Add files using upload-large-folder tool

env-llmeval/lib/python3.10/site-packages/numpy/core/_add_newdocs_scalars.py

@@ -0,0 +1,372 @@
+"""
+This file is separate from ``_add_newdocs.py`` so that it can be mocked out by
+our sphinx ``conf.py`` during doc builds, where we want to avoid showing
+platform-dependent information.
+"""
+import sys
+import os
+from numpy.core import dtype
+from numpy.core import numerictypes as _numerictypes
+from numpy.core.function_base import add_newdoc
+
+##############################################################################
+#
+# Documentation for concrete scalar classes
+#
+##############################################################################
+
+def numeric_type_aliases(aliases):
+    def type_aliases_gen():
+        for alias, doc in aliases:
+            try:
+                alias_type = getattr(_numerictypes, alias)
+            except AttributeError:
+                # The set of aliases that actually exist varies between platforms
+                pass
+            else:
+                yield (alias_type, alias, doc)
+    return list(type_aliases_gen())
+
+
+possible_aliases = numeric_type_aliases([
+    ('int8', '8-bit signed integer (``-128`` to ``127``)'),
+    ('int16', '16-bit signed integer (``-32_768`` to ``32_767``)'),
+    ('int32', '32-bit signed integer (``-2_147_483_648`` to ``2_147_483_647``)'),
+    ('int64', '64-bit signed integer (``-9_223_372_036_854_775_808`` to ``9_223_372_036_854_775_807``)'),
+    ('intp', 'Signed integer large enough to fit pointer, compatible with C ``intptr_t``'),
+    ('uint8', '8-bit unsigned integer (``0`` to ``255``)'),
+    ('uint16', '16-bit unsigned integer (``0`` to ``65_535``)'),
+    ('uint32', '32-bit unsigned integer (``0`` to ``4_294_967_295``)'),
+    ('uint64', '64-bit unsigned integer (``0`` to ``18_446_744_073_709_551_615``)'),
+    ('uintp', 'Unsigned integer large enough to fit pointer, compatible with C ``uintptr_t``'),
+    ('float16', '16-bit-precision floating-point number type: sign bit, 5 bits exponent, 10 bits mantissa'),
+    ('float32', '32-bit-precision floating-point number type: sign bit, 8 bits exponent, 23 bits mantissa'),
+    ('float64', '64-bit precision floating-point number type: sign bit, 11 bits exponent, 52 bits mantissa'),
+    ('float96', '96-bit extended-precision floating-point number type'),
+    ('float128', '128-bit extended-precision floating-point number type'),
+    ('complex64', 'Complex number type composed of 2 32-bit-precision floating-point numbers'),
+    ('complex128', 'Complex number type composed of 2 64-bit-precision floating-point numbers'),
+    ('complex192', 'Complex number type composed of 2 96-bit extended-precision floating-point numbers'),
+    ('complex256', 'Complex number type composed of 2 128-bit extended-precision floating-point numbers'),
+    ])
+
+
+def _get_platform_and_machine():
+    try:
+        system, _, _, _, machine = os.uname()
+    except AttributeError:
+        system = sys.platform
+        if system == 'win32':
+            machine = os.environ.get('PROCESSOR_ARCHITEW6432', '') \
+                    or os.environ.get('PROCESSOR_ARCHITECTURE', '')
+        else:
+            machine = 'unknown'
+    return system, machine
+
+
+_system, _machine = _get_platform_and_machine()
+_doc_alias_string = f":Alias on this platform ({_system} {_machine}):"
+
+
+def add_newdoc_for_scalar_type(obj, fixed_aliases, doc):
+    # note: `:field: value` is rST syntax which renders as field lists.
+    o = getattr(_numerictypes, obj)
+
+    character_code = dtype(o).char
+    canonical_name_doc = "" if obj == o.__name__ else \
+                        f":Canonical name: `numpy.{obj}`\n    "
+    if fixed_aliases:
+        alias_doc = ''.join(f":Alias: `numpy.{alias}`\n    "
+                            for alias in fixed_aliases)
+    else:
+        alias_doc = ''
+    alias_doc += ''.join(f"{_doc_alias_string} `numpy.{alias}`: {doc}.\n    "
+                         for (alias_type, alias, doc) in possible_aliases if alias_type is o)
+
+    docstring = f"""
+    {doc.strip()}
+
+    :Character code: ``'{character_code}'``
+    {canonical_name_doc}{alias_doc}
+    """
+
+    add_newdoc('numpy.core.numerictypes', obj, docstring)
+
+
+add_newdoc_for_scalar_type('bool_', [],
+    """
+    Boolean type (True or False), stored as a byte.
