Add files using upload-large-folder tool

ckpts/universal/global_step40/zero/16.attention.query_key_value.weight/exp_avg.pt

@@ -0,0 +1,3 @@
+version https://git-lfs.github.com/spec/v1
+oid sha256:afde3cede4adc1334c7a9c55de1b1f51c46a626bd30ef08b5c2f72ff3aea40e2
+size 50332828

ckpts/universal/global_step40/zero/16.attention.query_key_value.weight/fp32.pt

@@ -0,0 +1,3 @@
+version https://git-lfs.github.com/spec/v1
+oid sha256:0912f982ddaacb1da8501500b695615fe6baea1b6f3af90a819b1ab533c20c92
+size 50332749

ckpts/universal/global_step40/zero/7.attention.dense.weight/fp32.pt

@@ -0,0 +1,3 @@
+version https://git-lfs.github.com/spec/v1
+oid sha256:5c79525b81c8f0eebbae5022d5f47341e1febbc30438bfb99d81b1746926328e
+size 16778317

venv/lib/python3.10/site-packages/scipy/_lib/__init__.py

@@ -0,0 +1,14 @@
+"""
+Module containing private utility functions
+===========================================
+
+The ``scipy._lib`` namespace is empty (for now). Tests for all
+utilities in submodules of ``_lib`` can be run with::
+
+    from scipy import _lib
+    _lib.test()
+
+"""
+from scipy._lib._testutils import PytestTester
+test = PytestTester(__name__)
+del PytestTester

venv/lib/python3.10/site-packages/scipy/_lib/_array_api.py

@@ -0,0 +1,356 @@
+"""Utility functions to use Python Array API compatible libraries.
+
+For the context about the Array API see:
+https://data-apis.org/array-api/latest/purpose_and_scope.html
+
+The SciPy use case of the Array API is described on the following page:
+https://data-apis.org/array-api/latest/use_cases.html#use-case-scipy
+"""
+from __future__ import annotations
+
+import os
+import warnings
+
+import numpy as np
+
+from scipy._lib import array_api_compat
+from scipy._lib.array_api_compat import (
+    is_array_api_obj,
+    size,
+    numpy as np_compat,
+)
+
+__all__ = ['array_namespace', '_asarray', 'size']
+
+
+# To enable array API and strict array-like input validation
+SCIPY_ARRAY_API: str | bool = os.environ.get("SCIPY_ARRAY_API", False)
+# To control the default device - for use in the test suite only
+SCIPY_DEVICE = os.environ.get("SCIPY_DEVICE", "cpu")
+
+_GLOBAL_CONFIG = {
+    "SCIPY_ARRAY_API": SCIPY_ARRAY_API,
+    "SCIPY_DEVICE": SCIPY_DEVICE,
+}
+
+
+def compliance_scipy(arrays):
+    """Raise exceptions on known-bad subclasses.
+
+    The following subclasses are not supported and raise and error:
+    - `numpy.ma.MaskedArray`
+    - `numpy.matrix`
+    - NumPy arrays which do not have a boolean or numerical dtype
+    - Any array-like which is neither array API compatible nor coercible by NumPy
+    - Any array-like which is coerced by NumPy to an unsupported dtype
+    """
+    for i in range(len(arrays)):
+        array = arrays[i]
+        if isinstance(array, np.ma.MaskedArray):
+            raise TypeError("Inputs of type `numpy.ma.MaskedArray` are not supported.")
+        elif isinstance(array, np.matrix):
+            raise TypeError("Inputs of type `numpy.matrix` are not supported.")
+        if isinstance(array, (np.ndarray, np.generic)):
+            dtype = array.dtype
+            if not (np.issubdtype(dtype, np.number) or np.issubdtype(dtype, np.bool_)):
+                raise TypeError(f"An argument has dtype `{dtype!r}`; "
+                                f"only boolean and numerical dtypes are supported.")
+        elif not is_array_api_obj(array):
+            try:
+                array = np.asanyarray(array)
+            except TypeError:
+                raise TypeError("An argument is neither array API compatible nor "
+                                "coercible by NumPy.")
+            dtype = array.dtype
+            if not (np.issubdtype(dtype, np.number) or np.issubdtype(dtype, np.bool_)):
+                message = (
+                    f"An argument was coerced to an unsupported dtype `{dtype!r}`; "
+                    f"only boolean and numerical dtypes are supported."
+                )
+                raise TypeError(message)
+            arrays[i] = array
+    return arrays
+
+
+def _check_finite(array, xp):
+    """Check for NaNs or Infs."""
+    msg = "array must not contain infs or NaNs"
+    try:
+        if not xp.all(xp.isfinite(array)):
+            raise ValueError(msg)
+    except TypeError:
+        raise ValueError(msg)
+
+
+def array_namespace(*arrays):
+    """Get the array API compatible namespace for the arrays xs.
+
+    Parameters
+    ----------
+    *arrays : sequence of array_like
+        Arrays used to infer the common namespace.
+
+    Returns
+    -------
+    namespace : module
+        Common namespace.
+
+    Notes
+    -----
+    Thin wrapper around `array_api_compat.array_namespace`.
+
+    1. Check for the global switch: SCIPY_ARRAY_API. This can also be accessed
+       dynamically through ``_GLOBAL_CONFIG['SCIPY_ARRAY_API']``.
+    2. `compliance_scipy` raise exceptions on known-bad subclasses. See
+       its definition for more details.
+
+    When the global switch is False, it defaults to the `numpy` namespace.
+    In that case, there is no compliance check. This is a convenience to
+    ease the adoption. Otherwise, arrays must comply with the new rules.
+    """
+    if not _GLOBAL_CONFIG["SCIPY_ARRAY_API"]:
+        # here we could wrap the namespace if needed
+        return np_compat
+
+    arrays = [array for array in arrays if array is not None]
+
+    arrays = compliance_scipy(arrays)
+
+    return array_api_compat.array_namespace(*arrays)
+
+
+def _asarray(
+    array, dtype=None, order=None, copy=None, *, xp=None, check_finite=False
+):
+    """SciPy-specific replacement for `np.asarray` with `order` and `check_finite`.
+
+    Memory layout parameter `order` is not exposed in the Array API standard.
+    `order` is only enforced if the input array implementation
+    is NumPy based, otherwise `order` is just silently ignored.
+
+    `check_finite` is also not a keyword in the array API standard; included
+    here for convenience rather than that having to be a separate function
+    call inside SciPy functions.
+    """
+    if xp is None:
+        xp = array_namespace(array)
+    if xp.__name__ in {"numpy", "scipy._lib.array_api_compat.numpy"}:
+        # Use NumPy API to support order
+        if copy is True:
+            array = np.array(array, order=order, dtype=dtype)
+        else:
+            array = np.asarray(array, order=order, dtype=dtype)
+
+        # At this point array is a NumPy ndarray. We convert it to an array
+        # container that is consistent with the input's namespace.
+        array = xp.asarray(array)
+    else:
+        try:
+            array = xp.asarray(array, dtype=dtype, copy=copy)
+        except TypeError:
+            coerced_xp = array_namespace(xp.asarray(3))
+            array = coerced_xp.asarray(array, dtype=dtype, copy=copy)
+
+    if check_finite:
+        _check_finite(array, xp)
+
+    return array
+
+
+def atleast_nd(x, *, ndim, xp=None):
+    """Recursively expand the dimension to have at least `ndim`."""
+    if xp is None:
+        xp = array_namespace(x)
+    x = xp.asarray(x)
+    if x.ndim < ndim:
+        x = xp.expand_dims(x, axis=0)
+        x = atleast_nd(x, ndim=ndim, xp=xp)
+    return x
+
+
+def copy(x, *, xp=None):
+    """
+    Copies an array.
+
+    Parameters
+    ----------
+    x : array
+
+    xp : array_namespace
+
+    Returns
+    -------
+    copy : array
+        Copied array
+
+    Notes
+    -----
+    This copy function does not offer all the semantics of `np.copy`, i.e. the
+    `subok` and `order` keywords are not used.
+    """
+    # Note: xp.asarray fails if xp is numpy.
+    if xp is None:
+        xp = array_namespace(x)
+
+    return _asarray(x, copy=True, xp=xp)
+
+
+def is_numpy(xp):
+    return xp.__name__ in ('numpy', 'scipy._lib.array_api_compat.numpy')
+
+
+def is_cupy(xp):
+    return xp.__name__ in ('cupy', 'scipy._lib.array_api_compat.cupy')
+
+
+def is_torch(xp):
+    return xp.__name__ in ('torch', 'scipy._lib.array_api_compat.torch')
+
+
+def _strict_check(actual, desired, xp,
+                  check_namespace=True, check_dtype=True, check_shape=True):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    if check_namespace:
+        _assert_matching_namespace(actual, desired)
+
+    desired = xp.asarray(desired)
+
+    if check_dtype:
+        _msg = "dtypes do not match.\nActual: {actual.dtype}\nDesired: {desired.dtype}"
+        assert actual.dtype == desired.dtype, _msg
+
+    if check_shape:
+        _msg = "Shapes do not match.\nActual: {actual.shape}\nDesired: {desired.shape}"
+        assert actual.shape == desired.shape, _msg
+        _check_scalar(actual, desired, xp)
+
+    desired = xp.broadcast_to(desired, actual.shape)
+    return desired
+
+
+def _assert_matching_namespace(actual, desired):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    actual = actual if isinstance(actual, tuple) else (actual,)
+    desired_space = array_namespace(desired)
+    for arr in actual:
+        arr_space = array_namespace(arr)
+        _msg = (f"Namespaces do not match.\n"
+                f"Actual: {arr_space.__name__}\n"
+                f"Desired: {desired_space.__name__}")
+        assert arr_space == desired_space, _msg
+
+
+def _check_scalar(actual, desired, xp):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    # Shape check alone is sufficient unless desired.shape == (). Also,
+    # only NumPy distinguishes between scalars and arrays.
+    if desired.shape != () or not is_numpy(xp):
+        return
+    # We want to follow the conventions of the `xp` library. Libraries like
+    # NumPy, for which `np.asarray(0)[()]` returns a scalar, tend to return
+    # a scalar even when a 0D array might be more appropriate:
+    # import numpy as np
+    # np.mean([1, 2, 3])  # scalar, not 0d array
+    # np.asarray(0)*2  # scalar, not 0d array
+    # np.sin(np.asarray(0))  # scalar, not 0d array
+    # Libraries like CuPy, for which `cp.asarray(0)[()]` returns a 0D array,
+    # tend to return a 0D array in scenarios like those above.
+    # Therefore, regardless of whether the developer provides a scalar or 0D
+    # array for `desired`, we would typically want the type of `actual` to be
+    # the type of `desired[()]`. If the developer wants to override this
+    # behavior, they can set `check_shape=False`.
+    desired = desired[()]
+    _msg = f"Types do not match:\n Actual: {type(actual)}\n Desired: {type(desired)}"
+    assert (xp.isscalar(actual) and xp.isscalar(desired)
+            or (not xp.isscalar(actual) and not xp.isscalar(desired))), _msg
+
+
+def xp_assert_equal(actual, desired, check_namespace=True, check_dtype=True,
+                    check_shape=True, err_msg='', xp=None):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    if xp is None:
+        xp = array_namespace(actual)
+    desired = _strict_check(actual, desired, xp, check_namespace=check_namespace,
+                            check_dtype=check_dtype, check_shape=check_shape)
+    if is_cupy(xp):
+        return xp.testing.assert_array_equal(actual, desired, err_msg=err_msg)
+    elif is_torch(xp):
+        # PyTorch recommends using `rtol=0, atol=0` like this
+        # to test for exact equality
+        err_msg = None if err_msg == '' else err_msg
+        return xp.testing.assert_close(actual, desired, rtol=0, atol=0, equal_nan=True,
+                                       check_dtype=False, msg=err_msg)
+    return np.testing.assert_array_equal(actual, desired, err_msg=err_msg)
+
+
+def xp_assert_close(actual, desired, rtol=1e-07, atol=0, check_namespace=True,
+                    check_dtype=True, check_shape=True, err_msg='', xp=None):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    if xp is None:
+        xp = array_namespace(actual)
+    desired = _strict_check(actual, desired, xp, check_namespace=check_namespace,
+                            check_dtype=check_dtype, check_shape=check_shape)
+    if is_cupy(xp):
+        return xp.testing.assert_allclose(actual, desired, rtol=rtol,
+                                          atol=atol, err_msg=err_msg)
+    elif is_torch(xp):
+        err_msg = None if err_msg == '' else err_msg
+        return xp.testing.assert_close(actual, desired, rtol=rtol, atol=atol,
+                                       equal_nan=True, check_dtype=False, msg=err_msg)
+    return np.testing.assert_allclose(actual, desired, rtol=rtol,
+                                      atol=atol, err_msg=err_msg)
+
+
+def xp_assert_less(actual, desired, check_namespace=True, check_dtype=True,
+                   check_shape=True, err_msg='', verbose=True, xp=None):
+    __tracebackhide__ = True  # Hide traceback for py.test
+    if xp is None:
+        xp = array_namespace(actual)
+    desired = _strict_check(actual, desired, xp, check_namespace=check_namespace,
+                            check_dtype=check_dtype, check_shape=check_shape)
+    if is_cupy(xp):
+        return xp.testing.assert_array_less(actual, desired,
+                                            err_msg=err_msg, verbose=verbose)
+    elif is_torch(xp):
+        if actual.device.type != 'cpu':
+            actual = actual.cpu()
+        if desired.device.type != 'cpu':
+            desired = desired.cpu()
+    return np.testing.assert_array_less(actual, desired,
+                                        err_msg=err_msg, verbose=verbose)
+
+
+def cov(x, *, xp=None):
+    if xp is None:
+        xp = array_namespace(x)
+
+    X = copy(x, xp=xp)
+    dtype = xp.result_type(X, xp.float64)
+
+    X = atleast_nd(X, ndim=2, xp=xp)
+    X = xp.asarray(X, dtype=dtype)
+
+    avg = xp.mean(X, axis=1)
+    fact = X.shape[1] - 1
+
+    if fact <= 0:
+        warnings.warn("Degrees of freedom <= 0 for slice",
+                      RuntimeWarning, stacklevel=2)
+        fact = 0.0
+
+    X -= avg[:, None]
+    X_T = X.T
+    if xp.isdtype(X_T.dtype, 'complex floating'):
+        X_T = xp.conj(X_T)
+    c = X @ X_T
+    c /= fact
+    axes = tuple(axis for axis, length in enumerate(c.shape) if length == 1)
+    return xp.squeeze(c, axis=axes)
+
+
+def xp_unsupported_param_msg(param):
+    return f'Providing {param!r} is only supported for numpy arrays.'
+
+
+def is_complex(x, xp):
+    return xp.isdtype(x.dtype, 'complex floating')

venv/lib/python3.10/site-packages/scipy/_lib/_bunch.py

@@ -0,0 +1,225 @@
+import sys as _sys
+from keyword import iskeyword as _iskeyword
+
+
+def _validate_names(typename, field_names, extra_field_names):
+    """
+    Ensure that all the given names are valid Python identifiers that
+    do not start with '_'.  Also check that there are no duplicates
+    among field_names + extra_field_names.
+    """
+    for name in [typename] + field_names + extra_field_names:
+        if not isinstance(name, str):
+            raise TypeError('typename and all field names must be strings')
+        if not name.isidentifier():
+            raise ValueError('typename and all field names must be valid '
+                             f'identifiers: {name!r}')
+        if _iskeyword(name):
+            raise ValueError('typename and all field names cannot be a '
+                             f'keyword: {name!r}')
+
+    seen = set()
+    for name in field_names + extra_field_names:
+        if name.startswith('_'):
+            raise ValueError('Field names cannot start with an underscore: '
+                             f'{name!r}')
+        if name in seen:
+            raise ValueError(f'Duplicate field name: {name!r}')
+        seen.add(name)
+
+
+# Note: This code is adapted from CPython:Lib/collections/__init__.py
+def _make_tuple_bunch(typename, field_names, extra_field_names=None,
+                      module=None):
+    """
+    Create a namedtuple-like class with additional attributes.
+
+    This function creates a subclass of tuple that acts like a namedtuple
+    and that has additional attributes.
+
+    The additional attributes are listed in `extra_field_names`.  The
+    values assigned to these attributes are not part of the tuple.
+
+    The reason this function exists is to allow functions in SciPy
+    that currently return a tuple or a namedtuple to returned objects
+    that have additional attributes, while maintaining backwards
+    compatibility.
+
+    This should only be used to enhance *existing* functions in SciPy.
+    New functions are free to create objects as return values without
+    having to maintain backwards compatibility with an old tuple or
+    namedtuple return value.
+
+    Parameters
+    ----------
+    typename : str
+        The name of the type.
+    field_names : list of str
+        List of names of the values to be stored in the tuple. These names
+        will also be attributes of instances, so the values in the tuple
+        can be accessed by indexing or as attributes.  At least one name
+        is required.  See the Notes for additional restrictions.
+    extra_field_names : list of str, optional
+        List of names of values that will be stored as attributes of the
+        object.  See the notes for additional restrictions.
+
+    Returns
+    -------
+    cls : type
+        The new class.
+
+    Notes
+    -----
+    There are restrictions on the names that may be used in `field_names`
+    and `extra_field_names`:
+
+    * The names must be unique--no duplicates allowed.
+    * The names must be valid Python identifiers, and must not begin with
+      an underscore.
+    * The names must not be Python keywords (e.g. 'def', 'and', etc., are
+      not allowed).
+
+    Examples
+    --------
+    >>> from scipy._lib._bunch import _make_tuple_bunch
+
+    Create a class that acts like a namedtuple with length 2 (with field
+    names `x` and `y`) that will also have the attributes `w` and `beta`:
+
+    >>> Result = _make_tuple_bunch('Result', ['x', 'y'], ['w', 'beta'])
+
+    `Result` is the new class.  We call it with keyword arguments to create
+    a new instance with given values.
+
+    >>> result1 = Result(x=1, y=2, w=99, beta=0.5)
+    >>> result1
+    Result(x=1, y=2, w=99, beta=0.5)
+
+    `result1` acts like a tuple of length 2:
+
+    >>> len(result1)
+    2
+    >>> result1[:]
+    (1, 2)
+
+    The values assigned when the instance was created are available as
+    attributes:
+
+    >>> result1.y
+    2
+    >>> result1.beta
+    0.5
+    """
+    if len(field_names) == 0:
+        raise ValueError('field_names must contain at least one name')
+
+    if extra_field_names is None:
+        extra_field_names = []
+    _validate_names(typename, field_names, extra_field_names)
+
+    typename = _sys.intern(str(typename))
+    field_names = tuple(map(_sys.intern, field_names))
+    extra_field_names = tuple(map(_sys.intern, extra_field_names))
+
+    all_names = field_names + extra_field_names
+    arg_list = ', '.join(field_names)
+    full_list = ', '.join(all_names)
+    repr_fmt = ''.join(('(',
+                        ', '.join(f'{name}=%({name})r' for name in all_names),
+                        ')'))
+    tuple_new = tuple.__new__
+    _dict, _tuple, _zip = dict, tuple, zip
+
+    # Create all the named tuple methods to be added to the class namespace
+
+    s = f"""\
+def __new__(_cls, {arg_list}, **extra_fields):
+    return _tuple_new(_cls, ({arg_list},))
+
+def __init__(self, {arg_list}, **extra_fields):
+    for key in self._extra_fields:
+        if key not in extra_fields:
+            raise TypeError("missing keyword argument '%s'" % (key,))
+    for key, val in extra_fields.items():
+        if key not in self._extra_fields:
+            raise TypeError("unexpected keyword argument '%s'" % (key,))
+        self.__dict__[key] = val
+
+def __setattr__(self, key, val):
+    if key in {repr(field_names)}:
+        raise AttributeError("can't set attribute %r of class %r"
+                             % (key, self.__class__.__name__))
+    else:
+        self.__dict__[key] = val
+"""
+    del arg_list
+    namespace = {'_tuple_new': tuple_new,
+                 '__builtins__': dict(TypeError=TypeError,
+                                      AttributeError=AttributeError),
+                 '__name__': f'namedtuple_{typename}'}
+    exec(s, namespace)
+    __new__ = namespace['__new__']
+    __new__.__doc__ = f'Create new instance of {typename}({full_list})'
+    __init__ = namespace['__init__']
+    __init__.__doc__ = f'Instantiate instance of {typename}({full_list})'
+    __setattr__ = namespace['__setattr__']
+
+    def __repr__(self):
+        'Return a nicely formatted representation string'
+        return self.__class__.__name__ + repr_fmt % self._asdict()
+
+    def _asdict(self):
+        'Return a new dict which maps field names to their values.'
+        out = _dict(_zip(self._fields, self))
+        out.update(self.__dict__)
+        return out
+
+    def __getnewargs_ex__(self):
+        'Return self as a plain tuple.  Used by copy and pickle.'
+        return _tuple(self), self.__dict__
+
+    # Modify function metadata to help with introspection and debugging
+    for method in (__new__, __repr__, _asdict, __getnewargs_ex__):
+        method.__qualname__ = f'{typename}.{method.__name__}'
+
+    # Build-up the class namespace dictionary
+    # and use type() to build the result class
+    class_namespace = {
+        '__doc__': f'{typename}({full_list})',
+        '_fields': field_names,
+        '__new__': __new__,
+        '__init__': __init__,
+        '__repr__': __repr__,
+        '__setattr__': __setattr__,
+        '_asdict': _asdict,
+        '_extra_fields': extra_field_names,
+        '__getnewargs_ex__': __getnewargs_ex__,
+    }
+    for index, name in enumerate(field_names):
+
+        def _get(self, index=index):
+            return self[index]
+        class_namespace[name] = property(_get)
+    for name in extra_field_names:
+
+        def _get(self, name=name):
+            return self.__dict__[name]
+        class_namespace[name] = property(_get)
+
+    result = type(typename, (tuple,), class_namespace)
+
+    # For pickling to work, the __module__ variable needs to be set to the
+    # frame where the named tuple is created.  Bypass this step in environments
+    # where sys._getframe is not defined (Jython for example) or sys._getframe
+    # is not defined for arguments greater than 0 (IronPython), or where the
+    # user has specified a particular module.
+    if module is None:
+        try:
+            module = _sys._getframe(1).f_globals.get('__name__', '__main__')
+        except (AttributeError, ValueError):
+            pass
+    if module is not None:
+        result.__module__ = module
+        __new__.__module__ = module
+
+    return result

