_HEIGHT - 1); self.column_position = 0; } // clears row by overwriting characters with spaces fn clear_row(&mut self, row: usize) { let blank = ScreenChar { ascii_character: b' ', color_code: self.color_code, }; for col in 0..BUFFER_WIDTH { self.buffer.chars[row][col].write(blank); } } } // Provides support for Rust's formatting macros allowing easy printing // of different types like integers or floats. // Results in: Write! / Writeln! macro support impl fmt::Write for Writer { // The only required method of the fmt::Write trait fn write_str(&mut self, s: &str) -> fmt::Result { self.write_string(s); Ok(()) } } // Provides a static Writer object which utilizes non-const functions // Requires locking to provide interior mutability: since it utilizes &mut self for writing // it requires mutability, but its mutibility is not provided to users, therefore it is interior // mutability. The Mutex allows safe usage internally. lazy_static! { pub static ref WRITER: Mutex<Writer> = Mutex::new(Writer { column_position: 0, color_code: ColorCode::new(Color::Yellow, Color::Black), // provides a direct mutable reference to the VGA memory-mapped I/O address // allowing reading and writing. We deem this safe as this address always corresponds to // VGA, and therefore it is acceptable and required to wrap in an unsafe block buffer: unsafe { &mut *(0xb8000 as *mut Buffer) }, }); } // Defines the print! macro #[macro_export] macro_rules! print { ($($arg:tt)*) => ($crate::vga_buffer::print(format_args!($($arg)*))); } // Defines the println! macro #[macro_export] macro_rules! println { () => (print!("\n")); ($fmt:expr) => (print!(concat!($fmt, "\n"))); ($fmt:expr, $($arg:tt)*) => (print!(concat!($fmt, "\n"), $($arg)*)); } pub fn print(args: fmt::Arguments) { use core::fmt::Write; // imports write_fmt method from the Write trait WRITER.lock().write_fmt(args).unwrap(); } #[cfg(test)] mod test { use super::*; // import all items of parent module: vga_buffer // Specifies what char represents an empty cell in VGA buffer during testing fn empty_char() -> ScreenChar { ScreenChar { ascii_character: b' ', color_code: ColorCode::new(Color::Green, Color::Brown), } } fn construct_buffer() -> Buffer { // bypasses array construction requiring that contained type is Copy // ScreenChar satisfies this, but the Volatile wrapper does not use array_init::array_init; Buffer { // Provides array initialization without non-Copy types. // parameter of array_init is a closure. The single parameter to the closure is unused and therefore unimportant // otherwise it could be used to perform calculations on value before creating the array. // array_init utilizes type's size to create the required number of indices. In this case // the number of columns and rows are defined in the Buffer struct // "The width & height are deduced by type inference" chars: array_init(|_| array_init(|_| Volatile::new(empty_char()))), } } fn construct_writer() -> Writer { use std::boxed::Box; let buffer = construct_buffer(); Writer { column_position: 0, color_code: ColorCode::new(Color::Blue, Color::Magenta), // transforms the created buffer into a &'static mut to satisfy buffer property's type buffer: Box::leak(Box::new(buffer)), } } #[test] // tells test framework this is a test function fn write_byte() { let mut writer = construct_writer(); writer.write_byte(b'X'); writer.write_byte(b'Y'); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 1 && j == 0 { assert_eq!(screen_char.ascii_character, b'X'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 1 && j == 1 { assert_eq!(screen_char.ascii_character, b'Y'); assert_eq!(screen_char.color_code, writer.color_code); } else { assert_eq!(screen_char, empty_char()); } } } } #[test] fn write_formatted() { use core::fmt::Write; let mut writer = construct_writer(); writeln!(&mut writer, "a").unwrap(); writeln!(&mut writer, "b{}", "c").unwrap(); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 3 && j == 0 { assert_eq!(screen_char.ascii_character, b'a'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 0 { assert_eq!(screen_char.ascii_character, b'b'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 1 { assert_eq!(screen_char.ascii_character, b'c'); assert_eq!(screen_char.color_code, writer.color_code); } else if i >= BUFFER_HEIGHT - 2 { // ensures empty lines are shifted in on a new line and have correct color code assert_eq!(screen_char.ascii_character, b' '); assert_eq!(screen_char.color_code, writer.color_code); } else { assert_eq!(screen_char, empty_char()); } } } } }
Color
identifier_name
vga_buffer.rs
use core::fmt; use volatile::Volatile; use spin::Mutex; #[allow(dead_code)] // prevents compiler warnings that some enumerations are never used #[derive(Debug, Clone, Copy, PartialEq, Eq)] // enables copy semantics for the type: makes printable & comparable #[repr(u8)] // makes each enum variant be stored as a u8 pub enum Color { Black = 0, Blue = 1, Green = 2, Cyan = 3, Red = 4, Magenta = 5, Brown = 6, LightGray = 7, DarkGray = 8, LightBlue = 9, LightGreen = 10, LightCyan = 11, LightRed = 12, Pink = 13, Yellow = 14, White = 15, } // used to represent a full VGA color code (foreground & background) #[derive(Debug, Clone, Copy, PartialEq, Eq)] struct ColorCode(u8); // creates a type which is essentially an alias for a single byte impl ColorCode { // creates a single byte detailing the fore and background colors (based on VGA specifications) fn new(foreground: Color, background: Color) -> ColorCode { ColorCode((background as u8) << 4 | (foreground as u8)) } } #[derive(Debug, Clone, Copy, PartialEq, Eq)] // ensures struct's field laid out exactly like a C struct since VGA depends on the order of the two bytes #[repr(C)] struct ScreenChar { ascii_character: u8, // VGA byte representing ascii char color_code: ColorCode, // VGA byte representing char's color } // VGA typical buffer sizes const BUFFER_HEIGHT: usize = 25; // number of lines const BUFFER_WIDTH: usize = 80; // number of chars in line struct Buffer { // Volatile crate keeps rust compiler from optimizing and removing writes // since writes are never read and are going to the VGA buffer memory (a side-effect) // and not just writing to RAM chars: [[Volatile<ScreenChar>; BUFFER_WIDTH]; BUFFER_HEIGHT], } // To actually write to screen: always writes to last line & shift lines up when a line is full (or on \n) pub struct Writer { column_position: usize, // keeps track of current position in last row color_code: ColorCode, // current fore & background colors buffer: &'static mut Buffer, // reference to VGA buffer: 'static lifetime specifies reference is valid for whole program run time (VGA buffer) } impl Writer { // writes a single byte to the screen at current location pub fn write_byte(&mut self, byte: u8) { match byte { b'\n' => self.new_line(), byte => { if self.column_position >= BUFFER_WIDTH { self.new_line(); } let row = BUFFER_HEIGHT - 1; let col = self.column_position; let color_code = self.color_code; self.buffer.chars[row][col].write(ScreenChar { ascii_character: byte, color_code: color_code, }); self.column_position += 1; } } } // accepts a string to be written only writing valid ascii chars pub fn write_string(&mut self, s: &str) { for byte in s.bytes() { match byte { // printable ASCII byte or newline 0x20...0x7e | b'\n' => self.write_byte(byte), // not part of printable ASCII range _ => self.write_byte(0xfe), } } } fn new_line(&mut self) { // range notation is exclusive of upper end. // top line of screen is 0 and is shifted off screen for row in 1..BUFFER_HEIGHT { for col in 0..BUFFER_WIDTH { let char = self.buffer.chars[row][col].read(); self.buffer.chars[row-1][col].write(char); } } // clears last line of output for new input, otherwise if string being written // is not long enough all previous characters will not be overwritten self.clear_row(BUFFER_HEIGHT - 1); self.column_position = 0; } // clears row by overwriting characters with spaces fn clear_row(&mut self, row: usize) { let blank = ScreenChar { ascii_character: b' ', color_code: self.color_code, }; for col in 0..BUFFER_WIDTH { self.buffer.chars[row][col].write(blank); } } } // Provides support for Rust's formatting macros allowing easy printing // of different types like integers or floats. // Results in: Write! / Writeln! macro support impl fmt::Write for Writer { // The only required method of the fmt::Write trait fn write_str(&mut self, s: &str) -> fmt::Result
} // Provides a static Writer object which utilizes non-const functions // Requires locking to provide interior mutability: since it utilizes &mut self for writing // it requires mutability, but its mutibility is not provided to users, therefore it is interior // mutability. The Mutex allows safe usage internally. lazy_static! { pub static ref WRITER: Mutex<Writer> = Mutex::new(Writer { column_position: 0, color_code: ColorCode::new(Color::Yellow, Color::Black), // provides a direct mutable reference to the VGA memory-mapped I/O address // allowing reading and writing. We deem this safe as this address always corresponds to // VGA, and therefore it is acceptable and required to wrap in an unsafe block buffer: unsafe { &mut *(0xb8000 as *mut Buffer) }, }); } // Defines the print! macro #[macro_export] macro_rules! print { ($($arg:tt)*) => ($crate::vga_buffer::print(format_args!($($arg)*))); } // Defines the println! macro #[macro_export] macro_rules! println { () => (print!("\n")); ($fmt:expr) => (print!(concat!($fmt, "\n"))); ($fmt:expr, $($arg:tt)*) => (print!(concat!($fmt, "\n"), $($arg)*)); } pub fn print(args: fmt::Arguments) { use core::fmt::Write; // imports write_fmt method from the Write trait WRITER.lock().write_fmt(args).unwrap(); } #[cfg(test)] mod test { use super::*; // import all items of parent module: vga_buffer // Specifies what char represents an empty cell in VGA buffer during testing fn empty_char() -> ScreenChar { ScreenChar { ascii_character: b' ', color_code: ColorCode::new(Color::Green, Color::Brown), } } fn construct_buffer() -> Buffer { // bypasses array construction requiring that contained type is Copy // ScreenChar satisfies this, but the Volatile wrapper does not use array_init::array_init; Buffer { // Provides array initialization without non-Copy types. // parameter of array_init is a closure. The single parameter to the closure is unused and therefore unimportant // otherwise it could be used to perform calculations on value before creating the array. // array_init utilizes type's size to create the required number of indices. In this case // the number of columns and rows are defined in the Buffer struct // "The width & height are deduced by type inference" chars: array_init(|_| array_init(|_| Volatile::new(empty_char()))), } } fn construct_writer() -> Writer { use std::boxed::Box; let buffer = construct_buffer(); Writer { column_position: 0, color_code: ColorCode::new(Color::Blue, Color::Magenta), // transforms the created buffer into a &'static mut to satisfy buffer property's type buffer: Box::leak(Box::new(buffer)), } } #[test] // tells test framework this is a test function fn write_byte() { let mut writer = construct_writer(); writer.write_byte(b'X'); writer.write_byte(b'Y'); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 1 && j == 0 { assert_eq!(screen_char.ascii_character, b'X'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 1 && j == 1 { assert_eq!(screen_char.ascii_character, b'Y'); assert_eq!(screen_char.color_code, writer.color_code); } else { assert_eq!(screen_char, empty_char()); } } } } #[test] fn write_formatted() { use core::fmt::Write; let mut writer = construct_writer(); writeln!(&mut writer, "a").unwrap(); writeln!(&mut writer, "b{}", "c").unwrap(); for (i, row) in writer.buffer.chars.iter().enumerate() { for (j, screen_char) in row.iter().enumerate() { let screen_char = screen_char.read(); if i == BUFFER_HEIGHT - 3 && j == 0 { assert_eq!(screen_char.ascii_character, b'a'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 0 { assert_eq!(screen_char.ascii_character, b'b'); assert_eq!(screen_char.color_code, writer.color_code); } else if i == BUFFER_HEIGHT - 2 && j == 1 { assert_eq!(screen_char.ascii_character, b'c'); assert_eq!(screen_char.color_code, writer.color_code); } else if i >= BUFFER_HEIGHT - 2 { // ensures empty lines are shifted in on a new line and have correct color code assert_eq!(screen_char.ascii_character, b' '); assert_eq!(screen_char.color_code, writer.color_code); } else { assert_eq!(screen_char, empty_char()); } } } } }
{ self.write_string(s); Ok(()) }
identifier_body
059_Implementacion_plazos.py
#!/usr/bin/env python # -*- coding: utf-8 -*- # execfile(PATH + "syntax/03_Deteccion_info/059_Implementacion_plazos.py") if __name__ == "__main__": guardaResultados = True muestraHTML = True guardaES = True es_hdfs = False import sys import platform if platform.system() == "Windows": PATH = "D:/Judicial/" sys.path.append('C:/Python27/Lib/site-packages') eslocal = True try: pais except NameError: pais = "esp" else: PATH = "/home/dcortiada/" eslocal = False if len(sys.argv) < 7: raise Exception("Tiene que haber como minimo 6 argumentos!!\nEjemplo llamada:\n python 019_Implementacion_leyes.py ip_donde_leer(172.22.248.206:9229) ip_donde_escribir(172.22.248.206:9229) indice_donde_leer indice_donde_escribir criterio(name) fichero_a_procesar1 fichero_a_procesar2") else: ipread = sys.argv[1] ipwrite = sys.argv[2] indiceread = sys.argv[3] indicewrite = sys.argv[4] criterion = sys.argv[5] files2Eval = sys.argv[6].split("/") # pais = sys.argv[7] # idioma = sys.argv[8] # es_hdfs = sys.argv[9] pais = "esp" idioma = "es" es_hdfs = False print "Los archivos a evaluar son los siguientes:\n '" + reduce(lambda x, y: x + "', '" + y, files2Eval) + "'." if es_hdfs == "True": es_hdfs = True else: es_hdfs = False if es_hdfs: PATH = "hdfs:///user/ijdocs/" from pyspark import SparkConf, SparkContext from pyspark.sql import SQLContext, HiveContext # Crear la configuracion de spark conf = (SparkConf() .setAppName("ejemplo") .set("spark.executor.memory", "1g") .set("spark.yarn.appMasterEnv.PYSPARK_PYTHON", "/usr/bin/python") .set("spark.yarn.appMasterEnv.PYSPARK_DRIVER_PYTHON", "/usr/bin/python")) # Crear el SparkContext con la configuración anterior sc = SparkContext(conf=conf) # Conectores SQL para trabajar en nuestro script sqlContext = SQLContext(sc) hiveContext = HiveContext(sc) # Cargamos librerias y funciones from os import listdir import numpy as np from os.path import exists import pandas as pd from math import factorial import gensim import json from copy import deepcopy if not es_hdfs: execfile(PATH + "syntax/scripts/NER/carga_todas_funciones.py") else: filename = PATH + "syntax/scripts/NER/funciones_comparacion_texto.py" sc.addPyFile(filename) from funciones_comparacion_texto import * filename = PATH + "syntax/scripts/NER/funciones_elastic.py" sc.addPyFile(filename) from funciones_elastic import * filename = PATH + "syntax/scripts/NER/funciones_transforma_refs.py" sc.addPyFile(filename) from funciones_transforma_refs import * filename = PATH + "syntax/scripts/NER/funciones_busqueda.py" sc.addPyFile(filename) from funciones_busqueda import * filename = PATH + "syntax/scripts/NER/funciones_preprocesado.py" sc.addPyFile(filename) from funciones_preprocesado import * filename = PATH + "syntax/scripts/NER/funciones_tratamiento_texto.py" sc.addPyFile(filename) from funciones_tratamiento_texto import * filename = PATH + "syntax/scripts/NER/funciones_lectura_datos.py" sc.addPyFile(filename) from funciones_lectura_datos import * # Definimos parametros OUTPUTDIR = PATH + "output/resultados_plazos/" if eslocal: INPUTREAD = PATH + "input/documentos_expedientes/" files2Eval = listdir(INPUTREAD) else: try: files2Eval except NameError: files2Eval = list_docs(criterion = criterion, con = Elasticsearch([ipread]), indice = indiceread) # Definimos expresiones regulares de las cantidades DictPaisSearchMaxEnrere = dict( esp = [ dict(contiene = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'], # inicios = ['[0-9]+', "\\buno", "\\bdos", "\\btres", "\\bcuatro", "\\bcinco", "\\bseis", "\\bsiete", "\\bocho", "\\bnueve", "\\bdiez", "\\bonce", "\\bdoce", "\\btrece", "\\bcatorce", "\\bquince", "\\bdieciseis", "\\bdiecisiete", "\\bdieciocho", "\\bdiecinueve", "\\bveinte", "\\bventi", "\\bveinti", "\\btreinta", "\\btrenta", "\\bcuarenta", "\\bcincuenta", "\\bsesenta", "\\bochenta", "\\bnoventa", "\\bcien", "\\bdoscientos", "\\btrescientos", "\\bcuatrocientos", "\\bquinientos", "\\bseiscientos", "\\bsetecientos", "\\bochocientos"], inicios = ['pena', "plazo", "condena", "multa", "beneficio de la comunidad", "beneficio a la comunidad", "sancion"], finales = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'] ) ], bra = [ dict(contiene = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'], # inicios = ['[0-9]+', "\\buno", "\\bdos", "\\btres", "\\bcuatro", "\\bcinco", "\\bseis", "\\bsiete", "\\bocho", "\\bnueve", "\\bdiez", "\\bonce", "\\bdoce", "\\btrece", "\\bcatorce", "\\bquince", "\\bdieciseis", "\\bdiecisiete", "\\bdieciocho", "\\bdiecinueve", "\\bveinte", "\\bventi", "\\bveinti", "\\btreinta", "\\btrenta", "\\bcuarenta", "\\bcincuenta", "\\bsesenta", "\\bochenta", "\\bnoventa", "\\bcien", "\\bdoscientos", "\\btrescientos", "\\bcuatrocientos", "\\bquinientos", "\\bseiscientos", "\\bsetecientos", "\\bochocientos"], inicios = ['pena', "prazo", "conviccao", "fino", "sancao", "sancoes"], finales = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'] ) ] ) SearchMaxEnrere = DictPaisSearchMaxEnrere[pais] limSimFrases = 0.15 # Limit a partir del qual diem que 2 frases s'assemblen guardaES = guardaES and not eslocal # Solo guardamos a elastic si no se ejecuta desde local for filename in files2Eval: print("Procesando " + filename + "...") if eslocal: RawReadedFile = pdf2txt(INPUTREAD + filename) else: RawReadedFile = import_doc(filename, criterion = criterion, con = Elasticsearch([ipread]), indice = indiceread) readedFile = remove_accents(RawReadedFile) readedFile = readedFile.lower() # ================== # # === Script 050 === # # ================== # # Buscamos posiciones teniendo en cuenta lo maximo para atras index_points_max_enrere = [] for dictstr2search in SearchMaxEnrere: idxAct = [] for str2search in dictstr2search['contiene']: idxAct.extend(buscaPosicionRegexTexto(str2search, readedFile)) index_points_max_enrere.append(idxAct) plazos = [] for i in range(len(SearchMaxEnrere)): dictAct = SearchMaxEnrere[i] for item in index_points_max_enrere[i]: # Preparamos textos de inicios y finales aux_texto_ini = readedFile[:item[1]] aux_texto_fin = readedFile[item[0]:] # Buscamos inicios y fines listInicios = [] listFinal = [] for i_inicio in dictAct['inicios']: listInicios.extend(buscaPosicionRegexTexto(i_inicio, aux_texto_ini)) for i_final in dictAct['finales']: listFinal.extend(buscaPosicionRegexTexto(i_final, aux_texto_fin)) if len(listInicios) == 0 or len(listFinal) == 0: continue listInicios = np.array(listInicios) listFinal = np.array(listFinal) sel = abs(listInicios[:, 0] - len(aux_texto_ini)) < 50 if any(sel): selFin = listFinal[:, 1] < 50 if any(selFin): plazos.append((min(listInicios[sel, 0]), item[0] + max(listFinal[selFin, 1]))) else: plazos.append((min(listInicios[sel, 0]), item[0] + min(listFinal[:, 1]))) # Buscamos registros unicos plazos = list(set(plazos)) if len(plazos) == 0: print "No hemos encontrado plazos en este documento" continue # Regulamos que no se incluyan unos dentro de otros los textos plazos = pd.DataFrame(plazos) plazos = plazos.sort(0) plazos = plazos.values.tolist() jresta = 0 for i in range(1, len(plazos)): if plazos[i - jresta][0] < plazos[i - 1 - jresta][1]: plazos[i - jresta] = [plazos[i - 1 - jresta][0], plazos[i - jresta][1]] plazos.pop(i - 1 - jresta) jresta += 1 # ================== # # === Script 051 === # # ================== # # === # # Canvi respecte script 051!! listRefs = deepcopy(plazos) listRefs = pd.DataFrame(listRefs) listRefs.columns = ["PosInicio", "PosFin"] listRefs["Referencia"] = "" for i in range(listRefs.shape[0]): listRefs["Referencia"][i] = readedFile[listRefs["PosInicio"][i]:listRefs["PosFin"][i]] # === # listRefs["Ref_Orig"] = listRefs["Referencia"] # Hacemos modificaciones en las referencias caracteres_elimina = [":", ".", "(", ")", ",", ";"] caracteres_espacio = ["\n", "/", "-"] for ce in caracteres_elimina: listRefs["Referencia"] = listRefs["Referencia"].str.replace(ce, "") for ce in caracteres_espacio: listRefs["Referencia"] = listRefs["Referencia"].str.replace(ce, " ") for i in range(listRefs.shape[0]): listRefs["Referencia"][i] = quitaDoblesEspacios(listRefs["Referencia"][i]) listRefs["Referencia"] = listRefs["Referencia"].str.strip() # Normalizamos los campos listRefs["Referencia_Normalizada"] = '' for i in range(listRefs.shape[0]): normaliza = listRefs["Referencia"][i] normaliza = normaliza.replace(" un ", " uno ") aux_str = normaliza.split(" de ") aux_norm = aux_str[len(aux_str) - 1] aux_norm2 = aux_norm.split(" y ") resNums = [] for aux_norm in aux_norm2: aux_str = aux_norm.split(" ") unidades = aux_str[len(aux_str) - 1] number = reduce_concat(aux_str[:-1], sep = " ") try: number = transformaNumsString(number) except: pass resNums.append(number + " " + unidades) listRefs["Referencia_Normalizada"][i] = reduce_concat(resNums, sep = " y ") # ================== # # === Script 052 === # # ================== # # Montamos un string con la misma estructura y con acentos try: RawReadedFileAcc = str(RawReadedFile.decode("utf8").encode("latin1", 'ignore')) except: RawReadedFileAcc = str(RawReadedFile.encode("latin1", "ignore")) i = 0 while i < len(RawReadedFileAcc): letterAcc = RawReadedFileAcc[i] letterra = readedFile[i] if remove_accents(letterAcc, enc = "latin1").lower() != letterra: if letterAcc == readedFile[i + 1]: readedFile = readedFile[:i] + readedFile[(i + 1):] else: RawReadedFileAcc = RawReadedFileAcc[:i] + RawReadedFileAcc[(i + 1):] else: i += 1 if len(RawReadedFileAcc) != len(readedFile): raise Exception("No pot ser!!") # Leemos archivo posiciones fechas normalizadas ddNorm = deepcopy(listRefs) # Cogemos los textos que hay antes y despues de cada fecha ddNorm["Antes"] = "" ddNorm["Despues"] = "" x = 1000 for irow in range(ddNorm.shape[0]): ddNorm["Antes"][irow] = RawReadedFileAcc[(ddNorm["PosInicio"][irow] - x):ddNorm["PosInicio"][irow]] aux_text = RawReadedFileAcc[(ddNorm["PosFin"][irow] - 1):(ddNorm["PosFin"][irow] + x)] if len(aux_text) > 0: if aux_text[0] == ddNorm["Referencia"][irow][-1]: ddNorm["Despues"][irow] = aux_text[1:] else: ddNorm["Despues"][irow] = aux_text else: ddNorm["Despues"][irow] = "" # Pasamos a frases los textos de antes y despues for irow in range(ddNorm.shape[0]): ddNorm["Antes"][irow] = ddNorm["Antes"][irow].replace("\n", " ") ddNorm["Despues"][irow] = ddNorm["Despues"][irow].replace("\n", " ") auxa = sentences(ddNorm["Antes"][irow]) auxa = auxa.split(" .\n") ddNorm["Antes"][irow] = auxa[len(auxa) - 1] auxd = sentences(ddNorm["Despues"][irow]) auxd = auxd.split(" .\n") ddNorm["Despues"][irow] = auxd[0] # Vemos que relevancia tiene cada elemento aux_tt = ddNorm["Referencia_Normalizada"].value_counts() aux_tt2 = aux_tt/max(aux_tt) aux_tt = pd.DataFrame(data = dict(Referencia_Normalizada = list(aux_tt.index), Apariciones = list(aux_tt.values), Relevancia = list(aux_tt2.values))) ddNorm = ddNorm.merge(aux_tt, 'left') # Normalizamos las sentencias result = dict() for val in ddNorm["Referencia_Normalizada"].unique(): if int(aux_tt["Apariciones"][aux_tt["Referencia_Normalizada"] == val]) == 1: # Aqui posem les frases que apareixen a pinyo sel = ddNorm["Referencia_Normalizada"] == val aux_data = ddNorm[sel] aux_data = aux_data.reset_index() texto = str(aux_data["Antes"][0]) + str(aux_data["Ref_Orig"][0]) + str(aux_data["Despues"][0]) result[val] = dict(descripcion = texto.strip()) result[val]["posiciones"] = dict(inicio = list(aux_data["PosInicio"]), fin = list(aux_data["PosFin"])) result[val]["referencias"] = list(aux_data["Ref_Orig"]) else: # Aqui fem l'analisis per mes d'una frase, si son iguals intentem fer una frase descriptiva, sino doncs per cada item # posem el que s'assembli mes (PROVAR AMB GENSIM!!) frases = [] aux_data = ddNorm[ddNorm["Referencia_Normalizada"] == val] aux_data = aux_data.reset_index() for irow in range(aux_data.shape[0]): texto = aux_data["Antes"][irow] + aux_data["Ref_Orig"][irow] + aux_data["Despues"][irow] frases.append(texto) # Comparem frases i veiem quines s'assemblen a quines auxRes = comparaFrases(frases, fileMod = PATH + "data/modelos_NER/DS_RNN_2014") gruposUnidos = unirGrupos(list(auxRes["item1"]), list(auxRes["item2"]), list(auxRes["valor_comp"] > limSimFrases)) # Extraiem les frases mes rellevants per a cada grup frasesGrup = [] for grupo in gruposUnidos: frases_grupo_act = [""] for element in grupo: frases_grupo_act[0] = frases_grupo_act[0] + " " + frases[element] frases_grupo_act.append(frases[element]) auxRes = comparaFrases(frases_grupo_act, fileMod = PATH + "data/modelos_NER/DS_RNN_2014", totesContraTotes = False) auxResSel = auxRes[(auxRes["item1"] == 0) | (auxRes["item2"] == 0)] auxResSel = auxResSel[auxResSel["valor_comp"] == max(auxResSel["valor_comp"])].reset_index() auxResSel = auxResSel.loc[0, ["item1", "item2"]] i = int(auxResSel[auxResSel != 0]) - 1 frasesGrup.append(frases[grupo[i]]) if len(frasesGrup) == 1: r
else: for igrupo in range(len(gruposUnidos)): result[val + "_" + str(igrupo + 1)] = dict(descripcion = frasesGrup[igrupo]) result[val + "_" + str(igrupo + 1)]["posiciones"] = dict(inicio = list(aux_data.loc[(gruposUnidos[igrupo])]["PosInicio"]), fin = list(aux_data.loc[(gruposUnidos[igrupo])]["PosFin"])) result[val + "_" + str(igrupo + 1)]["referencias"] = list(aux_data.loc[(gruposUnidos[igrupo])]["Ref_Orig"]) for ielement in range(len(gruposUnidos[igrupo])): ddNorm["Referencia_Normalizada"][aux_data["index"][gruposUnidos[igrupo][ielement]]] = val + "_" + str(igrupo + 1) # Reescribimos fichero posiciones con las referencias normalizadas for ikey in result.keys(): result[ikey]["descripcion"] = result[ikey]["descripcion"].decode("latin1") for i in range(len(result[ikey]["referencias"])): result[ikey]["referencias"][i] = result[ikey]["referencias"][i].decode("latin1") result[ikey]["posiciones"]["inicio"][i] = str(result[ikey]["posiciones"]["inicio"][i]) result[ikey]["posiciones"]["fin"][i] = str(result[ikey]["posiciones"]["fin"][i]) # ============================= # # === Escribimos resultados === # # ============================= # # Guardamos outputs y los dejamos en ES if guardaResultados: ddNorm.to_csv(path_or_buf = OUTPUTDIR + filename.lower().replace(".pdf", "") + "_info_pos.csv", sep = "|") fileOut = OUTPUTDIR + filename.lower().replace(".pdf", "") + "_entities.json" with open(fileOut, 'w') as fp: json.dump(result, fp) if muestraHTML: dataJSON = deepcopy(result) name_file = filename.lower().replace(".pdf", "") ddNorm['order'] = [sum(ddNorm['Referencia_Normalizada'] == ddNorm['Referencia_Normalizada'][i]) for i in xrange(len(ddNorm))] ddNorm = ddNorm.sort("order", ascending = False) regUnics = pd.unique(ddNorm["Referencia_Normalizada"]) ddNorm["id_reg"] = "" compta = 0 for registre in regUnics: sel = ddNorm["Referencia_Normalizada"] == registre ddNorm["id_reg"][sel] = compta compta += 1 # Definimos las marcas ddNorm['mark'] = 'mark09' for i in range(1, 9): sel = ddNorm["id_reg"] == (i - 1) ddNorm["mark"][sel] = 'mark0' + str(i) # Escribimos html's con descripciones y definimos href ddNorm['href'] = '' for ikey in dataJSON.keys(): hrefFile = "href " + name_file + " " + ikey.replace('"', '').replace("'", "") + ".html" textohref = "Fecha: " + str(ikey) + "<br>Contexto: " + dataJSON[ikey]["descripcion"].encode("latin1") + "<br>Apariciones: " + str(len(dataJSON[ikey]["referencias"])) filehtml = open(OUTPUTDIR + hrefFile, mode = "w+") filehtml.write(textohref) filehtml.close() # sel = [x in dataJSON[ikey]["referencias"] for x in ddNorm["Ref_Orig"]] sel = ddNorm['Referencia_Normalizada'] == ikey ddNorm['href'][sel] = hrefFile # Escribimos html textohtml = "<head> <link rel = 'stylesheet' type = 'text/css' href = 'styles_css.css'> </head>" i_suma = 0 for i in range(ddNorm.shape[0]): before = "<a href = '" + ddNorm["href"][i] + "'>" + "<" + ddNorm["mark"][i] + ">" after = "</" + ddNorm["mark"][i] + "></a>" readedFile = readedFile[:(int(ddNorm["PosInicio"][i]) + i_suma)] + before + readedFile[(int(ddNorm["PosInicio"][i]) + i_suma):(int(ddNorm["PosFin"][i]) + i_suma)] + after + readedFile[(int(ddNorm["PosFin"][i]) + i_suma):] i_suma += len(before) + len(after) textohtml += "<p>" + readedFile + "</p>" filehtml = OUTPUTDIR + name_file + "_muestra_plazos.html" filehtml = open(filehtml, mode = "w+") filehtml.write(textohtml) filehtml.close() if guardaES: # Sacamos las posiciones de cada pagina perPageDoc = read_file_pagebypage(filename, criterion = criterion, con = Elasticsearch([ipread]), indice = indiceread) count_len = 0 listpos = [] for item in perPageDoc: listpos.append((count_len, count_len + len(item) - 1)) count_len += len(item) rawDoc = reduce_concat(perPageDoc) # Subimos a ES # Buscamos el texto en el rawDoc ddNorm["posRawDocIni"] = -1 ddNorm["posRawDocFin"] = -1 for i in range(ddNorm.shape[0]): texto = ddNorm["Referencia"][i] text2search = rawDoc[ddNorm["PosInicio"][i]:] text2search = remove_accents(text2search) text2search = text2search.lower() if texto in text2search: sumposini = text2search.index(texto) else: caracteres_elimina = [":", ".", "(", ")", ",", ";"] caracteres_espacio = ["\n", "/", "-"] for cel in caracteres_elimina: text2search = text2search.replace(cel, "") for ces in caracteres_espacio: text2search = text2search.replace(ces, " ") text2search = quitaDoblesEspacios(text2search) sumposini = text2search.index(texto) ddNorm["posRawDocIni"][i] = ddNorm["PosInicio"][i] + sumposini ddNorm["posRawDocFin"][i] = ddNorm["posRawDocIni"][i] + len(texto) # Vemos en que pagina y que posicion ocupa cada entidad ddNorm["pagina"] = '-1' for i in range(ddNorm.shape[0]): posBusca = ddNorm.loc[[i], ["posRawDocIni", "posRawDocFin"]] posBusca = posBusca.values.tolist()[0] encontrada = False ipag = 0 while not encontrada and ipag < len(listpos): ipag += 1 if listpos[ipag - 1][0] <= posBusca[0] and listpos[ipag - 1][1] >= posBusca[1]: ddNorm["pagina"][i] = str(ipag) encontrada = True elif len(listpos) > ipag: if listpos[ipag - 1][1] >= posBusca[0] and listpos[ipag][0] <= posBusca[1]: ddNorm["pagina"][i] = str(ipag - 1) + "," + str(ipag) encontrada = True ddNorm[ddNorm["pagina"] == -1]["pagina"] = len(listpos) ddNorm = posicionporpagina(ddNorm, listpos) # Subimos diccionarios a ES for i in range(ddNorm.shape[0]): # Creamos diccionario dictloadES = { "Doc_plazo_" + filename.lower().replace(".pdf", "") + "_" + str(i): dict( tipo = "plazo", documento = filename, pagina = ddNorm["pagina"][i], pos_inicial = ddNorm["posRawDocIni"][i], pos_final = ddNorm["posRawDocFin"][i], texto = ddNorm["Referencia"][i], texto_norm = ddNorm["Referencia_Normalizada"][i], contexto = result[ddNorm["Referencia_Normalizada"][i]]["descripcion"] ) } load2Elastic(dictloadES, INDEX_NAME = indicewrite, TYPE_NAME = "doc", newesconn = Elasticsearch([ipwrite])) print(filename + " procesado!!")
esult[val] = dict(descripcion = frasesGrup[0]) result[val]["posiciones"] = dict(inicio = list(aux_data["PosInicio"]), fin = list(aux_data["PosFin"])) result[val]["referencias"] = list(aux_data["Ref_Orig"])
conditional_block
059_Implementacion_plazos.py
#!/usr/bin/env python # -*- coding: utf-8 -*- # execfile(PATH + "syntax/03_Deteccion_info/059_Implementacion_plazos.py") if __name__ == "__main__": guardaResultados = True muestraHTML = True guardaES = True es_hdfs = False import sys import platform if platform.system() == "Windows": PATH = "D:/Judicial/" sys.path.append('C:/Python27/Lib/site-packages') eslocal = True try: pais except NameError: pais = "esp" else: PATH = "/home/dcortiada/" eslocal = False if len(sys.argv) < 7: raise Exception("Tiene que haber como minimo 6 argumentos!!\nEjemplo llamada:\n python 019_Implementacion_leyes.py ip_donde_leer(172.22.248.206:9229) ip_donde_escribir(172.22.248.206:9229) indice_donde_leer indice_donde_escribir criterio(name) fichero_a_procesar1 fichero_a_procesar2") else: ipread = sys.argv[1] ipwrite = sys.argv[2] indiceread = sys.argv[3] indicewrite = sys.argv[4] criterion = sys.argv[5] files2Eval = sys.argv[6].split("/") # pais = sys.argv[7] # idioma = sys.argv[8] # es_hdfs = sys.argv[9] pais = "esp" idioma = "es" es_hdfs = False print "Los archivos a evaluar son los siguientes:\n '" + reduce(lambda x, y: x + "', '" + y, files2Eval) + "'." if es_hdfs == "True": es_hdfs = True else: es_hdfs = False if es_hdfs: PATH = "hdfs:///user/ijdocs/" from pyspark import SparkConf, SparkContext from pyspark.sql import SQLContext, HiveContext # Crear la configuracion de spark conf = (SparkConf() .setAppName("ejemplo") .set("spark.executor.memory", "1g") .set("spark.yarn.appMasterEnv.PYSPARK_PYTHON", "/usr/bin/python") .set("spark.yarn.appMasterEnv.PYSPARK_DRIVER_PYTHON", "/usr/bin/python")) # Crear el SparkContext con la configuración anterior sc = SparkContext(conf=conf) # Conectores SQL para trabajar en nuestro script sqlContext = SQLContext(sc) hiveContext = HiveContext(sc) # Cargamos librerias y funciones from os import listdir import numpy as np from os.path import exists import pandas as pd from math import factorial import gensim import json from copy import deepcopy if not es_hdfs: execfile(PATH + "syntax/scripts/NER/carga_todas_funciones.py") else: filename = PATH + "syntax/scripts/NER/funciones_comparacion_texto.py" sc.addPyFile(filename) from funciones_comparacion_texto import * filename = PATH + "syntax/scripts/NER/funciones_elastic.py" sc.addPyFile(filename) from funciones_elastic import * filename = PATH + "syntax/scripts/NER/funciones_transforma_refs.py" sc.addPyFile(filename) from funciones_transforma_refs import * filename = PATH + "syntax/scripts/NER/funciones_busqueda.py" sc.addPyFile(filename) from funciones_busqueda import * filename = PATH + "syntax/scripts/NER/funciones_preprocesado.py" sc.addPyFile(filename) from funciones_preprocesado import * filename = PATH + "syntax/scripts/NER/funciones_tratamiento_texto.py" sc.addPyFile(filename) from funciones_tratamiento_texto import * filename = PATH + "syntax/scripts/NER/funciones_lectura_datos.py" sc.addPyFile(filename) from funciones_lectura_datos import * # Definimos parametros OUTPUTDIR = PATH + "output/resultados_plazos/" if eslocal: INPUTREAD = PATH + "input/documentos_expedientes/" files2Eval = listdir(INPUTREAD) else: try: files2Eval except NameError: files2Eval = list_docs(criterion = criterion, con = Elasticsearch([ipread]), indice = indiceread) # Definimos expresiones regulares de las cantidades DictPaisSearchMaxEnrere = dict( esp = [ dict(contiene = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'], # inicios = ['[0-9]+', "\\buno", "\\bdos", "\\btres", "\\bcuatro", "\\bcinco", "\\bseis", "\\bsiete", "\\bocho", "\\bnueve", "\\bdiez", "\\bonce", "\\bdoce", "\\btrece", "\\bcatorce", "\\bquince", "\\bdieciseis", "\\bdiecisiete", "\\bdieciocho", "\\bdiecinueve", "\\bveinte", "\\bventi", "\\bveinti", "\\btreinta", "\\btrenta", "\\bcuarenta", "\\bcincuenta", "\\bsesenta", "\\bochenta", "\\bnoventa", "\\bcien", "\\bdoscientos", "\\btrescientos", "\\bcuatrocientos", "\\bquinientos", "\\bseiscientos", "\\bsetecientos", "\\bochocientos"], inicios = ['pena', "plazo", "condena", "multa", "beneficio de la comunidad", "beneficio a la comunidad", "sancion"], finales = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'] ) ], bra = [ dict(contiene = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'], # inicios = ['[0-9]+', "\\buno", "\\bdos", "\\btres", "\\bcuatro", "\\bcinco", "\\bseis", "\\bsiete", "\\bocho", "\\bnueve", "\\bdiez", "\\bonce", "\\bdoce", "\\btrece", "\\bcatorce", "\\bquince", "\\bdieciseis", "\\bdiecisiete", "\\bdieciocho", "\\bdiecinueve", "\\bveinte", "\\bventi", "\\bveinti", "\\btreinta", "\\btrenta", "\\bcuarenta", "\\bcincuenta", "\\bsesenta", "\\bochenta", "\\bnoventa", "\\bcien", "\\bdoscientos", "\\btrescientos", "\\bcuatrocientos", "\\bquinientos", "\\bseiscientos", "\\bsetecientos", "\\bochocientos"], inicios = ['pena', "prazo", "conviccao", "fino", "sancao", "sancoes"], finales = ['\\bmes\\b', '\\bmeses\\b', '\\bdia\\b', '\\bdias\\b', '\\bano\\b', '\\banos\\b', '\\bsemana'] ) ] ) SearchMaxEnrere = DictPaisSearchMaxEnrere[pais] limSimFrases = 0.15 # Limit a partir del qual diem que 2 frases s'assemblen guardaES = guardaES and not eslocal # Solo guardamos a elastic si no se ejecuta desde local for filename in files2Eval: print("Procesando " + filename + "...") if eslocal: RawReadedFile = pdf2txt(INPUTREAD + filename) else: RawReadedFile = import_doc(filename, criterion = criterion, con = Elasticsearch([ipread]), indice = indiceread) readedFile = remove_accents(RawReadedFile) readedFile = readedFile.lower() # ================== # # === Script 050 === # # ================== #
# Buscamos posiciones teniendo en cuenta lo maximo para atras index_points_max_enrere = [] for dictstr2search in SearchMaxEnrere: idxAct = [] for str2search in dictstr2search['contiene']: idxAct.extend(buscaPosicionRegexTexto(str2search, readedFile)) index_points_max_enrere.append(idxAct) plazos = [] for i in range(len(SearchMaxEnrere)): dictAct = SearchMaxEnrere[i] for item in index_points_max_enrere[i]: # Preparamos textos de inicios y finales aux_texto_ini = readedFile[:item[1]] aux_texto_fin = readedFile[item[0]:] # Buscamos inicios y fines listInicios = [] listFinal = [] for i_inicio in dictAct['inicios']: listInicios.extend(buscaPosicionRegexTexto(i_inicio, aux_texto_ini)) for i_final in dictAct['finales']: listFinal.extend(buscaPosicionRegexTexto(i_final, aux_texto_fin)) if len(listInicios) == 0 or len(listFinal) == 0: continue listInicios = np.array(listInicios) listFinal = np.array(listFinal) sel = abs(listInicios[:, 0] - len(aux_texto_ini)) < 50 if any(sel): selFin = listFinal[:, 1] < 50 if any(selFin): plazos.append((min(listInicios[sel, 0]), item[0] + max(listFinal[selFin, 1]))) else: plazos.append((min(listInicios[sel, 0]), item[0] + min(listFinal[:, 1]))) # Buscamos registros unicos plazos = list(set(plazos)) if len(plazos) == 0: print "No hemos encontrado plazos en este documento" continue # Regulamos que no se incluyan unos dentro de otros los textos plazos = pd.DataFrame(plazos) plazos = plazos.sort(0) plazos = plazos.values.tolist() jresta = 0 for i in range(1, len(plazos)): if plazos[i - jresta][0] < plazos[i - 1 - jresta][1]: plazos[i - jresta] = [plazos[i - 1 - jresta][0], plazos[i - jresta][1]] plazos.pop(i - 1 - jresta) jresta += 1 # ================== # # === Script 051 === # # ================== # # === # # Canvi respecte script 051!! listRefs = deepcopy(plazos) listRefs = pd.DataFrame(listRefs) listRefs.columns = ["PosInicio", "PosFin"] listRefs["Referencia"] = "" for i in range(listRefs.shape[0]): listRefs["Referencia"][i] = readedFile[listRefs["PosInicio"][i]:listRefs["PosFin"][i]] # === # listRefs["Ref_Orig"] = listRefs["Referencia"] # Hacemos modificaciones en las referencias caracteres_elimina = [":", ".", "(", ")", ",", ";"] caracteres_espacio = ["\n", "/", "-"] for ce in caracteres_elimina: listRefs["Referencia"] = listRefs["Referencia"].str.replace(ce, "") for ce in caracteres_espacio: listRefs["Referencia"] = listRefs["Referencia"].str.replace(ce, " ") for i in range(listRefs.shape[0]): listRefs["Referencia"][i] = quitaDoblesEspacios(listRefs["Referencia"][i]) listRefs["Referencia"] = listRefs["Referencia"].str.strip() # Normalizamos los campos listRefs["Referencia_Normalizada"] = '' for i in range(listRefs.shape[0]): normaliza = listRefs["Referencia"][i] normaliza = normaliza.replace(" un ", " uno ") aux_str = normaliza.split(" de ") aux_norm = aux_str[len(aux_str) - 1] aux_norm2 = aux_norm.split(" y ") resNums = [] for aux_norm in aux_norm2: aux_str = aux_norm.split(" ") unidades = aux_str[len(aux_str) - 1] number = reduce_concat(aux_str[:-1], sep = " ") try: number = transformaNumsString(number) except: pass resNums.append(number + " " + unidades) listRefs["Referencia_Normalizada"][i] = reduce_concat(resNums, sep = " y ") # ================== # # === Script 052 === # # ================== # # Montamos un string con la misma estructura y con acentos try: RawReadedFileAcc = str(RawReadedFile.decode("utf8").encode("latin1", 'ignore')) except: RawReadedFileAcc = str(RawReadedFile.encode("latin1", "ignore")) i = 0 while i < len(RawReadedFileAcc): letterAcc = RawReadedFileAcc[i] letterra = readedFile[i] if remove_accents(letterAcc, enc = "latin1").lower() != letterra: if letterAcc == readedFile[i + 1]: readedFile = readedFile[:i] + readedFile[(i + 1):] else: RawReadedFileAcc = RawReadedFileAcc[:i] + RawReadedFileAcc[(i + 1):] else: i += 1 if len(RawReadedFileAcc) != len(readedFile): raise Exception("No pot ser!!") # Leemos archivo posiciones fechas normalizadas ddNorm = deepcopy(listRefs) # Cogemos los textos que hay antes y despues de cada fecha ddNorm["Antes"] = "" ddNorm["Despues"] = "" x = 1000 for irow in range(ddNorm.shape[0]): ddNorm["Antes"][irow] = RawReadedFileAcc[(ddNorm["PosInicio"][irow] - x):ddNorm["PosInicio"][irow]] aux_text = RawReadedFileAcc[(ddNorm["PosFin"][irow] - 1):(ddNorm["PosFin"][irow] + x)] if len(aux_text) > 0: if aux_text[0] == ddNorm["Referencia"][irow][-1]: ddNorm["Despues"][irow] = aux_text[1:] else: ddNorm["Despues"][irow] = aux_text else: ddNorm["Despues"][irow] = "" # Pasamos a frases los textos de antes y despues for irow in range(ddNorm.shape[0]): ddNorm["Antes"][irow] = ddNorm["Antes"][irow].replace("\n", " ") ddNorm["Despues"][irow] = ddNorm["Despues"][irow].replace("\n", " ") auxa = sentences(ddNorm["Antes"][irow]) auxa = auxa.split(" .\n") ddNorm["Antes"][irow] = auxa[len(auxa) - 1] auxd = sentences(ddNorm["Despues"][irow]) auxd = auxd.split(" .\n") ddNorm["Despues"][irow] = auxd[0] # Vemos que relevancia tiene cada elemento aux_tt = ddNorm["Referencia_Normalizada"].value_counts() aux_tt2 = aux_tt/max(aux_tt) aux_tt = pd.DataFrame(data = dict(Referencia_Normalizada = list(aux_tt.index), Apariciones = list(aux_tt.values), Relevancia = list(aux_tt2.values))) ddNorm = ddNorm.merge(aux_tt, 'left') # Normalizamos las sentencias result = dict() for val in ddNorm["Referencia_Normalizada"].unique(): if int(aux_tt["Apariciones"][aux_tt["Referencia_Normalizada"] == val]) == 1: # Aqui posem les frases que apareixen a pinyo sel = ddNorm["Referencia_Normalizada"] == val aux_data = ddNorm[sel] aux_data = aux_data.reset_index() texto = str(aux_data["Antes"][0]) + str(aux_data["Ref_Orig"][0]) + str(aux_data["Despues"][0]) result[val] = dict(descripcion = texto.strip()) result[val]["posiciones"] = dict(inicio = list(aux_data["PosInicio"]), fin = list(aux_data["PosFin"])) result[val]["referencias"] = list(aux_data["Ref_Orig"]) else: # Aqui fem l'analisis per mes d'una frase, si son iguals intentem fer una frase descriptiva, sino doncs per cada item # posem el que s'assembli mes (PROVAR AMB GENSIM!!) frases = [] aux_data = ddNorm[ddNorm["Referencia_Normalizada"] == val] aux_data = aux_data.reset_index() for irow in range(aux_data.shape[0]): texto = aux_data["Antes"][irow] + aux_data["Ref_Orig"][irow] + aux_data["Despues"][irow] frases.append(texto) # Comparem frases i veiem quines s'assemblen a quines auxRes = comparaFrases(frases, fileMod = PATH + "data/modelos_NER/DS_RNN_2014") gruposUnidos = unirGrupos(list(auxRes["item1"]), list(auxRes["item2"]), list(auxRes["valor_comp"] > limSimFrases)) # Extraiem les frases mes rellevants per a cada grup frasesGrup = [] for grupo in gruposUnidos: frases_grupo_act = [""] for element in grupo: frases_grupo_act[0] = frases_grupo_act[0] + " " + frases[element] frases_grupo_act.append(frases[element]) auxRes = comparaFrases(frases_grupo_act, fileMod = PATH + "data/modelos_NER/DS_RNN_2014", totesContraTotes = False) auxResSel = auxRes[(auxRes["item1"] == 0) | (auxRes["item2"] == 0)] auxResSel = auxResSel[auxResSel["valor_comp"] == max(auxResSel["valor_comp"])].reset_index() auxResSel = auxResSel.loc[0, ["item1", "item2"]] i = int(auxResSel[auxResSel != 0]) - 1 frasesGrup.append(frases[grupo[i]]) if len(frasesGrup) == 1: result[val] = dict(descripcion = frasesGrup[0]) result[val]["posiciones"] = dict(inicio = list(aux_data["PosInicio"]), fin = list(aux_data["PosFin"])) result[val]["referencias"] = list(aux_data["Ref_Orig"]) else: for igrupo in range(len(gruposUnidos)): result[val + "_" + str(igrupo + 1)] = dict(descripcion = frasesGrup[igrupo]) result[val + "_" + str(igrupo + 1)]["posiciones"] = dict(inicio = list(aux_data.loc[(gruposUnidos[igrupo])]["PosInicio"]), fin = list(aux_data.loc[(gruposUnidos[igrupo])]["PosFin"])) result[val + "_" + str(igrupo + 1)]["referencias"] = list(aux_data.loc[(gruposUnidos[igrupo])]["Ref_Orig"]) for ielement in range(len(gruposUnidos[igrupo])): ddNorm["Referencia_Normalizada"][aux_data["index"][gruposUnidos[igrupo][ielement]]] = val + "_" + str(igrupo + 1) # Reescribimos fichero posiciones con las referencias normalizadas for ikey in result.keys(): result[ikey]["descripcion"] = result[ikey]["descripcion"].decode("latin1") for i in range(len(result[ikey]["referencias"])): result[ikey]["referencias"][i] = result[ikey]["referencias"][i].decode("latin1") result[ikey]["posiciones"]["inicio"][i] = str(result[ikey]["posiciones"]["inicio"][i]) result[ikey]["posiciones"]["fin"][i] = str(result[ikey]["posiciones"]["fin"][i]) # ============================= # # === Escribimos resultados === # # ============================= # # Guardamos outputs y los dejamos en ES if guardaResultados: ddNorm.to_csv(path_or_buf = OUTPUTDIR + filename.lower().replace(".pdf", "") + "_info_pos.csv", sep = "|") fileOut = OUTPUTDIR + filename.lower().replace(".pdf", "") + "_entities.json" with open(fileOut, 'w') as fp: json.dump(result, fp) if muestraHTML: dataJSON = deepcopy(result) name_file = filename.lower().replace(".pdf", "") ddNorm['order'] = [sum(ddNorm['Referencia_Normalizada'] == ddNorm['Referencia_Normalizada'][i]) for i in xrange(len(ddNorm))] ddNorm = ddNorm.sort("order", ascending = False) regUnics = pd.unique(ddNorm["Referencia_Normalizada"]) ddNorm["id_reg"] = "" compta = 0 for registre in regUnics: sel = ddNorm["Referencia_Normalizada"] == registre ddNorm["id_reg"][sel] = compta compta += 1 # Definimos las marcas ddNorm['mark'] = 'mark09' for i in range(1, 9): sel = ddNorm["id_reg"] == (i - 1) ddNorm["mark"][sel] = 'mark0' + str(i) # Escribimos html's con descripciones y definimos href ddNorm['href'] = '' for ikey in dataJSON.keys(): hrefFile = "href " + name_file + " " + ikey.replace('"', '').replace("'", "") + ".html" textohref = "Fecha: " + str(ikey) + "<br>Contexto: " + dataJSON[ikey]["descripcion"].encode("latin1") + "<br>Apariciones: " + str(len(dataJSON[ikey]["referencias"])) filehtml = open(OUTPUTDIR + hrefFile, mode = "w+") filehtml.write(textohref) filehtml.close() # sel = [x in dataJSON[ikey]["referencias"] for x in ddNorm["Ref_Orig"]] sel = ddNorm['Referencia_Normalizada'] == ikey ddNorm['href'][sel] = hrefFile # Escribimos html textohtml = "<head> <link rel = 'stylesheet' type = 'text/css' href = 'styles_css.css'> </head>" i_suma = 0 for i in range(ddNorm.shape[0]): before = "<a href = '" + ddNorm["href"][i] + "'>" + "<" + ddNorm["mark"][i] + ">" after = "</" + ddNorm["mark"][i] + "></a>" readedFile = readedFile[:(int(ddNorm["PosInicio"][i]) + i_suma)] + before + readedFile[(int(ddNorm["PosInicio"][i]) + i_suma):(int(ddNorm["PosFin"][i]) + i_suma)] + after + readedFile[(int(ddNorm["PosFin"][i]) + i_suma):] i_suma += len(before) + len(after) textohtml += "<p>" + readedFile + "</p>" filehtml = OUTPUTDIR + name_file + "_muestra_plazos.html" filehtml = open(filehtml, mode = "w+") filehtml.write(textohtml) filehtml.close() if guardaES: # Sacamos las posiciones de cada pagina perPageDoc = read_file_pagebypage(filename, criterion = criterion, con = Elasticsearch([ipread]), indice = indiceread) count_len = 0 listpos = [] for item in perPageDoc: listpos.append((count_len, count_len + len(item) - 1)) count_len += len(item) rawDoc = reduce_concat(perPageDoc) # Subimos a ES # Buscamos el texto en el rawDoc ddNorm["posRawDocIni"] = -1 ddNorm["posRawDocFin"] = -1 for i in range(ddNorm.shape[0]): texto = ddNorm["Referencia"][i] text2search = rawDoc[ddNorm["PosInicio"][i]:] text2search = remove_accents(text2search) text2search = text2search.lower() if texto in text2search: sumposini = text2search.index(texto) else: caracteres_elimina = [":", ".", "(", ")", ",", ";"] caracteres_espacio = ["\n", "/", "-"] for cel in caracteres_elimina: text2search = text2search.replace(cel, "") for ces in caracteres_espacio: text2search = text2search.replace(ces, " ") text2search = quitaDoblesEspacios(text2search) sumposini = text2search.index(texto) ddNorm["posRawDocIni"][i] = ddNorm["PosInicio"][i] + sumposini ddNorm["posRawDocFin"][i] = ddNorm["posRawDocIni"][i] + len(texto) # Vemos en que pagina y que posicion ocupa cada entidad ddNorm["pagina"] = '-1' for i in range(ddNorm.shape[0]): posBusca = ddNorm.loc[[i], ["posRawDocIni", "posRawDocFin"]] posBusca = posBusca.values.tolist()[0] encontrada = False ipag = 0 while not encontrada and ipag < len(listpos): ipag += 1 if listpos[ipag - 1][0] <= posBusca[0] and listpos[ipag - 1][1] >= posBusca[1]: ddNorm["pagina"][i] = str(ipag) encontrada = True elif len(listpos) > ipag: if listpos[ipag - 1][1] >= posBusca[0] and listpos[ipag][0] <= posBusca[1]: ddNorm["pagina"][i] = str(ipag - 1) + "," + str(ipag) encontrada = True ddNorm[ddNorm["pagina"] == -1]["pagina"] = len(listpos) ddNorm = posicionporpagina(ddNorm, listpos) # Subimos diccionarios a ES for i in range(ddNorm.shape[0]): # Creamos diccionario dictloadES = { "Doc_plazo_" + filename.lower().replace(".pdf", "") + "_" + str(i): dict( tipo = "plazo", documento = filename, pagina = ddNorm["pagina"][i], pos_inicial = ddNorm["posRawDocIni"][i], pos_final = ddNorm["posRawDocFin"][i], texto = ddNorm["Referencia"][i], texto_norm = ddNorm["Referencia_Normalizada"][i], contexto = result[ddNorm["Referencia_Normalizada"][i]]["descripcion"] ) } load2Elastic(dictloadES, INDEX_NAME = indicewrite, TYPE_NAME = "doc", newesconn = Elasticsearch([ipwrite])) print(filename + " procesado!!")
random_line_split
ConcurrentAnimations.py
#!/usr/bin/env python """ Use version of DriverSlave that has pixmap and pixheights """ import threading # import base classes and driver from bibliopixel import LEDStrip, LEDMatrix # from bibliopixel.drivers.LPD8806 import DriverLPD8806, ChannelOrder from bibliopixel.drivers.visualizer import DriverVisualizer, ChannelOrder from bibliopixel.drivers.slave_driver import DriverSlave # import colors import bibliopixel.colors from bibliopixel.animation import BaseStripAnim from logging import DEBUG, INFO, WARNING, CRITICAL, ERROR from bibliopixel import log log.setLogLevel(WARNING) import re import time from operator import or_, ior, ixor import matplotlib.pyplot as plt import BiblioPixelAnimations.matrix.bloom as BA class MasterAnimation(BaseStripAnim): """ Takes copies of fake leds, combines using heights and mixing to fill and update a led NEED now ledcopies is list of the leds associated with each animation NEED also mapping of the leds into master led (i.e. path list) NEED also height of each animations and merging method if same height """ def __init__(self, led, animcopies, start=0, end=-1): super(MasterAnimation, self).__init__(led, start, end) if not isinstance(animcopies, list): animcopies = [animcopies] self._animcopies = animcopies self._ledcopies = [a._led for a, f in animcopies] self._idlelist = [] self.timedata = [[] for _ in range(len(self._ledcopies))] # [[]] * 5 NOT define 5 different lists! self._led.pixheights = [0] * self._led.numLEDs # def preRun(self, amt=1): # self._led.all_off() # for w, f in self._animcopies: # w.run(fps=f, max_steps=runtime * f, threaded = True) def preStep(self, amt=1): #print 'prestep {}'.format(self._step) # only step the master thread when something from ledcopies # has been done i.e. its event _wait must be false (I THINK) # TODO is this good code???? or is there a better way to block self._idlelist = [True] # to insure goes thru while loop at least once while all(self._idlelist): self._idlelist = [not ledcopy.driver[0]._updatenow.isSet() for ledcopy in self._ledcopies] if self._stopEvent.isSet(): self.animComplete = True print 'breaking out' break # def postStep(self, amt=1): # clear the ones found in preStep activewormind = [i for i, x in enumerate(self._idlelist) if x == False] [self._ledcopies[i].driver[0]._updatenow.clear() for i in activewormind] def step(self, amt=1): """ combines the buffers from the slave led's which then gets sent to led via update """ # For checking if all the animations have their framse looked at #activewormind = [i for i, x in enumerate(self._idlelist) if x == False] #print "Worm {} at {:5g}".format(activewormind, 1000*(time.time() - starttime)) # save times activated for each worm [self.timedata[i].append(1000*(time.time() - starttime)) for i, x in enumerate(self._idlelist) if x == False] #self._led.buffer = [0] * 480 self._led.pixheights = [-100] * self._led.numLEDs #print type(self._led.buffer) for ledcopy in self._ledcopies: # self._led.buffer = map(ixor, self._led.buffer, ledcopy.buffer) # use pixheights but assume all buffers same size # print ledcopy.driver[0].pixheights for pix in range(self._led.numLEDs): #for ledcopy in self._ledcopies: if self._led.pixheights[pix] == ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] ^= ledcopy.buffer[3*pix + i] elif self._led.pixheights[pix] < ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] = ledcopy.buffer[3*pix + i] self._led.pixheights[pix] = ledcopy.driver[0].pixheights[pix] self._step += 1 def
(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, joinThread = False, callback=None): #def run(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, threaded = True, joinThread = False, callback=None): # self.fps = fps # self.untilComplete = untilComplete super(MasterAnimation, self).run(amt = 1, fps=fps, sleep=None, max_steps = 0, untilComplete = untilComplete, max_cycles = 0, threaded = True, joinThread = joinThread, callback=callback) class Worm(BaseStripAnim): """ colors a list the worm segment (starting with head) colors path a list of the LED indices over which the worm will travel cyclelen controls speed, worm movement only when LED upload cycles == 0 mod cyclelen height (of worm segments) is same length as colors: higher value worms segments go over top of lower value worms """ def __init__(self, led, colors, path, cyclelen, direction=1, height=None, start=0, end=-1): super(Worm, self).__init__(led, start, end) if height is None: height = [0]*len(colors) elif type(height) == int: height = [height]*len(colors) self._colors = colors self._colors.append((0, 0, 0)) # add blank seqment to end worm self._path = path self._cyclelen = cyclelen self._height = height self._height.append(-1) # add lowest value for height self._activecount = 0 self._direction = direction self._headposition = -self._direction #print self._colors #print self._height def step(self, amt=1): if self._activecount == 0: self._headposition += amt*self._direction self._headposition %= len(self._path) # Put worm into strip and blank end segpos = self._headposition for x in range(len(self._colors)): if True: #self._height[x] >= LEDsegheights[self._path[segpos]]: # or x == len(self.colors) - 1: #if self._height[x] >= self._led.driver[0].pixheights[self._path[segpos]]: # or x == len(self.colors) - 1: self._led.set(self._path[segpos], self._colors[x]) self._led.driver[0].pixheights[self._path[segpos]] = self._height[x] segpos -= self._direction segpos %= len(self._path) self._activecount += amt self._activecount %= self._cyclelen self._step += amt def pathgen(nleft=0, nright=15, nbot=0, ntop=9, shift=0, turns=10, rounds=16): """ A path around a rectangle from strip wound helically 10 turns high by 16 round. rounds * turns must be number of pixels on strip nleft and nright is from 0 to rounds-1, nbot and ntop from 0 to turns-1 """ def ind(x, y): return x + y * rounds assert 0 <= nleft <= nright -1 <= rounds and 0 <= nbot <= ntop -1 <= turns nled = rounds*turns sleft = range(ind(nleft, nbot), ind(nleft, ntop), rounds) tp = range(ind(nleft, ntop), ind(nright, ntop), 1) sright = range(ind(nright, ntop), ind(nright, nbot), -rounds) bt = range(ind(nright, nbot), ind(nleft, nbot), -1) path = sleft+tp+sright+bt if len(path) == 0: path = [ind(nleft, nbot)] path = map(lambda x: (shift+x) % nled, path) log.logger.info("pathgen({}, {}, {}, {}, {}) is {}".format(nleft, nright, nbot, ntop, shift, path)) return path if True: #__name__ == '__main__': drivermaster = DriverVisualizer(160, pixelSize=62, stayTop=False, maxWindowWidth=1024) # using pixelSize 62 and changed code of visualizer.py to have maxWindowWidth=1024 #drivermaster = DriverVisualizer(160, pixelSize=31, stayTop=False) #ledmaster = LEDStrip(drivermaster, threadedUpdate=True) ledmaster = LEDStrip(drivermaster) lnin = [255, 222, 200, 150, 125] bluedimming = [(0, 0, i) for i in lnin] bluedimming = [(0, 0, 0) for i in lnin] reddimming = [(i, 0, 0) for i in lnin] greendimming = [(0, i, 0) for i in lnin] cyandimming = [(0, i, i) for i in lnin] whitedimming = [(i, i, i) for i in lnin] # Worm arguments wormblue = (bluedimming, pathgen(5, 10, 0, 9), 1, 1, 6) wormred = (reddimming, pathgen(1, 14, 1, 8), 1, 1, 2) wormgreen = (greendimming, pathgen(2, 13, 2, 7), 1, 1, 3) wormcyan = (cyandimming, pathgen(3, 12, 3, 6), 1, 1, 4) wormwhite = (whitedimming, pathgen(4, 11, 4, 5), 1, 1, 5) # List of pair (animation arguments, fps) wormdatalist = [(wormblue, 24), (wormred, 20), (wormgreen, 16), (wormcyan, 12), (wormwhite, 8)] #wormdatalist = [(wormwhite, 8)] #wormdatalist = [] # dummy strips must each have their own slavedriver as thread is attached # to the driver ledslaves = [LEDStrip(DriverSlave(160, pixheights=-1), threadedUpdate=True) for _ in range(len(wormdatalist))] # Make the Worm animations an list pairs (animation, fps) wormlist = [(Worm(ledslaves[i], *d[0]), d[1]) for i, d in enumerate(wormdatalist)] ledslaveb = LEDMatrix(DriverSlave(160, None, 0), width=16, height=10, threadedUpdate=True) bloom = BA.Bloom(ledslaveb) wormlist.append((bloom, 10)) #masteranimation = MasterAnimation(ledmaster, [w._led for w, f in wormlist]) masteranimation = MasterAnimation(ledmaster, wormlist) starttime = time.time() runtime = 1 # Master steps when it gets a go ahdead signal from one of the # concurrent annimations masteranimation.run(fps=None) # if give fps for master will skip faster frames # Run all the slave animations and master threaded # The slave animations update their buffers at the correct # time and rather than update, just signal the master they # are ready to be combined and sent to the actual leds for w, f in wormlist: w.run(fps=f, max_steps=runtime * f, threaded = True) #print threading.enumerate() print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) # idle and threaded animations will run jointly while not all([w.stopped() for w, f in wormlist]): pass # stop the master masteranimation.stopThread(True) # need True print "Master Animation Step Count {}".format(masteranimation._step) ledmaster.waitForUpdate() ledmaster.stopUpdateThreads() [w._led.stopUpdateThreads() for w, f in wormlist] print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) plt.clf() col = 'brgcwk' [plt.plot(masteranimation.timedata[i], [i] * len(masteranimation.timedata[i]), col[i%6]+'o') for i in range(len(wormlist))] ax = plt.axis() delx = .01 * (ax[1] - ax[0]) plt.axis([ax[0]-delx, ax[1]+delx, ax[2]-1, ax[3]+1])
run
identifier_name
ConcurrentAnimations.py
#!/usr/bin/env python """ Use version of DriverSlave that has pixmap and pixheights """ import threading # import base classes and driver from bibliopixel import LEDStrip, LEDMatrix # from bibliopixel.drivers.LPD8806 import DriverLPD8806, ChannelOrder from bibliopixel.drivers.visualizer import DriverVisualizer, ChannelOrder from bibliopixel.drivers.slave_driver import DriverSlave # import colors import bibliopixel.colors from bibliopixel.animation import BaseStripAnim from logging import DEBUG, INFO, WARNING, CRITICAL, ERROR from bibliopixel import log log.setLogLevel(WARNING) import re import time from operator import or_, ior, ixor import matplotlib.pyplot as plt import BiblioPixelAnimations.matrix.bloom as BA class MasterAnimation(BaseStripAnim): """ Takes copies of fake leds, combines using heights and mixing to fill and update a led NEED now ledcopies is list of the leds associated with each animation NEED also mapping of the leds into master led (i.e. path list) NEED also height of each animations and merging method if same height
self._animcopies = animcopies self._ledcopies = [a._led for a, f in animcopies] self._idlelist = [] self.timedata = [[] for _ in range(len(self._ledcopies))] # [[]] * 5 NOT define 5 different lists! self._led.pixheights = [0] * self._led.numLEDs # def preRun(self, amt=1): # self._led.all_off() # for w, f in self._animcopies: # w.run(fps=f, max_steps=runtime * f, threaded = True) def preStep(self, amt=1): #print 'prestep {}'.format(self._step) # only step the master thread when something from ledcopies # has been done i.e. its event _wait must be false (I THINK) # TODO is this good code???? or is there a better way to block self._idlelist = [True] # to insure goes thru while loop at least once while all(self._idlelist): self._idlelist = [not ledcopy.driver[0]._updatenow.isSet() for ledcopy in self._ledcopies] if self._stopEvent.isSet(): self.animComplete = True print 'breaking out' break # def postStep(self, amt=1): # clear the ones found in preStep activewormind = [i for i, x in enumerate(self._idlelist) if x == False] [self._ledcopies[i].driver[0]._updatenow.clear() for i in activewormind] def step(self, amt=1): """ combines the buffers from the slave led's which then gets sent to led via update """ # For checking if all the animations have their framse looked at #activewormind = [i for i, x in enumerate(self._idlelist) if x == False] #print "Worm {} at {:5g}".format(activewormind, 1000*(time.time() - starttime)) # save times activated for each worm [self.timedata[i].append(1000*(time.time() - starttime)) for i, x in enumerate(self._idlelist) if x == False] #self._led.buffer = [0] * 480 self._led.pixheights = [-100] * self._led.numLEDs #print type(self._led.buffer) for ledcopy in self._ledcopies: # self._led.buffer = map(ixor, self._led.buffer, ledcopy.buffer) # use pixheights but assume all buffers same size # print ledcopy.driver[0].pixheights for pix in range(self._led.numLEDs): #for ledcopy in self._ledcopies: if self._led.pixheights[pix] == ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] ^= ledcopy.buffer[3*pix + i] elif self._led.pixheights[pix] < ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] = ledcopy.buffer[3*pix + i] self._led.pixheights[pix] = ledcopy.driver[0].pixheights[pix] self._step += 1 def run(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, joinThread = False, callback=None): #def run(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, threaded = True, joinThread = False, callback=None): # self.fps = fps # self.untilComplete = untilComplete super(MasterAnimation, self).run(amt = 1, fps=fps, sleep=None, max_steps = 0, untilComplete = untilComplete, max_cycles = 0, threaded = True, joinThread = joinThread, callback=callback) class Worm(BaseStripAnim): """ colors a list the worm segment (starting with head) colors path a list of the LED indices over which the worm will travel cyclelen controls speed, worm movement only when LED upload cycles == 0 mod cyclelen height (of worm segments) is same length as colors: higher value worms segments go over top of lower value worms """ def __init__(self, led, colors, path, cyclelen, direction=1, height=None, start=0, end=-1): super(Worm, self).__init__(led, start, end) if height is None: height = [0]*len(colors) elif type(height) == int: height = [height]*len(colors) self._colors = colors self._colors.append((0, 0, 0)) # add blank seqment to end worm self._path = path self._cyclelen = cyclelen self._height = height self._height.append(-1) # add lowest value for height self._activecount = 0 self._direction = direction self._headposition = -self._direction #print self._colors #print self._height def step(self, amt=1): if self._activecount == 0: self._headposition += amt*self._direction self._headposition %= len(self._path) # Put worm into strip and blank end segpos = self._headposition for x in range(len(self._colors)): if True: #self._height[x] >= LEDsegheights[self._path[segpos]]: # or x == len(self.colors) - 1: #if self._height[x] >= self._led.driver[0].pixheights[self._path[segpos]]: # or x == len(self.colors) - 1: self._led.set(self._path[segpos], self._colors[x]) self._led.driver[0].pixheights[self._path[segpos]] = self._height[x] segpos -= self._direction segpos %= len(self._path) self._activecount += amt self._activecount %= self._cyclelen self._step += amt def pathgen(nleft=0, nright=15, nbot=0, ntop=9, shift=0, turns=10, rounds=16): """ A path around a rectangle from strip wound helically 10 turns high by 16 round. rounds * turns must be number of pixels on strip nleft and nright is from 0 to rounds-1, nbot and ntop from 0 to turns-1 """ def ind(x, y): return x + y * rounds assert 0 <= nleft <= nright -1 <= rounds and 0 <= nbot <= ntop -1 <= turns nled = rounds*turns sleft = range(ind(nleft, nbot), ind(nleft, ntop), rounds) tp = range(ind(nleft, ntop), ind(nright, ntop), 1) sright = range(ind(nright, ntop), ind(nright, nbot), -rounds) bt = range(ind(nright, nbot), ind(nleft, nbot), -1) path = sleft+tp+sright+bt if len(path) == 0: path = [ind(nleft, nbot)] path = map(lambda x: (shift+x) % nled, path) log.logger.info("pathgen({}, {}, {}, {}, {}) is {}".format(nleft, nright, nbot, ntop, shift, path)) return path if True: #__name__ == '__main__': drivermaster = DriverVisualizer(160, pixelSize=62, stayTop=False, maxWindowWidth=1024) # using pixelSize 62 and changed code of visualizer.py to have maxWindowWidth=1024 #drivermaster = DriverVisualizer(160, pixelSize=31, stayTop=False) #ledmaster = LEDStrip(drivermaster, threadedUpdate=True) ledmaster = LEDStrip(drivermaster) lnin = [255, 222, 200, 150, 125] bluedimming = [(0, 0, i) for i in lnin] bluedimming = [(0, 0, 0) for i in lnin] reddimming = [(i, 0, 0) for i in lnin] greendimming = [(0, i, 0) for i in lnin] cyandimming = [(0, i, i) for i in lnin] whitedimming = [(i, i, i) for i in lnin] # Worm arguments wormblue = (bluedimming, pathgen(5, 10, 0, 9), 1, 1, 6) wormred = (reddimming, pathgen(1, 14, 1, 8), 1, 1, 2) wormgreen = (greendimming, pathgen(2, 13, 2, 7), 1, 1, 3) wormcyan = (cyandimming, pathgen(3, 12, 3, 6), 1, 1, 4) wormwhite = (whitedimming, pathgen(4, 11, 4, 5), 1, 1, 5) # List of pair (animation arguments, fps) wormdatalist = [(wormblue, 24), (wormred, 20), (wormgreen, 16), (wormcyan, 12), (wormwhite, 8)] #wormdatalist = [(wormwhite, 8)] #wormdatalist = [] # dummy strips must each have their own slavedriver as thread is attached # to the driver ledslaves = [LEDStrip(DriverSlave(160, pixheights=-1), threadedUpdate=True) for _ in range(len(wormdatalist))] # Make the Worm animations an list pairs (animation, fps) wormlist = [(Worm(ledslaves[i], *d[0]), d[1]) for i, d in enumerate(wormdatalist)] ledslaveb = LEDMatrix(DriverSlave(160, None, 0), width=16, height=10, threadedUpdate=True) bloom = BA.Bloom(ledslaveb) wormlist.append((bloom, 10)) #masteranimation = MasterAnimation(ledmaster, [w._led for w, f in wormlist]) masteranimation = MasterAnimation(ledmaster, wormlist) starttime = time.time() runtime = 1 # Master steps when it gets a go ahdead signal from one of the # concurrent annimations masteranimation.run(fps=None) # if give fps for master will skip faster frames # Run all the slave animations and master threaded # The slave animations update their buffers at the correct # time and rather than update, just signal the master they # are ready to be combined and sent to the actual leds for w, f in wormlist: w.run(fps=f, max_steps=runtime * f, threaded = True) #print threading.enumerate() print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) # idle and threaded animations will run jointly while not all([w.stopped() for w, f in wormlist]): pass # stop the master masteranimation.stopThread(True) # need True print "Master Animation Step Count {}".format(masteranimation._step) ledmaster.waitForUpdate() ledmaster.stopUpdateThreads() [w._led.stopUpdateThreads() for w, f in wormlist] print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) plt.clf() col = 'brgcwk' [plt.plot(masteranimation.timedata[i], [i] * len(masteranimation.timedata[i]), col[i%6]+'o') for i in range(len(wormlist))] ax = plt.axis() delx = .01 * (ax[1] - ax[0]) plt.axis([ax[0]-delx, ax[1]+delx, ax[2]-1, ax[3]+1])
""" def __init__(self, led, animcopies, start=0, end=-1): super(MasterAnimation, self).__init__(led, start, end) if not isinstance(animcopies, list): animcopies = [animcopies]
random_line_split
ConcurrentAnimations.py
#!/usr/bin/env python """ Use version of DriverSlave that has pixmap and pixheights """ import threading # import base classes and driver from bibliopixel import LEDStrip, LEDMatrix # from bibliopixel.drivers.LPD8806 import DriverLPD8806, ChannelOrder from bibliopixel.drivers.visualizer import DriverVisualizer, ChannelOrder from bibliopixel.drivers.slave_driver import DriverSlave # import colors import bibliopixel.colors from bibliopixel.animation import BaseStripAnim from logging import DEBUG, INFO, WARNING, CRITICAL, ERROR from bibliopixel import log log.setLogLevel(WARNING) import re import time from operator import or_, ior, ixor import matplotlib.pyplot as plt import BiblioPixelAnimations.matrix.bloom as BA class MasterAnimation(BaseStripAnim): """ Takes copies of fake leds, combines using heights and mixing to fill and update a led NEED now ledcopies is list of the leds associated with each animation NEED also mapping of the leds into master led (i.e. path list) NEED also height of each animations and merging method if same height """ def __init__(self, led, animcopies, start=0, end=-1): super(MasterAnimation, self).__init__(led, start, end) if not isinstance(animcopies, list): animcopies = [animcopies] self._animcopies = animcopies self._ledcopies = [a._led for a, f in animcopies] self._idlelist = [] self.timedata = [[] for _ in range(len(self._ledcopies))] # [[]] * 5 NOT define 5 different lists! self._led.pixheights = [0] * self._led.numLEDs # def preRun(self, amt=1): # self._led.all_off() # for w, f in self._animcopies: # w.run(fps=f, max_steps=runtime * f, threaded = True) def preStep(self, amt=1): #print 'prestep {}'.format(self._step) # only step the master thread when something from ledcopies # has been done i.e. its event _wait must be false (I THINK) # TODO is this good code???? or is there a better way to block self._idlelist = [True] # to insure goes thru while loop at least once while all(self._idlelist): self._idlelist = [not ledcopy.driver[0]._updatenow.isSet() for ledcopy in self._ledcopies] if self._stopEvent.isSet():
# def postStep(self, amt=1): # clear the ones found in preStep activewormind = [i for i, x in enumerate(self._idlelist) if x == False] [self._ledcopies[i].driver[0]._updatenow.clear() for i in activewormind] def step(self, amt=1): """ combines the buffers from the slave led's which then gets sent to led via update """ # For checking if all the animations have their framse looked at #activewormind = [i for i, x in enumerate(self._idlelist) if x == False] #print "Worm {} at {:5g}".format(activewormind, 1000*(time.time() - starttime)) # save times activated for each worm [self.timedata[i].append(1000*(time.time() - starttime)) for i, x in enumerate(self._idlelist) if x == False] #self._led.buffer = [0] * 480 self._led.pixheights = [-100] * self._led.numLEDs #print type(self._led.buffer) for ledcopy in self._ledcopies: # self._led.buffer = map(ixor, self._led.buffer, ledcopy.buffer) # use pixheights but assume all buffers same size # print ledcopy.driver[0].pixheights for pix in range(self._led.numLEDs): #for ledcopy in self._ledcopies: if self._led.pixheights[pix] == ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] ^= ledcopy.buffer[3*pix + i] elif self._led.pixheights[pix] < ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] = ledcopy.buffer[3*pix + i] self._led.pixheights[pix] = ledcopy.driver[0].pixheights[pix] self._step += 1 def run(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, joinThread = False, callback=None): #def run(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, threaded = True, joinThread = False, callback=None): # self.fps = fps # self.untilComplete = untilComplete super(MasterAnimation, self).run(amt = 1, fps=fps, sleep=None, max_steps = 0, untilComplete = untilComplete, max_cycles = 0, threaded = True, joinThread = joinThread, callback=callback) class Worm(BaseStripAnim): """ colors a list the worm segment (starting with head) colors path a list of the LED indices over which the worm will travel cyclelen controls speed, worm movement only when LED upload cycles == 0 mod cyclelen height (of worm segments) is same length as colors: higher value worms segments go over top of lower value worms """ def __init__(self, led, colors, path, cyclelen, direction=1, height=None, start=0, end=-1): super(Worm, self).__init__(led, start, end) if height is None: height = [0]*len(colors) elif type(height) == int: height = [height]*len(colors) self._colors = colors self._colors.append((0, 0, 0)) # add blank seqment to end worm self._path = path self._cyclelen = cyclelen self._height = height self._height.append(-1) # add lowest value for height self._activecount = 0 self._direction = direction self._headposition = -self._direction #print self._colors #print self._height def step(self, amt=1): if self._activecount == 0: self._headposition += amt*self._direction self._headposition %= len(self._path) # Put worm into strip and blank end segpos = self._headposition for x in range(len(self._colors)): if True: #self._height[x] >= LEDsegheights[self._path[segpos]]: # or x == len(self.colors) - 1: #if self._height[x] >= self._led.driver[0].pixheights[self._path[segpos]]: # or x == len(self.colors) - 1: self._led.set(self._path[segpos], self._colors[x]) self._led.driver[0].pixheights[self._path[segpos]] = self._height[x] segpos -= self._direction segpos %= len(self._path) self._activecount += amt self._activecount %= self._cyclelen self._step += amt def pathgen(nleft=0, nright=15, nbot=0, ntop=9, shift=0, turns=10, rounds=16): """ A path around a rectangle from strip wound helically 10 turns high by 16 round. rounds * turns must be number of pixels on strip nleft and nright is from 0 to rounds-1, nbot and ntop from 0 to turns-1 """ def ind(x, y): return x + y * rounds assert 0 <= nleft <= nright -1 <= rounds and 0 <= nbot <= ntop -1 <= turns nled = rounds*turns sleft = range(ind(nleft, nbot), ind(nleft, ntop), rounds) tp = range(ind(nleft, ntop), ind(nright, ntop), 1) sright = range(ind(nright, ntop), ind(nright, nbot), -rounds) bt = range(ind(nright, nbot), ind(nleft, nbot), -1) path = sleft+tp+sright+bt if len(path) == 0: path = [ind(nleft, nbot)] path = map(lambda x: (shift+x) % nled, path) log.logger.info("pathgen({}, {}, {}, {}, {}) is {}".format(nleft, nright, nbot, ntop, shift, path)) return path if True: #__name__ == '__main__': drivermaster = DriverVisualizer(160, pixelSize=62, stayTop=False, maxWindowWidth=1024) # using pixelSize 62 and changed code of visualizer.py to have maxWindowWidth=1024 #drivermaster = DriverVisualizer(160, pixelSize=31, stayTop=False) #ledmaster = LEDStrip(drivermaster, threadedUpdate=True) ledmaster = LEDStrip(drivermaster) lnin = [255, 222, 200, 150, 125] bluedimming = [(0, 0, i) for i in lnin] bluedimming = [(0, 0, 0) for i in lnin] reddimming = [(i, 0, 0) for i in lnin] greendimming = [(0, i, 0) for i in lnin] cyandimming = [(0, i, i) for i in lnin] whitedimming = [(i, i, i) for i in lnin] # Worm arguments wormblue = (bluedimming, pathgen(5, 10, 0, 9), 1, 1, 6) wormred = (reddimming, pathgen(1, 14, 1, 8), 1, 1, 2) wormgreen = (greendimming, pathgen(2, 13, 2, 7), 1, 1, 3) wormcyan = (cyandimming, pathgen(3, 12, 3, 6), 1, 1, 4) wormwhite = (whitedimming, pathgen(4, 11, 4, 5), 1, 1, 5) # List of pair (animation arguments, fps) wormdatalist = [(wormblue, 24), (wormred, 20), (wormgreen, 16), (wormcyan, 12), (wormwhite, 8)] #wormdatalist = [(wormwhite, 8)] #wormdatalist = [] # dummy strips must each have their own slavedriver as thread is attached # to the driver ledslaves = [LEDStrip(DriverSlave(160, pixheights=-1), threadedUpdate=True) for _ in range(len(wormdatalist))] # Make the Worm animations an list pairs (animation, fps) wormlist = [(Worm(ledslaves[i], *d[0]), d[1]) for i, d in enumerate(wormdatalist)] ledslaveb = LEDMatrix(DriverSlave(160, None, 0), width=16, height=10, threadedUpdate=True) bloom = BA.Bloom(ledslaveb) wormlist.append((bloom, 10)) #masteranimation = MasterAnimation(ledmaster, [w._led for w, f in wormlist]) masteranimation = MasterAnimation(ledmaster, wormlist) starttime = time.time() runtime = 1 # Master steps when it gets a go ahdead signal from one of the # concurrent annimations masteranimation.run(fps=None) # if give fps for master will skip faster frames # Run all the slave animations and master threaded # The slave animations update their buffers at the correct # time and rather than update, just signal the master they # are ready to be combined and sent to the actual leds for w, f in wormlist: w.run(fps=f, max_steps=runtime * f, threaded = True) #print threading.enumerate() print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) # idle and threaded animations will run jointly while not all([w.stopped() for w, f in wormlist]): pass # stop the master masteranimation.stopThread(True) # need True print "Master Animation Step Count {}".format(masteranimation._step) ledmaster.waitForUpdate() ledmaster.stopUpdateThreads() [w._led.stopUpdateThreads() for w, f in wormlist] print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) plt.clf() col = 'brgcwk' [plt.plot(masteranimation.timedata[i], [i] * len(masteranimation.timedata[i]), col[i%6]+'o') for i in range(len(wormlist))] ax = plt.axis() delx = .01 * (ax[1] - ax[0]) plt.axis([ax[0]-delx, ax[1]+delx, ax[2]-1, ax[3]+1])
self.animComplete = True print 'breaking out' break
conditional_block
ConcurrentAnimations.py
#!/usr/bin/env python """ Use version of DriverSlave that has pixmap and pixheights """ import threading # import base classes and driver from bibliopixel import LEDStrip, LEDMatrix # from bibliopixel.drivers.LPD8806 import DriverLPD8806, ChannelOrder from bibliopixel.drivers.visualizer import DriverVisualizer, ChannelOrder from bibliopixel.drivers.slave_driver import DriverSlave # import colors import bibliopixel.colors from bibliopixel.animation import BaseStripAnim from logging import DEBUG, INFO, WARNING, CRITICAL, ERROR from bibliopixel import log log.setLogLevel(WARNING) import re import time from operator import or_, ior, ixor import matplotlib.pyplot as plt import BiblioPixelAnimations.matrix.bloom as BA class MasterAnimation(BaseStripAnim): """ Takes copies of fake leds, combines using heights and mixing to fill and update a led NEED now ledcopies is list of the leds associated with each animation NEED also mapping of the leds into master led (i.e. path list) NEED also height of each animations and merging method if same height """ def __init__(self, led, animcopies, start=0, end=-1): super(MasterAnimation, self).__init__(led, start, end) if not isinstance(animcopies, list): animcopies = [animcopies] self._animcopies = animcopies self._ledcopies = [a._led for a, f in animcopies] self._idlelist = [] self.timedata = [[] for _ in range(len(self._ledcopies))] # [[]] * 5 NOT define 5 different lists! self._led.pixheights = [0] * self._led.numLEDs # def preRun(self, amt=1): # self._led.all_off() # for w, f in self._animcopies: # w.run(fps=f, max_steps=runtime * f, threaded = True) def preStep(self, amt=1): #print 'prestep {}'.format(self._step) # only step the master thread when something from ledcopies # has been done i.e. its event _wait must be false (I THINK) # TODO is this good code???? or is there a better way to block self._idlelist = [True] # to insure goes thru while loop at least once while all(self._idlelist): self._idlelist = [not ledcopy.driver[0]._updatenow.isSet() for ledcopy in self._ledcopies] if self._stopEvent.isSet(): self.animComplete = True print 'breaking out' break # def postStep(self, amt=1): # clear the ones found in preStep activewormind = [i for i, x in enumerate(self._idlelist) if x == False] [self._ledcopies[i].driver[0]._updatenow.clear() for i in activewormind] def step(self, amt=1): """ combines the buffers from the slave led's which then gets sent to led via update """ # For checking if all the animations have their framse looked at #activewormind = [i for i, x in enumerate(self._idlelist) if x == False] #print "Worm {} at {:5g}".format(activewormind, 1000*(time.time() - starttime)) # save times activated for each worm [self.timedata[i].append(1000*(time.time() - starttime)) for i, x in enumerate(self._idlelist) if x == False] #self._led.buffer = [0] * 480 self._led.pixheights = [-100] * self._led.numLEDs #print type(self._led.buffer) for ledcopy in self._ledcopies: # self._led.buffer = map(ixor, self._led.buffer, ledcopy.buffer) # use pixheights but assume all buffers same size # print ledcopy.driver[0].pixheights for pix in range(self._led.numLEDs): #for ledcopy in self._ledcopies: if self._led.pixheights[pix] == ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] ^= ledcopy.buffer[3*pix + i] elif self._led.pixheights[pix] < ledcopy.driver[0].pixheights[pix]: for i in range(3): self._led.buffer[3*pix + i] = ledcopy.buffer[3*pix + i] self._led.pixheights[pix] = ledcopy.driver[0].pixheights[pix] self._step += 1 def run(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, joinThread = False, callback=None): #def run(self, amt = 1, fps=None, sleep=None, max_steps = 0, untilComplete = False, max_cycles = 0, threaded = True, joinThread = False, callback=None): # self.fps = fps # self.untilComplete = untilComplete super(MasterAnimation, self).run(amt = 1, fps=fps, sleep=None, max_steps = 0, untilComplete = untilComplete, max_cycles = 0, threaded = True, joinThread = joinThread, callback=callback) class Worm(BaseStripAnim): """ colors a list the worm segment (starting with head) colors path a list of the LED indices over which the worm will travel cyclelen controls speed, worm movement only when LED upload cycles == 0 mod cyclelen height (of worm segments) is same length as colors: higher value worms segments go over top of lower value worms """ def __init__(self, led, colors, path, cyclelen, direction=1, height=None, start=0, end=-1): super(Worm, self).__init__(led, start, end) if height is None: height = [0]*len(colors) elif type(height) == int: height = [height]*len(colors) self._colors = colors self._colors.append((0, 0, 0)) # add blank seqment to end worm self._path = path self._cyclelen = cyclelen self._height = height self._height.append(-1) # add lowest value for height self._activecount = 0 self._direction = direction self._headposition = -self._direction #print self._colors #print self._height def step(self, amt=1):
def pathgen(nleft=0, nright=15, nbot=0, ntop=9, shift=0, turns=10, rounds=16): """ A path around a rectangle from strip wound helically 10 turns high by 16 round. rounds * turns must be number of pixels on strip nleft and nright is from 0 to rounds-1, nbot and ntop from 0 to turns-1 """ def ind(x, y): return x + y * rounds assert 0 <= nleft <= nright -1 <= rounds and 0 <= nbot <= ntop -1 <= turns nled = rounds*turns sleft = range(ind(nleft, nbot), ind(nleft, ntop), rounds) tp = range(ind(nleft, ntop), ind(nright, ntop), 1) sright = range(ind(nright, ntop), ind(nright, nbot), -rounds) bt = range(ind(nright, nbot), ind(nleft, nbot), -1) path = sleft+tp+sright+bt if len(path) == 0: path = [ind(nleft, nbot)] path = map(lambda x: (shift+x) % nled, path) log.logger.info("pathgen({}, {}, {}, {}, {}) is {}".format(nleft, nright, nbot, ntop, shift, path)) return path if True: #__name__ == '__main__': drivermaster = DriverVisualizer(160, pixelSize=62, stayTop=False, maxWindowWidth=1024) # using pixelSize 62 and changed code of visualizer.py to have maxWindowWidth=1024 #drivermaster = DriverVisualizer(160, pixelSize=31, stayTop=False) #ledmaster = LEDStrip(drivermaster, threadedUpdate=True) ledmaster = LEDStrip(drivermaster) lnin = [255, 222, 200, 150, 125] bluedimming = [(0, 0, i) for i in lnin] bluedimming = [(0, 0, 0) for i in lnin] reddimming = [(i, 0, 0) for i in lnin] greendimming = [(0, i, 0) for i in lnin] cyandimming = [(0, i, i) for i in lnin] whitedimming = [(i, i, i) for i in lnin] # Worm arguments wormblue = (bluedimming, pathgen(5, 10, 0, 9), 1, 1, 6) wormred = (reddimming, pathgen(1, 14, 1, 8), 1, 1, 2) wormgreen = (greendimming, pathgen(2, 13, 2, 7), 1, 1, 3) wormcyan = (cyandimming, pathgen(3, 12, 3, 6), 1, 1, 4) wormwhite = (whitedimming, pathgen(4, 11, 4, 5), 1, 1, 5) # List of pair (animation arguments, fps) wormdatalist = [(wormblue, 24), (wormred, 20), (wormgreen, 16), (wormcyan, 12), (wormwhite, 8)] #wormdatalist = [(wormwhite, 8)] #wormdatalist = [] # dummy strips must each have their own slavedriver as thread is attached # to the driver ledslaves = [LEDStrip(DriverSlave(160, pixheights=-1), threadedUpdate=True) for _ in range(len(wormdatalist))] # Make the Worm animations an list pairs (animation, fps) wormlist = [(Worm(ledslaves[i], *d[0]), d[1]) for i, d in enumerate(wormdatalist)] ledslaveb = LEDMatrix(DriverSlave(160, None, 0), width=16, height=10, threadedUpdate=True) bloom = BA.Bloom(ledslaveb) wormlist.append((bloom, 10)) #masteranimation = MasterAnimation(ledmaster, [w._led for w, f in wormlist]) masteranimation = MasterAnimation(ledmaster, wormlist) starttime = time.time() runtime = 1 # Master steps when it gets a go ahdead signal from one of the # concurrent annimations masteranimation.run(fps=None) # if give fps for master will skip faster frames # Run all the slave animations and master threaded # The slave animations update their buffers at the correct # time and rather than update, just signal the master they # are ready to be combined and sent to the actual leds for w, f in wormlist: w.run(fps=f, max_steps=runtime * f, threaded = True) #print threading.enumerate() print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) # idle and threaded animations will run jointly while not all([w.stopped() for w, f in wormlist]): pass # stop the master masteranimation.stopThread(True) # need True print "Master Animation Step Count {}".format(masteranimation._step) ledmaster.waitForUpdate() ledmaster.stopUpdateThreads() [w._led.stopUpdateThreads() for w, f in wormlist] print "THREADS: " + ",".join([re.sub('<class |,|bibliopixel.\w*.|>', '', str(s.__class__)) for s in threading.enumerate()]) plt.clf() col = 'brgcwk' [plt.plot(masteranimation.timedata[i], [i] * len(masteranimation.timedata[i]), col[i%6]+'o') for i in range(len(wormlist))] ax = plt.axis() delx = .01 * (ax[1] - ax[0]) plt.axis([ax[0]-delx, ax[1]+delx, ax[2]-1, ax[3]+1])
if self._activecount == 0: self._headposition += amt*self._direction self._headposition %= len(self._path) # Put worm into strip and blank end segpos = self._headposition for x in range(len(self._colors)): if True: #self._height[x] >= LEDsegheights[self._path[segpos]]: # or x == len(self.colors) - 1: #if self._height[x] >= self._led.driver[0].pixheights[self._path[segpos]]: # or x == len(self.colors) - 1: self._led.set(self._path[segpos], self._colors[x]) self._led.driver[0].pixheights[self._path[segpos]] = self._height[x] segpos -= self._direction segpos %= len(self._path) self._activecount += amt self._activecount %= self._cyclelen self._step += amt
identifier_body
resource_ldap_object_attributes.go
package provider import ( "fmt" "strings" "github.com/go-ldap/ldap/v3" "github.com/hashicorp/terraform-plugin-sdk/v2/helper/schema" "github.com/trevex/terraform-provider-ldap/util" ) func resourceLDAPObjectAttributes() *schema.Resource { return &schema.Resource{ Create: resourceLDAPObjectAttributesCreate, Read: resourceLDAPObjectAttributesRead, Update: resourceLDAPObjectAttributesUpdate, Delete: resourceLDAPObjectAttributesDelete, Description: "The `ldap_object_attributes`-resource owns only specific attributes of an object. In case of multi-valued attributes the resource only owns the values defined by the resource and all pre-existing ones or ones added by other means are left in-tact.", Schema: map[string]*schema.Schema{ "dn": { Type: schema.TypeString, Description: "The Distinguished Name (DN) of the object, as the concatenation of its RDN (unique among siblings) and its parent's DN. The referenced object should exist to be able to add attributes.", Required: true, ForceNew: true, }, "attributes": { Type: schema.TypeSet, Description: "The map of attributes to add to the referenced object; each attribute can be multi-valued.", Set: attributeHash, MinItems: 0, Elem: &schema.Schema{ Type: schema.TypeMap, Description: "The list of values for a given attribute.", MinItems: 1, MaxItems: 1, Elem: &schema.Schema{ Type: schema.TypeString, Description: "The individual value for the given attribute.", }, }, Optional: true, }, }, } } func resourceLDAPObjectAttributesCreate(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::create - adding attributes to object %q", dn) request := ldap.NewModifyRequest(dn, []ldap.Control{}) // if there is a non empty list of attributes, loop though it and // create a new map collecting attribute names and its value(s); we need to // do this because we could not model the attributes as a map[string][]string // due to an appareent limitation in HCL; we have a []map[string]string, so // we loop through the list and accumulate values when they share the same // key, then we use these as attributes in the LDAP client. if v, ok := d.GetOk("attributes"); ok { attributes := v.(*schema.Set).List() if len(attributes) > 0 { debugLog("ldap_object_attributes::create - object %q updated with %d additional attributes", dn, len(attributes)) m := make(map[string][]string) for _, attribute := range attributes { debugLog("ldap_object_attributes::create - %q has attribute of type %T", dn, attribute) // each map should only have one entry (see resource declaration) for name, value := range attribute.(map[string]interface{}) { debugLog("ldap_object_attributes::create - %q has attribute[%v] => %v (%T)", dn, name, value, value) v := toAttributeValue(name, value.(string)) m[name] = append(m[name], v) } } // now loop through the map and add attributes with theys value(s) for name, values := range m { request.Add(name, values) } } } err := client.Modify(request) if err != nil { return err } debugLog("ldap_object_attributes::create - object %q updated with additional attributes", dn) return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesRead(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::read - looking for object %q", dn) // when searching by DN, you don't need t specify the base DN a search // filter a "subtree" scope: just put the DN (i.e. the primary key) as the // base DN with a "base object" scope, and the returned object will be the // entry, if it exists request := ldap.NewSearchRequest( dn, ldap.ScopeBaseObject, ldap.NeverDerefAliases, 0, 0, false, "(objectclass=*)", []string{"*"}, nil, ) sr, err := client.Search(request) if err != nil { if err, ok := err.(*ldap.Error); ok { if err.ResultCode == 32 { // no such object warnLog("ldap_object_attributes::read - object not found, removing %q from state because it no longer exists in LDAP", dn) d.SetId("") } } debugLog("ldap_object_attributes::read - lookup for %q returned an error %v", dn, err) return err } debugLog("ldap_object_attributes::read - query for %q returned %v", dn, sr) // Let's transform the attributes from LDAP into a set that we can intersect // with our resources sets. ldapSet := &schema.Set{ F: attributeHash, } for _, attribute := range sr.Entries[0].Attributes { debugLog("ldap_object_attributes::read - adding attribute %q to %q (%d values)", attribute.Name, dn, len(attribute.Values)) if len(attribute.Values) == 1 { // we don't treat the RDN as an ordinary attribute a := fmt.Sprintf("%s=%s", attribute.Name, attribute.Values[0]) if strings.HasPrefix(dn, a) { debugLog("ldap_object_attributes::read - skipping RDN %q of %q", a, dn) continue } } // now add each value as an individual entry into the object, because // we do not handle name => []values, and we have a set of maps each // holding a single entry name => value; multiple maps may share the // same key. for _, value := range attribute.Values { debugLog("ldap_object_attributes::read - for %q from ldap, setting %q => %q", dn, attribute.Name, value) ldapSet.Add(map[string]interface{}{ attribute.Name: value, }) } } debugLog("ldap_object_attributes::read - attributes from ldap of %q => %v", dn, ldapSet.List()) // We are both interested in the attributes before and after changes, so // depending on what is available, let's compute the union var ( oldSet *schema.Set newSet *schema.Set unionSet *schema.Set ) if d.HasChange("attributes") { prev, next := d.GetChange("attributes") oldSet = prev.(*schema.Set) newSet = next.(*schema.Set) } else { newSet = d.Get("attributes").(*schema.Set) } debugLog("ldap_object_attributes::read - newSet of %q => %v", dn, newSet.List()) if oldSet != nil { debugLog("ldap_object_attributes::read - oldSet of %q => %v", dn, oldSet.List()) unionSet = oldSet.Union(newSet) } else { unionSet = newSet } debugLog("ldap_object_attributes::read - union of %q => %v", dn, unionSet.List()) // Now that we both have union of relevant terraform states and ldap, let's // get the intersection and set it. set := unionSet.Intersection(ldapSet) debugLog("ldap_object_attributes::read - intersection with ldap of %q => %v", dn, set.List()) // If the set is empty the attributes do not exist, yet. if set.Len() == 0 { d.SetId("") return nil } // The set contains values, let's set them and indicate that the object // exists by setting the id as well. if err := d.Set("attributes", set); err != nil { warnLog("ldap_object_attributes::read - error setting attributes for %q : %v", dn, err) return err } d.SetId(dn) return nil } func resourceLDAPObjectAttributesUpdate(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::update - performing update on %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) if d.HasChange("attributes") { o, n := d.GetChange("attributes") debugLog("ldap_object_attributes::update - \n%s", printAttributes("old attributes map", o)) debugLog("ldap_object_attributes::update - \n%s", printAttributes("new attributes map", n)) err := computeAndAddAttributeDeltas(modify, o.(*schema.Set), n.(*schema.Set)) if err != nil { return err } } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil
} else { warnLog("ldap_object_attributes::update - didn't actually make changes to %q because there were no changes requested", dn) } return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesDelete(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::delete - removing attributes from %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) err := computeAndAddAttributeDeltas(modify, d.Get("attributes").(*schema.Set), &schema.Set{ F: attributeHash, }) if err != nil { return err } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil { errorLog("ldap_object_attributes::delete - error modifying LDAP object %q with values %v", d.Id(), err) return err } } else { warnLog("ldap_object_attributes::delete - didn't actually make changes to %q because there were no changes requested", dn) } debugLog("ldap_object::delete - %q removed", dn) return nil } func computeAndAddAttributeDeltas(modify *ldap.ModifyRequest, os, ns *schema.Set) error { ra := os.Difference(ns) // removed attributes rk := util.NewSet() // names of removed attributes for _, v := range ra.List() { for k := range v.(map[string]interface{}) { rk.Add(k) } } aa := ns.Difference(os) // added attributes ak := util.NewSet() // names of added attributes for _, v := range aa.List() { for k := range v.(map[string]interface{}) { ak.Add(k) } } // loop over remove attributes' names for _, k := range rk.List() { values := []string{} for _, m := range ra.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Delete(k, values) debugLog("ldap_object_attributes::deltas - removing attribute %q with values %v", k, values) } for _, k := range ak.List() { values := []string{} for _, m := range aa.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Add(k, values) debugLog("ldap_object_attributes::deltas - adding new attribute %q with values %v", k, values) } return nil }
{ errorLog("ldap_object_attributes::update - error modifying LDAP object %q with values %v", d.Id(), err) return err }
conditional_block
resource_ldap_object_attributes.go
package provider import ( "fmt" "strings" "github.com/go-ldap/ldap/v3" "github.com/hashicorp/terraform-plugin-sdk/v2/helper/schema" "github.com/trevex/terraform-provider-ldap/util" ) func resourceLDAPObjectAttributes() *schema.Resource { return &schema.Resource{ Create: resourceLDAPObjectAttributesCreate, Read: resourceLDAPObjectAttributesRead, Update: resourceLDAPObjectAttributesUpdate, Delete: resourceLDAPObjectAttributesDelete, Description: "The `ldap_object_attributes`-resource owns only specific attributes of an object. In case of multi-valued attributes the resource only owns the values defined by the resource and all pre-existing ones or ones added by other means are left in-tact.", Schema: map[string]*schema.Schema{ "dn": { Type: schema.TypeString, Description: "The Distinguished Name (DN) of the object, as the concatenation of its RDN (unique among siblings) and its parent's DN. The referenced object should exist to be able to add attributes.", Required: true, ForceNew: true, }, "attributes": { Type: schema.TypeSet, Description: "The map of attributes to add to the referenced object; each attribute can be multi-valued.", Set: attributeHash, MinItems: 0, Elem: &schema.Schema{ Type: schema.TypeMap, Description: "The list of values for a given attribute.", MinItems: 1, MaxItems: 1, Elem: &schema.Schema{ Type: schema.TypeString, Description: "The individual value for the given attribute.", }, }, Optional: true, }, }, } } func resourceLDAPObjectAttributesCreate(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::create - adding attributes to object %q", dn) request := ldap.NewModifyRequest(dn, []ldap.Control{}) // if there is a non empty list of attributes, loop though it and // create a new map collecting attribute names and its value(s); we need to // do this because we could not model the attributes as a map[string][]string // due to an appareent limitation in HCL; we have a []map[string]string, so // we loop through the list and accumulate values when they share the same // key, then we use these as attributes in the LDAP client. if v, ok := d.GetOk("attributes"); ok { attributes := v.(*schema.Set).List() if len(attributes) > 0 { debugLog("ldap_object_attributes::create - object %q updated with %d additional attributes", dn, len(attributes)) m := make(map[string][]string) for _, attribute := range attributes { debugLog("ldap_object_attributes::create - %q has attribute of type %T", dn, attribute) // each map should only have one entry (see resource declaration) for name, value := range attribute.(map[string]interface{}) { debugLog("ldap_object_attributes::create - %q has attribute[%v] => %v (%T)", dn, name, value, value) v := toAttributeValue(name, value.(string)) m[name] = append(m[name], v) } } // now loop through the map and add attributes with theys value(s) for name, values := range m { request.Add(name, values) } } } err := client.Modify(request) if err != nil { return err } debugLog("ldap_object_attributes::create - object %q updated with additional attributes", dn) return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesRead(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::read - looking for object %q", dn) // when searching by DN, you don't need t specify the base DN a search // filter a "subtree" scope: just put the DN (i.e. the primary key) as the // base DN with a "base object" scope, and the returned object will be the // entry, if it exists request := ldap.NewSearchRequest( dn, ldap.ScopeBaseObject, ldap.NeverDerefAliases, 0, 0, false, "(objectclass=*)", []string{"*"}, nil, ) sr, err := client.Search(request) if err != nil { if err, ok := err.(*ldap.Error); ok { if err.ResultCode == 32 { // no such object warnLog("ldap_object_attributes::read - object not found, removing %q from state because it no longer exists in LDAP", dn) d.SetId("") } } debugLog("ldap_object_attributes::read - lookup for %q returned an error %v", dn, err) return err } debugLog("ldap_object_attributes::read - query for %q returned %v", dn, sr) // Let's transform the attributes from LDAP into a set that we can intersect // with our resources sets. ldapSet := &schema.Set{ F: attributeHash, } for _, attribute := range sr.Entries[0].Attributes { debugLog("ldap_object_attributes::read - adding attribute %q to %q (%d values)", attribute.Name, dn, len(attribute.Values)) if len(attribute.Values) == 1 { // we don't treat the RDN as an ordinary attribute a := fmt.Sprintf("%s=%s", attribute.Name, attribute.Values[0]) if strings.HasPrefix(dn, a) { debugLog("ldap_object_attributes::read - skipping RDN %q of %q", a, dn) continue } } // now add each value as an individual entry into the object, because // we do not handle name => []values, and we have a set of maps each // holding a single entry name => value; multiple maps may share the // same key. for _, value := range attribute.Values { debugLog("ldap_object_attributes::read - for %q from ldap, setting %q => %q", dn, attribute.Name, value) ldapSet.Add(map[string]interface{}{ attribute.Name: value, }) } } debugLog("ldap_object_attributes::read - attributes from ldap of %q => %v", dn, ldapSet.List()) // We are both interested in the attributes before and after changes, so // depending on what is available, let's compute the union var ( oldSet *schema.Set newSet *schema.Set unionSet *schema.Set ) if d.HasChange("attributes") { prev, next := d.GetChange("attributes") oldSet = prev.(*schema.Set) newSet = next.(*schema.Set) } else { newSet = d.Get("attributes").(*schema.Set) } debugLog("ldap_object_attributes::read - newSet of %q => %v", dn, newSet.List()) if oldSet != nil { debugLog("ldap_object_attributes::read - oldSet of %q => %v", dn, oldSet.List()) unionSet = oldSet.Union(newSet) } else { unionSet = newSet } debugLog("ldap_object_attributes::read - union of %q => %v", dn, unionSet.List()) // Now that we both have union of relevant terraform states and ldap, let's // get the intersection and set it.