+
+    .. warning::
+
+       The :class:`bool_` type is not a subclass of the :class:`int_` type
+       (the :class:`bool_` is not even a number type). This is different
+       than Python's default implementation of :class:`bool` as a
+       sub-class of :class:`int`.
+    """)
+
+add_newdoc_for_scalar_type('byte', [],
+    """
+    Signed integer type, compatible with C ``char``.
+    """)
+
+add_newdoc_for_scalar_type('short', [],
+    """
+    Signed integer type, compatible with C ``short``.
+    """)
+
+add_newdoc_for_scalar_type('intc', [],
+    """
+    Signed integer type, compatible with C ``int``.
+    """)
+
+add_newdoc_for_scalar_type('int_', [],
+    """
+    Signed integer type, compatible with Python `int` and C ``long``.
+    """)
+
+add_newdoc_for_scalar_type('longlong', [],
+    """
+    Signed integer type, compatible with C ``long long``.
+    """)
+
+add_newdoc_for_scalar_type('ubyte', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned char``.
+    """)
+
+add_newdoc_for_scalar_type('ushort', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned short``.
+    """)
+
+add_newdoc_for_scalar_type('uintc', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned int``.
+    """)
+
+add_newdoc_for_scalar_type('uint', [],
+    """
+    Unsigned integer type, compatible with C ``unsigned long``.
+    """)
+
+add_newdoc_for_scalar_type('ulonglong', [],
+    """
+    Signed integer type, compatible with C ``unsigned long long``.
+    """)
+
+add_newdoc_for_scalar_type('half', [],
+    """
+    Half-precision floating-point number type.
+    """)
+
+add_newdoc_for_scalar_type('single', [],
+    """
+    Single-precision floating-point number type, compatible with C ``float``.
+    """)
+
+add_newdoc_for_scalar_type('double', ['float_'],
+    """
+    Double-precision floating-point number type, compatible with Python `float`
+    and C ``double``.
+    """)
+
+add_newdoc_for_scalar_type('longdouble', ['longfloat'],
+    """
+    Extended-precision floating-point number type, compatible with C
+    ``long double`` but not necessarily with IEEE 754 quadruple-precision.
+    """)
+
+add_newdoc_for_scalar_type('csingle', ['singlecomplex'],
+    """
+    Complex number type composed of two single-precision floating-point
+    numbers.
+    """)
+
+add_newdoc_for_scalar_type('cdouble', ['cfloat', 'complex_'],
+    """
+    Complex number type composed of two double-precision floating-point
+    numbers, compatible with Python `complex`.
+    """)
+
+add_newdoc_for_scalar_type('clongdouble', ['clongfloat', 'longcomplex'],
+    """
+    Complex number type composed of two extended-precision floating-point
+    numbers.
+    """)
+
+add_newdoc_for_scalar_type('object_', [],
+    """
+    Any Python object.
+    """)
+
+add_newdoc_for_scalar_type('str_', ['unicode_'],
+    r"""
+    A unicode string.
+
+    This type strips trailing null codepoints.
+
+    >>> s = np.str_("abc\x00")
+    >>> s
+    'abc'
+
+    Unlike the builtin `str`, this supports the :ref:`python:bufferobjects`, exposing its
+    contents as UCS4:
+
+    >>> m = memoryview(np.str_("abc"))
+    >>> m.format
+    '3w'
+    >>> m.tobytes()
+    b'a\x00\x00\x00b\x00\x00\x00c\x00\x00\x00'
+    """)
+
+add_newdoc_for_scalar_type('bytes_', ['string_'],
+    r"""
+    A byte string.
+
+    When used in arrays, this type strips trailing null bytes.
+    """)
+
+add_newdoc_for_scalar_type('void', [],
+    r"""
+    np.void(length_or_data, /, dtype=None)
+
+    Create a new structured or unstructured void scalar.