venv/lib/python3.10/site-packages/scipy/_lib/_ccallback.py

@@ -0,0 +1,251 @@
+from . import _ccallback_c
+
+import ctypes
+
+PyCFuncPtr = ctypes.CFUNCTYPE(ctypes.c_void_p).__bases__[0]
+
+ffi = None
+
+class CData:
+    pass
+
+def _import_cffi():
+    global ffi, CData
+
+    if ffi is not None:
+        return
+
+    try:
+        import cffi
+        ffi = cffi.FFI()
+        CData = ffi.CData
+    except ImportError:
+        ffi = False
+
+
+class LowLevelCallable(tuple):
+    """
+    Low-level callback function.
+
+    Some functions in SciPy take as arguments callback functions, which
+    can either be python callables or low-level compiled functions. Using
+    compiled callback functions can improve performance somewhat by
+    avoiding wrapping data in Python objects.
+
+    Such low-level functions in SciPy are wrapped in `LowLevelCallable`
+    objects, which can be constructed from function pointers obtained from
+    ctypes, cffi, Cython, or contained in Python `PyCapsule` objects.
+
+    .. seealso::
+
+       Functions accepting low-level callables:
+
+       `scipy.integrate.quad`, `scipy.ndimage.generic_filter`,
+       `scipy.ndimage.generic_filter1d`, `scipy.ndimage.geometric_transform`
+
+       Usage examples:
+
+       :ref:`ndimage-ccallbacks`, :ref:`quad-callbacks`
+
+    Parameters
+    ----------
+    function : {PyCapsule, ctypes function pointer, cffi function pointer}
+        Low-level callback function.
+    user_data : {PyCapsule, ctypes void pointer, cffi void pointer}
+        User data to pass on to the callback function.
+    signature : str, optional
+        Signature of the function. If omitted, determined from *function*,
+        if possible.
+
+    Attributes
+    ----------
+    function
+        Callback function given.
+    user_data
+        User data given.
+    signature
+        Signature of the function.
+
+    Methods
+    -------
+    from_cython
+        Class method for constructing callables from Cython C-exported
+        functions.
+
+    Notes
+    -----
+    The argument ``function`` can be one of:
+
+    - PyCapsule, whose name contains the C function signature
+    - ctypes function pointer
+    - cffi function pointer
+
+    The signature of the low-level callback must match one of those expected
+    by the routine it is passed to.
+
+    If constructing low-level functions from a PyCapsule, the name of the
+    capsule must be the corresponding signature, in the format::
+
+        return_type (arg1_type, arg2_type, ...)
+
+    For example::
+
+        "void (double)"
+        "double (double, int *, void *)"
+
+    The context of a PyCapsule passed in as ``function`` is used as ``user_data``,
+    if an explicit value for ``user_data`` was not given.
+
+    """
+
+    # Make the class immutable
+    __slots__ = ()
+
+    def __new__(cls, function, user_data=None, signature=None):
+        # We need to hold a reference to the function & user data,
+        # to prevent them going out of scope
+        item = cls._parse_callback(function, user_data, signature)
+        return tuple.__new__(cls, (item, function, user_data))
+
+    def __repr__(self):
+        return f"LowLevelCallable({self.function!r}, {self.user_data!r})"
+
+    @property
+    def function(self):
+        return tuple.__getitem__(self, 1)
+
+    @property
+    def user_data(self):
+        return tuple.__getitem__(self, 2)
+
+    @property
+    def signature(self):
+        return _ccallback_c.get_capsule_signature(tuple.__getitem__(self, 0))
+
+    def __getitem__(self, idx):
+        raise ValueError()
+
+    @classmethod
+    def from_cython(cls, module, name, user_data=None, signature=None):
+        """
+        Create a low-level callback function from an exported Cython function.
+
+        Parameters
+        ----------
+        module : module
+            Cython module where the exported function resides
+        name : str
+            Name of the exported function
+        user_data : {PyCapsule, ctypes void pointer, cffi void pointer}, optional
+            User data to pass on to the callback function.
+        signature : str, optional
+            Signature of the function. If omitted, determined from *function*.
+
+        """
+        try:
+            function = module.__pyx_capi__[name]
+        except AttributeError as e:
+            message = "Given module is not a Cython module with __pyx_capi__ attribute"
+            raise ValueError(message) from e
+        except KeyError as e:
+            message = f"No function {name!r} found in __pyx_capi__ of the module"
+            raise ValueError(message) from e
+        return cls(function, user_data, signature)
+
+    @classmethod
+    def _parse_callback(cls, obj, user_data=None, signature=None):
+        _import_cffi()
+
+        if isinstance(obj, LowLevelCallable):
+            func = tuple.__getitem__(obj, 0)
+        elif isinstance(obj, PyCFuncPtr):
+            func, signature = _get_ctypes_func(obj, signature)
+        elif isinstance(obj, CData):
+            func, signature = _get_cffi_func(obj, signature)
+        elif _ccallback_c.check_capsule(obj):
+            func = obj
+        else:
+            raise ValueError("Given input is not a callable or a "
+                             "low-level callable (pycapsule/ctypes/cffi)")
+
+        if isinstance(user_data, ctypes.c_void_p):
+            context = _get_ctypes_data(user_data)
+        elif isinstance(user_data, CData):
+            context = _get_cffi_data(user_data)
+        elif user_data is None:
+            context = 0
+        elif _ccallback_c.check_capsule(user_data):
+            context = user_data
+        else:
+            raise ValueError("Given user data is not a valid "
+                             "low-level void* pointer (pycapsule/ctypes/cffi)")
+
+        return _ccallback_c.get_raw_capsule(func, signature, context)
+
+
+#
+# ctypes helpers
+#
+
+def _get_ctypes_func(func, signature=None):
+    # Get function pointer
+    func_ptr = ctypes.cast(func, ctypes.c_void_p).value
+
+    # Construct function signature
+    if signature is None:
+        signature = _typename_from_ctypes(func.restype) + " ("
+        for j, arg in enumerate(func.argtypes):
+            if j == 0:
+                signature += _typename_from_ctypes(arg)
+            else:
+                signature += ", " + _typename_from_ctypes(arg)
+        signature += ")"
+
+    return func_ptr, signature
+
+
+def _typename_from_ctypes(item):
+    if item is None:
+        return "void"
+    elif item is ctypes.c_void_p:
+        return "void *"
+
+    name = item.__name__
+
+    pointer_level = 0
+    while name.startswith("LP_"):
+        pointer_level += 1
+        name = name[3:]
+
+    if name.startswith('c_'):
+        name = name[2:]
+
+    if pointer_level > 0:
+        name += " " + "*"*pointer_level
+
+    return name
+
+
+def _get_ctypes_data(data):
+    # Get voidp pointer
+    return ctypes.cast(data, ctypes.c_void_p).value
+
+
+#
+# CFFI helpers
+#
+
+def _get_cffi_func(func, signature=None):
+    # Get function pointer
+    func_ptr = ffi.cast('uintptr_t', func)
+
+    # Get signature
+    if signature is None:
+        signature = ffi.getctype(ffi.typeof(func)).replace('(*)', ' ')
+
+    return func_ptr, signature
+
+
+def _get_cffi_data(data):
+    # Get pointer
+    return ffi.cast('uintptr_t', data)

venv/lib/python3.10/site-packages/scipy/_lib/_disjoint_set.py

@@ -0,0 +1,254 @@
+"""
+Disjoint set data structure
+"""
+
+
+class DisjointSet:
+    """ Disjoint set data structure for incremental connectivity queries.
+
+    .. versionadded:: 1.6.0
+
+    Attributes
+    ----------
+    n_subsets : int
+        The number of subsets.
+
+    Methods
+    -------
+    add
+    merge
+    connected
+    subset
+    subset_size
+    subsets
+    __getitem__
+
+    Notes
+    -----
+    This class implements the disjoint set [1]_, also known as the *union-find*
+    or *merge-find* data structure. The *find* operation (implemented in
+    `__getitem__`) implements the *path halving* variant. The *merge* method
+    implements the *merge by size* variant.
+
+    References
+    ----------
+    .. [1] https://en.wikipedia.org/wiki/Disjoint-set_data_structure
+
+    Examples
+    --------
+    >>> from scipy.cluster.hierarchy import DisjointSet
+
+    Initialize a disjoint set:
+
+    >>> disjoint_set = DisjointSet([1, 2, 3, 'a', 'b'])
+
+    Merge some subsets:
+
+    >>> disjoint_set.merge(1, 2)
+    True
+    >>> disjoint_set.merge(3, 'a')
+    True
+    >>> disjoint_set.merge('a', 'b')
+    True
+    >>> disjoint_set.merge('b', 'b')
+    False
+
+    Find root elements:
+
+    >>> disjoint_set[2]
+    1
+    >>> disjoint_set['b']
+    3
+
+    Test connectivity:
+
+    >>> disjoint_set.connected(1, 2)
+    True
+    >>> disjoint_set.connected(1, 'b')
+    False
+
+    List elements in disjoint set:
+
+    >>> list(disjoint_set)
+    [1, 2, 3, 'a', 'b']
+
+    Get the subset containing 'a':
+
+    >>> disjoint_set.subset('a')
+    {'a', 3, 'b'}
+
+    Get the size of the subset containing 'a' (without actually instantiating
+    the subset):
+
+    >>> disjoint_set.subset_size('a')
+    3
+
+    Get all subsets in the disjoint set:
+
+    >>> disjoint_set.subsets()
+    [{1, 2}, {'a', 3, 'b'}]
+    """
+    def __init__(self, elements=None):
+        self.n_subsets = 0
+        self._sizes = {}
+        self._parents = {}
+        # _nbrs is a circular linked list which links connected elements.
+        self._nbrs = {}
+        # _indices tracks the element insertion order in `__iter__`.
+        self._indices = {}
+        if elements is not None:
+            for x in elements:
+                self.add(x)
+
+    def __iter__(self):
+        """Returns an iterator of the elements in the disjoint set.
+
+        Elements are ordered by insertion order.
+        """
+        return iter(self._indices)
+
+    def __len__(self):
+        return len(self._indices)
+
+    def __contains__(self, x):
+        return x in self._indices
+
+    def __getitem__(self, x):
+        """Find the root element of `x`.
+
+        Parameters
+        ----------
+        x : hashable object
+            Input element.
+
+        Returns
+        -------
+        root : hashable object
+            Root element of `x`.
+        """
+        if x not in self._indices:
+            raise KeyError(x)
+
+        # find by "path halving"
+        parents = self._parents
+        while self._indices[x] != self._indices[parents[x]]:
+            parents[x] = parents[parents[x]]
+            x = parents[x]
+        return x
+
+    def add(self, x):
+        """Add element `x` to disjoint set
+        """
+        if x in self._indices:
+            return
+
+        self._sizes[x] = 1
+        self._parents[x] = x
+        self._nbrs[x] = x
+        self._indices[x] = len(self._indices)
+        self.n_subsets += 1
+
+    def merge(self, x, y):
+        """Merge the subsets of `x` and `y`.
+
+        The smaller subset (the child) is merged into the larger subset (the
+        parent). If the subsets are of equal size, the root element which was
+        first inserted into the disjoint set is selected as the parent.
+
+        Parameters
+        ----------
+        x, y : hashable object
+            Elements to merge.
+
+        Returns
+        -------
+        merged : bool
+            True if `x` and `y` were in disjoint sets, False otherwise.
+        """
+        xr = self[x]
+        yr = self[y]
+        if self._indices[xr] == self._indices[yr]:
+            return False
+
+        sizes = self._sizes
+        if (sizes[xr], self._indices[yr]) < (sizes[yr], self._indices[xr]):
+            xr, yr = yr, xr
+        self._parents[yr] = xr
+        self._sizes[xr] += self._sizes[yr]
+        self._nbrs[xr], self._nbrs[yr] = self._nbrs[yr], self._nbrs[xr]
+        self.n_subsets -= 1
+        return True
+
+    def connected(self, x, y):
+        """Test whether `x` and `y` are in the same subset.
+
+        Parameters
+        ----------
+        x, y : hashable object
+            Elements to test.
+
+        Returns
+        -------
+        result : bool
+            True if `x` and `y` are in the same set, False otherwise.
+        """
+        return self._indices[self[x]] == self._indices[self[y]]
+
+    def subset(self, x):
+        """Get the subset containing `x`.
+
+        Parameters
+        ----------
+        x : hashable object
+            Input element.
+
+        Returns
+        -------
+        result : set
+            Subset containing `x`.
+        """
+        if x not in self._indices:
+            raise KeyError(x)
+
+        result = [x]
+        nxt = self._nbrs[x]
+        while self._indices[nxt] != self._indices[x]:
+            result.append(nxt)
+            nxt = self._nbrs[nxt]
+        return set(result)
+
+    def subset_size(self, x):
+        """Get the size of the subset containing `x`.
+
+        Note that this method is faster than ``len(self.subset(x))`` because
+        the size is directly read off an internal field, without the need to
+        instantiate the full subset.
+
+        Parameters
+        ----------
+        x : hashable object
+            Input element.
+
+        Returns
+        -------
+        result : int
+            Size of the subset containing `x`.
+        """
+        return self._sizes[self[x]]
+
+    def subsets(self):
+        """Get all the subsets in the disjoint set.
+
+        Returns
+        -------
+        result : list
+            Subsets in the disjoint set.
+        """
+        result = []
+        visited = set()
+        for x in self:
+            if x not in visited:
+                xset = self.subset(x)
+                visited.update(xset)
+                result.append(xset)
+        return result