debugLog("ldap_object_attributes::read - intersection with ldap of %q => %v", dn, set.List()) // If the set is empty the attributes do not exist, yet. if set.Len() == 0 { d.SetId("") return nil } // The set contains values, let's set them and indicate that the object // exists by setting the id as well. if err := d.Set("attributes", set); err != nil { warnLog("ldap_object_attributes::read - error setting attributes for %q : %v", dn, err) return err } d.SetId(dn) return nil } func resourceLDAPObjectAttributesUpdate(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::update - performing update on %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) if d.HasChange("attributes") { o, n := d.GetChange("attributes") debugLog("ldap_object_attributes::update - \n%s", printAttributes("old attributes map", o)) debugLog("ldap_object_attributes::update - \n%s", printAttributes("new attributes map", n)) err := computeAndAddAttributeDeltas(modify, o.(*schema.Set), n.(*schema.Set)) if err != nil { return err } } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil { errorLog("ldap_object_attributes::update - error modifying LDAP object %q with values %v", d.Id(), err) return err } } else { warnLog("ldap_object_attributes::update - didn't actually make changes to %q because there were no changes requested", dn) } return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesDelete(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::delete - removing attributes from %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) err := computeAndAddAttributeDeltas(modify, d.Get("attributes").(*schema.Set), &schema.Set{ F: attributeHash, }) if err != nil { return err } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil { errorLog("ldap_object_attributes::delete - error modifying LDAP object %q with values %v", d.Id(), err) return err } } else { warnLog("ldap_object_attributes::delete - didn't actually make changes to %q because there were no changes requested", dn) } debugLog("ldap_object::delete - %q removed", dn) return nil } func computeAndAddAttributeDeltas(modify *ldap.ModifyRequest, os, ns *schema.Set) error { ra := os.Difference(ns) // removed attributes rk := util.NewSet() // names of removed attributes for _, v := range ra.List() { for k := range v.(map[string]interface{}) { rk.Add(k) } } aa := ns.Difference(os) // added attributes ak := util.NewSet() // names of added attributes for _, v := range aa.List() { for k := range v.(map[string]interface{}) { ak.Add(k) } } // loop over remove attributes' names for _, k := range rk.List() { values := []string{} for _, m := range ra.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Delete(k, values) debugLog("ldap_object_attributes::deltas - removing attribute %q with values %v", k, values) } for _, k := range ak.List() { values := []string{} for _, m := range aa.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Add(k, values) debugLog("ldap_object_attributes::deltas - adding new attribute %q with values %v", k, values) } return nil }
set := unionSet.Intersection(ldapSet)
random_line_split
resource_ldap_object_attributes.go
package provider import ( "fmt" "strings" "github.com/go-ldap/ldap/v3" "github.com/hashicorp/terraform-plugin-sdk/v2/helper/schema" "github.com/trevex/terraform-provider-ldap/util" ) func resourceLDAPObjectAttributes() *schema.Resource
func resourceLDAPObjectAttributesCreate(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::create - adding attributes to object %q", dn) request := ldap.NewModifyRequest(dn, []ldap.Control{}) // if there is a non empty list of attributes, loop though it and // create a new map collecting attribute names and its value(s); we need to // do this because we could not model the attributes as a map[string][]string // due to an appareent limitation in HCL; we have a []map[string]string, so // we loop through the list and accumulate values when they share the same // key, then we use these as attributes in the LDAP client. if v, ok := d.GetOk("attributes"); ok { attributes := v.(*schema.Set).List() if len(attributes) > 0 { debugLog("ldap_object_attributes::create - object %q updated with %d additional attributes", dn, len(attributes)) m := make(map[string][]string) for _, attribute := range attributes { debugLog("ldap_object_attributes::create - %q has attribute of type %T", dn, attribute) // each map should only have one entry (see resource declaration) for name, value := range attribute.(map[string]interface{}) { debugLog("ldap_object_attributes::create - %q has attribute[%v] => %v (%T)", dn, name, value, value) v := toAttributeValue(name, value.(string)) m[name] = append(m[name], v) } } // now loop through the map and add attributes with theys value(s) for name, values := range m { request.Add(name, values) } } } err := client.Modify(request) if err != nil { return err } debugLog("ldap_object_attributes::create - object %q updated with additional attributes", dn) return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesRead(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::read - looking for object %q", dn) // when searching by DN, you don't need t specify the base DN a search // filter a "subtree" scope: just put the DN (i.e. the primary key) as the // base DN with a "base object" scope, and the returned object will be the // entry, if it exists request := ldap.NewSearchRequest( dn, ldap.ScopeBaseObject, ldap.NeverDerefAliases, 0, 0, false, "(objectclass=*)", []string{"*"}, nil, ) sr, err := client.Search(request) if err != nil { if err, ok := err.(*ldap.Error); ok { if err.ResultCode == 32 { // no such object warnLog("ldap_object_attributes::read - object not found, removing %q from state because it no longer exists in LDAP", dn) d.SetId("") } } debugLog("ldap_object_attributes::read - lookup for %q returned an error %v", dn, err) return err } debugLog("ldap_object_attributes::read - query for %q returned %v", dn, sr) // Let's transform the attributes from LDAP into a set that we can intersect // with our resources sets. ldapSet := &schema.Set{ F: attributeHash, } for _, attribute := range sr.Entries[0].Attributes { debugLog("ldap_object_attributes::read - adding attribute %q to %q (%d values)", attribute.Name, dn, len(attribute.Values)) if len(attribute.Values) == 1 { // we don't treat the RDN as an ordinary attribute a := fmt.Sprintf("%s=%s", attribute.Name, attribute.Values[0]) if strings.HasPrefix(dn, a) { debugLog("ldap_object_attributes::read - skipping RDN %q of %q", a, dn) continue } } // now add each value as an individual entry into the object, because // we do not handle name => []values, and we have a set of maps each // holding a single entry name => value; multiple maps may share the // same key. for _, value := range attribute.Values { debugLog("ldap_object_attributes::read - for %q from ldap, setting %q => %q", dn, attribute.Name, value) ldapSet.Add(map[string]interface{}{ attribute.Name: value, }) } } debugLog("ldap_object_attributes::read - attributes from ldap of %q => %v", dn, ldapSet.List()) // We are both interested in the attributes before and after changes, so // depending on what is available, let's compute the union var ( oldSet *schema.Set newSet *schema.Set unionSet *schema.Set ) if d.HasChange("attributes") { prev, next := d.GetChange("attributes") oldSet = prev.(*schema.Set) newSet = next.(*schema.Set) } else { newSet = d.Get("attributes").(*schema.Set) } debugLog("ldap_object_attributes::read - newSet of %q => %v", dn, newSet.List()) if oldSet != nil { debugLog("ldap_object_attributes::read - oldSet of %q => %v", dn, oldSet.List()) unionSet = oldSet.Union(newSet) } else { unionSet = newSet } debugLog("ldap_object_attributes::read - union of %q => %v", dn, unionSet.List()) // Now that we both have union of relevant terraform states and ldap, let's // get the intersection and set it. set := unionSet.Intersection(ldapSet) debugLog("ldap_object_attributes::read - intersection with ldap of %q => %v", dn, set.List()) // If the set is empty the attributes do not exist, yet. if set.Len() == 0 { d.SetId("") return nil } // The set contains values, let's set them and indicate that the object // exists by setting the id as well. if err := d.Set("attributes", set); err != nil { warnLog("ldap_object_attributes::read - error setting attributes for %q : %v", dn, err) return err } d.SetId(dn) return nil } func resourceLDAPObjectAttributesUpdate(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::update - performing update on %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) if d.HasChange("attributes") { o, n := d.GetChange("attributes") debugLog("ldap_object_attributes::update - \n%s", printAttributes("old attributes map", o)) debugLog("ldap_object_attributes::update - \n%s", printAttributes("new attributes map", n)) err := computeAndAddAttributeDeltas(modify, o.(*schema.Set), n.(*schema.Set)) if err != nil { return err } } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil { errorLog("ldap_object_attributes::update - error modifying LDAP object %q with values %v", d.Id(), err) return err } } else { warnLog("ldap_object_attributes::update - didn't actually make changes to %q because there were no changes requested", dn) } return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesDelete(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::delete - removing attributes from %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) err := computeAndAddAttributeDeltas(modify, d.Get("attributes").(*schema.Set), &schema.Set{ F: attributeHash, }) if err != nil { return err } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil { errorLog("ldap_object_attributes::delete - error modifying LDAP object %q with values %v", d.Id(), err) return err } } else { warnLog("ldap_object_attributes::delete - didn't actually make changes to %q because there were no changes requested", dn) } debugLog("ldap_object::delete - %q removed", dn) return nil } func computeAndAddAttributeDeltas(modify *ldap.ModifyRequest, os, ns *schema.Set) error { ra := os.Difference(ns) // removed attributes rk := util.NewSet() // names of removed attributes for _, v := range ra.List() { for k := range v.(map[string]interface{}) { rk.Add(k) } } aa := ns.Difference(os) // added attributes ak := util.NewSet() // names of added attributes for _, v := range aa.List() { for k := range v.(map[string]interface{}) { ak.Add(k) } } // loop over remove attributes' names for _, k := range rk.List() { values := []string{} for _, m := range ra.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Delete(k, values) debugLog("ldap_object_attributes::deltas - removing attribute %q with values %v", k, values) } for _, k := range ak.List() { values := []string{} for _, m := range aa.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Add(k, values) debugLog("ldap_object_attributes::deltas - adding new attribute %q with values %v", k, values) } return nil }
{ return &schema.Resource{ Create: resourceLDAPObjectAttributesCreate, Read: resourceLDAPObjectAttributesRead, Update: resourceLDAPObjectAttributesUpdate, Delete: resourceLDAPObjectAttributesDelete, Description: "The `ldap_object_attributes`-resource owns only specific attributes of an object. In case of multi-valued attributes the resource only owns the values defined by the resource and all pre-existing ones or ones added by other means are left in-tact.", Schema: map[string]*schema.Schema{ "dn": { Type: schema.TypeString, Description: "The Distinguished Name (DN) of the object, as the concatenation of its RDN (unique among siblings) and its parent's DN. The referenced object should exist to be able to add attributes.", Required: true, ForceNew: true, }, "attributes": { Type: schema.TypeSet, Description: "The map of attributes to add to the referenced object; each attribute can be multi-valued.", Set: attributeHash, MinItems: 0, Elem: &schema.Schema{ Type: schema.TypeMap, Description: "The list of values for a given attribute.", MinItems: 1, MaxItems: 1, Elem: &schema.Schema{ Type: schema.TypeString, Description: "The individual value for the given attribute.", }, }, Optional: true, }, }, } }
identifier_body
resource_ldap_object_attributes.go
package provider import ( "fmt" "strings" "github.com/go-ldap/ldap/v3" "github.com/hashicorp/terraform-plugin-sdk/v2/helper/schema" "github.com/trevex/terraform-provider-ldap/util" ) func resourceLDAPObjectAttributes() *schema.Resource { return &schema.Resource{ Create: resourceLDAPObjectAttributesCreate, Read: resourceLDAPObjectAttributesRead, Update: resourceLDAPObjectAttributesUpdate, Delete: resourceLDAPObjectAttributesDelete, Description: "The `ldap_object_attributes`-resource owns only specific attributes of an object. In case of multi-valued attributes the resource only owns the values defined by the resource and all pre-existing ones or ones added by other means are left in-tact.", Schema: map[string]*schema.Schema{ "dn": { Type: schema.TypeString, Description: "The Distinguished Name (DN) of the object, as the concatenation of its RDN (unique among siblings) and its parent's DN. The referenced object should exist to be able to add attributes.", Required: true, ForceNew: true, }, "attributes": { Type: schema.TypeSet, Description: "The map of attributes to add to the referenced object; each attribute can be multi-valued.", Set: attributeHash, MinItems: 0, Elem: &schema.Schema{ Type: schema.TypeMap, Description: "The list of values for a given attribute.", MinItems: 1, MaxItems: 1, Elem: &schema.Schema{ Type: schema.TypeString, Description: "The individual value for the given attribute.", }, }, Optional: true, }, }, } } func
(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::create - adding attributes to object %q", dn) request := ldap.NewModifyRequest(dn, []ldap.Control{}) // if there is a non empty list of attributes, loop though it and // create a new map collecting attribute names and its value(s); we need to // do this because we could not model the attributes as a map[string][]string // due to an appareent limitation in HCL; we have a []map[string]string, so // we loop through the list and accumulate values when they share the same // key, then we use these as attributes in the LDAP client. if v, ok := d.GetOk("attributes"); ok { attributes := v.(*schema.Set).List() if len(attributes) > 0 { debugLog("ldap_object_attributes::create - object %q updated with %d additional attributes", dn, len(attributes)) m := make(map[string][]string) for _, attribute := range attributes { debugLog("ldap_object_attributes::create - %q has attribute of type %T", dn, attribute) // each map should only have one entry (see resource declaration) for name, value := range attribute.(map[string]interface{}) { debugLog("ldap_object_attributes::create - %q has attribute[%v] => %v (%T)", dn, name, value, value) v := toAttributeValue(name, value.(string)) m[name] = append(m[name], v) } } // now loop through the map and add attributes with theys value(s) for name, values := range m { request.Add(name, values) } } } err := client.Modify(request) if err != nil { return err } debugLog("ldap_object_attributes::create - object %q updated with additional attributes", dn) return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesRead(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::read - looking for object %q", dn) // when searching by DN, you don't need t specify the base DN a search // filter a "subtree" scope: just put the DN (i.e. the primary key) as the // base DN with a "base object" scope, and the returned object will be the // entry, if it exists request := ldap.NewSearchRequest( dn, ldap.ScopeBaseObject, ldap.NeverDerefAliases, 0, 0, false, "(objectclass=*)", []string{"*"}, nil, ) sr, err := client.Search(request) if err != nil { if err, ok := err.(*ldap.Error); ok { if err.ResultCode == 32 { // no such object warnLog("ldap_object_attributes::read - object not found, removing %q from state because it no longer exists in LDAP", dn) d.SetId("") } } debugLog("ldap_object_attributes::read - lookup for %q returned an error %v", dn, err) return err } debugLog("ldap_object_attributes::read - query for %q returned %v", dn, sr) // Let's transform the attributes from LDAP into a set that we can intersect // with our resources sets. ldapSet := &schema.Set{ F: attributeHash, } for _, attribute := range sr.Entries[0].Attributes { debugLog("ldap_object_attributes::read - adding attribute %q to %q (%d values)", attribute.Name, dn, len(attribute.Values)) if len(attribute.Values) == 1 { // we don't treat the RDN as an ordinary attribute a := fmt.Sprintf("%s=%s", attribute.Name, attribute.Values[0]) if strings.HasPrefix(dn, a) { debugLog("ldap_object_attributes::read - skipping RDN %q of %q", a, dn) continue } } // now add each value as an individual entry into the object, because // we do not handle name => []values, and we have a set of maps each // holding a single entry name => value; multiple maps may share the // same key. for _, value := range attribute.Values { debugLog("ldap_object_attributes::read - for %q from ldap, setting %q => %q", dn, attribute.Name, value) ldapSet.Add(map[string]interface{}{ attribute.Name: value, }) } } debugLog("ldap_object_attributes::read - attributes from ldap of %q => %v", dn, ldapSet.List()) // We are both interested in the attributes before and after changes, so // depending on what is available, let's compute the union var ( oldSet *schema.Set newSet *schema.Set unionSet *schema.Set ) if d.HasChange("attributes") { prev, next := d.GetChange("attributes") oldSet = prev.(*schema.Set) newSet = next.(*schema.Set) } else { newSet = d.Get("attributes").(*schema.Set) } debugLog("ldap_object_attributes::read - newSet of %q => %v", dn, newSet.List()) if oldSet != nil { debugLog("ldap_object_attributes::read - oldSet of %q => %v", dn, oldSet.List()) unionSet = oldSet.Union(newSet) } else { unionSet = newSet } debugLog("ldap_object_attributes::read - union of %q => %v", dn, unionSet.List()) // Now that we both have union of relevant terraform states and ldap, let's // get the intersection and set it. set := unionSet.Intersection(ldapSet) debugLog("ldap_object_attributes::read - intersection with ldap of %q => %v", dn, set.List()) // If the set is empty the attributes do not exist, yet. if set.Len() == 0 { d.SetId("") return nil } // The set contains values, let's set them and indicate that the object // exists by setting the id as well. if err := d.Set("attributes", set); err != nil { warnLog("ldap_object_attributes::read - error setting attributes for %q : %v", dn, err) return err } d.SetId(dn) return nil } func resourceLDAPObjectAttributesUpdate(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::update - performing update on %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) if d.HasChange("attributes") { o, n := d.GetChange("attributes") debugLog("ldap_object_attributes::update - \n%s", printAttributes("old attributes map", o)) debugLog("ldap_object_attributes::update - \n%s", printAttributes("new attributes map", n)) err := computeAndAddAttributeDeltas(modify, o.(*schema.Set), n.(*schema.Set)) if err != nil { return err } } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil { errorLog("ldap_object_attributes::update - error modifying LDAP object %q with values %v", d.Id(), err) return err } } else { warnLog("ldap_object_attributes::update - didn't actually make changes to %q because there were no changes requested", dn) } return resourceLDAPObjectAttributesRead(d, meta) } func resourceLDAPObjectAttributesDelete(d *schema.ResourceData, meta interface{}) error { client := meta.(*ldap.Conn) dn := d.Get("dn").(string) debugLog("ldap_object_attributes::delete - removing attributes from %q", dn) modify := ldap.NewModifyRequest(dn, []ldap.Control{}) err := computeAndAddAttributeDeltas(modify, d.Get("attributes").(*schema.Set), &schema.Set{ F: attributeHash, }) if err != nil { return err } if len(modify.Changes) > 0 { err := client.Modify(modify) if err != nil { errorLog("ldap_object_attributes::delete - error modifying LDAP object %q with values %v", d.Id(), err) return err } } else { warnLog("ldap_object_attributes::delete - didn't actually make changes to %q because there were no changes requested", dn) } debugLog("ldap_object::delete - %q removed", dn) return nil } func computeAndAddAttributeDeltas(modify *ldap.ModifyRequest, os, ns *schema.Set) error { ra := os.Difference(ns) // removed attributes rk := util.NewSet() // names of removed attributes for _, v := range ra.List() { for k := range v.(map[string]interface{}) { rk.Add(k) } } aa := ns.Difference(os) // added attributes ak := util.NewSet() // names of added attributes for _, v := range aa.List() { for k := range v.(map[string]interface{}) { ak.Add(k) } } // loop over remove attributes' names for _, k := range rk.List() { values := []string{} for _, m := range ra.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Delete(k, values) debugLog("ldap_object_attributes::deltas - removing attribute %q with values %v", k, values) } for _, k := range ak.List() { values := []string{} for _, m := range aa.List() { for mk, mv := range m.(map[string]interface{}) { if k == mk { v := toAttributeValue(k, mv.(string)) values = append(values, v) } } } modify.Add(k, values) debugLog("ldap_object_attributes::deltas - adding new attribute %q with values %v", k, values) } return nil }
resourceLDAPObjectAttributesCreate
identifier_name
mod.rs
use std::cell::RefCell; use std::collections::HashSet; use std::collections::hash_map::HashMap; use std::fmt; use std::rc::Rc; use semver; use core::{PackageId, Registry, SourceId, Summary, Dependency}; use core::PackageIdSpec; use util::{CargoResult, Graph, human, ChainError, CargoError}; use util::profile; use util::graph::{Nodes, Edges}; pub use self::encode::{EncodableResolve, EncodableDependency, EncodablePackageId}; pub use self::encode::Metadata; mod encode; /// Represents a fully resolved package dependency graph. Each node in the graph /// is a package and edges represent dependencies between packages. /// /// Each instance of `Resolve` also understands the full set of features used /// for each package as well as what the root package is. #[derive(PartialEq, Eq, Clone)] pub struct Resolve { graph: Graph<PackageId>, features: HashMap<PackageId, HashSet<String>>, root: PackageId, metadata: Option<Metadata>, } #[derive(Clone, Copy)] pub enum Method<'a> { Everything, Required{ dev_deps: bool, features: &'a [String], uses_default_features: bool, target_platform: Option<&'a str>}, } impl Resolve { fn new(root: PackageId) -> Resolve { let mut g = Graph::new(); g.add(root.clone(), &[]); Resolve { graph: g, root: root, features: HashMap::new(), metadata: None } } pub fn copy_metadata(&mut self, other: &Resolve) { self.metadata = other.metadata.clone(); } pub fn iter(&self) -> Nodes<PackageId> { self.graph.iter() } pub fn root(&self) -> &PackageId { &self.root } pub fn deps(&self, pkg: &PackageId) -> Option<Edges<PackageId>> { self.graph.edges(pkg) } pub fn query(&self, spec: &str) -> CargoResult<&PackageId> { let spec = try!(PackageIdSpec::parse(spec).chain_error(|| { human(format!("invalid package id specification: `{}`", spec)) })); let mut ids = self.iter().filter(|p| spec.matches(*p)); let ret = match ids.next() { Some(id) => id, None => return Err(human(format!("package id specification `{}` \ matched no packages", spec))), }; return match ids.next() { Some(other) => { let mut msg = format!("There are multiple `{}` packages in \ your project, and the specification \ `{}` is ambiguous.\n\ Please re-run this command \ with `-p <spec>` where `<spec>` is one \ of the following:", spec.name(), spec); let mut vec = vec![ret, other]; vec.extend(ids); minimize(&mut msg, vec, &spec); Err(human(msg)) } None => Ok(ret) }; fn minimize(msg: &mut String, ids: Vec<&PackageId>, spec: &PackageIdSpec) { let mut version_cnt = HashMap::new(); for id in ids.iter() { *version_cnt.entry(id.version()).or_insert(0) += 1; } for id in ids.iter() { if version_cnt[id.version()] == 1 { msg.push_str(&format!("\n {}:{}", spec.name(), id.version())); } else { msg.push_str(&format!("\n {}", PackageIdSpec::from_package_id(*id))); } } } } pub fn features(&self, pkg: &PackageId) -> Option<&HashSet<String>>
} impl fmt::Debug for Resolve { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { try!(write!(fmt, "graph: {:?}\n", self.graph)); try!(write!(fmt, "\nfeatures: {{\n")); for (pkg, features) in &self.features { try!(write!(fmt, " {}: {:?}\n", pkg, features)); } write!(fmt, "}}") } } #[derive(Clone)] struct Context { activations: HashMap<(String, SourceId), Vec<Rc<Summary>>>, resolve: Resolve, visited: Rc<RefCell<HashSet<PackageId>>>, } /// Builds the list of all packages required to build the first argument. pub fn resolve(summary: &Summary, method: Method, registry: &mut Registry) -> CargoResult<Resolve> { trace!("resolve; summary={}", summary.package_id()); let summary = Rc::new(summary.clone()); let cx = Box::new(Context { resolve: Resolve::new(summary.package_id().clone()), activations: HashMap::new(), visited: Rc::new(RefCell::new(HashSet::new())), }); let _p = profile::start(format!("resolving: {}", summary.package_id())); match try!(activate(cx, registry, &summary, method)) { Ok(cx) => { debug!("resolved: {:?}", cx.resolve); Ok(cx.resolve) } Err(e) => Err(e), } } fn activate(mut cx: Box<Context>, registry: &mut Registry, parent: &Rc<Summary>, method: Method) -> CargoResult<CargoResult<Box<Context>>> { // Dependency graphs are required to be a DAG, so we keep a set of // packages we're visiting and bail if we hit a dupe. let id = parent.package_id(); if !cx.visited.borrow_mut().insert(id.clone()) { return Err(human(format!("cyclic package dependency: package `{}` \ depends on itself", id))) } // If we're already activated, then that was easy! if flag_activated(&mut *cx, parent, &method) { cx.visited.borrow_mut().remove(id); return Ok(Ok(cx)) } debug!("activating {}", parent.package_id()); // Extracting the platform request. let platform = match method { Method::Required{target_platform: platform, ..} => platform, Method::Everything => None, }; // First, figure out our set of dependencies based on the requsted set of // features. This also calculates what features we're going to enable for // our own dependencies. let deps = try!(resolve_features(&mut cx, parent, method)); // Next, transform all dependencies into a list of possible candidates which // can satisfy that dependency. let mut deps = try!(deps.into_iter().map(|(_dep_name, (dep, features))| { let mut candidates = try!(registry.query(dep)); // When we attempt versions for a package, we'll want to start at the // maximum version and work our way down. candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); let candidates = candidates.into_iter().map(Rc::new).collect::<Vec<_>>(); Ok((dep, candidates, features)) }).collect::<CargoResult<Vec<_>>>()); // When we recurse, attempt to resolve dependencies with fewer candidates // before recursing on dependencies with more candidates. This way if the // dependency with only one candidate can't be resolved we don't have to do // a bunch of work before we figure that out. deps.sort_by(|&(_, ref a, _), &(_, ref b, _)| { a.len().cmp(&b.len()) }); // Workaround compilation error: `deps` does not live long enough let platform = platform.map(|s| &*s); Ok(match try!(activate_deps(cx, registry, parent, platform, &deps, 0)) { Ok(cx) => { cx.visited.borrow_mut().remove(parent.package_id()); Ok(cx) } Err(e) => Err(e), }) } // Activate this summary by inserting it into our list of known activations. // // Returns if this summary with the given method is already activated. fn flag_activated(cx: &mut Context, summary: &Rc<Summary>, method: &Method) -> bool { let id = summary.package_id(); let key = (id.name().to_string(), id.source_id().clone()); let prev = cx.activations.entry(key).or_insert(Vec::new()); if !prev.iter().any(|c| c == summary) { cx.resolve.graph.add(id.clone(), &[]); prev.push(summary.clone()); return false } debug!("checking if {} is already activated", summary.package_id()); let (features, use_default) = match *method { Method::Required { features, uses_default_features, .. } => { (features, uses_default_features) } Method::Everything => return false, }; let has_default_feature = summary.features().contains_key("default"); match cx.resolve.features(id) { Some(prev) => { features.iter().all(|f| prev.contains(f)) && (!use_default || prev.contains("default") || !has_default_feature) } None => features.len() == 0 && (!use_default || !has_default_feature) } } fn activate_deps<'a>(cx: Box<Context>, registry: &mut Registry, parent: &Summary, platform: Option<&'a str>, deps: &'a [(&Dependency, Vec<Rc<Summary>>, Vec<String>)], cur: usize) -> CargoResult<CargoResult<Box<Context>>> { if cur == deps.len() { return Ok(Ok(cx)) } let (dep, ref candidates, ref features) = deps[cur]; let method = Method::Required{ dev_deps: false, features: &features, uses_default_features: dep.uses_default_features(), target_platform: platform}; let key = (dep.name().to_string(), dep.source_id().clone()); let prev_active = cx.activations.get(&key) .map(|v| &v[..]).unwrap_or(&[]); trace!("{}[{}]>{} {} candidates", parent.name(), cur, dep.name(), candidates.len()); trace!("{}[{}]>{} {} prev activations", parent.name(), cur, dep.name(), prev_active.len()); // Filter the set of candidates based on the previously activated // versions for this dependency. We can actually use a version if it // precisely matches an activated version or if it is otherwise // incompatible with all other activated versions. Note that we define // "compatible" here in terms of the semver sense where if the left-most // nonzero digit is the same they're considered compatible. let my_candidates = candidates.iter().filter(|&b| { prev_active.iter().any(|a| a == b) || prev_active.iter().all(|a| { !compatible(a.version(), b.version()) }) }); // Alright, for each candidate that's gotten this far, it meets the // following requirements: // // 1. The version matches the dependency requirement listed for this // package // 2. There are no activated versions for this package which are // semver-compatible, or there's an activated version which is // precisely equal to `candidate`. // // This means that we're going to attempt to activate each candidate in // turn. We could possibly fail to activate each candidate, so we try // each one in turn. let mut last_err = None; for candidate in my_candidates { trace!("{}[{}]>{} trying {}", parent.name(), cur, dep.name(), candidate.version()); let mut my_cx = cx.clone(); my_cx.resolve.graph.link(parent.package_id().clone(), candidate.package_id().clone()); // If we hit an intransitive dependency then clear out the visitation // list as we can't induce a cycle through transitive dependencies. if !dep.is_transitive() { my_cx.visited.borrow_mut().clear(); } let my_cx = match try!(activate(my_cx, registry, candidate, method)) { Ok(cx) => cx, Err(e) => { last_err = Some(e); continue } }; match try!(activate_deps(my_cx, registry, parent, platform, deps, cur + 1)) { Ok(cx) => return Ok(Ok(cx)), Err(e) => { last_err = Some(e); } } } trace!("{}[{}]>{} -- {:?}", parent.name(), cur, dep.name(), last_err); // Oh well, we couldn't activate any of the candidates, so we just can't // activate this dependency at all Ok(activation_error(&cx, registry, last_err, parent, dep, prev_active, &candidates)) } fn activation_error(cx: &Context, registry: &mut Registry, err: Option<Box<CargoError>>, parent: &Summary, dep: &Dependency, prev_active: &[Rc<Summary>], candidates: &[Rc<Summary>]) -> CargoResult<Box<Context>> { match err { Some(e) => return Err(e), None => {} } if candidates.len() > 0 { let mut msg = format!("failed to select a version for `{}` \ (required by `{}`):\n\ all possible versions conflict with \ previously selected versions of `{}`", dep.name(), parent.name(), dep.name()); 'outer: for v in prev_active.iter() { for node in cx.resolve.graph.iter() { let edges = match cx.resolve.graph.edges(node) { Some(edges) => edges, None => continue, }; for edge in edges { if edge != v.package_id() { continue } msg.push_str(&format!("\n version {} in use by {}", v.version(), edge)); continue 'outer; } } msg.push_str(&format!("\n version {} in use by ??", v.version())); } msg.push_str(&format!("\n possible versions to select: {}", candidates.iter() .map(|v| v.version()) .map(|v| v.to_string()) .collect::<Vec<_>>() .connect(", "))); return Err(human(msg)) } // Once we're all the way down here, we're definitely lost in the // weeds! We didn't actually use any candidates above, so we need to // give an error message that nothing was found. // // Note that we re-query the registry with a new dependency that // allows any version so we can give some nicer error reporting // which indicates a few versions that were actually found. let msg = format!("no matching package named `{}` found \ (required by `{}`)\n\ location searched: {}\n\ version required: {}", dep.name(), parent.name(), dep.source_id(), dep.version_req()); let mut msg = msg; let all_req = semver::VersionReq::parse("*").unwrap(); let new_dep = dep.clone().set_version_req(all_req); let mut candidates = try!(registry.query(&new_dep)); candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); if candidates.len() > 0 { msg.push_str("\nversions found: "); for (i, c) in candidates.iter().take(3).enumerate() { if i != 0 { msg.push_str(", "); } msg.push_str(&c.version().to_string()); } if candidates.len() > 3 { msg.push_str(", ..."); } } // If we have a path dependency with a locked version, then this may // indicate that we updated a sub-package and forgot to run `cargo // update`. In this case try to print a helpful error! if dep.source_id().is_path() && dep.version_req().to_string().starts_with("=") && candidates.len() > 0 { msg.push_str("\nconsider running `cargo update` to update \ a path dependency's locked version"); } Err(human(msg)) } // Returns if `a` and `b` are compatible in the semver sense. This is a // commutative operation. // // Versions `a` and `b` are compatible if their left-most nonzero digit is the // same. fn compatible(a: &semver::Version, b: &semver::Version) -> bool { if a.major != b.major { return false } if a.major != 0 { return true } if a.minor != b.minor { return false } if a.minor != 0 { return true } a.patch == b.patch } fn resolve_features<'a>(cx: &mut Context, parent: &'a Summary, method: Method) -> CargoResult<HashMap<&'a str, (&'a Dependency, Vec<String>)>> { let dev_deps = match method { Method::Everything => true, Method::Required { dev_deps, .. } => dev_deps, }; // First, filter by dev-dependencies let deps = parent.dependencies(); let deps = deps.iter().filter(|d| d.is_transitive() || dev_deps); // Second, ignoring dependencies that should not be compiled for this platform let deps = deps.filter(|d| { match method { Method::Required{target_platform: Some(ref platform), ..} => { d.is_active_for_platform(platform) }, _ => true } }); let (mut feature_deps, used_features) = try!(build_features(parent, method)); let mut ret = HashMap::new(); // Next, sanitize all requested features by whitelisting all the requested // features that correspond to optional dependencies for dep in deps { // weed out optional dependencies, but not those required if dep.is_optional() && !feature_deps.contains_key(dep.name()) { continue } let mut base = feature_deps.remove(dep.name()).unwrap_or(vec![]); for feature in dep.features().iter() { base.push(feature.clone()); if feature.contains("/") { return Err(human(format!("features in dependencies \ cannot enable features in \ other dependencies: `{}`", feature))); } } ret.insert(dep.name(), (dep, base)); } // All features can only point to optional dependencies, in which case they // should have all been weeded out by the above iteration. Any remaining // features are bugs in that the package does not actually have those // features. if feature_deps.len() > 0 { let unknown = feature_deps.keys().map(|s| &s[..]) .collect::<Vec<&str>>(); if unknown.len() > 0 { let features = unknown.connect(", "); return Err(human(format!("Package `{}` does not have these features: \ `{}`", parent.package_id(), features))) } } // Record what list of features is active for this package. if used_features.len() > 0 { let pkgid = parent.package_id(); cx.resolve.features.entry(pkgid.clone()) .or_insert(HashSet::new()) .extend(used_features); } Ok(ret) } // Returns a pair of (feature dependencies, all used features) // // The feature dependencies map is a mapping of package name to list of features // enabled. Each package should be enabled, and each package should have the // specified set of features enabled. // // The all used features set is the set of features which this local package had // enabled, which is later used when compiling to instruct the code what // features were enabled. fn build_features(s: &Summary, method: Method) -> CargoResult<(HashMap<String, Vec<String>>, HashSet<String>)> { let mut deps = HashMap::new(); let mut used = HashSet::new(); let mut visited = HashSet::new(); match method { Method::Everything => { for key in s.features().keys() { try!(add_feature(s, key, &mut deps, &mut used, &mut visited)); } for dep in s.dependencies().iter().filter(|d| d.is_optional()) { try!(add_feature(s, dep.name(), &mut deps, &mut used, &mut visited)); } } Method::Required{features: requested_features, ..} => { for feat in requested_features.iter() { try!(add_feature(s, feat, &mut deps, &mut used, &mut visited)); } } } match method { Method::Everything | Method::Required { uses_default_features: true, .. } => { if s.features().get("default").is_some() { try!(add_feature(s, "default", &mut deps, &mut used, &mut visited)); } } Method::Required { uses_default_features: false, .. } => {} } return Ok((deps, used)); fn add_feature(s: &Summary, feat: &str, deps: &mut HashMap<String, Vec<String>>, used: &mut HashSet<String>, visited: &mut HashSet<String>) -> CargoResult<()> { if feat.is_empty() { return Ok(()) } // If this feature is of the form `foo/bar`, then we just lookup package // `foo` and enable its feature `bar`. Otherwise this feature is of the // form `foo` and we need to recurse to enable the feature `foo` for our // own package, which may end up enabling more features or just enabling // a dependency. let mut parts = feat.splitn(2, '/'); let feat_or_package = parts.next().unwrap(); match parts.next() { Some(feat) => { let package = feat_or_package; deps.entry(package.to_string()) .or_insert(Vec::new()) .push(feat.to_string()); } None => { let feat = feat_or_package; if !visited.insert(feat.to_string()) { return Err(human(format!("Cyclic feature dependency: \ feature `{}` depends on itself", feat))) } used.insert(feat.to_string()); match s.features().get(feat) { Some(recursive) => { for f in recursive { try!(add_feature(s, f, deps, used, visited)); } } None => { deps.entry(feat.to_string()).or_insert(Vec::new()); } } visited.remove(&feat.to_string()); } } Ok(()) } }
{ self.features.get(pkg) }
identifier_body
mod.rs
use std::cell::RefCell; use std::collections::HashSet; use std::collections::hash_map::HashMap; use std::fmt; use std::rc::Rc; use semver; use core::{PackageId, Registry, SourceId, Summary, Dependency}; use core::PackageIdSpec; use util::{CargoResult, Graph, human, ChainError, CargoError}; use util::profile; use util::graph::{Nodes, Edges}; pub use self::encode::{EncodableResolve, EncodableDependency, EncodablePackageId}; pub use self::encode::Metadata; mod encode; /// Represents a fully resolved package dependency graph. Each node in the graph /// is a package and edges represent dependencies between packages. /// /// Each instance of `Resolve` also understands the full set of features used /// for each package as well as what the root package is. #[derive(PartialEq, Eq, Clone)] pub struct Resolve { graph: Graph<PackageId>, features: HashMap<PackageId, HashSet<String>>, root: PackageId, metadata: Option<Metadata>, } #[derive(Clone, Copy)] pub enum Method<'a> { Everything, Required{ dev_deps: bool, features: &'a [String], uses_default_features: bool, target_platform: Option<&'a str>}, } impl Resolve { fn new(root: PackageId) -> Resolve { let mut g = Graph::new(); g.add(root.clone(), &[]); Resolve { graph: g, root: root, features: HashMap::new(), metadata: None } } pub fn copy_metadata(&mut self, other: &Resolve) { self.metadata = other.metadata.clone(); } pub fn iter(&self) -> Nodes<PackageId> { self.graph.iter() } pub fn root(&self) -> &PackageId { &self.root } pub fn deps(&self, pkg: &PackageId) -> Option<Edges<PackageId>> { self.graph.edges(pkg) } pub fn query(&self, spec: &str) -> CargoResult<&PackageId> { let spec = try!(PackageIdSpec::parse(spec).chain_error(|| { human(format!("invalid package id specification: `{}`", spec)) })); let mut ids = self.iter().filter(|p| spec.matches(*p)); let ret = match ids.next() { Some(id) => id, None => return Err(human(format!("package id specification `{}` \ matched no packages", spec))), }; return match ids.next() { Some(other) => { let mut msg = format!("There are multiple `{}` packages in \ your project, and the specification \ `{}` is ambiguous.\n\ Please re-run this command \ with `-p <spec>` where `<spec>` is one \ of the following:", spec.name(), spec); let mut vec = vec![ret, other]; vec.extend(ids); minimize(&mut msg, vec, &spec); Err(human(msg)) } None => Ok(ret) }; fn minimize(msg: &mut String, ids: Vec<&PackageId>, spec: &PackageIdSpec) { let mut version_cnt = HashMap::new(); for id in ids.iter() { *version_cnt.entry(id.version()).or_insert(0) += 1; } for id in ids.iter() { if version_cnt[id.version()] == 1 { msg.push_str(&format!("\n {}:{}", spec.name(), id.version())); } else { msg.push_str(&format!("\n {}", PackageIdSpec::from_package_id(*id))); } } } } pub fn features(&self, pkg: &PackageId) -> Option<&HashSet<String>> { self.features.get(pkg) } } impl fmt::Debug for Resolve { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { try!(write!(fmt, "graph: {:?}\n", self.graph)); try!(write!(fmt, "\nfeatures: {{\n")); for (pkg, features) in &self.features { try!(write!(fmt, " {}: {:?}\n", pkg, features)); } write!(fmt, "}}") } } #[derive(Clone)] struct Context { activations: HashMap<(String, SourceId), Vec<Rc<Summary>>>, resolve: Resolve, visited: Rc<RefCell<HashSet<PackageId>>>, } /// Builds the list of all packages required to build the first argument. pub fn resolve(summary: &Summary, method: Method, registry: &mut Registry) -> CargoResult<Resolve> { trace!("resolve; summary={}", summary.package_id()); let summary = Rc::new(summary.clone()); let cx = Box::new(Context { resolve: Resolve::new(summary.package_id().clone()), activations: HashMap::new(), visited: Rc::new(RefCell::new(HashSet::new())), }); let _p = profile::start(format!("resolving: {}", summary.package_id())); match try!(activate(cx, registry, &summary, method)) { Ok(cx) => { debug!("resolved: {:?}", cx.resolve); Ok(cx.resolve) } Err(e) => Err(e), } } fn activate(mut cx: Box<Context>, registry: &mut Registry, parent: &Rc<Summary>, method: Method) -> CargoResult<CargoResult<Box<Context>>> { // Dependency graphs are required to be a DAG, so we keep a set of // packages we're visiting and bail if we hit a dupe. let id = parent.package_id(); if !cx.visited.borrow_mut().insert(id.clone()) { return Err(human(format!("cyclic package dependency: package `{}` \ depends on itself", id))) } // If we're already activated, then that was easy! if flag_activated(&mut *cx, parent, &method) { cx.visited.borrow_mut().remove(id); return Ok(Ok(cx)) } debug!("activating {}", parent.package_id()); // Extracting the platform request. let platform = match method { Method::Required{target_platform: platform, ..} => platform, Method::Everything => None, }; // First, figure out our set of dependencies based on the requsted set of // features. This also calculates what features we're going to enable for // our own dependencies. let deps = try!(resolve_features(&mut cx, parent, method)); // Next, transform all dependencies into a list of possible candidates which // can satisfy that dependency. let mut deps = try!(deps.into_iter().map(|(_dep_name, (dep, features))| { let mut candidates = try!(registry.query(dep)); // When we attempt versions for a package, we'll want to start at the // maximum version and work our way down. candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); let candidates = candidates.into_iter().map(Rc::new).collect::<Vec<_>>(); Ok((dep, candidates, features)) }).collect::<CargoResult<Vec<_>>>()); // When we recurse, attempt to resolve dependencies with fewer candidates // before recursing on dependencies with more candidates. This way if the // dependency with only one candidate can't be resolved we don't have to do // a bunch of work before we figure that out. deps.sort_by(|&(_, ref a, _), &(_, ref b, _)| { a.len().cmp(&b.len()) }); // Workaround compilation error: `deps` does not live long enough let platform = platform.map(|s| &*s); Ok(match try!(activate_deps(cx, registry, parent, platform, &deps, 0)) { Ok(cx) => { cx.visited.borrow_mut().remove(parent.package_id()); Ok(cx) } Err(e) => Err(e), }) } // Activate this summary by inserting it into our list of known activations. // // Returns if this summary with the given method is already activated. fn flag_activated(cx: &mut Context, summary: &Rc<Summary>, method: &Method) -> bool { let id = summary.package_id(); let key = (id.name().to_string(), id.source_id().clone()); let prev = cx.activations.entry(key).or_insert(Vec::new()); if !prev.iter().any(|c| c == summary) { cx.resolve.graph.add(id.clone(), &[]); prev.push(summary.clone()); return false } debug!("checking if {} is already activated", summary.package_id()); let (features, use_default) = match *method { Method::Required { features, uses_default_features, .. } => { (features, uses_default_features) } Method::Everything => return false, }; let has_default_feature = summary.features().contains_key("default"); match cx.resolve.features(id) { Some(prev) => { features.iter().all(|f| prev.contains(f)) && (!use_default || prev.contains("default") || !has_default_feature) } None => features.len() == 0 && (!use_default || !has_default_feature) } } fn activate_deps<'a>(cx: Box<Context>, registry: &mut Registry, parent: &Summary, platform: Option<&'a str>, deps: &'a [(&Dependency, Vec<Rc<Summary>>, Vec<String>)], cur: usize) -> CargoResult<CargoResult<Box<Context>>> { if cur == deps.len() { return Ok(Ok(cx)) } let (dep, ref candidates, ref features) = deps[cur]; let method = Method::Required{ dev_deps: false, features: &features, uses_default_features: dep.uses_default_features(), target_platform: platform}; let key = (dep.name().to_string(), dep.source_id().clone()); let prev_active = cx.activations.get(&key) .map(|v| &v[..]).unwrap_or(&[]); trace!("{}[{}]>{} {} candidates", parent.name(), cur, dep.name(), candidates.len()); trace!("{}[{}]>{} {} prev activations", parent.name(), cur, dep.name(), prev_active.len()); // Filter the set of candidates based on the previously activated // versions for this dependency. We can actually use a version if it // precisely matches an activated version or if it is otherwise // incompatible with all other activated versions. Note that we define // "compatible" here in terms of the semver sense where if the left-most // nonzero digit is the same they're considered compatible. let my_candidates = candidates.iter().filter(|&b| { prev_active.iter().any(|a| a == b) || prev_active.iter().all(|a| { !compatible(a.version(), b.version()) }) }); // Alright, for each candidate that's gotten this far, it meets the // following requirements: // // 1. The version matches the dependency requirement listed for this // package // 2. There are no activated versions for this package which are // semver-compatible, or there's an activated version which is // precisely equal to `candidate`. // // This means that we're going to attempt to activate each candidate in // turn. We could possibly fail to activate each candidate, so we try // each one in turn. let mut last_err = None; for candidate in my_candidates { trace!("{}[{}]>{} trying {}", parent.name(), cur, dep.name(), candidate.version()); let mut my_cx = cx.clone(); my_cx.resolve.graph.link(parent.package_id().clone(), candidate.package_id().clone()); // If we hit an intransitive dependency then clear out the visitation // list as we can't induce a cycle through transitive dependencies. if !dep.is_transitive() { my_cx.visited.borrow_mut().clear(); } let my_cx = match try!(activate(my_cx, registry, candidate, method)) { Ok(cx) => cx, Err(e) => { last_err = Some(e); continue } }; match try!(activate_deps(my_cx, registry, parent, platform, deps, cur + 1)) { Ok(cx) => return Ok(Ok(cx)), Err(e) => { last_err = Some(e); } } } trace!("{}[{}]>{} -- {:?}", parent.name(), cur, dep.name(), last_err); // Oh well, we couldn't activate any of the candidates, so we just can't // activate this dependency at all Ok(activation_error(&cx, registry, last_err, parent, dep, prev_active, &candidates)) } fn activation_error(cx: &Context, registry: &mut Registry, err: Option<Box<CargoError>>, parent: &Summary, dep: &Dependency, prev_active: &[Rc<Summary>], candidates: &[Rc<Summary>]) -> CargoResult<Box<Context>> { match err { Some(e) => return Err(e), None => {} } if candidates.len() > 0 { let mut msg = format!("failed to select a version for `{}` \ (required by `{}`):\n\ all possible versions conflict with \ previously selected versions of `{}`", dep.name(), parent.name(), dep.name()); 'outer: for v in prev_active.iter() { for node in cx.resolve.graph.iter() { let edges = match cx.resolve.graph.edges(node) { Some(edges) => edges, None => continue, }; for edge in edges { if edge != v.package_id() { continue } msg.push_str(&format!("\n version {} in use by {}", v.version(), edge)); continue 'outer; } } msg.push_str(&format!("\n version {} in use by ??", v.version())); } msg.push_str(&format!("\n possible versions to select: {}", candidates.iter() .map(|v| v.version()) .map(|v| v.to_string()) .collect::<Vec<_>>() .connect(", "))); return Err(human(msg)) } // Once we're all the way down here, we're definitely lost in the // weeds! We didn't actually use any candidates above, so we need to // give an error message that nothing was found. // // Note that we re-query the registry with a new dependency that // allows any version so we can give some nicer error reporting // which indicates a few versions that were actually found. let msg = format!("no matching package named `{}` found \ (required by `{}`)\n\ location searched: {}\n\ version required: {}", dep.name(), parent.name(), dep.source_id(), dep.version_req()); let mut msg = msg; let all_req = semver::VersionReq::parse("*").unwrap(); let new_dep = dep.clone().set_version_req(all_req); let mut candidates = try!(registry.query(&new_dep)); candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); if candidates.len() > 0 { msg.push_str("\nversions found: "); for (i, c) in candidates.iter().take(3).enumerate() { if i != 0 { msg.push_str(", "); } msg.push_str(&c.version().to_string()); } if candidates.len() > 3 { msg.push_str(", ..."); } } // If we have a path dependency with a locked version, then this may // indicate that we updated a sub-package and forgot to run `cargo // update`. In this case try to print a helpful error! if dep.source_id().is_path() && dep.version_req().to_string().starts_with("=") && candidates.len() > 0 { msg.push_str("\nconsider running `cargo update` to update \ a path dependency's locked version"); } Err(human(msg)) } // Returns if `a` and `b` are compatible in the semver sense. This is a // commutative operation. // // Versions `a` and `b` are compatible if their left-most nonzero digit is the // same. fn compatible(a: &semver::Version, b: &semver::Version) -> bool { if a.major != b.major { return false } if a.major != 0 { return true } if a.minor != b.minor { return false } if a.minor != 0 { return true } a.patch == b.patch } fn resolve_features<'a>(cx: &mut Context, parent: &'a Summary, method: Method) -> CargoResult<HashMap<&'a str, (&'a Dependency, Vec<String>)>> { let dev_deps = match method { Method::Everything => true, Method::Required { dev_deps, .. } => dev_deps, }; // First, filter by dev-dependencies let deps = parent.dependencies(); let deps = deps.iter().filter(|d| d.is_transitive() || dev_deps); // Second, ignoring dependencies that should not be compiled for this platform let deps = deps.filter(|d| { match method { Method::Required{target_platform: Some(ref platform), ..} => { d.is_active_for_platform(platform) }, _ => true } }); let (mut feature_deps, used_features) = try!(build_features(parent, method)); let mut ret = HashMap::new(); // Next, sanitize all requested features by whitelisting all the requested // features that correspond to optional dependencies for dep in deps { // weed out optional dependencies, but not those required if dep.is_optional() && !feature_deps.contains_key(dep.name()) { continue } let mut base = feature_deps.remove(dep.name()).unwrap_or(vec![]); for feature in dep.features().iter() { base.push(feature.clone()); if feature.contains("/") { return Err(human(format!("features in dependencies \ cannot enable features in \ other dependencies: `{}`", feature))); } } ret.insert(dep.name(), (dep, base)); } // All features can only point to optional dependencies, in which case they // should have all been weeded out by the above iteration. Any remaining // features are bugs in that the package does not actually have those // features. if feature_deps.len() > 0 { let unknown = feature_deps.keys().map(|s| &s[..]) .collect::<Vec<&str>>(); if unknown.len() > 0 { let features = unknown.connect(", "); return Err(human(format!("Package `{}` does not have these features: \ `{}`", parent.package_id(), features))) } } // Record what list of features is active for this package. if used_features.len() > 0 { let pkgid = parent.package_id(); cx.resolve.features.entry(pkgid.clone()) .or_insert(HashSet::new()) .extend(used_features); } Ok(ret) } // Returns a pair of (feature dependencies, all used features) // // The feature dependencies map is a mapping of package name to list of features // enabled. Each package should be enabled, and each package should have the // specified set of features enabled. // // The all used features set is the set of features which this local package had // enabled, which is later used when compiling to instruct the code what // features were enabled. fn build_features(s: &Summary, method: Method) -> CargoResult<(HashMap<String, Vec<String>>, HashSet<String>)> { let mut deps = HashMap::new(); let mut used = HashSet::new(); let mut visited = HashSet::new(); match method { Method::Everything =>
Method::Required{features: requested_features, ..} => { for feat in requested_features.iter() { try!(add_feature(s, feat, &mut deps, &mut used, &mut visited)); } } } match method { Method::Everything | Method::Required { uses_default_features: true, .. } => { if s.features().get("default").is_some() { try!(add_feature(s, "default", &mut deps, &mut used, &mut visited)); } } Method::Required { uses_default_features: false, .. } => {} } return Ok((deps, used)); fn add_feature(s: &Summary, feat: &str, deps: &mut HashMap<String, Vec<String>>, used: &mut HashSet<String>, visited: &mut HashSet<String>) -> CargoResult<()> { if feat.is_empty() { return Ok(()) } // If this feature is of the form `foo/bar`, then we just lookup package // `foo` and enable its feature `bar`. Otherwise this feature is of the // form `foo` and we need to recurse to enable the feature `foo` for our // own package, which may end up enabling more features or just enabling // a dependency. let mut parts = feat.splitn(2, '/'); let feat_or_package = parts.next().unwrap(); match parts.next() { Some(feat) => { let package = feat_or_package; deps.entry(package.to_string()) .or_insert(Vec::new()) .push(feat.to_string()); } None => { let feat = feat_or_package; if !visited.insert(feat.to_string()) { return Err(human(format!("Cyclic feature dependency: \ feature `{}` depends on itself", feat))) } used.insert(feat.to_string()); match s.features().get(feat) { Some(recursive) => { for f in recursive { try!(add_feature(s, f, deps, used, visited)); } } None => { deps.entry(feat.to_string()).or_insert(Vec::new()); } } visited.remove(&feat.to_string()); } } Ok(()) } }
{ for key in s.features().keys() { try!(add_feature(s, key, &mut deps, &mut used, &mut visited)); } for dep in s.dependencies().iter().filter(|d| d.is_optional()) { try!(add_feature(s, dep.name(), &mut deps, &mut used, &mut visited)); } }
conditional_block
mod.rs
use std::cell::RefCell; use std::collections::HashSet; use std::collections::hash_map::HashMap; use std::fmt; use std::rc::Rc; use semver; use core::{PackageId, Registry, SourceId, Summary, Dependency}; use core::PackageIdSpec; use util::{CargoResult, Graph, human, ChainError, CargoError}; use util::profile; use util::graph::{Nodes, Edges}; pub use self::encode::{EncodableResolve, EncodableDependency, EncodablePackageId}; pub use self::encode::Metadata; mod encode; /// Represents a fully resolved package dependency graph. Each node in the graph /// is a package and edges represent dependencies between packages. /// /// Each instance of `Resolve` also understands the full set of features used /// for each package as well as what the root package is. #[derive(PartialEq, Eq, Clone)] pub struct Resolve { graph: Graph<PackageId>, features: HashMap<PackageId, HashSet<String>>, root: PackageId, metadata: Option<Metadata>, } #[derive(Clone, Copy)] pub enum Method<'a> { Everything, Required{ dev_deps: bool, features: &'a [String], uses_default_features: bool, target_platform: Option<&'a str>}, } impl Resolve { fn new(root: PackageId) -> Resolve { let mut g = Graph::new(); g.add(root.clone(), &[]); Resolve { graph: g, root: root, features: HashMap::new(), metadata: None } } pub fn copy_metadata(&mut self, other: &Resolve) { self.metadata = other.metadata.clone(); } pub fn
(&self) -> Nodes<PackageId> { self.graph.iter() } pub fn root(&self) -> &PackageId { &self.root } pub fn deps(&self, pkg: &PackageId) -> Option<Edges<PackageId>> { self.graph.edges(pkg) } pub fn query(&self, spec: &str) -> CargoResult<&PackageId> { let spec = try!(PackageIdSpec::parse(spec).chain_error(|| { human(format!("invalid package id specification: `{}`", spec)) })); let mut ids = self.iter().filter(|p| spec.matches(*p)); let ret = match ids.next() { Some(id) => id, None => return Err(human(format!("package id specification `{}` \ matched no packages", spec))), }; return match ids.next() { Some(other) => { let mut msg = format!("There are multiple `{}` packages in \ your project, and the specification \ `{}` is ambiguous.\n\ Please re-run this command \ with `-p <spec>` where `<spec>` is one \ of the following:", spec.name(), spec); let mut vec = vec![ret, other]; vec.extend(ids); minimize(&mut msg, vec, &spec); Err(human(msg)) } None => Ok(ret) }; fn minimize(msg: &mut String, ids: Vec<&PackageId>, spec: &PackageIdSpec) { let mut version_cnt = HashMap::new(); for id in ids.iter() { *version_cnt.entry(id.version()).or_insert(0) += 1; } for id in ids.iter() { if version_cnt[id.version()] == 1 { msg.push_str(&format!("\n {}:{}", spec.name(), id.version())); } else { msg.push_str(&format!("\n {}", PackageIdSpec::from_package_id(*id))); } } } } pub fn features(&self, pkg: &PackageId) -> Option<&HashSet<String>> { self.features.get(pkg) } } impl fmt::Debug for Resolve { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { try!(write!(fmt, "graph: {:?}\n", self.graph)); try!(write!(fmt, "\nfeatures: {{\n")); for (pkg, features) in &self.features { try!(write!(fmt, " {}: {:?}\n", pkg, features)); } write!(fmt, "}}") } } #[derive(Clone)] struct Context { activations: HashMap<(String, SourceId), Vec<Rc<Summary>>>, resolve: Resolve, visited: Rc<RefCell<HashSet<PackageId>>>, } /// Builds the list of all packages required to build the first argument. pub fn resolve(summary: &Summary, method: Method, registry: &mut Registry) -> CargoResult<Resolve> { trace!("resolve; summary={}", summary.package_id()); let summary = Rc::new(summary.clone()); let cx = Box::new(Context { resolve: Resolve::new(summary.package_id().clone()), activations: HashMap::new(), visited: Rc::new(RefCell::new(HashSet::new())), }); let _p = profile::start(format!("resolving: {}", summary.package_id())); match try!(activate(cx, registry, &summary, method)) { Ok(cx) => { debug!("resolved: {:?}", cx.resolve); Ok(cx.resolve) } Err(e) => Err(e), } } fn activate(mut cx: Box<Context>, registry: &mut Registry, parent: &Rc<Summary>, method: Method) -> CargoResult<CargoResult<Box<Context>>> { // Dependency graphs are required to be a DAG, so we keep a set of // packages we're visiting and bail if we hit a dupe. let id = parent.package_id(); if !cx.visited.borrow_mut().insert(id.clone()) { return Err(human(format!("cyclic package dependency: package `{}` \ depends on itself", id))) } // If we're already activated, then that was easy! if flag_activated(&mut *cx, parent, &method) { cx.visited.borrow_mut().remove(id); return Ok(Ok(cx)) } debug!("activating {}", parent.package_id()); // Extracting the platform request. let platform = match method { Method::Required{target_platform: platform, ..} => platform, Method::Everything => None, }; // First, figure out our set of dependencies based on the requsted set of // features. This also calculates what features we're going to enable for // our own dependencies. let deps = try!(resolve_features(&mut cx, parent, method)); // Next, transform all dependencies into a list of possible candidates which // can satisfy that dependency. let mut deps = try!(deps.into_iter().map(|(_dep_name, (dep, features))| { let mut candidates = try!(registry.query(dep)); // When we attempt versions for a package, we'll want to start at the // maximum version and work our way down. candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); let candidates = candidates.into_iter().map(Rc::new).collect::<Vec<_>>(); Ok((dep, candidates, features)) }).collect::<CargoResult<Vec<_>>>()); // When we recurse, attempt to resolve dependencies with fewer candidates // before recursing on dependencies with more candidates. This way if the // dependency with only one candidate can't be resolved we don't have to do // a bunch of work before we figure that out. deps.sort_by(|&(_, ref a, _), &(_, ref b, _)| { a.len().cmp(&b.len()) }); // Workaround compilation error: `deps` does not live long enough let platform = platform.map(|s| &*s); Ok(match try!(activate_deps(cx, registry, parent, platform, &deps, 0)) { Ok(cx) => { cx.visited.borrow_mut().remove(parent.package_id()); Ok(cx) } Err(e) => Err(e), }) } // Activate this summary by inserting it into our list of known activations. // // Returns if this summary with the given method is already activated. fn flag_activated(cx: &mut Context, summary: &Rc<Summary>, method: &Method) -> bool { let id = summary.package_id(); let key = (id.name().to_string(), id.source_id().clone()); let prev = cx.activations.entry(key).or_insert(Vec::new()); if !prev.iter().any(|c| c == summary) { cx.resolve.graph.add(id.clone(), &[]); prev.push(summary.clone()); return false } debug!("checking if {} is already activated", summary.package_id()); let (features, use_default) = match *method { Method::Required { features, uses_default_features, .. } => { (features, uses_default_features) } Method::Everything => return false, }; let has_default_feature = summary.features().contains_key("default"); match cx.resolve.features(id) { Some(prev) => { features.iter().all(|f| prev.contains(f)) && (!use_default || prev.contains("default") || !has_default_feature) } None => features.len() == 0 && (!use_default || !has_default_feature) } } fn activate_deps<'a>(cx: Box<Context>, registry: &mut Registry, parent: &Summary, platform: Option<&'a str>, deps: &'a [(&Dependency, Vec<Rc<Summary>>, Vec<String>)], cur: usize) -> CargoResult<CargoResult<Box<Context>>> { if cur == deps.len() { return Ok(Ok(cx)) } let (dep, ref candidates, ref features) = deps[cur]; let method = Method::Required{ dev_deps: false, features: &features, uses_default_features: dep.uses_default_features(), target_platform: platform}; let key = (dep.name().to_string(), dep.source_id().clone()); let prev_active = cx.activations.get(&key) .map(|v| &v[..]).unwrap_or(&[]); trace!("{}[{}]>{} {} candidates", parent.name(), cur, dep.name(), candidates.len()); trace!("{}[{}]>{} {} prev activations", parent.name(), cur, dep.name(), prev_active.len()); // Filter the set of candidates based on the previously activated // versions for this dependency. We can actually use a version if it // precisely matches an activated version or if it is otherwise // incompatible with all other activated versions. Note that we define // "compatible" here in terms of the semver sense where if the left-most // nonzero digit is the same they're considered compatible. let my_candidates = candidates.iter().filter(|&b| { prev_active.iter().any(|a| a == b) || prev_active.iter().all(|a| { !compatible(a.version(), b.version()) }) }); // Alright, for each candidate that's gotten this far, it meets the // following requirements: // // 1. The version matches the dependency requirement listed for this // package // 2. There are no activated versions for this package which are // semver-compatible, or there's an activated version which is // precisely equal to `candidate`. // // This means that we're going to attempt to activate each candidate in // turn. We could possibly fail to activate each candidate, so we try // each one in turn. let mut last_err = None; for candidate in my_candidates { trace!("{}[{}]>{} trying {}", parent.name(), cur, dep.name(), candidate.version()); let mut my_cx = cx.clone(); my_cx.resolve.graph.link(parent.package_id().clone(), candidate.package_id().clone()); // If we hit an intransitive dependency then clear out the visitation // list as we can't induce a cycle through transitive dependencies. if !dep.is_transitive() { my_cx.visited.borrow_mut().clear(); } let my_cx = match try!(activate(my_cx, registry, candidate, method)) { Ok(cx) => cx, Err(e) => { last_err = Some(e); continue } }; match try!(activate_deps(my_cx, registry, parent, platform, deps, cur + 1)) { Ok(cx) => return Ok(Ok(cx)), Err(e) => { last_err = Some(e); } } } trace!("{}[{}]>{} -- {:?}", parent.name(), cur, dep.name(), last_err); // Oh well, we couldn't activate any of the candidates, so we just can't // activate this dependency at all Ok(activation_error(&cx, registry, last_err, parent, dep, prev_active, &candidates)) } fn activation_error(cx: &Context, registry: &mut Registry, err: Option<Box<CargoError>>, parent: &Summary, dep: &Dependency, prev_active: &[Rc<Summary>], candidates: &[Rc<Summary>]) -> CargoResult<Box<Context>> { match err { Some(e) => return Err(e), None => {} } if candidates.len() > 0 { let mut msg = format!("failed to select a version for `{}` \ (required by `{}`):\n\ all possible versions conflict with \ previously selected versions of `{}`", dep.name(), parent.name(), dep.name()); 'outer: for v in prev_active.iter() { for node in cx.resolve.graph.iter() { let edges = match cx.resolve.graph.edges(node) { Some(edges) => edges, None => continue, }; for edge in edges { if edge != v.package_id() { continue } msg.push_str(&format!("\n version {} in use by {}", v.version(), edge)); continue 'outer; } } msg.push_str(&format!("\n version {} in use by ??", v.version())); } msg.push_str(&format!("\n possible versions to select: {}", candidates.iter() .map(|v| v.version()) .map(|v| v.to_string()) .collect::<Vec<_>>() .connect(", "))); return Err(human(msg)) } // Once we're all the way down here, we're definitely lost in the // weeds! We didn't actually use any candidates above, so we need to // give an error message that nothing was found. // // Note that we re-query the registry with a new dependency that // allows any version so we can give some nicer error reporting // which indicates a few versions that were actually found. let msg = format!("no matching package named `{}` found \ (required by `{}`)\n\ location searched: {}\n\ version required: {}", dep.name(), parent.name(), dep.source_id(), dep.version_req()); let mut msg = msg; let all_req = semver::VersionReq::parse("*").unwrap(); let new_dep = dep.clone().set_version_req(all_req); let mut candidates = try!(registry.query(&new_dep)); candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); if candidates.len() > 0 { msg.push_str("\nversions found: "); for (i, c) in candidates.iter().take(3).enumerate() { if i != 0 { msg.push_str(", "); } msg.push_str(&c.version().to_string()); } if candidates.len() > 3 { msg.push_str(", ..."); } } // If we have a path dependency with a locked version, then this may // indicate that we updated a sub-package and forgot to run `cargo // update`. In this case try to print a helpful error! if dep.source_id().is_path() && dep.version_req().to_string().starts_with("=") && candidates.len() > 0 { msg.push_str("\nconsider running `cargo update` to update \ a path dependency's locked version"); } Err(human(msg)) } // Returns if `a` and `b` are compatible in the semver sense. This is a // commutative operation. // // Versions `a` and `b` are compatible if their left-most nonzero digit is the // same. fn compatible(a: &semver::Version, b: &semver::Version) -> bool { if a.major != b.major { return false } if a.major != 0 { return true } if a.minor != b.minor { return false } if a.minor != 0 { return true } a.patch == b.patch } fn resolve_features<'a>(cx: &mut Context, parent: &'a Summary, method: Method) -> CargoResult<HashMap<&'a str, (&'a Dependency, Vec<String>)>> { let dev_deps = match method { Method::Everything => true, Method::Required { dev_deps, .. } => dev_deps, }; // First, filter by dev-dependencies let deps = parent.dependencies(); let deps = deps.iter().filter(|d| d.is_transitive() || dev_deps); // Second, ignoring dependencies that should not be compiled for this platform let deps = deps.filter(|d| { match method { Method::Required{target_platform: Some(ref platform), ..} => { d.is_active_for_platform(platform) }, _ => true } }); let (mut feature_deps, used_features) = try!(build_features(parent, method)); let mut ret = HashMap::new(); // Next, sanitize all requested features by whitelisting all the requested // features that correspond to optional dependencies for dep in deps { // weed out optional dependencies, but not those required if dep.is_optional() && !feature_deps.contains_key(dep.name()) { continue } let mut base = feature_deps.remove(dep.name()).unwrap_or(vec![]); for feature in dep.features().iter() { base.push(feature.clone()); if feature.contains("/") { return Err(human(format!("features in dependencies \ cannot enable features in \ other dependencies: `{}`", feature))); } } ret.insert(dep.name(), (dep, base)); } // All features can only point to optional dependencies, in which case they // should have all been weeded out by the above iteration. Any remaining // features are bugs in that the package does not actually have those // features. if feature_deps.len() > 0 { let unknown = feature_deps.keys().map(|s| &s[..]) .collect::<Vec<&str>>(); if unknown.len() > 0 { let features = unknown.connect(", "); return Err(human(format!("Package `{}` does not have these features: \ `{}`", parent.package_id(), features))) } } // Record what list of features is active for this package. if used_features.len() > 0 { let pkgid = parent.package_id(); cx.resolve.features.entry(pkgid.clone()) .or_insert(HashSet::new()) .extend(used_features); } Ok(ret) } // Returns a pair of (feature dependencies, all used features) // // The feature dependencies map is a mapping of package name to list of features // enabled. Each package should be enabled, and each package should have the // specified set of features enabled. // // The all used features set is the set of features which this local package had // enabled, which is later used when compiling to instruct the code what // features were enabled. fn build_features(s: &Summary, method: Method) -> CargoResult<(HashMap<String, Vec<String>>, HashSet<String>)> { let mut deps = HashMap::new(); let mut used = HashSet::new(); let mut visited = HashSet::new(); match method { Method::Everything => { for key in s.features().keys() { try!(add_feature(s, key, &mut deps, &mut used, &mut visited)); } for dep in s.dependencies().iter().filter(|d| d.is_optional()) { try!(add_feature(s, dep.name(), &mut deps, &mut used, &mut visited)); } } Method::Required{features: requested_features, ..} => { for feat in requested_features.iter() { try!(add_feature(s, feat, &mut deps, &mut used, &mut visited)); } } } match method { Method::Everything | Method::Required { uses_default_features: true, .. } => { if s.features().get("default").is_some() { try!(add_feature(s, "default", &mut deps, &mut used, &mut visited)); } } Method::Required { uses_default_features: false, .. } => {} } return Ok((deps, used)); fn add_feature(s: &Summary, feat: &str, deps: &mut HashMap<String, Vec<String>>, used: &mut HashSet<String>, visited: &mut HashSet<String>) -> CargoResult<()> { if feat.is_empty() { return Ok(()) } // If this feature is of the form `foo/bar`, then we just lookup package // `foo` and enable its feature `bar`. Otherwise this feature is of the // form `foo` and we need to recurse to enable the feature `foo` for our // own package, which may end up enabling more features or just enabling // a dependency. let mut parts = feat.splitn(2, '/'); let feat_or_package = parts.next().unwrap(); match parts.next() { Some(feat) => { let package = feat_or_package; deps.entry(package.to_string()) .or_insert(Vec::new()) .push(feat.to_string()); } None => { let feat = feat_or_package; if !visited.insert(feat.to_string()) { return Err(human(format!("Cyclic feature dependency: \ feature `{}` depends on itself", feat))) } used.insert(feat.to_string()); match s.features().get(feat) { Some(recursive) => { for f in recursive { try!(add_feature(s, f, deps, used, visited)); } } None => { deps.entry(feat.to_string()).or_insert(Vec::new()); } } visited.remove(&feat.to_string()); } } Ok(()) } }
iter
identifier_name
mod.rs