+
+    Parameters
+    ----------
+    length_or_data : int, array-like, bytes-like, object
+       One of multiple meanings (see notes).  The length or
+       bytes data of an unstructured void.  Or alternatively,
+       the data to be stored in the new scalar when `dtype`
+       is provided.
+       This can be an array-like, in which case an array may
+       be returned.
+    dtype : dtype, optional
+        If provided the dtype of the new scalar.  This dtype must
+        be "void" dtype (i.e. a structured or unstructured void,
+        see also :ref:`defining-structured-types`).
+
+       ..versionadded:: 1.24
+
+    Notes
+    -----
+    For historical reasons and because void scalars can represent both
+    arbitrary byte data and structured dtypes, the void constructor
+    has three calling conventions:
+
+    1. ``np.void(5)`` creates a ``dtype="V5"`` scalar filled with five
+       ``\0`` bytes.  The 5 can be a Python or NumPy integer.
+    2. ``np.void(b"bytes-like")`` creates a void scalar from the byte string.
+       The dtype itemsize will match the byte string length, here ``"V10"``.
+    3. When a ``dtype=`` is passed the call is roughly the same as an
+       array creation.  However, a void scalar rather than array is returned.
+
+    Please see the examples which show all three different conventions.
+
+    Examples
+    --------
+    >>> np.void(5)
+    void(b'\x00\x00\x00\x00\x00')
+    >>> np.void(b'abcd')
+    void(b'\x61\x62\x63\x64')
+    >>> np.void((5, 3.2, "eggs"), dtype="i,d,S5")
+    (5, 3.2, b'eggs')  # looks like a tuple, but is `np.void`
+    >>> np.void(3, dtype=[('x', np.int8), ('y', np.int8)])
+    (3, 3)  # looks like a tuple, but is `np.void`
+
+    """)
+
+add_newdoc_for_scalar_type('datetime64', [],
+    """
+    If created from a 64-bit integer, it represents an offset from
+    ``1970-01-01T00:00:00``.
+    If created from string, the string can be in ISO 8601 date
+    or datetime format.
+
+    >>> np.datetime64(10, 'Y')
+    numpy.datetime64('1980')
+    >>> np.datetime64('1980', 'Y')
+    numpy.datetime64('1980')
+    >>> np.datetime64(10, 'D')
+    numpy.datetime64('1970-01-11')
+
+    See :ref:`arrays.datetime` for more information.
+    """)
+
+add_newdoc_for_scalar_type('timedelta64', [],
+    """
+    A timedelta stored as a 64-bit integer.
+
+    See :ref:`arrays.datetime` for more information.
+    """)
+
+add_newdoc('numpy.core.numerictypes', "integer", ('is_integer',
+    """
+    integer.is_integer() -> bool
+
+    Return ``True`` if the number is finite with integral value.
+
+    .. versionadded:: 1.22
+
+    Examples
+    --------
+    >>> np.int64(-2).is_integer()
+    True
+    >>> np.uint32(5).is_integer()
+    True
+    """))
+
+# TODO: work out how to put this on the base class, np.floating
+for float_name in ('half', 'single', 'double', 'longdouble'):
+    add_newdoc('numpy.core.numerictypes', float_name, ('as_integer_ratio',
+        """
+        {ftype}.as_integer_ratio() -> (int, int)
+
+        Return a pair of integers, whose ratio is exactly equal to the original
+        floating point number, and with a positive denominator.
+        Raise `OverflowError` on infinities and a `ValueError` on NaNs.
+
+        >>> np.{ftype}(10.0).as_integer_ratio()
+        (10, 1)
+        >>> np.{ftype}(0.0).as_integer_ratio()
+        (0, 1)
+        >>> np.{ftype}(-.25).as_integer_ratio()
+        (-1, 4)
+        """.format(ftype=float_name)))
+
+    add_newdoc('numpy.core.numerictypes', float_name, ('is_integer',
+        f"""
+        {float_name}.is_integer() -> bool
+
+        Return ``True`` if the floating point number is finite with integral
+        value, and ``False`` otherwise.