venv/lib/python3.10/site-packages/scipy/_lib/_docscrape.py

@@ -0,0 +1,679 @@
+"""Extract reference documentation from the NumPy source tree.
+
+"""
+# copied from numpydoc/docscrape.py
+import inspect
+import textwrap
+import re
+import pydoc
+from warnings import warn
+from collections import namedtuple
+from collections.abc import Callable, Mapping
+import copy
+import sys
+
+
+def strip_blank_lines(l):
+    "Remove leading and trailing blank lines from a list of lines"
+    while l and not l[0].strip():
+        del l[0]
+    while l and not l[-1].strip():
+        del l[-1]
+    return l
+
+
+class Reader:
+    """A line-based string reader.
+
+    """
+    def __init__(self, data):
+        """
+        Parameters
+        ----------
+        data : str
+           String with lines separated by '\\n'.
+
+        """
+        if isinstance(data, list):
+            self._str = data
+        else:
+            self._str = data.split('\n')  # store string as list of lines
+
+        self.reset()
+
+    def __getitem__(self, n):
+        return self._str[n]
+
+    def reset(self):
+        self._l = 0  # current line nr
+
+    def read(self):
+        if not self.eof():
+            out = self[self._l]
+            self._l += 1
+            return out
+        else:
+            return ''
+
+    def seek_next_non_empty_line(self):
+        for l in self[self._l:]:
+            if l.strip():
+                break
+            else:
+                self._l += 1
+
+    def eof(self):
+        return self._l >= len(self._str)
+
+    def read_to_condition(self, condition_func):
+        start = self._l
+        for line in self[start:]:
+            if condition_func(line):
+                return self[start:self._l]
+            self._l += 1
+            if self.eof():
+                return self[start:self._l+1]
+        return []
+
+    def read_to_next_empty_line(self):
+        self.seek_next_non_empty_line()
+
+        def is_empty(line):
+            return not line.strip()
+
+        return self.read_to_condition(is_empty)
+
+    def read_to_next_unindented_line(self):
+        def is_unindented(line):
+            return (line.strip() and (len(line.lstrip()) == len(line)))
+        return self.read_to_condition(is_unindented)
+
+    def peek(self, n=0):
+        if self._l + n < len(self._str):
+            return self[self._l + n]
+        else:
+            return ''
+
+    def is_empty(self):
+        return not ''.join(self._str).strip()
+
+
+class ParseError(Exception):
+    def __str__(self):
+        message = self.args[0]
+        if hasattr(self, 'docstring'):
+            message = f"{message} in {self.docstring!r}"
+        return message
+
+
+Parameter = namedtuple('Parameter', ['name', 'type', 'desc'])
+
+
+class NumpyDocString(Mapping):
+    """Parses a numpydoc string to an abstract representation
+
+    Instances define a mapping from section title to structured data.
+
+    """
+
+    sections = {
+        'Signature': '',
+        'Summary': [''],
+        'Extended Summary': [],
+        'Parameters': [],
+        'Returns': [],
+        'Yields': [],
+        'Receives': [],
+        'Raises': [],
+        'Warns': [],
+        'Other Parameters': [],
+        'Attributes': [],
+        'Methods': [],
+        'See Also': [],
+        'Notes': [],
+        'Warnings': [],
+        'References': '',
+        'Examples': '',
+        'index': {}
+    }
+
+    def __init__(self, docstring, config={}):
+        orig_docstring = docstring
+        docstring = textwrap.dedent(docstring).split('\n')
+
+        self._doc = Reader(docstring)
+        self._parsed_data = copy.deepcopy(self.sections)
+
+        try:
+            self._parse()
+        except ParseError as e:
+            e.docstring = orig_docstring
+            raise
+
+    def __getitem__(self, key):
+        return self._parsed_data[key]
+
+    def __setitem__(self, key, val):
+        if key not in self._parsed_data:
+            self._error_location("Unknown section %s" % key, error=False)
+        else:
+            self._parsed_data[key] = val
+
+    def __iter__(self):
+        return iter(self._parsed_data)
+
+    def __len__(self):
+        return len(self._parsed_data)
+
+    def _is_at_section(self):
+        self._doc.seek_next_non_empty_line()
+
+        if self._doc.eof():
+            return False
+
+        l1 = self._doc.peek().strip()  # e.g. Parameters
+
+        if l1.startswith('.. index::'):
+            return True
+
+        l2 = self._doc.peek(1).strip()  # ---------- or ==========
+        return l2.startswith('-'*len(l1)) or l2.startswith('='*len(l1))
+
+    def _strip(self, doc):
+        i = 0
+        j = 0
+        for i, line in enumerate(doc):
+            if line.strip():
+                break
+
+        for j, line in enumerate(doc[::-1]):
+            if line.strip():
+                break
+
+        return doc[i:len(doc)-j]
+
+    def _read_to_next_section(self):
+        section = self._doc.read_to_next_empty_line()
+
+        while not self._is_at_section() and not self._doc.eof():
+            if not self._doc.peek(-1).strip():  # previous line was empty
+                section += ['']
+
+            section += self._doc.read_to_next_empty_line()
+
+        return section
+
+    def _read_sections(self):
+        while not self._doc.eof():
+            data = self._read_to_next_section()
+            name = data[0].strip()
+
+            if name.startswith('..'):  # index section
+                yield name, data[1:]
+            elif len(data) < 2:
+                yield StopIteration
+            else:
+                yield name, self._strip(data[2:])
+
+    def _parse_param_list(self, content, single_element_is_type=False):
+        r = Reader(content)
+        params = []
+        while not r.eof():
+            header = r.read().strip()
+            if ' : ' in header:
+                arg_name, arg_type = header.split(' : ')[:2]
+            else:
+                if single_element_is_type:
+                    arg_name, arg_type = '', header
+                else:
+                    arg_name, arg_type = header, ''
+
+            desc = r.read_to_next_unindented_line()
+            desc = dedent_lines(desc)
+            desc = strip_blank_lines(desc)
+
+            params.append(Parameter(arg_name, arg_type, desc))
+
+        return params
+
+    # See also supports the following formats.
+    #
+    # <FUNCNAME>
+    # <FUNCNAME> SPACE* COLON SPACE+ <DESC> SPACE*
+    # <FUNCNAME> ( COMMA SPACE+ <FUNCNAME>)+ (COMMA | PERIOD)? SPACE*
+    # <FUNCNAME> ( COMMA SPACE+ <FUNCNAME>)* SPACE* COLON SPACE+ <DESC> SPACE*
+
+    # <FUNCNAME> is one of
+    #   <PLAIN_FUNCNAME>
+    #   COLON <ROLE> COLON BACKTICK <PLAIN_FUNCNAME> BACKTICK
+    # where
+    #   <PLAIN_FUNCNAME> is a legal function name, and
+    #   <ROLE> is any nonempty sequence of word characters.
+    # Examples: func_f1  :meth:`func_h1` :obj:`~baz.obj_r` :class:`class_j`
+    # <DESC> is a string describing the function.
+
+    _role = r":(?P<role>\w+):"
+    _funcbacktick = r"`(?P<name>(?:~\w+\.)?[a-zA-Z0-9_\.-]+)`"
+    _funcplain = r"(?P<name2>[a-zA-Z0-9_\.-]+)"
+    _funcname = r"(" + _role + _funcbacktick + r"|" + _funcplain + r")"
+    _funcnamenext = _funcname.replace('role', 'rolenext')
+    _funcnamenext = _funcnamenext.replace('name', 'namenext')
+    _description = r"(?P<description>\s*:(\s+(?P<desc>\S+.*))?)?\s*$"
+    _func_rgx = re.compile(r"^\s*" + _funcname + r"\s*")
+    _line_rgx = re.compile(
+        r"^\s*" +
+        r"(?P<allfuncs>" +        # group for all function names
+        _funcname +
+        r"(?P<morefuncs>([,]\s+" + _funcnamenext + r")*)" +
+        r")" +                     # end of "allfuncs"
+        # Some function lists have a trailing comma (or period)  '\s*'
+        r"(?P<trailing>[,\.])?" +
+        _description)
+
+    # Empty <DESC> elements are replaced with '..'
+    empty_description = '..'
+
+    def _parse_see_also(self, content):
+        """
+        func_name : Descriptive text
+            continued text
+        another_func_name : Descriptive text
+        func_name1, func_name2, :meth:`func_name`, func_name3
+
+        """
+
+        items = []
+
+        def parse_item_name(text):
+            """Match ':role:`name`' or 'name'."""
+            m = self._func_rgx.match(text)
+            if not m:
+                raise ParseError("%s is not a item name" % text)
+            role = m.group('role')
+            name = m.group('name') if role else m.group('name2')
+            return name, role, m.end()
+
+        rest = []
+        for line in content:
+            if not line.strip():
+                continue
+
+            line_match = self._line_rgx.match(line)
+            description = None
+            if line_match:
+                description = line_match.group('desc')
+                if line_match.group('trailing') and description:
+                    self._error_location(
+                        'Unexpected comma or period after function list at '
+                        'index %d of line "%s"' % (line_match.end('trailing'),
+                                                   line),
+                        error=False)
+            if not description and line.startswith(' '):
+                rest.append(line.strip())
+            elif line_match:
+                funcs = []
+                text = line_match.group('allfuncs')
+                while True:
+                    if not text.strip():
+                        break
+                    name, role, match_end = parse_item_name(text)
+                    funcs.append((name, role))
+                    text = text[match_end:].strip()
+                    if text and text[0] == ',':
+                        text = text[1:].strip()
+                rest = list(filter(None, [description]))
+                items.append((funcs, rest))
+            else:
+                raise ParseError("%s is not a item name" % line)
+        return items
+
+    def _parse_index(self, section, content):
+        """
+        .. index:: default
+           :refguide: something, else, and more
+
+        """
+        def strip_each_in(lst):
+            return [s.strip() for s in lst]
+
+        out = {}
+        section = section.split('::')
+        if len(section) > 1:
+            out['default'] = strip_each_in(section[1].split(','))[0]
+        for line in content:
+            line = line.split(':')
+            if len(line) > 2:
+                out[line[1]] = strip_each_in(line[2].split(','))
+        return out
+
+    def _parse_summary(self):
+        """Grab signature (if given) and summary"""
+        if self._is_at_section():
+            return
+
+        # If several signatures present, take the last one
+        while True:
+            summary = self._doc.read_to_next_empty_line()
+            summary_str = " ".join([s.strip() for s in summary]).strip()
+            compiled = re.compile(r'^([\w., ]+=)?\s*[\w\.]+\(.*\)$')
+            if compiled.match(summary_str):
+                self['Signature'] = summary_str
+                if not self._is_at_section():
+                    continue
+            break
+
+        if summary is not None:
+            self['Summary'] = summary
+
+        if not self._is_at_section():
+            self['Extended Summary'] = self._read_to_next_section()
+
+    def _parse(self):
+        self._doc.reset()
+        self._parse_summary()
+
+        sections = list(self._read_sections())
+        section_names = {section for section, content in sections}
+
+        has_returns = 'Returns' in section_names
+        has_yields = 'Yields' in section_names
+        # We could do more tests, but we are not. Arbitrarily.
+        if has_returns and has_yields:
+            msg = 'Docstring contains both a Returns and Yields section.'
+            raise ValueError(msg)
+        if not has_yields and 'Receives' in section_names:
+            msg = 'Docstring contains a Receives section but not Yields.'
+            raise ValueError(msg)
+
+        for (section, content) in sections:
+            if not section.startswith('..'):
+                section = (s.capitalize() for s in section.split(' '))
+                section = ' '.join(section)
+                if self.get(section):
+                    self._error_location("The section %s appears twice"
+                                         % section)
+
+            if section in ('Parameters', 'Other Parameters', 'Attributes',
+                           'Methods'):
+                self[section] = self._parse_param_list(content)
+            elif section in ('Returns', 'Yields', 'Raises', 'Warns',
+                             'Receives'):
+                self[section] = self._parse_param_list(
+                    content, single_element_is_type=True)
+            elif section.startswith('.. index::'):
+                self['index'] = self._parse_index(section, content)
+            elif section == 'See Also':
+                self['See Also'] = self._parse_see_also(content)
+            else:
+                self[section] = content
+
+    def _error_location(self, msg, error=True):
+        if hasattr(self, '_obj'):
+            # we know where the docs came from:
+            try:
+                filename = inspect.getsourcefile(self._obj)
+            except TypeError:
+                filename = None
+            msg = msg + (f" in the docstring of {self._obj} in {filename}.")
+        if error:
+            raise ValueError(msg)
+        else:
+            warn(msg, stacklevel=3)
+
+    # string conversion routines
+
+    def _str_header(self, name, symbol='-'):
+        return [name, len(name)*symbol]
+
+    def _str_indent(self, doc, indent=4):
+        out = []
+        for line in doc:
+            out += [' '*indent + line]
+        return out
+
+    def _str_signature(self):
+        if self['Signature']:
+            return [self['Signature'].replace('*', r'\*')] + ['']
+        else:
+            return ['']
+
+    def _str_summary(self):
+        if self['Summary']:
+            return self['Summary'] + ['']
+        else:
+            return []
+
+    def _str_extended_summary(self):
+        if self['Extended Summary']:
+            return self['Extended Summary'] + ['']
+        else:
+            return []
+
+    def _str_param_list(self, name):
+        out = []
+        if self[name]:
+            out += self._str_header(name)
+            for param in self[name]:
+                parts = []
+                if param.name:
+                    parts.append(param.name)
+                if param.type:
+                    parts.append(param.type)
+                out += [' : '.join(parts)]
+                if param.desc and ''.join(param.desc).strip():
+                    out += self._str_indent(param.desc)
+            out += ['']
+        return out
+
+    def _str_section(self, name):
+        out = []
+        if self[name]:
+            out += self._str_header(name)
+            out += self[name]
+            out += ['']
+        return out
+
+    def _str_see_also(self, func_role):
+        if not self['See Also']:
+            return []
+        out = []
+        out += self._str_header("See Also")
+        out += ['']
+        last_had_desc = True
+        for funcs, desc in self['See Also']:
+            assert isinstance(funcs, list)
+            links = []
+            for func, role in funcs:
+                if role:
+                    link = f':{role}:`{func}`'
+                elif func_role:
+                    link = f':{func_role}:`{func}`'
+                else:
+                    link = "`%s`_" % func
+                links.append(link)
+            link = ', '.join(links)
+            out += [link]
+            if desc:
+                out += self._str_indent([' '.join(desc)])
+                last_had_desc = True
+            else:
+                last_had_desc = False
+                out += self._str_indent([self.empty_description])
+
+        if last_had_desc:
+            out += ['']
+        out += ['']
+        return out
+
+    def _str_index(self):
+        idx = self['index']
+        out = []
+        output_index = False
+        default_index = idx.get('default', '')
+        if default_index:
+            output_index = True
+        out += ['.. index:: %s' % default_index]
+        for section, references in idx.items():
+            if section == 'default':
+                continue
+            output_index = True
+            out += ['   :{}: {}'.format(section, ', '.join(references))]
+        if output_index:
+            return out
+        else:
+            return ''
+
+    def __str__(self, func_role=''):
+        out = []
+        out += self._str_signature()
+        out += self._str_summary()
+        out += self._str_extended_summary()
+        for param_list in ('Parameters', 'Returns', 'Yields', 'Receives',
+                           'Other Parameters', 'Raises', 'Warns'):
+            out += self._str_param_list(param_list)
+        out += self._str_section('Warnings')
+        out += self._str_see_also(func_role)
+        for s in ('Notes', 'References', 'Examples'):
+            out += self._str_section(s)
+        for param_list in ('Attributes', 'Methods'):
+            out += self._str_param_list(param_list)
+        out += self._str_index()
+        return '\n'.join(out)
+
+
+def indent(str, indent=4):
+    indent_str = ' '*indent
+    if str is None:
+        return indent_str
+    lines = str.split('\n')
+    return '\n'.join(indent_str + l for l in lines)
+
+
+def dedent_lines(lines):
+    """Deindent a list of lines maximally"""
+    return textwrap.dedent("\n".join(lines)).split("\n")
+
+
+def header(text, style='-'):
+    return text + '\n' + style*len(text) + '\n'
+
+
+class FunctionDoc(NumpyDocString):
+    def __init__(self, func, role='func', doc=None, config={}):
+        self._f = func
+        self._role = role  # e.g. "func" or "meth"
+
+        if doc is None:
+            if func is None:
+                raise ValueError("No function or docstring given")
+            doc = inspect.getdoc(func) or ''
+        NumpyDocString.__init__(self, doc, config)
+
+    def get_func(self):
+        func_name = getattr(self._f, '__name__', self.__class__.__name__)
+        if inspect.isclass(self._f):
+            func = getattr(self._f, '__call__', self._f.__init__)
+        else:
+            func = self._f
+        return func, func_name
+
+    def __str__(self):
+        out = ''
+
+        func, func_name = self.get_func()
+
+        roles = {'func': 'function',
+                 'meth': 'method'}
+
+        if self._role:
+            if self._role not in roles:
+                print("Warning: invalid role %s" % self._role)
+            out += '.. {}:: {}\n    \n\n'.format(roles.get(self._role, ''),
+                                             func_name)
+
+        out += super().__str__(func_role=self._role)
+        return out
+
+
+class ClassDoc(NumpyDocString):
+
+    extra_public_methods = ['__call__']
+
+    def __init__(self, cls, doc=None, modulename='', func_doc=FunctionDoc,
+                 config={}):
+        if not inspect.isclass(cls) and cls is not None:
+            raise ValueError("Expected a class or None, but got %r" % cls)
+        self._cls = cls
+
+        if 'sphinx' in sys.modules:
+            from sphinx.ext.autodoc import ALL
+        else:
+            ALL = object()
+
+        self.show_inherited_members = config.get(
+                    'show_inherited_class_members', True)
+
+        if modulename and not modulename.endswith('.'):
+            modulename += '.'
+        self._mod = modulename
+
+        if doc is None:
+            if cls is None:
+                raise ValueError("No class or documentation string given")
+            doc = pydoc.getdoc(cls)
+
+        NumpyDocString.__init__(self, doc)
+
+        _members = config.get('members', [])
+        if _members is ALL:
+            _members = None
+        _exclude = config.get('exclude-members', [])
+
+        if config.get('show_class_members', True) and _exclude is not ALL:
+            def splitlines_x(s):
+                if not s:
+                    return []
+                else:
+                    return s.splitlines()
+            for field, items in [('Methods', self.methods),
+                                 ('Attributes', self.properties)]:
+                if not self[field]:
+                    doc_list = []
+                    for name in sorted(items):
+                        if (name in _exclude or
+                                (_members and name not in _members)):
+                            continue
+                        try:
+                            doc_item = pydoc.getdoc(getattr(self._cls, name))
+                            doc_list.append(
+                                Parameter(name, '', splitlines_x(doc_item)))
+                        except AttributeError:
+                            pass  # method doesn't exist
+                    self[field] = doc_list
+
+    @property
+    def methods(self):
+        if self._cls is None:
+            return []
+        return [name for name, func in inspect.getmembers(self._cls)
+                if ((not name.startswith('_')
+                     or name in self.extra_public_methods)
+                    and isinstance(func, Callable)
+                    and self._is_show_member(name))]
+
+    @property
+    def properties(self):
+        if self._cls is None:
+            return []
+        return [name for name, func in inspect.getmembers(self._cls)
+                if (not name.startswith('_') and
+                    (func is None or isinstance(func, property) or
+                     inspect.isdatadescriptor(func))
+                    and self._is_show_member(name))]
+
+    def _is_show_member(self, name):
+        if self.show_inherited_members:
+            return True  # show all class members
+        if name not in self._cls.__dict__:
+            return False  # class member is inherited, we do not show it
+        return True