use std::cell::RefCell; use std::collections::HashSet; use std::collections::hash_map::HashMap; use std::fmt; use std::rc::Rc; use semver; use core::{PackageId, Registry, SourceId, Summary, Dependency}; use core::PackageIdSpec; use util::{CargoResult, Graph, human, ChainError, CargoError}; use util::profile; use util::graph::{Nodes, Edges}; pub use self::encode::{EncodableResolve, EncodableDependency, EncodablePackageId}; pub use self::encode::Metadata; mod encode; /// Represents a fully resolved package dependency graph. Each node in the graph /// is a package and edges represent dependencies between packages. /// /// Each instance of `Resolve` also understands the full set of features used /// for each package as well as what the root package is. #[derive(PartialEq, Eq, Clone)] pub struct Resolve { graph: Graph<PackageId>, features: HashMap<PackageId, HashSet<String>>, root: PackageId, metadata: Option<Metadata>, } #[derive(Clone, Copy)] pub enum Method<'a> { Everything, Required{ dev_deps: bool, features: &'a [String], uses_default_features: bool, target_platform: Option<&'a str>}, } impl Resolve { fn new(root: PackageId) -> Resolve { let mut g = Graph::new(); g.add(root.clone(), &[]); Resolve { graph: g, root: root, features: HashMap::new(), metadata: None } } pub fn copy_metadata(&mut self, other: &Resolve) { self.metadata = other.metadata.clone(); } pub fn iter(&self) -> Nodes<PackageId> { self.graph.iter() } pub fn root(&self) -> &PackageId { &self.root } pub fn deps(&self, pkg: &PackageId) -> Option<Edges<PackageId>> { self.graph.edges(pkg) } pub fn query(&self, spec: &str) -> CargoResult<&PackageId> { let spec = try!(PackageIdSpec::parse(spec).chain_error(|| { human(format!("invalid package id specification: `{}`", spec)) })); let mut ids = self.iter().filter(|p| spec.matches(*p)); let ret = match ids.next() { Some(id) => id, None => return Err(human(format!("package id specification `{}` \ matched no packages", spec))), }; return match ids.next() { Some(other) => { let mut msg = format!("There are multiple `{}` packages in \ your project, and the specification \ `{}` is ambiguous.\n\ Please re-run this command \ with `-p <spec>` where `<spec>` is one \ of the following:", spec.name(), spec); let mut vec = vec![ret, other]; vec.extend(ids); minimize(&mut msg, vec, &spec); Err(human(msg)) } None => Ok(ret) }; fn minimize(msg: &mut String, ids: Vec<&PackageId>, spec: &PackageIdSpec) { let mut version_cnt = HashMap::new(); for id in ids.iter() { *version_cnt.entry(id.version()).or_insert(0) += 1; } for id in ids.iter() { if version_cnt[id.version()] == 1 { msg.push_str(&format!("\n {}:{}", spec.name(), id.version())); } else { msg.push_str(&format!("\n {}", PackageIdSpec::from_package_id(*id))); } } } } pub fn features(&self, pkg: &PackageId) -> Option<&HashSet<String>> { self.features.get(pkg) } } impl fmt::Debug for Resolve { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { try!(write!(fmt, "graph: {:?}\n", self.graph)); try!(write!(fmt, "\nfeatures: {{\n")); for (pkg, features) in &self.features { try!(write!(fmt, " {}: {:?}\n", pkg, features)); } write!(fmt, "}}") } } #[derive(Clone)] struct Context { activations: HashMap<(String, SourceId), Vec<Rc<Summary>>>, resolve: Resolve, visited: Rc<RefCell<HashSet<PackageId>>>, } /// Builds the list of all packages required to build the first argument. pub fn resolve(summary: &Summary, method: Method, registry: &mut Registry) -> CargoResult<Resolve> { trace!("resolve; summary={}", summary.package_id()); let summary = Rc::new(summary.clone()); let cx = Box::new(Context { resolve: Resolve::new(summary.package_id().clone()), activations: HashMap::new(), visited: Rc::new(RefCell::new(HashSet::new())), }); let _p = profile::start(format!("resolving: {}", summary.package_id())); match try!(activate(cx, registry, &summary, method)) { Ok(cx) => { debug!("resolved: {:?}", cx.resolve); Ok(cx.resolve) } Err(e) => Err(e), } } fn activate(mut cx: Box<Context>, registry: &mut Registry, parent: &Rc<Summary>, method: Method) -> CargoResult<CargoResult<Box<Context>>> { // Dependency graphs are required to be a DAG, so we keep a set of // packages we're visiting and bail if we hit a dupe. let id = parent.package_id(); if !cx.visited.borrow_mut().insert(id.clone()) { return Err(human(format!("cyclic package dependency: package `{}` \ depends on itself", id))) } // If we're already activated, then that was easy! if flag_activated(&mut *cx, parent, &method) { cx.visited.borrow_mut().remove(id); return Ok(Ok(cx)) } debug!("activating {}", parent.package_id()); // Extracting the platform request. let platform = match method { Method::Required{target_platform: platform, ..} => platform, Method::Everything => None, }; // First, figure out our set of dependencies based on the requsted set of // features. This also calculates what features we're going to enable for // our own dependencies. let deps = try!(resolve_features(&mut cx, parent, method)); // Next, transform all dependencies into a list of possible candidates which // can satisfy that dependency. let mut deps = try!(deps.into_iter().map(|(_dep_name, (dep, features))| { let mut candidates = try!(registry.query(dep)); // When we attempt versions for a package, we'll want to start at the // maximum version and work our way down. candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); let candidates = candidates.into_iter().map(Rc::new).collect::<Vec<_>>(); Ok((dep, candidates, features)) }).collect::<CargoResult<Vec<_>>>()); // When we recurse, attempt to resolve dependencies with fewer candidates // before recursing on dependencies with more candidates. This way if the // dependency with only one candidate can't be resolved we don't have to do // a bunch of work before we figure that out. deps.sort_by(|&(_, ref a, _), &(_, ref b, _)| { a.len().cmp(&b.len()) }); // Workaround compilation error: `deps` does not live long enough let platform = platform.map(|s| &*s); Ok(match try!(activate_deps(cx, registry, parent, platform, &deps, 0)) { Ok(cx) => { cx.visited.borrow_mut().remove(parent.package_id()); Ok(cx) } Err(e) => Err(e), }) } // Activate this summary by inserting it into our list of known activations. // // Returns if this summary with the given method is already activated. fn flag_activated(cx: &mut Context, summary: &Rc<Summary>, method: &Method) -> bool { let id = summary.package_id(); let key = (id.name().to_string(), id.source_id().clone()); let prev = cx.activations.entry(key).or_insert(Vec::new()); if !prev.iter().any(|c| c == summary) { cx.resolve.graph.add(id.clone(), &[]); prev.push(summary.clone()); return false } debug!("checking if {} is already activated", summary.package_id()); let (features, use_default) = match *method { Method::Required { features, uses_default_features, .. } => { (features, uses_default_features) } Method::Everything => return false, }; let has_default_feature = summary.features().contains_key("default"); match cx.resolve.features(id) { Some(prev) => { features.iter().all(|f| prev.contains(f)) && (!use_default || prev.contains("default") || !has_default_feature) } None => features.len() == 0 && (!use_default || !has_default_feature) } } fn activate_deps<'a>(cx: Box<Context>, registry: &mut Registry, parent: &Summary, platform: Option<&'a str>, deps: &'a [(&Dependency, Vec<Rc<Summary>>, Vec<String>)], cur: usize) -> CargoResult<CargoResult<Box<Context>>> { if cur == deps.len() { return Ok(Ok(cx)) } let (dep, ref candidates, ref features) = deps[cur]; let method = Method::Required{ dev_deps: false, features: &features, uses_default_features: dep.uses_default_features(), target_platform: platform}; let key = (dep.name().to_string(), dep.source_id().clone()); let prev_active = cx.activations.get(&key) .map(|v| &v[..]).unwrap_or(&[]); trace!("{}[{}]>{} {} candidates", parent.name(), cur, dep.name(), candidates.len()); trace!("{}[{}]>{} {} prev activations", parent.name(), cur, dep.name(), prev_active.len()); // Filter the set of candidates based on the previously activated // versions for this dependency. We can actually use a version if it // precisely matches an activated version or if it is otherwise // incompatible with all other activated versions. Note that we define // "compatible" here in terms of the semver sense where if the left-most // nonzero digit is the same they're considered compatible. let my_candidates = candidates.iter().filter(|&b| { prev_active.iter().any(|a| a == b) || prev_active.iter().all(|a| { !compatible(a.version(), b.version()) }) }); // Alright, for each candidate that's gotten this far, it meets the // following requirements: // // 1. The version matches the dependency requirement listed for this // package // 2. There are no activated versions for this package which are // semver-compatible, or there's an activated version which is // precisely equal to `candidate`. // // This means that we're going to attempt to activate each candidate in // turn. We could possibly fail to activate each candidate, so we try // each one in turn. let mut last_err = None; for candidate in my_candidates { trace!("{}[{}]>{} trying {}", parent.name(), cur, dep.name(), candidate.version()); let mut my_cx = cx.clone(); my_cx.resolve.graph.link(parent.package_id().clone(), candidate.package_id().clone()); // If we hit an intransitive dependency then clear out the visitation // list as we can't induce a cycle through transitive dependencies. if !dep.is_transitive() { my_cx.visited.borrow_mut().clear(); } let my_cx = match try!(activate(my_cx, registry, candidate, method)) { Ok(cx) => cx, Err(e) => { last_err = Some(e); continue } }; match try!(activate_deps(my_cx, registry, parent, platform, deps, cur + 1)) { Ok(cx) => return Ok(Ok(cx)), Err(e) => { last_err = Some(e); } } } trace!("{}[{}]>{} -- {:?}", parent.name(), cur, dep.name(), last_err); // Oh well, we couldn't activate any of the candidates, so we just can't // activate this dependency at all Ok(activation_error(&cx, registry, last_err, parent, dep, prev_active, &candidates)) } fn activation_error(cx: &Context, registry: &mut Registry, err: Option<Box<CargoError>>, parent: &Summary, dep: &Dependency, prev_active: &[Rc<Summary>], candidates: &[Rc<Summary>]) -> CargoResult<Box<Context>> { match err { Some(e) => return Err(e), None => {} } if candidates.len() > 0 { let mut msg = format!("failed to select a version for `{}` \ (required by `{}`):\n\ all possible versions conflict with \ previously selected versions of `{}`", dep.name(), parent.name(), dep.name()); 'outer: for v in prev_active.iter() { for node in cx.resolve.graph.iter() { let edges = match cx.resolve.graph.edges(node) { Some(edges) => edges, None => continue, }; for edge in edges { if edge != v.package_id() { continue } msg.push_str(&format!("\n version {} in use by {}", v.version(), edge)); continue 'outer; } } msg.push_str(&format!("\n version {} in use by ??", v.version())); } msg.push_str(&format!("\n possible versions to select: {}", candidates.iter() .map(|v| v.version()) .map(|v| v.to_string()) .collect::<Vec<_>>() .connect(", "))); return Err(human(msg)) } // Once we're all the way down here, we're definitely lost in the // weeds! We didn't actually use any candidates above, so we need to // give an error message that nothing was found. // // Note that we re-query the registry with a new dependency that // allows any version so we can give some nicer error reporting // which indicates a few versions that were actually found. let msg = format!("no matching package named `{}` found \ (required by `{}`)\n\ location searched: {}\n\ version required: {}", dep.name(), parent.name(), dep.source_id(), dep.version_req()); let mut msg = msg; let all_req = semver::VersionReq::parse("*").unwrap(); let new_dep = dep.clone().set_version_req(all_req); let mut candidates = try!(registry.query(&new_dep)); candidates.sort_by(|a, b| { b.version().cmp(a.version()) }); if candidates.len() > 0 { msg.push_str("\nversions found: "); for (i, c) in candidates.iter().take(3).enumerate() { if i != 0 { msg.push_str(", "); } msg.push_str(&c.version().to_string()); } if candidates.len() > 3 { msg.push_str(", ..."); } } // If we have a path dependency with a locked version, then this may // indicate that we updated a sub-package and forgot to run `cargo // update`. In this case try to print a helpful error! if dep.source_id().is_path() && dep.version_req().to_string().starts_with("=") && candidates.len() > 0 { msg.push_str("\nconsider running `cargo update` to update \ a path dependency's locked version"); } Err(human(msg)) } // Returns if `a` and `b` are compatible in the semver sense. This is a // commutative operation. // // Versions `a` and `b` are compatible if their left-most nonzero digit is the // same. fn compatible(a: &semver::Version, b: &semver::Version) -> bool { if a.major != b.major { return false } if a.major != 0 { return true } if a.minor != b.minor { return false } if a.minor != 0 { return true } a.patch == b.patch } fn resolve_features<'a>(cx: &mut Context, parent: &'a Summary, method: Method) -> CargoResult<HashMap<&'a str, (&'a Dependency, Vec<String>)>> { let dev_deps = match method { Method::Everything => true, Method::Required { dev_deps, .. } => dev_deps, }; // First, filter by dev-dependencies let deps = parent.dependencies(); let deps = deps.iter().filter(|d| d.is_transitive() || dev_deps); // Second, ignoring dependencies that should not be compiled for this platform let deps = deps.filter(|d| { match method { Method::Required{target_platform: Some(ref platform), ..} => { d.is_active_for_platform(platform) }, _ => true } }); let (mut feature_deps, used_features) = try!(build_features(parent, method)); let mut ret = HashMap::new();
continue } let mut base = feature_deps.remove(dep.name()).unwrap_or(vec![]); for feature in dep.features().iter() { base.push(feature.clone()); if feature.contains("/") { return Err(human(format!("features in dependencies \ cannot enable features in \ other dependencies: `{}`", feature))); } } ret.insert(dep.name(), (dep, base)); } // All features can only point to optional dependencies, in which case they // should have all been weeded out by the above iteration. Any remaining // features are bugs in that the package does not actually have those // features. if feature_deps.len() > 0 { let unknown = feature_deps.keys().map(|s| &s[..]) .collect::<Vec<&str>>(); if unknown.len() > 0 { let features = unknown.connect(", "); return Err(human(format!("Package `{}` does not have these features: \ `{}`", parent.package_id(), features))) } } // Record what list of features is active for this package. if used_features.len() > 0 { let pkgid = parent.package_id(); cx.resolve.features.entry(pkgid.clone()) .or_insert(HashSet::new()) .extend(used_features); } Ok(ret) } // Returns a pair of (feature dependencies, all used features) // // The feature dependencies map is a mapping of package name to list of features // enabled. Each package should be enabled, and each package should have the // specified set of features enabled. // // The all used features set is the set of features which this local package had // enabled, which is later used when compiling to instruct the code what // features were enabled. fn build_features(s: &Summary, method: Method) -> CargoResult<(HashMap<String, Vec<String>>, HashSet<String>)> { let mut deps = HashMap::new(); let mut used = HashSet::new(); let mut visited = HashSet::new(); match method { Method::Everything => { for key in s.features().keys() { try!(add_feature(s, key, &mut deps, &mut used, &mut visited)); } for dep in s.dependencies().iter().filter(|d| d.is_optional()) { try!(add_feature(s, dep.name(), &mut deps, &mut used, &mut visited)); } } Method::Required{features: requested_features, ..} => { for feat in requested_features.iter() { try!(add_feature(s, feat, &mut deps, &mut used, &mut visited)); } } } match method { Method::Everything | Method::Required { uses_default_features: true, .. } => { if s.features().get("default").is_some() { try!(add_feature(s, "default", &mut deps, &mut used, &mut visited)); } } Method::Required { uses_default_features: false, .. } => {} } return Ok((deps, used)); fn add_feature(s: &Summary, feat: &str, deps: &mut HashMap<String, Vec<String>>, used: &mut HashSet<String>, visited: &mut HashSet<String>) -> CargoResult<()> { if feat.is_empty() { return Ok(()) } // If this feature is of the form `foo/bar`, then we just lookup package // `foo` and enable its feature `bar`. Otherwise this feature is of the // form `foo` and we need to recurse to enable the feature `foo` for our // own package, which may end up enabling more features or just enabling // a dependency. let mut parts = feat.splitn(2, '/'); let feat_or_package = parts.next().unwrap(); match parts.next() { Some(feat) => { let package = feat_or_package; deps.entry(package.to_string()) .or_insert(Vec::new()) .push(feat.to_string()); } None => { let feat = feat_or_package; if !visited.insert(feat.to_string()) { return Err(human(format!("Cyclic feature dependency: \ feature `{}` depends on itself", feat))) } used.insert(feat.to_string()); match s.features().get(feat) { Some(recursive) => { for f in recursive { try!(add_feature(s, f, deps, used, visited)); } } None => { deps.entry(feat.to_string()).or_insert(Vec::new()); } } visited.remove(&feat.to_string()); } } Ok(()) } }
// Next, sanitize all requested features by whitelisting all the requested // features that correspond to optional dependencies for dep in deps { // weed out optional dependencies, but not those required if dep.is_optional() && !feature_deps.contains_key(dep.name()) {
random_line_split
new_IDRQN_main.py
# Xinwu Qian 2019-02-06 import warnings warnings.filterwarnings("ignore", category=RuntimeWarning) # This implements independent q learning approach use_gpu = 1 import os import config from multiprocessing import Pool import taxi_env as te import scipy import taxi_util as tu import time from datetime import datetime import pickle from collections import deque import tensorflow as tf import numpy as np import network import DRQN_agent from system_tracker import system_tracker import bandit from tensorflow.python.client import timeline np.set_printoptions(precision=2) if use_gpu == 0: os.environ['CUDA_VISIBLE_DEVICES'] = '-1' # force on gpu config1 = tf.ConfigProto() config1.gpu_options.allow_growth = True reward_out = open('log/IDRQN_reward_log_' + datetime.now().strftime('%Y-%m-%d %H-%M-%S') + '.csv', 'w+') with open('simulation_input.dat', 'rb') as fp: simulation_input = pickle.load(fp) # ------------------Parameter setting----------------------- N_station = simulation_input['N_station'] OD_mat = simulation_input['OD_mat'] distance = simulation_input['distance'] travel_time = simulation_input['travel_time'] arrival_rate = simulation_input['arrival_rate'] taxi_input = simulation_input['taxi_input'] exp_dist=simulation_input['exp_dist'] # Setting the training parameters batch_size = config.TRAIN_CONFIG['batch_size'] trace_length = config.TRAIN_CONFIG['trace_length'] # How long each experience trace will be when training update_freq = config.TRAIN_CONFIG['update_freq'] # How often to perform a training step. lstm_units=config.TRAIN_CONFIG['lstm_unit'] e_threshold=config.TRAIN_CONFIG['elimination_threshold'] y = config.TRAIN_CONFIG['y'] # Discount factor on the target Q-values startE = config.TRAIN_CONFIG['startE'] # Starting chance of random action endE = config.TRAIN_CONFIG['endE'] # Final chance of random action anneling_steps = config.TRAIN_CONFIG['anneling_steps'] # How many steps of training to reduce startE to endE. num_episodes = config.TRAIN_CONFIG['num_episodes'] # How many episodes of game environment to train network with. load_model = config.TRAIN_CONFIG['load_model'] # Whether to load a saved model. warmup_time = config.TRAIN_CONFIG['warmup_time']; path = "./large_case_model" # The path to save our model to. h_size = config.TRAIN_CONFIG['h_size'] max_epLength = config.TRAIN_CONFIG['max_epLength'] pre_train_steps = max_epLength * 10 # How many steps of random actions before training begins. softmax_action = config.TRAIN_CONFIG['softmax_action'] silent = config.TRAIN_CONFIG['silent'] # do not print training time prioritized = config.TRAIN_CONFIG['prioritized'] rng_seed=config.TRAIN_CONFIG['random_seed'] #set rng seed np.random.seed(rng_seed) tau = 0.1 # --------------Simulation initialization sys_tracker = system_tracker() sys_tracker.initialize(config, distance, travel_time, arrival_rate, int(taxi_input), N_station, num_episodes, max_epLength) env = te.taxi_simulator(arrival_rate, OD_mat, distance, travel_time, taxi_input) env.reset() print('System Successfully Initialized!') # ------------------Train the network----------------------- #--------------Output record-------------------# outf=open('temp_record.txt','w') # Set the rate of random action decrease. e = startE stepDrop = (startE-endE)/anneling_steps # create lists to contain total rewards and steps per episode jList = [] rList = [] total_steps = 0 # network number nn = 0 # Make a path for our model to be saved in. if not os.path.exists(path): os.makedirs(path) linucb_agent=bandit.linucb_agent(N_station,N_station*4) exp_replay = network.experience_buffer(15000) # a single buffer holds everything bandit_buffer = network.bandit_buffer(15000) bandit_swap_e=1; linucb_agent_backup=bandit.linucb_agent(N_station, N_station * 4) # # this step loads the model from the model that has been saved # if load_model == True: # print('Loading Model...') # ckpt = tf.train.get_checkpoint_state(path) # saver.restore(sess, ckpt.model_checkpoint_path) # this example equals target network to the original network after every few episodes # we may want to modify this with tf.Session(config=config1) as sess: # one DRQN per station is needed, different network requires a different scope (name) stand_agent = [] # targetOps=[] options = tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE) run_metadata = tf.RunMetadata() agent=DRQN_agent.drqn_agent_efficient(N_station, h_size, lstm_units,tau, sess, batch_size, trace_length,is_gpu=use_gpu) agent.drqn_build() global_init = tf.global_variables_initializer() saver = tf.train.Saver(max_to_keep=10) # writer = tf.summary.FileWriter('./graphs', sess.graph) # writer.close()1 sess.run(global_init) Qp_in=[] Qp_value_in=[] Q1_in=[] Q2_in=[] Q_train=[] Q_input_dict = dict() Q_train_dict = dict() Qp_input_dict=dict() for station in range(N_station): Qp_in.append(agent.mainPredict[station]) Qp_value_in.append(agent.mainQout[station]) Qp_input_dict[agent.trainLength] = 1 Qp_input_dict[agent.batch_size] = 1 Q1_in.append(agent.targetZ[station]) Q2_in.append(agent.targetQout[station]) Q_train.append(agent.updateModel[station]) total_train_iter=0; for i in range(num_episodes): global_epi_buffer=[] global_bandit_buffer=[] sys_tracker.new_episode() # Reset environment and get first new observation env.reset() # return the current state of the system sP, tempr, featurep,score,tr2 = env.get_state() # process the state into a list # replace the state action with future states feature=featurep s = network.processState(sP, N_station) pres=s prea=np.zeros((N_station)) within_frame_reward = 0 frame_skipping = 1 prediction_time=0 targetz_time=0 training_time=0 rAll = 0 rAll_unshape=0 j = 0 total_serve = 0 total_leave = 0 buffer_count=0; # We train one station in one single episode, and hold it unchanged for other stations, and we keep rotating. tinit=time.time() a = [st for st in range(N_station)] #bandit swapping scheme #bandit swapping scheme if bandit_swap_e - e >.1: # we do swapping when $e$ got declined by 0.05 percent. linucb_agent=linucb_agent_backup linucb_agent_backup=bandit.linucb_agent(N_station, N_station * 4) bandit_swap_e=e print('we swap bandit here') state_predict=deque() initial_rnn_cstate = np.zeros((1, 1, config.TRAIN_CONFIG['lstm_unit'])) initial_rnn_hstate = np.zeros((1, 1, config.TRAIN_CONFIG['lstm_unit'])) while j < max_epLength: # agent.update_conf(1,1.5*anneling_steps) tall=time.time() j += 1 hour=(j-1)//120 # for all the stations, act greedily # Choose an action by greedily (with e chance of random action) from the Q-network a = [-1] * N_station tempt = time.time() if config.TRAIN_CONFIG['use_linear'] == 0: # not using action elimination if np.random.rand(1) < e or total_steps < pre_train_steps: for station in range(N_station): if env.taxi_in_q[station]: a[station] = np.random.randint(0, N_station) # random actions for each station else: for station in range(N_station): if env.taxi_in_q[station]: a1 = agent.predict_regular(s, station) a[station] = a1[0] # action performed by DRQN if a[station] == N_station: a[station] = station else: # use e-greedy # predict_score = sess.run(linear_model.linear_Yh, feed_dict={linear_model.linear_X: [feature]}) predict_score=linucb_agent.return_upper_bound(feature) predict_score=predict_score*exp_dist[hour]/distance invalid=predict_score<e_threshold valid=predict_score>=e_threshold rand_num=np.random.rand(1) state_predict.append(s) if len(state_predict)>1: state_predict.popleft() if rand_num < e: rnn_value = 0 all_actions = 0 else: rnn_value,initial_rnn_state = sess.run([agent.main_rnn_value,agent.rnn_out_state],feed_dict={agent.scalarInput: np.vstack(state_predict), agent.rnn_cstate_holder:initial_rnn_cstate,agent.rnn_hstate_holder:initial_rnn_hstate,agent.iter_holder:[np.array([e])], agent.eps_holder:[np.array([total_train_iter])], agent.trainLength: len(state_predict), agent.batch_size: 1}) initial_rnn_cstate=initial_rnn_state[0] initial_rnn_hstate=initial_rnn_state[1] for station in range(N_station): if env.taxi_in_q[station]: a1 = agent.predict(rnn_value, predict_score[station, :], e, station, e_threshold, rand_num, valid[station, :], invalid[station, :]) a[station] = a1 # action performed by DRQN if a[station] == N_station: a[station] = station prediction_time += time.time() - tempt if config.TRAIN_CONFIG['use_tracker']: sys_tracker.record(s, a) # move to the next step based on action selected ssp, lfp = env.step(a) total_serve += ssp total_leave += lfp # get state and reward s1P, r, featurep,score,r2 = env.get_state() s1 = network.processState(s1P, N_station) total_steps += 1 if total_steps > pre_train_steps and j > warmup_time: # start training here if e > endE: e-=stepDrop # episode buffer # we don't store the initial 200 steps of the simulation, as warm up periods newr=r*np.ones((N_station)) v1=np.reshape(np.array([s, a, newr, s1,feature,score,featurep,e,total_train_iter]), [1,9]) global_epi_buffer.append(v1) global_bandit_buffer.append(v1) #exp replay # buffer_count+=1 # if buffer_count>=2*trace_length: # #pop the first trace length items # newbufferArray=[] # bufferArray=global_epi_buffer[:trace_length] # for bf in range(trace_length): # #recalibrate the rewards # reward_vec=sum([(y**id)*global_epi_buffer[bf+id][0][2] for id in range(trace_length)]) # bufferArray[bf][0][2]=reward_vec # exp_replay.add(bufferArray) # global_epi_buffer=global_epi_buffer[trace_length:] # buffer_count-=trace_length buffer_count+=1 if buffer_count>=2*trace_length: for it in range(trace_length):
global_epi_buffer=global_epi_buffer[trace_length:] buffer_count-=trace_length if total_steps % (500) == 0 and i>4: linubc_train = bandit_buffer.sample(batch_size * 40) linucb_agent.update(linubc_train[:, 4], linubc_train[:, 1], linubc_train[:, 5]) linucb_agent_backup.update(linubc_train[:, 4], linubc_train[:, 1], linubc_train[:, 5]) #use a single buffer if total_steps > pre_train_steps and j > warmup_time: #train linear multi-arm bandit first, we periodically update this (every 10*update_fequency steps) t1 = time.time() if total_steps % (update_freq) == 0: agent.update_target_net() # train_predict_score[train_predict_score<0.312]=100 # train_predict_score[train_predict_score>=0.312] =0 # predict_in=np.zeros((batch_size*trace_length,N_station+1)) # predict_in[:,:-1]=train_predict_score; # print('LINUCB predict time:', time.time() - t1) #get targetQ total_train_iter+=1/5000 trainBatch_list = [exp_replay.sample(batch_size, trace_length) for st in range(N_station)] for station in range(N_station): trainBatch= trainBatch_list[station] # generate the linucb score for each batch # train_predict_score= train_predict_score_list[(station)*batch_size*trace_length:(station+1)*batch_size*trace_length,:] * exp_dist train_predict_score = linucb_agent.return_upper_bound_batch(trainBatch[:, 6]) * exp_dist[hour] past_train_eps=np.vstack(trainBatch[:,7]) past_train_iter = np.vstack(trainBatch[:, 8]) current_action=np.vstack(trainBatch[:,1]) tr, t_action = agent.train_prepare(trainBatch, station) tp = train_predict_score/ distance[station, :] af = tp < e_threshold bf = tp >= e_threshold tp[af] = 100 tp[bf] = 0 tp[:, station] = 0 tempt = time.time() tz=sess.run(agent.targetZ[station],feed_dict={agent.scalarInput:np.vstack(trainBatch[:, 3]),agent.iter_holder:past_train_iter, agent.eps_holder:past_train_eps, agent.predict_score[station]:tp,agent.rewards[station]:tr,agent.trainLength:trace_length,agent.batch_size:batch_size}) targetz_time += time.time() - tempt tempt = time.time() sess.run(agent.updateModel[station], feed_dict={agent.targetQ[station]: tz, agent.rewards[station]: tr, agent.actions[station]: t_action, agent.scalarInput: np.vstack(trainBatch[:, 0]),agent.iter_holder:past_train_iter, agent.eps_holder:past_train_eps,agent.trainLength: trace_length, agent.batch_size: batch_size}) training_time += time.time() - tempt # train # sess.run(agent.updateModel[station],feed_dict={agent.targetQ[station]:tz,agent.rewards[station]:tr,agent.actions[station]:t_action,agent.scalarInput:np.vstack(trainBatch[:, 0]),agent.trainLength:trace_length,agent.batch_size:batch_size}) rAll += r rAll_unshape+=r2 # swap state s = s1 sP = s1P feature=featurep #preocess bandit buffer future_steps=2*trace_length tmask = np.linspace(0, 1, num=future_steps + 1) pdeta=0.5; quantile_mask=scipy.stats.norm.cdf(scipy.stats.norm.ppf(tmask)-pdeta) quantile_mask = np.diff(quantile_mask) # rescale the distribution to favor risk neutral or risk-averse behavior for epi in range(len(global_bandit_buffer)-future_steps-1): # print(global_bandit_buffer[i]) score=np.array([global_bandit_buffer[epi+k][0][5] for k in range(future_steps)]).T.dot(quantile_mask) record=global_bandit_buffer[epi] record[0][5]=score; #replay the score bandit_buffer.add(record) jList.append(j) rList.append(rAll) # reward in this episode sys_tracker.record_time(env) print('Episode:', i, ', totalreward:', rAll, ', old reward:',rAll_unshape,', total serve:', total_serve, ', total leave:', total_leave, ', total_cpu_time:',time.time()-tinit, ', terminal_taxi_distribution:', [len(v) for v in env.taxi_in_q], ', terminal_passenger:', [len(v) for v in env.passenger_qtime], e,agent.conf) n_vars=len(tf.trainable_variables()) print('TargetZ_time:',targetz_time,', Training time:',training_time, ', Prediction time:',prediction_time,'Number of tensorflow variables',n_vars) reward_out.write(str(i) + ',' + str(rAll) + '\n') outf.writelines(str(i)+','+str(rAll)+','+str(total_serve)+','+str(total_leave)+'\n') # Periodically save the model. if i % 20 == 0 and i != 0: saver.save(sess, path + '/model-' + str(i) + '.cptk') print("Saved Model") # if len(rList) % summaryLength == 0 and len(rList) != 0: # print(total_steps, np.mean(rList[-summaryLength:]), e) # saveToCenter(i,rList,jList,np.reshape(np.array(episodeBuffer),[len(episodeBuffer),5]),\ # summaryLength,h_size,sess,mainQN,time_per_step) # saver.save(sess,path+'/model-'+str(i)+'.cptk') outf.close() reward_out.close() sys_tracker.save('IDRQN') sys_tracker.playback(-1)
bufferArray=np.array(global_epi_buffer) exp_replay.add(bufferArray[it:it+trace_length])
conditional_block
new_IDRQN_main.py
# Xinwu Qian 2019-02-06 import warnings warnings.filterwarnings("ignore", category=RuntimeWarning) # This implements independent q learning approach use_gpu = 1 import os import config from multiprocessing import Pool import taxi_env as te import scipy import taxi_util as tu import time from datetime import datetime import pickle from collections import deque import tensorflow as tf import numpy as np import network
from system_tracker import system_tracker import bandit from tensorflow.python.client import timeline np.set_printoptions(precision=2) if use_gpu == 0: os.environ['CUDA_VISIBLE_DEVICES'] = '-1' # force on gpu config1 = tf.ConfigProto() config1.gpu_options.allow_growth = True reward_out = open('log/IDRQN_reward_log_' + datetime.now().strftime('%Y-%m-%d %H-%M-%S') + '.csv', 'w+') with open('simulation_input.dat', 'rb') as fp: simulation_input = pickle.load(fp) # ------------------Parameter setting----------------------- N_station = simulation_input['N_station'] OD_mat = simulation_input['OD_mat'] distance = simulation_input['distance'] travel_time = simulation_input['travel_time'] arrival_rate = simulation_input['arrival_rate'] taxi_input = simulation_input['taxi_input'] exp_dist=simulation_input['exp_dist'] # Setting the training parameters batch_size = config.TRAIN_CONFIG['batch_size'] trace_length = config.TRAIN_CONFIG['trace_length'] # How long each experience trace will be when training update_freq = config.TRAIN_CONFIG['update_freq'] # How often to perform a training step. lstm_units=config.TRAIN_CONFIG['lstm_unit'] e_threshold=config.TRAIN_CONFIG['elimination_threshold'] y = config.TRAIN_CONFIG['y'] # Discount factor on the target Q-values startE = config.TRAIN_CONFIG['startE'] # Starting chance of random action endE = config.TRAIN_CONFIG['endE'] # Final chance of random action anneling_steps = config.TRAIN_CONFIG['anneling_steps'] # How many steps of training to reduce startE to endE. num_episodes = config.TRAIN_CONFIG['num_episodes'] # How many episodes of game environment to train network with. load_model = config.TRAIN_CONFIG['load_model'] # Whether to load a saved model. warmup_time = config.TRAIN_CONFIG['warmup_time']; path = "./large_case_model" # The path to save our model to. h_size = config.TRAIN_CONFIG['h_size'] max_epLength = config.TRAIN_CONFIG['max_epLength'] pre_train_steps = max_epLength * 10 # How many steps of random actions before training begins. softmax_action = config.TRAIN_CONFIG['softmax_action'] silent = config.TRAIN_CONFIG['silent'] # do not print training time prioritized = config.TRAIN_CONFIG['prioritized'] rng_seed=config.TRAIN_CONFIG['random_seed'] #set rng seed np.random.seed(rng_seed) tau = 0.1 # --------------Simulation initialization sys_tracker = system_tracker() sys_tracker.initialize(config, distance, travel_time, arrival_rate, int(taxi_input), N_station, num_episodes, max_epLength) env = te.taxi_simulator(arrival_rate, OD_mat, distance, travel_time, taxi_input) env.reset() print('System Successfully Initialized!') # ------------------Train the network----------------------- #--------------Output record-------------------# outf=open('temp_record.txt','w') # Set the rate of random action decrease. e = startE stepDrop = (startE-endE)/anneling_steps # create lists to contain total rewards and steps per episode jList = [] rList = [] total_steps = 0 # network number nn = 0 # Make a path for our model to be saved in. if not os.path.exists(path): os.makedirs(path) linucb_agent=bandit.linucb_agent(N_station,N_station*4) exp_replay = network.experience_buffer(15000) # a single buffer holds everything bandit_buffer = network.bandit_buffer(15000) bandit_swap_e=1; linucb_agent_backup=bandit.linucb_agent(N_station, N_station * 4) # # this step loads the model from the model that has been saved # if load_model == True: # print('Loading Model...') # ckpt = tf.train.get_checkpoint_state(path) # saver.restore(sess, ckpt.model_checkpoint_path) # this example equals target network to the original network after every few episodes # we may want to modify this with tf.Session(config=config1) as sess: # one DRQN per station is needed, different network requires a different scope (name) stand_agent = [] # targetOps=[] options = tf.RunOptions(trace_level=tf.RunOptions.FULL_TRACE) run_metadata = tf.RunMetadata() agent=DRQN_agent.drqn_agent_efficient(N_station, h_size, lstm_units,tau, sess, batch_size, trace_length,is_gpu=use_gpu) agent.drqn_build() global_init = tf.global_variables_initializer() saver = tf.train.Saver(max_to_keep=10) # writer = tf.summary.FileWriter('./graphs', sess.graph) # writer.close()1 sess.run(global_init) Qp_in=[] Qp_value_in=[] Q1_in=[] Q2_in=[] Q_train=[] Q_input_dict = dict() Q_train_dict = dict() Qp_input_dict=dict() for station in range(N_station): Qp_in.append(agent.mainPredict[station]) Qp_value_in.append(agent.mainQout[station]) Qp_input_dict[agent.trainLength] = 1 Qp_input_dict[agent.batch_size] = 1 Q1_in.append(agent.targetZ[station]) Q2_in.append(agent.targetQout[station]) Q_train.append(agent.updateModel[station]) total_train_iter=0; for i in range(num_episodes): global_epi_buffer=[] global_bandit_buffer=[] sys_tracker.new_episode() # Reset environment and get first new observation env.reset() # return the current state of the system sP, tempr, featurep,score,tr2 = env.get_state() # process the state into a list # replace the state action with future states feature=featurep s = network.processState(sP, N_station) pres=s prea=np.zeros((N_station)) within_frame_reward = 0 frame_skipping = 1 prediction_time=0 targetz_time=0 training_time=0 rAll = 0 rAll_unshape=0 j = 0 total_serve = 0 total_leave = 0 buffer_count=0; # We train one station in one single episode, and hold it unchanged for other stations, and we keep rotating. tinit=time.time() a = [st for st in range(N_station)] #bandit swapping scheme #bandit swapping scheme if bandit_swap_e - e >.1: # we do swapping when $e$ got declined by 0.05 percent. linucb_agent=linucb_agent_backup linucb_agent_backup=bandit.linucb_agent(N_station, N_station * 4) bandit_swap_e=e print('we swap bandit here') state_predict=deque() initial_rnn_cstate = np.zeros((1, 1, config.TRAIN_CONFIG['lstm_unit'])) initial_rnn_hstate = np.zeros((1, 1, config.TRAIN_CONFIG['lstm_unit'])) while j < max_epLength: # agent.update_conf(1,1.5*anneling_steps) tall=time.time() j += 1 hour=(j-1)//120 # for all the stations, act greedily # Choose an action by greedily (with e chance of random action) from the Q-network a = [-1] * N_station tempt = time.time() if config.TRAIN_CONFIG['use_linear'] == 0: # not using action elimination if np.random.rand(1) < e or total_steps < pre_train_steps: for station in range(N_station): if env.taxi_in_q[station]: a[station] = np.random.randint(0, N_station) # random actions for each station else: for station in range(N_station): if env.taxi_in_q[station]: a1 = agent.predict_regular(s, station) a[station] = a1[0] # action performed by DRQN if a[station] == N_station: a[station] = station else: # use e-greedy # predict_score = sess.run(linear_model.linear_Yh, feed_dict={linear_model.linear_X: [feature]}) predict_score=linucb_agent.return_upper_bound(feature) predict_score=predict_score*exp_dist[hour]/distance invalid=predict_score<e_threshold valid=predict_score>=e_threshold rand_num=np.random.rand(1) state_predict.append(s) if len(state_predict)>1: state_predict.popleft() if rand_num < e: rnn_value = 0 all_actions = 0 else: rnn_value,initial_rnn_state = sess.run([agent.main_rnn_value,agent.rnn_out_state],feed_dict={agent.scalarInput: np.vstack(state_predict), agent.rnn_cstate_holder:initial_rnn_cstate,agent.rnn_hstate_holder:initial_rnn_hstate,agent.iter_holder:[np.array([e])], agent.eps_holder:[np.array([total_train_iter])], agent.trainLength: len(state_predict), agent.batch_size: 1}) initial_rnn_cstate=initial_rnn_state[0] initial_rnn_hstate=initial_rnn_state[1] for station in range(N_station): if env.taxi_in_q[station]: a1 = agent.predict(rnn_value, predict_score[station, :], e, station, e_threshold, rand_num, valid[station, :], invalid[station, :]) a[station] = a1 # action performed by DRQN if a[station] == N_station: a[station] = station prediction_time += time.time() - tempt if config.TRAIN_CONFIG['use_tracker']: sys_tracker.record(s, a) # move to the next step based on action selected ssp, lfp = env.step(a) total_serve += ssp total_leave += lfp # get state and reward s1P, r, featurep,score,r2 = env.get_state() s1 = network.processState(s1P, N_station) total_steps += 1 if total_steps > pre_train_steps and j > warmup_time: # start training here if e > endE: e-=stepDrop # episode buffer # we don't store the initial 200 steps of the simulation, as warm up periods newr=r*np.ones((N_station)) v1=np.reshape(np.array([s, a, newr, s1,feature,score,featurep,e,total_train_iter]), [1,9]) global_epi_buffer.append(v1) global_bandit_buffer.append(v1) #exp replay # buffer_count+=1 # if buffer_count>=2*trace_length: # #pop the first trace length items # newbufferArray=[] # bufferArray=global_epi_buffer[:trace_length] # for bf in range(trace_length): # #recalibrate the rewards # reward_vec=sum([(y**id)*global_epi_buffer[bf+id][0][2] for id in range(trace_length)]) # bufferArray[bf][0][2]=reward_vec # exp_replay.add(bufferArray) # global_epi_buffer=global_epi_buffer[trace_length:] # buffer_count-=trace_length buffer_count+=1 if buffer_count>=2*trace_length: for it in range(trace_length): bufferArray=np.array(global_epi_buffer) exp_replay.add(bufferArray[it:it+trace_length]) global_epi_buffer=global_epi_buffer[trace_length:] buffer_count-=trace_length if total_steps % (500) == 0 and i>4: linubc_train = bandit_buffer.sample(batch_size * 40) linucb_agent.update(linubc_train[:, 4], linubc_train[:, 1], linubc_train[:, 5]) linucb_agent_backup.update(linubc_train[:, 4], linubc_train[:, 1], linubc_train[:, 5]) #use a single buffer if total_steps > pre_train_steps and j > warmup_time: #train linear multi-arm bandit first, we periodically update this (every 10*update_fequency steps) t1 = time.time() if total_steps % (update_freq) == 0: agent.update_target_net() # train_predict_score[train_predict_score<0.312]=100 # train_predict_score[train_predict_score>=0.312] =0 # predict_in=np.zeros((batch_size*trace_length,N_station+1)) # predict_in[:,:-1]=train_predict_score; # print('LINUCB predict time:', time.time() - t1) #get targetQ total_train_iter+=1/5000 trainBatch_list = [exp_replay.sample(batch_size, trace_length) for st in range(N_station)] for station in range(N_station): trainBatch= trainBatch_list[station] # generate the linucb score for each batch # train_predict_score= train_predict_score_list[(station)*batch_size*trace_length:(station+1)*batch_size*trace_length,:] * exp_dist train_predict_score = linucb_agent.return_upper_bound_batch(trainBatch[:, 6]) * exp_dist[hour] past_train_eps=np.vstack(trainBatch[:,7]) past_train_iter = np.vstack(trainBatch[:, 8]) current_action=np.vstack(trainBatch[:,1]) tr, t_action = agent.train_prepare(trainBatch, station) tp = train_predict_score/ distance[station, :] af = tp < e_threshold bf = tp >= e_threshold tp[af] = 100 tp[bf] = 0 tp[:, station] = 0 tempt = time.time() tz=sess.run(agent.targetZ[station],feed_dict={agent.scalarInput:np.vstack(trainBatch[:, 3]),agent.iter_holder:past_train_iter, agent.eps_holder:past_train_eps, agent.predict_score[station]:tp,agent.rewards[station]:tr,agent.trainLength:trace_length,agent.batch_size:batch_size}) targetz_time += time.time() - tempt tempt = time.time() sess.run(agent.updateModel[station], feed_dict={agent.targetQ[station]: tz, agent.rewards[station]: tr, agent.actions[station]: t_action, agent.scalarInput: np.vstack(trainBatch[:, 0]),agent.iter_holder:past_train_iter, agent.eps_holder:past_train_eps,agent.trainLength: trace_length, agent.batch_size: batch_size}) training_time += time.time() - tempt # train # sess.run(agent.updateModel[station],feed_dict={agent.targetQ[station]:tz,agent.rewards[station]:tr,agent.actions[station]:t_action,agent.scalarInput:np.vstack(trainBatch[:, 0]),agent.trainLength:trace_length,agent.batch_size:batch_size}) rAll += r rAll_unshape+=r2 # swap state s = s1 sP = s1P feature=featurep #preocess bandit buffer future_steps=2*trace_length tmask = np.linspace(0, 1, num=future_steps + 1) pdeta=0.5; quantile_mask=scipy.stats.norm.cdf(scipy.stats.norm.ppf(tmask)-pdeta) quantile_mask = np.diff(quantile_mask) # rescale the distribution to favor risk neutral or risk-averse behavior for epi in range(len(global_bandit_buffer)-future_steps-1): # print(global_bandit_buffer[i]) score=np.array([global_bandit_buffer[epi+k][0][5] for k in range(future_steps)]).T.dot(quantile_mask) record=global_bandit_buffer[epi] record[0][5]=score; #replay the score bandit_buffer.add(record) jList.append(j) rList.append(rAll) # reward in this episode sys_tracker.record_time(env) print('Episode:', i, ', totalreward:', rAll, ', old reward:',rAll_unshape,', total serve:', total_serve, ', total leave:', total_leave, ', total_cpu_time:',time.time()-tinit, ', terminal_taxi_distribution:', [len(v) for v in env.taxi_in_q], ', terminal_passenger:', [len(v) for v in env.passenger_qtime], e,agent.conf) n_vars=len(tf.trainable_variables()) print('TargetZ_time:',targetz_time,', Training time:',training_time, ', Prediction time:',prediction_time,'Number of tensorflow variables',n_vars) reward_out.write(str(i) + ',' + str(rAll) + '\n') outf.writelines(str(i)+','+str(rAll)+','+str(total_serve)+','+str(total_leave)+'\n') # Periodically save the model. if i % 20 == 0 and i != 0: saver.save(sess, path + '/model-' + str(i) + '.cptk') print("Saved Model") # if len(rList) % summaryLength == 0 and len(rList) != 0: # print(total_steps, np.mean(rList[-summaryLength:]), e) # saveToCenter(i,rList,jList,np.reshape(np.array(episodeBuffer),[len(episodeBuffer),5]),\ # summaryLength,h_size,sess,mainQN,time_per_step) # saver.save(sess,path+'/model-'+str(i)+'.cptk') outf.close() reward_out.close() sys_tracker.save('IDRQN') sys_tracker.playback(-1)
import DRQN_agent
random_line_split
update.rs
//! Types used to describe updates on graphs. use std::convert::TryInto; use std::fs::File; use std::sync::Mutex; use crate::errors::{GraphAnnisCoreError, Result}; use crate::serializer::KeySerializer; use bincode::Options; use serde::de::Error as DeserializeError; use serde::de::{MapAccess, Visitor}; use serde::ser::{Error as SerializeError, SerializeMap}; use serde::{Deserialize, Deserializer, Serialize, Serializer}; use sstable::{SSIterator, Table, TableBuilder, TableIterator}; use tempfile::NamedTempFile; /// Describes a single update on the graph. #[derive(Serialize, Deserialize, Clone, Debug, MallocSizeOf)] pub enum UpdateEvent { /// Add a node with a name and type. AddNode { node_name: String, node_type: String, }, /// Delete a node given by the name. DeleteNode { node_name: String }, /// Add a label to a the node given by the name. AddNodeLabel { node_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label of an node given by the name of the node and the qualified label name. DeleteNodeLabel { node_name: String, anno_ns: String, anno_name: String, }, /// Add an edge between two nodes given by their name. AddEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Delete an existing edge between two nodes given by their name. DeleteEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Add a label to an edge between two nodes. AddEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label from an edge between two nodes. DeleteEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, }, } enum ChangeSet { InProgress { table_builder: Box<TableBuilder<File>>, outfile: NamedTempFile, }, Finished { table: Table, }, } /// A list of changes to apply to an graph. pub struct GraphUpdate { changesets: Mutex<Vec<ChangeSet>>, event_counter: u64, serialization: bincode::config::DefaultOptions, } impl Default for GraphUpdate { fn default() -> Self { GraphUpdate::new() } } impl GraphUpdate { /// Create a new empty list of updates. pub fn new() -> GraphUpdate { GraphUpdate { event_counter: 0, changesets: Mutex::new(Vec::new()), serialization: bincode::options(), } } /// Add the given event to the update list. pub fn add_event(&mut self, event: UpdateEvent) -> Result<()> { let new_event_counter = self.event_counter + 1; let key = new_event_counter.create_key(); let value = self.serialization.serialize(&event)?; let mut changeset = self.changesets.lock()?; if let ChangeSet::InProgress { table_builder, .. } = current_inprogress_changeset(&mut changeset)? { table_builder.add(&key, &value)?; self.event_counter = new_event_counter; } Ok(()) } /// Get all changes pub fn iter(&self) -> Result<GraphUpdateIterator> { let it = GraphUpdateIterator::new(self)?; Ok(it) } /// Returns `true` if the update list is empty. pub fn is_empty(&self) -> Result<bool> { Ok(self.event_counter == 0) } // Returns the number of updates. pub fn len(&self) -> Result<usize> { let result = self.event_counter.try_into()?; Ok(result) } } fn finish_all_changesets(changesets: &mut Vec<ChangeSet>) -> Result<()> { // Remove all changesets from the vector and finish them let finished: Result<Vec<ChangeSet>> = changesets .drain(..) .map(|c| match c { ChangeSet::InProgress { table_builder, outfile, } => { table_builder.finish()?; // Re-open as table let file = outfile.reopen()?; let size = file.metadata()?.len(); let table = Table::new(sstable::Options::default(), Box::new(file), size as usize)?; Ok(ChangeSet::Finished { table }) } ChangeSet::Finished { table } => Ok(ChangeSet::Finished { table }), }) .collect(); // Re-add the finished changesets changesets.extend(finished?); Ok(()) } fn current_inprogress_changeset(changesets: &mut Vec<ChangeSet>) -> Result<&mut ChangeSet> { let needs_new_changeset = if let Some(c) = changesets.last_mut() { match c { ChangeSet::InProgress { .. } => false, ChangeSet::Finished { .. } => true, } } else { true }; if needs_new_changeset { // Create a new changeset let outfile = NamedTempFile::new()?; let table_builder = TableBuilder::new(sstable::Options::default(), outfile.reopen()?); let c = ChangeSet::InProgress { table_builder: Box::new(table_builder), outfile, }; changesets.push(c); } // Get the last changeset, which must be in the InProgress state changesets .last_mut() .ok_or(GraphAnnisCoreError::GraphUpdatePersistanceFileMissing) } pub struct GraphUpdateIterator { iterators: Vec<TableIterator>, size_hint: u64, serialization: bincode::config::DefaultOptions, } impl GraphUpdateIterator { fn new(g: &GraphUpdate) -> Result<GraphUpdateIterator> { let mut changesets = g.changesets.lock()?; finish_all_changesets(&mut changesets)?; let iterators: Vec<_> = changesets .iter() .filter_map(|c| match c { ChangeSet::InProgress { .. } => None, ChangeSet::Finished { table } => { let mut it = table.iter(); it.seek_to_first(); Some(it) } }) .collect(); Ok(GraphUpdateIterator { size_hint: g.event_counter, iterators, serialization: g.serialization, }) } } impl std::iter::Iterator for GraphUpdateIterator { type Item = Result<(u64, UpdateEvent)>; fn next(&mut self) -> Option<Self::Item> { // Remove all empty table iterators. self.iterators.retain(|it| it.valid()); if let Some(it) = self.iterators.first_mut() { // Get the current values if let Some((key, value)) = sstable::current_key_val(it) { // Create the actual types let id = match u64::parse_key(&key) { Ok(id) => id, Err(e) => return Some(Err(e.into())), }; let event: UpdateEvent = match self.serialization.deserialize(&value) { Ok(event) => event, Err(e) => return Some(Err(e.into())), }; // Advance for next iteration it.advance(); return Some(Ok((id, event))); } } None } fn size_hint(&self) -> (usize, Option<usize>) { if let Ok(s) = self.size_hint.try_into()
else { (0, None) } } } impl Serialize for GraphUpdate { fn serialize<S>(&self, serializer: S) -> std::result::Result<S::Ok, S::Error> where S: Serializer, { let iter = self.iter().map_err(S::Error::custom)?; let number_of_updates = self.len().map_err(S::Error::custom)?; let mut map_serializer = serializer.serialize_map(Some(number_of_updates))?; for entry in iter { let (key, value) = entry.map_err(S::Error::custom)?; map_serializer .serialize_entry(&key, &value) .map_err(S::Error::custom)?; } map_serializer.end() } } struct GraphUpdateVisitor {} impl<'de> Visitor<'de> for GraphUpdateVisitor { type Value = GraphUpdate; fn expecting(&self, formatter: &mut std::fmt::Formatter) -> std::fmt::Result { formatter.write_str("a list of graph updates") } fn visit_map<M>(self, mut access: M) -> std::result::Result<Self::Value, M::Error> where M: MapAccess<'de>, { let serialization = bincode::options(); let outfile = NamedTempFile::new().map_err(M::Error::custom)?; let mut table_builder = TableBuilder::new( sstable::Options::default(), outfile.reopen().map_err(M::Error::custom)?, ); let mut event_counter = 0; while let Some((id, event)) = access .next_entry::<u64, GraphUpdate>() .map_err(M::Error::custom)? { event_counter = id; let key = id.create_key(); let value = serialization.serialize(&event).map_err(M::Error::custom)?; table_builder.add(&key, &value).map_err(M::Error::custom)? } let c = ChangeSet::InProgress { outfile, table_builder: Box::new(table_builder), }; let mut changesets = vec![c]; finish_all_changesets(&mut changesets).map_err(M::Error::custom)?; let g = GraphUpdate { changesets: Mutex::new(changesets), event_counter, serialization, }; Ok(g) } } impl<'de> Deserialize<'de> for GraphUpdate { fn deserialize<D>(deserializer: D) -> std::result::Result<Self, D::Error> where D: Deserializer<'de>, { deserializer.deserialize_map(GraphUpdateVisitor {}) } }
{ (s, Some(s)) }
conditional_block
update.rs
//! Types used to describe updates on graphs. use std::convert::TryInto; use std::fs::File; use std::sync::Mutex; use crate::errors::{GraphAnnisCoreError, Result}; use crate::serializer::KeySerializer; use bincode::Options; use serde::de::Error as DeserializeError; use serde::de::{MapAccess, Visitor}; use serde::ser::{Error as SerializeError, SerializeMap}; use serde::{Deserialize, Deserializer, Serialize, Serializer}; use sstable::{SSIterator, Table, TableBuilder, TableIterator}; use tempfile::NamedTempFile; /// Describes a single update on the graph. #[derive(Serialize, Deserialize, Clone, Debug, MallocSizeOf)] pub enum UpdateEvent { /// Add a node with a name and type. AddNode { node_name: String, node_type: String, }, /// Delete a node given by the name. DeleteNode { node_name: String }, /// Add a label to a the node given by the name. AddNodeLabel { node_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label of an node given by the name of the node and the qualified label name. DeleteNodeLabel { node_name: String, anno_ns: String, anno_name: String, }, /// Add an edge between two nodes given by their name. AddEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Delete an existing edge between two nodes given by their name. DeleteEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Add a label to an edge between two nodes. AddEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label from an edge between two nodes. DeleteEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, }, } enum ChangeSet { InProgress { table_builder: Box<TableBuilder<File>>, outfile: NamedTempFile, }, Finished { table: Table, }, } /// A list of changes to apply to an graph. pub struct GraphUpdate { changesets: Mutex<Vec<ChangeSet>>, event_counter: u64, serialization: bincode::config::DefaultOptions, } impl Default for GraphUpdate { fn default() -> Self { GraphUpdate::new() } } impl GraphUpdate { /// Create a new empty list of updates. pub fn new() -> GraphUpdate { GraphUpdate { event_counter: 0, changesets: Mutex::new(Vec::new()), serialization: bincode::options(), } } /// Add the given event to the update list. pub fn add_event(&mut self, event: UpdateEvent) -> Result<()> { let new_event_counter = self.event_counter + 1; let key = new_event_counter.create_key(); let value = self.serialization.serialize(&event)?; let mut changeset = self.changesets.lock()?; if let ChangeSet::InProgress { table_builder, .. } = current_inprogress_changeset(&mut changeset)? { table_builder.add(&key, &value)?; self.event_counter = new_event_counter; } Ok(()) } /// Get all changes pub fn iter(&self) -> Result<GraphUpdateIterator> { let it = GraphUpdateIterator::new(self)?; Ok(it) } /// Returns `true` if the update list is empty. pub fn is_empty(&self) -> Result<bool> { Ok(self.event_counter == 0) } // Returns the number of updates. pub fn len(&self) -> Result<usize> { let result = self.event_counter.try_into()?; Ok(result) } } fn finish_all_changesets(changesets: &mut Vec<ChangeSet>) -> Result<()> { // Remove all changesets from the vector and finish them let finished: Result<Vec<ChangeSet>> = changesets .drain(..) .map(|c| match c { ChangeSet::InProgress { table_builder, outfile, } => { table_builder.finish()?; // Re-open as table let file = outfile.reopen()?; let size = file.metadata()?.len(); let table = Table::new(sstable::Options::default(), Box::new(file), size as usize)?; Ok(ChangeSet::Finished { table }) } ChangeSet::Finished { table } => Ok(ChangeSet::Finished { table }), }) .collect(); // Re-add the finished changesets changesets.extend(finished?); Ok(()) } fn current_inprogress_changeset(changesets: &mut Vec<ChangeSet>) -> Result<&mut ChangeSet> { let needs_new_changeset = if let Some(c) = changesets.last_mut() { match c { ChangeSet::InProgress { .. } => false, ChangeSet::Finished { .. } => true, } } else { true }; if needs_new_changeset { // Create a new changeset let outfile = NamedTempFile::new()?; let table_builder = TableBuilder::new(sstable::Options::default(), outfile.reopen()?); let c = ChangeSet::InProgress { table_builder: Box::new(table_builder), outfile, }; changesets.push(c); } // Get the last changeset, which must be in the InProgress state changesets .last_mut() .ok_or(GraphAnnisCoreError::GraphUpdatePersistanceFileMissing) } pub struct GraphUpdateIterator { iterators: Vec<TableIterator>, size_hint: u64, serialization: bincode::config::DefaultOptions, } impl GraphUpdateIterator { fn new(g: &GraphUpdate) -> Result<GraphUpdateIterator> { let mut changesets = g.changesets.lock()?; finish_all_changesets(&mut changesets)?; let iterators: Vec<_> = changesets .iter() .filter_map(|c| match c { ChangeSet::InProgress { .. } => None, ChangeSet::Finished { table } => { let mut it = table.iter(); it.seek_to_first(); Some(it) } }) .collect(); Ok(GraphUpdateIterator { size_hint: g.event_counter, iterators, serialization: g.serialization, }) } } impl std::iter::Iterator for GraphUpdateIterator { type Item = Result<(u64, UpdateEvent)>; fn next(&mut self) -> Option<Self::Item> { // Remove all empty table iterators. self.iterators.retain(|it| it.valid()); if let Some(it) = self.iterators.first_mut() { // Get the current values if let Some((key, value)) = sstable::current_key_val(it) { // Create the actual types let id = match u64::parse_key(&key) { Ok(id) => id, Err(e) => return Some(Err(e.into())), }; let event: UpdateEvent = match self.serialization.deserialize(&value) { Ok(event) => event, Err(e) => return Some(Err(e.into())), }; // Advance for next iteration it.advance(); return Some(Ok((id, event))); } } None }
if let Ok(s) = self.size_hint.try_into() { (s, Some(s)) } else { (0, None) } } } impl Serialize for GraphUpdate { fn serialize<S>(&self, serializer: S) -> std::result::Result<S::Ok, S::Error> where S: Serializer, { let iter = self.iter().map_err(S::Error::custom)?; let number_of_updates = self.len().map_err(S::Error::custom)?; let mut map_serializer = serializer.serialize_map(Some(number_of_updates))?; for entry in iter { let (key, value) = entry.map_err(S::Error::custom)?; map_serializer .serialize_entry(&key, &value) .map_err(S::Error::custom)?; } map_serializer.end() } } struct GraphUpdateVisitor {} impl<'de> Visitor<'de> for GraphUpdateVisitor { type Value = GraphUpdate; fn expecting(&self, formatter: &mut std::fmt::Formatter) -> std::fmt::Result { formatter.write_str("a list of graph updates") } fn visit_map<M>(self, mut access: M) -> std::result::Result<Self::Value, M::Error> where M: MapAccess<'de>, { let serialization = bincode::options(); let outfile = NamedTempFile::new().map_err(M::Error::custom)?; let mut table_builder = TableBuilder::new( sstable::Options::default(), outfile.reopen().map_err(M::Error::custom)?, ); let mut event_counter = 0; while let Some((id, event)) = access .next_entry::<u64, GraphUpdate>() .map_err(M::Error::custom)? { event_counter = id; let key = id.create_key(); let value = serialization.serialize(&event).map_err(M::Error::custom)?; table_builder.add(&key, &value).map_err(M::Error::custom)? } let c = ChangeSet::InProgress { outfile, table_builder: Box::new(table_builder), }; let mut changesets = vec![c]; finish_all_changesets(&mut changesets).map_err(M::Error::custom)?; let g = GraphUpdate { changesets: Mutex::new(changesets), event_counter, serialization, }; Ok(g) } } impl<'de> Deserialize<'de> for GraphUpdate { fn deserialize<D>(deserializer: D) -> std::result::Result<Self, D::Error> where D: Deserializer<'de>, { deserializer.deserialize_map(GraphUpdateVisitor {}) } }
fn size_hint(&self) -> (usize, Option<usize>) {
random_line_split
update.rs
//! Types used to describe updates on graphs. use std::convert::TryInto; use std::fs::File; use std::sync::Mutex; use crate::errors::{GraphAnnisCoreError, Result}; use crate::serializer::KeySerializer; use bincode::Options; use serde::de::Error as DeserializeError; use serde::de::{MapAccess, Visitor}; use serde::ser::{Error as SerializeError, SerializeMap}; use serde::{Deserialize, Deserializer, Serialize, Serializer}; use sstable::{SSIterator, Table, TableBuilder, TableIterator}; use tempfile::NamedTempFile; /// Describes a single update on the graph. #[derive(Serialize, Deserialize, Clone, Debug, MallocSizeOf)] pub enum UpdateEvent { /// Add a node with a name and type. AddNode { node_name: String, node_type: String, }, /// Delete a node given by the name. DeleteNode { node_name: String }, /// Add a label to a the node given by the name. AddNodeLabel { node_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label of an node given by the name of the node and the qualified label name. DeleteNodeLabel { node_name: String, anno_ns: String, anno_name: String, }, /// Add an edge between two nodes given by their name. AddEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Delete an existing edge between two nodes given by their name. DeleteEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Add a label to an edge between two nodes. AddEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label from an edge between two nodes. DeleteEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, }, } enum
{ InProgress { table_builder: Box<TableBuilder<File>>, outfile: NamedTempFile, }, Finished { table: Table, }, } /// A list of changes to apply to an graph. pub struct GraphUpdate { changesets: Mutex<Vec<ChangeSet>>, event_counter: u64, serialization: bincode::config::DefaultOptions, } impl Default for GraphUpdate { fn default() -> Self { GraphUpdate::new() } } impl GraphUpdate { /// Create a new empty list of updates. pub fn new() -> GraphUpdate { GraphUpdate { event_counter: 0, changesets: Mutex::new(Vec::new()), serialization: bincode::options(), } } /// Add the given event to the update list. pub fn add_event(&mut self, event: UpdateEvent) -> Result<()> { let new_event_counter = self.event_counter + 1; let key = new_event_counter.create_key(); let value = self.serialization.serialize(&event)?; let mut changeset = self.changesets.lock()?; if let ChangeSet::InProgress { table_builder, .. } = current_inprogress_changeset(&mut changeset)? { table_builder.add(&key, &value)?; self.event_counter = new_event_counter; } Ok(()) } /// Get all changes pub fn iter(&self) -> Result<GraphUpdateIterator> { let it = GraphUpdateIterator::new(self)?; Ok(it) } /// Returns `true` if the update list is empty. pub fn is_empty(&self) -> Result<bool> { Ok(self.event_counter == 0) } // Returns the number of updates. pub fn len(&self) -> Result<usize> { let result = self.event_counter.try_into()?; Ok(result) } } fn finish_all_changesets(changesets: &mut Vec<ChangeSet>) -> Result<()> { // Remove all changesets from the vector and finish them let finished: Result<Vec<ChangeSet>> = changesets .drain(..) .map(|c| match c { ChangeSet::InProgress { table_builder, outfile, } => { table_builder.finish()?; // Re-open as table let file = outfile.reopen()?; let size = file.metadata()?.len(); let table = Table::new(sstable::Options::default(), Box::new(file), size as usize)?; Ok(ChangeSet::Finished { table }) } ChangeSet::Finished { table } => Ok(ChangeSet::Finished { table }), }) .collect(); // Re-add the finished changesets changesets.extend(finished?); Ok(()) } fn current_inprogress_changeset(changesets: &mut Vec<ChangeSet>) -> Result<&mut ChangeSet> { let needs_new_changeset = if let Some(c) = changesets.last_mut() { match c { ChangeSet::InProgress { .. } => false, ChangeSet::Finished { .. } => true, } } else { true }; if needs_new_changeset { // Create a new changeset let outfile = NamedTempFile::new()?; let table_builder = TableBuilder::new(sstable::Options::default(), outfile.reopen()?); let c = ChangeSet::InProgress { table_builder: Box::new(table_builder), outfile, }; changesets.push(c); } // Get the last changeset, which must be in the InProgress state changesets .last_mut() .ok_or(GraphAnnisCoreError::GraphUpdatePersistanceFileMissing) } pub struct GraphUpdateIterator { iterators: Vec<TableIterator>, size_hint: u64, serialization: bincode::config::DefaultOptions, } impl GraphUpdateIterator { fn new(g: &GraphUpdate) -> Result<GraphUpdateIterator> { let mut changesets = g.changesets.lock()?; finish_all_changesets(&mut changesets)?; let iterators: Vec<_> = changesets .iter() .filter_map(|c| match c { ChangeSet::InProgress { .. } => None, ChangeSet::Finished { table } => { let mut it = table.iter(); it.seek_to_first(); Some(it) } }) .collect(); Ok(GraphUpdateIterator { size_hint: g.event_counter, iterators, serialization: g.serialization, }) } } impl std::iter::Iterator for GraphUpdateIterator { type Item = Result<(u64, UpdateEvent)>; fn next(&mut self) -> Option<Self::Item> { // Remove all empty table iterators. self.iterators.retain(|it| it.valid()); if let Some(it) = self.iterators.first_mut() { // Get the current values if let Some((key, value)) = sstable::current_key_val(it) { // Create the actual types let id = match u64::parse_key(&key) { Ok(id) => id, Err(e) => return Some(Err(e.into())), }; let event: UpdateEvent = match self.serialization.deserialize(&value) { Ok(event) => event, Err(e) => return Some(Err(e.into())), }; // Advance for next iteration it.advance(); return Some(Ok((id, event))); } } None } fn size_hint(&self) -> (usize, Option<usize>) { if let Ok(s) = self.size_hint.try_into() { (s, Some(s)) } else { (0, None) } } } impl Serialize for GraphUpdate { fn serialize<S>(&self, serializer: S) -> std::result::Result<S::Ok, S::Error> where S: Serializer, { let iter = self.iter().map_err(S::Error::custom)?; let number_of_updates = self.len().map_err(S::Error::custom)?; let mut map_serializer = serializer.serialize_map(Some(number_of_updates))?; for entry in iter { let (key, value) = entry.map_err(S::Error::custom)?; map_serializer .serialize_entry(&key, &value) .map_err(S::Error::custom)?; } map_serializer.end() } } struct GraphUpdateVisitor {} impl<'de> Visitor<'de> for GraphUpdateVisitor { type Value = GraphUpdate; fn expecting(&self, formatter: &mut std::fmt::Formatter) -> std::fmt::Result { formatter.write_str("a list of graph updates") } fn visit_map<M>(self, mut access: M) -> std::result::Result<Self::Value, M::Error> where M: MapAccess<'de>, { let serialization = bincode::options(); let outfile = NamedTempFile::new().map_err(M::Error::custom)?; let mut table_builder = TableBuilder::new( sstable::Options::default(), outfile.reopen().map_err(M::Error::custom)?, ); let mut event_counter = 0; while let Some((id, event)) = access .next_entry::<u64, GraphUpdate>() .map_err(M::Error::custom)? { event_counter = id; let key = id.create_key(); let value = serialization.serialize(&event).map_err(M::Error::custom)?; table_builder.add(&key, &value).map_err(M::Error::custom)? } let c = ChangeSet::InProgress { outfile, table_builder: Box::new(table_builder), }; let mut changesets = vec![c]; finish_all_changesets(&mut changesets).map_err(M::Error::custom)?; let g = GraphUpdate { changesets: Mutex::new(changesets), event_counter, serialization, }; Ok(g) } } impl<'de> Deserialize<'de> for GraphUpdate { fn deserialize<D>(deserializer: D) -> std::result::Result<Self, D::Error> where D: Deserializer<'de>, { deserializer.deserialize_map(GraphUpdateVisitor {}) } }
ChangeSet
identifier_name
update.rs
//! Types used to describe updates on graphs. use std::convert::TryInto; use std::fs::File; use std::sync::Mutex; use crate::errors::{GraphAnnisCoreError, Result}; use crate::serializer::KeySerializer; use bincode::Options; use serde::de::Error as DeserializeError; use serde::de::{MapAccess, Visitor}; use serde::ser::{Error as SerializeError, SerializeMap}; use serde::{Deserialize, Deserializer, Serialize, Serializer}; use sstable::{SSIterator, Table, TableBuilder, TableIterator}; use tempfile::NamedTempFile; /// Describes a single update on the graph. #[derive(Serialize, Deserialize, Clone, Debug, MallocSizeOf)] pub enum UpdateEvent { /// Add a node with a name and type. AddNode { node_name: String, node_type: String, }, /// Delete a node given by the name. DeleteNode { node_name: String }, /// Add a label to a the node given by the name. AddNodeLabel { node_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label of an node given by the name of the node and the qualified label name. DeleteNodeLabel { node_name: String, anno_ns: String, anno_name: String, }, /// Add an edge between two nodes given by their name. AddEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Delete an existing edge between two nodes given by their name. DeleteEdge { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, }, /// Add a label to an edge between two nodes. AddEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, anno_value: String, }, /// Delete a label from an edge between two nodes. DeleteEdgeLabel { source_node: String, target_node: String, layer: String, component_type: String, component_name: String, anno_ns: String, anno_name: String, }, } enum ChangeSet { InProgress { table_builder: Box<TableBuilder<File>>, outfile: NamedTempFile, }, Finished { table: Table, }, } /// A list of changes to apply to an graph. pub struct GraphUpdate { changesets: Mutex<Vec<ChangeSet>>, event_counter: u64, serialization: bincode::config::DefaultOptions, } impl Default for GraphUpdate { fn default() -> Self { GraphUpdate::new() } } impl GraphUpdate { /// Create a new empty list of updates. pub fn new() -> GraphUpdate { GraphUpdate { event_counter: 0, changesets: Mutex::new(Vec::new()), serialization: bincode::options(), } } /// Add the given event to the update list. pub fn add_event(&mut self, event: UpdateEvent) -> Result<()> { let new_event_counter = self.event_counter + 1; let key = new_event_counter.create_key(); let value = self.serialization.serialize(&event)?; let mut changeset = self.changesets.lock()?; if let ChangeSet::InProgress { table_builder, .. } = current_inprogress_changeset(&mut changeset)? { table_builder.add(&key, &value)?; self.event_counter = new_event_counter; } Ok(()) } /// Get all changes pub fn iter(&self) -> Result<GraphUpdateIterator> { let it = GraphUpdateIterator::new(self)?; Ok(it) } /// Returns `true` if the update list is empty. pub fn is_empty(&self) -> Result<bool> { Ok(self.event_counter == 0) } // Returns the number of updates. pub fn len(&self) -> Result<usize> { let result = self.event_counter.try_into()?; Ok(result) } } fn finish_all_changesets(changesets: &mut Vec<ChangeSet>) -> Result<()> { // Remove all changesets from the vector and finish them let finished: Result<Vec<ChangeSet>> = changesets .drain(..) .map(|c| match c { ChangeSet::InProgress { table_builder, outfile, } => { table_builder.finish()?; // Re-open as table let file = outfile.reopen()?; let size = file.metadata()?.len(); let table = Table::new(sstable::Options::default(), Box::new(file), size as usize)?; Ok(ChangeSet::Finished { table }) } ChangeSet::Finished { table } => Ok(ChangeSet::Finished { table }), }) .collect(); // Re-add the finished changesets changesets.extend(finished?); Ok(()) } fn current_inprogress_changeset(changesets: &mut Vec<ChangeSet>) -> Result<&mut ChangeSet> { let needs_new_changeset = if let Some(c) = changesets.last_mut() { match c { ChangeSet::InProgress { .. } => false, ChangeSet::Finished { .. } => true, } } else { true }; if needs_new_changeset { // Create a new changeset let outfile = NamedTempFile::new()?; let table_builder = TableBuilder::new(sstable::Options::default(), outfile.reopen()?); let c = ChangeSet::InProgress { table_builder: Box::new(table_builder), outfile, }; changesets.push(c); } // Get the last changeset, which must be in the InProgress state changesets .last_mut() .ok_or(GraphAnnisCoreError::GraphUpdatePersistanceFileMissing) } pub struct GraphUpdateIterator { iterators: Vec<TableIterator>, size_hint: u64, serialization: bincode::config::DefaultOptions, } impl GraphUpdateIterator { fn new(g: &GraphUpdate) -> Result<GraphUpdateIterator> { let mut changesets = g.changesets.lock()?; finish_all_changesets(&mut changesets)?; let iterators: Vec<_> = changesets .iter() .filter_map(|c| match c { ChangeSet::InProgress { .. } => None, ChangeSet::Finished { table } => { let mut it = table.iter(); it.seek_to_first(); Some(it) } }) .collect(); Ok(GraphUpdateIterator { size_hint: g.event_counter, iterators, serialization: g.serialization, }) } } impl std::iter::Iterator for GraphUpdateIterator { type Item = Result<(u64, UpdateEvent)>; fn next(&mut self) -> Option<Self::Item>
fn size_hint(&self) -> (usize, Option<usize>) { if let Ok(s) = self.size_hint.try_into() { (s, Some(s)) } else { (0, None) } } } impl Serialize for GraphUpdate { fn serialize<S>(&self, serializer: S) -> std::result::Result<S::Ok, S::Error> where S: Serializer, { let iter = self.iter().map_err(S::Error::custom)?; let number_of_updates = self.len().map_err(S::Error::custom)?; let mut map_serializer = serializer.serialize_map(Some(number_of_updates))?; for entry in iter { let (key, value) = entry.map_err(S::Error::custom)?; map_serializer .serialize_entry(&key, &value) .map_err(S::Error::custom)?; } map_serializer.end() } } struct GraphUpdateVisitor {} impl<'de> Visitor<'de> for GraphUpdateVisitor { type Value = GraphUpdate; fn expecting(&self, formatter: &mut std::fmt::Formatter) -> std::fmt::Result { formatter.write_str("a list of graph updates") } fn visit_map<M>(self, mut access: M) -> std::result::Result<Self::Value, M::Error> where M: MapAccess<'de>, { let serialization = bincode::options(); let outfile = NamedTempFile::new().map_err(M::Error::custom)?; let mut table_builder = TableBuilder::new( sstable::Options::default(), outfile.reopen().map_err(M::Error::custom)?, ); let mut event_counter = 0; while let Some((id, event)) = access .next_entry::<u64, GraphUpdate>() .map_err(M::Error::custom)? { event_counter = id; let key = id.create_key(); let value = serialization.serialize(&event).map_err(M::Error::custom)?; table_builder.add(&key, &value).map_err(M::Error::custom)? } let c = ChangeSet::InProgress { outfile, table_builder: Box::new(table_builder), }; let mut changesets = vec![c]; finish_all_changesets(&mut changesets).map_err(M::Error::custom)?; let g = GraphUpdate { changesets: Mutex::new(changesets), event_counter, serialization, }; Ok(g) } } impl<'de> Deserialize<'de> for GraphUpdate { fn deserialize<D>(deserializer: D) -> std::result::Result<Self, D::Error> where D: Deserializer<'de>, { deserializer.deserialize_map(GraphUpdateVisitor {}) } }
{ // Remove all empty table iterators. self.iterators.retain(|it| it.valid()); if let Some(it) = self.iterators.first_mut() { // Get the current values if let Some((key, value)) = sstable::current_key_val(it) { // Create the actual types let id = match u64::parse_key(&key) { Ok(id) => id, Err(e) => return Some(Err(e.into())), }; let event: UpdateEvent = match self.serialization.deserialize(&value) { Ok(event) => event, Err(e) => return Some(Err(e.into())), }; // Advance for next iteration it.advance(); return Some(Ok((id, event))); } } None }
identifier_body
main.rs
#![warn(clippy::all)] #![forbid(unsafe_code)] // Import from other crates. use csv::ByteRecord; use humansize::{file_size_opts, FileSize}; use lazy_static::lazy_static; use log::debug; use regex::bytes::Regex; use std::{ borrow::Cow, fs, io::{self, prelude::*}, path::PathBuf, process, }; use structopt::StructOpt; // Modules defined in separate files. #[macro_use] mod errors; mod uniquifier; mod util; // Import from our own crates. use crate::errors::*; use crate::uniquifier::Uniquifier; use crate::util::{now, CharSpecifier}; /// Use reasonably large input and output buffers. This seems to give us a /// performance boost of around 5-10% compared to the standard 8 KiB buffer used /// by `csv`. const BUFFER_SIZE: usize = 256 * 1024; /// Our command-line arguments. #[derive(Debug, StructOpt)] #[structopt( name = "scrubcsv", about = "Clean and normalize a CSV file.", after_help = "Read a CSV file, normalize the \"good\" lines, and print them to standard output. Discard any lines with the wrong number of columns. Regular expressions use Rust syntax, as described here: https://doc.rust-lang.org/regex/regex/index.html#syntax scrubcsv should work with any ASCII-compatible encoding, but it will not attempt to transcode. Exit code: 0 on success 1 on error 2 if more than 10% of rows were bad" )] struct
{ /// Input file (uses stdin if omitted). input: Option<PathBuf>, /// Character used to separate fields in a row (must be a single ASCII /// byte, or "tab"). #[structopt( value_name = "CHAR", short = "d", long = "delimiter", default_value = "," )] delimiter: CharSpecifier, /// Convert values matching NULL_REGEX to an empty string. For a case-insensitive /// match, use `(?i)`: `--null '(?i)NULL'`. #[structopt(value_name = "NULL_REGEX", short = "n", long = "null")] null: Option<String>, /// Replace LF and CRLF sequences in values with spaces. This should improve /// compatibility with systems like BigQuery that don't expect newlines /// inside escaped strings. #[structopt(long = "replace-newlines")] replace_newlines: bool, /// Remove whitespace at beginning and end of each cell. #[structopt(long = "trim-whitespace")] trim_whitespace: bool, /// Make sure column names are unique, and use only lowercase letters, numbers /// and underscores. #[structopt(long = "clean-column-names")] clean_column_names: bool, /// Drop any rows where the specified column is empty or NULL. Can be passed /// more than once. Useful for cleaning primary key columns before /// upserting. Uses the cleaned form of column names. #[structopt(value_name = "COL", long = "drop-row-if-null")] drop_row_if_null: Vec<String>, /// Do not print performance information. #[structopt(short = "q", long = "quiet")] quiet: bool, /// Character used to quote entries. May be set to "none" to ignore all /// quoting. #[structopt(value_name = "CHAR", long = "quote", default_value = "\"")] quote: CharSpecifier, } lazy_static! { /// Either a CRLF newline, a LF newline, or a CR newline. Any of these /// will break certain CSV parsers, including BigQuery's CSV importer. static ref NEWLINE_RE: Regex = Regex::new(r#"\n|\r\n?"#) .expect("regex in source code is unparseable"); } /// This is a helper function called by our `main` function. Unlike /// `main`, we return a `Result`, which means that we can use `?` and other /// standard error-handling machinery. fn run() -> Result<()> { // Set up logging. env_logger::init(); // Parse our command-line arguments using `docopt`. let opt: Opt = Opt::from_args(); debug!("Options: {:#?}", opt); // Remember the time we started. let start_time = now(); // Build a regex containing our `--null` value. let null_re = if let Some(null_re_str) = opt.null.as_ref() { // Always match the full CSV value. let s = format!("^{}$", null_re_str); let re = Regex::new(&s).context("can't compile regular expression")?; Some(re) } else { None }; // Fetch our input from either standard input or a file. The only tricky // detail here is that we use a `Box<dyn Read>` to represent "some object // implementing `Read`, stored on the heap." This allows us to do runtime // dispatch (as if Rust were object oriented). But because `csv` wraps a // `BufReader` around the box, we only do that dispatch once per buffer // flush, not on every tiny write. let stdin = io::stdin(); let input: Box<dyn Read> = if let Some(ref path) = opt.input { Box::new( fs::File::open(path) .with_context(|_| format!("cannot open {}", path.display()))?, ) } else { Box::new(stdin.lock()) }; // Create our CSV reader. let mut rdr_builder = csv::ReaderBuilder::new(); // Set a reasonable buffer size. rdr_builder.buffer_capacity(BUFFER_SIZE); // We need headers so that we can honor --drop-row-if-null. rdr_builder.has_headers(true); // Allow records with the wrong number of columns. rdr_builder.flexible(true); // Configure our delimiter. if let Some(delimiter) = opt.delimiter.char() { rdr_builder.delimiter(delimiter); } else { return Err(format_err!("field delimiter is required")); } // Configure our quote character. if let Some(quote) = opt.quote.char() { rdr_builder.quote(quote); } else { rdr_builder.quoting(false); } let mut rdr = rdr_builder.from_reader(input); // We lock `stdout`, giving us exclusive access. In the past, this has made // an enormous difference in performance. let stdout = io::stdout(); let output = stdout.lock(); // Create our CSV writer. Note that we _don't_ allow variable numbers // of columns, non-standard delimiters, or other nonsense: We want our // output to be highly normalized. let mut wtr = csv::WriterBuilder::new() .buffer_capacity(BUFFER_SIZE) .from_writer(output); // Get our header and, if we were asked, make sure all the column names are unique. let mut hdr = rdr .byte_headers() .context("cannot read headers")? .to_owned(); if opt.clean_column_names { let mut uniquifier = Uniquifier::default(); let mut new_hdr = ByteRecord::default(); for col in hdr.into_iter() { // Convert from bytes to UTF-8, make unique (and clean), and convert back to bytes. let col = String::from_utf8_lossy(col); let col = uniquifier.unique_id_for(&col)?.to_owned(); new_hdr.push_field(col.as_bytes()); } hdr = new_hdr; } // Write our header to our output. wtr.write_byte_record(&hdr) .context("cannot write headers")?; // Calculate the number of expected columns. let expected_cols = hdr.len(); // Just in case --drop-row-if-null was passed, precompute which columns are // required to contain a value. let required_cols = hdr .iter() .map(|name| -> bool { opt.drop_row_if_null .iter() .any(|requried_name| requried_name.as_bytes() == name) }) .collect::<Vec<bool>>(); // Keep track of total rows and malformed rows seen. We count the header as // a row for backwards compatibility. let mut rows: u64 = 1; let mut bad_rows: u64 = 0; // Can we use the fast path and copy the data through unchanged? Or do we // need to clean up emebedded newlines in our data? (These break BigQuery, // for example.) let use_fast_path = null_re.is_none() && !opt.replace_newlines && !opt.trim_whitespace && opt.drop_row_if_null.is_empty(); // Iterate over all the rows, checking to make sure they look reasonable. // // If we use the lowest-level, zero-copy API for `csv`, we can process about // 225 MB/s. But it turns out we can't do that, because we need to count // all the row's fields before deciding whether or not to write it out. 'next_row: for record in rdr.byte_records() { let record = record.context("cannot read record")?; // Keep track of how many rows we've seen. rows += 1; // Check if we have the right number of columns in this row. if record.len() != expected_cols { bad_rows += 1; debug!( "row {}: expected {} columns, found {}", rows, expected_cols, record.len(), ); continue 'next_row; } // Decide how to handle this row. if use_fast_path { // We don't need to do anything fancy, so just pass it through. // I'm not sure how much this actually buys us in current Rust // versions, but it seemed like a good idea at the time. wtr.write_record(record.into_iter()) .context("cannot write record")?; } else { // We need to apply one or more cleanups, so run the slow path. let cleaned = record.into_iter().map(|mut val: &[u8]| -> Cow<[u8]> { // Convert values matching `--null` regex to empty strings. if let Some(ref null_re) = null_re { if null_re.is_match(val) { val = &[] } } // Remove whitespace from our cells. if opt.trim_whitespace { // We do this manually, because the built-in `trim` only // works on UTF-8 strings, and we work on any // "ASCII-compatible" encoding. let first = val.iter().position(|c| !c.is_ascii_whitespace()); let last = val.iter().rposition(|c| !c.is_ascii_whitespace()); val = match (first, last) { (Some(first), Some(last)) if first <= last => { &val[first..=last] } (None, None) => &[], _ => panic!( "tried to trim {:?}, got impossible indices {:?} {:?}", val, first, last, ), }; } // Fix newlines. if opt.replace_newlines && (val.contains(&b'\n') || val.contains(&b'\r')) { NEWLINE_RE.replace_all(val, &b" "[..]) } else { Cow::Borrowed(val) } }); if opt.drop_row_if_null.is_empty() { // Still somewhat fast! wtr.write_record(cleaned).context("cannot write record")?; } else { // We need to rebuild the record, check for null columns, // and only output the record if everything's OK. let row = cleaned.collect::<Vec<Cow<[u8]>>>(); for (value, &is_required_col) in row.iter().zip(required_cols.iter()) { // If the column is NULL but shouldn't be, bail on this row. if is_required_col && value.is_empty() { bad_rows += 1; debug!("row {}: required column is empty", rows); continue 'next_row; } } wtr.write_record(row).context("cannot write record")?; } } } // Flush all our buffers. wtr.flush().context("error writing records")?; // Print out some information about our run. if !opt.quiet { let ellapsed = (now() - start_time).as_seconds_f64(); let bytes_per_second = (rdr.position().byte() as f64 / ellapsed) as i64; eprintln!( "{} rows ({} bad) in {:.2} seconds, {}/sec", rows, bad_rows, ellapsed, bytes_per_second.file_size(file_size_opts::BINARY)?, ); } // If more than 10% of rows are bad, assume something has gone horribly // wrong. if bad_rows.checked_mul(10).expect("multiplication overflow") > rows { eprintln!("Too many rows ({} of {}) were bad", bad_rows, rows); process::exit(2); } Ok(()) } fn main() { if let Err(err) = run() { eprintln!("ERROR: {}", err); let mut source = err.source(); while let Some(cause) = source { eprintln!(" caused by: {}", cause); source = cause.source(); } process::exit(1); } }