+
+        .. versionadded:: 1.22
+
+        Examples
+        --------
+        >>> np.{float_name}(-2.0).is_integer()
+        True
+        >>> np.{float_name}(3.2).is_integer()
+        False
+        """))
+
+for int_name in ('int8', 'uint8', 'int16', 'uint16', 'int32', 'uint32',
+        'int64', 'uint64', 'int64', 'uint64', 'int64', 'uint64'):
+    # Add negative examples for signed cases by checking typecode
+    add_newdoc('numpy.core.numerictypes', int_name, ('bit_count',
+        f"""
+        {int_name}.bit_count() -> int
+
+        Computes the number of 1-bits in the absolute value of the input.
+        Analogous to the builtin `int.bit_count` or ``popcount`` in C++.
+
+        Examples
+        --------
+        >>> np.{int_name}(127).bit_count()
+        7""" +
+        (f"""
+        >>> np.{int_name}(-127).bit_count()
+        7
+        """ if dtype(int_name).char.islower() else "")))

env-llmeval/lib/python3.10/site-packages/numpy/core/_asarray.py

@@ -0,0 +1,134 @@
+"""
+Functions in the ``as*array`` family that promote array-likes into arrays.
+
+`require` fits this category despite its name not matching this pattern.
+"""
+from .overrides import (
+    array_function_dispatch,
+    set_array_function_like_doc,
+    set_module,
+)
+from .multiarray import array, asanyarray
+
+
+__all__ = ["require"]
+
+
+POSSIBLE_FLAGS = {
+    'C': 'C', 'C_CONTIGUOUS': 'C', 'CONTIGUOUS': 'C',
+    'F': 'F', 'F_CONTIGUOUS': 'F', 'FORTRAN': 'F',
+    'A': 'A', 'ALIGNED': 'A',
+    'W': 'W', 'WRITEABLE': 'W',
+    'O': 'O', 'OWNDATA': 'O',
+    'E': 'E', 'ENSUREARRAY': 'E'
+}
+
+
+@set_array_function_like_doc
+@set_module('numpy')
+def require(a, dtype=None, requirements=None, *, like=None):
+    """
+    Return an ndarray of the provided type that satisfies requirements.
+
+    This function is useful to be sure that an array with the correct flags
+    is returned for passing to compiled code (perhaps through ctypes).
+
+    Parameters
+    ----------
+    a : array_like
+       The object to be converted to a type-and-requirement-satisfying array.
+    dtype : data-type
+       The required data-type. If None preserve the current dtype. If your
+       application requires the data to be in native byteorder, include
+       a byteorder specification as a part of the dtype specification.
+    requirements : str or sequence of str
+       The requirements list can be any of the following
+
+       * 'F_CONTIGUOUS' ('F') - ensure a Fortran-contiguous array
+       * 'C_CONTIGUOUS' ('C') - ensure a C-contiguous array
+       * 'ALIGNED' ('A')      - ensure a data-type aligned array
+       * 'WRITEABLE' ('W')    - ensure a writable array
+       * 'OWNDATA' ('O')      - ensure an array that owns its own data
+       * 'ENSUREARRAY', ('E') - ensure a base array, instead of a subclass
+    ${ARRAY_FUNCTION_LIKE}
+
+        .. versionadded:: 1.20.0
+
+    Returns
+    -------
+    out : ndarray
+        Array with specified requirements and type if given.
+
+    See Also
+    --------
+    asarray : Convert input to an ndarray.
+    asanyarray : Convert to an ndarray, but pass through ndarray subclasses.
+    ascontiguousarray : Convert input to a contiguous array.
+    asfortranarray : Convert input to an ndarray with column-major
+                     memory order.
+    ndarray.flags : Information about the memory layout of the array.
+
+    Notes
+    -----
+    The returned array will be guaranteed to have the listed requirements
+    by making a copy if needed.