venv/lib/python3.10/site-packages/scipy/_lib/_elementwise_iterative_method.py

@@ -0,0 +1,320 @@
+# `_elementwise_iterative_method.py` includes tools for writing functions that
+# - are vectorized to work elementwise on arrays,
+# - implement non-trivial, iterative algorithms with a callback interface, and
+# - return rich objects with iteration count, termination status, etc.
+#
+# Examples include:
+# `scipy.optimize._chandrupatla._chandrupatla for scalar rootfinding,
+# `scipy.optimize._chandrupatla._chandrupatla_minimize for scalar minimization,
+# `scipy.optimize._differentiate._differentiate for numerical differentiation,
+# `scipy.optimize._bracket._bracket_root for finding rootfinding brackets,
+# `scipy.optimize._bracket._bracket_minimize for finding minimization brackets,
+# `scipy.integrate._tanhsinh._tanhsinh` for numerical quadrature.
+
+import numpy as np
+from ._util import _RichResult, _call_callback_maybe_halt
+
+_ESIGNERR = -1
+_ECONVERR = -2
+_EVALUEERR = -3
+_ECALLBACK = -4
+_ECONVERGED = 0
+_EINPROGRESS = 1
+
+def _initialize(func, xs, args, complex_ok=False, preserve_shape=None):
+    """Initialize abscissa, function, and args arrays for elementwise function
+
+    Parameters
+    ----------
+    func : callable
+        An elementwise function with signature
+
+            func(x: ndarray, *args) -> ndarray
+
+        where each element of ``x`` is a finite real and ``args`` is a tuple,
+        which may contain an arbitrary number of arrays that are broadcastable
+        with ``x``.
+    xs : tuple of arrays
+        Finite real abscissa arrays. Must be broadcastable.
+    args : tuple, optional
+        Additional positional arguments to be passed to `func`.
+    preserve_shape : bool, default:False
+        When ``preserve_shape=False`` (default), `func` may be passed
+        arguments of any shape; `_scalar_optimization_loop` is permitted
+        to reshape and compress arguments at will. When
+        ``preserve_shape=False``, arguments passed to `func` must have shape
+        `shape` or ``shape + (n,)``, where ``n`` is any integer.
+
+    Returns
+    -------
+    xs, fs, args : tuple of arrays
+        Broadcasted, writeable, 1D abscissa and function value arrays (or
+        NumPy floats, if appropriate). The dtypes of the `xs` and `fs` are
+        `xfat`; the dtype of the `args` are unchanged.
+    shape : tuple of ints
+        Original shape of broadcasted arrays.
+    xfat : NumPy dtype
+        Result dtype of abscissae, function values, and args determined using
+        `np.result_type`, except integer types are promoted to `np.float64`.
+
+    Raises
+    ------
+    ValueError
+        If the result dtype is not that of a real scalar
+
+    Notes
+    -----
+    Useful for initializing the input of SciPy functions that accept
+    an elementwise callable, abscissae, and arguments; e.g.
+    `scipy.optimize._chandrupatla`.
+    """
+    nx = len(xs)
+
+    # Try to preserve `dtype`, but we need to ensure that the arguments are at
+    # least floats before passing them into the function; integers can overflow
+    # and cause failure.
+    # There might be benefit to combining the `xs` into a single array and
+    # calling `func` once on the combined array. For now, keep them separate.
+    xas = np.broadcast_arrays(*xs, *args)  # broadcast and rename
+    xat = np.result_type(*[xa.dtype for xa in xas])
+    xat = np.float64 if np.issubdtype(xat, np.integer) else xat
+    xs, args = xas[:nx], xas[nx:]
+    xs = [x.astype(xat, copy=False)[()] for x in xs]
+    fs = [np.asarray(func(x, *args)) for x in xs]
+    shape = xs[0].shape
+    fshape = fs[0].shape
+
+    if preserve_shape:
+        # bind original shape/func now to avoid late-binding gotcha
+        def func(x, *args, shape=shape, func=func,  **kwargs):
+            i = (0,)*(len(fshape) - len(shape))
+            return func(x[i], *args, **kwargs)
+        shape = np.broadcast_shapes(fshape, shape)
+        xs = [np.broadcast_to(x, shape) for x in xs]
+        args = [np.broadcast_to(arg, shape) for arg in args]
+
+    message = ("The shape of the array returned by `func` must be the same as "
+               "the broadcasted shape of `x` and all other `args`.")
+    if preserve_shape is not None:  # only in tanhsinh for now
+        message = f"When `preserve_shape=False`, {message.lower()}"
+    shapes_equal = [f.shape == shape for f in fs]
+    if not np.all(shapes_equal):
+        raise ValueError(message)
+
+    # These algorithms tend to mix the dtypes of the abscissae and function
+    # values, so figure out what the result will be and convert them all to
+    # that type from the outset.
+    xfat = np.result_type(*([f.dtype for f in fs] + [xat]))
+    if not complex_ok and not np.issubdtype(xfat, np.floating):
+        raise ValueError("Abscissae and function output must be real numbers.")
+    xs = [x.astype(xfat, copy=True)[()] for x in xs]
+    fs = [f.astype(xfat, copy=True)[()] for f in fs]
+
+    # To ensure that we can do indexing, we'll work with at least 1d arrays,
+    # but remember the appropriate shape of the output.
+    xs = [x.ravel() for x in xs]
+    fs = [f.ravel() for f in fs]
+    args = [arg.flatten() for arg in args]
+    return func, xs, fs, args, shape, xfat
+
+
+def _loop(work, callback, shape, maxiter, func, args, dtype, pre_func_eval,
+          post_func_eval, check_termination, post_termination_check,
+          customize_result, res_work_pairs, preserve_shape=False):
+    """Main loop of a vectorized scalar optimization algorithm
+
+    Parameters
+    ----------
+    work : _RichResult
+        All variables that need to be retained between iterations. Must
+        contain attributes `nit`, `nfev`, and `success`
+    callback : callable
+        User-specified callback function
+    shape : tuple of ints
+        The shape of all output arrays
+    maxiter :
+        Maximum number of iterations of the algorithm
+    func : callable
+        The user-specified callable that is being optimized or solved
+    args : tuple
+        Additional positional arguments to be passed to `func`.
+    dtype : NumPy dtype
+        The common dtype of all abscissae and function values
+    pre_func_eval : callable
+        A function that accepts `work` and returns `x`, the active elements
+        of `x` at which `func` will be evaluated. May modify attributes
+        of `work` with any algorithmic steps that need to happen
+         at the beginning of an iteration, before `func` is evaluated,
+    post_func_eval : callable
+        A function that accepts `x`, `func(x)`, and `work`. May modify
+        attributes of `work` with any algorithmic steps that need to happen
+         in the middle of an iteration, after `func` is evaluated but before
+         the termination check.
+    check_termination : callable
+        A function that accepts `work` and returns `stop`, a boolean array
+        indicating which of the active elements have met a termination
+        condition.
+    post_termination_check : callable
+        A function that accepts `work`. May modify `work` with any algorithmic
+        steps that need to happen after the termination check and before the
+        end of the iteration.
+    customize_result : callable
+        A function that accepts `res` and `shape` and returns `shape`. May
+        modify `res` (in-place) according to preferences (e.g. rearrange
+        elements between attributes) and modify `shape` if needed.
+    res_work_pairs : list of (str, str)
+        Identifies correspondence between attributes of `res` and attributes
+        of `work`; i.e., attributes of active elements of `work` will be
+        copied to the appropriate indices of `res` when appropriate. The order
+        determines the order in which _RichResult attributes will be
+        pretty-printed.
+
+    Returns
+    -------
+    res : _RichResult
+        The final result object
+
+    Notes
+    -----
+    Besides providing structure, this framework provides several important
+    services for a vectorized optimization algorithm.
+
+    - It handles common tasks involving iteration count, function evaluation
+      count, a user-specified callback, and associated termination conditions.
+    - It compresses the attributes of `work` to eliminate unnecessary
+      computation on elements that have already converged.
+
+    """
+    cb_terminate = False
+
+    # Initialize the result object and active element index array
+    n_elements = int(np.prod(shape))
+    active = np.arange(n_elements)  # in-progress element indices
+    res_dict = {i: np.zeros(n_elements, dtype=dtype) for i, j in res_work_pairs}
+    res_dict['success'] = np.zeros(n_elements, dtype=bool)
+    res_dict['status'] = np.full(n_elements, _EINPROGRESS)
+    res_dict['nit'] = np.zeros(n_elements, dtype=int)
+    res_dict['nfev'] = np.zeros(n_elements, dtype=int)
+    res = _RichResult(res_dict)
+    work.args = args
+
+    active = _check_termination(work, res, res_work_pairs, active,
+                                check_termination, preserve_shape)
+
+    if callback is not None:
+        temp = _prepare_result(work, res, res_work_pairs, active, shape,
+                               customize_result, preserve_shape)
+        if _call_callback_maybe_halt(callback, temp):
+            cb_terminate = True
+
+    while work.nit < maxiter and active.size and not cb_terminate and n_elements:
+        x = pre_func_eval(work)
+
+        if work.args and work.args[0].ndim != x.ndim:
+            # `x` always starts as 1D. If the SciPy function that uses
+            # _loop added dimensions to `x`, we need to
+            # add them to the elements of `args`.
+            dims = np.arange(x.ndim, dtype=np.int64)
+            work.args = [np.expand_dims(arg, tuple(dims[arg.ndim:]))
+                         for arg in work.args]
+
+        x_shape = x.shape
+        if preserve_shape:
+            x = x.reshape(shape + (-1,))
+        f = func(x, *work.args)
+        f = np.asarray(f, dtype=dtype)
+        if preserve_shape:
+            x = x.reshape(x_shape)
+            f = f.reshape(x_shape)
+        work.nfev += 1 if x.ndim == 1 else x.shape[-1]
+
+        post_func_eval(x, f, work)
+
+        work.nit += 1
+        active = _check_termination(work, res, res_work_pairs, active,
+                                    check_termination, preserve_shape)
+
+        if callback is not None:
+            temp = _prepare_result(work, res, res_work_pairs, active, shape,
+                                   customize_result, preserve_shape)
+            if _call_callback_maybe_halt(callback, temp):
+                cb_terminate = True
+                break
+        if active.size == 0:
+            break
+
+        post_termination_check(work)
+
+    work.status[:] = _ECALLBACK if cb_terminate else _ECONVERR
+    return _prepare_result(work, res, res_work_pairs, active, shape,
+                           customize_result, preserve_shape)
+
+
+def _check_termination(work, res, res_work_pairs, active, check_termination,
+                       preserve_shape):
+    # Checks termination conditions, updates elements of `res` with
+    # corresponding elements of `work`, and compresses `work`.
+
+    stop = check_termination(work)
+
+    if np.any(stop):
+        # update the active elements of the result object with the active
+        # elements for which a termination condition has been met
+        _update_active(work, res, res_work_pairs, active, stop, preserve_shape)
+
+        if preserve_shape:
+            stop = stop[active]
+
+        proceed = ~stop
+        active = active[proceed]
+
+        if not preserve_shape:
+            # compress the arrays to avoid unnecessary computation
+            for key, val in work.items():
+                work[key] = val[proceed] if isinstance(val, np.ndarray) else val
+            work.args = [arg[proceed] for arg in work.args]
+
+    return active
+
+
+def _update_active(work, res, res_work_pairs, active, mask, preserve_shape):
+    # Update `active` indices of the arrays in result object `res` with the
+    # contents of the scalars and arrays in `update_dict`. When provided,
+    # `mask` is a boolean array applied both to the arrays in `update_dict`
+    # that are to be used and to the arrays in `res` that are to be updated.
+    update_dict = {key1: work[key2] for key1, key2 in res_work_pairs}
+    update_dict['success'] = work.status == 0
+
+    if mask is not None:
+        if preserve_shape:
+            active_mask = np.zeros_like(mask)
+            active_mask[active] = 1
+            active_mask = active_mask & mask
+            for key, val in update_dict.items():
+                res[key][active_mask] = (val[active_mask] if np.size(val) > 1
+                                         else val)
+        else:
+            active_mask = active[mask]
+            for key, val in update_dict.items():
+                res[key][active_mask] = val[mask] if np.size(val) > 1 else val
+    else:
+        for key, val in update_dict.items():
+            if preserve_shape and not np.isscalar(val):
+                val = val[active]
+            res[key][active] = val
+
+
+def _prepare_result(work, res, res_work_pairs, active, shape, customize_result,
+                    preserve_shape):
+    # Prepare the result object `res` by creating a copy, copying the latest
+    # data from work, running the provided result customization function,
+    # and reshaping the data to the original shapes.
+    res = res.copy()
+    _update_active(work, res, res_work_pairs, active, None, preserve_shape)
+
+    shape = customize_result(res, shape)
+
+    for key, val in res.items():
+        res[key] = np.reshape(val, shape)[()]
+    res['_order_keys'] = ['success'] + [i for i, j in res_work_pairs]
+    return _RichResult(**res)

venv/lib/python3.10/site-packages/scipy/_lib/_finite_differences.py

@@ -0,0 +1,145 @@
+from numpy import arange, newaxis, hstack, prod, array
+
+
+def _central_diff_weights(Np, ndiv=1):
+    """
+    Return weights for an Np-point central derivative.
+
+    Assumes equally-spaced function points.
+
+    If weights are in the vector w, then
+    derivative is w[0] * f(x-ho*dx) + ... + w[-1] * f(x+h0*dx)
+
+    Parameters
+    ----------
+    Np : int
+        Number of points for the central derivative.
+    ndiv : int, optional
+        Number of divisions. Default is 1.
+
+    Returns
+    -------
+    w : ndarray
+        Weights for an Np-point central derivative. Its size is `Np`.
+
+    Notes
+    -----
+    Can be inaccurate for a large number of points.
+
+    Examples
+    --------
+    We can calculate a derivative value of a function.
+
+    >>> def f(x):
+    ...     return 2 * x**2 + 3
+    >>> x = 3.0 # derivative point
+    >>> h = 0.1 # differential step
+    >>> Np = 3 # point number for central derivative
+    >>> weights = _central_diff_weights(Np) # weights for first derivative
+    >>> vals = [f(x + (i - Np/2) * h) for i in range(Np)]
+    >>> sum(w * v for (w, v) in zip(weights, vals))/h
+    11.79999999999998
+
+    This value is close to the analytical solution:
+    f'(x) = 4x, so f'(3) = 12
+
+    References
+    ----------
+    .. [1] https://en.wikipedia.org/wiki/Finite_difference
+
+    """
+    if Np < ndiv + 1:
+        raise ValueError(
+            "Number of points must be at least the derivative order + 1."
+        )
+    if Np % 2 == 0:
+        raise ValueError("The number of points must be odd.")
+    from scipy import linalg
+
+    ho = Np >> 1
+    x = arange(-ho, ho + 1.0)
+    x = x[:, newaxis]
+    X = x**0.0
+    for k in range(1, Np):
+        X = hstack([X, x**k])
+    w = prod(arange(1, ndiv + 1), axis=0) * linalg.inv(X)[ndiv]
+    return w
+
+
+def _derivative(func, x0, dx=1.0, n=1, args=(), order=3):
+    """
+    Find the nth derivative of a function at a point.
+
+    Given a function, use a central difference formula with spacing `dx` to
+    compute the nth derivative at `x0`.
+
+    Parameters
+    ----------
+    func : function
+        Input function.
+    x0 : float
+        The point at which the nth derivative is found.
+    dx : float, optional
+        Spacing.
+    n : int, optional
+        Order of the derivative. Default is 1.
+    args : tuple, optional
+        Arguments
+    order : int, optional
+        Number of points to use, must be odd.
+
+    Notes
+    -----
+    Decreasing the step size too small can result in round-off error.
+
+    Examples
+    --------
+    >>> def f(x):
+    ...     return x**3 + x**2
+    >>> _derivative(f, 1.0, dx=1e-6)
+    4.9999999999217337
+
+    """
+    if order < n + 1:
+        raise ValueError(
+            "'order' (the number of points used to compute the derivative), "
+            "must be at least the derivative order 'n' + 1."
+        )
+    if order % 2 == 0:
+        raise ValueError(
+            "'order' (the number of points used to compute the derivative) "
+            "must be odd."
+        )
+    # pre-computed for n=1 and 2 and low-order for speed.
+    if n == 1:
+        if order == 3:
+            weights = array([-1, 0, 1]) / 2.0
+        elif order == 5:
+            weights = array([1, -8, 0, 8, -1]) / 12.0
+        elif order == 7:
+            weights = array([-1, 9, -45, 0, 45, -9, 1]) / 60.0
+        elif order == 9:
+            weights = array([3, -32, 168, -672, 0, 672, -168, 32, -3]) / 840.0
+        else:
+            weights = _central_diff_weights(order, 1)
+    elif n == 2:
+        if order == 3:
+            weights = array([1, -2.0, 1])
+        elif order == 5:
+            weights = array([-1, 16, -30, 16, -1]) / 12.0
+        elif order == 7:
+            weights = array([2, -27, 270, -490, 270, -27, 2]) / 180.0
+        elif order == 9:
+            weights = (
+                array([-9, 128, -1008, 8064, -14350, 8064, -1008, 128, -9])
+                / 5040.0
+            )
+        else:
+            weights = _central_diff_weights(order, 2)
+    else:
+        weights = _central_diff_weights(order, n)
+    val = 0.0
+    ho = order >> 1
+    for k in range(order):
+        val += weights[k] * func(x0 + (k - ho) * dx, *args)
+    return val / prod((dx,) * n, axis=0)

venv/lib/python3.10/site-packages/scipy/_lib/_gcutils.py

@@ -0,0 +1,105 @@
+"""
+Module for testing automatic garbage collection of objects
+
+.. autosummary::
+   :toctree: generated/
+
+   set_gc_state - enable or disable garbage collection
+   gc_state - context manager for given state of garbage collector
+   assert_deallocated - context manager to check for circular references on object
+
+"""
+import weakref
+import gc
+
+from contextlib import contextmanager
+from platform import python_implementation
+
+__all__ = ['set_gc_state', 'gc_state', 'assert_deallocated']
+
+
+IS_PYPY = python_implementation() == 'PyPy'
+
+
+class ReferenceError(AssertionError):
+    pass
+
+
+def set_gc_state(state):
+    """ Set status of garbage collector """
+    if gc.isenabled() == state:
+        return
+    if state:
+        gc.enable()
+    else:
+        gc.disable()
+
+
+@contextmanager
+def gc_state(state):
+    """ Context manager to set state of garbage collector to `state`
+
+    Parameters
+    ----------
+    state : bool
+        True for gc enabled, False for disabled
+
+    Examples
+    --------
+    >>> with gc_state(False):
+    ...     assert not gc.isenabled()
+    >>> with gc_state(True):
+    ...     assert gc.isenabled()
+    """
+    orig_state = gc.isenabled()
+    set_gc_state(state)
+    yield
+    set_gc_state(orig_state)
+
+
+@contextmanager
+def assert_deallocated(func, *args, **kwargs):
+    """Context manager to check that object is deallocated
+
+    This is useful for checking that an object can be freed directly by
+    reference counting, without requiring gc to break reference cycles.
+    GC is disabled inside the context manager.
+
+    This check is not available on PyPy.
+
+    Parameters
+    ----------
+    func : callable
+        Callable to create object to check
+    \\*args : sequence
+        positional arguments to `func` in order to create object to check
+    \\*\\*kwargs : dict
+        keyword arguments to `func` in order to create object to check
+
+    Examples
+    --------
+    >>> class C: pass
+    >>> with assert_deallocated(C) as c:
+    ...     # do something
+    ...     del c
+
+    >>> class C:
+    ...     def __init__(self):
+    ...         self._circular = self # Make circular reference
+    >>> with assert_deallocated(C) as c: #doctest: +IGNORE_EXCEPTION_DETAIL
+    ...     # do something
+    ...     del c
+    Traceback (most recent call last):
+        ...
+    ReferenceError: Remaining reference(s) to object
+    """
+    if IS_PYPY:
+        raise RuntimeError("assert_deallocated is unavailable on PyPy")
+
+    with gc_state(False):
+        obj = func(*args, **kwargs)
+        ref = weakref.ref(obj)
+        yield obj
+        del obj
+        if ref() is not None:
+            raise ReferenceError("Remaining reference(s) to object")