Opt
identifier_name
main.rs
#![warn(clippy::all)] #![forbid(unsafe_code)] // Import from other crates. use csv::ByteRecord; use humansize::{file_size_opts, FileSize}; use lazy_static::lazy_static; use log::debug; use regex::bytes::Regex; use std::{ borrow::Cow, fs, io::{self, prelude::*}, path::PathBuf, process, }; use structopt::StructOpt; // Modules defined in separate files. #[macro_use] mod errors; mod uniquifier; mod util; // Import from our own crates. use crate::errors::*; use crate::uniquifier::Uniquifier; use crate::util::{now, CharSpecifier}; /// Use reasonably large input and output buffers. This seems to give us a /// performance boost of around 5-10% compared to the standard 8 KiB buffer used /// by `csv`. const BUFFER_SIZE: usize = 256 * 1024; /// Our command-line arguments. #[derive(Debug, StructOpt)] #[structopt( name = "scrubcsv", about = "Clean and normalize a CSV file.", after_help = "Read a CSV file, normalize the \"good\" lines, and print them to standard output. Discard any lines with the wrong number of columns. Regular expressions use Rust syntax, as described here: https://doc.rust-lang.org/regex/regex/index.html#syntax scrubcsv should work with any ASCII-compatible encoding, but it will not attempt to transcode. Exit code: 0 on success 1 on error 2 if more than 10% of rows were bad" )] struct Opt { /// Input file (uses stdin if omitted). input: Option<PathBuf>, /// Character used to separate fields in a row (must be a single ASCII /// byte, or "tab"). #[structopt( value_name = "CHAR", short = "d", long = "delimiter", default_value = "," )] delimiter: CharSpecifier, /// Convert values matching NULL_REGEX to an empty string. For a case-insensitive /// match, use `(?i)`: `--null '(?i)NULL'`. #[structopt(value_name = "NULL_REGEX", short = "n", long = "null")] null: Option<String>, /// Replace LF and CRLF sequences in values with spaces. This should improve /// compatibility with systems like BigQuery that don't expect newlines /// inside escaped strings. #[structopt(long = "replace-newlines")] replace_newlines: bool, /// Remove whitespace at beginning and end of each cell. #[structopt(long = "trim-whitespace")] trim_whitespace: bool, /// Make sure column names are unique, and use only lowercase letters, numbers /// and underscores. #[structopt(long = "clean-column-names")] clean_column_names: bool, /// Drop any rows where the specified column is empty or NULL. Can be passed /// more than once. Useful for cleaning primary key columns before /// upserting. Uses the cleaned form of column names. #[structopt(value_name = "COL", long = "drop-row-if-null")] drop_row_if_null: Vec<String>, /// Do not print performance information. #[structopt(short = "q", long = "quiet")] quiet: bool, /// Character used to quote entries. May be set to "none" to ignore all /// quoting. #[structopt(value_name = "CHAR", long = "quote", default_value = "\"")] quote: CharSpecifier, } lazy_static! { /// Either a CRLF newline, a LF newline, or a CR newline. Any of these /// will break certain CSV parsers, including BigQuery's CSV importer. static ref NEWLINE_RE: Regex = Regex::new(r#"\n|\r\n?"#) .expect("regex in source code is unparseable"); } /// This is a helper function called by our `main` function. Unlike /// `main`, we return a `Result`, which means that we can use `?` and other /// standard error-handling machinery. fn run() -> Result<()> { // Set up logging. env_logger::init(); // Parse our command-line arguments using `docopt`. let opt: Opt = Opt::from_args(); debug!("Options: {:#?}", opt); // Remember the time we started. let start_time = now(); // Build a regex containing our `--null` value. let null_re = if let Some(null_re_str) = opt.null.as_ref() { // Always match the full CSV value. let s = format!("^{}$", null_re_str); let re = Regex::new(&s).context("can't compile regular expression")?; Some(re) } else { None }; // Fetch our input from either standard input or a file. The only tricky // detail here is that we use a `Box<dyn Read>` to represent "some object
// flush, not on every tiny write. let stdin = io::stdin(); let input: Box<dyn Read> = if let Some(ref path) = opt.input { Box::new( fs::File::open(path) .with_context(|_| format!("cannot open {}", path.display()))?, ) } else { Box::new(stdin.lock()) }; // Create our CSV reader. let mut rdr_builder = csv::ReaderBuilder::new(); // Set a reasonable buffer size. rdr_builder.buffer_capacity(BUFFER_SIZE); // We need headers so that we can honor --drop-row-if-null. rdr_builder.has_headers(true); // Allow records with the wrong number of columns. rdr_builder.flexible(true); // Configure our delimiter. if let Some(delimiter) = opt.delimiter.char() { rdr_builder.delimiter(delimiter); } else { return Err(format_err!("field delimiter is required")); } // Configure our quote character. if let Some(quote) = opt.quote.char() { rdr_builder.quote(quote); } else { rdr_builder.quoting(false); } let mut rdr = rdr_builder.from_reader(input); // We lock `stdout`, giving us exclusive access. In the past, this has made // an enormous difference in performance. let stdout = io::stdout(); let output = stdout.lock(); // Create our CSV writer. Note that we _don't_ allow variable numbers // of columns, non-standard delimiters, or other nonsense: We want our // output to be highly normalized. let mut wtr = csv::WriterBuilder::new() .buffer_capacity(BUFFER_SIZE) .from_writer(output); // Get our header and, if we were asked, make sure all the column names are unique. let mut hdr = rdr .byte_headers() .context("cannot read headers")? .to_owned(); if opt.clean_column_names { let mut uniquifier = Uniquifier::default(); let mut new_hdr = ByteRecord::default(); for col in hdr.into_iter() { // Convert from bytes to UTF-8, make unique (and clean), and convert back to bytes. let col = String::from_utf8_lossy(col); let col = uniquifier.unique_id_for(&col)?.to_owned(); new_hdr.push_field(col.as_bytes()); } hdr = new_hdr; } // Write our header to our output. wtr.write_byte_record(&hdr) .context("cannot write headers")?; // Calculate the number of expected columns. let expected_cols = hdr.len(); // Just in case --drop-row-if-null was passed, precompute which columns are // required to contain a value. let required_cols = hdr .iter() .map(|name| -> bool { opt.drop_row_if_null .iter() .any(|requried_name| requried_name.as_bytes() == name) }) .collect::<Vec<bool>>(); // Keep track of total rows and malformed rows seen. We count the header as // a row for backwards compatibility. let mut rows: u64 = 1; let mut bad_rows: u64 = 0; // Can we use the fast path and copy the data through unchanged? Or do we // need to clean up emebedded newlines in our data? (These break BigQuery, // for example.) let use_fast_path = null_re.is_none() && !opt.replace_newlines && !opt.trim_whitespace && opt.drop_row_if_null.is_empty(); // Iterate over all the rows, checking to make sure they look reasonable. // // If we use the lowest-level, zero-copy API for `csv`, we can process about // 225 MB/s. But it turns out we can't do that, because we need to count // all the row's fields before deciding whether or not to write it out. 'next_row: for record in rdr.byte_records() { let record = record.context("cannot read record")?; // Keep track of how many rows we've seen. rows += 1; // Check if we have the right number of columns in this row. if record.len() != expected_cols { bad_rows += 1; debug!( "row {}: expected {} columns, found {}", rows, expected_cols, record.len(), ); continue 'next_row; } // Decide how to handle this row. if use_fast_path { // We don't need to do anything fancy, so just pass it through. // I'm not sure how much this actually buys us in current Rust // versions, but it seemed like a good idea at the time. wtr.write_record(record.into_iter()) .context("cannot write record")?; } else { // We need to apply one or more cleanups, so run the slow path. let cleaned = record.into_iter().map(|mut val: &[u8]| -> Cow<[u8]> { // Convert values matching `--null` regex to empty strings. if let Some(ref null_re) = null_re { if null_re.is_match(val) { val = &[] } } // Remove whitespace from our cells. if opt.trim_whitespace { // We do this manually, because the built-in `trim` only // works on UTF-8 strings, and we work on any // "ASCII-compatible" encoding. let first = val.iter().position(|c| !c.is_ascii_whitespace()); let last = val.iter().rposition(|c| !c.is_ascii_whitespace()); val = match (first, last) { (Some(first), Some(last)) if first <= last => { &val[first..=last] } (None, None) => &[], _ => panic!( "tried to trim {:?}, got impossible indices {:?} {:?}", val, first, last, ), }; } // Fix newlines. if opt.replace_newlines && (val.contains(&b'\n') || val.contains(&b'\r')) { NEWLINE_RE.replace_all(val, &b" "[..]) } else { Cow::Borrowed(val) } }); if opt.drop_row_if_null.is_empty() { // Still somewhat fast! wtr.write_record(cleaned).context("cannot write record")?; } else { // We need to rebuild the record, check for null columns, // and only output the record if everything's OK. let row = cleaned.collect::<Vec<Cow<[u8]>>>(); for (value, &is_required_col) in row.iter().zip(required_cols.iter()) { // If the column is NULL but shouldn't be, bail on this row. if is_required_col && value.is_empty() { bad_rows += 1; debug!("row {}: required column is empty", rows); continue 'next_row; } } wtr.write_record(row).context("cannot write record")?; } } } // Flush all our buffers. wtr.flush().context("error writing records")?; // Print out some information about our run. if !opt.quiet { let ellapsed = (now() - start_time).as_seconds_f64(); let bytes_per_second = (rdr.position().byte() as f64 / ellapsed) as i64; eprintln!( "{} rows ({} bad) in {:.2} seconds, {}/sec", rows, bad_rows, ellapsed, bytes_per_second.file_size(file_size_opts::BINARY)?, ); } // If more than 10% of rows are bad, assume something has gone horribly // wrong. if bad_rows.checked_mul(10).expect("multiplication overflow") > rows { eprintln!("Too many rows ({} of {}) were bad", bad_rows, rows); process::exit(2); } Ok(()) } fn main() { if let Err(err) = run() { eprintln!("ERROR: {}", err); let mut source = err.source(); while let Some(cause) = source { eprintln!(" caused by: {}", cause); source = cause.source(); } process::exit(1); } }
// implementing `Read`, stored on the heap." This allows us to do runtime // dispatch (as if Rust were object oriented). But because `csv` wraps a // `BufReader` around the box, we only do that dispatch once per buffer
random_line_split
main.rs
#![warn(clippy::all)] #![forbid(unsafe_code)] // Import from other crates. use csv::ByteRecord; use humansize::{file_size_opts, FileSize}; use lazy_static::lazy_static; use log::debug; use regex::bytes::Regex; use std::{ borrow::Cow, fs, io::{self, prelude::*}, path::PathBuf, process, }; use structopt::StructOpt; // Modules defined in separate files. #[macro_use] mod errors; mod uniquifier; mod util; // Import from our own crates. use crate::errors::*; use crate::uniquifier::Uniquifier; use crate::util::{now, CharSpecifier}; /// Use reasonably large input and output buffers. This seems to give us a /// performance boost of around 5-10% compared to the standard 8 KiB buffer used /// by `csv`. const BUFFER_SIZE: usize = 256 * 1024; /// Our command-line arguments. #[derive(Debug, StructOpt)] #[structopt( name = "scrubcsv", about = "Clean and normalize a CSV file.", after_help = "Read a CSV file, normalize the \"good\" lines, and print them to standard output. Discard any lines with the wrong number of columns. Regular expressions use Rust syntax, as described here: https://doc.rust-lang.org/regex/regex/index.html#syntax scrubcsv should work with any ASCII-compatible encoding, but it will not attempt to transcode. Exit code: 0 on success 1 on error 2 if more than 10% of rows were bad" )] struct Opt { /// Input file (uses stdin if omitted). input: Option<PathBuf>, /// Character used to separate fields in a row (must be a single ASCII /// byte, or "tab"). #[structopt( value_name = "CHAR", short = "d", long = "delimiter", default_value = "," )] delimiter: CharSpecifier, /// Convert values matching NULL_REGEX to an empty string. For a case-insensitive /// match, use `(?i)`: `--null '(?i)NULL'`. #[structopt(value_name = "NULL_REGEX", short = "n", long = "null")] null: Option<String>, /// Replace LF and CRLF sequences in values with spaces. This should improve /// compatibility with systems like BigQuery that don't expect newlines /// inside escaped strings. #[structopt(long = "replace-newlines")] replace_newlines: bool, /// Remove whitespace at beginning and end of each cell. #[structopt(long = "trim-whitespace")] trim_whitespace: bool, /// Make sure column names are unique, and use only lowercase letters, numbers /// and underscores. #[structopt(long = "clean-column-names")] clean_column_names: bool, /// Drop any rows where the specified column is empty or NULL. Can be passed /// more than once. Useful for cleaning primary key columns before /// upserting. Uses the cleaned form of column names. #[structopt(value_name = "COL", long = "drop-row-if-null")] drop_row_if_null: Vec<String>, /// Do not print performance information. #[structopt(short = "q", long = "quiet")] quiet: bool, /// Character used to quote entries. May be set to "none" to ignore all /// quoting. #[structopt(value_name = "CHAR", long = "quote", default_value = "\"")] quote: CharSpecifier, } lazy_static! { /// Either a CRLF newline, a LF newline, or a CR newline. Any of these /// will break certain CSV parsers, including BigQuery's CSV importer. static ref NEWLINE_RE: Regex = Regex::new(r#"\n|\r\n?"#) .expect("regex in source code is unparseable"); } /// This is a helper function called by our `main` function. Unlike /// `main`, we return a `Result`, which means that we can use `?` and other /// standard error-handling machinery. fn run() -> Result<()> { // Set up logging. env_logger::init(); // Parse our command-line arguments using `docopt`. let opt: Opt = Opt::from_args(); debug!("Options: {:#?}", opt); // Remember the time we started. let start_time = now(); // Build a regex containing our `--null` value. let null_re = if let Some(null_re_str) = opt.null.as_ref() { // Always match the full CSV value. let s = format!("^{}$", null_re_str); let re = Regex::new(&s).context("can't compile regular expression")?; Some(re) } else { None }; // Fetch our input from either standard input or a file. The only tricky // detail here is that we use a `Box<dyn Read>` to represent "some object // implementing `Read`, stored on the heap." This allows us to do runtime // dispatch (as if Rust were object oriented). But because `csv` wraps a // `BufReader` around the box, we only do that dispatch once per buffer // flush, not on every tiny write. let stdin = io::stdin(); let input: Box<dyn Read> = if let Some(ref path) = opt.input { Box::new( fs::File::open(path) .with_context(|_| format!("cannot open {}", path.display()))?, ) } else { Box::new(stdin.lock()) }; // Create our CSV reader. let mut rdr_builder = csv::ReaderBuilder::new(); // Set a reasonable buffer size. rdr_builder.buffer_capacity(BUFFER_SIZE); // We need headers so that we can honor --drop-row-if-null. rdr_builder.has_headers(true); // Allow records with the wrong number of columns. rdr_builder.flexible(true); // Configure our delimiter. if let Some(delimiter) = opt.delimiter.char() { rdr_builder.delimiter(delimiter); } else { return Err(format_err!("field delimiter is required")); } // Configure our quote character. if let Some(quote) = opt.quote.char() { rdr_builder.quote(quote); } else { rdr_builder.quoting(false); } let mut rdr = rdr_builder.from_reader(input); // We lock `stdout`, giving us exclusive access. In the past, this has made // an enormous difference in performance. let stdout = io::stdout(); let output = stdout.lock(); // Create our CSV writer. Note that we _don't_ allow variable numbers // of columns, non-standard delimiters, or other nonsense: We want our // output to be highly normalized. let mut wtr = csv::WriterBuilder::new() .buffer_capacity(BUFFER_SIZE) .from_writer(output); // Get our header and, if we were asked, make sure all the column names are unique. let mut hdr = rdr .byte_headers() .context("cannot read headers")? .to_owned(); if opt.clean_column_names { let mut uniquifier = Uniquifier::default(); let mut new_hdr = ByteRecord::default(); for col in hdr.into_iter() { // Convert from bytes to UTF-8, make unique (and clean), and convert back to bytes. let col = String::from_utf8_lossy(col); let col = uniquifier.unique_id_for(&col)?.to_owned(); new_hdr.push_field(col.as_bytes()); } hdr = new_hdr; } // Write our header to our output. wtr.write_byte_record(&hdr) .context("cannot write headers")?; // Calculate the number of expected columns. let expected_cols = hdr.len(); // Just in case --drop-row-if-null was passed, precompute which columns are // required to contain a value. let required_cols = hdr .iter() .map(|name| -> bool { opt.drop_row_if_null .iter() .any(|requried_name| requried_name.as_bytes() == name) }) .collect::<Vec<bool>>(); // Keep track of total rows and malformed rows seen. We count the header as // a row for backwards compatibility. let mut rows: u64 = 1; let mut bad_rows: u64 = 0; // Can we use the fast path and copy the data through unchanged? Or do we // need to clean up emebedded newlines in our data? (These break BigQuery, // for example.) let use_fast_path = null_re.is_none() && !opt.replace_newlines && !opt.trim_whitespace && opt.drop_row_if_null.is_empty(); // Iterate over all the rows, checking to make sure they look reasonable. // // If we use the lowest-level, zero-copy API for `csv`, we can process about // 225 MB/s. But it turns out we can't do that, because we need to count // all the row's fields before deciding whether or not to write it out. 'next_row: for record in rdr.byte_records() { let record = record.context("cannot read record")?; // Keep track of how many rows we've seen. rows += 1; // Check if we have the right number of columns in this row. if record.len() != expected_cols { bad_rows += 1; debug!( "row {}: expected {} columns, found {}", rows, expected_cols, record.len(), ); continue 'next_row; } // Decide how to handle this row. if use_fast_path { // We don't need to do anything fancy, so just pass it through. // I'm not sure how much this actually buys us in current Rust // versions, but it seemed like a good idea at the time. wtr.write_record(record.into_iter()) .context("cannot write record")?; } else { // We need to apply one or more cleanups, so run the slow path. let cleaned = record.into_iter().map(|mut val: &[u8]| -> Cow<[u8]> { // Convert values matching `--null` regex to empty strings. if let Some(ref null_re) = null_re
// Remove whitespace from our cells. if opt.trim_whitespace { // We do this manually, because the built-in `trim` only // works on UTF-8 strings, and we work on any // "ASCII-compatible" encoding. let first = val.iter().position(|c| !c.is_ascii_whitespace()); let last = val.iter().rposition(|c| !c.is_ascii_whitespace()); val = match (first, last) { (Some(first), Some(last)) if first <= last => { &val[first..=last] } (None, None) => &[], _ => panic!( "tried to trim {:?}, got impossible indices {:?} {:?}", val, first, last, ), }; } // Fix newlines. if opt.replace_newlines && (val.contains(&b'\n') || val.contains(&b'\r')) { NEWLINE_RE.replace_all(val, &b" "[..]) } else { Cow::Borrowed(val) } }); if opt.drop_row_if_null.is_empty() { // Still somewhat fast! wtr.write_record(cleaned).context("cannot write record")?; } else { // We need to rebuild the record, check for null columns, // and only output the record if everything's OK. let row = cleaned.collect::<Vec<Cow<[u8]>>>(); for (value, &is_required_col) in row.iter().zip(required_cols.iter()) { // If the column is NULL but shouldn't be, bail on this row. if is_required_col && value.is_empty() { bad_rows += 1; debug!("row {}: required column is empty", rows); continue 'next_row; } } wtr.write_record(row).context("cannot write record")?; } } } // Flush all our buffers. wtr.flush().context("error writing records")?; // Print out some information about our run. if !opt.quiet { let ellapsed = (now() - start_time).as_seconds_f64(); let bytes_per_second = (rdr.position().byte() as f64 / ellapsed) as i64; eprintln!( "{} rows ({} bad) in {:.2} seconds, {}/sec", rows, bad_rows, ellapsed, bytes_per_second.file_size(file_size_opts::BINARY)?, ); } // If more than 10% of rows are bad, assume something has gone horribly // wrong. if bad_rows.checked_mul(10).expect("multiplication overflow") > rows { eprintln!("Too many rows ({} of {}) were bad", bad_rows, rows); process::exit(2); } Ok(()) } fn main() { if let Err(err) = run() { eprintln!("ERROR: {}", err); let mut source = err.source(); while let Some(cause) = source { eprintln!(" caused by: {}", cause); source = cause.source(); } process::exit(1); } }
{ if null_re.is_match(val) { val = &[] } }
conditional_block
cmd.go
// Copyright Istio Authors // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. package app import ( "context" "fmt" "net" "net/netip" "os/exec" "strings" "github.com/spf13/cobra" "github.com/spf13/cobra/doc" "istio.io/api/annotation" meshconfig "istio.io/api/mesh/v1alpha1" "istio.io/istio/pilot/cmd/pilot-agent/config" "istio.io/istio/pilot/cmd/pilot-agent/options" "istio.io/istio/pilot/cmd/pilot-agent/status" "istio.io/istio/pilot/pkg/model" "istio.io/istio/pilot/pkg/util/network" "istio.io/istio/pkg/bootstrap" "istio.io/istio/pkg/cmd" "istio.io/istio/pkg/collateral" "istio.io/istio/pkg/config/constants" "istio.io/istio/pkg/envoy" istio_agent "istio.io/istio/pkg/istio-agent" "istio.io/istio/pkg/log" "istio.io/istio/pkg/security" "istio.io/istio/pkg/util/protomarshal" "istio.io/istio/pkg/util/sets" "istio.io/istio/pkg/version" stsserver "istio.io/istio/security/pkg/stsservice/server" "istio.io/istio/security/pkg/stsservice/tokenmanager" cleaniptables "istio.io/istio/tools/istio-clean-iptables/pkg/cmd" iptables "istio.io/istio/tools/istio-iptables/pkg/cmd" iptableslog "istio.io/istio/tools/istio-iptables/pkg/log" ) const ( localHostIPv4 = "127.0.0.1" localHostIPv6 = "::1" ) var ( loggingOptions = log.DefaultOptions() proxyArgs options.ProxyArgs ) func NewRootCommand() *cobra.Command { rootCmd := &cobra.Command{ Use: "pilot-agent", Short: "Istio Pilot agent.", Long: "Istio Pilot agent runs in the sidecar or gateway container and bootstraps Envoy.", SilenceUsage: true, FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, } // Attach the Istio logging options to the command. loggingOptions.AttachCobraFlags(rootCmd) cmd.AddFlags(rootCmd) proxyCmd := newProxyCommand() addFlags(proxyCmd) rootCmd.AddCommand(proxyCmd) rootCmd.AddCommand(requestCmd) rootCmd.AddCommand(waitCmd) rootCmd.AddCommand(version.CobraCommand()) rootCmd.AddCommand(iptables.GetCommand()) rootCmd.AddCommand(cleaniptables.GetCommand()) rootCmd.AddCommand(collateral.CobraCommand(rootCmd, &doc.GenManHeader{ Title: "Istio Pilot Agent", Section: "pilot-agent CLI", Manual: "Istio Pilot Agent", })) return rootCmd } func newProxyCommand() *cobra.Command { return &cobra.Command{ Use: "proxy", Short: "XDS proxy agent", FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, PersistentPreRunE: configureLogging, RunE: func(c *cobra.Command, args []string) error { cmd.PrintFlags(c.Flags()) log.Infof("Version %s", version.Info.String()) logLimits() proxy, err := initProxy(args) if err != nil { return err } proxyConfig, err := config.ConstructProxyConfig(proxyArgs.MeshConfigFile, proxyArgs.ServiceCluster, options.ProxyConfigEnv, proxyArgs.Concurrency, proxy) if err != nil { return fmt.Errorf("failed to get proxy config: %v", err) } if out, err := protomarshal.ToYAML(proxyConfig); err != nil { log.Infof("Failed to serialize to YAML: %v", err) } else { log.Infof("Effective config: %s", out) } secOpts, err := options.NewSecurityOptions(proxyConfig, proxyArgs.StsPort, proxyArgs.TokenManagerPlugin) if err != nil { return err } // If security token service (STS) port is not zero, start STS server and // listen on STS port for STS requests. For STS, see // https://tools.ietf.org/html/draft-ietf-oauth-token-exchange-16. // STS is used for stackdriver or other Envoy services using google gRPC. if proxyArgs.StsPort > 0 { stsServer, err := initStsServer(proxy, secOpts.TokenManager) if err != nil { return err } defer stsServer.Stop() } // If we are using a custom template file (for control plane proxy, for example), configure this. if proxyArgs.TemplateFile != "" && proxyConfig.CustomConfigFile == "" { proxyConfig.ProxyBootstrapTemplatePath = proxyArgs.TemplateFile } envoyOptions := envoy.ProxyConfig{ LogLevel: proxyArgs.ProxyLogLevel, ComponentLogLevel: proxyArgs.ProxyComponentLogLevel, LogAsJSON: loggingOptions.JSONEncoding, NodeIPs: proxy.IPAddresses, Sidecar: proxy.Type == model.SidecarProxy, OutlierLogPath: proxyArgs.OutlierLogPath, } agentOptions := options.NewAgentOptions(proxy, proxyConfig) agent := istio_agent.NewAgent(proxyConfig, agentOptions, secOpts, envoyOptions) ctx, cancel := context.WithCancel(context.Background()) defer cancel() defer agent.Close() // If a status port was provided, start handling status probes. if proxyConfig.StatusPort > 0 { if err := initStatusServer(ctx, proxy, proxyConfig, agentOptions.EnvoyPrometheusPort, proxyArgs.EnableProfiling, agent); err != nil { return err } } go iptableslog.ReadNFLOGSocket(ctx) // On SIGINT or SIGTERM, cancel the context, triggering a graceful shutdown go cmd.WaitSignalFunc(cancel) // Start in process SDS, dns server, xds proxy, and Envoy. wait, err := agent.Run(ctx) if err != nil { return err } wait() return nil }, } } func addFlags(proxyCmd *cobra.Command) { proxyArgs = options.NewProxyArgs() proxyCmd.PersistentFlags().StringVar(&proxyArgs.DNSDomain, "domain", "", "DNS domain suffix. If not provided uses ${POD_NAMESPACE}.svc.cluster.local") proxyCmd.PersistentFlags().StringVar(&proxyArgs.MeshConfigFile, "meshConfig", "./etc/istio/config/mesh", "File name for Istio mesh configuration. If not specified, a default mesh will be used. This may be overridden by "+ "PROXY_CONFIG environment variable or proxy.istio.io/config annotation.") proxyCmd.PersistentFlags().IntVar(&proxyArgs.StsPort, "stsPort", 0, "HTTP Port on which to serve Security Token Service (STS). If zero, STS service will not be provided.") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TokenManagerPlugin, "tokenManagerPlugin", tokenmanager.GoogleTokenExchange, "Token provider specific plugin name.") // DEPRECATED. Flags for proxy configuration proxyCmd.PersistentFlags().StringVar(&proxyArgs.ServiceCluster, "serviceCluster", constants.ServiceClusterName, "Service cluster") // Log levels are provided by the library https://github.com/gabime/spdlog, used by Envoy. proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyLogLevel, "proxyLogLevel", "warning,misc:error", fmt.Sprintf("The log level used to start the Envoy proxy (choose from {%s, %s, %s, %s, %s, %s, %s})."+ "Level may also include one or more scopes, such as 'info,misc:error,upstream:debug'", "trace", "debug", "info", "warning", "error", "critical", "off")) proxyCmd.PersistentFlags().IntVar(&proxyArgs.Concurrency, "concurrency", 0, "number of worker threads to run") // See https://www.envoyproxy.io/docs/envoy/latest/operations/cli#cmdoption-component-log-level proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyComponentLogLevel, "proxyComponentLogLevel", "", "The component log level used to start the Envoy proxy. Deprecated, use proxyLogLevel instead") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TemplateFile, "templateFile", "", "Go template bootstrap config") proxyCmd.PersistentFlags().StringVar(&proxyArgs.OutlierLogPath, "outlierLogPath", "", "The log path for outlier detection") proxyCmd.PersistentFlags().BoolVar(&proxyArgs.EnableProfiling, "profiling", true, "Enable profiling via web interface host:port/debug/pprof/.") } func initStatusServer(ctx context.Context, proxy *model.Proxy, proxyConfig *meshconfig.ProxyConfig, envoyPrometheusPort int, enableProfiling bool, agent *istio_agent.Agent, ) error
func initStsServer(proxy *model.Proxy, tokenManager security.TokenManager) (*stsserver.Server, error) { localHostAddr := localHostIPv4 if proxy.IsIPv6() { localHostAddr = localHostIPv6 } else { // if not ipv6-only, it can be ipv4-only or dual-stack // let InstanceIP decide the localhost netIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) if netIP.Is6() && !netIP.IsLinkLocalUnicast() { localHostAddr = localHostIPv6 } } stsServer, err := stsserver.NewServer(stsserver.Config{ LocalHostAddr: localHostAddr, LocalPort: proxyArgs.StsPort, }, tokenManager) if err != nil { return nil, err } return stsServer, nil } func getDNSDomain(podNamespace, domain string) string { if len(domain) == 0 { domain = podNamespace + ".svc." + constants.DefaultClusterLocalDomain } return domain } func configureLogging(_ *cobra.Command, _ []string) error { if err := log.Configure(loggingOptions); err != nil { return err } return nil } func initProxy(args []string) (*model.Proxy, error) { proxy := &model.Proxy{ Type: model.SidecarProxy, } if len(args) > 0 { proxy.Type = model.NodeType(args[0]) if !model.IsApplicationNodeType(proxy.Type) { return nil, fmt.Errorf("Invalid proxy Type: " + string(proxy.Type)) } } podIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) // protobuf encoding of IP_ADDRESS type if podIP.IsValid() { proxy.IPAddresses = []string{podIP.String()} } // Obtain all the IPs from the node if ipAddrs, ok := network.GetPrivateIPs(context.Background()); ok { if len(proxy.IPAddresses) == 1 { for _, ip := range ipAddrs { // prevent duplicate ips, the first one must be the pod ip // as we pick the first ip as pod ip in istiod if proxy.IPAddresses[0] != ip { proxy.IPAddresses = append(proxy.IPAddresses, ip) } } } else { proxy.IPAddresses = append(proxy.IPAddresses, ipAddrs...) } } // No IP addresses provided, append 127.0.0.1 for ipv4 and ::1 for ipv6 if len(proxy.IPAddresses) == 0 { proxy.IPAddresses = append(proxy.IPAddresses, localHostIPv4, localHostIPv6) } // Apply exclusions from traffic.sidecar.istio.io/excludeInterfaces proxy.IPAddresses = applyExcludeInterfaces(proxy.IPAddresses) // After IP addresses are set, let us discover IPMode. proxy.DiscoverIPMode() // Extract pod variables. proxy.ID = proxyArgs.PodName + "." + proxyArgs.PodNamespace // If not set, set a default based on platform - podNamespace.svc.cluster.local for // K8S proxy.DNSDomain = getDNSDomain(proxyArgs.PodNamespace, proxyArgs.DNSDomain) log.WithLabels("ips", proxy.IPAddresses, "type", proxy.Type, "id", proxy.ID, "domain", proxy.DNSDomain).Info("Proxy role") return proxy, nil } func applyExcludeInterfaces(ifaces []string) []string { // Get list of excluded interfaces from pod annotation // TODO: Discuss other input methods such as env, flag (ssuvasanth) annotations, err := bootstrap.ReadPodAnnotations("") if err != nil { log.Debugf("Reading podInfoAnnotations file to get excludeInterfaces was unsuccessful. Continuing without exclusions. msg: %v", err) return ifaces } value, ok := annotations[annotation.SidecarTrafficExcludeInterfaces.Name] if !ok { log.Debugf("ExcludeInterfaces annotation is not present. Proxy IPAddresses: %v", ifaces) return ifaces } exclusions := strings.Split(value, ",") // Find IP addr of excluded interfaces and add to a map for instant lookup exclusionMap := sets.New[string]() for _, ifaceName := range exclusions { iface, err := net.InterfaceByName(ifaceName) if err != nil { log.Warnf("Unable to get interface %s: %v", ifaceName, err) continue } addrs, err := iface.Addrs() if err != nil { log.Warnf("Unable to get IP addr(s) of interface %s: %v", ifaceName, err) continue } for _, addr := range addrs { // Get IP only var ip net.IP switch v := addr.(type) { case *net.IPNet: ip = v.IP case *net.IPAddr: ip = v.IP default: continue } // handling ipv4 wrapping in ipv6 ipAddr, okay := netip.AddrFromSlice(ip) if !okay { continue } unwrapAddr := ipAddr.Unmap() if !unwrapAddr.IsValid() || unwrapAddr.IsLoopback() || unwrapAddr.IsLinkLocalUnicast() || unwrapAddr.IsLinkLocalMulticast() || unwrapAddr.IsUnspecified() { continue } // Add to map exclusionMap.Insert(unwrapAddr.String()) } } // Remove excluded IP addresses from the input IP addresses list. var selectedInterfaces []string for _, ip := range ifaces { if exclusionMap.Contains(ip) { log.Infof("Excluding ip %s from proxy IPaddresses list", ip) continue } selectedInterfaces = append(selectedInterfaces, ip) } return selectedInterfaces } func logLimits() { out, err := exec.Command("bash", "-c", "ulimit -n").Output() outStr := strings.TrimSpace(string(out)) if err != nil { log.Warnf("failed running ulimit command: %v", outStr) } else { log.Infof("Maximum file descriptors (ulimit -n): %v", outStr) } }
{ o := options.NewStatusServerOptions(proxy, proxyConfig, agent) o.EnvoyPrometheusPort = envoyPrometheusPort o.EnableProfiling = enableProfiling o.Context = ctx statusServer, err := status.NewServer(*o) if err != nil { return err } go statusServer.Run(ctx) return nil }
identifier_body
cmd.go
// Copyright Istio Authors // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. package app import ( "context" "fmt" "net" "net/netip" "os/exec" "strings" "github.com/spf13/cobra" "github.com/spf13/cobra/doc" "istio.io/api/annotation" meshconfig "istio.io/api/mesh/v1alpha1" "istio.io/istio/pilot/cmd/pilot-agent/config" "istio.io/istio/pilot/cmd/pilot-agent/options" "istio.io/istio/pilot/cmd/pilot-agent/status" "istio.io/istio/pilot/pkg/model" "istio.io/istio/pilot/pkg/util/network" "istio.io/istio/pkg/bootstrap" "istio.io/istio/pkg/cmd" "istio.io/istio/pkg/collateral" "istio.io/istio/pkg/config/constants" "istio.io/istio/pkg/envoy" istio_agent "istio.io/istio/pkg/istio-agent" "istio.io/istio/pkg/log" "istio.io/istio/pkg/security" "istio.io/istio/pkg/util/protomarshal" "istio.io/istio/pkg/util/sets" "istio.io/istio/pkg/version" stsserver "istio.io/istio/security/pkg/stsservice/server" "istio.io/istio/security/pkg/stsservice/tokenmanager" cleaniptables "istio.io/istio/tools/istio-clean-iptables/pkg/cmd" iptables "istio.io/istio/tools/istio-iptables/pkg/cmd" iptableslog "istio.io/istio/tools/istio-iptables/pkg/log" ) const ( localHostIPv4 = "127.0.0.1" localHostIPv6 = "::1" ) var ( loggingOptions = log.DefaultOptions() proxyArgs options.ProxyArgs ) func
() *cobra.Command { rootCmd := &cobra.Command{ Use: "pilot-agent", Short: "Istio Pilot agent.", Long: "Istio Pilot agent runs in the sidecar or gateway container and bootstraps Envoy.", SilenceUsage: true, FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, } // Attach the Istio logging options to the command. loggingOptions.AttachCobraFlags(rootCmd) cmd.AddFlags(rootCmd) proxyCmd := newProxyCommand() addFlags(proxyCmd) rootCmd.AddCommand(proxyCmd) rootCmd.AddCommand(requestCmd) rootCmd.AddCommand(waitCmd) rootCmd.AddCommand(version.CobraCommand()) rootCmd.AddCommand(iptables.GetCommand()) rootCmd.AddCommand(cleaniptables.GetCommand()) rootCmd.AddCommand(collateral.CobraCommand(rootCmd, &doc.GenManHeader{ Title: "Istio Pilot Agent", Section: "pilot-agent CLI", Manual: "Istio Pilot Agent", })) return rootCmd } func newProxyCommand() *cobra.Command { return &cobra.Command{ Use: "proxy", Short: "XDS proxy agent", FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, PersistentPreRunE: configureLogging, RunE: func(c *cobra.Command, args []string) error { cmd.PrintFlags(c.Flags()) log.Infof("Version %s", version.Info.String()) logLimits() proxy, err := initProxy(args) if err != nil { return err } proxyConfig, err := config.ConstructProxyConfig(proxyArgs.MeshConfigFile, proxyArgs.ServiceCluster, options.ProxyConfigEnv, proxyArgs.Concurrency, proxy) if err != nil { return fmt.Errorf("failed to get proxy config: %v", err) } if out, err := protomarshal.ToYAML(proxyConfig); err != nil { log.Infof("Failed to serialize to YAML: %v", err) } else { log.Infof("Effective config: %s", out) } secOpts, err := options.NewSecurityOptions(proxyConfig, proxyArgs.StsPort, proxyArgs.TokenManagerPlugin) if err != nil { return err } // If security token service (STS) port is not zero, start STS server and // listen on STS port for STS requests. For STS, see // https://tools.ietf.org/html/draft-ietf-oauth-token-exchange-16. // STS is used for stackdriver or other Envoy services using google gRPC. if proxyArgs.StsPort > 0 { stsServer, err := initStsServer(proxy, secOpts.TokenManager) if err != nil { return err } defer stsServer.Stop() } // If we are using a custom template file (for control plane proxy, for example), configure this. if proxyArgs.TemplateFile != "" && proxyConfig.CustomConfigFile == "" { proxyConfig.ProxyBootstrapTemplatePath = proxyArgs.TemplateFile } envoyOptions := envoy.ProxyConfig{ LogLevel: proxyArgs.ProxyLogLevel, ComponentLogLevel: proxyArgs.ProxyComponentLogLevel, LogAsJSON: loggingOptions.JSONEncoding, NodeIPs: proxy.IPAddresses, Sidecar: proxy.Type == model.SidecarProxy, OutlierLogPath: proxyArgs.OutlierLogPath, } agentOptions := options.NewAgentOptions(proxy, proxyConfig) agent := istio_agent.NewAgent(proxyConfig, agentOptions, secOpts, envoyOptions) ctx, cancel := context.WithCancel(context.Background()) defer cancel() defer agent.Close() // If a status port was provided, start handling status probes. if proxyConfig.StatusPort > 0 { if err := initStatusServer(ctx, proxy, proxyConfig, agentOptions.EnvoyPrometheusPort, proxyArgs.EnableProfiling, agent); err != nil { return err } } go iptableslog.ReadNFLOGSocket(ctx) // On SIGINT or SIGTERM, cancel the context, triggering a graceful shutdown go cmd.WaitSignalFunc(cancel) // Start in process SDS, dns server, xds proxy, and Envoy. wait, err := agent.Run(ctx) if err != nil { return err } wait() return nil }, } } func addFlags(proxyCmd *cobra.Command) { proxyArgs = options.NewProxyArgs() proxyCmd.PersistentFlags().StringVar(&proxyArgs.DNSDomain, "domain", "", "DNS domain suffix. If not provided uses ${POD_NAMESPACE}.svc.cluster.local") proxyCmd.PersistentFlags().StringVar(&proxyArgs.MeshConfigFile, "meshConfig", "./etc/istio/config/mesh", "File name for Istio mesh configuration. If not specified, a default mesh will be used. This may be overridden by "+ "PROXY_CONFIG environment variable or proxy.istio.io/config annotation.") proxyCmd.PersistentFlags().IntVar(&proxyArgs.StsPort, "stsPort", 0, "HTTP Port on which to serve Security Token Service (STS). If zero, STS service will not be provided.") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TokenManagerPlugin, "tokenManagerPlugin", tokenmanager.GoogleTokenExchange, "Token provider specific plugin name.") // DEPRECATED. Flags for proxy configuration proxyCmd.PersistentFlags().StringVar(&proxyArgs.ServiceCluster, "serviceCluster", constants.ServiceClusterName, "Service cluster") // Log levels are provided by the library https://github.com/gabime/spdlog, used by Envoy. proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyLogLevel, "proxyLogLevel", "warning,misc:error", fmt.Sprintf("The log level used to start the Envoy proxy (choose from {%s, %s, %s, %s, %s, %s, %s})."+ "Level may also include one or more scopes, such as 'info,misc:error,upstream:debug'", "trace", "debug", "info", "warning", "error", "critical", "off")) proxyCmd.PersistentFlags().IntVar(&proxyArgs.Concurrency, "concurrency", 0, "number of worker threads to run") // See https://www.envoyproxy.io/docs/envoy/latest/operations/cli#cmdoption-component-log-level proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyComponentLogLevel, "proxyComponentLogLevel", "", "The component log level used to start the Envoy proxy. Deprecated, use proxyLogLevel instead") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TemplateFile, "templateFile", "", "Go template bootstrap config") proxyCmd.PersistentFlags().StringVar(&proxyArgs.OutlierLogPath, "outlierLogPath", "", "The log path for outlier detection") proxyCmd.PersistentFlags().BoolVar(&proxyArgs.EnableProfiling, "profiling", true, "Enable profiling via web interface host:port/debug/pprof/.") } func initStatusServer(ctx context.Context, proxy *model.Proxy, proxyConfig *meshconfig.ProxyConfig, envoyPrometheusPort int, enableProfiling bool, agent *istio_agent.Agent, ) error { o := options.NewStatusServerOptions(proxy, proxyConfig, agent) o.EnvoyPrometheusPort = envoyPrometheusPort o.EnableProfiling = enableProfiling o.Context = ctx statusServer, err := status.NewServer(*o) if err != nil { return err } go statusServer.Run(ctx) return nil } func initStsServer(proxy *model.Proxy, tokenManager security.TokenManager) (*stsserver.Server, error) { localHostAddr := localHostIPv4 if proxy.IsIPv6() { localHostAddr = localHostIPv6 } else { // if not ipv6-only, it can be ipv4-only or dual-stack // let InstanceIP decide the localhost netIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) if netIP.Is6() && !netIP.IsLinkLocalUnicast() { localHostAddr = localHostIPv6 } } stsServer, err := stsserver.NewServer(stsserver.Config{ LocalHostAddr: localHostAddr, LocalPort: proxyArgs.StsPort, }, tokenManager) if err != nil { return nil, err } return stsServer, nil } func getDNSDomain(podNamespace, domain string) string { if len(domain) == 0 { domain = podNamespace + ".svc." + constants.DefaultClusterLocalDomain } return domain } func configureLogging(_ *cobra.Command, _ []string) error { if err := log.Configure(loggingOptions); err != nil { return err } return nil } func initProxy(args []string) (*model.Proxy, error) { proxy := &model.Proxy{ Type: model.SidecarProxy, } if len(args) > 0 { proxy.Type = model.NodeType(args[0]) if !model.IsApplicationNodeType(proxy.Type) { return nil, fmt.Errorf("Invalid proxy Type: " + string(proxy.Type)) } } podIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) // protobuf encoding of IP_ADDRESS type if podIP.IsValid() { proxy.IPAddresses = []string{podIP.String()} } // Obtain all the IPs from the node if ipAddrs, ok := network.GetPrivateIPs(context.Background()); ok { if len(proxy.IPAddresses) == 1 { for _, ip := range ipAddrs { // prevent duplicate ips, the first one must be the pod ip // as we pick the first ip as pod ip in istiod if proxy.IPAddresses[0] != ip { proxy.IPAddresses = append(proxy.IPAddresses, ip) } } } else { proxy.IPAddresses = append(proxy.IPAddresses, ipAddrs...) } } // No IP addresses provided, append 127.0.0.1 for ipv4 and ::1 for ipv6 if len(proxy.IPAddresses) == 0 { proxy.IPAddresses = append(proxy.IPAddresses, localHostIPv4, localHostIPv6) } // Apply exclusions from traffic.sidecar.istio.io/excludeInterfaces proxy.IPAddresses = applyExcludeInterfaces(proxy.IPAddresses) // After IP addresses are set, let us discover IPMode. proxy.DiscoverIPMode() // Extract pod variables. proxy.ID = proxyArgs.PodName + "." + proxyArgs.PodNamespace // If not set, set a default based on platform - podNamespace.svc.cluster.local for // K8S proxy.DNSDomain = getDNSDomain(proxyArgs.PodNamespace, proxyArgs.DNSDomain) log.WithLabels("ips", proxy.IPAddresses, "type", proxy.Type, "id", proxy.ID, "domain", proxy.DNSDomain).Info("Proxy role") return proxy, nil } func applyExcludeInterfaces(ifaces []string) []string { // Get list of excluded interfaces from pod annotation // TODO: Discuss other input methods such as env, flag (ssuvasanth) annotations, err := bootstrap.ReadPodAnnotations("") if err != nil { log.Debugf("Reading podInfoAnnotations file to get excludeInterfaces was unsuccessful. Continuing without exclusions. msg: %v", err) return ifaces } value, ok := annotations[annotation.SidecarTrafficExcludeInterfaces.Name] if !ok { log.Debugf("ExcludeInterfaces annotation is not present. Proxy IPAddresses: %v", ifaces) return ifaces } exclusions := strings.Split(value, ",") // Find IP addr of excluded interfaces and add to a map for instant lookup exclusionMap := sets.New[string]() for _, ifaceName := range exclusions { iface, err := net.InterfaceByName(ifaceName) if err != nil { log.Warnf("Unable to get interface %s: %v", ifaceName, err) continue } addrs, err := iface.Addrs() if err != nil { log.Warnf("Unable to get IP addr(s) of interface %s: %v", ifaceName, err) continue } for _, addr := range addrs { // Get IP only var ip net.IP switch v := addr.(type) { case *net.IPNet: ip = v.IP case *net.IPAddr: ip = v.IP default: continue } // handling ipv4 wrapping in ipv6 ipAddr, okay := netip.AddrFromSlice(ip) if !okay { continue } unwrapAddr := ipAddr.Unmap() if !unwrapAddr.IsValid() || unwrapAddr.IsLoopback() || unwrapAddr.IsLinkLocalUnicast() || unwrapAddr.IsLinkLocalMulticast() || unwrapAddr.IsUnspecified() { continue } // Add to map exclusionMap.Insert(unwrapAddr.String()) } } // Remove excluded IP addresses from the input IP addresses list. var selectedInterfaces []string for _, ip := range ifaces { if exclusionMap.Contains(ip) { log.Infof("Excluding ip %s from proxy IPaddresses list", ip) continue } selectedInterfaces = append(selectedInterfaces, ip) } return selectedInterfaces } func logLimits() { out, err := exec.Command("bash", "-c", "ulimit -n").Output() outStr := strings.TrimSpace(string(out)) if err != nil { log.Warnf("failed running ulimit command: %v", outStr) } else { log.Infof("Maximum file descriptors (ulimit -n): %v", outStr) } }
NewRootCommand
identifier_name
cmd.go
// Copyright Istio Authors // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. package app import ( "context" "fmt" "net" "net/netip" "os/exec" "strings" "github.com/spf13/cobra" "github.com/spf13/cobra/doc" "istio.io/api/annotation" meshconfig "istio.io/api/mesh/v1alpha1" "istio.io/istio/pilot/cmd/pilot-agent/config" "istio.io/istio/pilot/cmd/pilot-agent/options" "istio.io/istio/pilot/cmd/pilot-agent/status" "istio.io/istio/pilot/pkg/model" "istio.io/istio/pilot/pkg/util/network" "istio.io/istio/pkg/bootstrap" "istio.io/istio/pkg/cmd" "istio.io/istio/pkg/collateral" "istio.io/istio/pkg/config/constants" "istio.io/istio/pkg/envoy" istio_agent "istio.io/istio/pkg/istio-agent" "istio.io/istio/pkg/log" "istio.io/istio/pkg/security" "istio.io/istio/pkg/util/protomarshal" "istio.io/istio/pkg/util/sets" "istio.io/istio/pkg/version" stsserver "istio.io/istio/security/pkg/stsservice/server" "istio.io/istio/security/pkg/stsservice/tokenmanager" cleaniptables "istio.io/istio/tools/istio-clean-iptables/pkg/cmd" iptables "istio.io/istio/tools/istio-iptables/pkg/cmd" iptableslog "istio.io/istio/tools/istio-iptables/pkg/log" ) const ( localHostIPv4 = "127.0.0.1" localHostIPv6 = "::1" ) var ( loggingOptions = log.DefaultOptions() proxyArgs options.ProxyArgs ) func NewRootCommand() *cobra.Command { rootCmd := &cobra.Command{ Use: "pilot-agent", Short: "Istio Pilot agent.", Long: "Istio Pilot agent runs in the sidecar or gateway container and bootstraps Envoy.", SilenceUsage: true, FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, } // Attach the Istio logging options to the command. loggingOptions.AttachCobraFlags(rootCmd) cmd.AddFlags(rootCmd) proxyCmd := newProxyCommand() addFlags(proxyCmd) rootCmd.AddCommand(proxyCmd) rootCmd.AddCommand(requestCmd) rootCmd.AddCommand(waitCmd) rootCmd.AddCommand(version.CobraCommand()) rootCmd.AddCommand(iptables.GetCommand()) rootCmd.AddCommand(cleaniptables.GetCommand()) rootCmd.AddCommand(collateral.CobraCommand(rootCmd, &doc.GenManHeader{ Title: "Istio Pilot Agent", Section: "pilot-agent CLI", Manual: "Istio Pilot Agent", })) return rootCmd } func newProxyCommand() *cobra.Command { return &cobra.Command{ Use: "proxy", Short: "XDS proxy agent", FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, PersistentPreRunE: configureLogging, RunE: func(c *cobra.Command, args []string) error { cmd.PrintFlags(c.Flags()) log.Infof("Version %s", version.Info.String()) logLimits() proxy, err := initProxy(args) if err != nil { return err } proxyConfig, err := config.ConstructProxyConfig(proxyArgs.MeshConfigFile, proxyArgs.ServiceCluster, options.ProxyConfigEnv, proxyArgs.Concurrency, proxy) if err != nil { return fmt.Errorf("failed to get proxy config: %v", err) } if out, err := protomarshal.ToYAML(proxyConfig); err != nil { log.Infof("Failed to serialize to YAML: %v", err) } else { log.Infof("Effective config: %s", out) } secOpts, err := options.NewSecurityOptions(proxyConfig, proxyArgs.StsPort, proxyArgs.TokenManagerPlugin) if err != nil { return err } // If security token service (STS) port is not zero, start STS server and // listen on STS port for STS requests. For STS, see // https://tools.ietf.org/html/draft-ietf-oauth-token-exchange-16. // STS is used for stackdriver or other Envoy services using google gRPC. if proxyArgs.StsPort > 0 { stsServer, err := initStsServer(proxy, secOpts.TokenManager) if err != nil { return err } defer stsServer.Stop() } // If we are using a custom template file (for control plane proxy, for example), configure this. if proxyArgs.TemplateFile != "" && proxyConfig.CustomConfigFile == "" { proxyConfig.ProxyBootstrapTemplatePath = proxyArgs.TemplateFile } envoyOptions := envoy.ProxyConfig{ LogLevel: proxyArgs.ProxyLogLevel, ComponentLogLevel: proxyArgs.ProxyComponentLogLevel, LogAsJSON: loggingOptions.JSONEncoding, NodeIPs: proxy.IPAddresses, Sidecar: proxy.Type == model.SidecarProxy, OutlierLogPath: proxyArgs.OutlierLogPath, } agentOptions := options.NewAgentOptions(proxy, proxyConfig) agent := istio_agent.NewAgent(proxyConfig, agentOptions, secOpts, envoyOptions) ctx, cancel := context.WithCancel(context.Background()) defer cancel() defer agent.Close() // If a status port was provided, start handling status probes. if proxyConfig.StatusPort > 0 { if err := initStatusServer(ctx, proxy, proxyConfig, agentOptions.EnvoyPrometheusPort, proxyArgs.EnableProfiling, agent); err != nil { return err } } go iptableslog.ReadNFLOGSocket(ctx) // On SIGINT or SIGTERM, cancel the context, triggering a graceful shutdown go cmd.WaitSignalFunc(cancel) // Start in process SDS, dns server, xds proxy, and Envoy. wait, err := agent.Run(ctx) if err != nil { return err } wait() return nil }, } } func addFlags(proxyCmd *cobra.Command) { proxyArgs = options.NewProxyArgs() proxyCmd.PersistentFlags().StringVar(&proxyArgs.DNSDomain, "domain", "", "DNS domain suffix. If not provided uses ${POD_NAMESPACE}.svc.cluster.local") proxyCmd.PersistentFlags().StringVar(&proxyArgs.MeshConfigFile, "meshConfig", "./etc/istio/config/mesh", "File name for Istio mesh configuration. If not specified, a default mesh will be used. This may be overridden by "+ "PROXY_CONFIG environment variable or proxy.istio.io/config annotation.") proxyCmd.PersistentFlags().IntVar(&proxyArgs.StsPort, "stsPort", 0, "HTTP Port on which to serve Security Token Service (STS). If zero, STS service will not be provided.") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TokenManagerPlugin, "tokenManagerPlugin", tokenmanager.GoogleTokenExchange, "Token provider specific plugin name.") // DEPRECATED. Flags for proxy configuration proxyCmd.PersistentFlags().StringVar(&proxyArgs.ServiceCluster, "serviceCluster", constants.ServiceClusterName, "Service cluster") // Log levels are provided by the library https://github.com/gabime/spdlog, used by Envoy. proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyLogLevel, "proxyLogLevel", "warning,misc:error", fmt.Sprintf("The log level used to start the Envoy proxy (choose from {%s, %s, %s, %s, %s, %s, %s})."+ "Level may also include one or more scopes, such as 'info,misc:error,upstream:debug'", "trace", "debug", "info", "warning", "error", "critical", "off")) proxyCmd.PersistentFlags().IntVar(&proxyArgs.Concurrency, "concurrency", 0, "number of worker threads to run") // See https://www.envoyproxy.io/docs/envoy/latest/operations/cli#cmdoption-component-log-level proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyComponentLogLevel, "proxyComponentLogLevel", "", "The component log level used to start the Envoy proxy. Deprecated, use proxyLogLevel instead") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TemplateFile, "templateFile", "", "Go template bootstrap config") proxyCmd.PersistentFlags().StringVar(&proxyArgs.OutlierLogPath, "outlierLogPath", "", "The log path for outlier detection") proxyCmd.PersistentFlags().BoolVar(&proxyArgs.EnableProfiling, "profiling", true, "Enable profiling via web interface host:port/debug/pprof/.") } func initStatusServer(ctx context.Context, proxy *model.Proxy, proxyConfig *meshconfig.ProxyConfig, envoyPrometheusPort int, enableProfiling bool, agent *istio_agent.Agent, ) error { o := options.NewStatusServerOptions(proxy, proxyConfig, agent) o.EnvoyPrometheusPort = envoyPrometheusPort o.EnableProfiling = enableProfiling o.Context = ctx statusServer, err := status.NewServer(*o) if err != nil { return err } go statusServer.Run(ctx) return nil } func initStsServer(proxy *model.Proxy, tokenManager security.TokenManager) (*stsserver.Server, error) { localHostAddr := localHostIPv4 if proxy.IsIPv6() { localHostAddr = localHostIPv6 } else { // if not ipv6-only, it can be ipv4-only or dual-stack // let InstanceIP decide the localhost netIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) if netIP.Is6() && !netIP.IsLinkLocalUnicast() { localHostAddr = localHostIPv6 } } stsServer, err := stsserver.NewServer(stsserver.Config{ LocalHostAddr: localHostAddr, LocalPort: proxyArgs.StsPort, }, tokenManager) if err != nil { return nil, err } return stsServer, nil } func getDNSDomain(podNamespace, domain string) string { if len(domain) == 0 { domain = podNamespace + ".svc." + constants.DefaultClusterLocalDomain } return domain } func configureLogging(_ *cobra.Command, _ []string) error { if err := log.Configure(loggingOptions); err != nil { return err } return nil } func initProxy(args []string) (*model.Proxy, error) { proxy := &model.Proxy{ Type: model.SidecarProxy, } if len(args) > 0 { proxy.Type = model.NodeType(args[0]) if !model.IsApplicationNodeType(proxy.Type)
} podIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) // protobuf encoding of IP_ADDRESS type if podIP.IsValid() { proxy.IPAddresses = []string{podIP.String()} } // Obtain all the IPs from the node if ipAddrs, ok := network.GetPrivateIPs(context.Background()); ok { if len(proxy.IPAddresses) == 1 { for _, ip := range ipAddrs { // prevent duplicate ips, the first one must be the pod ip // as we pick the first ip as pod ip in istiod if proxy.IPAddresses[0] != ip { proxy.IPAddresses = append(proxy.IPAddresses, ip) } } } else { proxy.IPAddresses = append(proxy.IPAddresses, ipAddrs...) } } // No IP addresses provided, append 127.0.0.1 for ipv4 and ::1 for ipv6 if len(proxy.IPAddresses) == 0 { proxy.IPAddresses = append(proxy.IPAddresses, localHostIPv4, localHostIPv6) } // Apply exclusions from traffic.sidecar.istio.io/excludeInterfaces proxy.IPAddresses = applyExcludeInterfaces(proxy.IPAddresses) // After IP addresses are set, let us discover IPMode. proxy.DiscoverIPMode() // Extract pod variables. proxy.ID = proxyArgs.PodName + "." + proxyArgs.PodNamespace // If not set, set a default based on platform - podNamespace.svc.cluster.local for // K8S proxy.DNSDomain = getDNSDomain(proxyArgs.PodNamespace, proxyArgs.DNSDomain) log.WithLabels("ips", proxy.IPAddresses, "type", proxy.Type, "id", proxy.ID, "domain", proxy.DNSDomain).Info("Proxy role") return proxy, nil } func applyExcludeInterfaces(ifaces []string) []string { // Get list of excluded interfaces from pod annotation // TODO: Discuss other input methods such as env, flag (ssuvasanth) annotations, err := bootstrap.ReadPodAnnotations("") if err != nil { log.Debugf("Reading podInfoAnnotations file to get excludeInterfaces was unsuccessful. Continuing without exclusions. msg: %v", err) return ifaces } value, ok := annotations[annotation.SidecarTrafficExcludeInterfaces.Name] if !ok { log.Debugf("ExcludeInterfaces annotation is not present. Proxy IPAddresses: %v", ifaces) return ifaces } exclusions := strings.Split(value, ",") // Find IP addr of excluded interfaces and add to a map for instant lookup exclusionMap := sets.New[string]() for _, ifaceName := range exclusions { iface, err := net.InterfaceByName(ifaceName) if err != nil { log.Warnf("Unable to get interface %s: %v", ifaceName, err) continue } addrs, err := iface.Addrs() if err != nil { log.Warnf("Unable to get IP addr(s) of interface %s: %v", ifaceName, err) continue } for _, addr := range addrs { // Get IP only var ip net.IP switch v := addr.(type) { case *net.IPNet: ip = v.IP case *net.IPAddr: ip = v.IP default: continue } // handling ipv4 wrapping in ipv6 ipAddr, okay := netip.AddrFromSlice(ip) if !okay { continue } unwrapAddr := ipAddr.Unmap() if !unwrapAddr.IsValid() || unwrapAddr.IsLoopback() || unwrapAddr.IsLinkLocalUnicast() || unwrapAddr.IsLinkLocalMulticast() || unwrapAddr.IsUnspecified() { continue } // Add to map exclusionMap.Insert(unwrapAddr.String()) } } // Remove excluded IP addresses from the input IP addresses list. var selectedInterfaces []string for _, ip := range ifaces { if exclusionMap.Contains(ip) { log.Infof("Excluding ip %s from proxy IPaddresses list", ip) continue } selectedInterfaces = append(selectedInterfaces, ip) } return selectedInterfaces } func logLimits() { out, err := exec.Command("bash", "-c", "ulimit -n").Output() outStr := strings.TrimSpace(string(out)) if err != nil { log.Warnf("failed running ulimit command: %v", outStr) } else { log.Infof("Maximum file descriptors (ulimit -n): %v", outStr) } }
{ return nil, fmt.Errorf("Invalid proxy Type: " + string(proxy.Type)) }
conditional_block
cmd.go
// Copyright Istio Authors // // Licensed under the Apache License, Version 2.0 (the "License"); // you may not use this file except in compliance with the License. // You may obtain a copy of the License at // // http://www.apache.org/licenses/LICENSE-2.0 // // Unless required by applicable law or agreed to in writing, software // distributed under the License is distributed on an "AS IS" BASIS, // WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. // See the License for the specific language governing permissions and // limitations under the License. package app import ( "context" "fmt" "net" "net/netip" "os/exec" "strings" "github.com/spf13/cobra" "github.com/spf13/cobra/doc" "istio.io/api/annotation"
"istio.io/istio/pilot/cmd/pilot-agent/config" "istio.io/istio/pilot/cmd/pilot-agent/options" "istio.io/istio/pilot/cmd/pilot-agent/status" "istio.io/istio/pilot/pkg/model" "istio.io/istio/pilot/pkg/util/network" "istio.io/istio/pkg/bootstrap" "istio.io/istio/pkg/cmd" "istio.io/istio/pkg/collateral" "istio.io/istio/pkg/config/constants" "istio.io/istio/pkg/envoy" istio_agent "istio.io/istio/pkg/istio-agent" "istio.io/istio/pkg/log" "istio.io/istio/pkg/security" "istio.io/istio/pkg/util/protomarshal" "istio.io/istio/pkg/util/sets" "istio.io/istio/pkg/version" stsserver "istio.io/istio/security/pkg/stsservice/server" "istio.io/istio/security/pkg/stsservice/tokenmanager" cleaniptables "istio.io/istio/tools/istio-clean-iptables/pkg/cmd" iptables "istio.io/istio/tools/istio-iptables/pkg/cmd" iptableslog "istio.io/istio/tools/istio-iptables/pkg/log" ) const ( localHostIPv4 = "127.0.0.1" localHostIPv6 = "::1" ) var ( loggingOptions = log.DefaultOptions() proxyArgs options.ProxyArgs ) func NewRootCommand() *cobra.Command { rootCmd := &cobra.Command{ Use: "pilot-agent", Short: "Istio Pilot agent.", Long: "Istio Pilot agent runs in the sidecar or gateway container and bootstraps Envoy.", SilenceUsage: true, FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, } // Attach the Istio logging options to the command. loggingOptions.AttachCobraFlags(rootCmd) cmd.AddFlags(rootCmd) proxyCmd := newProxyCommand() addFlags(proxyCmd) rootCmd.AddCommand(proxyCmd) rootCmd.AddCommand(requestCmd) rootCmd.AddCommand(waitCmd) rootCmd.AddCommand(version.CobraCommand()) rootCmd.AddCommand(iptables.GetCommand()) rootCmd.AddCommand(cleaniptables.GetCommand()) rootCmd.AddCommand(collateral.CobraCommand(rootCmd, &doc.GenManHeader{ Title: "Istio Pilot Agent", Section: "pilot-agent CLI", Manual: "Istio Pilot Agent", })) return rootCmd } func newProxyCommand() *cobra.Command { return &cobra.Command{ Use: "proxy", Short: "XDS proxy agent", FParseErrWhitelist: cobra.FParseErrWhitelist{ // Allow unknown flags for backward-compatibility. UnknownFlags: true, }, PersistentPreRunE: configureLogging, RunE: func(c *cobra.Command, args []string) error { cmd.PrintFlags(c.Flags()) log.Infof("Version %s", version.Info.String()) logLimits() proxy, err := initProxy(args) if err != nil { return err } proxyConfig, err := config.ConstructProxyConfig(proxyArgs.MeshConfigFile, proxyArgs.ServiceCluster, options.ProxyConfigEnv, proxyArgs.Concurrency, proxy) if err != nil { return fmt.Errorf("failed to get proxy config: %v", err) } if out, err := protomarshal.ToYAML(proxyConfig); err != nil { log.Infof("Failed to serialize to YAML: %v", err) } else { log.Infof("Effective config: %s", out) } secOpts, err := options.NewSecurityOptions(proxyConfig, proxyArgs.StsPort, proxyArgs.TokenManagerPlugin) if err != nil { return err } // If security token service (STS) port is not zero, start STS server and // listen on STS port for STS requests. For STS, see // https://tools.ietf.org/html/draft-ietf-oauth-token-exchange-16. // STS is used for stackdriver or other Envoy services using google gRPC. if proxyArgs.StsPort > 0 { stsServer, err := initStsServer(proxy, secOpts.TokenManager) if err != nil { return err } defer stsServer.Stop() } // If we are using a custom template file (for control plane proxy, for example), configure this. if proxyArgs.TemplateFile != "" && proxyConfig.CustomConfigFile == "" { proxyConfig.ProxyBootstrapTemplatePath = proxyArgs.TemplateFile } envoyOptions := envoy.ProxyConfig{ LogLevel: proxyArgs.ProxyLogLevel, ComponentLogLevel: proxyArgs.ProxyComponentLogLevel, LogAsJSON: loggingOptions.JSONEncoding, NodeIPs: proxy.IPAddresses, Sidecar: proxy.Type == model.SidecarProxy, OutlierLogPath: proxyArgs.OutlierLogPath, } agentOptions := options.NewAgentOptions(proxy, proxyConfig) agent := istio_agent.NewAgent(proxyConfig, agentOptions, secOpts, envoyOptions) ctx, cancel := context.WithCancel(context.Background()) defer cancel() defer agent.Close() // If a status port was provided, start handling status probes. if proxyConfig.StatusPort > 0 { if err := initStatusServer(ctx, proxy, proxyConfig, agentOptions.EnvoyPrometheusPort, proxyArgs.EnableProfiling, agent); err != nil { return err } } go iptableslog.ReadNFLOGSocket(ctx) // On SIGINT or SIGTERM, cancel the context, triggering a graceful shutdown go cmd.WaitSignalFunc(cancel) // Start in process SDS, dns server, xds proxy, and Envoy. wait, err := agent.Run(ctx) if err != nil { return err } wait() return nil }, } } func addFlags(proxyCmd *cobra.Command) { proxyArgs = options.NewProxyArgs() proxyCmd.PersistentFlags().StringVar(&proxyArgs.DNSDomain, "domain", "", "DNS domain suffix. If not provided uses ${POD_NAMESPACE}.svc.cluster.local") proxyCmd.PersistentFlags().StringVar(&proxyArgs.MeshConfigFile, "meshConfig", "./etc/istio/config/mesh", "File name for Istio mesh configuration. If not specified, a default mesh will be used. This may be overridden by "+ "PROXY_CONFIG environment variable or proxy.istio.io/config annotation.") proxyCmd.PersistentFlags().IntVar(&proxyArgs.StsPort, "stsPort", 0, "HTTP Port on which to serve Security Token Service (STS). If zero, STS service will not be provided.") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TokenManagerPlugin, "tokenManagerPlugin", tokenmanager.GoogleTokenExchange, "Token provider specific plugin name.") // DEPRECATED. Flags for proxy configuration proxyCmd.PersistentFlags().StringVar(&proxyArgs.ServiceCluster, "serviceCluster", constants.ServiceClusterName, "Service cluster") // Log levels are provided by the library https://github.com/gabime/spdlog, used by Envoy. proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyLogLevel, "proxyLogLevel", "warning,misc:error", fmt.Sprintf("The log level used to start the Envoy proxy (choose from {%s, %s, %s, %s, %s, %s, %s})."+ "Level may also include one or more scopes, such as 'info,misc:error,upstream:debug'", "trace", "debug", "info", "warning", "error", "critical", "off")) proxyCmd.PersistentFlags().IntVar(&proxyArgs.Concurrency, "concurrency", 0, "number of worker threads to run") // See https://www.envoyproxy.io/docs/envoy/latest/operations/cli#cmdoption-component-log-level proxyCmd.PersistentFlags().StringVar(&proxyArgs.ProxyComponentLogLevel, "proxyComponentLogLevel", "", "The component log level used to start the Envoy proxy. Deprecated, use proxyLogLevel instead") proxyCmd.PersistentFlags().StringVar(&proxyArgs.TemplateFile, "templateFile", "", "Go template bootstrap config") proxyCmd.PersistentFlags().StringVar(&proxyArgs.OutlierLogPath, "outlierLogPath", "", "The log path for outlier detection") proxyCmd.PersistentFlags().BoolVar(&proxyArgs.EnableProfiling, "profiling", true, "Enable profiling via web interface host:port/debug/pprof/.") } func initStatusServer(ctx context.Context, proxy *model.Proxy, proxyConfig *meshconfig.ProxyConfig, envoyPrometheusPort int, enableProfiling bool, agent *istio_agent.Agent, ) error { o := options.NewStatusServerOptions(proxy, proxyConfig, agent) o.EnvoyPrometheusPort = envoyPrometheusPort o.EnableProfiling = enableProfiling o.Context = ctx statusServer, err := status.NewServer(*o) if err != nil { return err } go statusServer.Run(ctx) return nil } func initStsServer(proxy *model.Proxy, tokenManager security.TokenManager) (*stsserver.Server, error) { localHostAddr := localHostIPv4 if proxy.IsIPv6() { localHostAddr = localHostIPv6 } else { // if not ipv6-only, it can be ipv4-only or dual-stack // let InstanceIP decide the localhost netIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) if netIP.Is6() && !netIP.IsLinkLocalUnicast() { localHostAddr = localHostIPv6 } } stsServer, err := stsserver.NewServer(stsserver.Config{ LocalHostAddr: localHostAddr, LocalPort: proxyArgs.StsPort, }, tokenManager) if err != nil { return nil, err } return stsServer, nil } func getDNSDomain(podNamespace, domain string) string { if len(domain) == 0 { domain = podNamespace + ".svc." + constants.DefaultClusterLocalDomain } return domain } func configureLogging(_ *cobra.Command, _ []string) error { if err := log.Configure(loggingOptions); err != nil { return err } return nil } func initProxy(args []string) (*model.Proxy, error) { proxy := &model.Proxy{ Type: model.SidecarProxy, } if len(args) > 0 { proxy.Type = model.NodeType(args[0]) if !model.IsApplicationNodeType(proxy.Type) { return nil, fmt.Errorf("Invalid proxy Type: " + string(proxy.Type)) } } podIP, _ := netip.ParseAddr(options.InstanceIPVar.Get()) // protobuf encoding of IP_ADDRESS type if podIP.IsValid() { proxy.IPAddresses = []string{podIP.String()} } // Obtain all the IPs from the node if ipAddrs, ok := network.GetPrivateIPs(context.Background()); ok { if len(proxy.IPAddresses) == 1 { for _, ip := range ipAddrs { // prevent duplicate ips, the first one must be the pod ip // as we pick the first ip as pod ip in istiod if proxy.IPAddresses[0] != ip { proxy.IPAddresses = append(proxy.IPAddresses, ip) } } } else { proxy.IPAddresses = append(proxy.IPAddresses, ipAddrs...) } } // No IP addresses provided, append 127.0.0.1 for ipv4 and ::1 for ipv6 if len(proxy.IPAddresses) == 0 { proxy.IPAddresses = append(proxy.IPAddresses, localHostIPv4, localHostIPv6) } // Apply exclusions from traffic.sidecar.istio.io/excludeInterfaces proxy.IPAddresses = applyExcludeInterfaces(proxy.IPAddresses) // After IP addresses are set, let us discover IPMode. proxy.DiscoverIPMode() // Extract pod variables. proxy.ID = proxyArgs.PodName + "." + proxyArgs.PodNamespace // If not set, set a default based on platform - podNamespace.svc.cluster.local for // K8S proxy.DNSDomain = getDNSDomain(proxyArgs.PodNamespace, proxyArgs.DNSDomain) log.WithLabels("ips", proxy.IPAddresses, "type", proxy.Type, "id", proxy.ID, "domain", proxy.DNSDomain).Info("Proxy role") return proxy, nil } func applyExcludeInterfaces(ifaces []string) []string { // Get list of excluded interfaces from pod annotation // TODO: Discuss other input methods such as env, flag (ssuvasanth) annotations, err := bootstrap.ReadPodAnnotations("") if err != nil { log.Debugf("Reading podInfoAnnotations file to get excludeInterfaces was unsuccessful. Continuing without exclusions. msg: %v", err) return ifaces } value, ok := annotations[annotation.SidecarTrafficExcludeInterfaces.Name] if !ok { log.Debugf("ExcludeInterfaces annotation is not present. Proxy IPAddresses: %v", ifaces) return ifaces } exclusions := strings.Split(value, ",") // Find IP addr of excluded interfaces and add to a map for instant lookup exclusionMap := sets.New[string]() for _, ifaceName := range exclusions { iface, err := net.InterfaceByName(ifaceName) if err != nil { log.Warnf("Unable to get interface %s: %v", ifaceName, err) continue } addrs, err := iface.Addrs() if err != nil { log.Warnf("Unable to get IP addr(s) of interface %s: %v", ifaceName, err) continue } for _, addr := range addrs { // Get IP only var ip net.IP switch v := addr.(type) { case *net.IPNet: ip = v.IP case *net.IPAddr: ip = v.IP default: continue } // handling ipv4 wrapping in ipv6 ipAddr, okay := netip.AddrFromSlice(ip) if !okay { continue } unwrapAddr := ipAddr.Unmap() if !unwrapAddr.IsValid() || unwrapAddr.IsLoopback() || unwrapAddr.IsLinkLocalUnicast() || unwrapAddr.IsLinkLocalMulticast() || unwrapAddr.IsUnspecified() { continue } // Add to map exclusionMap.Insert(unwrapAddr.String()) } } // Remove excluded IP addresses from the input IP addresses list. var selectedInterfaces []string for _, ip := range ifaces { if exclusionMap.Contains(ip) { log.Infof("Excluding ip %s from proxy IPaddresses list", ip) continue } selectedInterfaces = append(selectedInterfaces, ip) } return selectedInterfaces } func logLimits() { out, err := exec.Command("bash", "-c", "ulimit -n").Output() outStr := strings.TrimSpace(string(out)) if err != nil { log.Warnf("failed running ulimit command: %v", outStr) } else { log.Infof("Maximum file descriptors (ulimit -n): %v", outStr) } }
meshconfig "istio.io/api/mesh/v1alpha1"
random_line_split
EventForm.js
import React from "react"; import { useHistory } from "react-router"; import * as Yup from "yup"; import { Formik } from "formik"; import Map from "../mapbox/mapbox"; import axios from "axios"; import { Box, Button, Card, CardContent, CardHeader, Divider, FormHelperText, Grid, TextField, Typography, makeStyles, } from "@material-ui/core"; import "date-fns"; import DateFnsUtils from "@date-io/date-fns"; import { MuiPickersUtilsProvider, KeyboardTimePicker, KeyboardDatePicker, } from "@material-ui/pickers"; // <==========AutoComplete imports and functions ===========> import Autocomplete from "@material-ui/lab/Autocomplete"; import LocationOnIcon from "@material-ui/icons/LocationOn"; import parse from "autosuggest-highlight/parse"; import throttle from "lodash/throttle"; function
(src, position, id) { if (!position) { return; } const script = document.createElement("script"); script.setAttribute("async", ""); script.setAttribute("id", id); script.src = src; position.appendChild(script); } const autocompleteService = { current: null }; // <===================> const useStyles = makeStyles(theme => ({ root: {}, icon: { color: theme.palette.text.secondary, marginRight: theme.spacing(2), }, })); function EventForm({ className, ...rest }) { const classes = useStyles(); const history = useHistory(); // const { enqueueSnackbar } = useSnackbar(); const [selectedDate, setSelectedDate] = React.useState(new Date()); // <====================Helper Funtions for AutoFill===========> // eslint-disable-next-line const [value, setValue] = React.useState(null); const [inputValue, setInputValue] = React.useState(""); const [options, setOptions] = React.useState([]); const loaded = React.useRef(false); if (typeof window !== "undefined" && !loaded.current) { if (!document.querySelector("#google-maps")) { loadScript( `https://maps.googleapis.com/maps/api/js?key=${process.env.REACT_APP_GOOGLE_MAP_APP_API_KEY}&libraries=places`, document.querySelector("head"), "google-maps" ); } loaded.current = true; } const fetch = React.useMemo( () => throttle((request, callback) => { autocompleteService.current.getPlacePredictions(request, callback); }, 200), [] ); React.useEffect(() => { let active = true; if (!autocompleteService.current && window.google) { autocompleteService.current = new window.google.maps.places.AutocompleteService(); } if (!autocompleteService.current) { return undefined; } if (inputValue === "") { setOptions(value ? [value] : []); return undefined; } fetch({ input: inputValue }, results => { if (active) { let newOptions = []; if (value) { newOptions = [value]; } if (results) { newOptions = [...newOptions, ...results]; } setOptions(newOptions); } }); return () => { active = false; }; }, [value, inputValue, fetch]); // <===========================================> const handleDateChange = date => { setSelectedDate(date); }; return ( <Formik enableReinitialize initialValues={{ name: "", description: "", location: "", date: null, time: null, img: "", }} validationSchema={Yup.object().shape({ description: Yup.string().max(5000), name: Yup.string().max(255).required(), })} onSubmit={( values, { resetForm, setErrors, setStatus, setSubmitting } ) => { const { description, date, location, name, time, img } = values; axios .post("/api/event", { description, location, date, time, name, img }) .then(res => { resetForm(); setStatus({ success: true }); history.push("/events"); // enqueueSnackbar("Profile updated", { // // variant: "success", // // }); }) .catch(error => { setStatus({ success: false }); setErrors({ submit: error.message }); setSubmitting(false); }); }} > {({ errors, handleBlur, handleChange, handleSubmit, isSubmitting, touched, values, setFieldValue, }) => ( <form onSubmit={handleSubmit} className={classes.root}> <Grid container spacing={3}> <Grid item xs={12} lg={8}> <Card> <CardContent> <Box mt={2}> <TextField error={Boolean(touched.name && errors.name)} fullWidth helperText={touched.name && errors.name} label="Name" name="name" onBlur={handleBlur} onChange={handleChange} value={values.name} variant="outlined" /> </Box> <Box mt={2}> <TextField id="description" error={Boolean(touched.description && errors.description)} fullWidth helperText={touched.description && errors.description} multiline rows={5} label="Event Description" name="description" onBlur={handleBlur} onChange={handleChange} value={values.description} variant="outlined" /> </Box> <Box mt={2}> <TextField fullWidth label="Image Url" name="img" onBlur={handleBlur} onChange={handleChange} value={values.img} variant="outlined" /> </Box> </CardContent> </Card> <Box mt={3}> <Card> <CardHeader title="Time & Date" /> <Divider /> <CardContent> <MuiPickersUtilsProvider utils={DateFnsUtils}> <Grid container justify="space-evenly"> <KeyboardDatePicker disableToolbar disablePast variant="inline" format="MM/dd/yyyy" margin="normal" name="date" value={values.date} id="date-picker-inline" label="Pick a Date" onChange={(event, newValue) => { handleDateChange(); setFieldValue("date", newValue); }} KeyboardButtonProps={{ "aria-label": "change date", }} /> <KeyboardTimePicker margin="normal" id="time-picker" label="Select a time" name="time" minutesStep={5} value={selectedDate} color="secondary" onChange={(event, newValue) => { setFieldValue("time", newValue); }} KeyboardButtonProps={{ "aria-label": "change time", }} /> </Grid> </MuiPickersUtilsProvider> </CardContent> </Card> </Box> <Box mt={3}> <Card> <CardHeader title="Location" /> <Divider /> <CardContent> <Autocomplete fullWidth name="location" getOptionLabel={option => typeof option === "string" ? option : option.description } filterOptions={x => x} options={options} autoComplete includeInputInList filterSelectedOptions onChange={(event, newValue) => { setOptions(newValue ? [newValue, ...options] : options); // setValue(newValue.description); setFieldValue("location", newValue.description); }} onInputChange={(event, newInputValue) => { setInputValue(newInputValue); }} renderInput={params => ( <TextField {...params} label="Add a location" variant="outlined" fullWidth /> )} renderOption={option => { const matches = option.structured_formatting .main_text_matched_substrings; const parts = parse( option.structured_formatting.main_text, matches.map(match => [ match.offset, match.offset + match.length, ]) ); return ( <Grid container alignItems="center"> <Grid item> <LocationOnIcon className={classes.icon} /> </Grid> <Grid item xs> {parts.map((part, index) => ( <span key={index} style={{ fontWeight: part.highlight ? 700 : 400, }} > {part.text} </span> ))} <Typography variant="body2" color="textSecondary"> {option.structured_formatting.secondary_text} </Typography> </Grid> </Grid> ); }} /> </CardContent> </Card> </Box> </Grid> <Grid item xs={12} lg={4}> <Card> <CardHeader title="Map" /> <Divider /> <CardContent> <Box> <Map /> </Box> </CardContent> </Card> </Grid> </Grid> {errors.submit && ( <Box mt={3}> <FormHelperText error>{errors.submit}</FormHelperText> </Box> )} <Box mt={2}> <Button color="secondary" variant="contained" type="submit" disabled={isSubmitting} > Create event </Button> </Box> </form> )} </Formik> ); } export default EventForm;
loadScript
identifier_name
EventForm.js
import React from "react"; import { useHistory } from "react-router"; import * as Yup from "yup"; import { Formik } from "formik"; import Map from "../mapbox/mapbox"; import axios from "axios"; import { Box, Button, Card, CardContent, CardHeader, Divider, FormHelperText, Grid, TextField, Typography, makeStyles, } from "@material-ui/core"; import "date-fns"; import DateFnsUtils from "@date-io/date-fns"; import { MuiPickersUtilsProvider, KeyboardTimePicker, KeyboardDatePicker, } from "@material-ui/pickers"; // <==========AutoComplete imports and functions ===========> import Autocomplete from "@material-ui/lab/Autocomplete"; import LocationOnIcon from "@material-ui/icons/LocationOn"; import parse from "autosuggest-highlight/parse"; import throttle from "lodash/throttle"; function loadScript(src, position, id) { if (!position) { return; } const script = document.createElement("script"); script.setAttribute("async", ""); script.setAttribute("id", id); script.src = src; position.appendChild(script); } const autocompleteService = { current: null }; // <===================> const useStyles = makeStyles(theme => ({ root: {}, icon: { color: theme.palette.text.secondary, marginRight: theme.spacing(2), }, })); function EventForm({ className, ...rest })
export default EventForm;