+
+    Examples
+    --------
+    >>> x = np.arange(6).reshape(2,3)
+    >>> x.flags
+      C_CONTIGUOUS : True
+      F_CONTIGUOUS : False
+      OWNDATA : False
+      WRITEABLE : True
+      ALIGNED : True
+      WRITEBACKIFCOPY : False
+
+    >>> y = np.require(x, dtype=np.float32, requirements=['A', 'O', 'W', 'F'])
+    >>> y.flags
+      C_CONTIGUOUS : False
+      F_CONTIGUOUS : True
+      OWNDATA : True
+      WRITEABLE : True
+      ALIGNED : True
+      WRITEBACKIFCOPY : False
+
+    """
+    if like is not None:
+        return _require_with_like(
+            like,
+            a,
+            dtype=dtype,
+            requirements=requirements,
+        )
+
+    if not requirements:
+        return asanyarray(a, dtype=dtype)
+
+    requirements = {POSSIBLE_FLAGS[x.upper()] for x in requirements}
+
+    if 'E' in requirements:
+        requirements.remove('E')
+        subok = False
+    else:
+        subok = True
+
+    order = 'A'
+    if requirements >= {'C', 'F'}:
+        raise ValueError('Cannot specify both "C" and "F" order')
+    elif 'F' in requirements:
+        order = 'F'
+        requirements.remove('F')
+    elif 'C' in requirements:
+        order = 'C'
+        requirements.remove('C')
+
+    arr = array(a, dtype=dtype, order=order, copy=False, subok=subok)
+
+    for prop in requirements:
+        if not arr.flags[prop]:
+            return arr.copy(order)
+    return arr
+
+
+_require_with_like = array_function_dispatch()(require)

env-llmeval/lib/python3.10/site-packages/numpy/core/_exceptions.py

@@ -0,0 +1,172 @@
+"""
+Various richly-typed exceptions, that also help us deal with string formatting
+in python where it's easier.
+
+By putting the formatting in `__str__`, we also avoid paying the cost for
+users who silence the exceptions.
+"""
+from .._utils import set_module
+
+def _unpack_tuple(tup):
+    if len(tup) == 1:
+        return tup[0]
+    else:
+        return tup
+
+
+def _display_as_base(cls):
+    """
+    A decorator that makes an exception class look like its base.
+
+    We use this to hide subclasses that are implementation details - the user
+    should catch the base type, which is what the traceback will show them.
+
+    Classes decorated with this decorator are subject to removal without a
+    deprecation warning.
+    """
+    assert issubclass(cls, Exception)
+    cls.__name__ = cls.__base__.__name__
+    return cls
+
+
+class UFuncTypeError(TypeError):
+    """ Base class for all ufunc exceptions """
+    def __init__(self, ufunc):
+        self.ufunc = ufunc
+
+
+@_display_as_base
+class _UFuncNoLoopError(UFuncTypeError):
+    """ Thrown when a ufunc loop cannot be found """
+    def __init__(self, ufunc, dtypes):
+        super().__init__(ufunc)
+        self.dtypes = tuple(dtypes)
+
+    def __str__(self):
+        return (
+            "ufunc {!r} did not contain a loop with signature matching types "
+            "{!r} -> {!r}"
+        ).format(
+            self.ufunc.__name__,
+            _unpack_tuple(self.dtypes[:self.ufunc.nin]),
+            _unpack_tuple(self.dtypes[self.ufunc.nin:])
+        )
+
+
+@_display_as_base
+class _UFuncBinaryResolutionError(_UFuncNoLoopError):
+    """ Thrown when a binary resolution fails """
+    def __init__(self, ufunc, dtypes):
+        super().__init__(ufunc, dtypes)
+        assert len(self.dtypes) == 2
+
+    def __str__(self):
+        return (
+            "ufunc {!r} cannot use operands with types {!r} and {!r}"
+        ).format(
+            self.ufunc.__name__, *self.dtypes
+        )
+
+
+@_display_as_base
+class _UFuncCastingError(UFuncTypeError):
+    def __init__(self, ufunc, casting, from_, to):
+        super().__init__(ufunc)
+        self.casting = casting
+        self.from_ = from_
+        self.to = to
+
+
+@_display_as_base
+class _UFuncInputCastingError(_UFuncCastingError):
+    """ Thrown when a ufunc input cannot be casted """
+    def __init__(self, ufunc, casting, from_, to, i):
+        super().__init__(ufunc, casting, from_, to)
+        self.in_i = i
+
+    def __str__(self):
+        # only show the number if more than one input exists