venv/lib/python3.10/site-packages/scipy/_lib/_pep440.py

@@ -0,0 +1,487 @@
+"""Utility to compare pep440 compatible version strings.
+
+The LooseVersion and StrictVersion classes that distutils provides don't
+work; they don't recognize anything like alpha/beta/rc/dev versions.
+"""
+
+# Copyright (c) Donald Stufft and individual contributors.
+# All rights reserved.
+
+# Redistribution and use in source and binary forms, with or without
+# modification, are permitted provided that the following conditions are met:
+
+#     1. Redistributions of source code must retain the above copyright notice,
+#        this list of conditions and the following disclaimer.
+
+#     2. Redistributions in binary form must reproduce the above copyright
+#        notice, this list of conditions and the following disclaimer in the
+#        documentation and/or other materials provided with the distribution.
+
+# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+# ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE
+# LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+# CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+# SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+# INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+# CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+# ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+# POSSIBILITY OF SUCH DAMAGE.
+
+import collections
+import itertools
+import re
+
+
+__all__ = [
+    "parse", "Version", "LegacyVersion", "InvalidVersion", "VERSION_PATTERN",
+]
+
+
+# BEGIN packaging/_structures.py
+
+
+class Infinity:
+    def __repr__(self):
+        return "Infinity"
+
+    def __hash__(self):
+        return hash(repr(self))
+
+    def __lt__(self, other):
+        return False
+
+    def __le__(self, other):
+        return False
+
+    def __eq__(self, other):
+        return isinstance(other, self.__class__)
+
+    def __ne__(self, other):
+        return not isinstance(other, self.__class__)
+
+    def __gt__(self, other):
+        return True
+
+    def __ge__(self, other):
+        return True
+
+    def __neg__(self):
+        return NegativeInfinity
+
+
+Infinity = Infinity()
+
+
+class NegativeInfinity:
+    def __repr__(self):
+        return "-Infinity"
+
+    def __hash__(self):
+        return hash(repr(self))
+
+    def __lt__(self, other):
+        return True
+
+    def __le__(self, other):
+        return True
+
+    def __eq__(self, other):
+        return isinstance(other, self.__class__)
+
+    def __ne__(self, other):
+        return not isinstance(other, self.__class__)
+
+    def __gt__(self, other):
+        return False
+
+    def __ge__(self, other):
+        return False
+
+    def __neg__(self):
+        return Infinity
+
+
+# BEGIN packaging/version.py
+
+
+NegativeInfinity = NegativeInfinity()
+
+_Version = collections.namedtuple(
+    "_Version",
+    ["epoch", "release", "dev", "pre", "post", "local"],
+)
+
+
+def parse(version):
+    """
+    Parse the given version string and return either a :class:`Version` object
+    or a :class:`LegacyVersion` object depending on if the given version is
+    a valid PEP 440 version or a legacy version.
+    """
+    try:
+        return Version(version)
+    except InvalidVersion:
+        return LegacyVersion(version)
+
+
+class InvalidVersion(ValueError):
+    """
+    An invalid version was found, users should refer to PEP 440.
+    """
+
+
+class _BaseVersion:
+
+    def __hash__(self):
+        return hash(self._key)
+
+    def __lt__(self, other):
+        return self._compare(other, lambda s, o: s < o)
+
+    def __le__(self, other):
+        return self._compare(other, lambda s, o: s <= o)
+
+    def __eq__(self, other):
+        return self._compare(other, lambda s, o: s == o)
+
+    def __ge__(self, other):
+        return self._compare(other, lambda s, o: s >= o)
+
+    def __gt__(self, other):
+        return self._compare(other, lambda s, o: s > o)
+
+    def __ne__(self, other):
+        return self._compare(other, lambda s, o: s != o)
+
+    def _compare(self, other, method):
+        if not isinstance(other, _BaseVersion):
+            return NotImplemented
+
+        return method(self._key, other._key)
+
+
+class LegacyVersion(_BaseVersion):
+
+    def __init__(self, version):
+        self._version = str(version)
+        self._key = _legacy_cmpkey(self._version)
+
+    def __str__(self):
+        return self._version
+
+    def __repr__(self):
+        return f"<LegacyVersion({repr(str(self))})>"
+
+    @property
+    def public(self):
+        return self._version
+
+    @property
+    def base_version(self):
+        return self._version
+
+    @property
+    def local(self):
+        return None
+
+    @property
+    def is_prerelease(self):
+        return False
+
+    @property
+    def is_postrelease(self):
+        return False
+
+
+_legacy_version_component_re = re.compile(
+    r"(\d+ | [a-z]+ | \.| -)", re.VERBOSE,
+)
+
+_legacy_version_replacement_map = {
+    "pre": "c", "preview": "c", "-": "final-", "rc": "c", "dev": "@",
+}
+
+
+def _parse_version_parts(s):
+    for part in _legacy_version_component_re.split(s):
+        part = _legacy_version_replacement_map.get(part, part)
+
+        if not part or part == ".":
+            continue
+
+        if part[:1] in "0123456789":
+            # pad for numeric comparison
+            yield part.zfill(8)
+        else:
+            yield "*" + part
+
+    # ensure that alpha/beta/candidate are before final
+    yield "*final"
+
+
+def _legacy_cmpkey(version):
+    # We hardcode an epoch of -1 here. A PEP 440 version can only have an epoch
+    # greater than or equal to 0. This will effectively put the LegacyVersion,
+    # which uses the defacto standard originally implemented by setuptools,
+    # as before all PEP 440 versions.
+    epoch = -1
+
+    # This scheme is taken from pkg_resources.parse_version setuptools prior to
+    # its adoption of the packaging library.
+    parts = []
+    for part in _parse_version_parts(version.lower()):
+        if part.startswith("*"):
+            # remove "-" before a prerelease tag
+            if part < "*final":
+                while parts and parts[-1] == "*final-":
+                    parts.pop()
+
+            # remove trailing zeros from each series of numeric parts
+            while parts and parts[-1] == "00000000":
+                parts.pop()
+
+        parts.append(part)
+    parts = tuple(parts)
+
+    return epoch, parts
+
+
+# Deliberately not anchored to the start and end of the string, to make it
+# easier for 3rd party code to reuse
+VERSION_PATTERN = r"""
+    v?
+    (?:
+        (?:(?P<epoch>[0-9]+)!)?                           # epoch
+        (?P<release>[0-9]+(?:\.[0-9]+)*)                  # release segment
+        (?P<pre>                                          # pre-release
+            [-_\.]?
+            (?P<pre_l>(a|b|c|rc|alpha|beta|pre|preview))
+            [-_\.]?
+            (?P<pre_n>[0-9]+)?
+        )?
+        (?P<post>                                         # post release
+            (?:-(?P<post_n1>[0-9]+))
+            |
+            (?:
+                [-_\.]?
+                (?P<post_l>post|rev|r)
+                [-_\.]?
+                (?P<post_n2>[0-9]+)?
+            )
+        )?
+        (?P<dev>                                          # dev release
+            [-_\.]?
+            (?P<dev_l>dev)
+            [-_\.]?
+            (?P<dev_n>[0-9]+)?
+        )?
+    )
+    (?:\+(?P<local>[a-z0-9]+(?:[-_\.][a-z0-9]+)*))?       # local version
+"""
+
+
+class Version(_BaseVersion):
+
+    _regex = re.compile(
+        r"^\s*" + VERSION_PATTERN + r"\s*$",
+        re.VERBOSE | re.IGNORECASE,
+    )
+
+    def __init__(self, version):
+        # Validate the version and parse it into pieces
+        match = self._regex.search(version)
+        if not match:
+            raise InvalidVersion(f"Invalid version: '{version}'")
+
+        # Store the parsed out pieces of the version
+        self._version = _Version(
+            epoch=int(match.group("epoch")) if match.group("epoch") else 0,
+            release=tuple(int(i) for i in match.group("release").split(".")),
+            pre=_parse_letter_version(
+                match.group("pre_l"),
+                match.group("pre_n"),
+            ),
+            post=_parse_letter_version(
+                match.group("post_l"),
+                match.group("post_n1") or match.group("post_n2"),
+            ),
+            dev=_parse_letter_version(
+                match.group("dev_l"),
+                match.group("dev_n"),
+            ),
+            local=_parse_local_version(match.group("local")),
+        )
+
+        # Generate a key which will be used for sorting
+        self._key = _cmpkey(
+            self._version.epoch,
+            self._version.release,
+            self._version.pre,
+            self._version.post,
+            self._version.dev,
+            self._version.local,
+        )
+
+    def __repr__(self):
+        return f"<Version({repr(str(self))})>"
+
+    def __str__(self):
+        parts = []
+
+        # Epoch
+        if self._version.epoch != 0:
+            parts.append(f"{self._version.epoch}!")
+
+        # Release segment
+        parts.append(".".join(str(x) for x in self._version.release))
+
+        # Pre-release
+        if self._version.pre is not None:
+            parts.append("".join(str(x) for x in self._version.pre))
+
+        # Post-release
+        if self._version.post is not None:
+            parts.append(f".post{self._version.post[1]}")
+
+        # Development release
+        if self._version.dev is not None:
+            parts.append(f".dev{self._version.dev[1]}")
+
+        # Local version segment
+        if self._version.local is not None:
+            parts.append(
+                "+{}".format(".".join(str(x) for x in self._version.local))
+            )
+
+        return "".join(parts)
+
+    @property
+    def public(self):
+        return str(self).split("+", 1)[0]
+
+    @property
+    def base_version(self):
+        parts = []
+
+        # Epoch
+        if self._version.epoch != 0:
+            parts.append(f"{self._version.epoch}!")
+
+        # Release segment
+        parts.append(".".join(str(x) for x in self._version.release))
+
+        return "".join(parts)
+
+    @property
+    def local(self):
+        version_string = str(self)
+        if "+" in version_string:
+            return version_string.split("+", 1)[1]
+
+    @property
+    def is_prerelease(self):
+        return bool(self._version.dev or self._version.pre)
+
+    @property
+    def is_postrelease(self):
+        return bool(self._version.post)
+
+
+def _parse_letter_version(letter, number):
+    if letter:
+        # We assume there is an implicit 0 in a pre-release if there is
+        # no numeral associated with it.
+        if number is None:
+            number = 0
+
+        # We normalize any letters to their lower-case form
+        letter = letter.lower()
+
+        # We consider some words to be alternate spellings of other words and
+        # in those cases we want to normalize the spellings to our preferred
+        # spelling.
+        if letter == "alpha":
+            letter = "a"
+        elif letter == "beta":
+            letter = "b"
+        elif letter in ["c", "pre", "preview"]:
+            letter = "rc"
+        elif letter in ["rev", "r"]:
+            letter = "post"
+
+        return letter, int(number)
+    if not letter and number:
+        # We assume that if we are given a number but not given a letter,
+        # then this is using the implicit post release syntax (e.g., 1.0-1)
+        letter = "post"
+
+        return letter, int(number)
+
+
+_local_version_seperators = re.compile(r"[\._-]")
+
+
+def _parse_local_version(local):
+    """
+    Takes a string like abc.1.twelve and turns it into ("abc", 1, "twelve").
+    """
+    if local is not None:
+        return tuple(
+            part.lower() if not part.isdigit() else int(part)
+            for part in _local_version_seperators.split(local)
+        )
+
+
+def _cmpkey(epoch, release, pre, post, dev, local):
+    # When we compare a release version, we want to compare it with all of the
+    # trailing zeros removed. So we'll use a reverse the list, drop all the now
+    # leading zeros until we come to something non-zero, then take the rest,
+    # re-reverse it back into the correct order, and make it a tuple and use
+    # that for our sorting key.
+    release = tuple(
+        reversed(list(
+            itertools.dropwhile(
+                lambda x: x == 0,
+                reversed(release),
+            )
+        ))
+    )
+
+    # We need to "trick" the sorting algorithm to put 1.0.dev0 before 1.0a0.
+    # We'll do this by abusing the pre-segment, but we _only_ want to do this
+    # if there is no pre- or a post-segment. If we have one of those, then
+    # the normal sorting rules will handle this case correctly.
+    if pre is None and post is None and dev is not None:
+        pre = -Infinity
+    # Versions without a pre-release (except as noted above) should sort after
+    # those with one.
+    elif pre is None:
+        pre = Infinity
+
+    # Versions without a post-segment should sort before those with one.
+    if post is None:
+        post = -Infinity
+
+    # Versions without a development segment should sort after those with one.
+    if dev is None:
+        dev = Infinity
+
+    if local is None:
+        # Versions without a local segment should sort before those with one.
+        local = -Infinity
+    else:
+        # Versions with a local segment need that segment parsed to implement
+        # the sorting rules in PEP440.
+        # - Alphanumeric segments sort before numeric segments
+        # - Alphanumeric segments sort lexicographically
+        # - Numeric segments sort numerically
+        # - Shorter versions sort before longer versions when the prefixes
+        #   match exactly
+        local = tuple(
+            (i, "") if isinstance(i, int) else (-Infinity, i)
+            for i in local
+        )
+
+    return epoch, release, pre, post, dev, local

venv/lib/python3.10/site-packages/scipy/_lib/_testutils.py

@@ -0,0 +1,253 @@
+"""
+Generic test utilities.
+
+"""
+
+import os
+import re
+import sys
+import numpy as np
+import inspect
+import sysconfig
+
+
+__all__ = ['PytestTester', 'check_free_memory', '_TestPythranFunc', 'IS_MUSL']
+
+
+IS_MUSL = False
+# alternate way is
+# from packaging.tags import sys_tags
+#     _tags = list(sys_tags())
+#     if 'musllinux' in _tags[0].platform:
+_v = sysconfig.get_config_var('HOST_GNU_TYPE') or ''
+if 'musl' in _v:
+    IS_MUSL = True
+
+
+class FPUModeChangeWarning(RuntimeWarning):
+    """Warning about FPU mode change"""
+    pass
+
+
+class PytestTester:
+    """
+    Run tests for this namespace
+
+    ``scipy.test()`` runs tests for all of SciPy, with the default settings.
+    When used from a submodule (e.g., ``scipy.cluster.test()``, only the tests
+    for that namespace are run.
+
+    Parameters
+    ----------
+    label : {'fast', 'full'}, optional
+        Whether to run only the fast tests, or also those marked as slow.
+        Default is 'fast'.
+    verbose : int, optional
+        Test output verbosity. Default is 1.
+    extra_argv : list, optional
+        Arguments to pass through to Pytest.
+    doctests : bool, optional
+        Whether to run doctests or not. Default is False.
+    coverage : bool, optional
+        Whether to run tests with code coverage measurements enabled.
+        Default is False.
+    tests : list of str, optional
+        List of module names to run tests for. By default, uses the module
+        from which the ``test`` function is called.
+    parallel : int, optional
+        Run tests in parallel with pytest-xdist, if number given is larger than
+        1. Default is 1.
+
+    """
+    def __init__(self, module_name):
+        self.module_name = module_name
+
+    def __call__(self, label="fast", verbose=1, extra_argv=None, doctests=False,
+                 coverage=False, tests=None, parallel=None):
+        import pytest
+
+        module = sys.modules[self.module_name]
+        module_path = os.path.abspath(module.__path__[0])
+
+        pytest_args = ['--showlocals', '--tb=short']
+
+        if doctests:
+            raise ValueError("Doctests not supported")
+
+        if extra_argv:
+            pytest_args += list(extra_argv)
+
+        if verbose and int(verbose) > 1:
+            pytest_args += ["-" + "v"*(int(verbose)-1)]
+
+        if coverage:
+            pytest_args += ["--cov=" + module_path]
+
+        if label == "fast":
+            pytest_args += ["-m", "not slow"]
+        elif label != "full":
+            pytest_args += ["-m", label]
+
+        if tests is None:
+            tests = [self.module_name]
+
+        if parallel is not None and parallel > 1:
+            if _pytest_has_xdist():
+                pytest_args += ['-n', str(parallel)]
+            else:
+                import warnings
+                warnings.warn('Could not run tests in parallel because '
+                              'pytest-xdist plugin is not available.',
+                              stacklevel=2)
+
+        pytest_args += ['--pyargs'] + list(tests)
+
+        try:
+            code = pytest.main(pytest_args)
+        except SystemExit as exc:
+            code = exc.code
+
+        return (code == 0)
+
+
+class _TestPythranFunc:
+    '''
+    These are situations that can be tested in our pythran tests:
+    - A function with multiple array arguments and then
+      other positional and keyword arguments.
+    - A function with array-like keywords (e.g. `def somefunc(x0, x1=None)`.
+    Note: list/tuple input is not yet tested!
+
+    `self.arguments`: A dictionary which key is the index of the argument,
+                      value is tuple(array value, all supported dtypes)
+    `self.partialfunc`: A function used to freeze some non-array argument
+                        that of no interests in the original function
+    '''
+    ALL_INTEGER = [np.int8, np.int16, np.int32, np.int64, np.intc, np.intp]
+    ALL_FLOAT = [np.float32, np.float64]
+    ALL_COMPLEX = [np.complex64, np.complex128]
+
+    def setup_method(self):
+        self.arguments = {}
+        self.partialfunc = None
+        self.expected = None
+
+    def get_optional_args(self, func):
+        # get optional arguments with its default value,
+        # used for testing keywords
+        signature = inspect.signature(func)
+        optional_args = {}
+        for k, v in signature.parameters.items():
+            if v.default is not inspect.Parameter.empty:
+                optional_args[k] = v.default
+        return optional_args
+
+    def get_max_dtype_list_length(self):
+        # get the max supported dtypes list length in all arguments
+        max_len = 0
+        for arg_idx in self.arguments:
+            cur_len = len(self.arguments[arg_idx][1])
+            if cur_len > max_len:
+                max_len = cur_len
+        return max_len
+
+    def get_dtype(self, dtype_list, dtype_idx):
+        # get the dtype from dtype_list via index
+        # if the index is out of range, then return the last dtype
+        if dtype_idx > len(dtype_list)-1:
+            return dtype_list[-1]
+        else:
+            return dtype_list[dtype_idx]
+
+    def test_all_dtypes(self):
+        for type_idx in range(self.get_max_dtype_list_length()):
+            args_array = []
+            for arg_idx in self.arguments:
+                new_dtype = self.get_dtype(self.arguments[arg_idx][1],
+                                           type_idx)
+                args_array.append(self.arguments[arg_idx][0].astype(new_dtype))
+            self.pythranfunc(*args_array)
+
+    def test_views(self):
+        args_array = []
+        for arg_idx in self.arguments:
+            args_array.append(self.arguments[arg_idx][0][::-1][::-1])
+        self.pythranfunc(*args_array)
+
+    def test_strided(self):
+        args_array = []
+        for arg_idx in self.arguments:
+            args_array.append(np.repeat(self.arguments[arg_idx][0],
+                                        2, axis=0)[::2])
+        self.pythranfunc(*args_array)
+
+
+def _pytest_has_xdist():
+    """
+    Check if the pytest-xdist plugin is installed, providing parallel tests
+    """
+    # Check xdist exists without importing, otherwise pytests emits warnings
+    from importlib.util import find_spec
+    return find_spec('xdist') is not None
+
+
+def check_free_memory(free_mb):
+    """
+    Check *free_mb* of memory is available, otherwise do pytest.skip
+    """
+    import pytest
+
+    try:
+        mem_free = _parse_size(os.environ['SCIPY_AVAILABLE_MEM'])
+        msg = '{} MB memory required, but environment SCIPY_AVAILABLE_MEM={}'.format(
+            free_mb, os.environ['SCIPY_AVAILABLE_MEM'])
+    except KeyError:
+        mem_free = _get_mem_available()
+        if mem_free is None:
+            pytest.skip("Could not determine available memory; set SCIPY_AVAILABLE_MEM "
+                        "variable to free memory in MB to run the test.")
+        msg = f'{free_mb} MB memory required, but {mem_free/1e6} MB available'
+
+    if mem_free < free_mb * 1e6:
+        pytest.skip(msg)
+
+
+def _parse_size(size_str):
+    suffixes = {'': 1e6,
+                'b': 1.0,
+                'k': 1e3, 'M': 1e6, 'G': 1e9, 'T': 1e12,
+                'kb': 1e3, 'Mb': 1e6, 'Gb': 1e9, 'Tb': 1e12,
+                'kib': 1024.0, 'Mib': 1024.0**2, 'Gib': 1024.0**3, 'Tib': 1024.0**4}
+    m = re.match(r'^\s*(\d+)\s*({})\s*$'.format('|'.join(suffixes.keys())),
+                 size_str,
+                 re.I)
+    if not m or m.group(2) not in suffixes:
+        raise ValueError("Invalid size string")
+
+    return float(m.group(1)) * suffixes[m.group(2)]
+
+
+def _get_mem_available():
+    """
+    Get information about memory available, not counting swap.
+    """
+    try:
+        import psutil
+        return psutil.virtual_memory().available
+    except (ImportError, AttributeError):
+        pass
+
+    if sys.platform.startswith('linux'):
+        info = {}
+        with open('/proc/meminfo') as f:
+            for line in f:
+                p = line.split()
+                info[p[0].strip(':').lower()] = float(p[1]) * 1e3
+
+        if 'memavailable' in info:
+            # Linux >= 3.14
+            return info['memavailable']
+        else:
+            return info['memfree'] + info['cached']
+
+    return None

venv/lib/python3.10/site-packages/scipy/_lib/_threadsafety.py

@@ -0,0 +1,58 @@
+import threading
+
+import scipy._lib.decorator
+
+
+__all__ = ['ReentrancyError', 'ReentrancyLock', 'non_reentrant']
+
+
+class ReentrancyError(RuntimeError):
+    pass
+
+
+class ReentrancyLock:
+    """
+    Threading lock that raises an exception for reentrant calls.
+
+    Calls from different threads are serialized, and nested calls from the
+    same thread result to an error.
+
+    The object can be used as a context manager or to decorate functions
+    via the decorate() method.
+
+    """
+
+    def __init__(self, err_msg):
+        self._rlock = threading.RLock()
+        self._entered = False
+        self._err_msg = err_msg
+
+    def __enter__(self):
+        self._rlock.acquire()
+        if self._entered:
+            self._rlock.release()
+            raise ReentrancyError(self._err_msg)
+        self._entered = True
+
+    def __exit__(self, type, value, traceback):
+        self._entered = False
+        self._rlock.release()
+
+    def decorate(self, func):
+        def caller(func, *a, **kw):
+            with self:
+                return func(*a, **kw)
+        return scipy._lib.decorator.decorate(func, caller)
+
+
+def non_reentrant(err_msg=None):
+    """
+    Decorate a function with a threading lock and prevent reentrant calls.
+    """
+    def decorator(func):
+        msg = err_msg
+        if msg is None:
+            msg = "%s is not re-entrant" % func.__name__
+        lock = ReentrancyLock(msg)
+        return lock.decorate(func)
+    return decorator

venv/lib/python3.10/site-packages/scipy/_lib/_tmpdirs.py

@@ -0,0 +1,86 @@
+''' Contexts for *with* statement providing temporary directories
+'''
+import os
+from contextlib import contextmanager
+from shutil import rmtree
+from tempfile import mkdtemp
+
+
+@contextmanager
+def tempdir():
+    """Create and return a temporary directory. This has the same
+    behavior as mkdtemp but can be used as a context manager.
+
+    Upon exiting the context, the directory and everything contained
+    in it are removed.
+
+    Examples
+    --------
+    >>> import os
+    >>> with tempdir() as tmpdir:
+    ...     fname = os.path.join(tmpdir, 'example_file.txt')
+    ...     with open(fname, 'wt') as fobj:
+    ...         _ = fobj.write('a string\\n')
+    >>> os.path.exists(tmpdir)
+    False
+    """
+    d = mkdtemp()
+    yield d
+    rmtree(d)
+
+
+@contextmanager
+def in_tempdir():
+    ''' Create, return, and change directory to a temporary directory
+
+    Examples
+    --------
+    >>> import os
+    >>> my_cwd = os.getcwd()
+    >>> with in_tempdir() as tmpdir:
+    ...     _ = open('test.txt', 'wt').write('some text')
+    ...     assert os.path.isfile('test.txt')
+    ...     assert os.path.isfile(os.path.join(tmpdir, 'test.txt'))
+    >>> os.path.exists(tmpdir)
+    False
+    >>> os.getcwd() == my_cwd
+    True
+    '''
+    pwd = os.getcwd()
+    d = mkdtemp()
+    os.chdir(d)
+    yield d
+    os.chdir(pwd)
+    rmtree(d)
+
+
+@contextmanager
+def in_dir(dir=None):
+    """ Change directory to given directory for duration of ``with`` block
+
+    Useful when you want to use `in_tempdir` for the final test, but
+    you are still debugging. For example, you may want to do this in the end:
+
+    >>> with in_tempdir() as tmpdir:
+    ...     # do something complicated which might break
+    ...     pass
+
+    But, indeed, the complicated thing does break, and meanwhile, the
+    ``in_tempdir`` context manager wiped out the directory with the
+    temporary files that you wanted for debugging. So, while debugging, you
+    replace with something like:
+
+    >>> with in_dir() as tmpdir: # Use working directory by default
+    ...     # do something complicated which might break
+    ...     pass
+
+    You can then look at the temporary file outputs to debug what is happening,
+    fix, and finally replace ``in_dir`` with ``in_tempdir`` again.
+    """
+    cwd = os.getcwd()
+    if dir is None:
+        yield cwd
+        return
+    os.chdir(dir)
+    yield dir
+    os.chdir(cwd)