{ const classes = useStyles(); const history = useHistory(); // const { enqueueSnackbar } = useSnackbar(); const [selectedDate, setSelectedDate] = React.useState(new Date()); // <====================Helper Funtions for AutoFill===========> // eslint-disable-next-line const [value, setValue] = React.useState(null); const [inputValue, setInputValue] = React.useState(""); const [options, setOptions] = React.useState([]); const loaded = React.useRef(false); if (typeof window !== "undefined" && !loaded.current) { if (!document.querySelector("#google-maps")) { loadScript( `https://maps.googleapis.com/maps/api/js?key=${process.env.REACT_APP_GOOGLE_MAP_APP_API_KEY}&libraries=places`, document.querySelector("head"), "google-maps" ); } loaded.current = true; } const fetch = React.useMemo( () => throttle((request, callback) => { autocompleteService.current.getPlacePredictions(request, callback); }, 200), [] ); React.useEffect(() => { let active = true; if (!autocompleteService.current && window.google) { autocompleteService.current = new window.google.maps.places.AutocompleteService(); } if (!autocompleteService.current) { return undefined; } if (inputValue === "") { setOptions(value ? [value] : []); return undefined; } fetch({ input: inputValue }, results => { if (active) { let newOptions = []; if (value) { newOptions = [value]; } if (results) { newOptions = [...newOptions, ...results]; } setOptions(newOptions); } }); return () => { active = false; }; }, [value, inputValue, fetch]); // <===========================================> const handleDateChange = date => { setSelectedDate(date); }; return ( <Formik enableReinitialize initialValues={{ name: "", description: "", location: "", date: null, time: null, img: "", }} validationSchema={Yup.object().shape({ description: Yup.string().max(5000), name: Yup.string().max(255).required(), })} onSubmit={( values, { resetForm, setErrors, setStatus, setSubmitting } ) => { const { description, date, location, name, time, img } = values; axios .post("/api/event", { description, location, date, time, name, img }) .then(res => { resetForm(); setStatus({ success: true }); history.push("/events"); // enqueueSnackbar("Profile updated", { // // variant: "success", // // }); }) .catch(error => { setStatus({ success: false }); setErrors({ submit: error.message }); setSubmitting(false); }); }} > {({ errors, handleBlur, handleChange, handleSubmit, isSubmitting, touched, values, setFieldValue, }) => ( <form onSubmit={handleSubmit} className={classes.root}> <Grid container spacing={3}> <Grid item xs={12} lg={8}> <Card> <CardContent> <Box mt={2}> <TextField error={Boolean(touched.name && errors.name)} fullWidth helperText={touched.name && errors.name} label="Name" name="name" onBlur={handleBlur} onChange={handleChange} value={values.name} variant="outlined" /> </Box> <Box mt={2}> <TextField id="description" error={Boolean(touched.description && errors.description)} fullWidth helperText={touched.description && errors.description} multiline rows={5} label="Event Description" name="description" onBlur={handleBlur} onChange={handleChange} value={values.description} variant="outlined" /> </Box> <Box mt={2}> <TextField fullWidth label="Image Url" name="img" onBlur={handleBlur} onChange={handleChange} value={values.img} variant="outlined" /> </Box> </CardContent> </Card> <Box mt={3}> <Card> <CardHeader title="Time & Date" /> <Divider /> <CardContent> <MuiPickersUtilsProvider utils={DateFnsUtils}> <Grid container justify="space-evenly"> <KeyboardDatePicker disableToolbar disablePast variant="inline" format="MM/dd/yyyy" margin="normal" name="date" value={values.date} id="date-picker-inline" label="Pick a Date" onChange={(event, newValue) => { handleDateChange(); setFieldValue("date", newValue); }} KeyboardButtonProps={{ "aria-label": "change date", }} /> <KeyboardTimePicker margin="normal" id="time-picker" label="Select a time" name="time" minutesStep={5} value={selectedDate} color="secondary" onChange={(event, newValue) => { setFieldValue("time", newValue); }} KeyboardButtonProps={{ "aria-label": "change time", }} /> </Grid> </MuiPickersUtilsProvider> </CardContent> </Card> </Box> <Box mt={3}> <Card> <CardHeader title="Location" /> <Divider /> <CardContent> <Autocomplete fullWidth name="location" getOptionLabel={option => typeof option === "string" ? option : option.description } filterOptions={x => x} options={options} autoComplete includeInputInList filterSelectedOptions onChange={(event, newValue) => { setOptions(newValue ? [newValue, ...options] : options); // setValue(newValue.description); setFieldValue("location", newValue.description); }} onInputChange={(event, newInputValue) => { setInputValue(newInputValue); }} renderInput={params => ( <TextField {...params} label="Add a location" variant="outlined" fullWidth /> )} renderOption={option => { const matches = option.structured_formatting .main_text_matched_substrings; const parts = parse( option.structured_formatting.main_text, matches.map(match => [ match.offset, match.offset + match.length, ]) ); return ( <Grid container alignItems="center"> <Grid item> <LocationOnIcon className={classes.icon} /> </Grid> <Grid item xs> {parts.map((part, index) => ( <span key={index} style={{ fontWeight: part.highlight ? 700 : 400, }} > {part.text} </span> ))} <Typography variant="body2" color="textSecondary"> {option.structured_formatting.secondary_text} </Typography> </Grid> </Grid> ); }} /> </CardContent> </Card> </Box> </Grid> <Grid item xs={12} lg={4}> <Card> <CardHeader title="Map" /> <Divider /> <CardContent> <Box> <Map /> </Box> </CardContent> </Card> </Grid> </Grid> {errors.submit && ( <Box mt={3}> <FormHelperText error>{errors.submit}</FormHelperText> </Box> )} <Box mt={2}> <Button color="secondary" variant="contained" type="submit" disabled={isSubmitting} > Create event </Button> </Box> </form> )} </Formik> ); }
identifier_body
EventForm.js
import React from "react"; import { useHistory } from "react-router"; import * as Yup from "yup"; import { Formik } from "formik"; import Map from "../mapbox/mapbox"; import axios from "axios"; import { Box, Button, Card, CardContent, CardHeader, Divider, FormHelperText, Grid, TextField, Typography, makeStyles, } from "@material-ui/core"; import "date-fns"; import DateFnsUtils from "@date-io/date-fns"; import { MuiPickersUtilsProvider, KeyboardTimePicker, KeyboardDatePicker, } from "@material-ui/pickers"; // <==========AutoComplete imports and functions ===========> import Autocomplete from "@material-ui/lab/Autocomplete"; import LocationOnIcon from "@material-ui/icons/LocationOn"; import parse from "autosuggest-highlight/parse"; import throttle from "lodash/throttle"; function loadScript(src, position, id) { if (!position) { return; } const script = document.createElement("script"); script.setAttribute("async", ""); script.setAttribute("id", id); script.src = src; position.appendChild(script); } const autocompleteService = { current: null }; // <===================> const useStyles = makeStyles(theme => ({ root: {}, icon: { color: theme.palette.text.secondary, marginRight: theme.spacing(2), }, })); function EventForm({ className, ...rest }) { const classes = useStyles(); const history = useHistory(); // const { enqueueSnackbar } = useSnackbar(); const [selectedDate, setSelectedDate] = React.useState(new Date()); // <====================Helper Funtions for AutoFill===========> // eslint-disable-next-line const [value, setValue] = React.useState(null); const [inputValue, setInputValue] = React.useState(""); const [options, setOptions] = React.useState([]); const loaded = React.useRef(false); if (typeof window !== "undefined" && !loaded.current)
const fetch = React.useMemo( () => throttle((request, callback) => { autocompleteService.current.getPlacePredictions(request, callback); }, 200), [] ); React.useEffect(() => { let active = true; if (!autocompleteService.current && window.google) { autocompleteService.current = new window.google.maps.places.AutocompleteService(); } if (!autocompleteService.current) { return undefined; } if (inputValue === "") { setOptions(value ? [value] : []); return undefined; } fetch({ input: inputValue }, results => { if (active) { let newOptions = []; if (value) { newOptions = [value]; } if (results) { newOptions = [...newOptions, ...results]; } setOptions(newOptions); } }); return () => { active = false; }; }, [value, inputValue, fetch]); // <===========================================> const handleDateChange = date => { setSelectedDate(date); }; return ( <Formik enableReinitialize initialValues={{ name: "", description: "", location: "", date: null, time: null, img: "", }} validationSchema={Yup.object().shape({ description: Yup.string().max(5000), name: Yup.string().max(255).required(), })} onSubmit={( values, { resetForm, setErrors, setStatus, setSubmitting } ) => { const { description, date, location, name, time, img } = values; axios .post("/api/event", { description, location, date, time, name, img }) .then(res => { resetForm(); setStatus({ success: true }); history.push("/events"); // enqueueSnackbar("Profile updated", { // // variant: "success", // // }); }) .catch(error => { setStatus({ success: false }); setErrors({ submit: error.message }); setSubmitting(false); }); }} > {({ errors, handleBlur, handleChange, handleSubmit, isSubmitting, touched, values, setFieldValue, }) => ( <form onSubmit={handleSubmit} className={classes.root}> <Grid container spacing={3}> <Grid item xs={12} lg={8}> <Card> <CardContent> <Box mt={2}> <TextField error={Boolean(touched.name && errors.name)} fullWidth helperText={touched.name && errors.name} label="Name" name="name" onBlur={handleBlur} onChange={handleChange} value={values.name} variant="outlined" /> </Box> <Box mt={2}> <TextField id="description" error={Boolean(touched.description && errors.description)} fullWidth helperText={touched.description && errors.description} multiline rows={5} label="Event Description" name="description" onBlur={handleBlur} onChange={handleChange} value={values.description} variant="outlined" /> </Box> <Box mt={2}> <TextField fullWidth label="Image Url" name="img" onBlur={handleBlur} onChange={handleChange} value={values.img} variant="outlined" /> </Box> </CardContent> </Card> <Box mt={3}> <Card> <CardHeader title="Time & Date" /> <Divider /> <CardContent> <MuiPickersUtilsProvider utils={DateFnsUtils}> <Grid container justify="space-evenly"> <KeyboardDatePicker disableToolbar disablePast variant="inline" format="MM/dd/yyyy" margin="normal" name="date" value={values.date} id="date-picker-inline" label="Pick a Date" onChange={(event, newValue) => { handleDateChange(); setFieldValue("date", newValue); }} KeyboardButtonProps={{ "aria-label": "change date", }} /> <KeyboardTimePicker margin="normal" id="time-picker" label="Select a time" name="time" minutesStep={5} value={selectedDate} color="secondary" onChange={(event, newValue) => { setFieldValue("time", newValue); }} KeyboardButtonProps={{ "aria-label": "change time", }} /> </Grid> </MuiPickersUtilsProvider> </CardContent> </Card> </Box> <Box mt={3}> <Card> <CardHeader title="Location" /> <Divider /> <CardContent> <Autocomplete fullWidth name="location" getOptionLabel={option => typeof option === "string" ? option : option.description } filterOptions={x => x} options={options} autoComplete includeInputInList filterSelectedOptions onChange={(event, newValue) => { setOptions(newValue ? [newValue, ...options] : options); // setValue(newValue.description); setFieldValue("location", newValue.description); }} onInputChange={(event, newInputValue) => { setInputValue(newInputValue); }} renderInput={params => ( <TextField {...params} label="Add a location" variant="outlined" fullWidth /> )} renderOption={option => { const matches = option.structured_formatting .main_text_matched_substrings; const parts = parse( option.structured_formatting.main_text, matches.map(match => [ match.offset, match.offset + match.length, ]) ); return ( <Grid container alignItems="center"> <Grid item> <LocationOnIcon className={classes.icon} /> </Grid> <Grid item xs> {parts.map((part, index) => ( <span key={index} style={{ fontWeight: part.highlight ? 700 : 400, }} > {part.text} </span> ))} <Typography variant="body2" color="textSecondary"> {option.structured_formatting.secondary_text} </Typography> </Grid> </Grid> ); }} /> </CardContent> </Card> </Box> </Grid> <Grid item xs={12} lg={4}> <Card> <CardHeader title="Map" /> <Divider /> <CardContent> <Box> <Map /> </Box> </CardContent> </Card> </Grid> </Grid> {errors.submit && ( <Box mt={3}> <FormHelperText error>{errors.submit}</FormHelperText> </Box> )} <Box mt={2}> <Button color="secondary" variant="contained" type="submit" disabled={isSubmitting} > Create event </Button> </Box> </form> )} </Formik> ); } export default EventForm;
{ if (!document.querySelector("#google-maps")) { loadScript( `https://maps.googleapis.com/maps/api/js?key=${process.env.REACT_APP_GOOGLE_MAP_APP_API_KEY}&libraries=places`, document.querySelector("head"), "google-maps" ); } loaded.current = true; }
conditional_block
EventForm.js
import React from "react"; import { useHistory } from "react-router"; import * as Yup from "yup"; import { Formik } from "formik"; import Map from "../mapbox/mapbox"; import axios from "axios"; import { Box, Button, Card, CardContent, CardHeader, Divider, FormHelperText, Grid, TextField, Typography, makeStyles, } from "@material-ui/core"; import "date-fns"; import DateFnsUtils from "@date-io/date-fns"; import { MuiPickersUtilsProvider, KeyboardTimePicker, KeyboardDatePicker, } from "@material-ui/pickers"; // <==========AutoComplete imports and functions ===========> import Autocomplete from "@material-ui/lab/Autocomplete"; import LocationOnIcon from "@material-ui/icons/LocationOn"; import parse from "autosuggest-highlight/parse"; import throttle from "lodash/throttle"; function loadScript(src, position, id) { if (!position) { return; } const script = document.createElement("script"); script.setAttribute("async", ""); script.setAttribute("id", id); script.src = src; position.appendChild(script); } const autocompleteService = { current: null }; // <===================> const useStyles = makeStyles(theme => ({ root: {}, icon: { color: theme.palette.text.secondary, marginRight: theme.spacing(2), }, })); function EventForm({ className, ...rest }) { const classes = useStyles(); const history = useHistory(); // const { enqueueSnackbar } = useSnackbar(); const [selectedDate, setSelectedDate] = React.useState(new Date()); // <====================Helper Funtions for AutoFill===========> // eslint-disable-next-line const [value, setValue] = React.useState(null); const [inputValue, setInputValue] = React.useState(""); const [options, setOptions] = React.useState([]); const loaded = React.useRef(false); if (typeof window !== "undefined" && !loaded.current) { if (!document.querySelector("#google-maps")) { loadScript( `https://maps.googleapis.com/maps/api/js?key=${process.env.REACT_APP_GOOGLE_MAP_APP_API_KEY}&libraries=places`, document.querySelector("head"), "google-maps" ); } loaded.current = true; } const fetch = React.useMemo( () => throttle((request, callback) => { autocompleteService.current.getPlacePredictions(request, callback); }, 200), [] ); React.useEffect(() => { let active = true; if (!autocompleteService.current && window.google) { autocompleteService.current = new window.google.maps.places.AutocompleteService(); } if (!autocompleteService.current) { return undefined; } if (inputValue === "") { setOptions(value ? [value] : []); return undefined; } fetch({ input: inputValue }, results => { if (active) { let newOptions = []; if (value) { newOptions = [value]; } if (results) { newOptions = [...newOptions, ...results]; } setOptions(newOptions); } }); return () => { active = false; }; }, [value, inputValue, fetch]); // <===========================================> const handleDateChange = date => { setSelectedDate(date); }; return ( <Formik enableReinitialize initialValues={{ name: "", description: "", location: "", date: null, time: null, img: "", }} validationSchema={Yup.object().shape({ description: Yup.string().max(5000), name: Yup.string().max(255).required(), })} onSubmit={( values, { resetForm, setErrors, setStatus, setSubmitting } ) => { const { description, date, location, name, time, img } = values; axios .post("/api/event", { description, location, date, time, name, img }) .then(res => { resetForm(); setStatus({ success: true }); history.push("/events"); // enqueueSnackbar("Profile updated", { // // variant: "success", // // }); }) .catch(error => { setStatus({ success: false }); setErrors({ submit: error.message }); setSubmitting(false); }); }} > {({ errors, handleBlur, handleChange, handleSubmit, isSubmitting, touched, values, setFieldValue, }) => ( <form onSubmit={handleSubmit} className={classes.root}> <Grid container spacing={3}> <Grid item xs={12} lg={8}> <Card> <CardContent> <Box mt={2}> <TextField error={Boolean(touched.name && errors.name)} fullWidth helperText={touched.name && errors.name} label="Name" name="name" onBlur={handleBlur} onChange={handleChange} value={values.name} variant="outlined" /> </Box> <Box mt={2}> <TextField id="description" error={Boolean(touched.description && errors.description)} fullWidth helperText={touched.description && errors.description} multiline rows={5} label="Event Description" name="description" onBlur={handleBlur} onChange={handleChange} value={values.description} variant="outlined" /> </Box> <Box mt={2}> <TextField fullWidth label="Image Url" name="img" onBlur={handleBlur} onChange={handleChange} value={values.img} variant="outlined" /> </Box> </CardContent> </Card> <Box mt={3}> <Card> <CardHeader title="Time & Date" /> <Divider /> <CardContent> <MuiPickersUtilsProvider utils={DateFnsUtils}> <Grid container justify="space-evenly"> <KeyboardDatePicker disableToolbar disablePast variant="inline" format="MM/dd/yyyy" margin="normal" name="date" value={values.date} id="date-picker-inline" label="Pick a Date" onChange={(event, newValue) => { handleDateChange(); setFieldValue("date", newValue); }} KeyboardButtonProps={{ "aria-label": "change date", }} /> <KeyboardTimePicker margin="normal" id="time-picker" label="Select a time" name="time" minutesStep={5} value={selectedDate} color="secondary" onChange={(event, newValue) => { setFieldValue("time", newValue); }} KeyboardButtonProps={{ "aria-label": "change time", }} /> </Grid> </MuiPickersUtilsProvider>
<CardHeader title="Location" /> <Divider /> <CardContent> <Autocomplete fullWidth name="location" getOptionLabel={option => typeof option === "string" ? option : option.description } filterOptions={x => x} options={options} autoComplete includeInputInList filterSelectedOptions onChange={(event, newValue) => { setOptions(newValue ? [newValue, ...options] : options); // setValue(newValue.description); setFieldValue("location", newValue.description); }} onInputChange={(event, newInputValue) => { setInputValue(newInputValue); }} renderInput={params => ( <TextField {...params} label="Add a location" variant="outlined" fullWidth /> )} renderOption={option => { const matches = option.structured_formatting .main_text_matched_substrings; const parts = parse( option.structured_formatting.main_text, matches.map(match => [ match.offset, match.offset + match.length, ]) ); return ( <Grid container alignItems="center"> <Grid item> <LocationOnIcon className={classes.icon} /> </Grid> <Grid item xs> {parts.map((part, index) => ( <span key={index} style={{ fontWeight: part.highlight ? 700 : 400, }} > {part.text} </span> ))} <Typography variant="body2" color="textSecondary"> {option.structured_formatting.secondary_text} </Typography> </Grid> </Grid> ); }} /> </CardContent> </Card> </Box> </Grid> <Grid item xs={12} lg={4}> <Card> <CardHeader title="Map" /> <Divider /> <CardContent> <Box> <Map /> </Box> </CardContent> </Card> </Grid> </Grid> {errors.submit && ( <Box mt={3}> <FormHelperText error>{errors.submit}</FormHelperText> </Box> )} <Box mt={2}> <Button color="secondary" variant="contained" type="submit" disabled={isSubmitting} > Create event </Button> </Box> </form> )} </Formik> ); } export default EventForm;
</CardContent> </Card> </Box> <Box mt={3}> <Card>
random_line_split
main.go
// Copyright 2015 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. // Benchstat computes and compares statistics about benchmarks. // // This package has moved. Please use https://golang.org/x/perf/cmd/benchstat package main import ( "bytes" "flag" "fmt" "html" "io/ioutil" "log" "os" "strconv" "strings" "unicode/utf8" "rsc.io/benchstat/internal/go-moremath/stats" ) func usage() { fmt.Fprintf(os.Stderr, "usage: benchstat [options] old.txt [new.txt] [more.txt ...]\n") fmt.Fprintf(os.Stderr, "options:\n") flag.PrintDefaults() os.Exit(2) } var ( flagDeltaTest = flag.String("delta-test", "utest", "significance `test` to apply to delta: utest, ttest, or none") flagAlpha = flag.Float64("alpha", 0.05, "consider change significant if p < `α`") flagGeomean = flag.Bool("geomean", false, "print the geometric mean of each file") flagHTML = flag.Bool("html", false, "print results as an HTML table") ) var deltaTestNames = map[string]func(old, new *Benchstat) (float64, error){ "none": notest, "u": utest, "u-test": utest, "utest": utest, "t": ttest, "t-test": ttest, "ttest": ttest, } type row struct { cols []string } func newRow(cols ...string) *row { return &row{cols: cols} } func (r *row) add(col string) { r.cols = append(r.cols, col) } func (r *row) trim() { for len(r.cols) > 0 && r.cols[len(r.cols)-1] == "" { r.cols = r.cols[:len(r.cols)-1] } } func main() { log.SetPrefix("benchstat: ") log.SetFlags(0) flag.Usage = usage flag.Parse() deltaTest := deltaTestNames[strings.ToLower(*flagDeltaTest)] if flag.NArg() < 1 || deltaTest == nil { flag.Usage() } // Read in benchmark data. c := readFiles(flag.Args()) for _, stat := range c.Stats { stat.ComputeStats() } var tables [][]*row switch len(c.Configs) { case 2: before, after := c.Configs[0], c.Configs[1] key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) for _, key.Benchmark = range c.Benchmarks { key.Config = before old := c.Stats[key] key.Config = after new := c.Stats[key] if old == nil || new == nil { continue } if len(table) == 0 { table = append(table, newRow("name", "old "+metric, "new "+metric, "delta")) } pval, testerr := deltaTest(old, new) scaler := newScaler(old.Mean, old.Unit) row := newRow(key.Benchmark, old.Format(scaler), new.Format(scaler), "~ ") if testerr == stats.ErrZeroVariance { row.add("(zero variance)") } else if testerr == stats.ErrSampleSize { row.add("(too few samples)") } else if testerr == stats.ErrSamplesEqual { row.add("(all equal)") } else if testerr != nil { row.add(fmt.Sprintf("(%s)", testerr)) } else if pval < *flagAlpha { row.cols[3] = fmt.Sprintf("%+.2f%%", ((new.Mean/old.Mean)-1.0)*100.0) } if len(row.cols) == 4 && pval != -1 { row.add(fmt.Sprintf("(p=%0.3f n=%d+%d)", pval, len(old.RValues), len(new.RValues))) } table = append(table, row) } if len(table) > 0 { table = addGeomean(table, c, key.Unit, true) tables = append(tables, table) } } default: key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) if len(c.Configs) > 1 { hdr := newRow("name \\ " + metric) for _, config := range c.Configs { hdr.add(config) } table = append(table, hdr) } else { table = append(table, newRow("name", metric)) } for _, key.Benchmark = range c.Benchmarks { row := newRow(key.Benchmark) var scaler func(float64) string for _, key.Config = range c.Configs { stat := c.Stats[key] if stat == nil { row.add("") continue } if scaler == nil { scaler = newScaler(stat.Mean, stat.Unit) } row.add(stat.Format(scaler)) } row.trim() if len(row.cols) > 1 { table = append(table, row) } } table = addGeomean(table, c, key.Unit, false) tables = append(tables, table) } } numColumn := 0 for _, table := range tables { for _, row := range table { if numColumn < len(row.cols) { numColumn = len(row.cols) } } } max := make([]int, numColumn) for _, table := range tables { for _, row := range table { for i, s := range row.cols { n := utf8.RuneCountInString(s) if max[i] < n { max[i] = n } } } } var buf bytes.Buffer for i, table := range tables { if i > 0 { fmt.Fprintf(&buf, "\n") } if *flagHTML { fmt.Fprintf(&buf, "<style>.benchstat tbody td:nth-child(1n+2) { text-align: right; padding: 0em 1em; }</style>\n") fmt.Fprintf(&buf, "<table class='benchstat'>\n") printRow := func(row *row, tag string) { fmt.Fprintf(&buf, "<tr>") for _, cell := range row.cols { fmt.Fprintf(&buf, "<%s>%s</%s>", tag, html.EscapeString(cell), tag) } fmt.Fprintf(&buf, "\n") } printRow(table[0], "th") for _, row := range table[1:] { printRow(row, "td") } fmt.Fprintf(&buf, "</table>\n") continue } // headings row := table[0] for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: fmt.Fprintf(&buf, " %-*s", max[i], s) case len(row.cols) - 1: fmt.Fprintf(&buf, " %s\n", s) } } // data for _, row := range table[1:] { for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: if i == len(row.cols)-1 && len(s) > 0 && s[0] == '(' { // Left-align p value. fmt.Fprintf(&buf, " %s", s) break } fmt.Fprintf(&buf, " %*s", max[i], s) } } fmt.Fprintf(&buf, "\n") } } os.Stdout.Write(buf.Bytes()) } func addGeomean(table []*row, c *Collection, unit string, delta bool) []*row { if !*flagGeomean { return table } row := newRow("[Geo mean]") key := BenchKey{Unit: unit} geomeans := []float64{} for _, key.Config = range c.Configs { var means []float64 for _, key.Benchmark = range c.Benchmarks { stat := c.Stats[key] if stat != nil { means = append(means, stat.Mean) } } if len(means) == 0 { row.add("") delta = false } else { geomean := stats.GeoMean(means) geomeans = append(geomeans, geomean) row.add(newScaler(geomean, unit)(geomean) + " ") } } if delta { row.add(fmt.Sprintf("%+.2f%%", ((geomeans[1]/geomeans[0])-1.0)*100.0)) } return append(table, row) } func timeScaler(ns float64) func(float64) string { var format string var scale float64 switch x := ns / 1e9; { case x >= 99.5: format, scale = "%.0fs", 1 case x >= 9.95: format, scale = "%.1fs", 1 case x >= 0.995: format, scale = "%.2fs", 1 case x >= 0.0995: format, scale = "%.0fms", 1000 case x >= 0.00995: format, scale = "%.1fms", 1000 case x >= 0.000995: format, scale = "%.2fms", 1000 case x >= 0.0000995: format, scale = "%.0fµs", 1000*1000 case x >= 0.00000995: format, scale = "%.1fµs", 1000*1000 case x >= 0.000000995: format, scale = "%.2fµs", 1000*1000 case x >= 0.0000000995: format, scale = "%.0fns", 1000*1000*1000 case x >= 0.00000000995: format, scale = "%.1fns", 1000*1000*1000 default: format, scale = "%.2fns", 1000*1000*1000 } return func(ns float64) string { return fmt.Sprintf(format, ns/1e9*scale) } } func newScaler(val float64, unit string) func(float64) string { if unit == "ns/op" { return timeScaler(val) } var format string var scale float64 var suffix string prescale := 1.0 if unit == "MB/s" { prescale = 1e6 } switch x := val * prescale; { case x >= 99500000000000: format, scale, suffix = "%.0f", 1e12, "T" case x >= 9950000000000: format, scale, suffix = "%.1f", 1e12, "T" case x >= 995000000000: format, scale, suffix = "%.2f", 1e12, "T" case x >= 99500000000: format, scale, suffix = "%.0f", 1e9, "G" case x >= 9950000000: format, scale, suffix = "%.1f", 1e9, "G" case x >= 995000000: format, scale, suffix = "%.2f", 1e9, "G" case x >= 99500000: format, scale, suffix = "%.0f", 1e6, "M" case x >= 9950000: format, scale, suffix = "%.1f", 1e6, "M" case x >= 995000: format, scale, suffix = "%.2f", 1e6, "M" case x >= 99500: format, scale, suffix = "%.0f", 1e3, "k" case x >= 9950: format, scale, suffix = "%.1f", 1e3, "k" case x >= 995: format, scale, suffix = "%.2f", 1e3, "k" case x >= 99.5: format, scale, suffix = "%.0f", 1, "" case x >= 9.95: format, scale, suffix = "%.1f", 1, "" default: format, scale, suffix = "%.2f", 1, "" } if unit == "B/op" { suffix += "B" } if unit == "MB/s" { suffix += "B/s" } scale /= prescale return func(val float64) string { return fmt.Sprintf(format+suffix, val/scale) } } func (b *Benchstat) Format(scaler func(float64) string) string { diff := 1 - b.Min/b.Mean if d := b.Max/b.Mean - 1; d > diff { diff = d } s := scaler(b.Mean) if b.Mean == 0 { s += " " } else { s = fmt.Sprintf("%s ±%3s", s, fmt.Sprintf("%.0f%%", diff*100.0)) } return s } // ComputeStats updates the derived statistics in s from the raw // samples in s.Values. func (stat *Benchstat) ComputeStats() { // Discard outliers. values := stats.Sample{Xs: stat.Values} q1, q3 := values.Percentile(0.25), values.Percentile(0.75) lo, hi := q1-1.5*(q3-q1), q3+1.5*(q3-q1) for _, value := range stat.Values { if lo <= value && value <= hi { stat.RValues = append(stat.RValues, value) } } // Compute statistics of remaining data. stat.Min, stat.Max = stats.Bounds(stat.RValues) stat.Mean = stats.Mean(stat.RValues) } // A Benchstat is the metrics along one axis (e.g., ns/op or MB/s) // for all runs of a specific benchmark. type Benchstat struct { Unit string Values []float64 // metrics RValues []float64 // metrics with outliers removed Min float64 // min of RValues Mean float64 // mean of RValues Max float64 // max of RValues } // A BenchKey identifies one metric (e.g., "ns/op", "B/op") from one // benchmark (function name sans "Benchmark" prefix) in one // configuration (input file name). type BenchKey struct { Config, Benchmark, Unit string } type Collection struct { Stats map[BenchKey]*Benchstat // Configs, Benchmarks, and Units give the set of configs, // benchmarks, and units from the keys in Stats in an order // meant to match the order the benchmarks were read in. Configs, Benchmarks, Units []string } func (c *Collection) AddStat(key BenchKey) *Benchstat { if stat, ok := c.Stats[key]; ok { return stat } addString := func(strings *[]string, add string) { for _, s := range *strings { if s == add { return } } *strings = append(*strings, add) } addString(&c.Configs, key.Config) addString(&c.Benchmarks, key.Benchmark) addString(&c.Units, key.Unit) stat := &Benchstat{Unit: key.Unit} c.Stats[key] = stat return stat } // readFiles reads a set of benchmark files. func readFiles(files []string) *Collection { c := Collection{Stats: make(map[BenchKey]*Benchstat)} for _, file := range files { readFile(file, &c) } return &c } // readFile reads a set of benchmarks from a file in to a Collection. func readFile(file string, c *Collection) { c.Configs = append(c.Configs, file) key := BenchKey{Config: file} text, err := ioutil.ReadFile(file) if err != nil { log.Fatal(err) } for _, line := range strings.Split(string(text), "\n") { f := strings.Fields(line) if len(f) < 4 { continue } name := f[0] if !strings.HasPrefix(name, "Benchmark") { continue } name = strings.TrimPrefix(name, "Benchmark") n, _ := strconv.Atoi(f[1]) if n == 0 { continue } key.Benchmark = name for i := 2; i+2 <= len(f); i += 2 { val, err := strconv.ParseFloat(f[i], 64) if err != nil { continue } key.Unit = f[i+1] stat := c.AddStat(key) stat.Values = append(stat.Values, val) } } } func metricOf(unit string) string { switch unit { case "ns/op": return "time/op" case "B/op": return "alloc/op" case "MB/s": return "speed" default: return unit } } // Significance tests. func notest(old, new *Benchstat) (pval float64, err error) { return -1, nil } func ttest
new *Benchstat) (pval float64, err error) { t, err := stats.TwoSampleWelchTTest(stats.Sample{Xs: old.RValues}, stats.Sample{Xs: new.RValues}, stats.LocationDiffers) if err != nil { return -1, err } return t.P, nil } func utest(old, new *Benchstat) (pval float64, err error) { u, err := stats.MannWhitneyUTest(old.RValues, new.RValues, stats.LocationDiffers) if err != nil { return -1, err } return u.P, nil }
(old,
identifier_name
main.go
// Copyright 2015 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. // Benchstat computes and compares statistics about benchmarks. // // This package has moved. Please use https://golang.org/x/perf/cmd/benchstat package main import ( "bytes" "flag" "fmt" "html" "io/ioutil" "log" "os" "strconv" "strings" "unicode/utf8" "rsc.io/benchstat/internal/go-moremath/stats" ) func usage() { fmt.Fprintf(os.Stderr, "usage: benchstat [options] old.txt [new.txt] [more.txt ...]\n") fmt.Fprintf(os.Stderr, "options:\n") flag.PrintDefaults() os.Exit(2) } var ( flagDeltaTest = flag.String("delta-test", "utest", "significance `test` to apply to delta: utest, ttest, or none") flagAlpha = flag.Float64("alpha", 0.05, "consider change significant if p < `α`") flagGeomean = flag.Bool("geomean", false, "print the geometric mean of each file") flagHTML = flag.Bool("html", false, "print results as an HTML table") ) var deltaTestNames = map[string]func(old, new *Benchstat) (float64, error){ "none": notest, "u": utest, "u-test": utest, "utest": utest, "t": ttest, "t-test": ttest, "ttest": ttest, } type row struct { cols []string } func newRow(cols ...string) *row { return &row{cols: cols} } func (r *row) add(col string) { r.cols = append(r.cols, col) } func (r *row) trim() { for len(r.cols) > 0 && r.cols[len(r.cols)-1] == "" { r.cols = r.cols[:len(r.cols)-1] } } func main() { log.SetPrefix("benchstat: ") log.SetFlags(0) flag.Usage = usage flag.Parse() deltaTest := deltaTestNames[strings.ToLower(*flagDeltaTest)] if flag.NArg() < 1 || deltaTest == nil { flag.Usage() } // Read in benchmark data. c := readFiles(flag.Args()) for _, stat := range c.Stats { stat.ComputeStats() } var tables [][]*row switch len(c.Configs) { case 2: before, after := c.Configs[0], c.Configs[1] key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) for _, key.Benchmark = range c.Benchmarks { key.Config = before old := c.Stats[key] key.Config = after new := c.Stats[key] if old == nil || new == nil { continue } if len(table) == 0 { table = append(table, newRow("name", "old "+metric, "new "+metric, "delta")) } pval, testerr := deltaTest(old, new) scaler := newScaler(old.Mean, old.Unit) row := newRow(key.Benchmark, old.Format(scaler), new.Format(scaler), "~ ") if testerr == stats.ErrZeroVariance { row.add("(zero variance)") } else if testerr == stats.ErrSampleSize { row.add("(too few samples)") } else if testerr == stats.ErrSamplesEqual { row.add("(all equal)") } else if testerr != nil { row.add(fmt.Sprintf("(%s)", testerr)) } else if pval < *flagAlpha { row.cols[3] = fmt.Sprintf("%+.2f%%", ((new.Mean/old.Mean)-1.0)*100.0) } if len(row.cols) == 4 && pval != -1 { row.add(fmt.Sprintf("(p=%0.3f n=%d+%d)", pval, len(old.RValues), len(new.RValues))) } table = append(table, row) } if len(table) > 0 { table = addGeomean(table, c, key.Unit, true) tables = append(tables, table) } } default: key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) if len(c.Configs) > 1 { hdr := newRow("name \\ " + metric) for _, config := range c.Configs { hdr.add(config) } table = append(table, hdr) } else { table = append(table, newRow("name", metric)) } for _, key.Benchmark = range c.Benchmarks { row := newRow(key.Benchmark) var scaler func(float64) string for _, key.Config = range c.Configs { stat := c.Stats[key] if stat == nil { row.add("") continue } if scaler == nil { scaler = newScaler(stat.Mean, stat.Unit) } row.add(stat.Format(scaler)) } row.trim() if len(row.cols) > 1 { table = append(table, row) } } table = addGeomean(table, c, key.Unit, false) tables = append(tables, table) } } numColumn := 0 for _, table := range tables { for _, row := range table { if numColumn < len(row.cols) { numColumn = len(row.cols) } } } max := make([]int, numColumn) for _, table := range tables { for _, row := range table { for i, s := range row.cols { n := utf8.RuneCountInString(s) if max[i] < n { max[i] = n } } } } var buf bytes.Buffer for i, table := range tables { if i > 0 { fmt.Fprintf(&buf, "\n") } if *flagHTML { fmt.Fprintf(&buf, "<style>.benchstat tbody td:nth-child(1n+2) { text-align: right; padding: 0em 1em; }</style>\n") fmt.Fprintf(&buf, "<table class='benchstat'>\n") printRow := func(row *row, tag string) { fmt.Fprintf(&buf, "<tr>") for _, cell := range row.cols { fmt.Fprintf(&buf, "<%s>%s</%s>", tag, html.EscapeString(cell), tag) } fmt.Fprintf(&buf, "\n") } printRow(table[0], "th") for _, row := range table[1:] { printRow(row, "td") } fmt.Fprintf(&buf, "</table>\n") continue } // headings row := table[0] for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: fmt.Fprintf(&buf, " %-*s", max[i], s) case len(row.cols) - 1: fmt.Fprintf(&buf, " %s\n", s) } } // data for _, row := range table[1:] { for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: if i == len(row.cols)-1 && len(s) > 0 && s[0] == '(' { // Left-align p value. fmt.Fprintf(&buf, " %s", s) break } fmt.Fprintf(&buf, " %*s", max[i], s) } } fmt.Fprintf(&buf, "\n") } } os.Stdout.Write(buf.Bytes()) } func addGeomean(table []*row, c *Collection, unit string, delta bool) []*row { if !*flagGeomean { return table } row := newRow("[Geo mean]") key := BenchKey{Unit: unit} geomeans := []float64{} for _, key.Config = range c.Configs { var means []float64 for _, key.Benchmark = range c.Benchmarks { stat := c.Stats[key] if stat != nil { means = append(means, stat.Mean) } } if len(means) == 0 { row.add("") delta = false } else { geomean := stats.GeoMean(means) geomeans = append(geomeans, geomean) row.add(newScaler(geomean, unit)(geomean) + " ") } } if delta { row.add(fmt.Sprintf("%+.2f%%", ((geomeans[1]/geomeans[0])-1.0)*100.0)) } return append(table, row) } func timeScaler(ns float64) func(float64) string { var format string var scale float64 switch x := ns / 1e9; { case x >= 99.5: format, scale = "%.0fs", 1 case x >= 9.95: format, scale = "%.1fs", 1 case x >= 0.995: format, scale = "%.2fs", 1 case x >= 0.0995: format, scale = "%.0fms", 1000 case x >= 0.00995: format, scale = "%.1fms", 1000 case x >= 0.000995: format, scale = "%.2fms", 1000 case x >= 0.0000995: format, scale = "%.0fµs", 1000*1000 case x >= 0.00000995: format, scale = "%.1fµs", 1000*1000 case x >= 0.000000995: format, scale = "%.2fµs", 1000*1000 case x >= 0.0000000995: format, scale = "%.0fns", 1000*1000*1000 case x >= 0.00000000995: format, scale = "%.1fns", 1000*1000*1000 default: format, scale = "%.2fns", 1000*1000*1000 } return func(ns float64) string { return fmt.Sprintf(format, ns/1e9*scale) } } func newScaler(val float64, unit string) func(float64) string { if unit == "ns/op" { return timeScaler(val) } var format string var scale float64 var suffix string prescale := 1.0 if unit == "MB/s" { prescale = 1e6 } switch x := val * prescale; { case x >= 99500000000000: format, scale, suffix = "%.0f", 1e12, "T" case x >= 9950000000000: format, scale, suffix = "%.1f", 1e12, "T" case x >= 995000000000: format, scale, suffix = "%.2f", 1e12, "T" case x >= 99500000000: format, scale, suffix = "%.0f", 1e9, "G" case x >= 9950000000: format, scale, suffix = "%.1f", 1e9, "G" case x >= 995000000: format, scale, suffix = "%.2f", 1e9, "G" case x >= 99500000: format, scale, suffix = "%.0f", 1e6, "M" case x >= 9950000: format, scale, suffix = "%.1f", 1e6, "M" case x >= 995000: format, scale, suffix = "%.2f", 1e6, "M" case x >= 99500: format, scale, suffix = "%.0f", 1e3, "k" case x >= 9950: format, scale, suffix = "%.1f", 1e3, "k" case x >= 995: format, scale, suffix = "%.2f", 1e3, "k" case x >= 99.5: format, scale, suffix = "%.0f", 1, "" case x >= 9.95: format, scale, suffix = "%.1f", 1, "" default: format, scale, suffix = "%.2f", 1, "" } if unit == "B/op" { suffix += "B" } if unit == "MB/s" { suffix += "B/s" } scale /= prescale return func(val float64) string { return fmt.Sprintf(format+suffix, val/scale) } } func (b *Benchstat) Format(scaler func(float64) string) string { diff := 1 - b.Min/b.Mean if d := b.Max/b.Mean - 1; d > diff { diff = d } s := scaler(b.Mean) if b.Mean == 0 { s += " " } else { s = fmt.Sprintf("%s ±%3s", s, fmt.Sprintf("%.0f%%", diff*100.0)) } return s } // ComputeStats updates the derived statistics in s from the raw // samples in s.Values. func (stat *Benchstat) ComputeStats() { // Discard outliers. values := stats.Sample{Xs: stat.Values} q1, q3 := values.Percentile(0.25), values.Percentile(0.75) lo, hi := q1-1.5*(q3-q1), q3+1.5*(q3-q1) for _, value := range stat.Values { if lo <= value && value <= hi { stat.RValues = append(stat.RValues, value) } } // Compute statistics of remaining data. stat.Min, stat.Max = stats.Bounds(stat.RValues) stat.Mean = stats.Mean(stat.RValues) } // A Benchstat is the metrics along one axis (e.g., ns/op or MB/s) // for all runs of a specific benchmark. type Benchstat struct { Unit string Values []float64 // metrics RValues []float64 // metrics with outliers removed Min float64 // min of RValues Mean float64 // mean of RValues Max float64 // max of RValues } // A BenchKey identifies one metric (e.g., "ns/op", "B/op") from one // benchmark (function name sans "Benchmark" prefix) in one // configuration (input file name). type BenchKey struct { Config, Benchmark, Unit string } type Collection struct { Stats map[BenchKey]*Benchstat // Configs, Benchmarks, and Units give the set of configs, // benchmarks, and units from the keys in Stats in an order // meant to match the order the benchmarks were read in. Configs, Benchmarks, Units []string } func (c *Collection) AddStat(key BenchKey) *Benchstat { if stat, ok := c.Stats[key]; ok { return stat } addString := func(strings *[]string, add string) { for _, s := range *strings { if s == add { return } } *strings = append(*strings, add) } addString(&c.Configs, key.Config) addString(&c.Benchmarks, key.Benchmark) addString(&c.Units, key.Unit) stat := &Benchstat{Unit: key.Unit} c.Stats[key] = stat return stat } // readFiles reads a set of benchmark files. func readFiles(files []string) *Collection { c := Collection{Stats: make(map[BenchKey]*Benchstat)} for _, file := range files { readFile(file, &c) } return &c } // readFile reads a set of benchmarks from a file in to a Collection. func readFile(file string, c *Collection) { c.Configs = append(c.Configs, file) key := BenchKey{Config: file} text, err := ioutil.ReadFile(file) if err != nil { log.Fatal(err) } for _, line := range strings.Split(string(text), "\n") { f := strings.Fields(line) if len(f) < 4 { continue } name := f[0] if !strings.HasPrefix(name, "Benchmark") { continue } name = strings.TrimPrefix(name, "Benchmark") n, _ := strconv.Atoi(f[1]) if n == 0 { continue } key.Benchmark = name for i := 2; i+2 <= len(f); i += 2 { val, err := strconv.ParseFloat(f[i], 64) if err != nil { continue } key.Unit = f[i+1] stat := c.AddStat(key) stat.Values = append(stat.Values, val) } } } func metricOf(unit string) string { switch unit { case "ns/op": return "time/op" case "B/op": return "alloc/op" case "MB/s": return "speed" default: return unit } } // Significance tests. func notest(old, new *Benchstat) (pval float64, err error) { return -1, nil } func ttest(old, new *Benchstat) (pval float64, err error) { t,
c utest(old, new *Benchstat) (pval float64, err error) { u, err := stats.MannWhitneyUTest(old.RValues, new.RValues, stats.LocationDiffers) if err != nil { return -1, err } return u.P, nil }
err := stats.TwoSampleWelchTTest(stats.Sample{Xs: old.RValues}, stats.Sample{Xs: new.RValues}, stats.LocationDiffers) if err != nil { return -1, err } return t.P, nil } fun
identifier_body
main.go
// Copyright 2015 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. // Benchstat computes and compares statistics about benchmarks. // // This package has moved. Please use https://golang.org/x/perf/cmd/benchstat package main import ( "bytes" "flag" "fmt" "html" "io/ioutil" "log" "os" "strconv" "strings" "unicode/utf8" "rsc.io/benchstat/internal/go-moremath/stats" ) func usage() { fmt.Fprintf(os.Stderr, "usage: benchstat [options] old.txt [new.txt] [more.txt ...]\n") fmt.Fprintf(os.Stderr, "options:\n") flag.PrintDefaults() os.Exit(2) } var ( flagDeltaTest = flag.String("delta-test", "utest", "significance `test` to apply to delta: utest, ttest, or none") flagAlpha = flag.Float64("alpha", 0.05, "consider change significant if p < `α`") flagGeomean = flag.Bool("geomean", false, "print the geometric mean of each file") flagHTML = flag.Bool("html", false, "print results as an HTML table") ) var deltaTestNames = map[string]func(old, new *Benchstat) (float64, error){ "none": notest, "u": utest, "u-test": utest, "utest": utest, "t": ttest, "t-test": ttest, "ttest": ttest, } type row struct { cols []string } func newRow(cols ...string) *row { return &row{cols: cols} } func (r *row) add(col string) { r.cols = append(r.cols, col) } func (r *row) trim() { for len(r.cols) > 0 && r.cols[len(r.cols)-1] == "" { r.cols = r.cols[:len(r.cols)-1] } } func main() { log.SetPrefix("benchstat: ") log.SetFlags(0) flag.Usage = usage flag.Parse() deltaTest := deltaTestNames[strings.ToLower(*flagDeltaTest)] if flag.NArg() < 1 || deltaTest == nil { flag.Usage() } // Read in benchmark data. c := readFiles(flag.Args()) for _, stat := range c.Stats { stat.ComputeStats() } var tables [][]*row switch len(c.Configs) { case 2: before, after := c.Configs[0], c.Configs[1] key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) for _, key.Benchmark = range c.Benchmarks { key.Config = before old := c.Stats[key] key.Config = after new := c.Stats[key] if old == nil || new == nil { continue } if len(table) == 0 { table = append(table, newRow("name", "old "+metric, "new "+metric, "delta")) } pval, testerr := deltaTest(old, new) scaler := newScaler(old.Mean, old.Unit) row := newRow(key.Benchmark, old.Format(scaler), new.Format(scaler), "~ ") if testerr == stats.ErrZeroVariance { row.add("(zero variance)") } else if testerr == stats.ErrSampleSize { row.add("(too few samples)") } else if testerr == stats.ErrSamplesEqual { row.add("(all equal)") } else if testerr != nil { row.add(fmt.Sprintf("(%s)", testerr)) } else if pval < *flagAlpha { row.cols[3] = fmt.Sprintf("%+.2f%%", ((new.Mean/old.Mean)-1.0)*100.0) } if len(row.cols) == 4 && pval != -1 { row.add(fmt.Sprintf("(p=%0.3f n=%d+%d)", pval, len(old.RValues), len(new.RValues))) } table = append(table, row) } if len(table) > 0 { table = addGeomean(table, c, key.Unit, true) tables = append(tables, table) } } default: key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) if len(c.Configs) > 1 { hdr := newRow("name \\ " + metric) for _, config := range c.Configs { hdr.add(config) } table = append(table, hdr) } else { table = append(table, newRow("name", metric)) } for _, key.Benchmark = range c.Benchmarks { row := newRow(key.Benchmark) var scaler func(float64) string for _, key.Config = range c.Configs { stat := c.Stats[key] if stat == nil { row.add("") continue } if scaler == nil { scaler = newScaler(stat.Mean, stat.Unit) } row.add(stat.Format(scaler)) } row.trim() if len(row.cols) > 1 { table = append(table, row) } } table = addGeomean(table, c, key.Unit, false) tables = append(tables, table) } } numColumn := 0 for _, table := range tables { for _, row := range table { if numColumn < len(row.cols) { numColumn = len(row.cols) } } } max := make([]int, numColumn) for _, table := range tables { for _, row := range table { for i, s := range row.cols { n := utf8.RuneCountInString(s) if max[i] < n { max[i] = n } } } } var buf bytes.Buffer for i, table := range tables { if i > 0 { fmt.Fprintf(&buf, "\n") } if *flagHTML { fmt.Fprintf(&buf, "<style>.benchstat tbody td:nth-child(1n+2) { text-align: right; padding: 0em 1em; }</style>\n") fmt.Fprintf(&buf, "<table class='benchstat'>\n") printRow := func(row *row, tag string) { fmt.Fprintf(&buf, "<tr>") for _, cell := range row.cols { fmt.Fprintf(&buf, "<%s>%s</%s>", tag, html.EscapeString(cell), tag) } fmt.Fprintf(&buf, "\n") } printRow(table[0], "th") for _, row := range table[1:] { printRow(row, "td") } fmt.Fprintf(&buf, "</table>\n") continue } // headings row := table[0] for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: fmt.Fprintf(&buf, " %-*s", max[i], s) case len(row.cols) - 1: fmt.Fprintf(&buf, " %s\n", s) } } // data for _, row := range table[1:] { for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: if i == len(row.cols)-1 && len(s) > 0 && s[0] == '(' { // Left-align p value. fmt.Fprintf(&buf, " %s", s) break } fmt.Fprintf(&buf, " %*s", max[i], s) } } fmt.Fprintf(&buf, "\n") } } os.Stdout.Write(buf.Bytes()) } func addGeomean(table []*row, c *Collection, unit string, delta bool) []*row { if !*flagGeomean { return table } row := newRow("[Geo mean]") key := BenchKey{Unit: unit} geomeans := []float64{} for _, key.Config = range c.Configs { var means []float64 for _, key.Benchmark = range c.Benchmarks { stat := c.Stats[key] if stat != nil { means = append(means, stat.Mean) } } if len(means) == 0 { row.add("") delta = false } else { geomean := stats.GeoMean(means) geomeans = append(geomeans, geomean) row.add(newScaler(geomean, unit)(geomean) + " ") } } if delta { row.add(fmt.Sprintf("%+.2f%%", ((geomeans[1]/geomeans[0])-1.0)*100.0)) } return append(table, row) } func timeScaler(ns float64) func(float64) string { var format string var scale float64 switch x := ns / 1e9; { case x >= 99.5: format, scale = "%.0fs", 1 case x >= 9.95: format, scale = "%.1fs", 1 case x >= 0.995: format, scale = "%.2fs", 1 case x >= 0.0995: format, scale = "%.0fms", 1000 case x >= 0.00995: format, scale = "%.1fms", 1000 case x >= 0.000995: format, scale = "%.2fms", 1000 case x >= 0.0000995: format, scale = "%.0fµs", 1000*1000 case x >= 0.00000995: format, scale = "%.1fµs", 1000*1000 case x >= 0.000000995: format, scale = "%.2fµs", 1000*1000 case x >= 0.0000000995: format, scale = "%.0fns", 1000*1000*1000 case x >= 0.00000000995: format, scale = "%.1fns", 1000*1000*1000 default: format, scale = "%.2fns", 1000*1000*1000 } return func(ns float64) string { return fmt.Sprintf(format, ns/1e9*scale) } } func newScaler(val float64, unit string) func(float64) string { if unit == "ns/op" { return timeScaler(val) } var format string var scale float64 var suffix string prescale := 1.0 if unit == "MB/s" { prescale = 1e6 } switch x := val * prescale; { case x >= 99500000000000: format, scale, suffix = "%.0f", 1e12, "T" case x >= 9950000000000: format, scale, suffix = "%.1f", 1e12, "T" case x >= 995000000000: format, scale, suffix = "%.2f", 1e12, "T" case x >= 99500000000: format, scale, suffix = "%.0f", 1e9, "G" case x >= 9950000000: format, scale, suffix = "%.1f", 1e9, "G" case x >= 995000000: format, scale, suffix = "%.2f", 1e9, "G" case x >= 99500000: format, scale, suffix = "%.0f", 1e6, "M" case x >= 9950000: format, scale, suffix = "%.1f", 1e6, "M" case x >= 995000: format, scale, suffix = "%.2f", 1e6, "M" case x >= 99500: format, scale, suffix = "%.0f", 1e3, "k" case x >= 9950: format, scale, suffix = "%.1f", 1e3, "k" case x >= 995: format, scale, suffix = "%.2f", 1e3, "k" case x >= 99.5: format, scale, suffix = "%.0f", 1, "" case x >= 9.95: format, scale, suffix = "%.1f", 1, "" default: format, scale, suffix = "%.2f", 1, "" } if unit == "B/op" { suffix += "B" } if unit == "MB/s" { suffix += "B/s" } scale /= prescale return func(val float64) string { return fmt.Sprintf(format+suffix, val/scale)
} func (b *Benchstat) Format(scaler func(float64) string) string { diff := 1 - b.Min/b.Mean if d := b.Max/b.Mean - 1; d > diff { diff = d } s := scaler(b.Mean) if b.Mean == 0 { s += " " } else { s = fmt.Sprintf("%s ±%3s", s, fmt.Sprintf("%.0f%%", diff*100.0)) } return s } // ComputeStats updates the derived statistics in s from the raw // samples in s.Values. func (stat *Benchstat) ComputeStats() { // Discard outliers. values := stats.Sample{Xs: stat.Values} q1, q3 := values.Percentile(0.25), values.Percentile(0.75) lo, hi := q1-1.5*(q3-q1), q3+1.5*(q3-q1) for _, value := range stat.Values { if lo <= value && value <= hi { stat.RValues = append(stat.RValues, value) } } // Compute statistics of remaining data. stat.Min, stat.Max = stats.Bounds(stat.RValues) stat.Mean = stats.Mean(stat.RValues) } // A Benchstat is the metrics along one axis (e.g., ns/op or MB/s) // for all runs of a specific benchmark. type Benchstat struct { Unit string Values []float64 // metrics RValues []float64 // metrics with outliers removed Min float64 // min of RValues Mean float64 // mean of RValues Max float64 // max of RValues } // A BenchKey identifies one metric (e.g., "ns/op", "B/op") from one // benchmark (function name sans "Benchmark" prefix) in one // configuration (input file name). type BenchKey struct { Config, Benchmark, Unit string } type Collection struct { Stats map[BenchKey]*Benchstat // Configs, Benchmarks, and Units give the set of configs, // benchmarks, and units from the keys in Stats in an order // meant to match the order the benchmarks were read in. Configs, Benchmarks, Units []string } func (c *Collection) AddStat(key BenchKey) *Benchstat { if stat, ok := c.Stats[key]; ok { return stat } addString := func(strings *[]string, add string) { for _, s := range *strings { if s == add { return } } *strings = append(*strings, add) } addString(&c.Configs, key.Config) addString(&c.Benchmarks, key.Benchmark) addString(&c.Units, key.Unit) stat := &Benchstat{Unit: key.Unit} c.Stats[key] = stat return stat } // readFiles reads a set of benchmark files. func readFiles(files []string) *Collection { c := Collection{Stats: make(map[BenchKey]*Benchstat)} for _, file := range files { readFile(file, &c) } return &c } // readFile reads a set of benchmarks from a file in to a Collection. func readFile(file string, c *Collection) { c.Configs = append(c.Configs, file) key := BenchKey{Config: file} text, err := ioutil.ReadFile(file) if err != nil { log.Fatal(err) } for _, line := range strings.Split(string(text), "\n") { f := strings.Fields(line) if len(f) < 4 { continue } name := f[0] if !strings.HasPrefix(name, "Benchmark") { continue } name = strings.TrimPrefix(name, "Benchmark") n, _ := strconv.Atoi(f[1]) if n == 0 { continue } key.Benchmark = name for i := 2; i+2 <= len(f); i += 2 { val, err := strconv.ParseFloat(f[i], 64) if err != nil { continue } key.Unit = f[i+1] stat := c.AddStat(key) stat.Values = append(stat.Values, val) } } } func metricOf(unit string) string { switch unit { case "ns/op": return "time/op" case "B/op": return "alloc/op" case "MB/s": return "speed" default: return unit } } // Significance tests. func notest(old, new *Benchstat) (pval float64, err error) { return -1, nil } func ttest(old, new *Benchstat) (pval float64, err error) { t, err := stats.TwoSampleWelchTTest(stats.Sample{Xs: old.RValues}, stats.Sample{Xs: new.RValues}, stats.LocationDiffers) if err != nil { return -1, err } return t.P, nil } func utest(old, new *Benchstat) (pval float64, err error) { u, err := stats.MannWhitneyUTest(old.RValues, new.RValues, stats.LocationDiffers) if err != nil { return -1, err } return u.P, nil }
}
random_line_split
main.go
// Copyright 2015 The Go Authors. All rights reserved. // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. // Benchstat computes and compares statistics about benchmarks. // // This package has moved. Please use https://golang.org/x/perf/cmd/benchstat package main import ( "bytes" "flag" "fmt" "html" "io/ioutil" "log" "os" "strconv" "strings" "unicode/utf8" "rsc.io/benchstat/internal/go-moremath/stats" ) func usage() { fmt.Fprintf(os.Stderr, "usage: benchstat [options] old.txt [new.txt] [more.txt ...]\n") fmt.Fprintf(os.Stderr, "options:\n") flag.PrintDefaults() os.Exit(2) } var ( flagDeltaTest = flag.String("delta-test", "utest", "significance `test` to apply to delta: utest, ttest, or none") flagAlpha = flag.Float64("alpha", 0.05, "consider change significant if p < `α`") flagGeomean = flag.Bool("geomean", false, "print the geometric mean of each file") flagHTML = flag.Bool("html", false, "print results as an HTML table") ) var deltaTestNames = map[string]func(old, new *Benchstat) (float64, error){ "none": notest, "u": utest, "u-test": utest, "utest": utest, "t": ttest, "t-test": ttest, "ttest": ttest, } type row struct { cols []string } func newRow(cols ...string) *row { return &row{cols: cols} } func (r *row) add(col string) { r.cols = append(r.cols, col) } func (r *row) trim() { for len(r.cols) > 0 && r.cols[len(r.cols)-1] == "" {
} func main() { log.SetPrefix("benchstat: ") log.SetFlags(0) flag.Usage = usage flag.Parse() deltaTest := deltaTestNames[strings.ToLower(*flagDeltaTest)] if flag.NArg() < 1 || deltaTest == nil { flag.Usage() } // Read in benchmark data. c := readFiles(flag.Args()) for _, stat := range c.Stats { stat.ComputeStats() } var tables [][]*row switch len(c.Configs) { case 2: before, after := c.Configs[0], c.Configs[1] key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) for _, key.Benchmark = range c.Benchmarks { key.Config = before old := c.Stats[key] key.Config = after new := c.Stats[key] if old == nil || new == nil { continue } if len(table) == 0 { table = append(table, newRow("name", "old "+metric, "new "+metric, "delta")) } pval, testerr := deltaTest(old, new) scaler := newScaler(old.Mean, old.Unit) row := newRow(key.Benchmark, old.Format(scaler), new.Format(scaler), "~ ") if testerr == stats.ErrZeroVariance { row.add("(zero variance)") } else if testerr == stats.ErrSampleSize { row.add("(too few samples)") } else if testerr == stats.ErrSamplesEqual { row.add("(all equal)") } else if testerr != nil { row.add(fmt.Sprintf("(%s)", testerr)) } else if pval < *flagAlpha { row.cols[3] = fmt.Sprintf("%+.2f%%", ((new.Mean/old.Mean)-1.0)*100.0) } if len(row.cols) == 4 && pval != -1 { row.add(fmt.Sprintf("(p=%0.3f n=%d+%d)", pval, len(old.RValues), len(new.RValues))) } table = append(table, row) } if len(table) > 0 { table = addGeomean(table, c, key.Unit, true) tables = append(tables, table) } } default: key := BenchKey{} for _, key.Unit = range c.Units { var table []*row metric := metricOf(key.Unit) if len(c.Configs) > 1 { hdr := newRow("name \\ " + metric) for _, config := range c.Configs { hdr.add(config) } table = append(table, hdr) } else { table = append(table, newRow("name", metric)) } for _, key.Benchmark = range c.Benchmarks { row := newRow(key.Benchmark) var scaler func(float64) string for _, key.Config = range c.Configs { stat := c.Stats[key] if stat == nil { row.add("") continue } if scaler == nil { scaler = newScaler(stat.Mean, stat.Unit) } row.add(stat.Format(scaler)) } row.trim() if len(row.cols) > 1 { table = append(table, row) } } table = addGeomean(table, c, key.Unit, false) tables = append(tables, table) } } numColumn := 0 for _, table := range tables { for _, row := range table { if numColumn < len(row.cols) { numColumn = len(row.cols) } } } max := make([]int, numColumn) for _, table := range tables { for _, row := range table { for i, s := range row.cols { n := utf8.RuneCountInString(s) if max[i] < n { max[i] = n } } } } var buf bytes.Buffer for i, table := range tables { if i > 0 { fmt.Fprintf(&buf, "\n") } if *flagHTML { fmt.Fprintf(&buf, "<style>.benchstat tbody td:nth-child(1n+2) { text-align: right; padding: 0em 1em; }</style>\n") fmt.Fprintf(&buf, "<table class='benchstat'>\n") printRow := func(row *row, tag string) { fmt.Fprintf(&buf, "<tr>") for _, cell := range row.cols { fmt.Fprintf(&buf, "<%s>%s</%s>", tag, html.EscapeString(cell), tag) } fmt.Fprintf(&buf, "\n") } printRow(table[0], "th") for _, row := range table[1:] { printRow(row, "td") } fmt.Fprintf(&buf, "</table>\n") continue } // headings row := table[0] for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: fmt.Fprintf(&buf, " %-*s", max[i], s) case len(row.cols) - 1: fmt.Fprintf(&buf, " %s\n", s) } } // data for _, row := range table[1:] { for i, s := range row.cols { switch i { case 0: fmt.Fprintf(&buf, "%-*s", max[i], s) default: if i == len(row.cols)-1 && len(s) > 0 && s[0] == '(' { // Left-align p value. fmt.Fprintf(&buf, " %s", s) break } fmt.Fprintf(&buf, " %*s", max[i], s) } } fmt.Fprintf(&buf, "\n") } } os.Stdout.Write(buf.Bytes()) } func addGeomean(table []*row, c *Collection, unit string, delta bool) []*row { if !*flagGeomean { return table } row := newRow("[Geo mean]") key := BenchKey{Unit: unit} geomeans := []float64{} for _, key.Config = range c.Configs { var means []float64 for _, key.Benchmark = range c.Benchmarks { stat := c.Stats[key] if stat != nil { means = append(means, stat.Mean) } } if len(means) == 0 { row.add("") delta = false } else { geomean := stats.GeoMean(means) geomeans = append(geomeans, geomean) row.add(newScaler(geomean, unit)(geomean) + " ") } } if delta { row.add(fmt.Sprintf("%+.2f%%", ((geomeans[1]/geomeans[0])-1.0)*100.0)) } return append(table, row) } func timeScaler(ns float64) func(float64) string { var format string var scale float64 switch x := ns / 1e9; { case x >= 99.5: format, scale = "%.0fs", 1 case x >= 9.95: format, scale = "%.1fs", 1 case x >= 0.995: format, scale = "%.2fs", 1 case x >= 0.0995: format, scale = "%.0fms", 1000 case x >= 0.00995: format, scale = "%.1fms", 1000 case x >= 0.000995: format, scale = "%.2fms", 1000 case x >= 0.0000995: format, scale = "%.0fµs", 1000*1000 case x >= 0.00000995: format, scale = "%.1fµs", 1000*1000 case x >= 0.000000995: format, scale = "%.2fµs", 1000*1000 case x >= 0.0000000995: format, scale = "%.0fns", 1000*1000*1000 case x >= 0.00000000995: format, scale = "%.1fns", 1000*1000*1000 default: format, scale = "%.2fns", 1000*1000*1000 } return func(ns float64) string { return fmt.Sprintf(format, ns/1e9*scale) } } func newScaler(val float64, unit string) func(float64) string { if unit == "ns/op" { return timeScaler(val) } var format string var scale float64 var suffix string prescale := 1.0 if unit == "MB/s" { prescale = 1e6 } switch x := val * prescale; { case x >= 99500000000000: format, scale, suffix = "%.0f", 1e12, "T" case x >= 9950000000000: format, scale, suffix = "%.1f", 1e12, "T" case x >= 995000000000: format, scale, suffix = "%.2f", 1e12, "T" case x >= 99500000000: format, scale, suffix = "%.0f", 1e9, "G" case x >= 9950000000: format, scale, suffix = "%.1f", 1e9, "G" case x >= 995000000: format, scale, suffix = "%.2f", 1e9, "G" case x >= 99500000: format, scale, suffix = "%.0f", 1e6, "M" case x >= 9950000: format, scale, suffix = "%.1f", 1e6, "M" case x >= 995000: format, scale, suffix = "%.2f", 1e6, "M" case x >= 99500: format, scale, suffix = "%.0f", 1e3, "k" case x >= 9950: format, scale, suffix = "%.1f", 1e3, "k" case x >= 995: format, scale, suffix = "%.2f", 1e3, "k" case x >= 99.5: format, scale, suffix = "%.0f", 1, "" case x >= 9.95: format, scale, suffix = "%.1f", 1, "" default: format, scale, suffix = "%.2f", 1, "" } if unit == "B/op" { suffix += "B" } if unit == "MB/s" { suffix += "B/s" } scale /= prescale return func(val float64) string { return fmt.Sprintf(format+suffix, val/scale) } } func (b *Benchstat) Format(scaler func(float64) string) string { diff := 1 - b.Min/b.Mean if d := b.Max/b.Mean - 1; d > diff { diff = d } s := scaler(b.Mean) if b.Mean == 0 { s += " " } else { s = fmt.Sprintf("%s ±%3s", s, fmt.Sprintf("%.0f%%", diff*100.0)) } return s } // ComputeStats updates the derived statistics in s from the raw // samples in s.Values. func (stat *Benchstat) ComputeStats() { // Discard outliers. values := stats.Sample{Xs: stat.Values} q1, q3 := values.Percentile(0.25), values.Percentile(0.75) lo, hi := q1-1.5*(q3-q1), q3+1.5*(q3-q1) for _, value := range stat.Values { if lo <= value && value <= hi { stat.RValues = append(stat.RValues, value) } } // Compute statistics of remaining data. stat.Min, stat.Max = stats.Bounds(stat.RValues) stat.Mean = stats.Mean(stat.RValues) } // A Benchstat is the metrics along one axis (e.g., ns/op or MB/s) // for all runs of a specific benchmark. type Benchstat struct { Unit string Values []float64 // metrics RValues []float64 // metrics with outliers removed Min float64 // min of RValues Mean float64 // mean of RValues Max float64 // max of RValues } // A BenchKey identifies one metric (e.g., "ns/op", "B/op") from one // benchmark (function name sans "Benchmark" prefix) in one // configuration (input file name). type BenchKey struct { Config, Benchmark, Unit string } type Collection struct { Stats map[BenchKey]*Benchstat // Configs, Benchmarks, and Units give the set of configs, // benchmarks, and units from the keys in Stats in an order // meant to match the order the benchmarks were read in. Configs, Benchmarks, Units []string } func (c *Collection) AddStat(key BenchKey) *Benchstat { if stat, ok := c.Stats[key]; ok { return stat } addString := func(strings *[]string, add string) { for _, s := range *strings { if s == add { return } } *strings = append(*strings, add) } addString(&c.Configs, key.Config) addString(&c.Benchmarks, key.Benchmark) addString(&c.Units, key.Unit) stat := &Benchstat{Unit: key.Unit} c.Stats[key] = stat return stat } // readFiles reads a set of benchmark files. func readFiles(files []string) *Collection { c := Collection{Stats: make(map[BenchKey]*Benchstat)} for _, file := range files { readFile(file, &c) } return &c } // readFile reads a set of benchmarks from a file in to a Collection. func readFile(file string, c *Collection) { c.Configs = append(c.Configs, file) key := BenchKey{Config: file} text, err := ioutil.ReadFile(file) if err != nil { log.Fatal(err) } for _, line := range strings.Split(string(text), "\n") { f := strings.Fields(line) if len(f) < 4 { continue } name := f[0] if !strings.HasPrefix(name, "Benchmark") { continue } name = strings.TrimPrefix(name, "Benchmark") n, _ := strconv.Atoi(f[1]) if n == 0 { continue } key.Benchmark = name for i := 2; i+2 <= len(f); i += 2 { val, err := strconv.ParseFloat(f[i], 64) if err != nil { continue } key.Unit = f[i+1] stat := c.AddStat(key) stat.Values = append(stat.Values, val) } } } func metricOf(unit string) string { switch unit { case "ns/op": return "time/op" case "B/op": return "alloc/op" case "MB/s": return "speed" default: return unit } } // Significance tests. func notest(old, new *Benchstat) (pval float64, err error) { return -1, nil } func ttest(old, new *Benchstat) (pval float64, err error) { t, err := stats.TwoSampleWelchTTest(stats.Sample{Xs: old.RValues}, stats.Sample{Xs: new.RValues}, stats.LocationDiffers) if err != nil { return -1, err } return t.P, nil } func utest(old, new *Benchstat) (pval float64, err error) { u, err := stats.MannWhitneyUTest(old.RValues, new.RValues, stats.LocationDiffers) if err != nil { return -1, err } return u.P, nil }
r.cols = r.cols[:len(r.cols)-1] }
conditional_block
extractor.rs
use crate::{ client, config::{Configuration, CONFIGURATION}, scanner::SCANNED_URLS, statistics::{ StatCommand::{self, UpdateUsizeField}, StatField::{LinksExtracted, TotalExpected}, }, utils::{format_url, make_request}, FeroxResponse, }; use lazy_static::lazy_static; use regex::Regex; use reqwest::Url; use std::collections::HashSet; use tokio::sync::mpsc::UnboundedSender; /// Regular expression used in [LinkFinder](https://github.com/GerbenJavado/LinkFinder) /// /// Incorporates change from this [Pull Request](https://github.com/GerbenJavado/LinkFinder/pull/66/files) const LINKFINDER_REGEX: &str = r#"(?:"|')(((?:[a-zA-Z]{1,10}://|//)[^"'/]{1,}\.[a-zA-Z]{2,}[^"']{0,})|((?:/|\.\./|\./)[^"'><,;| *()(%%$^/\\\[\]][^"'><,;|()]{1,})|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{1,}\.(?:[a-zA-Z]{1,4}|action)(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{3,}(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-.]{1,}\.(?:php|asp|aspx|jsp|json|action|html|js|txt|xml)(?:[\?|#][^"|']{0,}|)))(?:"|')"#; /// Regular expression to pull url paths from robots.txt /// /// ref: https://developers.google.com/search/reference/robots_txt const ROBOTS_TXT_REGEX: &str = r#"(?m)^ *(Allow|Disallow): *(?P<url_path>[a-zA-Z0-9._/?#@!&'()+,;%=-]+?)$"#; // multi-line (?m) lazy_static! { /// `LINKFINDER_REGEX` as a regex::Regex type static ref LINKS_REGEX: Regex = Regex::new(LINKFINDER_REGEX).unwrap(); /// `ROBOTS_TXT_REGEX` as a regex::Regex type static ref ROBOTS_REGEX: Regex = Regex::new(ROBOTS_TXT_REGEX).unwrap(); } /// Iterate over a given path, return a list of every sub-path found /// /// example: `path` contains a link fragment `homepage/assets/img/icons/handshake.svg` /// the following fragments would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn get_sub_paths_from_path(path: &str) -> Vec<String> { log::trace!("enter: get_sub_paths_from_path({})", path); let mut paths = vec![]; // filter out any empty strings caused by .split let mut parts: Vec<&str> = path.split('/').filter(|s| !s.is_empty()).collect(); let length = parts.len(); for i in 0..length { // iterate over all parts of the path if parts.is_empty() { // pop left us with an empty vector, we're done break; } let mut possible_path = parts.join("/"); if possible_path.is_empty() { // .join can result in an empty string, which we don't need, ignore continue; } if i > 0 { // this isn't the last index of the parts array // ex: /buried/misc/stupidfile.php // this block skips the file but sees all parent folders possible_path = format!("{}/", possible_path); } paths.push(possible_path); // good sub-path found parts.pop(); // use .pop() to remove the last part of the path and continue iteration } log::trace!("exit: get_sub_paths_from_path -> {:?}", paths); paths } /// simple helper to stay DRY, trys to join a url + fragment and add it to the `links` HashSet fn add_link_to_set_of_links(link: &str, url: &Url, links: &mut HashSet<String>) { log::trace!( "enter: add_link_to_set_of_links({}, {}, {:?})", link, url.to_string(), links ); match url.join(&link) { Ok(new_url) => { links.insert(new_url.to_string()); } Err(e) => { log::error!("Could not join given url to the base url: {}", e); } } log::trace!("exit: add_link_to_set_of_links"); } /// Given a `reqwest::Response`, perform the following actions /// - parse the response's text for links using the linkfinder regex /// - for every link found take its url path and parse each sub-path /// - example: Response contains a link fragment `homepage/assets/img/icons/handshake.svg` /// with a base url of http://localhost, the following urls would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ pub async fn get_links( response: &FeroxResponse, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: get_links({}, {:?})", response.url().as_str(), tx_stats ); let mut links = HashSet::<String>::new(); let body = response.text(); for capture in LINKS_REGEX.captures_iter(&body) { // remove single & double quotes from both ends of the capture // capture[0] is the entire match, additional capture groups start at [1] let link = capture[0].trim_matches(|c| c == '\'' || c == '"'); match Url::parse(link) { Ok(absolute) => { if absolute.domain() != response.url().domain() || absolute.host() != response.url().host() { // domains/ips are not the same, don't scan things that aren't part of the original // target url continue; } add_all_sub_paths(absolute.path(), &response, &mut links); } Err(e) => { // this is the expected error that happens when we try to parse a url fragment // ex: Url::parse("/login") -> Err("relative URL without a base") // while this is technically an error, these are good results for us if e.to_string().contains("relative URL without a base") { add_all_sub_paths(link, &response, &mut links); } else { // unexpected error has occurred log::error!("Could not parse given url: {}", e); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: get_links -> {:?}", links); links } /// take a url fragment like homepage/assets/img/icons/handshake.svg and /// incrementally add /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn add_all_sub_paths(url_path: &str, response: &FeroxResponse, mut links: &mut HashSet<String>) { log::trace!( "enter: add_all_sub_paths({}, {}, {:?})", url_path, response, links ); for sub_path in get_sub_paths_from_path(url_path) { log::debug!("Adding {} to {:?}", sub_path, links); add_link_to_set_of_links(&sub_path, &response.url(), &mut links); } log::trace!("exit: add_all_sub_paths"); } /// Wrapper around link extraction logic /// currently used in two places: /// - links from response bodys /// - links from robots.txt responses /// /// general steps taken: /// - create a new Url object based on cli options/args /// - check if the new Url has already been seen/scanned -> None /// - make a request to the new Url ? -> Some(response) : None pub async fn request_feroxresponse_from_new_link( url: &str, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: request_feroxresponse_from_new_link({}, {:?})", url, tx_stats ); // create a url based on the given command line options, return None on error let new_url = match format_url( &url, &"", CONFIGURATION.add_slash, &CONFIGURATION.queries, None, tx_stats.clone(), ) { Ok(url) => url, Err(_) =>
}; if SCANNED_URLS.get_scan_by_url(&new_url.to_string()).is_some() { //we've seen the url before and don't need to scan again log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } // make the request and store the response let new_response = match make_request(&CONFIGURATION.client, &new_url, tx_stats).await { Ok(resp) => resp, Err(_) => { log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } }; let new_ferox_response = FeroxResponse::from(new_response, true).await; log::trace!( "exit: request_feroxresponse_from_new_link -> {:?}", new_ferox_response ); Some(new_ferox_response) } /// helper function that simply requests /robots.txt on the given url's base url /// /// example: /// http://localhost/api/users -> http://localhost/robots.txt /// /// The length of the given path has no effect on what's requested; it's always /// base url + /robots.txt pub async fn request_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: get_robots_file({}, CONFIGURATION, {:?})", base_url, tx_stats ); // more often than not, domain/robots.txt will redirect to www.domain/robots.txt or something // similar; to account for that, create a client that will follow redirects, regardless of // what the user specified for the scanning client. Other than redirects, it will respect // all other user specified settings let follow_redirects = true; let proxy = if config.proxy.is_empty() { None } else { Some(config.proxy.as_str()) }; let client = client::initialize( config.timeout, &config.user_agent, follow_redirects, config.insecure, &config.headers, proxy, ); if let Ok(mut url) = Url::parse(base_url) { url.set_path("/robots.txt"); // overwrite existing path with /robots.txt if let Ok(response) = make_request(&client, &url, tx_stats).await { let ferox_response = FeroxResponse::from(response, true).await; log::trace!("exit: get_robots_file -> {}", ferox_response); return Some(ferox_response); } } None } /// Entry point to perform link extraction from robots.txt /// /// `base_url` can have paths and subpaths, however robots.txt will be requested from the /// root of the url /// given the url: /// http://localhost/stuff/things /// this function requests: /// http://localhost/robots.txt pub async fn extract_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: extract_robots_txt({}, CONFIGURATION, {:?})", base_url, tx_stats ); let mut links = HashSet::new(); if let Some(response) = request_robots_txt(&base_url, &config, tx_stats.clone()).await { for capture in ROBOTS_REGEX.captures_iter(response.text.as_str()) { if let Some(new_path) = capture.name("url_path") { if let Ok(mut new_url) = Url::parse(base_url) { new_url.set_path(new_path.as_str()); add_all_sub_paths(new_url.path(), &response, &mut links); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: extract_robots_txt -> {:?}", links); links } #[cfg(test)] mod tests { use super::*; use crate::utils::make_request; use crate::FeroxChannel; use httpmock::Method::GET; use httpmock::MockServer; use reqwest::Client; use tokio::sync::mpsc; #[test] /// extract sub paths from the given url fragment; expect 4 sub paths and that all are /// in the expected array fn extractor_get_sub_paths_from_path_with_multiple_paths() { let path = "homepage/assets/img/icons/handshake.svg"; let paths = get_sub_paths_from_path(&path); let expected = vec![ "homepage/", "homepage/assets/", "homepage/assets/img/", "homepage/assets/img/icons/", "homepage/assets/img/icons/handshake.svg", ]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 2 sub paths and that all are /// in the expected array. the fragment is wrapped in slashes to ensure no empty strings are /// returned fn extractor_get_sub_paths_from_path_with_enclosing_slashes() { let path = "/homepage/assets/"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage/", "homepage/assets"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, no forward slashes are /// included fn extractor_get_sub_paths_from_path_with_only_a_word() { let path = "homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, forward slash removed fn extractor_get_sub_paths_from_path_with_an_absolute_word() { let path = "/homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// test that a full url and fragment are joined correctly, then added to the given list /// i.e. the happy path fn extractor_add_link_to_set_of_links_happy_path() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "admin"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 1); assert!(links.contains("https://localhost/admin")); } #[test] /// test that an invalid path fragment doesn't add anything to the set of links fn extractor_add_link_to_set_of_links_with_non_base_url() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "\\\\\\\\"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 0); assert!(links.is_empty()); } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// use make_request to generate a Response, and use the Response to test get_links; /// the response will contain an absolute path to a domain that is not part of the scanned /// domain; expect an empty set returned async fn extractor_get_links_with_absolute_url_that_differs_from_target_domain( ) -> Result<(), Box<dyn std::error::Error>> { let srv = MockServer::start(); let mock = srv.mock(|when, then|{ when.method(GET) .path("/some-path"); then.status(200) .body("\"http://defintely.not.a.thing.probably.com/homepage/assets/img/icons/handshake.svg\""); }); let client = Client::new(); let url = Url::parse(&srv.url("/some-path")).unwrap(); let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); let response = make_request(&client, &url, tx.clone()).await.unwrap(); let ferox_response = FeroxResponse::from(response, true).await; let links = get_links(&ferox_response, tx).await; assert!(links.is_empty()); assert_eq!(mock.hits(), 1); Ok(()) } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// test that /robots.txt is correctly requested given a base url (happy path) async fn request_robots_txt_with_and_without_proxy() { let srv = MockServer::start(); let mock = srv.mock(|when, then| { when.method(GET).path("/robots.txt"); then.status(200).body("this is a test"); }); let mut config = Configuration::default(); let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); request_robots_txt(&srv.url("/api/users/stuff/things"), &config, tx.clone()).await; // note: the proxy doesn't actually do anything other than hit a different code branch // in this unit test; it would however have an effect on an integration test config.proxy = srv.url("/ima-proxy"); request_robots_txt(&srv.url("/api/different/path"), &config, tx).await; assert_eq!(mock.hits(), 2); } }
{ log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; }
conditional_block
extractor.rs