+        i_str = "{} ".format(self.in_i) if self.ufunc.nin != 1 else ""
+        return (
+            "Cannot cast ufunc {!r} input {}from {!r} to {!r} with casting "
+            "rule {!r}"
+        ).format(
+            self.ufunc.__name__, i_str, self.from_, self.to, self.casting
+        )
+
+
+@_display_as_base
+class _UFuncOutputCastingError(_UFuncCastingError):
+    """ Thrown when a ufunc output cannot be casted """
+    def __init__(self, ufunc, casting, from_, to, i):
+        super().__init__(ufunc, casting, from_, to)
+        self.out_i = i
+
+    def __str__(self):
+        # only show the number if more than one output exists
+        i_str = "{} ".format(self.out_i) if self.ufunc.nout != 1 else ""
+        return (
+            "Cannot cast ufunc {!r} output {}from {!r} to {!r} with casting "
+            "rule {!r}"
+        ).format(
+            self.ufunc.__name__, i_str, self.from_, self.to, self.casting
+        )
+
+
+@_display_as_base
+class _ArrayMemoryError(MemoryError):
+    """ Thrown when an array cannot be allocated"""
+    def __init__(self, shape, dtype):
+        self.shape = shape
+        self.dtype = dtype
+
+    @property
+    def _total_size(self):
+        num_bytes = self.dtype.itemsize
+        for dim in self.shape:
+            num_bytes *= dim
+        return num_bytes
+
+    @staticmethod
+    def _size_to_string(num_bytes):
+        """ Convert a number of bytes into a binary size string """
+
+        # https://en.wikipedia.org/wiki/Binary_prefix
+        LOG2_STEP = 10
+        STEP = 1024
+        units = ['bytes', 'KiB', 'MiB', 'GiB', 'TiB', 'PiB', 'EiB']
+
+        unit_i = max(num_bytes.bit_length() - 1, 1) // LOG2_STEP
+        unit_val = 1 << (unit_i * LOG2_STEP)
+        n_units = num_bytes / unit_val
+        del unit_val
+
+        # ensure we pick a unit that is correct after rounding
+        if round(n_units) == STEP:
+            unit_i += 1
+            n_units /= STEP
+
+        # deal with sizes so large that we don't have units for them
+        if unit_i >= len(units):
+            new_unit_i = len(units) - 1
+            n_units *= 1 << ((unit_i - new_unit_i) * LOG2_STEP)
+            unit_i = new_unit_i
+
+        unit_name = units[unit_i]
+        # format with a sensible number of digits
+        if unit_i == 0:
+            # no decimal point on bytes
+            return '{:.0f} {}'.format(n_units, unit_name)
+        elif round(n_units) < 1000:
+            # 3 significant figures, if none are dropped to the left of the .
+            return '{:#.3g} {}'.format(n_units, unit_name)
+        else:
+            # just give all the digits otherwise
+            return '{:#.0f} {}'.format(n_units, unit_name)
+
+    def __str__(self):
+        size_str = self._size_to_string(self._total_size)
+        return (
+            "Unable to allocate {} for an array with shape {} and data type {}"
+            .format(size_str, self.shape, self.dtype)
+        )

env-llmeval/lib/python3.10/site-packages/numpy/core/_machar.py

@@ -0,0 +1,356 @@
+"""
+Machine arithmetic - determine the parameters of the
+floating-point arithmetic system
+
+Author: Pearu Peterson, September 2003
+
+"""
+__all__ = ['MachAr']
+
+from .fromnumeric import any
+from ._ufunc_config import errstate
+from .._utils import set_module
+
+# Need to speed this up...especially for longfloat
+
+# Deprecated 2021-10-20, NumPy 1.22
+class MachAr:
+    """
+    Diagnosing machine parameters.
+
+    Attributes
+    ----------
+    ibeta : int
+        Radix in which numbers are represented.
+    it : int
+        Number of base-`ibeta` digits in the floating point mantissa M.
+    machep : int
+        Exponent of the smallest (most negative) power of `ibeta` that,
+        added to 1.0, gives something different from 1.0
+    eps : float
+        Floating-point number ``beta**machep`` (floating point precision)
+    negep : int
+        Exponent of the smallest power of `ibeta` that, subtracted
+        from 1.0, gives something different from 1.0.
+    epsneg : float
+        Floating-point number ``beta**negep``.
+    iexp : int
+        Number of bits in the exponent (including its sign and bias).