venv/lib/python3.10/site-packages/scipy/_lib/_util.py

@@ -0,0 +1,948 @@
+import re
+from contextlib import contextmanager
+import functools
+import operator
+import warnings
+import numbers
+from collections import namedtuple
+import inspect
+import math
+from typing import (
+    Optional,
+    Union,
+    TYPE_CHECKING,
+    TypeVar,
+)
+
+import numpy as np
+from scipy._lib._array_api import array_namespace
+
+
+AxisError: type[Exception]
+ComplexWarning: type[Warning]
+VisibleDeprecationWarning: type[Warning]
+
+if np.lib.NumpyVersion(np.__version__) >= '1.25.0':
+    from numpy.exceptions import (
+        AxisError, ComplexWarning, VisibleDeprecationWarning,
+        DTypePromotionError
+    )
+else:
+    from numpy import (
+        AxisError, ComplexWarning, VisibleDeprecationWarning  # noqa: F401
+    )
+    DTypePromotionError = TypeError  # type: ignore
+
+np_long: type
+np_ulong: type
+
+if np.lib.NumpyVersion(np.__version__) >= "2.0.0.dev0":
+    try:
+        with warnings.catch_warnings():
+            warnings.filterwarnings(
+                "ignore",
+                r".*In the future `np\.long` will be defined as.*",
+                FutureWarning,
+            )
+            np_long = np.long  # type: ignore[attr-defined]
+            np_ulong = np.ulong  # type: ignore[attr-defined]
+    except AttributeError:
+            np_long = np.int_
+            np_ulong = np.uint
+else:
+    np_long = np.int_
+    np_ulong = np.uint
+
+IntNumber = Union[int, np.integer]
+DecimalNumber = Union[float, np.floating, np.integer]
+
+copy_if_needed: Optional[bool]
+
+if np.lib.NumpyVersion(np.__version__) >= "2.0.0":
+    copy_if_needed = None
+elif np.lib.NumpyVersion(np.__version__) < "1.28.0":
+    copy_if_needed = False
+else:
+    # 2.0.0 dev versions, handle cases where copy may or may not exist
+    try:
+        np.array([1]).__array__(copy=None)  # type: ignore[call-overload]
+        copy_if_needed = None
+    except TypeError:
+        copy_if_needed = False
+
+# Since Generator was introduced in numpy 1.17, the following condition is needed for
+# backward compatibility
+if TYPE_CHECKING:
+    SeedType = Optional[Union[IntNumber, np.random.Generator,
+                              np.random.RandomState]]
+    GeneratorType = TypeVar("GeneratorType", bound=Union[np.random.Generator,
+                                                         np.random.RandomState])
+
+try:
+    from numpy.random import Generator as Generator
+except ImportError:
+    class Generator:  # type: ignore[no-redef]
+        pass
+
+
+def _lazywhere(cond, arrays, f, fillvalue=None, f2=None):
+    """Return elements chosen from two possibilities depending on a condition
+
+    Equivalent to ``f(*arrays) if cond else fillvalue`` performed elementwise.
+
+    Parameters
+    ----------
+    cond : array
+        The condition (expressed as a boolean array).
+    arrays : tuple of array
+        Arguments to `f` (and `f2`). Must be broadcastable with `cond`.
+    f : callable
+        Where `cond` is True, output will be ``f(arr1[cond], arr2[cond], ...)``
+    fillvalue : object
+        If provided, value with which to fill output array where `cond` is
+        not True.
+    f2 : callable
+        If provided, output will be ``f2(arr1[cond], arr2[cond], ...)`` where
+        `cond` is not True.
+
+    Returns
+    -------
+    out : array
+        An array with elements from the output of `f` where `cond` is True
+        and `fillvalue` (or elements from the output of `f2`) elsewhere. The
+        returned array has data type determined by Type Promotion Rules
+        with the output of `f` and `fillvalue` (or the output of `f2`).
+
+    Notes
+    -----
+    ``xp.where(cond, x, fillvalue)`` requires explicitly forming `x` even where
+    `cond` is False. This function evaluates ``f(arr1[cond], arr2[cond], ...)``
+    onle where `cond` ``is True.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> a, b = np.array([1, 2, 3, 4]), np.array([5, 6, 7, 8])
+    >>> def f(a, b):
+    ...     return a*b
+    >>> _lazywhere(a > 2, (a, b), f, np.nan)
+    array([ nan,  nan,  21.,  32.])
+
+    """
+    xp = array_namespace(cond, *arrays)
+
+    if (f2 is fillvalue is None) or (f2 is not None and fillvalue is not None):
+        raise ValueError("Exactly one of `fillvalue` or `f2` must be given.")
+
+    args = xp.broadcast_arrays(cond, *arrays)
+    bool_dtype = xp.asarray([True]).dtype  # numpy 1.xx doesn't have `bool`
+    cond, arrays = xp.astype(args[0], bool_dtype, copy=False), args[1:]
+
+    temp1 = xp.asarray(f(*(arr[cond] for arr in arrays)))
+
+    if f2 is None:
+        fillvalue = xp.asarray(fillvalue)
+        dtype = xp.result_type(temp1.dtype, fillvalue.dtype)
+        out = xp.full(cond.shape, fill_value=fillvalue, dtype=dtype)
+    else:
+        ncond = ~cond
+        temp2 = xp.asarray(f2(*(arr[ncond] for arr in arrays)))
+        dtype = xp.result_type(temp1, temp2)
+        out = xp.empty(cond.shape, dtype=dtype)
+        out[ncond] = temp2
+
+    out[cond] = temp1
+
+    return out
+
+
+def _lazyselect(condlist, choicelist, arrays, default=0):
+    """
+    Mimic `np.select(condlist, choicelist)`.
+
+    Notice, it assumes that all `arrays` are of the same shape or can be
+    broadcasted together.
+
+    All functions in `choicelist` must accept array arguments in the order
+    given in `arrays` and must return an array of the same shape as broadcasted
+    `arrays`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> x = np.arange(6)
+    >>> np.select([x <3, x > 3], [x**2, x**3], default=0)
+    array([  0,   1,   4,   0,  64, 125])
+
+    >>> _lazyselect([x < 3, x > 3], [lambda x: x**2, lambda x: x**3], (x,))
+    array([   0.,    1.,    4.,   0.,   64.,  125.])
+
+    >>> a = -np.ones_like(x)
+    >>> _lazyselect([x < 3, x > 3],
+    ...             [lambda x, a: x**2, lambda x, a: a * x**3],
+    ...             (x, a), default=np.nan)
+    array([   0.,    1.,    4.,   nan,  -64., -125.])
+
+    """
+    arrays = np.broadcast_arrays(*arrays)
+    tcode = np.mintypecode([a.dtype.char for a in arrays])
+    out = np.full(np.shape(arrays[0]), fill_value=default, dtype=tcode)
+    for func, cond in zip(choicelist, condlist):
+        if np.all(cond is False):
+            continue
+        cond, _ = np.broadcast_arrays(cond, arrays[0])
+        temp = tuple(np.extract(cond, arr) for arr in arrays)
+        np.place(out, cond, func(*temp))
+    return out
+
+
+def _aligned_zeros(shape, dtype=float, order="C", align=None):
+    """Allocate a new ndarray with aligned memory.
+
+    Primary use case for this currently is working around a f2py issue
+    in NumPy 1.9.1, where dtype.alignment is such that np.zeros() does
+    not necessarily create arrays aligned up to it.
+
+    """
+    dtype = np.dtype(dtype)
+    if align is None:
+        align = dtype.alignment
+    if not hasattr(shape, '__len__'):
+        shape = (shape,)
+    size = functools.reduce(operator.mul, shape) * dtype.itemsize
+    buf = np.empty(size + align + 1, np.uint8)
+    offset = buf.__array_interface__['data'][0] % align
+    if offset != 0:
+        offset = align - offset
+    # Note: slices producing 0-size arrays do not necessarily change
+    # data pointer --- so we use and allocate size+1
+    buf = buf[offset:offset+size+1][:-1]
+    data = np.ndarray(shape, dtype, buf, order=order)
+    data.fill(0)
+    return data
+
+
+def _prune_array(array):
+    """Return an array equivalent to the input array. If the input
+    array is a view of a much larger array, copy its contents to a
+    newly allocated array. Otherwise, return the input unchanged.
+    """
+    if array.base is not None and array.size < array.base.size // 2:
+        return array.copy()
+    return array
+
+
+def float_factorial(n: int) -> float:
+    """Compute the factorial and return as a float
+
+    Returns infinity when result is too large for a double
+    """
+    return float(math.factorial(n)) if n < 171 else np.inf
+
+
+# copy-pasted from scikit-learn utils/validation.py
+# change this to scipy.stats._qmc.check_random_state once numpy 1.16 is dropped
+def check_random_state(seed):
+    """Turn `seed` into a `np.random.RandomState` instance.
+
+    Parameters
+    ----------
+    seed : {None, int, `numpy.random.Generator`, `numpy.random.RandomState`}, optional
+        If `seed` is None (or `np.random`), the `numpy.random.RandomState`
+        singleton is used.
+        If `seed` is an int, a new ``RandomState`` instance is used,
+        seeded with `seed`.
+        If `seed` is already a ``Generator`` or ``RandomState`` instance then
+        that instance is used.
+
+    Returns
+    -------
+    seed : {`numpy.random.Generator`, `numpy.random.RandomState`}
+        Random number generator.
+
+    """
+    if seed is None or seed is np.random:
+        return np.random.mtrand._rand
+    if isinstance(seed, (numbers.Integral, np.integer)):
+        return np.random.RandomState(seed)
+    if isinstance(seed, (np.random.RandomState, np.random.Generator)):
+        return seed
+
+    raise ValueError('%r cannot be used to seed a numpy.random.RandomState'
+                     ' instance' % seed)
+
+
+def _asarray_validated(a, check_finite=True,
+                       sparse_ok=False, objects_ok=False, mask_ok=False,
+                       as_inexact=False):
+    """
+    Helper function for SciPy argument validation.
+
+    Many SciPy linear algebra functions do support arbitrary array-like
+    input arguments. Examples of commonly unsupported inputs include
+    matrices containing inf/nan, sparse matrix representations, and
+    matrices with complicated elements.
+
+    Parameters
+    ----------
+    a : array_like
+        The array-like input.
+    check_finite : bool, optional
+        Whether to check that the input matrices contain only finite numbers.
+        Disabling may give a performance gain, but may result in problems
+        (crashes, non-termination) if the inputs do contain infinities or NaNs.
+        Default: True
+    sparse_ok : bool, optional
+        True if scipy sparse matrices are allowed.
+    objects_ok : bool, optional
+        True if arrays with dype('O') are allowed.
+    mask_ok : bool, optional
+        True if masked arrays are allowed.
+    as_inexact : bool, optional
+        True to convert the input array to a np.inexact dtype.
+
+    Returns
+    -------
+    ret : ndarray
+        The converted validated array.
+
+    """
+    if not sparse_ok:
+        import scipy.sparse
+        if scipy.sparse.issparse(a):
+            msg = ('Sparse matrices are not supported by this function. '
+                   'Perhaps one of the scipy.sparse.linalg functions '
+                   'would work instead.')
+            raise ValueError(msg)
+    if not mask_ok:
+        if np.ma.isMaskedArray(a):
+            raise ValueError('masked arrays are not supported')
+    toarray = np.asarray_chkfinite if check_finite else np.asarray
+    a = toarray(a)
+    if not objects_ok:
+        if a.dtype is np.dtype('O'):
+            raise ValueError('object arrays are not supported')
+    if as_inexact:
+        if not np.issubdtype(a.dtype, np.inexact):
+            a = toarray(a, dtype=np.float64)
+    return a
+
+
+def _validate_int(k, name, minimum=None):
+    """
+    Validate a scalar integer.
+
+    This function can be used to validate an argument to a function
+    that expects the value to be an integer.  It uses `operator.index`
+    to validate the value (so, for example, k=2.0 results in a
+    TypeError).
+
+    Parameters
+    ----------
+    k : int
+        The value to be validated.
+    name : str
+        The name of the parameter.
+    minimum : int, optional
+        An optional lower bound.
+    """
+    try:
+        k = operator.index(k)
+    except TypeError:
+        raise TypeError(f'{name} must be an integer.') from None
+    if minimum is not None and k < minimum:
+        raise ValueError(f'{name} must be an integer not less '
+                         f'than {minimum}') from None
+    return k
+
+
+# Add a replacement for inspect.getfullargspec()/
+# The version below is borrowed from Django,
+# https://github.com/django/django/pull/4846.
+
+# Note an inconsistency between inspect.getfullargspec(func) and
+# inspect.signature(func). If `func` is a bound method, the latter does *not*
+# list `self` as a first argument, while the former *does*.
+# Hence, cook up a common ground replacement: `getfullargspec_no_self` which
+# mimics `inspect.getfullargspec` but does not list `self`.
+#
+# This way, the caller code does not need to know whether it uses a legacy
+# .getfullargspec or a bright and shiny .signature.
+
+FullArgSpec = namedtuple('FullArgSpec',
+                         ['args', 'varargs', 'varkw', 'defaults',
+                          'kwonlyargs', 'kwonlydefaults', 'annotations'])
+
+
+def getfullargspec_no_self(func):
+    """inspect.getfullargspec replacement using inspect.signature.
+
+    If func is a bound method, do not list the 'self' parameter.
+
+    Parameters
+    ----------
+    func : callable
+        A callable to inspect
+
+    Returns
+    -------
+    fullargspec : FullArgSpec(args, varargs, varkw, defaults, kwonlyargs,
+                              kwonlydefaults, annotations)
+
+        NOTE: if the first argument of `func` is self, it is *not*, I repeat
+        *not*, included in fullargspec.args.
+        This is done for consistency between inspect.getargspec() under
+        Python 2.x, and inspect.signature() under Python 3.x.
+
+    """
+    sig = inspect.signature(func)
+    args = [
+        p.name for p in sig.parameters.values()
+        if p.kind in [inspect.Parameter.POSITIONAL_OR_KEYWORD,
+                      inspect.Parameter.POSITIONAL_ONLY]
+    ]
+    varargs = [
+        p.name for p in sig.parameters.values()
+        if p.kind == inspect.Parameter.VAR_POSITIONAL
+    ]
+    varargs = varargs[0] if varargs else None
+    varkw = [
+        p.name for p in sig.parameters.values()
+        if p.kind == inspect.Parameter.VAR_KEYWORD
+    ]
+    varkw = varkw[0] if varkw else None
+    defaults = tuple(
+        p.default for p in sig.parameters.values()
+        if (p.kind == inspect.Parameter.POSITIONAL_OR_KEYWORD and
+            p.default is not p.empty)
+    ) or None
+    kwonlyargs = [
+        p.name for p in sig.parameters.values()
+        if p.kind == inspect.Parameter.KEYWORD_ONLY
+    ]
+    kwdefaults = {p.name: p.default for p in sig.parameters.values()
+                  if p.kind == inspect.Parameter.KEYWORD_ONLY and
+                  p.default is not p.empty}
+    annotations = {p.name: p.annotation for p in sig.parameters.values()
+                   if p.annotation is not p.empty}
+    return FullArgSpec(args, varargs, varkw, defaults, kwonlyargs,
+                       kwdefaults or None, annotations)
+
+
+class _FunctionWrapper:
+    """
+    Object to wrap user's function, allowing picklability
+    """
+    def __init__(self, f, args):
+        self.f = f
+        self.args = [] if args is None else args
+
+    def __call__(self, x):
+        return self.f(x, *self.args)
+
+
+class MapWrapper:
+    """
+    Parallelisation wrapper for working with map-like callables, such as
+    `multiprocessing.Pool.map`.
+
+    Parameters
+    ----------
+    pool : int or map-like callable
+        If `pool` is an integer, then it specifies the number of threads to
+        use for parallelization. If ``int(pool) == 1``, then no parallel
+        processing is used and the map builtin is used.
+        If ``pool == -1``, then the pool will utilize all available CPUs.
+        If `pool` is a map-like callable that follows the same
+        calling sequence as the built-in map function, then this callable is
+        used for parallelization.
+    """
+    def __init__(self, pool=1):
+        self.pool = None
+        self._mapfunc = map
+        self._own_pool = False
+
+        if callable(pool):
+            self.pool = pool
+            self._mapfunc = self.pool
+        else:
+            from multiprocessing import Pool
+            # user supplies a number
+            if int(pool) == -1:
+                # use as many processors as possible
+                self.pool = Pool()
+                self._mapfunc = self.pool.map
+                self._own_pool = True
+            elif int(pool) == 1:
+                pass
+            elif int(pool) > 1:
+                # use the number of processors requested
+                self.pool = Pool(processes=int(pool))
+                self._mapfunc = self.pool.map
+                self._own_pool = True
+            else:
+                raise RuntimeError("Number of workers specified must be -1,"
+                                   " an int >= 1, or an object with a 'map' "
+                                   "method")
+
+    def __enter__(self):
+        return self
+
+    def terminate(self):
+        if self._own_pool:
+            self.pool.terminate()
+
+    def join(self):
+        if self._own_pool:
+            self.pool.join()
+
+    def close(self):
+        if self._own_pool:
+            self.pool.close()
+
+    def __exit__(self, exc_type, exc_value, traceback):
+        if self._own_pool:
+            self.pool.close()
+            self.pool.terminate()
+
+    def __call__(self, func, iterable):
+        # only accept one iterable because that's all Pool.map accepts
+        try:
+            return self._mapfunc(func, iterable)
+        except TypeError as e:
+            # wrong number of arguments
+            raise TypeError("The map-like callable must be of the"
+                            " form f(func, iterable)") from e
+
+
+def rng_integers(gen, low, high=None, size=None, dtype='int64',
+                 endpoint=False):
+    """
+    Return random integers from low (inclusive) to high (exclusive), or if
+    endpoint=True, low (inclusive) to high (inclusive). Replaces
+    `RandomState.randint` (with endpoint=False) and
+    `RandomState.random_integers` (with endpoint=True).
+
+    Return random integers from the "discrete uniform" distribution of the
+    specified dtype. If high is None (the default), then results are from
+    0 to low.
+
+    Parameters
+    ----------
+    gen : {None, np.random.RandomState, np.random.Generator}
+        Random number generator. If None, then the np.random.RandomState
+        singleton is used.
+    low : int or array-like of ints
+        Lowest (signed) integers to be drawn from the distribution (unless
+        high=None, in which case this parameter is 0 and this value is used
+        for high).
+    high : int or array-like of ints
+        If provided, one above the largest (signed) integer to be drawn from
+        the distribution (see above for behavior if high=None). If array-like,
+        must contain integer values.
+    size : array-like of ints, optional
+        Output shape. If the given shape is, e.g., (m, n, k), then m * n * k
+        samples are drawn. Default is None, in which case a single value is
+        returned.
+    dtype : {str, dtype}, optional
+        Desired dtype of the result. All dtypes are determined by their name,
+        i.e., 'int64', 'int', etc, so byteorder is not available and a specific
+        precision may have different C types depending on the platform.
+        The default value is 'int64'.
+    endpoint : bool, optional
+        If True, sample from the interval [low, high] instead of the default
+        [low, high) Defaults to False.
+
+    Returns
+    -------
+    out: int or ndarray of ints
+        size-shaped array of random integers from the appropriate distribution,
+        or a single such random int if size not provided.
+    """
+    if isinstance(gen, Generator):
+        return gen.integers(low, high=high, size=size, dtype=dtype,
+                            endpoint=endpoint)
+    else:
+        if gen is None:
+            # default is RandomState singleton used by np.random.
+            gen = np.random.mtrand._rand
+        if endpoint:
+            # inclusive of endpoint
+            # remember that low and high can be arrays, so don't modify in
+            # place
+            if high is None:
+                return gen.randint(low + 1, size=size, dtype=dtype)
+            if high is not None:
+                return gen.randint(low, high=high + 1, size=size, dtype=dtype)
+
+        # exclusive
+        return gen.randint(low, high=high, size=size, dtype=dtype)
+
+
+@contextmanager
+def _fixed_default_rng(seed=1638083107694713882823079058616272161):
+    """Context with a fixed np.random.default_rng seed."""
+    orig_fun = np.random.default_rng
+    np.random.default_rng = lambda seed=seed: orig_fun(seed)
+    try:
+        yield
+    finally:
+        np.random.default_rng = orig_fun
+
+
+def _rng_html_rewrite(func):
+    """Rewrite the HTML rendering of ``np.random.default_rng``.
+
+    This is intended to decorate
+    ``numpydoc.docscrape_sphinx.SphinxDocString._str_examples``.
+
+    Examples are only run by Sphinx when there are plot involved. Even so,
+    it does not change the result values getting printed.
+    """
+    # hexadecimal or number seed, case-insensitive
+    pattern = re.compile(r'np.random.default_rng\((0x[0-9A-F]+|\d+)\)', re.I)
+
+    def _wrapped(*args, **kwargs):
+        res = func(*args, **kwargs)
+        lines = [
+            re.sub(pattern, 'np.random.default_rng()', line)
+            for line in res
+        ]
+        return lines
+
+    return _wrapped
+
+
+def _argmin(a, keepdims=False, axis=None):
+    """
+    argmin with a `keepdims` parameter.
+
+    See https://github.com/numpy/numpy/issues/8710
+
+    If axis is not None, a.shape[axis] must be greater than 0.
+    """
+    res = np.argmin(a, axis=axis)
+    if keepdims and axis is not None:
+        res = np.expand_dims(res, axis=axis)
+    return res
+
+
+def _first_nonnan(a, axis):
+    """
+    Return the first non-nan value along the given axis.
+
+    If a slice is all nan, nan is returned for that slice.
+
+    The shape of the return value corresponds to ``keepdims=True``.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> nan = np.nan
+    >>> a = np.array([[ 3.,  3., nan,  3.],
+                      [ 1., nan,  2.,  4.],
+                      [nan, nan,  9., -1.],
+                      [nan,  5.,  4.,  3.],
+                      [ 2.,  2.,  2.,  2.],
+                      [nan, nan, nan, nan]])
+    >>> _first_nonnan(a, axis=0)
+    array([[3., 3., 2., 3.]])
+    >>> _first_nonnan(a, axis=1)
+    array([[ 3.],
+           [ 1.],
+           [ 9.],
+           [ 5.],
+           [ 2.],
+           [nan]])
+    """
+    k = _argmin(np.isnan(a), axis=axis, keepdims=True)
+    return np.take_along_axis(a, k, axis=axis)
+
+
+def _nan_allsame(a, axis, keepdims=False):
+    """
+    Determine if the values along an axis are all the same.
+
+    nan values are ignored.
+
+    `a` must be a numpy array.
+
+    `axis` is assumed to be normalized; that is, 0 <= axis < a.ndim.
+
+    For an axis of length 0, the result is True.  That is, we adopt the
+    convention that ``allsame([])`` is True. (There are no values in the
+    input that are different.)
+
+    `True` is returned for slices that are all nan--not because all the
+    values are the same, but because this is equivalent to ``allsame([])``.
+
+    Examples
+    --------
+    >>> from numpy import nan, array
+    >>> a = array([[ 3.,  3., nan,  3.],
+    ...            [ 1., nan,  2.,  4.],
+    ...            [nan, nan,  9., -1.],
+    ...            [nan,  5.,  4.,  3.],
+    ...            [ 2.,  2.,  2.,  2.],
+    ...            [nan, nan, nan, nan]])
+    >>> _nan_allsame(a, axis=1, keepdims=True)
+    array([[ True],
+           [False],
+           [False],
+           [False],
+           [ True],
+           [ True]])
+    """
+    if axis is None:
+        if a.size == 0:
+            return True
+        a = a.ravel()
+        axis = 0
+    else:
+        shp = a.shape
+        if shp[axis] == 0:
+            shp = shp[:axis] + (1,)*keepdims + shp[axis + 1:]
+            return np.full(shp, fill_value=True, dtype=bool)
+    a0 = _first_nonnan(a, axis=axis)
+    return ((a0 == a) | np.isnan(a)).all(axis=axis, keepdims=keepdims)
+
+
+def _contains_nan(a, nan_policy='propagate', use_summation=True,
+                  policies=None):
+    if not isinstance(a, np.ndarray):
+        use_summation = False  # some array_likes ignore nans (e.g. pandas)
+    if policies is None:
+        policies = ['propagate', 'raise', 'omit']
+    if nan_policy not in policies:
+        raise ValueError("nan_policy must be one of {%s}" %
+                         ', '.join("'%s'" % s for s in policies))
+
+    if np.issubdtype(a.dtype, np.inexact):
+        # The summation method avoids creating a (potentially huge) array.
+        if use_summation:
+            with np.errstate(invalid='ignore', over='ignore'):
+                contains_nan = np.isnan(np.sum(a))
+        else:
+            contains_nan = np.isnan(a).any()
+    elif np.issubdtype(a.dtype, object):
+        contains_nan = False
+        for el in a.ravel():
+            # isnan doesn't work on non-numeric elements
+            if np.issubdtype(type(el), np.number) and np.isnan(el):
+                contains_nan = True
+                break
+    else:
+        # Only `object` and `inexact` arrays can have NaNs
+        contains_nan = False
+
+    if contains_nan and nan_policy == 'raise':
+        raise ValueError("The input contains nan values")
+
+    return contains_nan, nan_policy
+
+
+def _rename_parameter(old_name, new_name, dep_version=None):
+    """
+    Generate decorator for backward-compatible keyword renaming.
+
+    Apply the decorator generated by `_rename_parameter` to functions with a
+    recently renamed parameter to maintain backward-compatibility.
+
+    After decoration, the function behaves as follows:
+    If only the new parameter is passed into the function, behave as usual.
+    If only the old parameter is passed into the function (as a keyword), raise
+    a DeprecationWarning if `dep_version` is provided, and behave as usual
+    otherwise.
+    If both old and new parameters are passed into the function, raise a
+    DeprecationWarning if `dep_version` is provided, and raise the appropriate
+    TypeError (function got multiple values for argument).
+
+    Parameters
+    ----------
+    old_name : str
+        Old name of parameter
+    new_name : str
+        New name of parameter
+    dep_version : str, optional
+        Version of SciPy in which old parameter was deprecated in the format
+        'X.Y.Z'. If supplied, the deprecation message will indicate that
+        support for the old parameter will be removed in version 'X.Y+2.Z'
+
+    Notes
+    -----
+    Untested with functions that accept *args. Probably won't work as written.
+
+    """
+    def decorator(fun):
+        @functools.wraps(fun)
+        def wrapper(*args, **kwargs):
+            if old_name in kwargs:
+                if dep_version:
+                    end_version = dep_version.split('.')
+                    end_version[1] = str(int(end_version[1]) + 2)
+                    end_version = '.'.join(end_version)
+                    message = (f"Use of keyword argument `{old_name}` is "
+                               f"deprecated and replaced by `{new_name}`.  "
+                               f"Support for `{old_name}` will be removed "
+                               f"in SciPy {end_version}.")
+                    warnings.warn(message, DeprecationWarning, stacklevel=2)
+                if new_name in kwargs:
+                    message = (f"{fun.__name__}() got multiple values for "
+                               f"argument now known as `{new_name}`")
+                    raise TypeError(message)
+                kwargs[new_name] = kwargs.pop(old_name)
+            return fun(*args, **kwargs)
+        return wrapper
+    return decorator
+
+
+def _rng_spawn(rng, n_children):
+    # spawns independent RNGs from a parent RNG
+    bg = rng._bit_generator
+    ss = bg._seed_seq
+    child_rngs = [np.random.Generator(type(bg)(child_ss))
+                  for child_ss in ss.spawn(n_children)]
+    return child_rngs
+
+
+def _get_nan(*data):
+    # Get NaN of appropriate dtype for data
+    data = [np.asarray(item) for item in data]
+    try:
+        dtype = np.result_type(*data, np.half)  # must be a float16 at least
+    except DTypePromotionError:
+        # fallback to float64
+        return np.array(np.nan, dtype=np.float64)[()]
+    return np.array(np.nan, dtype=dtype)[()]
+
+
+def normalize_axis_index(axis, ndim):
+    # Check if `axis` is in the correct range and normalize it
+    if axis < -ndim or axis >= ndim:
+        msg = f"axis {axis} is out of bounds for array of dimension {ndim}"
+        raise AxisError(msg)
+
+    if axis < 0:
+        axis = axis + ndim
+    return axis
+
+
+def _call_callback_maybe_halt(callback, res):
+    """Call wrapped callback; return True if algorithm should stop.
+
+    Parameters
+    ----------
+    callback : callable or None
+        A user-provided callback wrapped with `_wrap_callback`
+    res : OptimizeResult
+        Information about the current iterate
+
+    Returns
+    -------
+    halt : bool
+        True if minimization should stop
+
+    """
+    if callback is None:
+        return False
+    try:
+        callback(res)
+        return False
+    except StopIteration:
+        callback.stop_iteration = True
+        return True
+
+
+class _RichResult(dict):
+    """ Container for multiple outputs with pretty-printing """
+    def __getattr__(self, name):
+        try:
+            return self[name]
+        except KeyError as e:
+            raise AttributeError(name) from e
+
+    __setattr__ = dict.__setitem__
+    __delattr__ = dict.__delitem__
+
+    def __repr__(self):
+        order_keys = ['message', 'success', 'status', 'fun', 'funl', 'x', 'xl',
+                      'col_ind', 'nit', 'lower', 'upper', 'eqlin', 'ineqlin',
+                      'converged', 'flag', 'function_calls', 'iterations',
+                      'root']
+        order_keys = getattr(self, '_order_keys', order_keys)
+        # 'slack', 'con' are redundant with residuals
+        # 'crossover_nit' is probably not interesting to most users
+        omit_keys = {'slack', 'con', 'crossover_nit', '_order_keys'}
+
+        def key(item):
+            try:
+                return order_keys.index(item[0].lower())
+            except ValueError:  # item not in list
+                return np.inf
+
+        def omit_redundant(items):
+            for item in items:
+                if item[0] in omit_keys:
+                    continue
+                yield item
+
+        def item_sorter(d):
+            return sorted(omit_redundant(d.items()), key=key)
+
+        if self.keys():
+            return _dict_formatter(self, sorter=item_sorter)
+        else:
+            return self.__class__.__name__ + "()"
+
+    def __dir__(self):
+        return list(self.keys())
+
+
+def _indenter(s, n=0):
+    """
+    Ensures that lines after the first are indented by the specified amount
+    """
+    split = s.split("\n")
+    indent = " "*n
+    return ("\n" + indent).join(split)
+
+
+def _float_formatter_10(x):
+    """
+    Returns a string representation of a float with exactly ten characters
+    """
+    if np.isposinf(x):
+        return "       inf"
+    elif np.isneginf(x):
+        return "      -inf"
+    elif np.isnan(x):
+        return "       nan"
+    return np.format_float_scientific(x, precision=3, pad_left=2, unique=False)
+
+
+def _dict_formatter(d, n=0, mplus=1, sorter=None):
+    """
+    Pretty printer for dictionaries
+
+    `n` keeps track of the starting indentation;
+    lines are indented by this much after a line break.
+    `mplus` is additional left padding applied to keys
+    """
+    if isinstance(d, dict):
+        m = max(map(len, list(d.keys()))) + mplus  # width to print keys
+        s = '\n'.join([k.rjust(m) + ': ' +  # right justified, width m
+                       _indenter(_dict_formatter(v, m+n+2, 0, sorter), m+2)
+                       for k, v in sorter(d)])  # +2 for ': '
+    else:
+        # By default, NumPy arrays print with linewidth=76. `n` is
+        # the indent at which a line begins printing, so it is subtracted
+        # from the default to avoid exceeding 76 characters total.
+        # `edgeitems` is the number of elements to include before and after
+        # ellipses when arrays are not shown in full.
+        # `threshold` is the maximum number of elements for which an
+        # array is shown in full.
+        # These values tend to work well for use with OptimizeResult.
+        with np.printoptions(linewidth=76-n, edgeitems=2, threshold=12,
+                             formatter={'float_kind': _float_formatter_10}):
+            s = str(d)
+    return s