use crate::{ client, config::{Configuration, CONFIGURATION}, scanner::SCANNED_URLS, statistics::{ StatCommand::{self, UpdateUsizeField}, StatField::{LinksExtracted, TotalExpected}, }, utils::{format_url, make_request}, FeroxResponse, }; use lazy_static::lazy_static; use regex::Regex; use reqwest::Url; use std::collections::HashSet; use tokio::sync::mpsc::UnboundedSender; /// Regular expression used in [LinkFinder](https://github.com/GerbenJavado/LinkFinder) /// /// Incorporates change from this [Pull Request](https://github.com/GerbenJavado/LinkFinder/pull/66/files) const LINKFINDER_REGEX: &str = r#"(?:"|')(((?:[a-zA-Z]{1,10}://|//)[^"'/]{1,}\.[a-zA-Z]{2,}[^"']{0,})|((?:/|\.\./|\./)[^"'><,;| *()(%%$^/\\\[\]][^"'><,;|()]{1,})|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{1,}\.(?:[a-zA-Z]{1,4}|action)(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{3,}(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-.]{1,}\.(?:php|asp|aspx|jsp|json|action|html|js|txt|xml)(?:[\?|#][^"|']{0,}|)))(?:"|')"#; /// Regular expression to pull url paths from robots.txt /// /// ref: https://developers.google.com/search/reference/robots_txt const ROBOTS_TXT_REGEX: &str = r#"(?m)^ *(Allow|Disallow): *(?P<url_path>[a-zA-Z0-9._/?#@!&'()+,;%=-]+?)$"#; // multi-line (?m) lazy_static! { /// `LINKFINDER_REGEX` as a regex::Regex type static ref LINKS_REGEX: Regex = Regex::new(LINKFINDER_REGEX).unwrap(); /// `ROBOTS_TXT_REGEX` as a regex::Regex type static ref ROBOTS_REGEX: Regex = Regex::new(ROBOTS_TXT_REGEX).unwrap(); } /// Iterate over a given path, return a list of every sub-path found /// /// example: `path` contains a link fragment `homepage/assets/img/icons/handshake.svg` /// the following fragments would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn get_sub_paths_from_path(path: &str) -> Vec<String> { log::trace!("enter: get_sub_paths_from_path({})", path); let mut paths = vec![]; // filter out any empty strings caused by .split let mut parts: Vec<&str> = path.split('/').filter(|s| !s.is_empty()).collect(); let length = parts.len(); for i in 0..length { // iterate over all parts of the path if parts.is_empty() { // pop left us with an empty vector, we're done break; } let mut possible_path = parts.join("/"); if possible_path.is_empty() { // .join can result in an empty string, which we don't need, ignore continue; } if i > 0 { // this isn't the last index of the parts array // ex: /buried/misc/stupidfile.php // this block skips the file but sees all parent folders possible_path = format!("{}/", possible_path); } paths.push(possible_path); // good sub-path found parts.pop(); // use .pop() to remove the last part of the path and continue iteration } log::trace!("exit: get_sub_paths_from_path -> {:?}", paths); paths } /// simple helper to stay DRY, trys to join a url + fragment and add it to the `links` HashSet fn add_link_to_set_of_links(link: &str, url: &Url, links: &mut HashSet<String>) { log::trace!( "enter: add_link_to_set_of_links({}, {}, {:?})", link, url.to_string(), links ); match url.join(&link) { Ok(new_url) => { links.insert(new_url.to_string()); } Err(e) => { log::error!("Could not join given url to the base url: {}", e); } } log::trace!("exit: add_link_to_set_of_links"); } /// Given a `reqwest::Response`, perform the following actions /// - parse the response's text for links using the linkfinder regex /// - for every link found take its url path and parse each sub-path /// - example: Response contains a link fragment `homepage/assets/img/icons/handshake.svg` /// with a base url of http://localhost, the following urls would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ pub async fn
( response: &FeroxResponse, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: get_links({}, {:?})", response.url().as_str(), tx_stats ); let mut links = HashSet::<String>::new(); let body = response.text(); for capture in LINKS_REGEX.captures_iter(&body) { // remove single & double quotes from both ends of the capture // capture[0] is the entire match, additional capture groups start at [1] let link = capture[0].trim_matches(|c| c == '\'' || c == '"'); match Url::parse(link) { Ok(absolute) => { if absolute.domain() != response.url().domain() || absolute.host() != response.url().host() { // domains/ips are not the same, don't scan things that aren't part of the original // target url continue; } add_all_sub_paths(absolute.path(), &response, &mut links); } Err(e) => { // this is the expected error that happens when we try to parse a url fragment // ex: Url::parse("/login") -> Err("relative URL without a base") // while this is technically an error, these are good results for us if e.to_string().contains("relative URL without a base") { add_all_sub_paths(link, &response, &mut links); } else { // unexpected error has occurred log::error!("Could not parse given url: {}", e); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: get_links -> {:?}", links); links } /// take a url fragment like homepage/assets/img/icons/handshake.svg and /// incrementally add /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn add_all_sub_paths(url_path: &str, response: &FeroxResponse, mut links: &mut HashSet<String>) { log::trace!( "enter: add_all_sub_paths({}, {}, {:?})", url_path, response, links ); for sub_path in get_sub_paths_from_path(url_path) { log::debug!("Adding {} to {:?}", sub_path, links); add_link_to_set_of_links(&sub_path, &response.url(), &mut links); } log::trace!("exit: add_all_sub_paths"); } /// Wrapper around link extraction logic /// currently used in two places: /// - links from response bodys /// - links from robots.txt responses /// /// general steps taken: /// - create a new Url object based on cli options/args /// - check if the new Url has already been seen/scanned -> None /// - make a request to the new Url ? -> Some(response) : None pub async fn request_feroxresponse_from_new_link( url: &str, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: request_feroxresponse_from_new_link({}, {:?})", url, tx_stats ); // create a url based on the given command line options, return None on error let new_url = match format_url( &url, &"", CONFIGURATION.add_slash, &CONFIGURATION.queries, None, tx_stats.clone(), ) { Ok(url) => url, Err(_) => { log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } }; if SCANNED_URLS.get_scan_by_url(&new_url.to_string()).is_some() { //we've seen the url before and don't need to scan again log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } // make the request and store the response let new_response = match make_request(&CONFIGURATION.client, &new_url, tx_stats).await { Ok(resp) => resp, Err(_) => { log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } }; let new_ferox_response = FeroxResponse::from(new_response, true).await; log::trace!( "exit: request_feroxresponse_from_new_link -> {:?}", new_ferox_response ); Some(new_ferox_response) } /// helper function that simply requests /robots.txt on the given url's base url /// /// example: /// http://localhost/api/users -> http://localhost/robots.txt /// /// The length of the given path has no effect on what's requested; it's always /// base url + /robots.txt pub async fn request_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: get_robots_file({}, CONFIGURATION, {:?})", base_url, tx_stats ); // more often than not, domain/robots.txt will redirect to www.domain/robots.txt or something // similar; to account for that, create a client that will follow redirects, regardless of // what the user specified for the scanning client. Other than redirects, it will respect // all other user specified settings let follow_redirects = true; let proxy = if config.proxy.is_empty() { None } else { Some(config.proxy.as_str()) }; let client = client::initialize( config.timeout, &config.user_agent, follow_redirects, config.insecure, &config.headers, proxy, ); if let Ok(mut url) = Url::parse(base_url) { url.set_path("/robots.txt"); // overwrite existing path with /robots.txt if let Ok(response) = make_request(&client, &url, tx_stats).await { let ferox_response = FeroxResponse::from(response, true).await; log::trace!("exit: get_robots_file -> {}", ferox_response); return Some(ferox_response); } } None } /// Entry point to perform link extraction from robots.txt /// /// `base_url` can have paths and subpaths, however robots.txt will be requested from the /// root of the url /// given the url: /// http://localhost/stuff/things /// this function requests: /// http://localhost/robots.txt pub async fn extract_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: extract_robots_txt({}, CONFIGURATION, {:?})", base_url, tx_stats ); let mut links = HashSet::new(); if let Some(response) = request_robots_txt(&base_url, &config, tx_stats.clone()).await { for capture in ROBOTS_REGEX.captures_iter(response.text.as_str()) { if let Some(new_path) = capture.name("url_path") { if let Ok(mut new_url) = Url::parse(base_url) { new_url.set_path(new_path.as_str()); add_all_sub_paths(new_url.path(), &response, &mut links); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: extract_robots_txt -> {:?}", links); links } #[cfg(test)] mod tests { use super::*; use crate::utils::make_request; use crate::FeroxChannel; use httpmock::Method::GET; use httpmock::MockServer; use reqwest::Client; use tokio::sync::mpsc; #[test] /// extract sub paths from the given url fragment; expect 4 sub paths and that all are /// in the expected array fn extractor_get_sub_paths_from_path_with_multiple_paths() { let path = "homepage/assets/img/icons/handshake.svg"; let paths = get_sub_paths_from_path(&path); let expected = vec![ "homepage/", "homepage/assets/", "homepage/assets/img/", "homepage/assets/img/icons/", "homepage/assets/img/icons/handshake.svg", ]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 2 sub paths and that all are /// in the expected array. the fragment is wrapped in slashes to ensure no empty strings are /// returned fn extractor_get_sub_paths_from_path_with_enclosing_slashes() { let path = "/homepage/assets/"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage/", "homepage/assets"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, no forward slashes are /// included fn extractor_get_sub_paths_from_path_with_only_a_word() { let path = "homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, forward slash removed fn extractor_get_sub_paths_from_path_with_an_absolute_word() { let path = "/homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// test that a full url and fragment are joined correctly, then added to the given list /// i.e. the happy path fn extractor_add_link_to_set_of_links_happy_path() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "admin"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 1); assert!(links.contains("https://localhost/admin")); } #[test] /// test that an invalid path fragment doesn't add anything to the set of links fn extractor_add_link_to_set_of_links_with_non_base_url() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "\\\\\\\\"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 0); assert!(links.is_empty()); } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// use make_request to generate a Response, and use the Response to test get_links; /// the response will contain an absolute path to a domain that is not part of the scanned /// domain; expect an empty set returned async fn extractor_get_links_with_absolute_url_that_differs_from_target_domain( ) -> Result<(), Box<dyn std::error::Error>> { let srv = MockServer::start(); let mock = srv.mock(|when, then|{ when.method(GET) .path("/some-path"); then.status(200) .body("\"http://defintely.not.a.thing.probably.com/homepage/assets/img/icons/handshake.svg\""); }); let client = Client::new(); let url = Url::parse(&srv.url("/some-path")).unwrap(); let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); let response = make_request(&client, &url, tx.clone()).await.unwrap(); let ferox_response = FeroxResponse::from(response, true).await; let links = get_links(&ferox_response, tx).await; assert!(links.is_empty()); assert_eq!(mock.hits(), 1); Ok(()) } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// test that /robots.txt is correctly requested given a base url (happy path) async fn request_robots_txt_with_and_without_proxy() { let srv = MockServer::start(); let mock = srv.mock(|when, then| { when.method(GET).path("/robots.txt"); then.status(200).body("this is a test"); }); let mut config = Configuration::default(); let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); request_robots_txt(&srv.url("/api/users/stuff/things"), &config, tx.clone()).await; // note: the proxy doesn't actually do anything other than hit a different code branch // in this unit test; it would however have an effect on an integration test config.proxy = srv.url("/ima-proxy"); request_robots_txt(&srv.url("/api/different/path"), &config, tx).await; assert_eq!(mock.hits(), 2); } }
get_links
identifier_name
extractor.rs
use crate::{ client, config::{Configuration, CONFIGURATION}, scanner::SCANNED_URLS, statistics::{ StatCommand::{self, UpdateUsizeField}, StatField::{LinksExtracted, TotalExpected}, }, utils::{format_url, make_request}, FeroxResponse, }; use lazy_static::lazy_static; use regex::Regex; use reqwest::Url; use std::collections::HashSet; use tokio::sync::mpsc::UnboundedSender; /// Regular expression used in [LinkFinder](https://github.com/GerbenJavado/LinkFinder) /// /// Incorporates change from this [Pull Request](https://github.com/GerbenJavado/LinkFinder/pull/66/files) const LINKFINDER_REGEX: &str = r#"(?:"|')(((?:[a-zA-Z]{1,10}://|//)[^"'/]{1,}\.[a-zA-Z]{2,}[^"']{0,})|((?:/|\.\./|\./)[^"'><,;| *()(%%$^/\\\[\]][^"'><,;|()]{1,})|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{1,}\.(?:[a-zA-Z]{1,4}|action)(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{3,}(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-.]{1,}\.(?:php|asp|aspx|jsp|json|action|html|js|txt|xml)(?:[\?|#][^"|']{0,}|)))(?:"|')"#; /// Regular expression to pull url paths from robots.txt /// /// ref: https://developers.google.com/search/reference/robots_txt const ROBOTS_TXT_REGEX: &str = r#"(?m)^ *(Allow|Disallow): *(?P<url_path>[a-zA-Z0-9._/?#@!&'()+,;%=-]+?)$"#; // multi-line (?m) lazy_static! { /// `LINKFINDER_REGEX` as a regex::Regex type static ref LINKS_REGEX: Regex = Regex::new(LINKFINDER_REGEX).unwrap(); /// `ROBOTS_TXT_REGEX` as a regex::Regex type static ref ROBOTS_REGEX: Regex = Regex::new(ROBOTS_TXT_REGEX).unwrap(); } /// Iterate over a given path, return a list of every sub-path found /// /// example: `path` contains a link fragment `homepage/assets/img/icons/handshake.svg` /// the following fragments would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn get_sub_paths_from_path(path: &str) -> Vec<String> { log::trace!("enter: get_sub_paths_from_path({})", path); let mut paths = vec![]; // filter out any empty strings caused by .split let mut parts: Vec<&str> = path.split('/').filter(|s| !s.is_empty()).collect(); let length = parts.len(); for i in 0..length { // iterate over all parts of the path if parts.is_empty() { // pop left us with an empty vector, we're done break; } let mut possible_path = parts.join("/"); if possible_path.is_empty() { // .join can result in an empty string, which we don't need, ignore continue; } if i > 0 { // this isn't the last index of the parts array // ex: /buried/misc/stupidfile.php // this block skips the file but sees all parent folders possible_path = format!("{}/", possible_path); } paths.push(possible_path); // good sub-path found parts.pop(); // use .pop() to remove the last part of the path and continue iteration } log::trace!("exit: get_sub_paths_from_path -> {:?}", paths); paths } /// simple helper to stay DRY, trys to join a url + fragment and add it to the `links` HashSet fn add_link_to_set_of_links(link: &str, url: &Url, links: &mut HashSet<String>) { log::trace!( "enter: add_link_to_set_of_links({}, {}, {:?})", link, url.to_string(), links ); match url.join(&link) { Ok(new_url) => { links.insert(new_url.to_string()); } Err(e) => { log::error!("Could not join given url to the base url: {}", e); } } log::trace!("exit: add_link_to_set_of_links"); } /// Given a `reqwest::Response`, perform the following actions /// - parse the response's text for links using the linkfinder regex /// - for every link found take its url path and parse each sub-path /// - example: Response contains a link fragment `homepage/assets/img/icons/handshake.svg` /// with a base url of http://localhost, the following urls would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ pub async fn get_links( response: &FeroxResponse, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: get_links({}, {:?})", response.url().as_str(), tx_stats ); let mut links = HashSet::<String>::new(); let body = response.text(); for capture in LINKS_REGEX.captures_iter(&body) { // remove single & double quotes from both ends of the capture // capture[0] is the entire match, additional capture groups start at [1] let link = capture[0].trim_matches(|c| c == '\'' || c == '"'); match Url::parse(link) { Ok(absolute) => { if absolute.domain() != response.url().domain() || absolute.host() != response.url().host() { // domains/ips are not the same, don't scan things that aren't part of the original // target url continue; } add_all_sub_paths(absolute.path(), &response, &mut links); } Err(e) => { // this is the expected error that happens when we try to parse a url fragment // ex: Url::parse("/login") -> Err("relative URL without a base") // while this is technically an error, these are good results for us if e.to_string().contains("relative URL without a base") { add_all_sub_paths(link, &response, &mut links); } else { // unexpected error has occurred log::error!("Could not parse given url: {}", e); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: get_links -> {:?}", links); links } /// take a url fragment like homepage/assets/img/icons/handshake.svg and /// incrementally add /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn add_all_sub_paths(url_path: &str, response: &FeroxResponse, mut links: &mut HashSet<String>) { log::trace!( "enter: add_all_sub_paths({}, {}, {:?})", url_path, response, links ); for sub_path in get_sub_paths_from_path(url_path) { log::debug!("Adding {} to {:?}", sub_path, links); add_link_to_set_of_links(&sub_path, &response.url(), &mut links); } log::trace!("exit: add_all_sub_paths"); } /// Wrapper around link extraction logic /// currently used in two places: /// - links from response bodys /// - links from robots.txt responses /// /// general steps taken: /// - create a new Url object based on cli options/args /// - check if the new Url has already been seen/scanned -> None /// - make a request to the new Url ? -> Some(response) : None pub async fn request_feroxresponse_from_new_link( url: &str, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: request_feroxresponse_from_new_link({}, {:?})", url, tx_stats ); // create a url based on the given command line options, return None on error let new_url = match format_url( &url, &"", CONFIGURATION.add_slash, &CONFIGURATION.queries, None, tx_stats.clone(), ) { Ok(url) => url, Err(_) => { log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } }; if SCANNED_URLS.get_scan_by_url(&new_url.to_string()).is_some() { //we've seen the url before and don't need to scan again log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } // make the request and store the response let new_response = match make_request(&CONFIGURATION.client, &new_url, tx_stats).await { Ok(resp) => resp, Err(_) => { log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } }; let new_ferox_response = FeroxResponse::from(new_response, true).await; log::trace!( "exit: request_feroxresponse_from_new_link -> {:?}", new_ferox_response ); Some(new_ferox_response) } /// helper function that simply requests /robots.txt on the given url's base url /// /// example: /// http://localhost/api/users -> http://localhost/robots.txt /// /// The length of the given path has no effect on what's requested; it's always /// base url + /robots.txt pub async fn request_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: get_robots_file({}, CONFIGURATION, {:?})", base_url, tx_stats ); // more often than not, domain/robots.txt will redirect to www.domain/robots.txt or something // similar; to account for that, create a client that will follow redirects, regardless of // what the user specified for the scanning client. Other than redirects, it will respect // all other user specified settings let follow_redirects = true; let proxy = if config.proxy.is_empty() { None } else { Some(config.proxy.as_str()) }; let client = client::initialize( config.timeout, &config.user_agent, follow_redirects, config.insecure, &config.headers, proxy, ); if let Ok(mut url) = Url::parse(base_url) { url.set_path("/robots.txt"); // overwrite existing path with /robots.txt if let Ok(response) = make_request(&client, &url, tx_stats).await { let ferox_response = FeroxResponse::from(response, true).await; log::trace!("exit: get_robots_file -> {}", ferox_response); return Some(ferox_response); } } None } /// Entry point to perform link extraction from robots.txt /// /// `base_url` can have paths and subpaths, however robots.txt will be requested from the /// root of the url /// given the url: /// http://localhost/stuff/things /// this function requests: /// http://localhost/robots.txt pub async fn extract_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: extract_robots_txt({}, CONFIGURATION, {:?})", base_url, tx_stats ); let mut links = HashSet::new(); if let Some(response) = request_robots_txt(&base_url, &config, tx_stats.clone()).await { for capture in ROBOTS_REGEX.captures_iter(response.text.as_str()) { if let Some(new_path) = capture.name("url_path") { if let Ok(mut new_url) = Url::parse(base_url) { new_url.set_path(new_path.as_str()); add_all_sub_paths(new_url.path(), &response, &mut links); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: extract_robots_txt -> {:?}", links); links } #[cfg(test)] mod tests { use super::*; use crate::utils::make_request; use crate::FeroxChannel; use httpmock::Method::GET; use httpmock::MockServer; use reqwest::Client; use tokio::sync::mpsc; #[test] /// extract sub paths from the given url fragment; expect 4 sub paths and that all are /// in the expected array fn extractor_get_sub_paths_from_path_with_multiple_paths() { let path = "homepage/assets/img/icons/handshake.svg"; let paths = get_sub_paths_from_path(&path); let expected = vec![ "homepage/", "homepage/assets/", "homepage/assets/img/", "homepage/assets/img/icons/", "homepage/assets/img/icons/handshake.svg", ]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 2 sub paths and that all are /// in the expected array. the fragment is wrapped in slashes to ensure no empty strings are /// returned fn extractor_get_sub_paths_from_path_with_enclosing_slashes() { let path = "/homepage/assets/"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage/", "homepage/assets"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, no forward slashes are /// included fn extractor_get_sub_paths_from_path_with_only_a_word() { let path = "homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, forward slash removed fn extractor_get_sub_paths_from_path_with_an_absolute_word() { let path = "/homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// test that a full url and fragment are joined correctly, then added to the given list /// i.e. the happy path fn extractor_add_link_to_set_of_links_happy_path() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "admin"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 1); assert!(links.contains("https://localhost/admin")); } #[test] /// test that an invalid path fragment doesn't add anything to the set of links fn extractor_add_link_to_set_of_links_with_non_base_url() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "\\\\\\\\"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 0); assert!(links.is_empty()); } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// use make_request to generate a Response, and use the Response to test get_links; /// the response will contain an absolute path to a domain that is not part of the scanned /// domain; expect an empty set returned async fn extractor_get_links_with_absolute_url_that_differs_from_target_domain( ) -> Result<(), Box<dyn std::error::Error>> { let srv = MockServer::start(); let mock = srv.mock(|when, then|{ when.method(GET) .path("/some-path"); then.status(200) .body("\"http://defintely.not.a.thing.probably.com/homepage/assets/img/icons/handshake.svg\""); }); let client = Client::new(); let url = Url::parse(&srv.url("/some-path")).unwrap();
let links = get_links(&ferox_response, tx).await; assert!(links.is_empty()); assert_eq!(mock.hits(), 1); Ok(()) } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// test that /robots.txt is correctly requested given a base url (happy path) async fn request_robots_txt_with_and_without_proxy() { let srv = MockServer::start(); let mock = srv.mock(|when, then| { when.method(GET).path("/robots.txt"); then.status(200).body("this is a test"); }); let mut config = Configuration::default(); let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); request_robots_txt(&srv.url("/api/users/stuff/things"), &config, tx.clone()).await; // note: the proxy doesn't actually do anything other than hit a different code branch // in this unit test; it would however have an effect on an integration test config.proxy = srv.url("/ima-proxy"); request_robots_txt(&srv.url("/api/different/path"), &config, tx).await; assert_eq!(mock.hits(), 2); } }
let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); let response = make_request(&client, &url, tx.clone()).await.unwrap(); let ferox_response = FeroxResponse::from(response, true).await;
random_line_split
extractor.rs
use crate::{ client, config::{Configuration, CONFIGURATION}, scanner::SCANNED_URLS, statistics::{ StatCommand::{self, UpdateUsizeField}, StatField::{LinksExtracted, TotalExpected}, }, utils::{format_url, make_request}, FeroxResponse, }; use lazy_static::lazy_static; use regex::Regex; use reqwest::Url; use std::collections::HashSet; use tokio::sync::mpsc::UnboundedSender; /// Regular expression used in [LinkFinder](https://github.com/GerbenJavado/LinkFinder) /// /// Incorporates change from this [Pull Request](https://github.com/GerbenJavado/LinkFinder/pull/66/files) const LINKFINDER_REGEX: &str = r#"(?:"|')(((?:[a-zA-Z]{1,10}://|//)[^"'/]{1,}\.[a-zA-Z]{2,}[^"']{0,})|((?:/|\.\./|\./)[^"'><,;| *()(%%$^/\\\[\]][^"'><,;|()]{1,})|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{1,}\.(?:[a-zA-Z]{1,4}|action)(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-/]{1,}/[a-zA-Z0-9_\-/]{3,}(?:[\?|#][^"|']{0,}|))|([a-zA-Z0-9_\-.]{1,}\.(?:php|asp|aspx|jsp|json|action|html|js|txt|xml)(?:[\?|#][^"|']{0,}|)))(?:"|')"#; /// Regular expression to pull url paths from robots.txt /// /// ref: https://developers.google.com/search/reference/robots_txt const ROBOTS_TXT_REGEX: &str = r#"(?m)^ *(Allow|Disallow): *(?P<url_path>[a-zA-Z0-9._/?#@!&'()+,;%=-]+?)$"#; // multi-line (?m) lazy_static! { /// `LINKFINDER_REGEX` as a regex::Regex type static ref LINKS_REGEX: Regex = Regex::new(LINKFINDER_REGEX).unwrap(); /// `ROBOTS_TXT_REGEX` as a regex::Regex type static ref ROBOTS_REGEX: Regex = Regex::new(ROBOTS_TXT_REGEX).unwrap(); } /// Iterate over a given path, return a list of every sub-path found /// /// example: `path` contains a link fragment `homepage/assets/img/icons/handshake.svg` /// the following fragments would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn get_sub_paths_from_path(path: &str) -> Vec<String> { log::trace!("enter: get_sub_paths_from_path({})", path); let mut paths = vec![]; // filter out any empty strings caused by .split let mut parts: Vec<&str> = path.split('/').filter(|s| !s.is_empty()).collect(); let length = parts.len(); for i in 0..length { // iterate over all parts of the path if parts.is_empty() { // pop left us with an empty vector, we're done break; } let mut possible_path = parts.join("/"); if possible_path.is_empty() { // .join can result in an empty string, which we don't need, ignore continue; } if i > 0 { // this isn't the last index of the parts array // ex: /buried/misc/stupidfile.php // this block skips the file but sees all parent folders possible_path = format!("{}/", possible_path); } paths.push(possible_path); // good sub-path found parts.pop(); // use .pop() to remove the last part of the path and continue iteration } log::trace!("exit: get_sub_paths_from_path -> {:?}", paths); paths } /// simple helper to stay DRY, trys to join a url + fragment and add it to the `links` HashSet fn add_link_to_set_of_links(link: &str, url: &Url, links: &mut HashSet<String>) { log::trace!( "enter: add_link_to_set_of_links({}, {}, {:?})", link, url.to_string(), links ); match url.join(&link) { Ok(new_url) => { links.insert(new_url.to_string()); } Err(e) => { log::error!("Could not join given url to the base url: {}", e); } } log::trace!("exit: add_link_to_set_of_links"); } /// Given a `reqwest::Response`, perform the following actions /// - parse the response's text for links using the linkfinder regex /// - for every link found take its url path and parse each sub-path /// - example: Response contains a link fragment `homepage/assets/img/icons/handshake.svg` /// with a base url of http://localhost, the following urls would be returned: /// - homepage/assets/img/icons/handshake.svg /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ pub async fn get_links( response: &FeroxResponse, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: get_links({}, {:?})", response.url().as_str(), tx_stats ); let mut links = HashSet::<String>::new(); let body = response.text(); for capture in LINKS_REGEX.captures_iter(&body) { // remove single & double quotes from both ends of the capture // capture[0] is the entire match, additional capture groups start at [1] let link = capture[0].trim_matches(|c| c == '\'' || c == '"'); match Url::parse(link) { Ok(absolute) => { if absolute.domain() != response.url().domain() || absolute.host() != response.url().host() { // domains/ips are not the same, don't scan things that aren't part of the original // target url continue; } add_all_sub_paths(absolute.path(), &response, &mut links); } Err(e) => { // this is the expected error that happens when we try to parse a url fragment // ex: Url::parse("/login") -> Err("relative URL without a base") // while this is technically an error, these are good results for us if e.to_string().contains("relative URL without a base") { add_all_sub_paths(link, &response, &mut links); } else { // unexpected error has occurred log::error!("Could not parse given url: {}", e); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: get_links -> {:?}", links); links } /// take a url fragment like homepage/assets/img/icons/handshake.svg and /// incrementally add /// - homepage/assets/img/icons/ /// - homepage/assets/img/ /// - homepage/assets/ /// - homepage/ fn add_all_sub_paths(url_path: &str, response: &FeroxResponse, mut links: &mut HashSet<String>) { log::trace!( "enter: add_all_sub_paths({}, {}, {:?})", url_path, response, links ); for sub_path in get_sub_paths_from_path(url_path) { log::debug!("Adding {} to {:?}", sub_path, links); add_link_to_set_of_links(&sub_path, &response.url(), &mut links); } log::trace!("exit: add_all_sub_paths"); } /// Wrapper around link extraction logic /// currently used in two places: /// - links from response bodys /// - links from robots.txt responses /// /// general steps taken: /// - create a new Url object based on cli options/args /// - check if the new Url has already been seen/scanned -> None /// - make a request to the new Url ? -> Some(response) : None pub async fn request_feroxresponse_from_new_link( url: &str, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: request_feroxresponse_from_new_link({}, {:?})", url, tx_stats ); // create a url based on the given command line options, return None on error let new_url = match format_url( &url, &"", CONFIGURATION.add_slash, &CONFIGURATION.queries, None, tx_stats.clone(), ) { Ok(url) => url, Err(_) => { log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } }; if SCANNED_URLS.get_scan_by_url(&new_url.to_string()).is_some() { //we've seen the url before and don't need to scan again log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } // make the request and store the response let new_response = match make_request(&CONFIGURATION.client, &new_url, tx_stats).await { Ok(resp) => resp, Err(_) => { log::trace!("exit: request_feroxresponse_from_new_link -> None"); return None; } }; let new_ferox_response = FeroxResponse::from(new_response, true).await; log::trace!( "exit: request_feroxresponse_from_new_link -> {:?}", new_ferox_response ); Some(new_ferox_response) } /// helper function that simply requests /robots.txt on the given url's base url /// /// example: /// http://localhost/api/users -> http://localhost/robots.txt /// /// The length of the given path has no effect on what's requested; it's always /// base url + /robots.txt pub async fn request_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> Option<FeroxResponse> { log::trace!( "enter: get_robots_file({}, CONFIGURATION, {:?})", base_url, tx_stats ); // more often than not, domain/robots.txt will redirect to www.domain/robots.txt or something // similar; to account for that, create a client that will follow redirects, regardless of // what the user specified for the scanning client. Other than redirects, it will respect // all other user specified settings let follow_redirects = true; let proxy = if config.proxy.is_empty() { None } else { Some(config.proxy.as_str()) }; let client = client::initialize( config.timeout, &config.user_agent, follow_redirects, config.insecure, &config.headers, proxy, ); if let Ok(mut url) = Url::parse(base_url) { url.set_path("/robots.txt"); // overwrite existing path with /robots.txt if let Ok(response) = make_request(&client, &url, tx_stats).await { let ferox_response = FeroxResponse::from(response, true).await; log::trace!("exit: get_robots_file -> {}", ferox_response); return Some(ferox_response); } } None } /// Entry point to perform link extraction from robots.txt /// /// `base_url` can have paths and subpaths, however robots.txt will be requested from the /// root of the url /// given the url: /// http://localhost/stuff/things /// this function requests: /// http://localhost/robots.txt pub async fn extract_robots_txt( base_url: &str, config: &Configuration, tx_stats: UnboundedSender<StatCommand>, ) -> HashSet<String> { log::trace!( "enter: extract_robots_txt({}, CONFIGURATION, {:?})", base_url, tx_stats ); let mut links = HashSet::new(); if let Some(response) = request_robots_txt(&base_url, &config, tx_stats.clone()).await { for capture in ROBOTS_REGEX.captures_iter(response.text.as_str()) { if let Some(new_path) = capture.name("url_path") { if let Ok(mut new_url) = Url::parse(base_url) { new_url.set_path(new_path.as_str()); add_all_sub_paths(new_url.path(), &response, &mut links); } } } } let multiplier = CONFIGURATION.extensions.len().max(1); update_stat!(tx_stats, UpdateUsizeField(LinksExtracted, links.len())); update_stat!( tx_stats, UpdateUsizeField(TotalExpected, links.len() * multiplier) ); log::trace!("exit: extract_robots_txt -> {:?}", links); links } #[cfg(test)] mod tests { use super::*; use crate::utils::make_request; use crate::FeroxChannel; use httpmock::Method::GET; use httpmock::MockServer; use reqwest::Client; use tokio::sync::mpsc; #[test] /// extract sub paths from the given url fragment; expect 4 sub paths and that all are /// in the expected array fn extractor_get_sub_paths_from_path_with_multiple_paths() { let path = "homepage/assets/img/icons/handshake.svg"; let paths = get_sub_paths_from_path(&path); let expected = vec![ "homepage/", "homepage/assets/", "homepage/assets/img/", "homepage/assets/img/icons/", "homepage/assets/img/icons/handshake.svg", ]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 2 sub paths and that all are /// in the expected array. the fragment is wrapped in slashes to ensure no empty strings are /// returned fn extractor_get_sub_paths_from_path_with_enclosing_slashes() { let path = "/homepage/assets/"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage/", "homepage/assets"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, no forward slashes are /// included fn extractor_get_sub_paths_from_path_with_only_a_word() { let path = "homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// extract sub paths from the given url fragment; expect 1 sub path, forward slash removed fn extractor_get_sub_paths_from_path_with_an_absolute_word() { let path = "/homepage"; let paths = get_sub_paths_from_path(&path); let expected = vec!["homepage"]; assert_eq!(paths.len(), expected.len()); for expected_path in expected { assert_eq!(paths.contains(&expected_path.to_string()), true); } } #[test] /// test that a full url and fragment are joined correctly, then added to the given list /// i.e. the happy path fn extractor_add_link_to_set_of_links_happy_path() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "admin"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 1); assert!(links.contains("https://localhost/admin")); } #[test] /// test that an invalid path fragment doesn't add anything to the set of links fn extractor_add_link_to_set_of_links_with_non_base_url() { let url = Url::parse("https://localhost").unwrap(); let mut links = HashSet::<String>::new(); let link = "\\\\\\\\"; assert_eq!(links.len(), 0); add_link_to_set_of_links(link, &url, &mut links); assert_eq!(links.len(), 0); assert!(links.is_empty()); } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// use make_request to generate a Response, and use the Response to test get_links; /// the response will contain an absolute path to a domain that is not part of the scanned /// domain; expect an empty set returned async fn extractor_get_links_with_absolute_url_that_differs_from_target_domain( ) -> Result<(), Box<dyn std::error::Error>> { let srv = MockServer::start(); let mock = srv.mock(|when, then|{ when.method(GET) .path("/some-path"); then.status(200) .body("\"http://defintely.not.a.thing.probably.com/homepage/assets/img/icons/handshake.svg\""); }); let client = Client::new(); let url = Url::parse(&srv.url("/some-path")).unwrap(); let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); let response = make_request(&client, &url, tx.clone()).await.unwrap(); let ferox_response = FeroxResponse::from(response, true).await; let links = get_links(&ferox_response, tx).await; assert!(links.is_empty()); assert_eq!(mock.hits(), 1); Ok(()) } #[tokio::test(flavor = "multi_thread", worker_threads = 1)] /// test that /robots.txt is correctly requested given a base url (happy path) async fn request_robots_txt_with_and_without_proxy()
}
{ let srv = MockServer::start(); let mock = srv.mock(|when, then| { when.method(GET).path("/robots.txt"); then.status(200).body("this is a test"); }); let mut config = Configuration::default(); let (tx, _): FeroxChannel<StatCommand> = mpsc::unbounded_channel(); request_robots_txt(&srv.url("/api/users/stuff/things"), &config, tx.clone()).await; // note: the proxy doesn't actually do anything other than hit a different code branch // in this unit test; it would however have an effect on an integration test config.proxy = srv.url("/ima-proxy"); request_robots_txt(&srv.url("/api/different/path"), &config, tx).await; assert_eq!(mock.hits(), 2); }
identifier_body
keyboard.rs
use crate::input::device::{Device, DeviceType}; use crate::input::event_filter::{EventFilter, EventFilterManager}; use crate::input::events::{InputEvent, KeyboardEvent}; use crate::{config::ConfigManager, input::seat::SeatManager}; use log::debug; use serde::{Deserialize, Serialize}; use std::cell::RefCell; use std::ops::Deref; use std::pin::Pin; use std::rc::{Rc, Weak}; use wlroots_sys::*; use xkbcommon::xkb; #[cfg(not(test))] use xkbcommon::xkb::ffi::xkb_state_ref; #[derive(Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] pub struct RepeatRate(u32); impl Default for RepeatRate { fn default() -> Self { RepeatRate(33) } } #[derive(Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] pub struct RepeatDelay(u32); impl Default for RepeatDelay { fn default() -> Self { RepeatDelay(500) } } #[derive(Default, Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] #[serde(default)] pub struct KeyboardConfig { pub xkb_rules: String, pub xkb_model: String, pub xkb_layout: String, pub xkb_variant: String, pub xkb_options: Option<String>, pub repeat_rate: RepeatRate, pub repeat_delay: RepeatDelay, } pub struct Keyboard { seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, device: Rc<Device>, keyboard: *mut wlr_keyboard, xkb_state: RefCell<xkb::State>, event_manager: RefCell<Option<Pin<Box<KeyboardEventManager>>>>, } impl Keyboard { fn init( config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, device: Rc<Device>, ) -> Rc<Keyboard> { debug!("Keyboard::init: {}", device.name()); let keyboard_ptr = match device.device_type() { DeviceType::Keyboard(keyboard_ptr) => keyboard_ptr, _ => panic!("Keyboard::init expects a keyboard device"), }; let config = &config_manager.config().keyboard; set_keymap_from_config(keyboard_ptr, config); let keyboard = Rc::new(Keyboard { seat_manager, event_filter_manager, device: device.clone(), keyboard: keyboard_ptr, xkb_state: RefCell::new(unsafe { xkb::State::from_raw_ptr(xkb_state_ref((*keyboard_ptr).xkb_state)) }), event_manager: RefCell::new(None), }); let subscription = config_manager .on_config_changed() .subscribe(listener!(keyboard => move |config| { set_keymap_from_config(keyboard.raw_ptr(), &config.keyboard); *keyboard.xkb_state.borrow_mut() = unsafe { xkb::State::from_raw_ptr(xkb_state_ref((*keyboard_ptr).xkb_state)) }; })); device.on_destroy.then(listener!(config_manager => move || { config_manager.on_config_changed().unsubscribe(subscription); })); let mut event_manager = KeyboardEventManager::new(Rc::downgrade(&keyboard)); unsafe { event_manager.modifiers(&mut (*keyboard_ptr).events.modifiers); event_manager.key(&mut (*keyboard_ptr).events.key); } *keyboard.event_manager.borrow_mut() = Some(event_manager); keyboard } pub fn raw_ptr(&self) -> *mut wlr_keyboard { self.keyboard } pub fn device(&self) -> Rc<Device> { self.device.clone() } pub fn xkb_state(&self) -> xkb::State { self.xkb_state.borrow().clone() } } fn set_keymap_from_config(keyboard_ptr: *mut wlr_keyboard, config: &KeyboardConfig) { // We need to prepare an XKB keymap and assign it to the keyboard. let context = xkb::Context::new(xkb::CONTEXT_NO_FLAGS); let keymap = xkb::Keymap::new_from_names( &context, &config.xkb_rules, &config.xkb_model, &config.xkb_layout, &config.xkb_variant, config.xkb_options.clone(), xkb::KEYMAP_COMPILE_NO_FLAGS, ) .expect("xkb::Keymap could not be created"); unsafe { wlr_keyboard_set_keymap(keyboard_ptr, keymap.get_raw_ptr()); wlr_keyboard_set_repeat_info( keyboard_ptr, config.repeat_rate.0 as i32, config.repeat_delay.0 as i32, ); } } pub(crate) trait KeyboardEventHandler { fn modifiers(&self); fn key(&self, event: *const wlr_event_keyboard_key); } impl KeyboardEventHandler for Keyboard { fn modifiers(&self) { unsafe { // A seat can only have one keyboard, but this is a limitation of the // Wayland protocol - not wlroots. We assign all connected keyboards to the // same seat. You can swap out the underlying wlr_keyboard like this and // wlr_seat handles this transparently. wlr_seat_set_keyboard(self.seat_manager.raw_seat(), self.device.raw_ptr()); // Send modifiers to the client. wlr_seat_keyboard_notify_modifiers( self.seat_manager.raw_seat(), &mut (*self.keyboard).modifiers, ); } } fn key(&self, event: *const wlr_event_keyboard_key) { let event = unsafe { KeyboardEvent::from_ptr(self, event) }; let handled = self.event_filter_manager.handle_keyboard_event(&event); if !handled
} } wayland_listener!( KeyboardEventManager, Weak<Keyboard>, [ modifiers => modifiers_func: |this: &mut KeyboardEventManager, _data: *mut libc::c_void,| unsafe { if let Some(handler) = this.data.upgrade() { handler.modifiers(); } }; key => key_func: |this: &mut KeyboardEventManager, data: *mut libc::c_void,| unsafe { if let Some(handler) = this.data.upgrade() { handler.key(data as _); } }; ] ); pub struct KeyboardManager { config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, keyboards: RefCell<Vec<Rc<Keyboard>>>, } impl KeyboardManager { pub(crate) fn init( config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, ) -> Rc<KeyboardManager> { let keyboard_manager = Rc::new(KeyboardManager { config_manager, seat_manager: seat_manager.clone(), event_filter_manager, keyboards: RefCell::new(vec![]), }); seat_manager .on_new_device .subscribe(listener!(keyboard_manager => move |device| { if let DeviceType::Keyboard(_) = device.device_type() { device.on_destroy.then(listener!(device, keyboard_manager => move || { keyboard_manager .keyboards .borrow_mut() .retain(|keyboard| keyboard.device.deref() != device.deref()); keyboard_manager .seat_manager .set_has_any_keyboard(keyboard_manager.has_keyboard()); })); unsafe { wlr_seat_set_keyboard(keyboard_manager.seat_manager.raw_seat(), device.raw_ptr()); } let keyboard = Keyboard::init( keyboard_manager.config_manager.clone(), keyboard_manager.seat_manager.clone(), keyboard_manager.event_filter_manager.clone(), device.clone(), ); keyboard_manager.keyboards.borrow_mut().push(keyboard); keyboard_manager.seat_manager.set_has_any_keyboard(true); } })); keyboard_manager } pub fn has_keyboard(&self) -> bool { !self.keyboards.borrow().is_empty() } } #[cfg(test)] mod tests { use super::*; use crate::test_util::*; use std::ptr; use std::rc::Rc; #[test] fn it_drops_and_cleans_up_on_destroy() { let config_manager = Rc::new(ConfigManager::default()); let seat_manager = SeatManager::mock(ptr::null_mut(), ptr::null_mut()); let event_filter_manager = Rc::new(EventFilterManager::new()); let keyboard_manager = Rc::new(KeyboardManager::init( config_manager, seat_manager.clone(), event_filter_manager, )); let mut raw_keyboard = wlr_keyboard { impl_: ptr::null(), group: ptr::null_mut(), keymap_string: ptr::null_mut(), keymap_size: 0, keymap: ptr::null_mut(), xkb_state: ptr::null_mut(), led_indexes: [0; 3], mod_indexes: [0; 8], keycodes: [0; 32], num_keycodes: 0, modifiers: wlr_keyboard_modifiers { depressed: 0, latched: 0, locked: 0, group: 0, }, repeat_info: wlr_keyboard__bindgen_ty_1 { rate: 0, delay: 0 }, events: wlr_keyboard__bindgen_ty_2 { key: new_wl_signal(), modifiers: new_wl_signal(), keymap: new_wl_signal(), repeat_info: new_wl_signal(), destroy: new_wl_signal(), }, data: ptr::null_mut(), }; let mut device = wlr_input_device { impl_: ptr::null(), type_: wlr_input_device_type_WLR_INPUT_DEVICE_KEYBOARD, vendor: 0, product: 0, name: ptr::null_mut(), width_mm: 0.0, height_mm: 0.0, output_name: ptr::null_mut(), __bindgen_anon_1: wlr_input_device__bindgen_ty_1 { keyboard: &mut raw_keyboard, }, events: wlr_input_device__bindgen_ty_2 { destroy: new_wl_signal(), }, data: ptr::null_mut(), link: new_wl_list(), }; let key_signal = WlSignal::from_ptr(&mut raw_keyboard.events.key); let modifiers_signal = WlSignal::from_ptr(&mut raw_keyboard.events.modifiers); let keymap_signal = WlSignal::from_ptr(&mut raw_keyboard.events.keymap); let repeat_info_signal = WlSignal::from_ptr(&mut raw_keyboard.events.repeat_info); let destroy_signal = WlSignal::from_ptr(&mut device.events.destroy); let device = Device::init(&mut device); let weak_device = Rc::downgrade(&device); seat_manager.on_new_device.fire(device); let keyboard = keyboard_manager.keyboards.borrow().first().unwrap().clone(); let weak_keyboard = Rc::downgrade(&keyboard); drop(keyboard); assert!(weak_device.upgrade().is_some()); assert!(weak_keyboard.upgrade().is_some()); assert!(key_signal.listener_count() == 1); assert!(modifiers_signal.listener_count() == 1); assert!(destroy_signal.listener_count() == 1); assert!(keyboard_manager.has_keyboard()); destroy_signal.emit(); assert!(key_signal.listener_count() == 0); assert!(modifiers_signal.listener_count() == 0); assert!(keymap_signal.listener_count() == 0); assert!(repeat_info_signal.listener_count() == 0); assert!(destroy_signal.listener_count() == 0); assert!(!keyboard_manager.has_keyboard()); assert!(weak_keyboard.upgrade().is_none()); assert!(weak_device.upgrade().is_none()); } } #[cfg(test)] use xkbcommon::xkb::ffi::{xkb_keymap, xkb_state}; #[cfg(test)] unsafe fn wlr_seat_set_keyboard(_: *mut wlr_seat, _: *mut wlr_input_device) {} #[cfg(test)] unsafe fn wlr_keyboard_set_keymap(_: *mut wlr_keyboard, _: *mut xkb_keymap) {} #[cfg(test)] unsafe fn wlr_keyboard_set_repeat_info(_: *mut wlr_keyboard, _: i32, _: i32) {} #[cfg(test)] unsafe fn xkb_state_ref(ptr: *mut xkb_state) -> *mut xkb_state { ptr }
{ unsafe { // Otherwise, we pass it along to the client. wlr_seat_set_keyboard(self.seat_manager.raw_seat(), self.device.raw_ptr()); wlr_seat_keyboard_notify_key( self.seat_manager.raw_seat(), event.time_msec(), event.libinput_keycode(), event.raw_state(), ); } }
conditional_block
keyboard.rs
use crate::input::device::{Device, DeviceType}; use crate::input::event_filter::{EventFilter, EventFilterManager}; use crate::input::events::{InputEvent, KeyboardEvent}; use crate::{config::ConfigManager, input::seat::SeatManager}; use log::debug; use serde::{Deserialize, Serialize}; use std::cell::RefCell; use std::ops::Deref; use std::pin::Pin; use std::rc::{Rc, Weak}; use wlroots_sys::*; use xkbcommon::xkb; #[cfg(not(test))] use xkbcommon::xkb::ffi::xkb_state_ref; #[derive(Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] pub struct RepeatRate(u32); impl Default for RepeatRate { fn default() -> Self { RepeatRate(33) } } #[derive(Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] pub struct RepeatDelay(u32); impl Default for RepeatDelay { fn default() -> Self { RepeatDelay(500) } } #[derive(Default, Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] #[serde(default)] pub struct KeyboardConfig { pub xkb_rules: String, pub xkb_model: String, pub xkb_layout: String, pub xkb_variant: String, pub xkb_options: Option<String>, pub repeat_rate: RepeatRate, pub repeat_delay: RepeatDelay, } pub struct
{ seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, device: Rc<Device>, keyboard: *mut wlr_keyboard, xkb_state: RefCell<xkb::State>, event_manager: RefCell<Option<Pin<Box<KeyboardEventManager>>>>, } impl Keyboard { fn init( config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, device: Rc<Device>, ) -> Rc<Keyboard> { debug!("Keyboard::init: {}", device.name()); let keyboard_ptr = match device.device_type() { DeviceType::Keyboard(keyboard_ptr) => keyboard_ptr, _ => panic!("Keyboard::init expects a keyboard device"), }; let config = &config_manager.config().keyboard; set_keymap_from_config(keyboard_ptr, config); let keyboard = Rc::new(Keyboard { seat_manager, event_filter_manager, device: device.clone(), keyboard: keyboard_ptr, xkb_state: RefCell::new(unsafe { xkb::State::from_raw_ptr(xkb_state_ref((*keyboard_ptr).xkb_state)) }), event_manager: RefCell::new(None), }); let subscription = config_manager .on_config_changed() .subscribe(listener!(keyboard => move |config| { set_keymap_from_config(keyboard.raw_ptr(), &config.keyboard); *keyboard.xkb_state.borrow_mut() = unsafe { xkb::State::from_raw_ptr(xkb_state_ref((*keyboard_ptr).xkb_state)) }; })); device.on_destroy.then(listener!(config_manager => move || { config_manager.on_config_changed().unsubscribe(subscription); })); let mut event_manager = KeyboardEventManager::new(Rc::downgrade(&keyboard)); unsafe { event_manager.modifiers(&mut (*keyboard_ptr).events.modifiers); event_manager.key(&mut (*keyboard_ptr).events.key); } *keyboard.event_manager.borrow_mut() = Some(event_manager); keyboard } pub fn raw_ptr(&self) -> *mut wlr_keyboard { self.keyboard } pub fn device(&self) -> Rc<Device> { self.device.clone() } pub fn xkb_state(&self) -> xkb::State { self.xkb_state.borrow().clone() } } fn set_keymap_from_config(keyboard_ptr: *mut wlr_keyboard, config: &KeyboardConfig) { // We need to prepare an XKB keymap and assign it to the keyboard. let context = xkb::Context::new(xkb::CONTEXT_NO_FLAGS); let keymap = xkb::Keymap::new_from_names( &context, &config.xkb_rules, &config.xkb_model, &config.xkb_layout, &config.xkb_variant, config.xkb_options.clone(), xkb::KEYMAP_COMPILE_NO_FLAGS, ) .expect("xkb::Keymap could not be created"); unsafe { wlr_keyboard_set_keymap(keyboard_ptr, keymap.get_raw_ptr()); wlr_keyboard_set_repeat_info( keyboard_ptr, config.repeat_rate.0 as i32, config.repeat_delay.0 as i32, ); } } pub(crate) trait KeyboardEventHandler { fn modifiers(&self); fn key(&self, event: *const wlr_event_keyboard_key); } impl KeyboardEventHandler for Keyboard { fn modifiers(&self) { unsafe { // A seat can only have one keyboard, but this is a limitation of the // Wayland protocol - not wlroots. We assign all connected keyboards to the // same seat. You can swap out the underlying wlr_keyboard like this and // wlr_seat handles this transparently. wlr_seat_set_keyboard(self.seat_manager.raw_seat(), self.device.raw_ptr()); // Send modifiers to the client. wlr_seat_keyboard_notify_modifiers( self.seat_manager.raw_seat(), &mut (*self.keyboard).modifiers, ); } } fn key(&self, event: *const wlr_event_keyboard_key) { let event = unsafe { KeyboardEvent::from_ptr(self, event) }; let handled = self.event_filter_manager.handle_keyboard_event(&event); if !handled { unsafe { // Otherwise, we pass it along to the client. wlr_seat_set_keyboard(self.seat_manager.raw_seat(), self.device.raw_ptr()); wlr_seat_keyboard_notify_key( self.seat_manager.raw_seat(), event.time_msec(), event.libinput_keycode(), event.raw_state(), ); } } } } wayland_listener!( KeyboardEventManager, Weak<Keyboard>, [ modifiers => modifiers_func: |this: &mut KeyboardEventManager, _data: *mut libc::c_void,| unsafe { if let Some(handler) = this.data.upgrade() { handler.modifiers(); } }; key => key_func: |this: &mut KeyboardEventManager, data: *mut libc::c_void,| unsafe { if let Some(handler) = this.data.upgrade() { handler.key(data as _); } }; ] ); pub struct KeyboardManager { config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, keyboards: RefCell<Vec<Rc<Keyboard>>>, } impl KeyboardManager { pub(crate) fn init( config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, ) -> Rc<KeyboardManager> { let keyboard_manager = Rc::new(KeyboardManager { config_manager, seat_manager: seat_manager.clone(), event_filter_manager, keyboards: RefCell::new(vec![]), }); seat_manager .on_new_device .subscribe(listener!(keyboard_manager => move |device| { if let DeviceType::Keyboard(_) = device.device_type() { device.on_destroy.then(listener!(device, keyboard_manager => move || { keyboard_manager .keyboards .borrow_mut() .retain(|keyboard| keyboard.device.deref() != device.deref()); keyboard_manager .seat_manager .set_has_any_keyboard(keyboard_manager.has_keyboard()); })); unsafe { wlr_seat_set_keyboard(keyboard_manager.seat_manager.raw_seat(), device.raw_ptr()); } let keyboard = Keyboard::init( keyboard_manager.config_manager.clone(), keyboard_manager.seat_manager.clone(), keyboard_manager.event_filter_manager.clone(), device.clone(), ); keyboard_manager.keyboards.borrow_mut().push(keyboard); keyboard_manager.seat_manager.set_has_any_keyboard(true); } })); keyboard_manager } pub fn has_keyboard(&self) -> bool { !self.keyboards.borrow().is_empty() } } #[cfg(test)] mod tests { use super::*; use crate::test_util::*; use std::ptr; use std::rc::Rc; #[test] fn it_drops_and_cleans_up_on_destroy() { let config_manager = Rc::new(ConfigManager::default()); let seat_manager = SeatManager::mock(ptr::null_mut(), ptr::null_mut()); let event_filter_manager = Rc::new(EventFilterManager::new()); let keyboard_manager = Rc::new(KeyboardManager::init( config_manager, seat_manager.clone(), event_filter_manager, )); let mut raw_keyboard = wlr_keyboard { impl_: ptr::null(), group: ptr::null_mut(), keymap_string: ptr::null_mut(), keymap_size: 0, keymap: ptr::null_mut(), xkb_state: ptr::null_mut(), led_indexes: [0; 3], mod_indexes: [0; 8], keycodes: [0; 32], num_keycodes: 0, modifiers: wlr_keyboard_modifiers { depressed: 0, latched: 0, locked: 0, group: 0, }, repeat_info: wlr_keyboard__bindgen_ty_1 { rate: 0, delay: 0 }, events: wlr_keyboard__bindgen_ty_2 { key: new_wl_signal(), modifiers: new_wl_signal(), keymap: new_wl_signal(), repeat_info: new_wl_signal(), destroy: new_wl_signal(), }, data: ptr::null_mut(), }; let mut device = wlr_input_device { impl_: ptr::null(), type_: wlr_input_device_type_WLR_INPUT_DEVICE_KEYBOARD, vendor: 0, product: 0, name: ptr::null_mut(), width_mm: 0.0, height_mm: 0.0, output_name: ptr::null_mut(), __bindgen_anon_1: wlr_input_device__bindgen_ty_1 { keyboard: &mut raw_keyboard, }, events: wlr_input_device__bindgen_ty_2 { destroy: new_wl_signal(), }, data: ptr::null_mut(), link: new_wl_list(), }; let key_signal = WlSignal::from_ptr(&mut raw_keyboard.events.key); let modifiers_signal = WlSignal::from_ptr(&mut raw_keyboard.events.modifiers); let keymap_signal = WlSignal::from_ptr(&mut raw_keyboard.events.keymap); let repeat_info_signal = WlSignal::from_ptr(&mut raw_keyboard.events.repeat_info); let destroy_signal = WlSignal::from_ptr(&mut device.events.destroy); let device = Device::init(&mut device); let weak_device = Rc::downgrade(&device); seat_manager.on_new_device.fire(device); let keyboard = keyboard_manager.keyboards.borrow().first().unwrap().clone(); let weak_keyboard = Rc::downgrade(&keyboard); drop(keyboard); assert!(weak_device.upgrade().is_some()); assert!(weak_keyboard.upgrade().is_some()); assert!(key_signal.listener_count() == 1); assert!(modifiers_signal.listener_count() == 1); assert!(destroy_signal.listener_count() == 1); assert!(keyboard_manager.has_keyboard()); destroy_signal.emit(); assert!(key_signal.listener_count() == 0); assert!(modifiers_signal.listener_count() == 0); assert!(keymap_signal.listener_count() == 0); assert!(repeat_info_signal.listener_count() == 0); assert!(destroy_signal.listener_count() == 0); assert!(!keyboard_manager.has_keyboard()); assert!(weak_keyboard.upgrade().is_none()); assert!(weak_device.upgrade().is_none()); } } #[cfg(test)] use xkbcommon::xkb::ffi::{xkb_keymap, xkb_state}; #[cfg(test)] unsafe fn wlr_seat_set_keyboard(_: *mut wlr_seat, _: *mut wlr_input_device) {} #[cfg(test)] unsafe fn wlr_keyboard_set_keymap(_: *mut wlr_keyboard, _: *mut xkb_keymap) {} #[cfg(test)] unsafe fn wlr_keyboard_set_repeat_info(_: *mut wlr_keyboard, _: i32, _: i32) {} #[cfg(test)] unsafe fn xkb_state_ref(ptr: *mut xkb_state) -> *mut xkb_state { ptr }
Keyboard
identifier_name
keyboard.rs
use crate::input::device::{Device, DeviceType}; use crate::input::event_filter::{EventFilter, EventFilterManager}; use crate::input::events::{InputEvent, KeyboardEvent}; use crate::{config::ConfigManager, input::seat::SeatManager}; use log::debug; use serde::{Deserialize, Serialize}; use std::cell::RefCell; use std::ops::Deref; use std::pin::Pin; use std::rc::{Rc, Weak}; use wlroots_sys::*; use xkbcommon::xkb; #[cfg(not(test))] use xkbcommon::xkb::ffi::xkb_state_ref; #[derive(Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] pub struct RepeatRate(u32); impl Default for RepeatRate { fn default() -> Self { RepeatRate(33) } } #[derive(Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] pub struct RepeatDelay(u32); impl Default for RepeatDelay { fn default() -> Self { RepeatDelay(500) } } #[derive(Default, Debug, Eq, PartialEq, Clone, Serialize, Deserialize)] #[serde(default)] pub struct KeyboardConfig { pub xkb_rules: String, pub xkb_model: String, pub xkb_layout: String, pub xkb_variant: String, pub xkb_options: Option<String>, pub repeat_rate: RepeatRate, pub repeat_delay: RepeatDelay, } pub struct Keyboard { seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, device: Rc<Device>, keyboard: *mut wlr_keyboard, xkb_state: RefCell<xkb::State>, event_manager: RefCell<Option<Pin<Box<KeyboardEventManager>>>>, } impl Keyboard { fn init( config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, device: Rc<Device>, ) -> Rc<Keyboard> { debug!("Keyboard::init: {}", device.name()); let keyboard_ptr = match device.device_type() { DeviceType::Keyboard(keyboard_ptr) => keyboard_ptr, _ => panic!("Keyboard::init expects a keyboard device"), }; let config = &config_manager.config().keyboard; set_keymap_from_config(keyboard_ptr, config); let keyboard = Rc::new(Keyboard { seat_manager, event_filter_manager, device: device.clone(), keyboard: keyboard_ptr, xkb_state: RefCell::new(unsafe { xkb::State::from_raw_ptr(xkb_state_ref((*keyboard_ptr).xkb_state)) }), event_manager: RefCell::new(None), }); let subscription = config_manager .on_config_changed() .subscribe(listener!(keyboard => move |config| { set_keymap_from_config(keyboard.raw_ptr(), &config.keyboard); *keyboard.xkb_state.borrow_mut() = unsafe { xkb::State::from_raw_ptr(xkb_state_ref((*keyboard_ptr).xkb_state)) }; })); device.on_destroy.then(listener!(config_manager => move || { config_manager.on_config_changed().unsubscribe(subscription); })); let mut event_manager = KeyboardEventManager::new(Rc::downgrade(&keyboard)); unsafe { event_manager.modifiers(&mut (*keyboard_ptr).events.modifiers); event_manager.key(&mut (*keyboard_ptr).events.key); } *keyboard.event_manager.borrow_mut() = Some(event_manager); keyboard } pub fn raw_ptr(&self) -> *mut wlr_keyboard { self.keyboard } pub fn device(&self) -> Rc<Device> { self.device.clone() } pub fn xkb_state(&self) -> xkb::State { self.xkb_state.borrow().clone() } } fn set_keymap_from_config(keyboard_ptr: *mut wlr_keyboard, config: &KeyboardConfig) { // We need to prepare an XKB keymap and assign it to the keyboard. let context = xkb::Context::new(xkb::CONTEXT_NO_FLAGS); let keymap = xkb::Keymap::new_from_names( &context, &config.xkb_rules, &config.xkb_model, &config.xkb_layout, &config.xkb_variant, config.xkb_options.clone(), xkb::KEYMAP_COMPILE_NO_FLAGS, ) .expect("xkb::Keymap could not be created"); unsafe { wlr_keyboard_set_keymap(keyboard_ptr, keymap.get_raw_ptr()); wlr_keyboard_set_repeat_info( keyboard_ptr, config.repeat_rate.0 as i32,
} } pub(crate) trait KeyboardEventHandler { fn modifiers(&self); fn key(&self, event: *const wlr_event_keyboard_key); } impl KeyboardEventHandler for Keyboard { fn modifiers(&self) { unsafe { // A seat can only have one keyboard, but this is a limitation of the // Wayland protocol - not wlroots. We assign all connected keyboards to the // same seat. You can swap out the underlying wlr_keyboard like this and // wlr_seat handles this transparently. wlr_seat_set_keyboard(self.seat_manager.raw_seat(), self.device.raw_ptr()); // Send modifiers to the client. wlr_seat_keyboard_notify_modifiers( self.seat_manager.raw_seat(), &mut (*self.keyboard).modifiers, ); } } fn key(&self, event: *const wlr_event_keyboard_key) { let event = unsafe { KeyboardEvent::from_ptr(self, event) }; let handled = self.event_filter_manager.handle_keyboard_event(&event); if !handled { unsafe { // Otherwise, we pass it along to the client. wlr_seat_set_keyboard(self.seat_manager.raw_seat(), self.device.raw_ptr()); wlr_seat_keyboard_notify_key( self.seat_manager.raw_seat(), event.time_msec(), event.libinput_keycode(), event.raw_state(), ); } } } } wayland_listener!( KeyboardEventManager, Weak<Keyboard>, [ modifiers => modifiers_func: |this: &mut KeyboardEventManager, _data: *mut libc::c_void,| unsafe { if let Some(handler) = this.data.upgrade() { handler.modifiers(); } }; key => key_func: |this: &mut KeyboardEventManager, data: *mut libc::c_void,| unsafe { if let Some(handler) = this.data.upgrade() { handler.key(data as _); } }; ] ); pub struct KeyboardManager { config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, keyboards: RefCell<Vec<Rc<Keyboard>>>, } impl KeyboardManager { pub(crate) fn init( config_manager: Rc<ConfigManager>, seat_manager: Rc<SeatManager>, event_filter_manager: Rc<EventFilterManager>, ) -> Rc<KeyboardManager> { let keyboard_manager = Rc::new(KeyboardManager { config_manager, seat_manager: seat_manager.clone(), event_filter_manager, keyboards: RefCell::new(vec![]), }); seat_manager .on_new_device .subscribe(listener!(keyboard_manager => move |device| { if let DeviceType::Keyboard(_) = device.device_type() { device.on_destroy.then(listener!(device, keyboard_manager => move || { keyboard_manager .keyboards .borrow_mut() .retain(|keyboard| keyboard.device.deref() != device.deref()); keyboard_manager .seat_manager .set_has_any_keyboard(keyboard_manager.has_keyboard()); })); unsafe { wlr_seat_set_keyboard(keyboard_manager.seat_manager.raw_seat(), device.raw_ptr()); } let keyboard = Keyboard::init( keyboard_manager.config_manager.clone(), keyboard_manager.seat_manager.clone(), keyboard_manager.event_filter_manager.clone(), device.clone(), ); keyboard_manager.keyboards.borrow_mut().push(keyboard); keyboard_manager.seat_manager.set_has_any_keyboard(true); } })); keyboard_manager } pub fn has_keyboard(&self) -> bool { !self.keyboards.borrow().is_empty() } } #[cfg(test)] mod tests { use super::*; use crate::test_util::*; use std::ptr; use std::rc::Rc; #[test] fn it_drops_and_cleans_up_on_destroy() { let config_manager = Rc::new(ConfigManager::default()); let seat_manager = SeatManager::mock(ptr::null_mut(), ptr::null_mut()); let event_filter_manager = Rc::new(EventFilterManager::new()); let keyboard_manager = Rc::new(KeyboardManager::init( config_manager, seat_manager.clone(), event_filter_manager, )); let mut raw_keyboard = wlr_keyboard { impl_: ptr::null(), group: ptr::null_mut(), keymap_string: ptr::null_mut(), keymap_size: 0, keymap: ptr::null_mut(), xkb_state: ptr::null_mut(), led_indexes: [0; 3], mod_indexes: [0; 8], keycodes: [0; 32], num_keycodes: 0, modifiers: wlr_keyboard_modifiers { depressed: 0, latched: 0, locked: 0, group: 0, }, repeat_info: wlr_keyboard__bindgen_ty_1 { rate: 0, delay: 0 }, events: wlr_keyboard__bindgen_ty_2 { key: new_wl_signal(), modifiers: new_wl_signal(), keymap: new_wl_signal(), repeat_info: new_wl_signal(), destroy: new_wl_signal(), }, data: ptr::null_mut(), }; let mut device = wlr_input_device { impl_: ptr::null(), type_: wlr_input_device_type_WLR_INPUT_DEVICE_KEYBOARD, vendor: 0, product: 0, name: ptr::null_mut(), width_mm: 0.0, height_mm: 0.0, output_name: ptr::null_mut(), __bindgen_anon_1: wlr_input_device__bindgen_ty_1 { keyboard: &mut raw_keyboard, }, events: wlr_input_device__bindgen_ty_2 { destroy: new_wl_signal(), }, data: ptr::null_mut(), link: new_wl_list(), }; let key_signal = WlSignal::from_ptr(&mut raw_keyboard.events.key); let modifiers_signal = WlSignal::from_ptr(&mut raw_keyboard.events.modifiers); let keymap_signal = WlSignal::from_ptr(&mut raw_keyboard.events.keymap); let repeat_info_signal = WlSignal::from_ptr(&mut raw_keyboard.events.repeat_info); let destroy_signal = WlSignal::from_ptr(&mut device.events.destroy); let device = Device::init(&mut device); let weak_device = Rc::downgrade(&device); seat_manager.on_new_device.fire(device); let keyboard = keyboard_manager.keyboards.borrow().first().unwrap().clone(); let weak_keyboard = Rc::downgrade(&keyboard); drop(keyboard); assert!(weak_device.upgrade().is_some()); assert!(weak_keyboard.upgrade().is_some()); assert!(key_signal.listener_count() == 1); assert!(modifiers_signal.listener_count() == 1); assert!(destroy_signal.listener_count() == 1); assert!(keyboard_manager.has_keyboard()); destroy_signal.emit(); assert!(key_signal.listener_count() == 0); assert!(modifiers_signal.listener_count() == 0); assert!(keymap_signal.listener_count() == 0); assert!(repeat_info_signal.listener_count() == 0); assert!(destroy_signal.listener_count() == 0); assert!(!keyboard_manager.has_keyboard()); assert!(weak_keyboard.upgrade().is_none()); assert!(weak_device.upgrade().is_none()); } } #[cfg(test)] use xkbcommon::xkb::ffi::{xkb_keymap, xkb_state}; #[cfg(test)] unsafe fn wlr_seat_set_keyboard(_: *mut wlr_seat, _: *mut wlr_input_device) {} #[cfg(test)] unsafe fn wlr_keyboard_set_keymap(_: *mut wlr_keyboard, _: *mut xkb_keymap) {} #[cfg(test)] unsafe fn wlr_keyboard_set_repeat_info(_: *mut wlr_keyboard, _: i32, _: i32) {} #[cfg(test)] unsafe fn xkb_state_ref(ptr: *mut xkb_state) -> *mut xkb_state { ptr }
config.repeat_delay.0 as i32, );
random_line_split
quic.rs
use { crossbeam_channel::Sender, futures_util::stream::StreamExt, pem::Pem, pkcs8::{der::Document, AlgorithmIdentifier, ObjectIdentifier}, quinn::{Endpoint, EndpointConfig, ServerConfig}, rcgen::{CertificateParams, DistinguishedName, DnType, SanType}, solana_perf::packet::PacketBatch, solana_sdk::{ packet::{Packet, PACKET_DATA_SIZE}, signature::Keypair, }, std::{ error::Error, net::{IpAddr, SocketAddr, UdpSocket}, sync::{ atomic::{AtomicBool, Ordering}, Arc, }, thread, time::Duration, }, tokio::{ runtime::{Builder, Runtime}, time::timeout, }, }; /// Returns default server configuration along with its PEM certificate chain. #[allow(clippy::field_reassign_with_default)] // https://github.com/rust-lang/rust-clippy/issues/6527 fn configure_server( identity_keypair: &Keypair, gossip_host: IpAddr, ) -> Result<(ServerConfig, String), QuicServerError> { let (cert_chain, priv_key) = new_cert(identity_keypair, gossip_host).map_err(|_e| QuicServerError::ConfigureFailed)?; let cert_chain_pem_parts: Vec<Pem> = cert_chain .iter() .map(|cert| Pem { tag: "CERTIFICATE".to_string(), contents: cert.0.clone(), }) .collect(); let cert_chain_pem = pem::encode_many(&cert_chain_pem_parts); let mut server_config = ServerConfig::with_single_cert(cert_chain, priv_key) .map_err(|_e| QuicServerError::ConfigureFailed)?; let config = Arc::get_mut(&mut server_config.transport).unwrap(); const MAX_CONCURRENT_UNI_STREAMS: u32 = 1; config.max_concurrent_uni_streams(MAX_CONCURRENT_UNI_STREAMS.into()); config.stream_receive_window((PACKET_DATA_SIZE as u32).into()); config.receive_window((PACKET_DATA_SIZE as u32 * MAX_CONCURRENT_UNI_STREAMS).into()); // disable bidi & datagrams const MAX_CONCURRENT_BIDI_STREAMS: u32 = 0; config.max_concurrent_bidi_streams(MAX_CONCURRENT_BIDI_STREAMS.into()); config.datagram_receive_buffer_size(None); Ok((server_config, cert_chain_pem)) } fn new_cert( identity_keypair: &Keypair, san: IpAddr, ) -> Result<(Vec<rustls::Certificate>, rustls::PrivateKey), Box<dyn Error>> { // Generate a self-signed cert from validator identity key let cert_params = new_cert_params(identity_keypair, san); let cert = rcgen::Certificate::from_params(cert_params)?; let cert_der = cert.serialize_der().unwrap(); let priv_key = cert.serialize_private_key_der(); let priv_key = rustls::PrivateKey(priv_key); let cert_chain = vec![rustls::Certificate(cert_der)]; Ok((cert_chain, priv_key)) } fn convert_to_rcgen_keypair(identity_keypair: &Keypair) -> rcgen::KeyPair { // from https://datatracker.ietf.org/doc/html/rfc8410#section-3 const ED25519_IDENTIFIER: [u32; 4] = [1, 3, 101, 112]; let mut private_key = Vec::<u8>::with_capacity(34); private_key.extend_from_slice(&[0x04, 0x20]); // ASN.1 OCTET STRING private_key.extend_from_slice(identity_keypair.secret().as_bytes()); let key_pkcs8 = pkcs8::PrivateKeyInfo { algorithm: AlgorithmIdentifier { oid: ObjectIdentifier::from_arcs(&ED25519_IDENTIFIER).unwrap(), parameters: None, }, private_key: &private_key, public_key: None, }; let key_pkcs8_der = key_pkcs8 .to_der() .expect("Failed to convert keypair to DER") .to_der(); // Parse private key into rcgen::KeyPair struct. rcgen::KeyPair::from_der(&key_pkcs8_der).expect("Failed to parse keypair from DER") } fn new_cert_params(identity_keypair: &Keypair, san: IpAddr) -> CertificateParams { // TODO(terorie): Is it safe to sign the TLS cert with the identity private key? // Unfortunately, rcgen does not accept a "raw" Ed25519 key. // We have to convert it to DER and pass it to the library. // Convert private key into PKCS#8 v1 object. // RFC 8410, Section 7: Private Key Format // https://datatracker.ietf.org/doc/html/rfc8410#section- let keypair = convert_to_rcgen_keypair(identity_keypair); let mut cert_params = CertificateParams::default(); cert_params.subject_alt_names = vec![SanType::IpAddress(san)]; cert_params.alg = &rcgen::PKCS_ED25519; cert_params.key_pair = Some(keypair); cert_params.distinguished_name = DistinguishedName::new(); cert_params .distinguished_name .push(DnType::CommonName, "Solana node"); cert_params } pub fn rt() -> Runtime { Builder::new_current_thread().enable_all().build().unwrap() } #[derive(thiserror::Error, Debug)] pub enum
{ #[error("Server configure failed")] ConfigureFailed, #[error("Endpoint creation failed")] EndpointFailed, } // Return true if the server should drop the stream fn handle_chunk( chunk: &Result<Option<quinn::Chunk>, quinn::ReadError>, maybe_batch: &mut Option<PacketBatch>, remote_addr: &SocketAddr, packet_sender: &Sender<PacketBatch>, ) -> bool { match chunk { Ok(maybe_chunk) => { if let Some(chunk) = maybe_chunk { trace!("got chunk: {:?}", chunk); let chunk_len = chunk.bytes.len() as u64; // shouldn't happen, but sanity check the size and offsets if chunk.offset > PACKET_DATA_SIZE as u64 || chunk_len > PACKET_DATA_SIZE as u64 { return true; } if chunk.offset + chunk_len > PACKET_DATA_SIZE as u64 { return true; } // chunk looks valid if maybe_batch.is_none() { let mut batch = PacketBatch::with_capacity(1); let mut packet = Packet::default(); packet.meta.set_addr(remote_addr); batch.packets.push(packet); *maybe_batch = Some(batch); } if let Some(batch) = maybe_batch.as_mut() { let end = chunk.offset as usize + chunk.bytes.len(); batch.packets[0].data[chunk.offset as usize..end].copy_from_slice(&chunk.bytes); batch.packets[0].meta.size = std::cmp::max(batch.packets[0].meta.size, end); } } else { trace!("chunk is none"); // done receiving chunks if let Some(batch) = maybe_batch.take() { let len = batch.packets[0].meta.size; if let Err(e) = packet_sender.send(batch) { info!("send error: {}", e); } else { trace!("sent {} byte packet", len); } } return true; } } Err(e) => { debug!("Received stream error: {:?}", e); return true; } } false } pub fn spawn_server( sock: UdpSocket, keypair: &Keypair, gossip_host: IpAddr, packet_sender: Sender<PacketBatch>, exit: Arc<AtomicBool>, ) -> Result<thread::JoinHandle<()>, QuicServerError> { let (config, _cert) = configure_server(keypair, gossip_host)?; let runtime = rt(); let (_, mut incoming) = { let _guard = runtime.enter(); Endpoint::new(EndpointConfig::default(), Some(config), sock) .map_err(|_e| QuicServerError::EndpointFailed)? }; let handle = thread::spawn(move || { let handle = runtime.spawn(async move { while !exit.load(Ordering::Relaxed) { const WAIT_FOR_CONNECTION_TIMEOUT_MS: u64 = 1000; let timeout_connection = timeout( Duration::from_millis(WAIT_FOR_CONNECTION_TIMEOUT_MS), incoming.next(), ) .await; if let Ok(Some(connection)) = timeout_connection { if let Ok(new_connection) = connection.await { let exit = exit.clone(); let quinn::NewConnection { connection, mut uni_streams, .. } = new_connection; let remote_addr = connection.remote_address(); let packet_sender = packet_sender.clone(); tokio::spawn(async move { debug!("new connection {}", remote_addr); while let Some(Ok(mut stream)) = uni_streams.next().await { let mut maybe_batch = None; while !exit.load(Ordering::Relaxed) { if handle_chunk( &stream.read_chunk(PACKET_DATA_SIZE, false).await, &mut maybe_batch, &remote_addr, &packet_sender, ) { break; } } } }); } } } }); if let Err(e) = runtime.block_on(handle) { warn!("error from runtime.block_on: {:?}", e); } }); Ok(handle) } #[cfg(test)] mod test { use { super::*, crossbeam_channel::unbounded, quinn::{ClientConfig, NewConnection}, std::{net::SocketAddr, time::Instant}, }; struct SkipServerVerification; impl SkipServerVerification { fn new() -> Arc<Self> { Arc::new(Self) } } impl rustls::client::ServerCertVerifier for SkipServerVerification { fn verify_server_cert( &self, _end_entity: &rustls::Certificate, _intermediates: &[rustls::Certificate], _server_name: &rustls::ServerName, _scts: &mut dyn Iterator<Item = &[u8]>, _ocsp_response: &[u8], _now: std::time::SystemTime, ) -> Result<rustls::client::ServerCertVerified, rustls::Error> { Ok(rustls::client::ServerCertVerified::assertion()) } } pub fn get_client_config() -> quinn::ClientConfig { let crypto = rustls::ClientConfig::builder() .with_safe_defaults() .with_custom_certificate_verifier(SkipServerVerification::new()) .with_no_client_auth(); ClientConfig::new(Arc::new(crypto)) } #[test] fn test_quic_server_exit() { let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, _receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } fn make_client_endpoint(runtime: &Runtime, addr: &SocketAddr) -> NewConnection { let client_socket = UdpSocket::bind("127.0.0.1:0").unwrap(); let mut endpoint = quinn::Endpoint::new(EndpointConfig::default(), None, client_socket) .unwrap() .0; endpoint.set_default_client_config(get_client_config()); runtime .block_on(endpoint.connect(*addr, "localhost").unwrap()) .unwrap() } #[test] fn test_quic_server_multiple_streams() { solana_logger::setup(); let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let server_address = s.local_addr().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); let runtime = rt(); let _rt_guard = runtime.enter(); let conn1 = Arc::new(make_client_endpoint(&runtime, &server_address)); let conn2 = Arc::new(make_client_endpoint(&runtime, &server_address)); let mut num_expected_packets = 0; for i in 0..10 { info!("sending: {}", i); let c1 = conn1.clone(); let c2 = conn2.clone(); let handle = runtime.spawn(async move { let mut s1 = c1.connection.open_uni().await.unwrap(); let mut s2 = c2.connection.open_uni().await.unwrap(); s1.write_all(&[0u8]).await.unwrap(); s1.finish().await.unwrap(); s2.write_all(&[0u8]).await.unwrap(); s2.finish().await.unwrap(); }); runtime.block_on(handle).unwrap(); num_expected_packets += 2; thread::sleep(Duration::from_millis(200)); } let mut all_packets = vec![]; let now = Instant::now(); let mut total_packets = 0; while now.elapsed().as_secs() < 10 { if let Ok(packets) = receiver.recv_timeout(Duration::from_secs(1)) { total_packets += packets.packets.len(); all_packets.push(packets) } if total_packets == num_expected_packets { break; } } for batch in all_packets { for p in &batch.packets { assert_eq!(p.meta.size, 1); } } assert_eq!(total_packets, num_expected_packets); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } #[test] fn test_quic_server_multiple_writes() { solana_logger::setup(); let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let server_address = s.local_addr().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); let runtime = rt(); let _rt_guard = runtime.enter(); let conn1 = Arc::new(make_client_endpoint(&runtime, &server_address)); // Send a full size packet with single byte writes. let num_bytes = PACKET_DATA_SIZE; let num_expected_packets = 1; let handle = runtime.spawn(async move { let mut s1 = conn1.connection.open_uni().await.unwrap(); for _ in 0..num_bytes { s1.write_all(&[0u8]).await.unwrap(); } s1.finish().await.unwrap(); }); runtime.block_on(handle).unwrap(); let mut all_packets = vec![]; let now = Instant::now(); let mut total_packets = 0; while now.elapsed().as_secs() < 5 { if let Ok(packets) = receiver.recv_timeout(Duration::from_secs(1)) { total_packets += packets.packets.len(); all_packets.push(packets) } if total_packets > num_expected_packets { break; } } for batch in all_packets { for p in &batch.packets { assert_eq!(p.meta.size, num_bytes); } } assert_eq!(total_packets, num_expected_packets); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } }
QuicServerError
identifier_name
quic.rs
use { crossbeam_channel::Sender, futures_util::stream::StreamExt, pem::Pem, pkcs8::{der::Document, AlgorithmIdentifier, ObjectIdentifier}, quinn::{Endpoint, EndpointConfig, ServerConfig}, rcgen::{CertificateParams, DistinguishedName, DnType, SanType}, solana_perf::packet::PacketBatch, solana_sdk::{ packet::{Packet, PACKET_DATA_SIZE}, signature::Keypair, }, std::{ error::Error, net::{IpAddr, SocketAddr, UdpSocket}, sync::{ atomic::{AtomicBool, Ordering}, Arc, }, thread, time::Duration, }, tokio::{ runtime::{Builder, Runtime}, time::timeout, }, }; /// Returns default server configuration along with its PEM certificate chain. #[allow(clippy::field_reassign_with_default)] // https://github.com/rust-lang/rust-clippy/issues/6527 fn configure_server( identity_keypair: &Keypair, gossip_host: IpAddr, ) -> Result<(ServerConfig, String), QuicServerError> { let (cert_chain, priv_key) =
contents: cert.0.clone(), }) .collect(); let cert_chain_pem = pem::encode_many(&cert_chain_pem_parts); let mut server_config = ServerConfig::with_single_cert(cert_chain, priv_key) .map_err(|_e| QuicServerError::ConfigureFailed)?; let config = Arc::get_mut(&mut server_config.transport).unwrap(); const MAX_CONCURRENT_UNI_STREAMS: u32 = 1; config.max_concurrent_uni_streams(MAX_CONCURRENT_UNI_STREAMS.into()); config.stream_receive_window((PACKET_DATA_SIZE as u32).into()); config.receive_window((PACKET_DATA_SIZE as u32 * MAX_CONCURRENT_UNI_STREAMS).into()); // disable bidi & datagrams const MAX_CONCURRENT_BIDI_STREAMS: u32 = 0; config.max_concurrent_bidi_streams(MAX_CONCURRENT_BIDI_STREAMS.into()); config.datagram_receive_buffer_size(None); Ok((server_config, cert_chain_pem)) } fn new_cert( identity_keypair: &Keypair, san: IpAddr, ) -> Result<(Vec<rustls::Certificate>, rustls::PrivateKey), Box<dyn Error>> { // Generate a self-signed cert from validator identity key let cert_params = new_cert_params(identity_keypair, san); let cert = rcgen::Certificate::from_params(cert_params)?; let cert_der = cert.serialize_der().unwrap(); let priv_key = cert.serialize_private_key_der(); let priv_key = rustls::PrivateKey(priv_key); let cert_chain = vec![rustls::Certificate(cert_der)]; Ok((cert_chain, priv_key)) } fn convert_to_rcgen_keypair(identity_keypair: &Keypair) -> rcgen::KeyPair { // from https://datatracker.ietf.org/doc/html/rfc8410#section-3 const ED25519_IDENTIFIER: [u32; 4] = [1, 3, 101, 112]; let mut private_key = Vec::<u8>::with_capacity(34); private_key.extend_from_slice(&[0x04, 0x20]); // ASN.1 OCTET STRING private_key.extend_from_slice(identity_keypair.secret().as_bytes()); let key_pkcs8 = pkcs8::PrivateKeyInfo { algorithm: AlgorithmIdentifier { oid: ObjectIdentifier::from_arcs(&ED25519_IDENTIFIER).unwrap(), parameters: None, }, private_key: &private_key, public_key: None, }; let key_pkcs8_der = key_pkcs8 .to_der() .expect("Failed to convert keypair to DER") .to_der(); // Parse private key into rcgen::KeyPair struct. rcgen::KeyPair::from_der(&key_pkcs8_der).expect("Failed to parse keypair from DER") } fn new_cert_params(identity_keypair: &Keypair, san: IpAddr) -> CertificateParams { // TODO(terorie): Is it safe to sign the TLS cert with the identity private key? // Unfortunately, rcgen does not accept a "raw" Ed25519 key. // We have to convert it to DER and pass it to the library. // Convert private key into PKCS#8 v1 object. // RFC 8410, Section 7: Private Key Format // https://datatracker.ietf.org/doc/html/rfc8410#section- let keypair = convert_to_rcgen_keypair(identity_keypair); let mut cert_params = CertificateParams::default(); cert_params.subject_alt_names = vec![SanType::IpAddress(san)]; cert_params.alg = &rcgen::PKCS_ED25519; cert_params.key_pair = Some(keypair); cert_params.distinguished_name = DistinguishedName::new(); cert_params .distinguished_name .push(DnType::CommonName, "Solana node"); cert_params } pub fn rt() -> Runtime { Builder::new_current_thread().enable_all().build().unwrap() } #[derive(thiserror::Error, Debug)] pub enum QuicServerError { #[error("Server configure failed")] ConfigureFailed, #[error("Endpoint creation failed")] EndpointFailed, } // Return true if the server should drop the stream fn handle_chunk( chunk: &Result<Option<quinn::Chunk>, quinn::ReadError>, maybe_batch: &mut Option<PacketBatch>, remote_addr: &SocketAddr, packet_sender: &Sender<PacketBatch>, ) -> bool { match chunk { Ok(maybe_chunk) => { if let Some(chunk) = maybe_chunk { trace!("got chunk: {:?}", chunk); let chunk_len = chunk.bytes.len() as u64; // shouldn't happen, but sanity check the size and offsets if chunk.offset > PACKET_DATA_SIZE as u64 || chunk_len > PACKET_DATA_SIZE as u64 { return true; } if chunk.offset + chunk_len > PACKET_DATA_SIZE as u64 { return true; } // chunk looks valid if maybe_batch.is_none() { let mut batch = PacketBatch::with_capacity(1); let mut packet = Packet::default(); packet.meta.set_addr(remote_addr); batch.packets.push(packet); *maybe_batch = Some(batch); } if let Some(batch) = maybe_batch.as_mut() { let end = chunk.offset as usize + chunk.bytes.len(); batch.packets[0].data[chunk.offset as usize..end].copy_from_slice(&chunk.bytes); batch.packets[0].meta.size = std::cmp::max(batch.packets[0].meta.size, end); } } else { trace!("chunk is none"); // done receiving chunks if let Some(batch) = maybe_batch.take() { let len = batch.packets[0].meta.size; if let Err(e) = packet_sender.send(batch) { info!("send error: {}", e); } else { trace!("sent {} byte packet", len); } } return true; } } Err(e) => { debug!("Received stream error: {:?}", e); return true; } } false } pub fn spawn_server( sock: UdpSocket, keypair: &Keypair, gossip_host: IpAddr, packet_sender: Sender<PacketBatch>, exit: Arc<AtomicBool>, ) -> Result<thread::JoinHandle<()>, QuicServerError> { let (config, _cert) = configure_server(keypair, gossip_host)?; let runtime = rt(); let (_, mut incoming) = { let _guard = runtime.enter(); Endpoint::new(EndpointConfig::default(), Some(config), sock) .map_err(|_e| QuicServerError::EndpointFailed)? }; let handle = thread::spawn(move || { let handle = runtime.spawn(async move { while !exit.load(Ordering::Relaxed) { const WAIT_FOR_CONNECTION_TIMEOUT_MS: u64 = 1000; let timeout_connection = timeout( Duration::from_millis(WAIT_FOR_CONNECTION_TIMEOUT_MS), incoming.next(), ) .await; if let Ok(Some(connection)) = timeout_connection { if let Ok(new_connection) = connection.await { let exit = exit.clone(); let quinn::NewConnection { connection, mut uni_streams, .. } = new_connection; let remote_addr = connection.remote_address(); let packet_sender = packet_sender.clone(); tokio::spawn(async move { debug!("new connection {}", remote_addr); while let Some(Ok(mut stream)) = uni_streams.next().await { let mut maybe_batch = None; while !exit.load(Ordering::Relaxed) { if handle_chunk( &stream.read_chunk(PACKET_DATA_SIZE, false).await, &mut maybe_batch, &remote_addr, &packet_sender, ) { break; } } } }); } } } }); if let Err(e) = runtime.block_on(handle) { warn!("error from runtime.block_on: {:?}", e); } }); Ok(handle) } #[cfg(test)] mod test { use { super::*, crossbeam_channel::unbounded, quinn::{ClientConfig, NewConnection}, std::{net::SocketAddr, time::Instant}, }; struct SkipServerVerification; impl SkipServerVerification { fn new() -> Arc<Self> { Arc::new(Self) } } impl rustls::client::ServerCertVerifier for SkipServerVerification { fn verify_server_cert( &self, _end_entity: &rustls::Certificate, _intermediates: &[rustls::Certificate], _server_name: &rustls::ServerName, _scts: &mut dyn Iterator<Item = &[u8]>, _ocsp_response: &[u8], _now: std::time::SystemTime, ) -> Result<rustls::client::ServerCertVerified, rustls::Error> { Ok(rustls::client::ServerCertVerified::assertion()) } } pub fn get_client_config() -> quinn::ClientConfig { let crypto = rustls::ClientConfig::builder() .with_safe_defaults() .with_custom_certificate_verifier(SkipServerVerification::new()) .with_no_client_auth(); ClientConfig::new(Arc::new(crypto)) } #[test] fn test_quic_server_exit() { let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, _receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } fn make_client_endpoint(runtime: &Runtime, addr: &SocketAddr) -> NewConnection { let client_socket = UdpSocket::bind("127.0.0.1:0").unwrap(); let mut endpoint = quinn::Endpoint::new(EndpointConfig::default(), None, client_socket) .unwrap() .0; endpoint.set_default_client_config(get_client_config()); runtime .block_on(endpoint.connect(*addr, "localhost").unwrap()) .unwrap() } #[test] fn test_quic_server_multiple_streams() { solana_logger::setup(); let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let server_address = s.local_addr().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); let runtime = rt(); let _rt_guard = runtime.enter(); let conn1 = Arc::new(make_client_endpoint(&runtime, &server_address)); let conn2 = Arc::new(make_client_endpoint(&runtime, &server_address)); let mut num_expected_packets = 0; for i in 0..10 { info!("sending: {}", i); let c1 = conn1.clone(); let c2 = conn2.clone(); let handle = runtime.spawn(async move { let mut s1 = c1.connection.open_uni().await.unwrap(); let mut s2 = c2.connection.open_uni().await.unwrap(); s1.write_all(&[0u8]).await.unwrap(); s1.finish().await.unwrap(); s2.write_all(&[0u8]).await.unwrap(); s2.finish().await.unwrap(); }); runtime.block_on(handle).unwrap(); num_expected_packets += 2; thread::sleep(Duration::from_millis(200)); } let mut all_packets = vec![]; let now = Instant::now(); let mut total_packets = 0; while now.elapsed().as_secs() < 10 { if let Ok(packets) = receiver.recv_timeout(Duration::from_secs(1)) { total_packets += packets.packets.len(); all_packets.push(packets) } if total_packets == num_expected_packets { break; } } for batch in all_packets { for p in &batch.packets { assert_eq!(p.meta.size, 1); } } assert_eq!(total_packets, num_expected_packets); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } #[test] fn test_quic_server_multiple_writes() { solana_logger::setup(); let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let server_address = s.local_addr().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); let runtime = rt(); let _rt_guard = runtime.enter(); let conn1 = Arc::new(make_client_endpoint(&runtime, &server_address)); // Send a full size packet with single byte writes. let num_bytes = PACKET_DATA_SIZE; let num_expected_packets = 1; let handle = runtime.spawn(async move { let mut s1 = conn1.connection.open_uni().await.unwrap(); for _ in 0..num_bytes { s1.write_all(&[0u8]).await.unwrap(); } s1.finish().await.unwrap(); }); runtime.block_on(handle).unwrap(); let mut all_packets = vec![]; let now = Instant::now(); let mut total_packets = 0; while now.elapsed().as_secs() < 5 { if let Ok(packets) = receiver.recv_timeout(Duration::from_secs(1)) { total_packets += packets.packets.len(); all_packets.push(packets) } if total_packets > num_expected_packets { break; } } for batch in all_packets { for p in &batch.packets { assert_eq!(p.meta.size, num_bytes); } } assert_eq!(total_packets, num_expected_packets); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } }
new_cert(identity_keypair, gossip_host).map_err(|_e| QuicServerError::ConfigureFailed)?; let cert_chain_pem_parts: Vec<Pem> = cert_chain .iter() .map(|cert| Pem { tag: "CERTIFICATE".to_string(),
random_line_split
quic.rs
use { crossbeam_channel::Sender, futures_util::stream::StreamExt, pem::Pem, pkcs8::{der::Document, AlgorithmIdentifier, ObjectIdentifier}, quinn::{Endpoint, EndpointConfig, ServerConfig}, rcgen::{CertificateParams, DistinguishedName, DnType, SanType}, solana_perf::packet::PacketBatch, solana_sdk::{ packet::{Packet, PACKET_DATA_SIZE}, signature::Keypair, }, std::{ error::Error, net::{IpAddr, SocketAddr, UdpSocket}, sync::{ atomic::{AtomicBool, Ordering}, Arc, }, thread, time::Duration, }, tokio::{ runtime::{Builder, Runtime}, time::timeout, }, }; /// Returns default server configuration along with its PEM certificate chain. #[allow(clippy::field_reassign_with_default)] // https://github.com/rust-lang/rust-clippy/issues/6527 fn configure_server( identity_keypair: &Keypair, gossip_host: IpAddr, ) -> Result<(ServerConfig, String), QuicServerError> { let (cert_chain, priv_key) = new_cert(identity_keypair, gossip_host).map_err(|_e| QuicServerError::ConfigureFailed)?; let cert_chain_pem_parts: Vec<Pem> = cert_chain .iter() .map(|cert| Pem { tag: "CERTIFICATE".to_string(), contents: cert.0.clone(), }) .collect(); let cert_chain_pem = pem::encode_many(&cert_chain_pem_parts); let mut server_config = ServerConfig::with_single_cert(cert_chain, priv_key) .map_err(|_e| QuicServerError::ConfigureFailed)?; let config = Arc::get_mut(&mut server_config.transport).unwrap(); const MAX_CONCURRENT_UNI_STREAMS: u32 = 1; config.max_concurrent_uni_streams(MAX_CONCURRENT_UNI_STREAMS.into()); config.stream_receive_window((PACKET_DATA_SIZE as u32).into()); config.receive_window((PACKET_DATA_SIZE as u32 * MAX_CONCURRENT_UNI_STREAMS).into()); // disable bidi & datagrams const MAX_CONCURRENT_BIDI_STREAMS: u32 = 0; config.max_concurrent_bidi_streams(MAX_CONCURRENT_BIDI_STREAMS.into()); config.datagram_receive_buffer_size(None); Ok((server_config, cert_chain_pem)) } fn new_cert( identity_keypair: &Keypair, san: IpAddr, ) -> Result<(Vec<rustls::Certificate>, rustls::PrivateKey), Box<dyn Error>> { // Generate a self-signed cert from validator identity key let cert_params = new_cert_params(identity_keypair, san); let cert = rcgen::Certificate::from_params(cert_params)?; let cert_der = cert.serialize_der().unwrap(); let priv_key = cert.serialize_private_key_der(); let priv_key = rustls::PrivateKey(priv_key); let cert_chain = vec![rustls::Certificate(cert_der)]; Ok((cert_chain, priv_key)) } fn convert_to_rcgen_keypair(identity_keypair: &Keypair) -> rcgen::KeyPair { // from https://datatracker.ietf.org/doc/html/rfc8410#section-3 const ED25519_IDENTIFIER: [u32; 4] = [1, 3, 101, 112]; let mut private_key = Vec::<u8>::with_capacity(34); private_key.extend_from_slice(&[0x04, 0x20]); // ASN.1 OCTET STRING private_key.extend_from_slice(identity_keypair.secret().as_bytes()); let key_pkcs8 = pkcs8::PrivateKeyInfo { algorithm: AlgorithmIdentifier { oid: ObjectIdentifier::from_arcs(&ED25519_IDENTIFIER).unwrap(), parameters: None, }, private_key: &private_key, public_key: None, }; let key_pkcs8_der = key_pkcs8 .to_der() .expect("Failed to convert keypair to DER") .to_der(); // Parse private key into rcgen::KeyPair struct. rcgen::KeyPair::from_der(&key_pkcs8_der).expect("Failed to parse keypair from DER") } fn new_cert_params(identity_keypair: &Keypair, san: IpAddr) -> CertificateParams { // TODO(terorie): Is it safe to sign the TLS cert with the identity private key? // Unfortunately, rcgen does not accept a "raw" Ed25519 key. // We have to convert it to DER and pass it to the library. // Convert private key into PKCS#8 v1 object. // RFC 8410, Section 7: Private Key Format // https://datatracker.ietf.org/doc/html/rfc8410#section- let keypair = convert_to_rcgen_keypair(identity_keypair); let mut cert_params = CertificateParams::default(); cert_params.subject_alt_names = vec![SanType::IpAddress(san)]; cert_params.alg = &rcgen::PKCS_ED25519; cert_params.key_pair = Some(keypair); cert_params.distinguished_name = DistinguishedName::new(); cert_params .distinguished_name .push(DnType::CommonName, "Solana node"); cert_params } pub fn rt() -> Runtime { Builder::new_current_thread().enable_all().build().unwrap() } #[derive(thiserror::Error, Debug)] pub enum QuicServerError { #[error("Server configure failed")] ConfigureFailed, #[error("Endpoint creation failed")] EndpointFailed, } // Return true if the server should drop the stream fn handle_chunk( chunk: &Result<Option<quinn::Chunk>, quinn::ReadError>, maybe_batch: &mut Option<PacketBatch>, remote_addr: &SocketAddr, packet_sender: &Sender<PacketBatch>, ) -> bool { match chunk { Ok(maybe_chunk) => { if let Some(chunk) = maybe_chunk { trace!("got chunk: {:?}", chunk); let chunk_len = chunk.bytes.len() as u64; // shouldn't happen, but sanity check the size and offsets if chunk.offset > PACKET_DATA_SIZE as u64 || chunk_len > PACKET_DATA_SIZE as u64 { return true; } if chunk.offset + chunk_len > PACKET_DATA_SIZE as u64 { return true; } // chunk looks valid if maybe_batch.is_none() { let mut batch = PacketBatch::with_capacity(1); let mut packet = Packet::default(); packet.meta.set_addr(remote_addr); batch.packets.push(packet); *maybe_batch = Some(batch); } if let Some(batch) = maybe_batch.as_mut() { let end = chunk.offset as usize + chunk.bytes.len(); batch.packets[0].data[chunk.offset as usize..end].copy_from_slice(&chunk.bytes); batch.packets[0].meta.size = std::cmp::max(batch.packets[0].meta.size, end); } } else { trace!("chunk is none"); // done receiving chunks if let Some(batch) = maybe_batch.take() { let len = batch.packets[0].meta.size; if let Err(e) = packet_sender.send(batch) { info!("send error: {}", e); } else { trace!("sent {} byte packet", len); } } return true; } } Err(e) => { debug!("Received stream error: {:?}", e); return true; } } false } pub fn spawn_server( sock: UdpSocket, keypair: &Keypair, gossip_host: IpAddr, packet_sender: Sender<PacketBatch>, exit: Arc<AtomicBool>, ) -> Result<thread::JoinHandle<()>, QuicServerError> { let (config, _cert) = configure_server(keypair, gossip_host)?; let runtime = rt(); let (_, mut incoming) = { let _guard = runtime.enter(); Endpoint::new(EndpointConfig::default(), Some(config), sock) .map_err(|_e| QuicServerError::EndpointFailed)? }; let handle = thread::spawn(move || { let handle = runtime.spawn(async move { while !exit.load(Ordering::Relaxed) { const WAIT_FOR_CONNECTION_TIMEOUT_MS: u64 = 1000; let timeout_connection = timeout( Duration::from_millis(WAIT_FOR_CONNECTION_TIMEOUT_MS), incoming.next(), ) .await; if let Ok(Some(connection)) = timeout_connection { if let Ok(new_connection) = connection.await { let exit = exit.clone(); let quinn::NewConnection { connection, mut uni_streams, .. } = new_connection; let remote_addr = connection.remote_address(); let packet_sender = packet_sender.clone(); tokio::spawn(async move { debug!("new connection {}", remote_addr); while let Some(Ok(mut stream)) = uni_streams.next().await { let mut maybe_batch = None; while !exit.load(Ordering::Relaxed) { if handle_chunk( &stream.read_chunk(PACKET_DATA_SIZE, false).await, &mut maybe_batch, &remote_addr, &packet_sender, ) { break; } } } }); } } } }); if let Err(e) = runtime.block_on(handle) { warn!("error from runtime.block_on: {:?}", e); } }); Ok(handle) } #[cfg(test)] mod test { use { super::*, crossbeam_channel::unbounded, quinn::{ClientConfig, NewConnection}, std::{net::SocketAddr, time::Instant}, }; struct SkipServerVerification; impl SkipServerVerification { fn new() -> Arc<Self> { Arc::new(Self) } } impl rustls::client::ServerCertVerifier for SkipServerVerification { fn verify_server_cert( &self, _end_entity: &rustls::Certificate, _intermediates: &[rustls::Certificate], _server_name: &rustls::ServerName, _scts: &mut dyn Iterator<Item = &[u8]>, _ocsp_response: &[u8], _now: std::time::SystemTime, ) -> Result<rustls::client::ServerCertVerified, rustls::Error> { Ok(rustls::client::ServerCertVerified::assertion()) } } pub fn get_client_config() -> quinn::ClientConfig { let crypto = rustls::ClientConfig::builder() .with_safe_defaults() .with_custom_certificate_verifier(SkipServerVerification::new()) .with_no_client_auth(); ClientConfig::new(Arc::new(crypto)) } #[test] fn test_quic_server_exit() { let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, _receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } fn make_client_endpoint(runtime: &Runtime, addr: &SocketAddr) -> NewConnection { let client_socket = UdpSocket::bind("127.0.0.1:0").unwrap(); let mut endpoint = quinn::Endpoint::new(EndpointConfig::default(), None, client_socket) .unwrap() .0; endpoint.set_default_client_config(get_client_config()); runtime .block_on(endpoint.connect(*addr, "localhost").unwrap()) .unwrap() } #[test] fn test_quic_server_multiple_streams()
#[test] fn test_quic_server_multiple_writes() { solana_logger::setup(); let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let server_address = s.local_addr().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); let runtime = rt(); let _rt_guard = runtime.enter(); let conn1 = Arc::new(make_client_endpoint(&runtime, &server_address)); // Send a full size packet with single byte writes. let num_bytes = PACKET_DATA_SIZE; let num_expected_packets = 1; let handle = runtime.spawn(async move { let mut s1 = conn1.connection.open_uni().await.unwrap(); for _ in 0..num_bytes { s1.write_all(&[0u8]).await.unwrap(); } s1.finish().await.unwrap(); }); runtime.block_on(handle).unwrap(); let mut all_packets = vec![]; let now = Instant::now(); let mut total_packets = 0; while now.elapsed().as_secs() < 5 { if let Ok(packets) = receiver.recv_timeout(Duration::from_secs(1)) { total_packets += packets.packets.len(); all_packets.push(packets) } if total_packets > num_expected_packets { break; } } for batch in all_packets { for p in &batch.packets { assert_eq!(p.meta.size, num_bytes); } } assert_eq!(total_packets, num_expected_packets); exit.store(true, Ordering::Relaxed); t.join().unwrap(); } }
{ solana_logger::setup(); let s = UdpSocket::bind("127.0.0.1:0").unwrap(); let exit = Arc::new(AtomicBool::new(false)); let (sender, receiver) = unbounded(); let keypair = Keypair::new(); let ip = "127.0.0.1".parse().unwrap(); let server_address = s.local_addr().unwrap(); let t = spawn_server(s, &keypair, ip, sender, exit.clone()).unwrap(); let runtime = rt(); let _rt_guard = runtime.enter(); let conn1 = Arc::new(make_client_endpoint(&runtime, &server_address)); let conn2 = Arc::new(make_client_endpoint(&runtime, &server_address)); let mut num_expected_packets = 0; for i in 0..10 { info!("sending: {}", i); let c1 = conn1.clone(); let c2 = conn2.clone(); let handle = runtime.spawn(async move { let mut s1 = c1.connection.open_uni().await.unwrap(); let mut s2 = c2.connection.open_uni().await.unwrap(); s1.write_all(&[0u8]).await.unwrap(); s1.finish().await.unwrap(); s2.write_all(&[0u8]).await.unwrap(); s2.finish().await.unwrap(); }); runtime.block_on(handle).unwrap(); num_expected_packets += 2; thread::sleep(Duration::from_millis(200)); } let mut all_packets = vec![]; let now = Instant::now(); let mut total_packets = 0; while now.elapsed().as_secs() < 10 { if let Ok(packets) = receiver.recv_timeout(Duration::from_secs(1)) { total_packets += packets.packets.len(); all_packets.push(packets) } if total_packets == num_expected_packets { break; } } for batch in all_packets { for p in &batch.packets { assert_eq!(p.meta.size, 1); } } assert_eq!(total_packets, num_expected_packets); exit.store(true, Ordering::Relaxed); t.join().unwrap(); }
identifier_body
bob.py
# -*- coding: utf-8 -*- from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals import json import datetime from django import template from django.utils.safestring import mark_safe from django.utils.html import conditional_escape as esc from django.utils.timesince import timesince from bob.forms.dependency import DependencyForm register = template.Library() @register.simple_tag def bob_icon(name, is_white=False): """ Display a bootstrap icon. :param name: The name of the icon to display. :param is_white: Whether the icon should be white (for dark background). """ white = ' icon-white' if is_white else '' return mark_safe('<i class="icon-%s%s"></i>' % esc(name, white)) @register.inclusion_tag('bob/main_menu.html') def main_menu(items, selected, title=None, search=None, white=False, position='', title_url="/"): """ Show main menu bar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param title: The title to show in the menu bar. :param search: The URL for the search form. :param white: If True, the menu bar will be white. :param position: Empty, or one of ``'fixed'``, ``'static'``, ``'bottom'``. """ positions = { 'static': 'navbar-static-top', 'fixed': 'navbar-fixed-top', 'bottom': 'navbar-fixed-bottom', } klass = ['navbar', positions.get(position, '')] if not white: klass.append('navbar-inverse') return { 'items': items, 'selected': selected, 'title': title, 'search': search, 'position': position, 'white': bool(white), 'title_url': title_url, 'class': ' '.join(klass), } @register.inclusion_tag('bob/dropdown_items.html') def dropdown_items(items, white=False): """ Render dropdown items. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param title: The title to show in the menu bar. :param white: If True, the menu bar will be white. """ return { 'items': items.subitems, 'white': bool(white), } @register.simple_tag def render_cell(column, row): """Render the cell for a given column and row.""" return column.render_cell(row) @register.inclusion_tag('bob/tab_menu.html') def tab_menu(items, selected, side=None): """ Show a menu in form of tabs. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param side: The direction of tabs, may be on of ``"left"``, ``"right"``, ``"top"`` or ``"bottom"``. Defaults to ``"top"``. """ return { 'items': items, 'selected': selected, 'side': side, } @register.inclusion_tag('bob/sidebar_menu.html') def sidebar_menu(items, selected): """ Show menu in a sidebar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. """ return { 'items': items, 'selected': selected, } @register.inclusion_tag('bob/sidebar_menu_subitems.html') def sidebar_menu_subitems(item, selected): """ Show subitems of a menu in a sidebar. """ return { 'item': item, 'selected': selected, } @register.inclusion_tag('bob/pagination.html') def pagination(page, show_all=False, show_csv=False, fugue_icons=False, url_query=None, neighbors=1, query_variable_name='page', export_variable_name='export'): """ Display pagination for a list of items. :param page: Django's paginator page to display. :param show_all: Whether to show a link for disabling pagination. :param show_csv: Whether to show a link to CSV download. :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. :param url_query: The query parameters to add to all page links. :param neighbors: How many neighboring pages to show in paginator. """ if not page: return { 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'export_variable_name': export_variable_name, } paginator = page.paginator page_no = page.number pages = paginator.page_range[ max(0, page_no - 1 - neighbors): min(paginator.num_pages, page_no + neighbors) ] if 1 not in pages: pages.insert(0, 1) pages.insert(1, '...') if paginator.num_pages not in pages: pages.append('...') pages.append(paginator.num_pages) urls = [] for item in pages: if item == '...': urls.append(changed_url(url_query, query_variable_name, page_no)) else: urls.append(changed_url(url_query, query_variable_name, item)) url_pages = zip(pages, urls) return { 'paginator': paginator, 'page_no': page_no, 'page': page, 'pages': pages, 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'url_previous_page': changed_url( url_query, query_variable_name, page_no - 1 ), 'url_next_page': changed_url( url_query, query_variable_name, page_no + 1 ), 'url_pages': url_pages, 'url_all': changed_url(url_query, query_variable_name, 0), 'export_variable_name': export_variable_name, } def changed_url(query, name, value): if not query: return '%s=%s' % (name, value) query = query.copy() if value is not None and value not in ('1', 1): query[name] = value else: try: del query[name] except KeyError: pass return query.urlencode() @register.filter def bob_export(query, export): """Modify the query string of an URL to change the ``export`` argument.""" if not query: return 'export=%s' % export query = query.copy() if export: query['export'] = export else: try: del query['export'] except KeyError: pass return query.urlencode() @register.filter def timesince_limited(d): """ Display time between given date and now in a human-readable form if the time span is less than a day, otherwise display the date normally. :param d: The date to display. """ today = datetime.datetime.now() delta = datetime.timedelta interval = today - d if today.strftime('%Y-%m-%d') == d.strftime('%Y-%m-%d'): if interval < delta(days=0, hours=1): return timesince(d) + ' ago ' else:
else: return d @register.inclusion_tag('bob/form.html') def form(form, action="", method="POST", fugue_icons=False, css_class="form-horizontal", title="", submit_label='Save'): """ Render a form. :param form: The form to render. :param action: The submit URL. :param method: The submit method, either ``"GET"`` or ``"POST"``. :param fugue_icons: Whether to use Fugue or Bootstrap icon. :param css_class: The CSS class to use for the ``<form>`` tag. :param title: Form title. :param submit_label: Submit button label. """ return { 'form': form, 'action': action, 'title': title, 'method': method, 'fugue_icons': fugue_icons, 'css_class': css_class, 'submit_label': submit_label, } @register.inclusion_tag('bob/form_as_fieldsets.html') def form_as_fieldsets(form_instance, *args, **kwargs): if not getattr(form_instance.Meta, 'fieldset', None): raise Exception( "{}.Meta.fieldset attribute is UNDEFINED or EMPTY".format( repr(form_instance) ) ) return form(form_instance, *args, **kwargs) @register.inclusion_tag('bob/form.html') def form_horizontal(*args, **kwargs): return form(*args, **kwargs) @register.inclusion_tag('bob/table_header.html') def table_header(columns=None, url_query=None, sort=None, fugue_icons=False, sort_variable_name='sort'): """ Render a table header with sorted column options :param columns: a list of objects of type :py:class:bob.data_table.DataTableColumn :param url_query: The query parameters to add to all page links :param sort: means that the column is now sorted :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. show_conditions field on column item - func and args which determines whether the column is to be displayed. """ new_columns = [] for column in columns: if isinstance(column.show_conditions, tuple): func, arg = column.show_conditions if func(arg): new_columns.append(column) else: new_columns.append(column) return { 'columns': new_columns, 'sort': sort, 'url_query': url_query, 'fugue_icons': fugue_icons, 'sort_variable_name': sort_variable_name, } @register.simple_tag def bob_sort_url(query, field, sort_variable_name, type): """Modify the query string of an URL to change the ``sort_variable_name`` argument. """ query = query.copy() if type == 'desc': query[sort_variable_name] = '-' + field elif type == 'asc': query[sort_variable_name] = field return query.urlencode() @register.simple_tag def bob_export_url(query, value, export_variable_name='export'): """Modify the query string of an URL to change the ``export_variable_name`` argument. """ if not query: return '%s=%s' % (export_variable_name, value) query = query.copy() if value: query[export_variable_name] = value else: try: del query[export_variable_name] except KeyError: pass return query.urlencode() @register.simple_tag def dependency_data(form): """Render the data-bob-dependencies tag if this is a DependencyForm""" if not isinstance(form, DependencyForm): return '' return 'data-bob-dependencies="{0}"'.format( esc(json.dumps(form.get_dependencies_for_js()))) @register.inclusion_tag('bob/field_wrapper.html') def field_wrapper(field): """Render the full control-group tag of a field.""" return {'field': field} @register.filter def get_item(obj, key): return obj[key]
return d.strftime('%H:%M')
conditional_block
bob.py
# -*- coding: utf-8 -*- from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals import json import datetime from django import template from django.utils.safestring import mark_safe from django.utils.html import conditional_escape as esc from django.utils.timesince import timesince from bob.forms.dependency import DependencyForm register = template.Library() @register.simple_tag def bob_icon(name, is_white=False): """ Display a bootstrap icon. :param name: The name of the icon to display. :param is_white: Whether the icon should be white (for dark background). """ white = ' icon-white' if is_white else '' return mark_safe('<i class="icon-%s%s"></i>' % esc(name, white)) @register.inclusion_tag('bob/main_menu.html') def main_menu(items, selected, title=None, search=None, white=False, position='', title_url="/"): """ Show main menu bar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param title: The title to show in the menu bar. :param search: The URL for the search form. :param white: If True, the menu bar will be white. :param position: Empty, or one of ``'fixed'``, ``'static'``, ``'bottom'``. """ positions = { 'static': 'navbar-static-top', 'fixed': 'navbar-fixed-top', 'bottom': 'navbar-fixed-bottom', } klass = ['navbar', positions.get(position, '')] if not white: klass.append('navbar-inverse') return { 'items': items, 'selected': selected, 'title': title, 'search': search, 'position': position, 'white': bool(white), 'title_url': title_url, 'class': ' '.join(klass), } @register.inclusion_tag('bob/dropdown_items.html') def dropdown_items(items, white=False): """ Render dropdown items. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param title: The title to show in the menu bar. :param white: If True, the menu bar will be white. """ return { 'items': items.subitems, 'white': bool(white), } @register.simple_tag def render_cell(column, row): """Render the cell for a given column and row.""" return column.render_cell(row) @register.inclusion_tag('bob/tab_menu.html') def tab_menu(items, selected, side=None): """ Show a menu in form of tabs. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param side: The direction of tabs, may be on of ``"left"``, ``"right"``, ``"top"`` or ``"bottom"``. Defaults to ``"top"``. """ return { 'items': items, 'selected': selected, 'side': side, } @register.inclusion_tag('bob/sidebar_menu.html') def sidebar_menu(items, selected): """ Show menu in a sidebar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. """ return { 'items': items, 'selected': selected, } @register.inclusion_tag('bob/sidebar_menu_subitems.html') def
(item, selected): """ Show subitems of a menu in a sidebar. """ return { 'item': item, 'selected': selected, } @register.inclusion_tag('bob/pagination.html') def pagination(page, show_all=False, show_csv=False, fugue_icons=False, url_query=None, neighbors=1, query_variable_name='page', export_variable_name='export'): """ Display pagination for a list of items. :param page: Django's paginator page to display. :param show_all: Whether to show a link for disabling pagination. :param show_csv: Whether to show a link to CSV download. :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. :param url_query: The query parameters to add to all page links. :param neighbors: How many neighboring pages to show in paginator. """ if not page: return { 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'export_variable_name': export_variable_name, } paginator = page.paginator page_no = page.number pages = paginator.page_range[ max(0, page_no - 1 - neighbors): min(paginator.num_pages, page_no + neighbors) ] if 1 not in pages: pages.insert(0, 1) pages.insert(1, '...') if paginator.num_pages not in pages: pages.append('...') pages.append(paginator.num_pages) urls = [] for item in pages: if item == '...': urls.append(changed_url(url_query, query_variable_name, page_no)) else: urls.append(changed_url(url_query, query_variable_name, item)) url_pages = zip(pages, urls) return { 'paginator': paginator, 'page_no': page_no, 'page': page, 'pages': pages, 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'url_previous_page': changed_url( url_query, query_variable_name, page_no - 1 ), 'url_next_page': changed_url( url_query, query_variable_name, page_no + 1 ), 'url_pages': url_pages, 'url_all': changed_url(url_query, query_variable_name, 0), 'export_variable_name': export_variable_name, } def changed_url(query, name, value): if not query: return '%s=%s' % (name, value) query = query.copy() if value is not None and value not in ('1', 1): query[name] = value else: try: del query[name] except KeyError: pass return query.urlencode() @register.filter def bob_export(query, export): """Modify the query string of an URL to change the ``export`` argument.""" if not query: return 'export=%s' % export query = query.copy() if export: query['export'] = export else: try: del query['export'] except KeyError: pass return query.urlencode() @register.filter def timesince_limited(d): """ Display time between given date and now in a human-readable form if the time span is less than a day, otherwise display the date normally. :param d: The date to display. """ today = datetime.datetime.now() delta = datetime.timedelta interval = today - d if today.strftime('%Y-%m-%d') == d.strftime('%Y-%m-%d'): if interval < delta(days=0, hours=1): return timesince(d) + ' ago ' else: return d.strftime('%H:%M') else: return d @register.inclusion_tag('bob/form.html') def form(form, action="", method="POST", fugue_icons=False, css_class="form-horizontal", title="", submit_label='Save'): """ Render a form. :param form: The form to render. :param action: The submit URL. :param method: The submit method, either ``"GET"`` or ``"POST"``. :param fugue_icons: Whether to use Fugue or Bootstrap icon. :param css_class: The CSS class to use for the ``<form>`` tag. :param title: Form title. :param submit_label: Submit button label. """ return { 'form': form, 'action': action, 'title': title, 'method': method, 'fugue_icons': fugue_icons, 'css_class': css_class, 'submit_label': submit_label, } @register.inclusion_tag('bob/form_as_fieldsets.html') def form_as_fieldsets(form_instance, *args, **kwargs): if not getattr(form_instance.Meta, 'fieldset', None): raise Exception( "{}.Meta.fieldset attribute is UNDEFINED or EMPTY".format( repr(form_instance) ) ) return form(form_instance, *args, **kwargs) @register.inclusion_tag('bob/form.html') def form_horizontal(*args, **kwargs): return form(*args, **kwargs) @register.inclusion_tag('bob/table_header.html') def table_header(columns=None, url_query=None, sort=None, fugue_icons=False, sort_variable_name='sort'): """ Render a table header with sorted column options :param columns: a list of objects of type :py:class:bob.data_table.DataTableColumn :param url_query: The query parameters to add to all page links :param sort: means that the column is now sorted :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. show_conditions field on column item - func and args which determines whether the column is to be displayed. """ new_columns = [] for column in columns: if isinstance(column.show_conditions, tuple): func, arg = column.show_conditions if func(arg): new_columns.append(column) else: new_columns.append(column) return { 'columns': new_columns, 'sort': sort, 'url_query': url_query, 'fugue_icons': fugue_icons, 'sort_variable_name': sort_variable_name, } @register.simple_tag def bob_sort_url(query, field, sort_variable_name, type): """Modify the query string of an URL to change the ``sort_variable_name`` argument. """ query = query.copy() if type == 'desc': query[sort_variable_name] = '-' + field elif type == 'asc': query[sort_variable_name] = field return query.urlencode() @register.simple_tag def bob_export_url(query, value, export_variable_name='export'): """Modify the query string of an URL to change the ``export_variable_name`` argument. """ if not query: return '%s=%s' % (export_variable_name, value) query = query.copy() if value: query[export_variable_name] = value else: try: del query[export_variable_name] except KeyError: pass return query.urlencode() @register.simple_tag def dependency_data(form): """Render the data-bob-dependencies tag if this is a DependencyForm""" if not isinstance(form, DependencyForm): return '' return 'data-bob-dependencies="{0}"'.format( esc(json.dumps(form.get_dependencies_for_js()))) @register.inclusion_tag('bob/field_wrapper.html') def field_wrapper(field): """Render the full control-group tag of a field.""" return {'field': field} @register.filter def get_item(obj, key): return obj[key]
sidebar_menu_subitems
identifier_name
bob.py
# -*- coding: utf-8 -*- from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals import json import datetime from django import template from django.utils.safestring import mark_safe from django.utils.html import conditional_escape as esc from django.utils.timesince import timesince from bob.forms.dependency import DependencyForm register = template.Library() @register.simple_tag def bob_icon(name, is_white=False): """ Display a bootstrap icon. :param name: The name of the icon to display. :param is_white: Whether the icon should be white (for dark background). """ white = ' icon-white' if is_white else '' return mark_safe('<i class="icon-%s%s"></i>' % esc(name, white)) @register.inclusion_tag('bob/main_menu.html') def main_menu(items, selected, title=None, search=None, white=False, position='', title_url="/"): """ Show main menu bar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param title: The title to show in the menu bar. :param search: The URL for the search form. :param white: If True, the menu bar will be white. :param position: Empty, or one of ``'fixed'``, ``'static'``, ``'bottom'``. """ positions = { 'static': 'navbar-static-top', 'fixed': 'navbar-fixed-top', 'bottom': 'navbar-fixed-bottom', } klass = ['navbar', positions.get(position, '')] if not white: klass.append('navbar-inverse') return { 'items': items, 'selected': selected, 'title': title, 'search': search, 'position': position, 'white': bool(white), 'title_url': title_url, 'class': ' '.join(klass), } @register.inclusion_tag('bob/dropdown_items.html') def dropdown_items(items, white=False): """ Render dropdown items. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param title: The title to show in the menu bar. :param white: If True, the menu bar will be white. """ return { 'items': items.subitems, 'white': bool(white), } @register.simple_tag def render_cell(column, row): """Render the cell for a given column and row.""" return column.render_cell(row) @register.inclusion_tag('bob/tab_menu.html') def tab_menu(items, selected, side=None): """ Show a menu in form of tabs. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param side: The direction of tabs, may be on of ``"left"``, ``"right"``, ``"top"`` or ``"bottom"``. Defaults to ``"top"``. """ return { 'items': items, 'selected': selected, 'side': side, } @register.inclusion_tag('bob/sidebar_menu.html') def sidebar_menu(items, selected): """ Show menu in a sidebar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. """ return { 'items': items, 'selected': selected, } @register.inclusion_tag('bob/sidebar_menu_subitems.html') def sidebar_menu_subitems(item, selected): """ Show subitems of a menu in a sidebar. """ return { 'item': item, 'selected': selected, } @register.inclusion_tag('bob/pagination.html') def pagination(page, show_all=False, show_csv=False, fugue_icons=False, url_query=None, neighbors=1, query_variable_name='page', export_variable_name='export'): """ Display pagination for a list of items. :param page: Django's paginator page to display. :param show_all: Whether to show a link for disabling pagination. :param show_csv: Whether to show a link to CSV download. :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. :param url_query: The query parameters to add to all page links. :param neighbors: How many neighboring pages to show in paginator. """ if not page: return { 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'export_variable_name': export_variable_name, } paginator = page.paginator page_no = page.number pages = paginator.page_range[ max(0, page_no - 1 - neighbors): min(paginator.num_pages, page_no + neighbors) ] if 1 not in pages: pages.insert(0, 1) pages.insert(1, '...') if paginator.num_pages not in pages: pages.append('...') pages.append(paginator.num_pages) urls = [] for item in pages: if item == '...': urls.append(changed_url(url_query, query_variable_name, page_no)) else: urls.append(changed_url(url_query, query_variable_name, item)) url_pages = zip(pages, urls) return { 'paginator': paginator, 'page_no': page_no, 'page': page, 'pages': pages, 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'url_previous_page': changed_url( url_query, query_variable_name, page_no - 1 ), 'url_next_page': changed_url( url_query, query_variable_name, page_no + 1 ), 'url_pages': url_pages, 'url_all': changed_url(url_query, query_variable_name, 0), 'export_variable_name': export_variable_name, } def changed_url(query, name, value): if not query: return '%s=%s' % (name, value) query = query.copy() if value is not None and value not in ('1', 1): query[name] = value else: try: del query[name] except KeyError: pass return query.urlencode() @register.filter def bob_export(query, export): """Modify the query string of an URL to change the ``export`` argument.""" if not query: return 'export=%s' % export query = query.copy() if export: query['export'] = export else: try: del query['export'] except KeyError: pass return query.urlencode() @register.filter def timesince_limited(d): """ Display time between given date and now in a human-readable form if the time span is less than a day, otherwise display the date normally. :param d: The date to display. """ today = datetime.datetime.now() delta = datetime.timedelta interval = today - d if today.strftime('%Y-%m-%d') == d.strftime('%Y-%m-%d'): if interval < delta(days=0, hours=1): return timesince(d) + ' ago ' else: return d.strftime('%H:%M') else: return d @register.inclusion_tag('bob/form.html') def form(form, action="", method="POST", fugue_icons=False, css_class="form-horizontal", title="", submit_label='Save'): """ Render a form. :param form: The form to render. :param action: The submit URL. :param method: The submit method, either ``"GET"`` or ``"POST"``. :param fugue_icons: Whether to use Fugue or Bootstrap icon. :param css_class: The CSS class to use for the ``<form>`` tag. :param title: Form title. :param submit_label: Submit button label. """ return { 'form': form, 'action': action, 'title': title, 'method': method, 'fugue_icons': fugue_icons, 'css_class': css_class, 'submit_label': submit_label, } @register.inclusion_tag('bob/form_as_fieldsets.html') def form_as_fieldsets(form_instance, *args, **kwargs): if not getattr(form_instance.Meta, 'fieldset', None): raise Exception( "{}.Meta.fieldset attribute is UNDEFINED or EMPTY".format( repr(form_instance) ) ) return form(form_instance, *args, **kwargs) @register.inclusion_tag('bob/form.html') def form_horizontal(*args, **kwargs): return form(*args, **kwargs) @register.inclusion_tag('bob/table_header.html') def table_header(columns=None, url_query=None, sort=None, fugue_icons=False, sort_variable_name='sort'): """ Render a table header with sorted column options :param columns: a list of objects of type :py:class:bob.data_table.DataTableColumn :param url_query: The query parameters to add to all page links :param sort: means that the column is now sorted :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. show_conditions field on column item - func and args which determines whether the column is to be displayed. """ new_columns = [] for column in columns: if isinstance(column.show_conditions, tuple): func, arg = column.show_conditions if func(arg): new_columns.append(column) else: new_columns.append(column) return { 'columns': new_columns, 'sort': sort, 'url_query': url_query, 'fugue_icons': fugue_icons,
@register.simple_tag def bob_sort_url(query, field, sort_variable_name, type): """Modify the query string of an URL to change the ``sort_variable_name`` argument. """ query = query.copy() if type == 'desc': query[sort_variable_name] = '-' + field elif type == 'asc': query[sort_variable_name] = field return query.urlencode() @register.simple_tag def bob_export_url(query, value, export_variable_name='export'): """Modify the query string of an URL to change the ``export_variable_name`` argument. """ if not query: return '%s=%s' % (export_variable_name, value) query = query.copy() if value: query[export_variable_name] = value else: try: del query[export_variable_name] except KeyError: pass return query.urlencode() @register.simple_tag def dependency_data(form): """Render the data-bob-dependencies tag if this is a DependencyForm""" if not isinstance(form, DependencyForm): return '' return 'data-bob-dependencies="{0}"'.format( esc(json.dumps(form.get_dependencies_for_js()))) @register.inclusion_tag('bob/field_wrapper.html') def field_wrapper(field): """Render the full control-group tag of a field.""" return {'field': field} @register.filter def get_item(obj, key): return obj[key]
'sort_variable_name': sort_variable_name, }
random_line_split
bob.py
# -*- coding: utf-8 -*- from __future__ import absolute_import from __future__ import division from __future__ import print_function from __future__ import unicode_literals import json import datetime from django import template from django.utils.safestring import mark_safe from django.utils.html import conditional_escape as esc from django.utils.timesince import timesince from bob.forms.dependency import DependencyForm register = template.Library() @register.simple_tag def bob_icon(name, is_white=False): """ Display a bootstrap icon. :param name: The name of the icon to display. :param is_white: Whether the icon should be white (for dark background). """ white = ' icon-white' if is_white else '' return mark_safe('<i class="icon-%s%s"></i>' % esc(name, white)) @register.inclusion_tag('bob/main_menu.html') def main_menu(items, selected, title=None, search=None, white=False, position='', title_url="/"): """ Show main menu bar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param title: The title to show in the menu bar. :param search: The URL for the search form. :param white: If True, the menu bar will be white. :param position: Empty, or one of ``'fixed'``, ``'static'``, ``'bottom'``. """ positions = { 'static': 'navbar-static-top', 'fixed': 'navbar-fixed-top', 'bottom': 'navbar-fixed-bottom', } klass = ['navbar', positions.get(position, '')] if not white: klass.append('navbar-inverse') return { 'items': items, 'selected': selected, 'title': title, 'search': search, 'position': position, 'white': bool(white), 'title_url': title_url, 'class': ' '.join(klass), } @register.inclusion_tag('bob/dropdown_items.html') def dropdown_items(items, white=False): """ Render dropdown items. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param title: The title to show in the menu bar. :param white: If True, the menu bar will be white. """ return { 'items': items.subitems, 'white': bool(white), } @register.simple_tag def render_cell(column, row): """Render the cell for a given column and row.""" return column.render_cell(row) @register.inclusion_tag('bob/tab_menu.html') def tab_menu(items, selected, side=None):
@register.inclusion_tag('bob/sidebar_menu.html') def sidebar_menu(items, selected): """ Show menu in a sidebar. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. """ return { 'items': items, 'selected': selected, } @register.inclusion_tag('bob/sidebar_menu_subitems.html') def sidebar_menu_subitems(item, selected): """ Show subitems of a menu in a sidebar. """ return { 'item': item, 'selected': selected, } @register.inclusion_tag('bob/pagination.html') def pagination(page, show_all=False, show_csv=False, fugue_icons=False, url_query=None, neighbors=1, query_variable_name='page', export_variable_name='export'): """ Display pagination for a list of items. :param page: Django's paginator page to display. :param show_all: Whether to show a link for disabling pagination. :param show_csv: Whether to show a link to CSV download. :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. :param url_query: The query parameters to add to all page links. :param neighbors: How many neighboring pages to show in paginator. """ if not page: return { 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'export_variable_name': export_variable_name, } paginator = page.paginator page_no = page.number pages = paginator.page_range[ max(0, page_no - 1 - neighbors): min(paginator.num_pages, page_no + neighbors) ] if 1 not in pages: pages.insert(0, 1) pages.insert(1, '...') if paginator.num_pages not in pages: pages.append('...') pages.append(paginator.num_pages) urls = [] for item in pages: if item == '...': urls.append(changed_url(url_query, query_variable_name, page_no)) else: urls.append(changed_url(url_query, query_variable_name, item)) url_pages = zip(pages, urls) return { 'paginator': paginator, 'page_no': page_no, 'page': page, 'pages': pages, 'show_all': show_all, 'show_csv': show_csv, 'fugue_icons': fugue_icons, 'url_query': url_query, 'url_previous_page': changed_url( url_query, query_variable_name, page_no - 1 ), 'url_next_page': changed_url( url_query, query_variable_name, page_no + 1 ), 'url_pages': url_pages, 'url_all': changed_url(url_query, query_variable_name, 0), 'export_variable_name': export_variable_name, } def changed_url(query, name, value): if not query: return '%s=%s' % (name, value) query = query.copy() if value is not None and value not in ('1', 1): query[name] = value else: try: del query[name] except KeyError: pass return query.urlencode() @register.filter def bob_export(query, export): """Modify the query string of an URL to change the ``export`` argument.""" if not query: return 'export=%s' % export query = query.copy() if export: query['export'] = export else: try: del query['export'] except KeyError: pass return query.urlencode() @register.filter def timesince_limited(d): """ Display time between given date and now in a human-readable form if the time span is less than a day, otherwise display the date normally. :param d: The date to display. """ today = datetime.datetime.now() delta = datetime.timedelta interval = today - d if today.strftime('%Y-%m-%d') == d.strftime('%Y-%m-%d'): if interval < delta(days=0, hours=1): return timesince(d) + ' ago ' else: return d.strftime('%H:%M') else: return d @register.inclusion_tag('bob/form.html') def form(form, action="", method="POST", fugue_icons=False, css_class="form-horizontal", title="", submit_label='Save'): """ Render a form. :param form: The form to render. :param action: The submit URL. :param method: The submit method, either ``"GET"`` or ``"POST"``. :param fugue_icons: Whether to use Fugue or Bootstrap icon. :param css_class: The CSS class to use for the ``<form>`` tag. :param title: Form title. :param submit_label: Submit button label. """ return { 'form': form, 'action': action, 'title': title, 'method': method, 'fugue_icons': fugue_icons, 'css_class': css_class, 'submit_label': submit_label, } @register.inclusion_tag('bob/form_as_fieldsets.html') def form_as_fieldsets(form_instance, *args, **kwargs): if not getattr(form_instance.Meta, 'fieldset', None): raise Exception( "{}.Meta.fieldset attribute is UNDEFINED or EMPTY".format( repr(form_instance) ) ) return form(form_instance, *args, **kwargs) @register.inclusion_tag('bob/form.html') def form_horizontal(*args, **kwargs): return form(*args, **kwargs) @register.inclusion_tag('bob/table_header.html') def table_header(columns=None, url_query=None, sort=None, fugue_icons=False, sort_variable_name='sort'): """ Render a table header with sorted column options :param columns: a list of objects of type :py:class:bob.data_table.DataTableColumn :param url_query: The query parameters to add to all page links :param sort: means that the column is now sorted :param fugue_icons: Whether to use Fugue icons or Bootstrap icons. show_conditions field on column item - func and args which determines whether the column is to be displayed. """ new_columns = [] for column in columns: if isinstance(column.show_conditions, tuple): func, arg = column.show_conditions if func(arg): new_columns.append(column) else: new_columns.append(column) return { 'columns': new_columns, 'sort': sort, 'url_query': url_query, 'fugue_icons': fugue_icons, 'sort_variable_name': sort_variable_name, } @register.simple_tag def bob_sort_url(query, field, sort_variable_name, type): """Modify the query string of an URL to change the ``sort_variable_name`` argument. """ query = query.copy() if type == 'desc': query[sort_variable_name] = '-' + field elif type == 'asc': query[sort_variable_name] = field return query.urlencode() @register.simple_tag def bob_export_url(query, value, export_variable_name='export'): """Modify the query string of an URL to change the ``export_variable_name`` argument. """ if not query: return '%s=%s' % (export_variable_name, value) query = query.copy() if value: query[export_variable_name] = value else: try: del query[export_variable_name] except KeyError: pass return query.urlencode() @register.simple_tag def dependency_data(form): """Render the data-bob-dependencies tag if this is a DependencyForm""" if not isinstance(form, DependencyForm): return '' return 'data-bob-dependencies="{0}"'.format( esc(json.dumps(form.get_dependencies_for_js()))) @register.inclusion_tag('bob/field_wrapper.html') def field_wrapper(field): """Render the full control-group tag of a field.""" return {'field': field} @register.filter def get_item(obj, key): return obj[key]
""" Show a menu in form of tabs. :param items: The list of :class:`bob.menu.MenuItem` instances to show. :param selected: The :data:`name` of the currently selected item. :param side: The direction of tabs, may be on of ``"left"``, ``"right"``, ``"top"`` or ``"bottom"``. Defaults to ``"top"``. """ return { 'items': items, 'selected': selected, 'side': side, }
identifier_body
render.rs
//! Definitions, constructors, and management for the EnsoGL shapes that are used to draw an edge. //! //! The core function of this module is to translate edge layouts into the shape parameters that //! will implement them. use crate::prelude::*; use ensogl::display::shape::*; use crate::GraphLayers; use super::layout::Corner; use super::layout::EdgeSplit; use super::layout::Oriented; use super::layout::SplitArc; use super::layout::TargetAttachment; use ensogl::data::color; use ensogl::display; use ensogl::display::scene::Scene; use std::f32::consts::FRAC_PI_2; use std::f32::consts::PI; use std::f32::consts::TAU; // ================= // === Constants === // ================= const LINE_WIDTH: f32 = 4.0; const HOVER_EXTENSION: f32 = 10.0; pub(super) const HOVER_WIDTH: f32 = LINE_WIDTH + HOVER_EXTENSION; mod arrow { use super::*; pub(super) const SIZE: Vector2 = Vector2(18.75, 18.75); } mod attachment { /// Extra length to add to the top and bottom of the target-attachment bit, to ensure that it /// appears to pass through the top of the node. Without this adjustment, inexact /// floating-point math and anti-aliasing would cause a 1-pixel gap artifact right where /// the attachment should meet the corner at the edge of the node. pub(super) const LENGTH_ADJUSTMENT: f32 = 0.1; } // =================== // === Edge Shapes === // =================== /// The shapes used to render an edge. #[derive(Debug, Default)] pub(super) struct Shapes { /// The individual [`Corner`]s making up the edge. Each is drawn in the focused or unfocused /// color. sections: RefCell<Vec<Rectangle>>, /// A pair of [`arc`] shapes used when the mouse is over the rounded corner, and the edge must /// must be split into focused and unfocused sides at a certain angle along the arc. split_arc: RefCell<Option<[arc::View; 2]>>, /// Wider versions of the [`sections`], for receiving mouse events. hover_sections: RefCell<Vec<Rectangle>>, /// The end of the edge that is drawn on top of the node and connects to the target node's /// input port. target_attachment: RefCell<Option<Rectangle>>, /// Arrow drawn on long backward edges to indicate data flow direction. dataflow_arrow: RefCell<Option<Rectangle>>, /// An rectangle representing the source node shape when the edge is in detached state. Used /// to mask out the edge fragment that would otherwise be drawn over the source node. source_cutout: RefCell<Option<Rectangle>>, } impl Shapes { /// Redraw the arrow used to mark long backward edges. pub(super) fn redraw_dataflow_arrow( &self, parent: &impl ShapeParent, parameters: RedrawDataflowArrow, ) { let RedrawDataflowArrow { arrow, source_color, target_color, focus_split, is_attached } = parameters; let shape = self.dataflow_arrow.take(); if let Some(arrow_center) = arrow { // The arrow will have the same color as the target-end of the first corner from the // source (this is the `arrow_center` point). let color = match focus_split.map(|split| split.corner_index) { Some(0) => target_color, _ => source_color, }; let shape = shape.unwrap_or_else(|| parent.new_dataflow_arrow()); shape.set_xy(arrow_center - arrow::SIZE / 2.0); shape.set_color(color); Self::set_layer(parent, &shape, is_attached, false); self.dataflow_arrow.replace(Some(shape)); } } /// Redraw the invisible mouse-event-catching edges. pub(super) fn redraw_hover_sections( &self, parent: &impl ShapeParent, corners: &[Oriented<Corner>], ) { let hover_factory = self .hover_sections .take() .into_iter() .chain(iter::repeat_with(|| parent.new_hover_section())); *self.hover_sections.borrow_mut() = corners .iter() .zip(hover_factory) .map(|(corner, shape)| draw_corner(shape, **corner, INVISIBLE_HOVER_COLOR, HOVER_WIDTH)) .collect(); } /// Redraw the sections, each of which is a [`Rectangle`] implementing a [`Corner`], or multiple /// [`Rectangle`]s and multiple [`arc::View`]s, if it is a split [`Corner`]. pub(super) fn redraw_sections(&self, parent: &impl ShapeParent, parameters: RedrawSections) { let RedrawSections { corners, source_color, target_color, focus_split, is_attached } = parameters; let corner_index = focus_split.map(|split| split.corner_index).unwrap_or_else(|| corners.len()); let split_corner = focus_split.map(|split| split.split_corner); let mut section_factory = self.sections.take().into_iter().chain(iter::repeat_with(|| parent.new_section())); let mut new_sections = self.redraw_complete_sections( &mut section_factory, corners, corner_index, source_color, target_color, ); let arc_shapes = self.split_arc.take(); if let Some(split_corner) = split_corner { if let Some(split_arc) = split_corner.split_arc { let arc_shapes = arc_shapes.unwrap_or_else(|| [parent.new_arc(), parent.new_arc()]); let arc_shapes = draw_split_arc(arc_shapes, split_arc); arc_shapes[0].color.set(source_color.into()); arc_shapes[1].color.set(target_color.into()); self.split_arc.replace(Some(arc_shapes)); } let (source_shape, target_shape) = (section_factory.next().unwrap(), section_factory.next().unwrap()); new_sections.extend([ draw_corner(source_shape, *split_corner.source_end, source_color, LINE_WIDTH), draw_corner(target_shape, *split_corner.target_end, target_color, LINE_WIDTH), ]); } for (i, shape) in new_sections.iter().enumerate() { Self::set_layer(parent, shape, is_attached, i == 0); } *self.sections.borrow_mut() = new_sections; } pub(crate) fn redraw_cutout( &self, parent: &impl ShapeParent, is_attached: bool, source_size: Vector2, ) { let cutout = self.source_cutout.take(); if !is_attached { let cutout = cutout.unwrap_or_else(|| parent.new_cutout()); cutout.set_xy(-source_size / 2.0); cutout.set_size(source_size); self.source_cutout.replace(Some(cutout)); } } /// Redraw the sections that aren't split by the focus position. pub(super) fn redraw_complete_sections( &self, section_factory: impl Iterator<Item = Rectangle>, corners: &[Oriented<Corner>], corner_index: usize, source_color: color::Rgba, target_color: color::Rgba, ) -> Vec<Rectangle> { corners .iter() .enumerate() .filter_map(|(i, corner)| { if i == corner_index { None } else { let color = match i < corner_index { true => source_color, false => target_color, }; Some((color, corner)) } }) .zip(section_factory) .map(|((color, corner), shape)| draw_corner(shape, **corner, color, LINE_WIDTH)) .collect() } /// Redraw the little bit that goes on top of the target node. pub(super) fn redraw_target_attachment( &self, parent: &impl ShapeParent, target_attachment: Option<TargetAttachment>, color: color::Rgba, ) { let shape = self.target_attachment.take(); if let Some(TargetAttachment { target, length }) = target_attachment && length > f32::EPSILON { let shape = shape.unwrap_or_else(|| parent.new_target_attachment()); shape.set_size_y(length + attachment::LENGTH_ADJUSTMENT * 2.0); let offset = Vector2(-LINE_WIDTH / 2.0, - length - attachment::LENGTH_ADJUSTMENT); shape.set_xy(target + offset); shape.set_color(color); self.target_attachment.replace(Some(shape)); } } /// Add the given shape to the appropriate layer depending on whether it is attached. fn set_layer( parent: &impl ShapeParent, shape: &Rectangle, below_nodes: bool, near_source: bool, ) { let layers = parent.layers(); let layer = if below_nodes { &layers.edge_below_nodes } else if near_source { &layers.masked_edge_above_nodes } else { &layers.edge_above_nodes }; layer.add(shape); } } // === Redraw parameters ==== /// Arguments passed to [`Shapes::redraw_sections`]. pub(super) struct RedrawSections<'a> { /// The corners to be redrawn. pub(super) corners: &'a [Oriented<Corner>], /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } /// Arguments passed to [`Shapes::redraw_dataflow_arrow`]. pub(super) struct RedrawDataflowArrow { /// The center of the arrow, if the arrow should be drawn. pub(super) arrow: Option<Vector2>, /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } // ========================= // === Shape Definitions === // ========================= /// An arc around the origin. `outer_radius` determines the distance from the origin to the outer /// edge of the arc, `stroke_width` the width of the arc. The arc starts at `start_angle`, relative /// to the origin. Its radial size is `sector_angle`. The ends are flat, not rounded as in /// [`RoundedArc`]. mod arc { use super::*; ensogl::shape! { pointer_events = false; ( style: Style, color: Vector4, outer_radius: f32, stroke_width: f32, start_angle: f32, sector_angle: f32, ) { let circle = Circle(outer_radius.px()) - Circle((outer_radius - stroke_width).px()); let angle_adjust = Var::<f32>::from(FRAC_PI_2); let rotate_angle = -start_angle + angle_adjust - &sector_angle / 2.0; let angle = PlaneAngleFast(sector_angle).rotate(rotate_angle); let angle = angle.grow(0.5.px()); let shape = circle * angle; let shape = shape.fill(color); shape.into() } } } // ====================== // === Shape Creation === // ====================== pub(super) trait ShapeParent: display::Object { fn scene(&self) -> &Scene; fn layers(&self) -> &GraphLayers; /// Create a shape object to render one of the [`Corner`]s making up the edge. fn new_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(LINE_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); new } /// Create a shape object to render the invisible hover area corresponding to one of the /// [`Corner`]s making up the edge. fn new_hover_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(HOVER_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); self.display_object().add_child(&new); self.layers().edge_below_nodes.add(&new); new } /// Create a shape object to render an arbitrary-angle arc. This is used when the focus is split /// in the rounded part of a [`Corner`]. fn new_arc(&self) -> arc::View { let arc = arc::View::new();
/// Create a shape object to render the little bit at the target end of the edge, that draws on /// top of the node. fn new_target_attachment(&self) -> Rectangle { let new = Rectangle::new(); new.set_size_x(LINE_WIDTH); new.set_border_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); self.layers().edge_above_nodes.add(&new); new } /// Create a shape object to render the arrow that is drawn on long backward edges to show the /// direction of data flow. fn new_dataflow_arrow(&self) -> Rectangle { let new = SimpleTriangle::from_size(arrow::SIZE); new.set_pointer_events(false); self.display_object().add_child(&new); new.into() } /// Create a shape object to render the cutout mask for the edge nearby the source node. fn new_cutout(&self) -> Rectangle { let cutout = Rectangle::new(); self.display_object().add_child(&cutout); // FIXME (temporary assumption): Currently we assume that the node background is a rectangle // with always rounded corners. Ideally we would somehow use actual source node's background // shape for this. cutout.set_corner_radius(crate::component::node::CORNER_RADIUS); self.layers().edge_above_nodes_cutout.add(&cutout); // Pointer events must be enabled, so that the hover area is masked out as well. cutout.set_pointer_events(true); cutout } } // ========================= // === Rendering Corners === // ========================= /// Set the given [`Rectangle`]'s geometry to draw this corner shape. /// /// Note that the shape's `inset` and `border` should be the same value as the provided /// [`line_width`]. They are not set here as an optimization: When shapes are reused, the value does /// not need to be set again, reducing needed GPU uploads. pub(super) fn draw_corner( shape: Rectangle, corner: Corner, color: color::Rgba, line_width: f32, ) -> Rectangle { shape.set_xy(corner.origin(line_width)); shape.set_size(corner.size(line_width)); shape.set_clip(corner.clip()); shape.set_corner_radius(corner.radius(line_width)); shape.set_border_color(color); shape } // ============================== // === Rendering Partial Arcs === // ============================== /// Apply the specified arc-splitting parameters to the given arc shapes. pub(super) fn draw_split_arc(arc_shapes: [arc::View; 2], split_arc: SplitArc) -> [arc::View; 2] { let outer_radius = split_arc.radius + LINE_WIDTH / 2.0; let arc_box = Vector2(outer_radius * 2.0, outer_radius * 2.0); let arc_offset = Vector2(-outer_radius, -outer_radius); let geometry = ArcGeometry::bisection( split_arc.source_end_angle, split_arc.split_angle, split_arc.target_end_angle, ); for (shape, geometry) in arc_shapes.iter().zip(&geometry) { shape.set_xy(split_arc.origin + arc_offset); shape.set_size(arc_box); shape.outer_radius.set(outer_radius); shape.start_angle.set(geometry.start); shape.sector_angle.set(geometry.sector); } arc_shapes } // === Arc geometry === #[derive(Debug, Copy, Clone, PartialEq)] struct ArcGeometry { start: f32, sector: f32, } impl ArcGeometry { fn bisection(a: f32, b: f32, c: f32) -> [Self; 2] { [Self::new_minor(a, b), Self::new_minor(b, c)] } fn new_minor(a: f32, b: f32) -> Self { let start = minor_arc_start(a, b); let sector = minor_arc_sector(a, b); Self { start, sector } } } fn minor_arc_start(a: f32, b: f32) -> f32 { let a = a.rem_euclid(TAU); let b = b.rem_euclid(TAU); let wrapped = (a - b).abs() >= PI; if wrapped { if a < f32::EPSILON { b } else { a } } else { min(a, b) } } fn minor_arc_sector(a: f32, b: f32) -> f32 { let a = a.abs(); let b = b.abs(); let ab = (a - b).abs(); min(ab, TAU - ab) }
arc.stroke_width.set(LINE_WIDTH); self.display_object().add_child(&arc); self.layers().edge_below_nodes.add(&arc); arc }
random_line_split
render.rs
//! Definitions, constructors, and management for the EnsoGL shapes that are used to draw an edge. //! //! The core function of this module is to translate edge layouts into the shape parameters that //! will implement them. use crate::prelude::*; use ensogl::display::shape::*; use crate::GraphLayers; use super::layout::Corner; use super::layout::EdgeSplit; use super::layout::Oriented; use super::layout::SplitArc; use super::layout::TargetAttachment; use ensogl::data::color; use ensogl::display; use ensogl::display::scene::Scene; use std::f32::consts::FRAC_PI_2; use std::f32::consts::PI; use std::f32::consts::TAU; // ================= // === Constants === // ================= const LINE_WIDTH: f32 = 4.0; const HOVER_EXTENSION: f32 = 10.0; pub(super) const HOVER_WIDTH: f32 = LINE_WIDTH + HOVER_EXTENSION; mod arrow { use super::*; pub(super) const SIZE: Vector2 = Vector2(18.75, 18.75); } mod attachment { /// Extra length to add to the top and bottom of the target-attachment bit, to ensure that it /// appears to pass through the top of the node. Without this adjustment, inexact /// floating-point math and anti-aliasing would cause a 1-pixel gap artifact right where /// the attachment should meet the corner at the edge of the node. pub(super) const LENGTH_ADJUSTMENT: f32 = 0.1; } // =================== // === Edge Shapes === // =================== /// The shapes used to render an edge. #[derive(Debug, Default)] pub(super) struct Shapes { /// The individual [`Corner`]s making up the edge. Each is drawn in the focused or unfocused /// color. sections: RefCell<Vec<Rectangle>>, /// A pair of [`arc`] shapes used when the mouse is over the rounded corner, and the edge must /// must be split into focused and unfocused sides at a certain angle along the arc. split_arc: RefCell<Option<[arc::View; 2]>>, /// Wider versions of the [`sections`], for receiving mouse events. hover_sections: RefCell<Vec<Rectangle>>, /// The end of the edge that is drawn on top of the node and connects to the target node's /// input port. target_attachment: RefCell<Option<Rectangle>>, /// Arrow drawn on long backward edges to indicate data flow direction. dataflow_arrow: RefCell<Option<Rectangle>>, /// An rectangle representing the source node shape when the edge is in detached state. Used /// to mask out the edge fragment that would otherwise be drawn over the source node. source_cutout: RefCell<Option<Rectangle>>, } impl Shapes { /// Redraw the arrow used to mark long backward edges. pub(super) fn redraw_dataflow_arrow( &self, parent: &impl ShapeParent, parameters: RedrawDataflowArrow, ) { let RedrawDataflowArrow { arrow, source_color, target_color, focus_split, is_attached } = parameters; let shape = self.dataflow_arrow.take(); if let Some(arrow_center) = arrow { // The arrow will have the same color as the target-end of the first corner from the // source (this is the `arrow_center` point). let color = match focus_split.map(|split| split.corner_index) { Some(0) => target_color, _ => source_color, }; let shape = shape.unwrap_or_else(|| parent.new_dataflow_arrow()); shape.set_xy(arrow_center - arrow::SIZE / 2.0); shape.set_color(color); Self::set_layer(parent, &shape, is_attached, false); self.dataflow_arrow.replace(Some(shape)); } } /// Redraw the invisible mouse-event-catching edges. pub(super) fn
( &self, parent: &impl ShapeParent, corners: &[Oriented<Corner>], ) { let hover_factory = self .hover_sections .take() .into_iter() .chain(iter::repeat_with(|| parent.new_hover_section())); *self.hover_sections.borrow_mut() = corners .iter() .zip(hover_factory) .map(|(corner, shape)| draw_corner(shape, **corner, INVISIBLE_HOVER_COLOR, HOVER_WIDTH)) .collect(); } /// Redraw the sections, each of which is a [`Rectangle`] implementing a [`Corner`], or multiple /// [`Rectangle`]s and multiple [`arc::View`]s, if it is a split [`Corner`]. pub(super) fn redraw_sections(&self, parent: &impl ShapeParent, parameters: RedrawSections) { let RedrawSections { corners, source_color, target_color, focus_split, is_attached } = parameters; let corner_index = focus_split.map(|split| split.corner_index).unwrap_or_else(|| corners.len()); let split_corner = focus_split.map(|split| split.split_corner); let mut section_factory = self.sections.take().into_iter().chain(iter::repeat_with(|| parent.new_section())); let mut new_sections = self.redraw_complete_sections( &mut section_factory, corners, corner_index, source_color, target_color, ); let arc_shapes = self.split_arc.take(); if let Some(split_corner) = split_corner { if let Some(split_arc) = split_corner.split_arc { let arc_shapes = arc_shapes.unwrap_or_else(|| [parent.new_arc(), parent.new_arc()]); let arc_shapes = draw_split_arc(arc_shapes, split_arc); arc_shapes[0].color.set(source_color.into()); arc_shapes[1].color.set(target_color.into()); self.split_arc.replace(Some(arc_shapes)); } let (source_shape, target_shape) = (section_factory.next().unwrap(), section_factory.next().unwrap()); new_sections.extend([ draw_corner(source_shape, *split_corner.source_end, source_color, LINE_WIDTH), draw_corner(target_shape, *split_corner.target_end, target_color, LINE_WIDTH), ]); } for (i, shape) in new_sections.iter().enumerate() { Self::set_layer(parent, shape, is_attached, i == 0); } *self.sections.borrow_mut() = new_sections; } pub(crate) fn redraw_cutout( &self, parent: &impl ShapeParent, is_attached: bool, source_size: Vector2, ) { let cutout = self.source_cutout.take(); if !is_attached { let cutout = cutout.unwrap_or_else(|| parent.new_cutout()); cutout.set_xy(-source_size / 2.0); cutout.set_size(source_size); self.source_cutout.replace(Some(cutout)); } } /// Redraw the sections that aren't split by the focus position. pub(super) fn redraw_complete_sections( &self, section_factory: impl Iterator<Item = Rectangle>, corners: &[Oriented<Corner>], corner_index: usize, source_color: color::Rgba, target_color: color::Rgba, ) -> Vec<Rectangle> { corners .iter() .enumerate() .filter_map(|(i, corner)| { if i == corner_index { None } else { let color = match i < corner_index { true => source_color, false => target_color, }; Some((color, corner)) } }) .zip(section_factory) .map(|((color, corner), shape)| draw_corner(shape, **corner, color, LINE_WIDTH)) .collect() } /// Redraw the little bit that goes on top of the target node. pub(super) fn redraw_target_attachment( &self, parent: &impl ShapeParent, target_attachment: Option<TargetAttachment>, color: color::Rgba, ) { let shape = self.target_attachment.take(); if let Some(TargetAttachment { target, length }) = target_attachment && length > f32::EPSILON { let shape = shape.unwrap_or_else(|| parent.new_target_attachment()); shape.set_size_y(length + attachment::LENGTH_ADJUSTMENT * 2.0); let offset = Vector2(-LINE_WIDTH / 2.0, - length - attachment::LENGTH_ADJUSTMENT); shape.set_xy(target + offset); shape.set_color(color); self.target_attachment.replace(Some(shape)); } } /// Add the given shape to the appropriate layer depending on whether it is attached. fn set_layer( parent: &impl ShapeParent, shape: &Rectangle, below_nodes: bool, near_source: bool, ) { let layers = parent.layers(); let layer = if below_nodes { &layers.edge_below_nodes } else if near_source { &layers.masked_edge_above_nodes } else { &layers.edge_above_nodes }; layer.add(shape); } } // === Redraw parameters ==== /// Arguments passed to [`Shapes::redraw_sections`]. pub(super) struct RedrawSections<'a> { /// The corners to be redrawn. pub(super) corners: &'a [Oriented<Corner>], /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } /// Arguments passed to [`Shapes::redraw_dataflow_arrow`]. pub(super) struct RedrawDataflowArrow { /// The center of the arrow, if the arrow should be drawn. pub(super) arrow: Option<Vector2>, /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } // ========================= // === Shape Definitions === // ========================= /// An arc around the origin. `outer_radius` determines the distance from the origin to the outer /// edge of the arc, `stroke_width` the width of the arc. The arc starts at `start_angle`, relative /// to the origin. Its radial size is `sector_angle`. The ends are flat, not rounded as in /// [`RoundedArc`]. mod arc { use super::*; ensogl::shape! { pointer_events = false; ( style: Style, color: Vector4, outer_radius: f32, stroke_width: f32, start_angle: f32, sector_angle: f32, ) { let circle = Circle(outer_radius.px()) - Circle((outer_radius - stroke_width).px()); let angle_adjust = Var::<f32>::from(FRAC_PI_2); let rotate_angle = -start_angle + angle_adjust - &sector_angle / 2.0; let angle = PlaneAngleFast(sector_angle).rotate(rotate_angle); let angle = angle.grow(0.5.px()); let shape = circle * angle; let shape = shape.fill(color); shape.into() } } } // ====================== // === Shape Creation === // ====================== pub(super) trait ShapeParent: display::Object { fn scene(&self) -> &Scene; fn layers(&self) -> &GraphLayers; /// Create a shape object to render one of the [`Corner`]s making up the edge. fn new_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(LINE_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); new } /// Create a shape object to render the invisible hover area corresponding to one of the /// [`Corner`]s making up the edge. fn new_hover_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(HOVER_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); self.display_object().add_child(&new); self.layers().edge_below_nodes.add(&new); new } /// Create a shape object to render an arbitrary-angle arc. This is used when the focus is split /// in the rounded part of a [`Corner`]. fn new_arc(&self) -> arc::View { let arc = arc::View::new(); arc.stroke_width.set(LINE_WIDTH); self.display_object().add_child(&arc); self.layers().edge_below_nodes.add(&arc); arc } /// Create a shape object to render the little bit at the target end of the edge, that draws on /// top of the node. fn new_target_attachment(&self) -> Rectangle { let new = Rectangle::new(); new.set_size_x(LINE_WIDTH); new.set_border_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); self.layers().edge_above_nodes.add(&new); new } /// Create a shape object to render the arrow that is drawn on long backward edges to show the /// direction of data flow. fn new_dataflow_arrow(&self) -> Rectangle { let new = SimpleTriangle::from_size(arrow::SIZE); new.set_pointer_events(false); self.display_object().add_child(&new); new.into() } /// Create a shape object to render the cutout mask for the edge nearby the source node. fn new_cutout(&self) -> Rectangle { let cutout = Rectangle::new(); self.display_object().add_child(&cutout); // FIXME (temporary assumption): Currently we assume that the node background is a rectangle // with always rounded corners. Ideally we would somehow use actual source node's background // shape for this. cutout.set_corner_radius(crate::component::node::CORNER_RADIUS); self.layers().edge_above_nodes_cutout.add(&cutout); // Pointer events must be enabled, so that the hover area is masked out as well. cutout.set_pointer_events(true); cutout } } // ========================= // === Rendering Corners === // ========================= /// Set the given [`Rectangle`]'s geometry to draw this corner shape. /// /// Note that the shape's `inset` and `border` should be the same value as the provided /// [`line_width`]. They are not set here as an optimization: When shapes are reused, the value does /// not need to be set again, reducing needed GPU uploads. pub(super) fn draw_corner( shape: Rectangle, corner: Corner, color: color::Rgba, line_width: f32, ) -> Rectangle { shape.set_xy(corner.origin(line_width)); shape.set_size(corner.size(line_width)); shape.set_clip(corner.clip()); shape.set_corner_radius(corner.radius(line_width)); shape.set_border_color(color); shape } // ============================== // === Rendering Partial Arcs === // ============================== /// Apply the specified arc-splitting parameters to the given arc shapes. pub(super) fn draw_split_arc(arc_shapes: [arc::View; 2], split_arc: SplitArc) -> [arc::View; 2] { let outer_radius = split_arc.radius + LINE_WIDTH / 2.0; let arc_box = Vector2(outer_radius * 2.0, outer_radius * 2.0); let arc_offset = Vector2(-outer_radius, -outer_radius); let geometry = ArcGeometry::bisection( split_arc.source_end_angle, split_arc.split_angle, split_arc.target_end_angle, ); for (shape, geometry) in arc_shapes.iter().zip(&geometry) { shape.set_xy(split_arc.origin + arc_offset); shape.set_size(arc_box); shape.outer_radius.set(outer_radius); shape.start_angle.set(geometry.start); shape.sector_angle.set(geometry.sector); } arc_shapes } // === Arc geometry === #[derive(Debug, Copy, Clone, PartialEq)] struct ArcGeometry { start: f32, sector: f32, } impl ArcGeometry { fn bisection(a: f32, b: f32, c: f32) -> [Self; 2] { [Self::new_minor(a, b), Self::new_minor(b, c)] } fn new_minor(a: f32, b: f32) -> Self { let start = minor_arc_start(a, b); let sector = minor_arc_sector(a, b); Self { start, sector } } } fn minor_arc_start(a: f32, b: f32) -> f32 { let a = a.rem_euclid(TAU); let b = b.rem_euclid(TAU); let wrapped = (a - b).abs() >= PI; if wrapped { if a < f32::EPSILON { b } else { a } } else { min(a, b) } } fn minor_arc_sector(a: f32, b: f32) -> f32 { let a = a.abs(); let b = b.abs(); let ab = (a - b).abs(); min(ab, TAU - ab) }