venv/lib/python3.10/site-packages/scipy/_lib/decorator.py

@@ -0,0 +1,399 @@
+# #########################     LICENSE     ############################ #
+
+# Copyright (c) 2005-2015, Michele Simionato
+# All rights reserved.
+
+# Redistribution and use in source and binary forms, with or without
+# modification, are permitted provided that the following conditions are
+# met:
+
+#   Redistributions of source code must retain the above copyright
+#   notice, this list of conditions and the following disclaimer.
+#   Redistributions in bytecode form must reproduce the above copyright
+#   notice, this list of conditions and the following disclaimer in
+#   the documentation and/or other materials provided with the
+#   distribution.
+
+# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS
+# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT
+# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR
+# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT
+# HOLDERS OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT,
+# INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING,
+# BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS
+# OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+# ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR
+# TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE
+# USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH
+# DAMAGE.
+
+"""
+Decorator module, see https://pypi.python.org/pypi/decorator
+for the documentation.
+"""
+import re
+import sys
+import inspect
+import operator
+import itertools
+import collections
+
+from inspect import getfullargspec
+
+__version__ = '4.0.5'
+
+
+def get_init(cls):
+    return cls.__init__
+
+
+# getargspec has been deprecated in Python 3.5
+ArgSpec = collections.namedtuple(
+    'ArgSpec', 'args varargs varkw defaults')
+
+
+def getargspec(f):
+    """A replacement for inspect.getargspec"""
+    spec = getfullargspec(f)
+    return ArgSpec(spec.args, spec.varargs, spec.varkw, spec.defaults)
+
+
+DEF = re.compile(r'\s*def\s*([_\w][_\w\d]*)\s*\(')
+
+
+# basic functionality
+class FunctionMaker:
+    """
+    An object with the ability to create functions with a given signature.
+    It has attributes name, doc, module, signature, defaults, dict, and
+    methods update and make.
+    """
+
+    # Atomic get-and-increment provided by the GIL
+    _compile_count = itertools.count()
+
+    def __init__(self, func=None, name=None, signature=None,
+                 defaults=None, doc=None, module=None, funcdict=None):
+        self.shortsignature = signature
+        if func:
+            # func can be a class or a callable, but not an instance method
+            self.name = func.__name__
+            if self.name == '<lambda>':  # small hack for lambda functions
+                self.name = '_lambda_'
+            self.doc = func.__doc__
+            self.module = func.__module__
+            if inspect.isfunction(func):
+                argspec = getfullargspec(func)
+                self.annotations = getattr(func, '__annotations__', {})
+                for a in ('args', 'varargs', 'varkw', 'defaults', 'kwonlyargs',
+                          'kwonlydefaults'):
+                    setattr(self, a, getattr(argspec, a))
+                for i, arg in enumerate(self.args):
+                    setattr(self, 'arg%d' % i, arg)
+                allargs = list(self.args)
+                allshortargs = list(self.args)
+                if self.varargs:
+                    allargs.append('*' + self.varargs)
+                    allshortargs.append('*' + self.varargs)
+                elif self.kwonlyargs:
+                    allargs.append('*')  # single star syntax
+                for a in self.kwonlyargs:
+                    allargs.append('%s=None' % a)
+                    allshortargs.append(f'{a}={a}')
+                if self.varkw:
+                    allargs.append('**' + self.varkw)
+                    allshortargs.append('**' + self.varkw)
+                self.signature = ', '.join(allargs)
+                self.shortsignature = ', '.join(allshortargs)
+                self.dict = func.__dict__.copy()
+        # func=None happens when decorating a caller
+        if name:
+            self.name = name
+        if signature is not None:
+            self.signature = signature
+        if defaults:
+            self.defaults = defaults
+        if doc:
+            self.doc = doc
+        if module:
+            self.module = module
+        if funcdict:
+            self.dict = funcdict
+        # check existence required attributes
+        assert hasattr(self, 'name')
+        if not hasattr(self, 'signature'):
+            raise TypeError('You are decorating a non-function: %s' % func)
+
+    def update(self, func, **kw):
+        "Update the signature of func with the data in self"
+        func.__name__ = self.name
+        func.__doc__ = getattr(self, 'doc', None)
+        func.__dict__ = getattr(self, 'dict', {})
+        func.__defaults__ = getattr(self, 'defaults', ())
+        func.__kwdefaults__ = getattr(self, 'kwonlydefaults', None)
+        func.__annotations__ = getattr(self, 'annotations', None)
+        try:
+            frame = sys._getframe(3)
+        except AttributeError:  # for IronPython and similar implementations
+            callermodule = '?'
+        else:
+            callermodule = frame.f_globals.get('__name__', '?')
+        func.__module__ = getattr(self, 'module', callermodule)
+        func.__dict__.update(kw)
+
+    def make(self, src_templ, evaldict=None, addsource=False, **attrs):
+        "Make a new function from a given template and update the signature"
+        src = src_templ % vars(self)  # expand name and signature
+        evaldict = evaldict or {}
+        mo = DEF.match(src)
+        if mo is None:
+            raise SyntaxError('not a valid function template\n%s' % src)
+        name = mo.group(1)  # extract the function name
+        names = set([name] + [arg.strip(' *') for arg in
+                              self.shortsignature.split(',')])
+        for n in names:
+            if n in ('_func_', '_call_'):
+                raise NameError(f'{n} is overridden in\n{src}')
+        if not src.endswith('\n'):  # add a newline just for safety
+            src += '\n'  # this is needed in old versions of Python
+
+        # Ensure each generated function has a unique filename for profilers
+        # (such as cProfile) that depend on the tuple of (<filename>,
+        # <definition line>, <function name>) being unique.
+        filename = '<decorator-gen-%d>' % (next(self._compile_count),)
+        try:
+            code = compile(src, filename, 'single')
+            exec(code, evaldict)
+        except:  # noqa: E722
+            print('Error in generated code:', file=sys.stderr)
+            print(src, file=sys.stderr)
+            raise
+        func = evaldict[name]
+        if addsource:
+            attrs['__source__'] = src
+        self.update(func, **attrs)
+        return func
+
+    @classmethod
+    def create(cls, obj, body, evaldict, defaults=None,
+               doc=None, module=None, addsource=True, **attrs):
+        """
+        Create a function from the strings name, signature, and body.
+        evaldict is the evaluation dictionary. If addsource is true, an
+        attribute __source__ is added to the result. The attributes attrs
+        are added, if any.
+        """
+        if isinstance(obj, str):  # "name(signature)"
+            name, rest = obj.strip().split('(', 1)
+            signature = rest[:-1]  # strip a right parens
+            func = None
+        else:  # a function
+            name = None
+            signature = None
+            func = obj
+        self = cls(func, name, signature, defaults, doc, module)
+        ibody = '\n'.join('    ' + line for line in body.splitlines())
+        return self.make('def %(name)s(%(signature)s):\n' + ibody,
+                         evaldict, addsource, **attrs)
+
+
+def decorate(func, caller):
+    """
+    decorate(func, caller) decorates a function using a caller.
+    """
+    evaldict = func.__globals__.copy()
+    evaldict['_call_'] = caller
+    evaldict['_func_'] = func
+    fun = FunctionMaker.create(
+        func, "return _call_(_func_, %(shortsignature)s)",
+        evaldict, __wrapped__=func)
+    if hasattr(func, '__qualname__'):
+        fun.__qualname__ = func.__qualname__
+    return fun
+
+
+def decorator(caller, _func=None):
+    """decorator(caller) converts a caller function into a decorator"""
+    if _func is not None:  # return a decorated function
+        # this is obsolete behavior; you should use decorate instead
+        return decorate(_func, caller)
+    # else return a decorator function
+    if inspect.isclass(caller):
+        name = caller.__name__.lower()
+        callerfunc = get_init(caller)
+        doc = (f'decorator({caller.__name__}) converts functions/generators into ' 
+               f'factories of {caller.__name__} objects')
+    elif inspect.isfunction(caller):
+        if caller.__name__ == '<lambda>':
+            name = '_lambda_'
+        else:
+            name = caller.__name__
+        callerfunc = caller
+        doc = caller.__doc__
+    else:  # assume caller is an object with a __call__ method
+        name = caller.__class__.__name__.lower()
+        callerfunc = caller.__call__.__func__
+        doc = caller.__call__.__doc__
+    evaldict = callerfunc.__globals__.copy()
+    evaldict['_call_'] = caller
+    evaldict['_decorate_'] = decorate
+    return FunctionMaker.create(
+        '%s(func)' % name, 'return _decorate_(func, _call_)',
+        evaldict, doc=doc, module=caller.__module__,
+        __wrapped__=caller)
+
+
+# ####################### contextmanager ####################### #
+
+try:  # Python >= 3.2
+    from contextlib import _GeneratorContextManager
+except ImportError:  # Python >= 2.5
+    from contextlib import GeneratorContextManager as _GeneratorContextManager
+
+
+class ContextManager(_GeneratorContextManager):
+    def __call__(self, func):
+        """Context manager decorator"""
+        return FunctionMaker.create(
+            func, "with _self_: return _func_(%(shortsignature)s)",
+            dict(_self_=self, _func_=func), __wrapped__=func)
+
+
+init = getfullargspec(_GeneratorContextManager.__init__)
+n_args = len(init.args)
+if n_args == 2 and not init.varargs:  # (self, genobj) Python 2.7
+    def __init__(self, g, *a, **k):
+        return _GeneratorContextManager.__init__(self, g(*a, **k))
+    ContextManager.__init__ = __init__
+elif n_args == 2 and init.varargs:  # (self, gen, *a, **k) Python 3.4
+    pass
+elif n_args == 4:  # (self, gen, args, kwds) Python 3.5
+    def __init__(self, g, *a, **k):
+        return _GeneratorContextManager.__init__(self, g, a, k)
+    ContextManager.__init__ = __init__
+
+contextmanager = decorator(ContextManager)
+
+
+# ############################ dispatch_on ############################ #
+
+def append(a, vancestors):
+    """
+    Append ``a`` to the list of the virtual ancestors, unless it is already
+    included.
+    """
+    add = True
+    for j, va in enumerate(vancestors):
+        if issubclass(va, a):
+            add = False
+            break
+        if issubclass(a, va):
+            vancestors[j] = a
+            add = False
+    if add:
+        vancestors.append(a)
+
+
+# inspired from simplegeneric by P.J. Eby and functools.singledispatch
+def dispatch_on(*dispatch_args):
+    """
+    Factory of decorators turning a function into a generic function
+    dispatching on the given arguments.
+    """
+    assert dispatch_args, 'No dispatch args passed'
+    dispatch_str = '(%s,)' % ', '.join(dispatch_args)
+
+    def check(arguments, wrong=operator.ne, msg=''):
+        """Make sure one passes the expected number of arguments"""
+        if wrong(len(arguments), len(dispatch_args)):
+            raise TypeError('Expected %d arguments, got %d%s' %
+                            (len(dispatch_args), len(arguments), msg))
+
+    def gen_func_dec(func):
+        """Decorator turning a function into a generic function"""
+
+        # first check the dispatch arguments
+        argset = set(getfullargspec(func).args)
+        if not set(dispatch_args) <= argset:
+            raise NameError('Unknown dispatch arguments %s' % dispatch_str)
+
+        typemap = {}
+
+        def vancestors(*types):
+            """
+            Get a list of sets of virtual ancestors for the given types
+            """
+            check(types)
+            ras = [[] for _ in range(len(dispatch_args))]
+            for types_ in typemap:
+                for t, type_, ra in zip(types, types_, ras):
+                    if issubclass(t, type_) and type_ not in t.__mro__:
+                        append(type_, ra)
+            return [set(ra) for ra in ras]
+
+        def ancestors(*types):
+            """
+            Get a list of virtual MROs, one for each type
+            """
+            check(types)
+            lists = []
+            for t, vas in zip(types, vancestors(*types)):
+                n_vas = len(vas)
+                if n_vas > 1:
+                    raise RuntimeError(
+                        f'Ambiguous dispatch for {t}: {vas}')
+                elif n_vas == 1:
+                    va, = vas
+                    mro = type('t', (t, va), {}).__mro__[1:]
+                else:
+                    mro = t.__mro__
+                lists.append(mro[:-1])  # discard t and object
+            return lists
+
+        def register(*types):
+            """
+            Decorator to register an implementation for the given types
+            """
+            check(types)
+
+            def dec(f):
+                check(getfullargspec(f).args, operator.lt, ' in ' + f.__name__)
+                typemap[types] = f
+                return f
+            return dec
+
+        def dispatch_info(*types):
+            """
+            An utility to introspect the dispatch algorithm
+            """
+            check(types)
+            lst = [tuple(a.__name__ for a in anc)
+                   for anc in itertools.product(*ancestors(*types))]
+            return lst
+
+        def _dispatch(dispatch_args, *args, **kw):
+            types = tuple(type(arg) for arg in dispatch_args)
+            try:  # fast path
+                f = typemap[types]
+            except KeyError:
+                pass
+            else:
+                return f(*args, **kw)
+            combinations = itertools.product(*ancestors(*types))
+            next(combinations)  # the first one has been already tried
+            for types_ in combinations:
+                f = typemap.get(types_)
+                if f is not None:
+                    return f(*args, **kw)
+
+            # else call the default implementation
+            return func(*args, **kw)
+
+        return FunctionMaker.create(
+            func, 'return _f_(%s, %%(shortsignature)s)' % dispatch_str,
+            dict(_f_=_dispatch), register=register, default=func,
+            typemap=typemap, vancestors=vancestors, ancestors=ancestors,
+            dispatch_info=dispatch_info, __wrapped__=func)
+
+    gen_func_dec.__name__ = 'dispatch_on' + dispatch_str
+    return gen_func_dec