redraw_hover_sections
identifier_name
render.rs
//! Definitions, constructors, and management for the EnsoGL shapes that are used to draw an edge. //! //! The core function of this module is to translate edge layouts into the shape parameters that //! will implement them. use crate::prelude::*; use ensogl::display::shape::*; use crate::GraphLayers; use super::layout::Corner; use super::layout::EdgeSplit; use super::layout::Oriented; use super::layout::SplitArc; use super::layout::TargetAttachment; use ensogl::data::color; use ensogl::display; use ensogl::display::scene::Scene; use std::f32::consts::FRAC_PI_2; use std::f32::consts::PI; use std::f32::consts::TAU; // ================= // === Constants === // ================= const LINE_WIDTH: f32 = 4.0; const HOVER_EXTENSION: f32 = 10.0; pub(super) const HOVER_WIDTH: f32 = LINE_WIDTH + HOVER_EXTENSION; mod arrow { use super::*; pub(super) const SIZE: Vector2 = Vector2(18.75, 18.75); } mod attachment { /// Extra length to add to the top and bottom of the target-attachment bit, to ensure that it /// appears to pass through the top of the node. Without this adjustment, inexact /// floating-point math and anti-aliasing would cause a 1-pixel gap artifact right where /// the attachment should meet the corner at the edge of the node. pub(super) const LENGTH_ADJUSTMENT: f32 = 0.1; } // =================== // === Edge Shapes === // =================== /// The shapes used to render an edge. #[derive(Debug, Default)] pub(super) struct Shapes { /// The individual [`Corner`]s making up the edge. Each is drawn in the focused or unfocused /// color. sections: RefCell<Vec<Rectangle>>, /// A pair of [`arc`] shapes used when the mouse is over the rounded corner, and the edge must /// must be split into focused and unfocused sides at a certain angle along the arc. split_arc: RefCell<Option<[arc::View; 2]>>, /// Wider versions of the [`sections`], for receiving mouse events. hover_sections: RefCell<Vec<Rectangle>>, /// The end of the edge that is drawn on top of the node and connects to the target node's /// input port. target_attachment: RefCell<Option<Rectangle>>, /// Arrow drawn on long backward edges to indicate data flow direction. dataflow_arrow: RefCell<Option<Rectangle>>, /// An rectangle representing the source node shape when the edge is in detached state. Used /// to mask out the edge fragment that would otherwise be drawn over the source node. source_cutout: RefCell<Option<Rectangle>>, } impl Shapes { /// Redraw the arrow used to mark long backward edges. pub(super) fn redraw_dataflow_arrow( &self, parent: &impl ShapeParent, parameters: RedrawDataflowArrow, ) { let RedrawDataflowArrow { arrow, source_color, target_color, focus_split, is_attached } = parameters; let shape = self.dataflow_arrow.take(); if let Some(arrow_center) = arrow { // The arrow will have the same color as the target-end of the first corner from the // source (this is the `arrow_center` point). let color = match focus_split.map(|split| split.corner_index) { Some(0) => target_color, _ => source_color, }; let shape = shape.unwrap_or_else(|| parent.new_dataflow_arrow()); shape.set_xy(arrow_center - arrow::SIZE / 2.0); shape.set_color(color); Self::set_layer(parent, &shape, is_attached, false); self.dataflow_arrow.replace(Some(shape)); } } /// Redraw the invisible mouse-event-catching edges. pub(super) fn redraw_hover_sections( &self, parent: &impl ShapeParent, corners: &[Oriented<Corner>], ) { let hover_factory = self .hover_sections .take() .into_iter() .chain(iter::repeat_with(|| parent.new_hover_section())); *self.hover_sections.borrow_mut() = corners .iter() .zip(hover_factory) .map(|(corner, shape)| draw_corner(shape, **corner, INVISIBLE_HOVER_COLOR, HOVER_WIDTH)) .collect(); } /// Redraw the sections, each of which is a [`Rectangle`] implementing a [`Corner`], or multiple /// [`Rectangle`]s and multiple [`arc::View`]s, if it is a split [`Corner`]. pub(super) fn redraw_sections(&self, parent: &impl ShapeParent, parameters: RedrawSections) { let RedrawSections { corners, source_color, target_color, focus_split, is_attached } = parameters; let corner_index = focus_split.map(|split| split.corner_index).unwrap_or_else(|| corners.len()); let split_corner = focus_split.map(|split| split.split_corner); let mut section_factory = self.sections.take().into_iter().chain(iter::repeat_with(|| parent.new_section())); let mut new_sections = self.redraw_complete_sections( &mut section_factory, corners, corner_index, source_color, target_color, ); let arc_shapes = self.split_arc.take(); if let Some(split_corner) = split_corner { if let Some(split_arc) = split_corner.split_arc { let arc_shapes = arc_shapes.unwrap_or_else(|| [parent.new_arc(), parent.new_arc()]); let arc_shapes = draw_split_arc(arc_shapes, split_arc); arc_shapes[0].color.set(source_color.into()); arc_shapes[1].color.set(target_color.into()); self.split_arc.replace(Some(arc_shapes)); } let (source_shape, target_shape) = (section_factory.next().unwrap(), section_factory.next().unwrap()); new_sections.extend([ draw_corner(source_shape, *split_corner.source_end, source_color, LINE_WIDTH), draw_corner(target_shape, *split_corner.target_end, target_color, LINE_WIDTH), ]); } for (i, shape) in new_sections.iter().enumerate() { Self::set_layer(parent, shape, is_attached, i == 0); } *self.sections.borrow_mut() = new_sections; } pub(crate) fn redraw_cutout( &self, parent: &impl ShapeParent, is_attached: bool, source_size: Vector2, ) { let cutout = self.source_cutout.take(); if !is_attached { let cutout = cutout.unwrap_or_else(|| parent.new_cutout()); cutout.set_xy(-source_size / 2.0); cutout.set_size(source_size); self.source_cutout.replace(Some(cutout)); } } /// Redraw the sections that aren't split by the focus position. pub(super) fn redraw_complete_sections( &self, section_factory: impl Iterator<Item = Rectangle>, corners: &[Oriented<Corner>], corner_index: usize, source_color: color::Rgba, target_color: color::Rgba, ) -> Vec<Rectangle> { corners .iter() .enumerate() .filter_map(|(i, corner)| { if i == corner_index { None } else { let color = match i < corner_index { true => source_color, false => target_color, }; Some((color, corner)) } }) .zip(section_factory) .map(|((color, corner), shape)| draw_corner(shape, **corner, color, LINE_WIDTH)) .collect() } /// Redraw the little bit that goes on top of the target node. pub(super) fn redraw_target_attachment( &self, parent: &impl ShapeParent, target_attachment: Option<TargetAttachment>, color: color::Rgba, ) { let shape = self.target_attachment.take(); if let Some(TargetAttachment { target, length }) = target_attachment && length > f32::EPSILON { let shape = shape.unwrap_or_else(|| parent.new_target_attachment()); shape.set_size_y(length + attachment::LENGTH_ADJUSTMENT * 2.0); let offset = Vector2(-LINE_WIDTH / 2.0, - length - attachment::LENGTH_ADJUSTMENT); shape.set_xy(target + offset); shape.set_color(color); self.target_attachment.replace(Some(shape)); } } /// Add the given shape to the appropriate layer depending on whether it is attached. fn set_layer( parent: &impl ShapeParent, shape: &Rectangle, below_nodes: bool, near_source: bool, ) { let layers = parent.layers(); let layer = if below_nodes { &layers.edge_below_nodes } else if near_source { &layers.masked_edge_above_nodes } else { &layers.edge_above_nodes }; layer.add(shape); } } // === Redraw parameters ==== /// Arguments passed to [`Shapes::redraw_sections`]. pub(super) struct RedrawSections<'a> { /// The corners to be redrawn. pub(super) corners: &'a [Oriented<Corner>], /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } /// Arguments passed to [`Shapes::redraw_dataflow_arrow`]. pub(super) struct RedrawDataflowArrow { /// The center of the arrow, if the arrow should be drawn. pub(super) arrow: Option<Vector2>, /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } // ========================= // === Shape Definitions === // ========================= /// An arc around the origin. `outer_radius` determines the distance from the origin to the outer /// edge of the arc, `stroke_width` the width of the arc. The arc starts at `start_angle`, relative /// to the origin. Its radial size is `sector_angle`. The ends are flat, not rounded as in /// [`RoundedArc`]. mod arc { use super::*; ensogl::shape! { pointer_events = false; ( style: Style, color: Vector4, outer_radius: f32, stroke_width: f32, start_angle: f32, sector_angle: f32, ) { let circle = Circle(outer_radius.px()) - Circle((outer_radius - stroke_width).px()); let angle_adjust = Var::<f32>::from(FRAC_PI_2); let rotate_angle = -start_angle + angle_adjust - &sector_angle / 2.0; let angle = PlaneAngleFast(sector_angle).rotate(rotate_angle); let angle = angle.grow(0.5.px()); let shape = circle * angle; let shape = shape.fill(color); shape.into() } } } // ====================== // === Shape Creation === // ====================== pub(super) trait ShapeParent: display::Object { fn scene(&self) -> &Scene; fn layers(&self) -> &GraphLayers; /// Create a shape object to render one of the [`Corner`]s making up the edge. fn new_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(LINE_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); new } /// Create a shape object to render the invisible hover area corresponding to one of the /// [`Corner`]s making up the edge. fn new_hover_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(HOVER_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); self.display_object().add_child(&new); self.layers().edge_below_nodes.add(&new); new } /// Create a shape object to render an arbitrary-angle arc. This is used when the focus is split /// in the rounded part of a [`Corner`]. fn new_arc(&self) -> arc::View { let arc = arc::View::new(); arc.stroke_width.set(LINE_WIDTH); self.display_object().add_child(&arc); self.layers().edge_below_nodes.add(&arc); arc } /// Create a shape object to render the little bit at the target end of the edge, that draws on /// top of the node. fn new_target_attachment(&self) -> Rectangle { let new = Rectangle::new(); new.set_size_x(LINE_WIDTH); new.set_border_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); self.layers().edge_above_nodes.add(&new); new } /// Create a shape object to render the arrow that is drawn on long backward edges to show the /// direction of data flow. fn new_dataflow_arrow(&self) -> Rectangle
/// Create a shape object to render the cutout mask for the edge nearby the source node. fn new_cutout(&self) -> Rectangle { let cutout = Rectangle::new(); self.display_object().add_child(&cutout); // FIXME (temporary assumption): Currently we assume that the node background is a rectangle // with always rounded corners. Ideally we would somehow use actual source node's background // shape for this. cutout.set_corner_radius(crate::component::node::CORNER_RADIUS); self.layers().edge_above_nodes_cutout.add(&cutout); // Pointer events must be enabled, so that the hover area is masked out as well. cutout.set_pointer_events(true); cutout } } // ========================= // === Rendering Corners === // ========================= /// Set the given [`Rectangle`]'s geometry to draw this corner shape. /// /// Note that the shape's `inset` and `border` should be the same value as the provided /// [`line_width`]. They are not set here as an optimization: When shapes are reused, the value does /// not need to be set again, reducing needed GPU uploads. pub(super) fn draw_corner( shape: Rectangle, corner: Corner, color: color::Rgba, line_width: f32, ) -> Rectangle { shape.set_xy(corner.origin(line_width)); shape.set_size(corner.size(line_width)); shape.set_clip(corner.clip()); shape.set_corner_radius(corner.radius(line_width)); shape.set_border_color(color); shape } // ============================== // === Rendering Partial Arcs === // ============================== /// Apply the specified arc-splitting parameters to the given arc shapes. pub(super) fn draw_split_arc(arc_shapes: [arc::View; 2], split_arc: SplitArc) -> [arc::View; 2] { let outer_radius = split_arc.radius + LINE_WIDTH / 2.0; let arc_box = Vector2(outer_radius * 2.0, outer_radius * 2.0); let arc_offset = Vector2(-outer_radius, -outer_radius); let geometry = ArcGeometry::bisection( split_arc.source_end_angle, split_arc.split_angle, split_arc.target_end_angle, ); for (shape, geometry) in arc_shapes.iter().zip(&geometry) { shape.set_xy(split_arc.origin + arc_offset); shape.set_size(arc_box); shape.outer_radius.set(outer_radius); shape.start_angle.set(geometry.start); shape.sector_angle.set(geometry.sector); } arc_shapes } // === Arc geometry === #[derive(Debug, Copy, Clone, PartialEq)] struct ArcGeometry { start: f32, sector: f32, } impl ArcGeometry { fn bisection(a: f32, b: f32, c: f32) -> [Self; 2] { [Self::new_minor(a, b), Self::new_minor(b, c)] } fn new_minor(a: f32, b: f32) -> Self { let start = minor_arc_start(a, b); let sector = minor_arc_sector(a, b); Self { start, sector } } } fn minor_arc_start(a: f32, b: f32) -> f32 { let a = a.rem_euclid(TAU); let b = b.rem_euclid(TAU); let wrapped = (a - b).abs() >= PI; if wrapped { if a < f32::EPSILON { b } else { a } } else { min(a, b) } } fn minor_arc_sector(a: f32, b: f32) -> f32 { let a = a.abs(); let b = b.abs(); let ab = (a - b).abs(); min(ab, TAU - ab) }
{ let new = SimpleTriangle::from_size(arrow::SIZE); new.set_pointer_events(false); self.display_object().add_child(&new); new.into() }
identifier_body
render.rs
//! Definitions, constructors, and management for the EnsoGL shapes that are used to draw an edge. //! //! The core function of this module is to translate edge layouts into the shape parameters that //! will implement them. use crate::prelude::*; use ensogl::display::shape::*; use crate::GraphLayers; use super::layout::Corner; use super::layout::EdgeSplit; use super::layout::Oriented; use super::layout::SplitArc; use super::layout::TargetAttachment; use ensogl::data::color; use ensogl::display; use ensogl::display::scene::Scene; use std::f32::consts::FRAC_PI_2; use std::f32::consts::PI; use std::f32::consts::TAU; // ================= // === Constants === // ================= const LINE_WIDTH: f32 = 4.0; const HOVER_EXTENSION: f32 = 10.0; pub(super) const HOVER_WIDTH: f32 = LINE_WIDTH + HOVER_EXTENSION; mod arrow { use super::*; pub(super) const SIZE: Vector2 = Vector2(18.75, 18.75); } mod attachment { /// Extra length to add to the top and bottom of the target-attachment bit, to ensure that it /// appears to pass through the top of the node. Without this adjustment, inexact /// floating-point math and anti-aliasing would cause a 1-pixel gap artifact right where /// the attachment should meet the corner at the edge of the node. pub(super) const LENGTH_ADJUSTMENT: f32 = 0.1; } // =================== // === Edge Shapes === // =================== /// The shapes used to render an edge. #[derive(Debug, Default)] pub(super) struct Shapes { /// The individual [`Corner`]s making up the edge. Each is drawn in the focused or unfocused /// color. sections: RefCell<Vec<Rectangle>>, /// A pair of [`arc`] shapes used when the mouse is over the rounded corner, and the edge must /// must be split into focused and unfocused sides at a certain angle along the arc. split_arc: RefCell<Option<[arc::View; 2]>>, /// Wider versions of the [`sections`], for receiving mouse events. hover_sections: RefCell<Vec<Rectangle>>, /// The end of the edge that is drawn on top of the node and connects to the target node's /// input port. target_attachment: RefCell<Option<Rectangle>>, /// Arrow drawn on long backward edges to indicate data flow direction. dataflow_arrow: RefCell<Option<Rectangle>>, /// An rectangle representing the source node shape when the edge is in detached state. Used /// to mask out the edge fragment that would otherwise be drawn over the source node. source_cutout: RefCell<Option<Rectangle>>, } impl Shapes { /// Redraw the arrow used to mark long backward edges. pub(super) fn redraw_dataflow_arrow( &self, parent: &impl ShapeParent, parameters: RedrawDataflowArrow, ) { let RedrawDataflowArrow { arrow, source_color, target_color, focus_split, is_attached } = parameters; let shape = self.dataflow_arrow.take(); if let Some(arrow_center) = arrow { // The arrow will have the same color as the target-end of the first corner from the // source (this is the `arrow_center` point). let color = match focus_split.map(|split| split.corner_index) { Some(0) => target_color, _ => source_color, }; let shape = shape.unwrap_or_else(|| parent.new_dataflow_arrow()); shape.set_xy(arrow_center - arrow::SIZE / 2.0); shape.set_color(color); Self::set_layer(parent, &shape, is_attached, false); self.dataflow_arrow.replace(Some(shape)); } } /// Redraw the invisible mouse-event-catching edges. pub(super) fn redraw_hover_sections( &self, parent: &impl ShapeParent, corners: &[Oriented<Corner>], ) { let hover_factory = self .hover_sections .take() .into_iter() .chain(iter::repeat_with(|| parent.new_hover_section())); *self.hover_sections.borrow_mut() = corners .iter() .zip(hover_factory) .map(|(corner, shape)| draw_corner(shape, **corner, INVISIBLE_HOVER_COLOR, HOVER_WIDTH)) .collect(); } /// Redraw the sections, each of which is a [`Rectangle`] implementing a [`Corner`], or multiple /// [`Rectangle`]s and multiple [`arc::View`]s, if it is a split [`Corner`]. pub(super) fn redraw_sections(&self, parent: &impl ShapeParent, parameters: RedrawSections) { let RedrawSections { corners, source_color, target_color, focus_split, is_attached } = parameters; let corner_index = focus_split.map(|split| split.corner_index).unwrap_or_else(|| corners.len()); let split_corner = focus_split.map(|split| split.split_corner); let mut section_factory = self.sections.take().into_iter().chain(iter::repeat_with(|| parent.new_section())); let mut new_sections = self.redraw_complete_sections( &mut section_factory, corners, corner_index, source_color, target_color, ); let arc_shapes = self.split_arc.take(); if let Some(split_corner) = split_corner { if let Some(split_arc) = split_corner.split_arc { let arc_shapes = arc_shapes.unwrap_or_else(|| [parent.new_arc(), parent.new_arc()]); let arc_shapes = draw_split_arc(arc_shapes, split_arc); arc_shapes[0].color.set(source_color.into()); arc_shapes[1].color.set(target_color.into()); self.split_arc.replace(Some(arc_shapes)); } let (source_shape, target_shape) = (section_factory.next().unwrap(), section_factory.next().unwrap()); new_sections.extend([ draw_corner(source_shape, *split_corner.source_end, source_color, LINE_WIDTH), draw_corner(target_shape, *split_corner.target_end, target_color, LINE_WIDTH), ]); } for (i, shape) in new_sections.iter().enumerate() { Self::set_layer(parent, shape, is_attached, i == 0); } *self.sections.borrow_mut() = new_sections; } pub(crate) fn redraw_cutout( &self, parent: &impl ShapeParent, is_attached: bool, source_size: Vector2, ) { let cutout = self.source_cutout.take(); if !is_attached { let cutout = cutout.unwrap_or_else(|| parent.new_cutout()); cutout.set_xy(-source_size / 2.0); cutout.set_size(source_size); self.source_cutout.replace(Some(cutout)); } } /// Redraw the sections that aren't split by the focus position. pub(super) fn redraw_complete_sections( &self, section_factory: impl Iterator<Item = Rectangle>, corners: &[Oriented<Corner>], corner_index: usize, source_color: color::Rgba, target_color: color::Rgba, ) -> Vec<Rectangle> { corners .iter() .enumerate() .filter_map(|(i, corner)| { if i == corner_index { None } else { let color = match i < corner_index { true => source_color, false => target_color, }; Some((color, corner)) } }) .zip(section_factory) .map(|((color, corner), shape)| draw_corner(shape, **corner, color, LINE_WIDTH)) .collect() } /// Redraw the little bit that goes on top of the target node. pub(super) fn redraw_target_attachment( &self, parent: &impl ShapeParent, target_attachment: Option<TargetAttachment>, color: color::Rgba, ) { let shape = self.target_attachment.take(); if let Some(TargetAttachment { target, length }) = target_attachment && length > f32::EPSILON { let shape = shape.unwrap_or_else(|| parent.new_target_attachment()); shape.set_size_y(length + attachment::LENGTH_ADJUSTMENT * 2.0); let offset = Vector2(-LINE_WIDTH / 2.0, - length - attachment::LENGTH_ADJUSTMENT); shape.set_xy(target + offset); shape.set_color(color); self.target_attachment.replace(Some(shape)); } } /// Add the given shape to the appropriate layer depending on whether it is attached. fn set_layer( parent: &impl ShapeParent, shape: &Rectangle, below_nodes: bool, near_source: bool, ) { let layers = parent.layers(); let layer = if below_nodes { &layers.edge_below_nodes } else if near_source { &layers.masked_edge_above_nodes } else { &layers.edge_above_nodes }; layer.add(shape); } } // === Redraw parameters ==== /// Arguments passed to [`Shapes::redraw_sections`]. pub(super) struct RedrawSections<'a> { /// The corners to be redrawn. pub(super) corners: &'a [Oriented<Corner>], /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } /// Arguments passed to [`Shapes::redraw_dataflow_arrow`]. pub(super) struct RedrawDataflowArrow { /// The center of the arrow, if the arrow should be drawn. pub(super) arrow: Option<Vector2>, /// The color to use for the part of the edge closer to the source. pub(super) source_color: color::Rgba, /// The color to use for the part of the edge closer to the target. pub(super) target_color: color::Rgba, /// Where the edge should be split into differently-colored source and target parts. pub(super) focus_split: Option<EdgeSplit>, /// Whether the edge is fully-attached. pub(super) is_attached: bool, } // ========================= // === Shape Definitions === // ========================= /// An arc around the origin. `outer_radius` determines the distance from the origin to the outer /// edge of the arc, `stroke_width` the width of the arc. The arc starts at `start_angle`, relative /// to the origin. Its radial size is `sector_angle`. The ends are flat, not rounded as in /// [`RoundedArc`]. mod arc { use super::*; ensogl::shape! { pointer_events = false; ( style: Style, color: Vector4, outer_radius: f32, stroke_width: f32, start_angle: f32, sector_angle: f32, ) { let circle = Circle(outer_radius.px()) - Circle((outer_radius - stroke_width).px()); let angle_adjust = Var::<f32>::from(FRAC_PI_2); let rotate_angle = -start_angle + angle_adjust - &sector_angle / 2.0; let angle = PlaneAngleFast(sector_angle).rotate(rotate_angle); let angle = angle.grow(0.5.px()); let shape = circle * angle; let shape = shape.fill(color); shape.into() } } } // ====================== // === Shape Creation === // ====================== pub(super) trait ShapeParent: display::Object { fn scene(&self) -> &Scene; fn layers(&self) -> &GraphLayers; /// Create a shape object to render one of the [`Corner`]s making up the edge. fn new_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(LINE_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); new } /// Create a shape object to render the invisible hover area corresponding to one of the /// [`Corner`]s making up the edge. fn new_hover_section(&self) -> Rectangle { let new = Rectangle::new(); new.set_inner_border(HOVER_WIDTH, 0.0); new.set_color(color::Rgba::transparent()); self.display_object().add_child(&new); self.layers().edge_below_nodes.add(&new); new } /// Create a shape object to render an arbitrary-angle arc. This is used when the focus is split /// in the rounded part of a [`Corner`]. fn new_arc(&self) -> arc::View { let arc = arc::View::new(); arc.stroke_width.set(LINE_WIDTH); self.display_object().add_child(&arc); self.layers().edge_below_nodes.add(&arc); arc } /// Create a shape object to render the little bit at the target end of the edge, that draws on /// top of the node. fn new_target_attachment(&self) -> Rectangle { let new = Rectangle::new(); new.set_size_x(LINE_WIDTH); new.set_border_color(color::Rgba::transparent()); new.set_pointer_events(false); self.display_object().add_child(&new); self.layers().edge_above_nodes.add(&new); new } /// Create a shape object to render the arrow that is drawn on long backward edges to show the /// direction of data flow. fn new_dataflow_arrow(&self) -> Rectangle { let new = SimpleTriangle::from_size(arrow::SIZE); new.set_pointer_events(false); self.display_object().add_child(&new); new.into() } /// Create a shape object to render the cutout mask for the edge nearby the source node. fn new_cutout(&self) -> Rectangle { let cutout = Rectangle::new(); self.display_object().add_child(&cutout); // FIXME (temporary assumption): Currently we assume that the node background is a rectangle // with always rounded corners. Ideally we would somehow use actual source node's background // shape for this. cutout.set_corner_radius(crate::component::node::CORNER_RADIUS); self.layers().edge_above_nodes_cutout.add(&cutout); // Pointer events must be enabled, so that the hover area is masked out as well. cutout.set_pointer_events(true); cutout } } // ========================= // === Rendering Corners === // ========================= /// Set the given [`Rectangle`]'s geometry to draw this corner shape. /// /// Note that the shape's `inset` and `border` should be the same value as the provided /// [`line_width`]. They are not set here as an optimization: When shapes are reused, the value does /// not need to be set again, reducing needed GPU uploads. pub(super) fn draw_corner( shape: Rectangle, corner: Corner, color: color::Rgba, line_width: f32, ) -> Rectangle { shape.set_xy(corner.origin(line_width)); shape.set_size(corner.size(line_width)); shape.set_clip(corner.clip()); shape.set_corner_radius(corner.radius(line_width)); shape.set_border_color(color); shape } // ============================== // === Rendering Partial Arcs === // ============================== /// Apply the specified arc-splitting parameters to the given arc shapes. pub(super) fn draw_split_arc(arc_shapes: [arc::View; 2], split_arc: SplitArc) -> [arc::View; 2] { let outer_radius = split_arc.radius + LINE_WIDTH / 2.0; let arc_box = Vector2(outer_radius * 2.0, outer_radius * 2.0); let arc_offset = Vector2(-outer_radius, -outer_radius); let geometry = ArcGeometry::bisection( split_arc.source_end_angle, split_arc.split_angle, split_arc.target_end_angle, ); for (shape, geometry) in arc_shapes.iter().zip(&geometry) { shape.set_xy(split_arc.origin + arc_offset); shape.set_size(arc_box); shape.outer_radius.set(outer_radius); shape.start_angle.set(geometry.start); shape.sector_angle.set(geometry.sector); } arc_shapes } // === Arc geometry === #[derive(Debug, Copy, Clone, PartialEq)] struct ArcGeometry { start: f32, sector: f32, } impl ArcGeometry { fn bisection(a: f32, b: f32, c: f32) -> [Self; 2] { [Self::new_minor(a, b), Self::new_minor(b, c)] } fn new_minor(a: f32, b: f32) -> Self { let start = minor_arc_start(a, b); let sector = minor_arc_sector(a, b); Self { start, sector } } } fn minor_arc_start(a: f32, b: f32) -> f32 { let a = a.rem_euclid(TAU); let b = b.rem_euclid(TAU); let wrapped = (a - b).abs() >= PI; if wrapped { if a < f32::EPSILON { b } else
} else { min(a, b) } } fn minor_arc_sector(a: f32, b: f32) -> f32 { let a = a.abs(); let b = b.abs(); let ab = (a - b).abs(); min(ab, TAU - ab) }
{ a }
conditional_block
PDDSP_encoder.py
""" Predictive Encoder""" import sys sys.path.append('APC') import tensorflow as tf import numpy as np import matplotlib.pyplot as plt import librosa import ddsp.core as core import PLP_model.PDDSP_spectral_ops as PDDSP_spectral_ops def np_diff(a, n=1, axis=-1): """Tensorflow implementation of np.diff""" if n == 0: return a if n < 0: raise ValueError( "order must be non-negative but got " + repr(n)) nd = len(a.shape) slice1 = [slice(None)]*nd slice2 = [slice(None)]*nd slice1[axis] = slice(1, None) slice2[axis] = slice(None, -1) slice1 = tuple(slice1) slice2 = tuple(slice2) if n > 1: return np_diff(a[slice1]-a[slice2], n-1, axis=axis) else: return a[slice1]-a[slice2] def audio_to_spectralflux_tf(audio, N, H, Fs): """ computes novelty via differences in the spectral energy between adjacent frames """ X = tf.transpose(PDDSP_spectral_ops.stft(audio, N, H, fft_length=N, pad_end=False, center=True, # todo centering? window_fn=tf.signal.hann_window)) gamma = 10 # todo tune compression prior, make adaptive? Y = tf.math.log(1 + gamma * np.abs(X)) Y_diff = np_diff(Y, n=1) Y_diff = tf.clip_by_value(Y_diff, clip_value_min=0., clip_value_max=1000000.) # todo # todo replace the audio filtering with adaptive weighting of FT bins: nov = tf.reduce_mean(Y_diff, axis=0) # todo tune aggregation function nov = tf.concat([nov, np.array([0])], axis=0) Fs_nov = Fs / H nov -= tf.math.reduce_mean(nov) # todo tune output normalization nov = tf.clip_by_value(nov, clip_value_min=0., clip_value_max=1000000.) nov /= tf.math.reduce_max(nov) # normalize return nov, Fs_nov def get_slope(prev, cur): return tf.cond(prev[0] < cur, lambda: (cur, ascending_or_valley(prev, cur)), lambda: (cur, descending_or_peak(prev, cur))) def ascending_or_valley(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('A'), lambda: np.array('V')) def descending_or_peak(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('P'), lambda: np.array('D')) def label_local_extrema(tens): """Return a vector of chars indicating ascending, descending, peak, or valley slopes""" initializer = (np.array(0, dtype=np.float32), np.array('A')) slope = tf.scan(get_slope, tens, initializer) return slope[1][1:] def find_local_maxima(tens): """Tensorflow peak picking via local maxima Returns the indices of the local maxima of the first dimension of the tensor Based on https://stackoverflow.com/questions/48178286/finding-local-maxima-with-tensorflow """ return tf.squeeze(tf.where(tf.equal(label_local_extrema(tens), 'P'))) def fft_frequencies(sr=22050, n_fft=2048): """Tensorflow-based implementation of np.fft.fftfreq """ # TODO endpoint=True return tf.linspace(0, tf.cast(sr/2., dtype=tf.int32), tf.cast(1. + n_fft // 2., dtype=tf.int32)) def fourier_tempo_frequencies(sr=22050, win_length=384, hop_length=512):
def bandpass_filter_audio(audio, f_low=400, f_high=450): """Bandpass filters audio to given frequency range""" filtered_audio = core.sinc_filter(audio, f_low, window_size=256, high_pass=True) filtered_audio = core.sinc_filter(filtered_audio, f_high, window_size=256, high_pass=False) return tf.squeeze(filtered_audio) def plp_tf( y, sr=22050, tempo_min=30, tempo_max=300, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.1, loudness_max=1., prior=None): """Tensorflow-based implementation of librosa.beat.plp Process chain: audio -> spectral flux novelty -> Fourier tempogram -> local pulse """ y = tf.squeeze(y) # get spectral flux novelty oenv, sr_ = audio_to_spectralflux_tf(y, win_length_novelty, hop_length_novelty, sr) # get fourier tempogram tempogram = tf.transpose(PDDSP_spectral_ops.stft(oenv, win_length, frame_step=hop_length, fft_length=win_length, pad_end=False, center=True, window_fn=tf.signal.hann_window)) # restrict to tempo range prior tempo_frequencies = tf.cast(fourier_tempo_frequencies(sr=sr_, hop_length=hop_length, win_length=win_length), dtype=tf.float32) mask = tempo_frequencies < tempo_max mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) mask = tempo_frequencies > tempo_min mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) # discard everything below the peak ftmag = tf.math.log1p(1e6 * np.abs(tempogram)) if prior is not None: log_prob = tf.squeeze(prior.log_prob(tempo_frequencies)) log_prob = tf.tile(log_prob[:, tf.newaxis], [1, ftmag.shape[1]]) ftmag += log_prob peak_values = tf.math.reduce_max(ftmag, axis=0, keepdims=True) peak_values = tf.tile(peak_values, [ftmag.shape[0], 1]) tempogram = tf.cast(ftmag >= peak_values, dtype=tempogram.dtype) * tempogram # todo keep only phase #ftgram = tempogram.numpy() #import librosa #ftgram /= librosa.util.tiny(ftgram) ** 0.5 + np.abs(ftgram.max(axis=0, keepdims=True)) #tempogram = tf.cast(ftgram, dtype=tf.complex64) # Compute pulse by inverting the tempogram pulse = PDDSP_spectral_ops.inverse_stft( tf.transpose(tempogram), win_length, hop_length, fft_length=win_length, center=True, window_fn=tf.signal.inverse_stft_window_fn(hop_length, forward_window_fn=tf.signal.hann_window)) # retain only the positive part and normalize pulse /= tf.math.reduce_max(pulse) pulse -= tf.math.reduce_mean(pulse) pulse = tf.clip_by_value(pulse, clip_value_min=0, clip_value_max=100000) # compute mean period and expected next onset position F_mean = dominant_freq_from_tempogram(tempogram, tempo_frequencies) period_mean, mean_offset, next_onset_shift, peaks = period_from_pulse(pulse, F_mean, sr=sr_, loudness_min=loudness_min, loudness_max=loudness_max) period_mean, next_onset_shift, mean_offset = (period_mean/sr_)*sr, (next_onset_shift/sr_)*sr, (mean_offset/sr_)*sr return pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift def period_from_pulse(pulse, F_mean_in_Hz, sr, loudness_min=0.1, loudness_max=1.): """Compute mean period and the next expected onset position""" # Find last peak in the pulse peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] first_peak = tf.cast(peaks[0], dtype=tf.float32) if peaks.shape[0] > 1 else 0. last_peak = tf.cast(peaks[-1], dtype=tf.float32) if peaks.shape[0] > 1 else 0. # return average offset for each peak mean_offset = tf.math.reduce_mean(tf.cast([tf.math.floormod(tf.cast(peak, dtype=tf.int64), tf.cast(sr, dtype=tf.int64)) for peak in peaks], dtype=tf.float32)) # Compute mean period period_mean = (1/F_mean_in_Hz) * sr # Predict the first onset in the next audio input next_onset_shift = tf.abs(period_mean - (tf.cast(pulse.shape[0], dtype=tf.float32) - last_peak)) next_onset_shift = tf.math.floormod(next_onset_shift, period_mean) return period_mean, mean_offset, next_onset_shift, peaks def dominant_freq_from_tempogram(tempogram, tempo_frequencies, return_Hz = True): """Calculate dominant frequency from tempogram.""" tempo_BPM_max = tempo_frequencies \ * tf.cast(tf.math.abs(tempogram[:, 0]) == tf.math.reduce_max(tf.math.abs(tempogram[:, 0])), tempo_frequencies.dtype) if return_Hz: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max)/60, dtype=tf.float32) else: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max), dtype=tf.float32) weights = tf.cast(tf.math.abs(tempogram[:, 0]), dtype=tf.float32) weighted_mean = tf.nn.weighted_moments(tempo_frequencies, axes=[0], frequency_weights=weights)[0] if return_Hz: weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean/60, dtype=tf.float32), axis = 0) else: weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean, dtype=tf.float32), axis = 0) dominant_tempo = tf.expand_dims(dominant_tempo, axis=0) out = tf.concat([dominant_tempo, weighted_mean_tempo], axis=0) return tf.cast(out, dtype=tf.float32) def encode_song(y, sr, chunks=8, tempo_min=60, tempo_max=300, f_low=400, f_high=450, loudness_min=0.1, loudness_max=1, filter=False, plot=True, padding_seconds=4, frame_step=0.1): """Run PLP encoder over all chunks in a song""" if chunks != 0: y_list = tf.signal.frame(y, sr*chunks, int(sr*frame_step), pad_end=True, pad_value=0, axis=-1) # TODO padding else: y_list = [tf.cast(y, dtype=tf.float32)] tempo_mean_list, period_mean_list, beats_list = None, None, None for y, index in zip(y_list, range(len(y_list))): # Bandpass filter audio if filter: y = bandpass_filter_audio(y[tf.newaxis,:], f_low=f_low, f_high=f_high) # Compute phase and period pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift = plp_tf( y=y, sr=sr, tempo_min=tempo_min, tempo_max=tempo_max, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.2, loudness_max=1.) if tempo_mean_list is None: tempo_mean_list = [F_mean] # in Hz period_mean_list = [mean_offset/sr] # in seconds else: tempo_mean_list.append(F_mean) # in Hz period_mean_list.append(mean_offset/sr) # in seconds # Compute beat positions via local maxima beats = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] # correct timing in each chunk beats = tf.cast(beats, dtype=tf.float32) + (tf.cast(index, dtype=tf.float32) * pulse.shape[0]) beats = beats - padding_seconds*sr_ #remove padding #TODO fix if beats_list is None: beats_list = beats else: beats_list = np.concatenate([beats_list, beats], axis=0) # Optionally plot tempogram and pulse for each input if plot: plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, 1) plot_librosa_tempogram(y.numpy(), sr) # samples to time beats_list = np.asarray(beats_list) / sr_ return tempo_mean_list, period_mean_list, beats_list, oenv.numpy() """Helper functions""" def plot_librosa_tempogram(y, sr, hop_length = 512): oenv = librosa.onset.onset_strength(y=y, sr=sr, hop_length=hop_length) tempogram = librosa.feature.fourier_tempogram(onset_envelope=oenv, sr=sr, hop_length=hop_length) librosa.display.specshow(np.abs(tempogram), sr=sr, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.title('Librosa Fourier tempogram') plt.show() def plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, hop_length, plot_pulse=True): """Plots tempogram and local pulse.""" tempogram = tempogram.numpy() librosa.display.specshow(np.abs(tempogram), sr=sr_, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.show() peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=0.1, clip_value_max=1.))[1:] if plot_pulse: oenv = oenv.numpy() pulse = pulse.numpy() plt.plot(oenv, color="black") plt.plot(pulse, color="blue") plt.plot(peaks, pulse[peaks.numpy()], "ro") plt.show()
"""Tensorflow-based implementation of librosa.core.fourier_tempo_frequencies""" return fft_frequencies(sr=sr * 60 / float(hop_length), n_fft=win_length)
identifier_body
PDDSP_encoder.py
""" Predictive Encoder""" import sys sys.path.append('APC') import tensorflow as tf import numpy as np import matplotlib.pyplot as plt import librosa import ddsp.core as core import PLP_model.PDDSP_spectral_ops as PDDSP_spectral_ops def np_diff(a, n=1, axis=-1): """Tensorflow implementation of np.diff""" if n == 0: return a if n < 0: raise ValueError( "order must be non-negative but got " + repr(n)) nd = len(a.shape) slice1 = [slice(None)]*nd slice2 = [slice(None)]*nd slice1[axis] = slice(1, None) slice2[axis] = slice(None, -1) slice1 = tuple(slice1) slice2 = tuple(slice2) if n > 1: return np_diff(a[slice1]-a[slice2], n-1, axis=axis) else: return a[slice1]-a[slice2] def audio_to_spectralflux_tf(audio, N, H, Fs): """ computes novelty via differences in the spectral energy between adjacent frames """ X = tf.transpose(PDDSP_spectral_ops.stft(audio, N, H, fft_length=N, pad_end=False, center=True, # todo centering? window_fn=tf.signal.hann_window)) gamma = 10 # todo tune compression prior, make adaptive? Y = tf.math.log(1 + gamma * np.abs(X)) Y_diff = np_diff(Y, n=1) Y_diff = tf.clip_by_value(Y_diff, clip_value_min=0., clip_value_max=1000000.) # todo # todo replace the audio filtering with adaptive weighting of FT bins: nov = tf.reduce_mean(Y_diff, axis=0) # todo tune aggregation function nov = tf.concat([nov, np.array([0])], axis=0) Fs_nov = Fs / H nov -= tf.math.reduce_mean(nov) # todo tune output normalization nov = tf.clip_by_value(nov, clip_value_min=0., clip_value_max=1000000.) nov /= tf.math.reduce_max(nov) # normalize return nov, Fs_nov def get_slope(prev, cur): return tf.cond(prev[0] < cur, lambda: (cur, ascending_or_valley(prev, cur)), lambda: (cur, descending_or_peak(prev, cur))) def ascending_or_valley(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('A'), lambda: np.array('V')) def descending_or_peak(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('P'), lambda: np.array('D')) def label_local_extrema(tens): """Return a vector of chars indicating ascending, descending, peak, or valley slopes""" initializer = (np.array(0, dtype=np.float32), np.array('A')) slope = tf.scan(get_slope, tens, initializer) return slope[1][1:] def find_local_maxima(tens): """Tensorflow peak picking via local maxima Returns the indices of the local maxima of the first dimension of the tensor Based on https://stackoverflow.com/questions/48178286/finding-local-maxima-with-tensorflow """ return tf.squeeze(tf.where(tf.equal(label_local_extrema(tens), 'P'))) def fft_frequencies(sr=22050, n_fft=2048): """Tensorflow-based implementation of np.fft.fftfreq """ # TODO endpoint=True return tf.linspace(0, tf.cast(sr/2., dtype=tf.int32), tf.cast(1. + n_fft // 2., dtype=tf.int32)) def fourier_tempo_frequencies(sr=22050, win_length=384, hop_length=512): """Tensorflow-based implementation of librosa.core.fourier_tempo_frequencies""" return fft_frequencies(sr=sr * 60 / float(hop_length), n_fft=win_length) def bandpass_filter_audio(audio, f_low=400, f_high=450): """Bandpass filters audio to given frequency range""" filtered_audio = core.sinc_filter(audio, f_low, window_size=256, high_pass=True) filtered_audio = core.sinc_filter(filtered_audio, f_high, window_size=256, high_pass=False) return tf.squeeze(filtered_audio) def plp_tf( y, sr=22050, tempo_min=30, tempo_max=300, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.1, loudness_max=1., prior=None): """Tensorflow-based implementation of librosa.beat.plp Process chain: audio -> spectral flux novelty -> Fourier tempogram -> local pulse """ y = tf.squeeze(y) # get spectral flux novelty oenv, sr_ = audio_to_spectralflux_tf(y, win_length_novelty, hop_length_novelty, sr) # get fourier tempogram tempogram = tf.transpose(PDDSP_spectral_ops.stft(oenv, win_length, frame_step=hop_length, fft_length=win_length, pad_end=False, center=True, window_fn=tf.signal.hann_window)) # restrict to tempo range prior tempo_frequencies = tf.cast(fourier_tempo_frequencies(sr=sr_, hop_length=hop_length, win_length=win_length), dtype=tf.float32) mask = tempo_frequencies < tempo_max mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) mask = tempo_frequencies > tempo_min mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) # discard everything below the peak ftmag = tf.math.log1p(1e6 * np.abs(tempogram)) if prior is not None: log_prob = tf.squeeze(prior.log_prob(tempo_frequencies)) log_prob = tf.tile(log_prob[:, tf.newaxis], [1, ftmag.shape[1]]) ftmag += log_prob peak_values = tf.math.reduce_max(ftmag, axis=0, keepdims=True) peak_values = tf.tile(peak_values, [ftmag.shape[0], 1]) tempogram = tf.cast(ftmag >= peak_values, dtype=tempogram.dtype) * tempogram # todo keep only phase #ftgram = tempogram.numpy() #import librosa #ftgram /= librosa.util.tiny(ftgram) ** 0.5 + np.abs(ftgram.max(axis=0, keepdims=True)) #tempogram = tf.cast(ftgram, dtype=tf.complex64) # Compute pulse by inverting the tempogram pulse = PDDSP_spectral_ops.inverse_stft( tf.transpose(tempogram), win_length, hop_length, fft_length=win_length, center=True, window_fn=tf.signal.inverse_stft_window_fn(hop_length, forward_window_fn=tf.signal.hann_window)) # retain only the positive part and normalize pulse /= tf.math.reduce_max(pulse) pulse -= tf.math.reduce_mean(pulse) pulse = tf.clip_by_value(pulse, clip_value_min=0, clip_value_max=100000) # compute mean period and expected next onset position F_mean = dominant_freq_from_tempogram(tempogram, tempo_frequencies) period_mean, mean_offset, next_onset_shift, peaks = period_from_pulse(pulse, F_mean, sr=sr_, loudness_min=loudness_min, loudness_max=loudness_max) period_mean, next_onset_shift, mean_offset = (period_mean/sr_)*sr, (next_onset_shift/sr_)*sr, (mean_offset/sr_)*sr return pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift def period_from_pulse(pulse, F_mean_in_Hz, sr, loudness_min=0.1, loudness_max=1.): """Compute mean period and the next expected onset position""" # Find last peak in the pulse peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] first_peak = tf.cast(peaks[0], dtype=tf.float32) if peaks.shape[0] > 1 else 0. last_peak = tf.cast(peaks[-1], dtype=tf.float32) if peaks.shape[0] > 1 else 0. # return average offset for each peak mean_offset = tf.math.reduce_mean(tf.cast([tf.math.floormod(tf.cast(peak, dtype=tf.int64), tf.cast(sr, dtype=tf.int64)) for peak in peaks], dtype=tf.float32)) # Compute mean period period_mean = (1/F_mean_in_Hz) * sr # Predict the first onset in the next audio input next_onset_shift = tf.abs(period_mean - (tf.cast(pulse.shape[0], dtype=tf.float32) - last_peak)) next_onset_shift = tf.math.floormod(next_onset_shift, period_mean) return period_mean, mean_offset, next_onset_shift, peaks def dominant_freq_from_tempogram(tempogram, tempo_frequencies, return_Hz = True): """Calculate dominant frequency from tempogram.""" tempo_BPM_max = tempo_frequencies \ * tf.cast(tf.math.abs(tempogram[:, 0]) == tf.math.reduce_max(tf.math.abs(tempogram[:, 0])), tempo_frequencies.dtype) if return_Hz: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max)/60, dtype=tf.float32) else: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max), dtype=tf.float32) weights = tf.cast(tf.math.abs(tempogram[:, 0]), dtype=tf.float32) weighted_mean = tf.nn.weighted_moments(tempo_frequencies, axes=[0], frequency_weights=weights)[0] if return_Hz: weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean/60, dtype=tf.float32), axis = 0) else:
dominant_tempo = tf.expand_dims(dominant_tempo, axis=0) out = tf.concat([dominant_tempo, weighted_mean_tempo], axis=0) return tf.cast(out, dtype=tf.float32) def encode_song(y, sr, chunks=8, tempo_min=60, tempo_max=300, f_low=400, f_high=450, loudness_min=0.1, loudness_max=1, filter=False, plot=True, padding_seconds=4, frame_step=0.1): """Run PLP encoder over all chunks in a song""" if chunks != 0: y_list = tf.signal.frame(y, sr*chunks, int(sr*frame_step), pad_end=True, pad_value=0, axis=-1) # TODO padding else: y_list = [tf.cast(y, dtype=tf.float32)] tempo_mean_list, period_mean_list, beats_list = None, None, None for y, index in zip(y_list, range(len(y_list))): # Bandpass filter audio if filter: y = bandpass_filter_audio(y[tf.newaxis,:], f_low=f_low, f_high=f_high) # Compute phase and period pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift = plp_tf( y=y, sr=sr, tempo_min=tempo_min, tempo_max=tempo_max, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.2, loudness_max=1.) if tempo_mean_list is None: tempo_mean_list = [F_mean] # in Hz period_mean_list = [mean_offset/sr] # in seconds else: tempo_mean_list.append(F_mean) # in Hz period_mean_list.append(mean_offset/sr) # in seconds # Compute beat positions via local maxima beats = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] # correct timing in each chunk beats = tf.cast(beats, dtype=tf.float32) + (tf.cast(index, dtype=tf.float32) * pulse.shape[0]) beats = beats - padding_seconds*sr_ #remove padding #TODO fix if beats_list is None: beats_list = beats else: beats_list = np.concatenate([beats_list, beats], axis=0) # Optionally plot tempogram and pulse for each input if plot: plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, 1) plot_librosa_tempogram(y.numpy(), sr) # samples to time beats_list = np.asarray(beats_list) / sr_ return tempo_mean_list, period_mean_list, beats_list, oenv.numpy() """Helper functions""" def plot_librosa_tempogram(y, sr, hop_length = 512): oenv = librosa.onset.onset_strength(y=y, sr=sr, hop_length=hop_length) tempogram = librosa.feature.fourier_tempogram(onset_envelope=oenv, sr=sr, hop_length=hop_length) librosa.display.specshow(np.abs(tempogram), sr=sr, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.title('Librosa Fourier tempogram') plt.show() def plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, hop_length, plot_pulse=True): """Plots tempogram and local pulse.""" tempogram = tempogram.numpy() librosa.display.specshow(np.abs(tempogram), sr=sr_, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.show() peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=0.1, clip_value_max=1.))[1:] if plot_pulse: oenv = oenv.numpy() pulse = pulse.numpy() plt.plot(oenv, color="black") plt.plot(pulse, color="blue") plt.plot(peaks, pulse[peaks.numpy()], "ro") plt.show()
weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean, dtype=tf.float32), axis = 0)
conditional_block
PDDSP_encoder.py
""" Predictive Encoder""" import sys sys.path.append('APC') import tensorflow as tf import numpy as np import matplotlib.pyplot as plt import librosa import ddsp.core as core import PLP_model.PDDSP_spectral_ops as PDDSP_spectral_ops def np_diff(a, n=1, axis=-1): """Tensorflow implementation of np.diff""" if n == 0: return a if n < 0: raise ValueError( "order must be non-negative but got " + repr(n)) nd = len(a.shape) slice1 = [slice(None)]*nd slice2 = [slice(None)]*nd slice1[axis] = slice(1, None) slice2[axis] = slice(None, -1) slice1 = tuple(slice1) slice2 = tuple(slice2) if n > 1: return np_diff(a[slice1]-a[slice2], n-1, axis=axis) else: return a[slice1]-a[slice2] def audio_to_spectralflux_tf(audio, N, H, Fs): """ computes novelty via differences in the spectral energy between adjacent frames """ X = tf.transpose(PDDSP_spectral_ops.stft(audio, N, H, fft_length=N, pad_end=False, center=True, # todo centering? window_fn=tf.signal.hann_window)) gamma = 10 # todo tune compression prior, make adaptive? Y = tf.math.log(1 + gamma * np.abs(X)) Y_diff = np_diff(Y, n=1) Y_diff = tf.clip_by_value(Y_diff, clip_value_min=0., clip_value_max=1000000.) # todo # todo replace the audio filtering with adaptive weighting of FT bins: nov = tf.reduce_mean(Y_diff, axis=0) # todo tune aggregation function nov = tf.concat([nov, np.array([0])], axis=0) Fs_nov = Fs / H nov -= tf.math.reduce_mean(nov) # todo tune output normalization nov = tf.clip_by_value(nov, clip_value_min=0., clip_value_max=1000000.) nov /= tf.math.reduce_max(nov) # normalize return nov, Fs_nov def get_slope(prev, cur): return tf.cond(prev[0] < cur, lambda: (cur, ascending_or_valley(prev, cur)), lambda: (cur, descending_or_peak(prev, cur))) def ascending_or_valley(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('A'), lambda: np.array('V')) def descending_or_peak(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('P'), lambda: np.array('D')) def label_local_extrema(tens): """Return a vector of chars indicating ascending, descending, peak, or valley slopes""" initializer = (np.array(0, dtype=np.float32), np.array('A')) slope = tf.scan(get_slope, tens, initializer) return slope[1][1:] def
(tens): """Tensorflow peak picking via local maxima Returns the indices of the local maxima of the first dimension of the tensor Based on https://stackoverflow.com/questions/48178286/finding-local-maxima-with-tensorflow """ return tf.squeeze(tf.where(tf.equal(label_local_extrema(tens), 'P'))) def fft_frequencies(sr=22050, n_fft=2048): """Tensorflow-based implementation of np.fft.fftfreq """ # TODO endpoint=True return tf.linspace(0, tf.cast(sr/2., dtype=tf.int32), tf.cast(1. + n_fft // 2., dtype=tf.int32)) def fourier_tempo_frequencies(sr=22050, win_length=384, hop_length=512): """Tensorflow-based implementation of librosa.core.fourier_tempo_frequencies""" return fft_frequencies(sr=sr * 60 / float(hop_length), n_fft=win_length) def bandpass_filter_audio(audio, f_low=400, f_high=450): """Bandpass filters audio to given frequency range""" filtered_audio = core.sinc_filter(audio, f_low, window_size=256, high_pass=True) filtered_audio = core.sinc_filter(filtered_audio, f_high, window_size=256, high_pass=False) return tf.squeeze(filtered_audio) def plp_tf( y, sr=22050, tempo_min=30, tempo_max=300, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.1, loudness_max=1., prior=None): """Tensorflow-based implementation of librosa.beat.plp Process chain: audio -> spectral flux novelty -> Fourier tempogram -> local pulse """ y = tf.squeeze(y) # get spectral flux novelty oenv, sr_ = audio_to_spectralflux_tf(y, win_length_novelty, hop_length_novelty, sr) # get fourier tempogram tempogram = tf.transpose(PDDSP_spectral_ops.stft(oenv, win_length, frame_step=hop_length, fft_length=win_length, pad_end=False, center=True, window_fn=tf.signal.hann_window)) # restrict to tempo range prior tempo_frequencies = tf.cast(fourier_tempo_frequencies(sr=sr_, hop_length=hop_length, win_length=win_length), dtype=tf.float32) mask = tempo_frequencies < tempo_max mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) mask = tempo_frequencies > tempo_min mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) # discard everything below the peak ftmag = tf.math.log1p(1e6 * np.abs(tempogram)) if prior is not None: log_prob = tf.squeeze(prior.log_prob(tempo_frequencies)) log_prob = tf.tile(log_prob[:, tf.newaxis], [1, ftmag.shape[1]]) ftmag += log_prob peak_values = tf.math.reduce_max(ftmag, axis=0, keepdims=True) peak_values = tf.tile(peak_values, [ftmag.shape[0], 1]) tempogram = tf.cast(ftmag >= peak_values, dtype=tempogram.dtype) * tempogram # todo keep only phase #ftgram = tempogram.numpy() #import librosa #ftgram /= librosa.util.tiny(ftgram) ** 0.5 + np.abs(ftgram.max(axis=0, keepdims=True)) #tempogram = tf.cast(ftgram, dtype=tf.complex64) # Compute pulse by inverting the tempogram pulse = PDDSP_spectral_ops.inverse_stft( tf.transpose(tempogram), win_length, hop_length, fft_length=win_length, center=True, window_fn=tf.signal.inverse_stft_window_fn(hop_length, forward_window_fn=tf.signal.hann_window)) # retain only the positive part and normalize pulse /= tf.math.reduce_max(pulse) pulse -= tf.math.reduce_mean(pulse) pulse = tf.clip_by_value(pulse, clip_value_min=0, clip_value_max=100000) # compute mean period and expected next onset position F_mean = dominant_freq_from_tempogram(tempogram, tempo_frequencies) period_mean, mean_offset, next_onset_shift, peaks = period_from_pulse(pulse, F_mean, sr=sr_, loudness_min=loudness_min, loudness_max=loudness_max) period_mean, next_onset_shift, mean_offset = (period_mean/sr_)*sr, (next_onset_shift/sr_)*sr, (mean_offset/sr_)*sr return pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift def period_from_pulse(pulse, F_mean_in_Hz, sr, loudness_min=0.1, loudness_max=1.): """Compute mean period and the next expected onset position""" # Find last peak in the pulse peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] first_peak = tf.cast(peaks[0], dtype=tf.float32) if peaks.shape[0] > 1 else 0. last_peak = tf.cast(peaks[-1], dtype=tf.float32) if peaks.shape[0] > 1 else 0. # return average offset for each peak mean_offset = tf.math.reduce_mean(tf.cast([tf.math.floormod(tf.cast(peak, dtype=tf.int64), tf.cast(sr, dtype=tf.int64)) for peak in peaks], dtype=tf.float32)) # Compute mean period period_mean = (1/F_mean_in_Hz) * sr # Predict the first onset in the next audio input next_onset_shift = tf.abs(period_mean - (tf.cast(pulse.shape[0], dtype=tf.float32) - last_peak)) next_onset_shift = tf.math.floormod(next_onset_shift, period_mean) return period_mean, mean_offset, next_onset_shift, peaks def dominant_freq_from_tempogram(tempogram, tempo_frequencies, return_Hz = True): """Calculate dominant frequency from tempogram.""" tempo_BPM_max = tempo_frequencies \ * tf.cast(tf.math.abs(tempogram[:, 0]) == tf.math.reduce_max(tf.math.abs(tempogram[:, 0])), tempo_frequencies.dtype) if return_Hz: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max)/60, dtype=tf.float32) else: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max), dtype=tf.float32) weights = tf.cast(tf.math.abs(tempogram[:, 0]), dtype=tf.float32) weighted_mean = tf.nn.weighted_moments(tempo_frequencies, axes=[0], frequency_weights=weights)[0] if return_Hz: weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean/60, dtype=tf.float32), axis = 0) else: weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean, dtype=tf.float32), axis = 0) dominant_tempo = tf.expand_dims(dominant_tempo, axis=0) out = tf.concat([dominant_tempo, weighted_mean_tempo], axis=0) return tf.cast(out, dtype=tf.float32) def encode_song(y, sr, chunks=8, tempo_min=60, tempo_max=300, f_low=400, f_high=450, loudness_min=0.1, loudness_max=1, filter=False, plot=True, padding_seconds=4, frame_step=0.1): """Run PLP encoder over all chunks in a song""" if chunks != 0: y_list = tf.signal.frame(y, sr*chunks, int(sr*frame_step), pad_end=True, pad_value=0, axis=-1) # TODO padding else: y_list = [tf.cast(y, dtype=tf.float32)] tempo_mean_list, period_mean_list, beats_list = None, None, None for y, index in zip(y_list, range(len(y_list))): # Bandpass filter audio if filter: y = bandpass_filter_audio(y[tf.newaxis,:], f_low=f_low, f_high=f_high) # Compute phase and period pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift = plp_tf( y=y, sr=sr, tempo_min=tempo_min, tempo_max=tempo_max, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.2, loudness_max=1.) if tempo_mean_list is None: tempo_mean_list = [F_mean] # in Hz period_mean_list = [mean_offset/sr] # in seconds else: tempo_mean_list.append(F_mean) # in Hz period_mean_list.append(mean_offset/sr) # in seconds # Compute beat positions via local maxima beats = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] # correct timing in each chunk beats = tf.cast(beats, dtype=tf.float32) + (tf.cast(index, dtype=tf.float32) * pulse.shape[0]) beats = beats - padding_seconds*sr_ #remove padding #TODO fix if beats_list is None: beats_list = beats else: beats_list = np.concatenate([beats_list, beats], axis=0) # Optionally plot tempogram and pulse for each input if plot: plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, 1) plot_librosa_tempogram(y.numpy(), sr) # samples to time beats_list = np.asarray(beats_list) / sr_ return tempo_mean_list, period_mean_list, beats_list, oenv.numpy() """Helper functions""" def plot_librosa_tempogram(y, sr, hop_length = 512): oenv = librosa.onset.onset_strength(y=y, sr=sr, hop_length=hop_length) tempogram = librosa.feature.fourier_tempogram(onset_envelope=oenv, sr=sr, hop_length=hop_length) librosa.display.specshow(np.abs(tempogram), sr=sr, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.title('Librosa Fourier tempogram') plt.show() def plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, hop_length, plot_pulse=True): """Plots tempogram and local pulse.""" tempogram = tempogram.numpy() librosa.display.specshow(np.abs(tempogram), sr=sr_, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.show() peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=0.1, clip_value_max=1.))[1:] if plot_pulse: oenv = oenv.numpy() pulse = pulse.numpy() plt.plot(oenv, color="black") plt.plot(pulse, color="blue") plt.plot(peaks, pulse[peaks.numpy()], "ro") plt.show()
find_local_maxima
identifier_name
PDDSP_encoder.py
""" Predictive Encoder""" import sys sys.path.append('APC') import tensorflow as tf import numpy as np import matplotlib.pyplot as plt import librosa import ddsp.core as core import PLP_model.PDDSP_spectral_ops as PDDSP_spectral_ops def np_diff(a, n=1, axis=-1): """Tensorflow implementation of np.diff""" if n == 0: return a if n < 0: raise ValueError( "order must be non-negative but got " + repr(n)) nd = len(a.shape) slice1 = [slice(None)]*nd slice2 = [slice(None)]*nd slice1[axis] = slice(1, None) slice2[axis] = slice(None, -1) slice1 = tuple(slice1) slice2 = tuple(slice2) if n > 1: return np_diff(a[slice1]-a[slice2], n-1, axis=axis) else: return a[slice1]-a[slice2] def audio_to_spectralflux_tf(audio, N, H, Fs): """ computes novelty via differences in the spectral energy between adjacent frames """ X = tf.transpose(PDDSP_spectral_ops.stft(audio, N, H, fft_length=N, pad_end=False, center=True, # todo centering? window_fn=tf.signal.hann_window)) gamma = 10 # todo tune compression prior, make adaptive? Y = tf.math.log(1 + gamma * np.abs(X)) Y_diff = np_diff(Y, n=1) Y_diff = tf.clip_by_value(Y_diff, clip_value_min=0., clip_value_max=1000000.) # todo # todo replace the audio filtering with adaptive weighting of FT bins: nov = tf.reduce_mean(Y_diff, axis=0) # todo tune aggregation function nov = tf.concat([nov, np.array([0])], axis=0) Fs_nov = Fs / H nov -= tf.math.reduce_mean(nov) # todo tune output normalization nov = tf.clip_by_value(nov, clip_value_min=0., clip_value_max=1000000.) nov /= tf.math.reduce_max(nov) # normalize return nov, Fs_nov def get_slope(prev, cur): return tf.cond(prev[0] < cur, lambda: (cur, ascending_or_valley(prev, cur)), lambda: (cur, descending_or_peak(prev, cur))) def ascending_or_valley(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('A'), lambda: np.array('V')) def descending_or_peak(prev, cur): return tf.cond(tf.logical_or(tf.equal(prev[1], 'A'), tf.equal(prev[1], 'V')), lambda: np.array('P'), lambda: np.array('D')) def label_local_extrema(tens): """Return a vector of chars indicating ascending, descending, peak, or valley slopes""" initializer = (np.array(0, dtype=np.float32), np.array('A')) slope = tf.scan(get_slope, tens, initializer) return slope[1][1:] def find_local_maxima(tens): """Tensorflow peak picking via local maxima Returns the indices of the local maxima of the first dimension of the tensor Based on https://stackoverflow.com/questions/48178286/finding-local-maxima-with-tensorflow """ return tf.squeeze(tf.where(tf.equal(label_local_extrema(tens), 'P'))) def fft_frequencies(sr=22050, n_fft=2048): """Tensorflow-based implementation of np.fft.fftfreq """ # TODO endpoint=True return tf.linspace(0, tf.cast(sr/2., dtype=tf.int32), tf.cast(1. + n_fft // 2., dtype=tf.int32)) def fourier_tempo_frequencies(sr=22050, win_length=384, hop_length=512): """Tensorflow-based implementation of librosa.core.fourier_tempo_frequencies""" return fft_frequencies(sr=sr * 60 / float(hop_length), n_fft=win_length) def bandpass_filter_audio(audio, f_low=400, f_high=450): """Bandpass filters audio to given frequency range""" filtered_audio = core.sinc_filter(audio, f_low, window_size=256, high_pass=True) filtered_audio = core.sinc_filter(filtered_audio, f_high, window_size=256, high_pass=False) return tf.squeeze(filtered_audio) def plp_tf( y, sr=22050, tempo_min=30, tempo_max=300, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.1, loudness_max=1., prior=None): """Tensorflow-based implementation of librosa.beat.plp Process chain: audio -> spectral flux novelty -> Fourier tempogram -> local pulse """ y = tf.squeeze(y) # get spectral flux novelty oenv, sr_ = audio_to_spectralflux_tf(y, win_length_novelty, hop_length_novelty, sr) # get fourier tempogram tempogram = tf.transpose(PDDSP_spectral_ops.stft(oenv, win_length, frame_step=hop_length, fft_length=win_length, pad_end=False, center=True, window_fn=tf.signal.hann_window)) # restrict to tempo range prior tempo_frequencies = tf.cast(fourier_tempo_frequencies(sr=sr_, hop_length=hop_length, win_length=win_length), dtype=tf.float32) mask = tempo_frequencies < tempo_max mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) mask = tempo_frequencies > tempo_min mask = tf.tile(mask[:, tf.newaxis], [1, tempogram.shape[1]]) tempogram = tempogram * tf.cast(mask, dtype=tempogram.dtype) # discard everything below the peak ftmag = tf.math.log1p(1e6 * np.abs(tempogram)) if prior is not None: log_prob = tf.squeeze(prior.log_prob(tempo_frequencies)) log_prob = tf.tile(log_prob[:, tf.newaxis], [1, ftmag.shape[1]]) ftmag += log_prob peak_values = tf.math.reduce_max(ftmag, axis=0, keepdims=True) peak_values = tf.tile(peak_values, [ftmag.shape[0], 1]) tempogram = tf.cast(ftmag >= peak_values, dtype=tempogram.dtype) * tempogram # todo keep only phase #ftgram = tempogram.numpy() #import librosa #ftgram /= librosa.util.tiny(ftgram) ** 0.5 + np.abs(ftgram.max(axis=0, keepdims=True)) #tempogram = tf.cast(ftgram, dtype=tf.complex64) # Compute pulse by inverting the tempogram pulse = PDDSP_spectral_ops.inverse_stft( tf.transpose(tempogram), win_length, hop_length, fft_length=win_length, center=True, window_fn=tf.signal.inverse_stft_window_fn(hop_length, forward_window_fn=tf.signal.hann_window)) # retain only the positive part and normalize pulse /= tf.math.reduce_max(pulse) pulse -= tf.math.reduce_mean(pulse) pulse = tf.clip_by_value(pulse, clip_value_min=0, clip_value_max=100000) # compute mean period and expected next onset position F_mean = dominant_freq_from_tempogram(tempogram, tempo_frequencies) period_mean, mean_offset, next_onset_shift, peaks = period_from_pulse(pulse, F_mean, sr=sr_, loudness_min=loudness_min, loudness_max=loudness_max) period_mean, next_onset_shift, mean_offset = (period_mean/sr_)*sr, (next_onset_shift/sr_)*sr, (mean_offset/sr_)*sr return pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift
def period_from_pulse(pulse, F_mean_in_Hz, sr, loudness_min=0.1, loudness_max=1.): """Compute mean period and the next expected onset position""" # Find last peak in the pulse peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] first_peak = tf.cast(peaks[0], dtype=tf.float32) if peaks.shape[0] > 1 else 0. last_peak = tf.cast(peaks[-1], dtype=tf.float32) if peaks.shape[0] > 1 else 0. # return average offset for each peak mean_offset = tf.math.reduce_mean(tf.cast([tf.math.floormod(tf.cast(peak, dtype=tf.int64), tf.cast(sr, dtype=tf.int64)) for peak in peaks], dtype=tf.float32)) # Compute mean period period_mean = (1/F_mean_in_Hz) * sr # Predict the first onset in the next audio input next_onset_shift = tf.abs(period_mean - (tf.cast(pulse.shape[0], dtype=tf.float32) - last_peak)) next_onset_shift = tf.math.floormod(next_onset_shift, period_mean) return period_mean, mean_offset, next_onset_shift, peaks def dominant_freq_from_tempogram(tempogram, tempo_frequencies, return_Hz = True): """Calculate dominant frequency from tempogram.""" tempo_BPM_max = tempo_frequencies \ * tf.cast(tf.math.abs(tempogram[:, 0]) == tf.math.reduce_max(tf.math.abs(tempogram[:, 0])), tempo_frequencies.dtype) if return_Hz: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max)/60, dtype=tf.float32) else: dominant_tempo = tf.cast(tf.math.reduce_max(tempo_BPM_max), dtype=tf.float32) weights = tf.cast(tf.math.abs(tempogram[:, 0]), dtype=tf.float32) weighted_mean = tf.nn.weighted_moments(tempo_frequencies, axes=[0], frequency_weights=weights)[0] if return_Hz: weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean/60, dtype=tf.float32), axis = 0) else: weighted_mean_tempo = tf.expand_dims(tf.cast(weighted_mean, dtype=tf.float32), axis = 0) dominant_tempo = tf.expand_dims(dominant_tempo, axis=0) out = tf.concat([dominant_tempo, weighted_mean_tempo], axis=0) return tf.cast(out, dtype=tf.float32) def encode_song(y, sr, chunks=8, tempo_min=60, tempo_max=300, f_low=400, f_high=450, loudness_min=0.1, loudness_max=1, filter=False, plot=True, padding_seconds=4, frame_step=0.1): """Run PLP encoder over all chunks in a song""" if chunks != 0: y_list = tf.signal.frame(y, sr*chunks, int(sr*frame_step), pad_end=True, pad_value=0, axis=-1) # TODO padding else: y_list = [tf.cast(y, dtype=tf.float32)] tempo_mean_list, period_mean_list, beats_list = None, None, None for y, index in zip(y_list, range(len(y_list))): # Bandpass filter audio if filter: y = bandpass_filter_audio(y[tf.newaxis,:], f_low=f_low, f_high=f_high) # Compute phase and period pulse, tempogram, oenv, sr_, F_mean, period_mean, mean_offset, next_onset_shift = plp_tf( y=y, sr=sr, tempo_min=tempo_min, tempo_max=tempo_max, hop_length=1, win_length=512, hop_length_novelty=256, win_length_novelty=1024, loudness_min=0.2, loudness_max=1.) if tempo_mean_list is None: tempo_mean_list = [F_mean] # in Hz period_mean_list = [mean_offset/sr] # in seconds else: tempo_mean_list.append(F_mean) # in Hz period_mean_list.append(mean_offset/sr) # in seconds # Compute beat positions via local maxima beats = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=loudness_min, clip_value_max=loudness_max))[1:] # correct timing in each chunk beats = tf.cast(beats, dtype=tf.float32) + (tf.cast(index, dtype=tf.float32) * pulse.shape[0]) beats = beats - padding_seconds*sr_ #remove padding #TODO fix if beats_list is None: beats_list = beats else: beats_list = np.concatenate([beats_list, beats], axis=0) # Optionally plot tempogram and pulse for each input if plot: plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, 1) plot_librosa_tempogram(y.numpy(), sr) # samples to time beats_list = np.asarray(beats_list) / sr_ return tempo_mean_list, period_mean_list, beats_list, oenv.numpy() """Helper functions""" def plot_librosa_tempogram(y, sr, hop_length = 512): oenv = librosa.onset.onset_strength(y=y, sr=sr, hop_length=hop_length) tempogram = librosa.feature.fourier_tempogram(onset_envelope=oenv, sr=sr, hop_length=hop_length) librosa.display.specshow(np.abs(tempogram), sr=sr, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.title('Librosa Fourier tempogram') plt.show() def plot_tempogram_and_pulse(tempogram, pulse, oenv, sr_, hop_length, plot_pulse=True): """Plots tempogram and local pulse.""" tempogram = tempogram.numpy() librosa.display.specshow(np.abs(tempogram), sr=sr_, hop_length=hop_length, x_axis='time', y_axis='fourier_tempo', cmap='magma') plt.show() peaks = find_local_maxima(tf.clip_by_value(pulse, clip_value_min=0.1, clip_value_max=1.))[1:] if plot_pulse: oenv = oenv.numpy() pulse = pulse.numpy() plt.plot(oenv, color="black") plt.plot(pulse, color="blue") plt.plot(peaks, pulse[peaks.numpy()], "ro") plt.show()
random_line_split
test2.py
import os, sys import Tkinter import tkFileDialog import PIL from PIL import ImageTk, Image import numpy as np import matplotlib.pyplot as plt import matplotlib.patches as patches import matplotlib.path as path import cv2 from scipy.cluster.vq import kmeans from skimage import data, img_as_float #from skimage.measure import compare_ssim as ssim from skimage.measure import structural_similarity as ssim LETTERS = ["a","b","c","d","e","f","g","h","i","j","k","l","m", "n","o","p","q","r","s","t","u","v","w","x","y","z"] class Rectangle: def __init__(self, x_param=0, y_param=0, w_param=0, h_param=0): self.x = x_param self.y = y_param self.w = w_param self.h = h_param def __str__(self): return "Width = "+str(self.w)+", Height = "+str(self.h) class MainWindow: def __init__(self, master): self.video = None self.frame_rate = 0 self.video_length = 0 # The scaled image used for display. Needs to persist for display self.display_image = None self.display_ratio = 0 self.awaiting_corners = False self.corners = [] #Tkinter related fields self.master = master self.master.title("Auto Kifu Test2") self.window_width = root.winfo_screenwidth() self.window_height = root.winfo_screenheight() - 100 self.master.geometry("%dx%d+0+0" % (self.window_width, self.window_height)) self.master.configure(background='grey') self.canvas = Tkinter.Canvas(self.master) self.canvas.place(x=0, y=0, width=self.window_width, height=self.window_height) self.canvas.bind("<Button-1>", self.mouse_clicked) self.menubar = Tkinter.Menu(root) root.config(menu=self.menubar) self.fileMenu = Tkinter.Menu(self.menubar) self.fileMenu.add_command(label="Load Image", command=self.load()) self.menubar.add_cascade(label="File", menu=self.fileMenu) def mouse_clicked(self, event): if self.awaiting_corners: self.draw_x(event.x, event.y) self.corners += [(event.x/self.display_ratio, event.y/self.display_ratio)] if len(self.corners) == 4: self.awaiting_corners = False self.main() def main(self): board_positions, crop_window = self.find_grid(self.corners) frames = self.parse_video(crop_window) for x in range(len(frames)): frames[x] = cv2.cvtColor(frames[x], cv2.COLOR_BGR2GRAY) frames[x] = cv2.GaussianBlur(frames[x], (51, 51), 0) thresholds = self.determine_thresholds(frames[-1], board_positions) for x in range(len(frames)): cv2.imwrite('output/2/frames'+str(x)+'.png', frames[x]) for x in range(len(frames)): frames[x] = self.parse_frames(frames[x], board_positions, thresholds) for x in range(1, len(frames)): print "Board: "+str(x) self.print_board(frames[x]) output = "(;GM[1]FF[4]CA[UTF-8]AP[CGoban:3]ST[2]SZ[19]" for i in range(1, len(frames)): moves = self.frame_difference(frames[i-1], frames[i]) for move in moves: color = move["color"] x = LETTERS[move["position"][0]] y = LETTERS[move["position"][1]] output += ";"+color+"["+x+y+"]" output += ")" file = open("output.txt", "w") file.write(output) file.close() def find_grid(self, corners): top_left = corners[0] bottom_right = corners[2] board_width = bottom_right[0] - top_left[0] board_height = bottom_right[1] - top_left[1] horizontal_spacing = board_width / 18 vertical_spacing = board_height / 18 crop_window = Rectangle() crop_window.x = int(top_left[0] - horizontal_spacing) crop_window.y = int(top_left[1] - vertical_spacing) crop_window.w = int(board_width + (2 * horizontal_spacing)) crop_window.h = int(board_height + (2 * vertical_spacing)) board_positions = [] for x in range(0, 19): board_positions += [[]] for y in range(0, 19): x_coord = int(top_left[0] + horizontal_spacing * x) y_coord = int(top_left[1] + vertical_spacing * y) x_coord -= crop_window.x y_coord -= crop_window.y board_positions[x] += [(y_coord, x_coord)] return board_positions, crop_window def print_board(self, frame):
def parse_video(self, crop_window): fourcc = cv2.VideoWriter_fourcc(*'XVID') out1 = cv2.VideoWriter('output.avi', fourcc, 30.0, (crop_window.w, crop_window.h)) success, current_frame = self.video.read() current_frame = current_frame[crop_window.y:crop_window.y + crop_window.h, crop_window.x:crop_window.x + crop_window.w] differences = [] final_video = [current_frame] while (self.video.isOpened() and success): last_frame = current_frame success, current_frame = self.video.read() if not success: break current_frame = current_frame[crop_window.y:crop_window.y+crop_window.h, crop_window.x:crop_window.x+crop_window.w] out1.write(current_frame) s = self.mse_total(last_frame, current_frame) #s = ssim(last_frame, current_frame) # Doesn't Work differences += [s] recently_still = True still_duration = 15 for x in range(still_duration): if x<len(differences) and differences[-x]>4: recently_still = False if recently_still: #out1.write(current_frame) s = self.mse_total(current_frame, final_video[-1]) if s>20: final_video += [current_frame] #plt.hist(differences, bins=400) plt.title("Frame Difference Historgram") plt.xlabel("Difference (mean squared error)") plt.ylabel("Number of Frames") #plt.show() time = np.arange(0, self.video_length/self.frame_rate, 1.0/self.frame_rate) time = time[:len(differences)] #plt.plot(time, differences) plt.xlabel('time (s)') plt.ylabel('Difference') plt.title('MSE over Time') plt.grid(True) #plt.show() out1.release() ''' fourcc = cv2.VideoWriter_fourcc(*'XVID') out2 = cv2.VideoWriter('output2.avi', fourcc, 30.0, (self.crop_w, self.crop_h)) for x in final_video: for y in range(30): out2.write(x) out2.release() ''' return final_video def mse_total(self, imageA, imageB): err = np.sum((imageA.astype("float") - imageB.astype("float")) ** 2) err /= float(imageA.shape[0] * imageA.shape[1]) return err def mse_image(self, imageA, imageB): return (imageA - imageB) ** 2 def determine_thresholds(self, image, board_positions): samples = [] for x in range(0, 19): for y in range(0, 19): position = board_positions[x][y] samples += [float(image[position[0]][position[1]])] plt.hist(samples, bins=255) plt.title("Intersection Intensity Historgram") plt.xlabel("Intensity (Greyscale)") plt.ylabel("Number of Intersections") # plt.show() centroids, _ = kmeans(samples, 3) plt.axvline(x=centroids[0], color="red") plt.axvline(x=centroids[1], color="red") plt.axvline(x=centroids[2], color="red") plt.show() min = 0 mid = 0 max = 0 for x in range(0, 3): if centroids[x] < centroids[min]: min = x if centroids[x] > centroids[max]: max = x for x in range(0, 3): if x != min and x != max: mid = x min = centroids[min] mid = centroids[mid] max = centroids[max] threshold1 = (min + mid) / 2 threshold2 = (max + mid) / 2 print "threshold 1 = "+str(threshold1) print "threshold 2 = "+str(threshold2) #return [threshold1, threshold2] return [120,185] def parse_frames(self, image, board_positions, thresholds): return_array = [] for x in range(0, 19): return_array += [[]] for y in range(0, 19): position = board_positions[x][y] intensity = image[position[0]][position[1]] if intensity < thresholds[0]: return_array[x] += ["B"] elif intensity > thresholds[1]: return_array[x] += ["W"] else: return_array[x] += ["+"] return return_array def frame_difference(self, former_frame, later_frame): moves = [] for x in range(19): for y in range(19): if (later_frame[x][y] != former_frame[x][y] and former_frame[x][y] == "+"): moves += [{"color":later_frame[x][y], "position":(x,y)}] return moves def display_grid(self, board_positions): for x in range(0, 19): for y in range(0, 19): self.draw_x(board_positions[x][y][1], board_positions[x][y][0], transform=self.display_ratio) def draw_x(self, x, y, radius=10, width=3, color = "red", transform = 1): self.canvas.create_line((x-radius)*transform, (y-radius)*transform, (x+radius)*transform, (y+radius)*transform, width=width, fill=color) self.canvas.create_line((x-radius)*transform, (y+radius)*transform, (x+radius)*transform, (y-radius)*transform, width=width, fill=color) def load(self): # Load Video dir_path = os.path.dirname(os.path.realpath(__file__)) path = tkFileDialog.askopenfilename(initialdir=dir_path, title="Select file", filetypes=( ("mp4 files", "*.mp4"), ("jpeg files", "*.jpg"), ("png files", "*.png"))) self.video = cv2.VideoCapture(path) self.frame_rate = self.video.get(cv2.CAP_PROP_FPS) self.video_length = int(self.video.get(cv2.CAP_PROP_FRAME_COUNT)) success, first_frame = self.video.read() image_height, image_width = first_frame.shape[:2] # Display Image self.display_ratio = float(self.window_height - 200)/image_height resize_dimentions = (int(image_width*self.display_ratio), int(image_height*self.display_ratio)) resized_image = cv2.resize(first_frame, resize_dimentions, interpolation=cv2.INTER_CUBIC) tk_image = self.convert_cv2_to_PIL(resized_image) self.display_image = PIL.ImageTk.PhotoImage(tk_image) self.canvas.create_image(0, 0, anchor ="nw", image = self.display_image) # cue corner collection self.awaiting_corners = True def convert_cv2_to_PIL(self, cv2image): cv2_im = cv2.cvtColor(cv2image, cv2.COLOR_BGR2RGB) return PIL.Image.fromarray(cv2_im) root = Tkinter.Tk() main_window = MainWindow(root) root.mainloop()
print "-------------------" for y in range(19): string = "" for x in range(19): string += frame[x][y] print string print "-------------------"
identifier_body