venv/lib/python3.10/site-packages/scipy/_lib/deprecation.py

@@ -0,0 +1,239 @@
+from inspect import Parameter, signature
+import functools
+import warnings
+from importlib import import_module
+
+
+__all__ = ["_deprecated"]
+
+
+# Object to use as default value for arguments to be deprecated. This should
+# be used over 'None' as the user could parse 'None' as a positional argument
+_NoValue = object()
+
+def _sub_module_deprecation(*, sub_package, module, private_modules, all,
+                            attribute, correct_module=None):
+    """Helper function for deprecating modules that are public but were
+    intended to be private.
+
+    Parameters
+    ----------
+    sub_package : str
+        Subpackage the module belongs to eg. stats
+    module : str
+        Public but intended private module to deprecate
+    private_modules : list
+        Private replacement(s) for `module`; should contain the
+        content of ``all``, possibly spread over several modules.
+    all : list
+        ``__all__`` belonging to `module`
+    attribute : str
+        The attribute in `module` being accessed
+    correct_module : str, optional
+        Module in `sub_package` that `attribute` should be imported from.
+        Default is that `attribute` should be imported from ``scipy.sub_package``.
+    """
+    if correct_module is not None:
+        correct_import = f"scipy.{sub_package}.{correct_module}"
+    else:
+        correct_import = f"scipy.{sub_package}"
+
+    if attribute not in all:
+        raise AttributeError(
+            f"`scipy.{sub_package}.{module}` has no attribute `{attribute}`; "
+            f"furthermore, `scipy.{sub_package}.{module}` is deprecated "
+            f"and will be removed in SciPy 2.0.0."
+        )
+
+    attr = getattr(import_module(correct_import), attribute, None)
+
+    if attr is not None:
+        message = (
+            f"Please import `{attribute}` from the `{correct_import}` namespace; "
+            f"the `scipy.{sub_package}.{module}` namespace is deprecated "
+            f"and will be removed in SciPy 2.0.0."
+        )
+    else:
+        message = (
+            f"`scipy.{sub_package}.{module}.{attribute}` is deprecated along with "
+            f"the `scipy.{sub_package}.{module}` namespace. "
+            f"`scipy.{sub_package}.{module}.{attribute}` will be removed "
+            f"in SciPy 1.14.0, and the `scipy.{sub_package}.{module}` namespace "
+            f"will be removed in SciPy 2.0.0."
+        )
+
+    warnings.warn(message, category=DeprecationWarning, stacklevel=3)
+
+    for module in private_modules:
+        try:
+            return getattr(import_module(f"scipy.{sub_package}.{module}"), attribute)
+        except AttributeError as e:
+            # still raise an error if the attribute isn't in any of the expected
+            # private modules
+            if module == private_modules[-1]:
+                raise e
+            continue
+    
+
+def _deprecated(msg, stacklevel=2):
+    """Deprecate a function by emitting a warning on use."""
+    def wrap(fun):
+        if isinstance(fun, type):
+            warnings.warn(
+                f"Trying to deprecate class {fun!r}",
+                category=RuntimeWarning, stacklevel=2)
+            return fun
+
+        @functools.wraps(fun)
+        def call(*args, **kwargs):
+            warnings.warn(msg, category=DeprecationWarning,
+                          stacklevel=stacklevel)
+            return fun(*args, **kwargs)
+        call.__doc__ = fun.__doc__
+        return call
+
+    return wrap
+
+
+class _DeprecationHelperStr:
+    """
+    Helper class used by deprecate_cython_api
+    """
+    def __init__(self, content, message):
+        self._content = content
+        self._message = message
+
+    def __hash__(self):
+        return hash(self._content)
+
+    def __eq__(self, other):
+        res = (self._content == other)
+        if res:
+            warnings.warn(self._message, category=DeprecationWarning,
+                          stacklevel=2)
+        return res
+
+
+def deprecate_cython_api(module, routine_name, new_name=None, message=None):
+    """
+    Deprecate an exported cdef function in a public Cython API module.
+
+    Only functions can be deprecated; typedefs etc. cannot.
+
+    Parameters
+    ----------
+    module : module
+        Public Cython API module (e.g. scipy.linalg.cython_blas).
+    routine_name : str
+        Name of the routine to deprecate. May also be a fused-type
+        routine (in which case its all specializations are deprecated).
+    new_name : str
+        New name to include in the deprecation warning message
+    message : str
+        Additional text in the deprecation warning message
+
+    Examples
+    --------
+    Usually, this function would be used in the top-level of the
+    module ``.pyx`` file:
+
+    >>> from scipy._lib.deprecation import deprecate_cython_api
+    >>> import scipy.linalg.cython_blas as mod
+    >>> deprecate_cython_api(mod, "dgemm", "dgemm_new",
+    ...                      message="Deprecated in Scipy 1.5.0")
+    >>> del deprecate_cython_api, mod
+
+    After this, Cython modules that use the deprecated function emit a
+    deprecation warning when they are imported.
+
+    """
+    old_name = f"{module.__name__}.{routine_name}"
+
+    if new_name is None:
+        depdoc = "`%s` is deprecated!" % old_name
+    else:
+        depdoc = f"`{old_name}` is deprecated, use `{new_name}` instead!"
+
+    if message is not None:
+        depdoc += "\n" + message
+
+    d = module.__pyx_capi__
+
+    # Check if the function is a fused-type function with a mangled name
+    j = 0
+    has_fused = False
+    while True:
+        fused_name = f"__pyx_fuse_{j}{routine_name}"
+        if fused_name in d:
+            has_fused = True
+            d[_DeprecationHelperStr(fused_name, depdoc)] = d.pop(fused_name)
+            j += 1
+        else:
+            break
+
+    # If not, apply deprecation to the named routine
+    if not has_fused:
+        d[_DeprecationHelperStr(routine_name, depdoc)] = d.pop(routine_name)
+
+
+# taken from scikit-learn, see
+# https://github.com/scikit-learn/scikit-learn/blob/1.3.0/sklearn/utils/validation.py#L38
+def _deprecate_positional_args(func=None, *, version=None):
+    """Decorator for methods that issues warnings for positional arguments.
+
+    Using the keyword-only argument syntax in pep 3102, arguments after the
+    * will issue a warning when passed as a positional argument.
+
+    Parameters
+    ----------
+    func : callable, default=None
+        Function to check arguments on.
+    version : callable, default=None
+        The version when positional arguments will result in error.
+    """
+    if version is None:
+        msg = "Need to specify a version where signature will be changed"
+        raise ValueError(msg)
+
+    def _inner_deprecate_positional_args(f):
+        sig = signature(f)
+        kwonly_args = []
+        all_args = []
+
+        for name, param in sig.parameters.items():
+            if param.kind == Parameter.POSITIONAL_OR_KEYWORD:
+                all_args.append(name)
+            elif param.kind == Parameter.KEYWORD_ONLY:
+                kwonly_args.append(name)
+
+        @functools.wraps(f)
+        def inner_f(*args, **kwargs):
+            extra_args = len(args) - len(all_args)
+            if extra_args <= 0:
+                return f(*args, **kwargs)
+
+            # extra_args > 0
+            args_msg = [
+                f"{name}={arg}"
+                for name, arg in zip(kwonly_args[:extra_args], args[-extra_args:])
+            ]
+            args_msg = ", ".join(args_msg)
+            warnings.warn(
+                (
+                    f"You are passing {args_msg} as a positional argument. "
+                    "Please change your invocation to use keyword arguments. "
+                    f"From SciPy {version}, passing these as positional "
+                    "arguments will result in an error."
+                ),
+                DeprecationWarning,
+                stacklevel=2,
+            )
+            kwargs.update(zip(sig.parameters, args))
+            return f(**kwargs)
+
+        return inner_f
+
+    if func is not None:
+        return _inner_deprecate_positional_args(func)
+
+    return _inner_deprecate_positional_args

venv/lib/python3.10/site-packages/scipy/_lib/doccer.py

@@ -0,0 +1,275 @@
+''' Utilities to allow inserting docstring fragments for common
+parameters into function and method docstrings'''
+
+import sys
+
+__all__ = [
+    'docformat', 'inherit_docstring_from', 'indentcount_lines',
+    'filldoc', 'unindent_dict', 'unindent_string', 'extend_notes_in_docstring',
+    'replace_notes_in_docstring', 'doc_replace'
+]
+
+
+def docformat(docstring, docdict=None):
+    ''' Fill a function docstring from variables in dictionary
+
+    Adapt the indent of the inserted docs
+
+    Parameters
+    ----------
+    docstring : string
+        docstring from function, possibly with dict formatting strings
+    docdict : dict, optional
+        dictionary with keys that match the dict formatting strings
+        and values that are docstring fragments to be inserted. The
+        indentation of the inserted docstrings is set to match the
+        minimum indentation of the ``docstring`` by adding this
+        indentation to all lines of the inserted string, except the
+        first.
+
+    Returns
+    -------
+    outstring : string
+        string with requested ``docdict`` strings inserted
+
+    Examples
+    --------
+    >>> docformat(' Test string with %(value)s', {'value':'inserted value'})
+    ' Test string with inserted value'
+    >>> docstring = 'First line\\n    Second line\\n    %(value)s'
+    >>> inserted_string = "indented\\nstring"
+    >>> docdict = {'value': inserted_string}
+    >>> docformat(docstring, docdict)
+    'First line\\n    Second line\\n    indented\\n    string'
+    '''
+    if not docstring:
+        return docstring
+    if docdict is None:
+        docdict = {}
+    if not docdict:
+        return docstring
+    lines = docstring.expandtabs().splitlines()
+    # Find the minimum indent of the main docstring, after first line
+    if len(lines) < 2:
+        icount = 0
+    else:
+        icount = indentcount_lines(lines[1:])
+    indent = ' ' * icount
+    # Insert this indent to dictionary docstrings
+    indented = {}
+    for name, dstr in docdict.items():
+        lines = dstr.expandtabs().splitlines()
+        try:
+            newlines = [lines[0]]
+            for line in lines[1:]:
+                newlines.append(indent+line)
+            indented[name] = '\n'.join(newlines)
+        except IndexError:
+            indented[name] = dstr
+    return docstring % indented
+
+
+def inherit_docstring_from(cls):
+    """
+    This decorator modifies the decorated function's docstring by
+    replacing occurrences of '%(super)s' with the docstring of the
+    method of the same name from the class `cls`.
+
+    If the decorated method has no docstring, it is simply given the
+    docstring of `cls`s method.
+
+    Parameters
+    ----------
+    cls : Python class or instance
+        A class with a method with the same name as the decorated method.
+        The docstring of the method in this class replaces '%(super)s' in the
+        docstring of the decorated method.
+
+    Returns
+    -------
+    f : function
+        The decorator function that modifies the __doc__ attribute
+        of its argument.
+
+    Examples
+    --------
+    In the following, the docstring for Bar.func created using the
+    docstring of `Foo.func`.
+
+    >>> class Foo:
+    ...     def func(self):
+    ...         '''Do something useful.'''
+    ...         return
+    ...
+    >>> class Bar(Foo):
+    ...     @inherit_docstring_from(Foo)
+    ...     def func(self):
+    ...         '''%(super)s
+    ...         Do it fast.
+    ...         '''
+    ...         return
+    ...
+    >>> b = Bar()
+    >>> b.func.__doc__
+    'Do something useful.\n        Do it fast.\n        '
+
+    """
+    def _doc(func):
+        cls_docstring = getattr(cls, func.__name__).__doc__
+        func_docstring = func.__doc__
+        if func_docstring is None:
+            func.__doc__ = cls_docstring
+        else:
+            new_docstring = func_docstring % dict(super=cls_docstring)
+            func.__doc__ = new_docstring
+        return func
+    return _doc
+
+
+def extend_notes_in_docstring(cls, notes):
+    """
+    This decorator replaces the decorated function's docstring
+    with the docstring from corresponding method in `cls`.
+    It extends the 'Notes' section of that docstring to include
+    the given `notes`.
+    """
+    def _doc(func):
+        cls_docstring = getattr(cls, func.__name__).__doc__
+        # If python is called with -OO option,
+        # there is no docstring
+        if cls_docstring is None:
+            return func
+        end_of_notes = cls_docstring.find('        References\n')
+        if end_of_notes == -1:
+            end_of_notes = cls_docstring.find('        Examples\n')
+            if end_of_notes == -1:
+                end_of_notes = len(cls_docstring)
+        func.__doc__ = (cls_docstring[:end_of_notes] + notes +
+                        cls_docstring[end_of_notes:])
+        return func
+    return _doc
+
+
+def replace_notes_in_docstring(cls, notes):
+    """
+    This decorator replaces the decorated function's docstring
+    with the docstring from corresponding method in `cls`.
+    It replaces the 'Notes' section of that docstring with
+    the given `notes`.
+    """
+    def _doc(func):
+        cls_docstring = getattr(cls, func.__name__).__doc__
+        notes_header = '        Notes\n        -----\n'
+        # If python is called with -OO option,
+        # there is no docstring
+        if cls_docstring is None:
+            return func
+        start_of_notes = cls_docstring.find(notes_header)
+        end_of_notes = cls_docstring.find('        References\n')
+        if end_of_notes == -1:
+            end_of_notes = cls_docstring.find('        Examples\n')
+            if end_of_notes == -1:
+                end_of_notes = len(cls_docstring)
+        func.__doc__ = (cls_docstring[:start_of_notes + len(notes_header)] +
+                        notes +
+                        cls_docstring[end_of_notes:])
+        return func
+    return _doc
+
+
+def indentcount_lines(lines):
+    ''' Minimum indent for all lines in line list
+
+    >>> lines = [' one', '  two', '   three']
+    >>> indentcount_lines(lines)
+    1
+    >>> lines = []
+    >>> indentcount_lines(lines)
+    0
+    >>> lines = [' one']
+    >>> indentcount_lines(lines)
+    1
+    >>> indentcount_lines(['    '])
+    0
+    '''
+    indentno = sys.maxsize
+    for line in lines:
+        stripped = line.lstrip()
+        if stripped:
+            indentno = min(indentno, len(line) - len(stripped))
+    if indentno == sys.maxsize:
+        return 0
+    return indentno
+
+
+def filldoc(docdict, unindent_params=True):
+    ''' Return docstring decorator using docdict variable dictionary
+
+    Parameters
+    ----------
+    docdict : dictionary
+        dictionary containing name, docstring fragment pairs
+    unindent_params : {False, True}, boolean, optional
+        If True, strip common indentation from all parameters in
+        docdict
+
+    Returns
+    -------
+    decfunc : function
+        decorator that applies dictionary to input function docstring
+
+    '''
+    if unindent_params:
+        docdict = unindent_dict(docdict)
+
+    def decorate(f):
+        f.__doc__ = docformat(f.__doc__, docdict)
+        return f
+    return decorate
+
+
+def unindent_dict(docdict):
+    ''' Unindent all strings in a docdict '''
+    can_dict = {}
+    for name, dstr in docdict.items():
+        can_dict[name] = unindent_string(dstr)
+    return can_dict
+
+
+def unindent_string(docstring):
+    ''' Set docstring to minimum indent for all lines, including first
+
+    >>> unindent_string(' two')
+    'two'
+    >>> unindent_string('  two\\n   three')
+    'two\\n three'
+    '''
+    lines = docstring.expandtabs().splitlines()
+    icount = indentcount_lines(lines)
+    if icount == 0:
+        return docstring
+    return '\n'.join([line[icount:] for line in lines])
+
+
+def doc_replace(obj, oldval, newval):
+    """Decorator to take the docstring from obj, with oldval replaced by newval
+
+    Equivalent to ``func.__doc__ = obj.__doc__.replace(oldval, newval)``
+
+    Parameters
+    ----------
+    obj : object
+        The object to take the docstring from.
+    oldval : string
+        The string to replace from the original docstring.
+    newval : string
+        The string to replace ``oldval`` with.
+    """
+    # __doc__ may be None for optimized Python (-OO)
+    doc = (obj.__doc__ or '').replace(oldval, newval)
+
+    def inner(func):
+        func.__doc__ = doc
+        return func
+
+    return inner