+    minexp : int
+        Smallest (most negative) power of `ibeta` consistent with there
+        being no leading zeros in the mantissa.
+    xmin : float
+        Floating-point number ``beta**minexp`` (the smallest [in
+        magnitude] positive floating point number with full precision).
+    maxexp : int
+        Smallest (positive) power of `ibeta` that causes overflow.
+    xmax : float
+        ``(1-epsneg) * beta**maxexp`` (the largest [in magnitude]
+        usable floating value).
+    irnd : int
+        In ``range(6)``, information on what kind of rounding is done
+        in addition, and on how underflow is handled.
+    ngrd : int
+        Number of 'guard digits' used when truncating the product
+        of two mantissas to fit the representation.
+    epsilon : float
+        Same as `eps`.
+    tiny : float
+        An alias for `smallest_normal`, kept for backwards compatibility.
+    huge : float
+        Same as `xmax`.
+    precision : float
+        ``- int(-log10(eps))``
+    resolution : float
+        ``- 10**(-precision)``
+    smallest_normal : float
+        The smallest positive floating point number with 1 as leading bit in
+        the mantissa following IEEE-754. Same as `xmin`.
+    smallest_subnormal : float
+        The smallest positive floating point number with 0 as leading bit in
+        the mantissa following IEEE-754.
+
+    Parameters
+    ----------
+    float_conv : function, optional
+        Function that converts an integer or integer array to a float
+        or float array. Default is `float`.
+    int_conv : function, optional
+        Function that converts a float or float array to an integer or
+        integer array. Default is `int`.
+    float_to_float : function, optional
+        Function that converts a float array to float. Default is `float`.
+        Note that this does not seem to do anything useful in the current
+        implementation.
+    float_to_str : function, optional
+        Function that converts a single float to a string. Default is
+        ``lambda v:'%24.16e' %v``.
+    title : str, optional
+        Title that is printed in the string representation of `MachAr`.
+
+    See Also
+    --------
+    finfo : Machine limits for floating point types.
+    iinfo : Machine limits for integer types.
+
+    References
+    ----------
+    .. [1] Press, Teukolsky, Vetterling and Flannery,
+           "Numerical Recipes in C++," 2nd ed,
+           Cambridge University Press, 2002, p. 31.
+
+    """
+
+    def __init__(self, float_conv=float,int_conv=int,
+                 float_to_float=float,
+                 float_to_str=lambda v:'%24.16e' % v,
+                 title='Python floating point number'):
+        """
+
+        float_conv - convert integer to float (array)
+        int_conv   - convert float (array) to integer
+        float_to_float - convert float array to float
+        float_to_str - convert array float to str
+        title        - description of used floating point numbers
+
+        """
+        # We ignore all errors here because we are purposely triggering
+        # underflow to detect the properties of the runninng arch.
+        with errstate(under='ignore'):
+            self._do_init(float_conv, int_conv, float_to_float, float_to_str, title)
+
+    def _do_init(self, float_conv, int_conv, float_to_float, float_to_str, title):
+        max_iterN = 10000
+        msg = "Did not converge after %d tries with %s"
+        one = float_conv(1)
+        two = one + one
+        zero = one - one
+
+        # Do we really need to do this?  Aren't they 2 and 2.0?
+        # Determine ibeta and beta
+        a = one
+        for _ in range(max_iterN):
+            a = a + a
+            temp = a + one
+            temp1 = temp - a
+            if any(temp1 - one != zero):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        b = one
+        for _ in range(max_iterN):
+            b = b + b
+            temp = a + b
+            itemp = int_conv(temp-a)
+            if any(itemp != 0):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        ibeta = itemp
+        beta = float_conv(ibeta)
+
+        # Determine it and irnd
+        it = -1
+        b = one
+        for _ in range(max_iterN):
+            it = it + 1
+            b = b * beta
+            temp = b + one
+            temp1 = temp - b
+            if any(temp1 - one != zero):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+
+        betah = beta / two
+        a = one
+        for _ in range(max_iterN):
+            a = a + a
+            temp = a + one
+            temp1 = temp - a
+            if any(temp1 - one != zero):
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        temp = a + betah
+        irnd = 0
+        if any(temp-a != zero):
+            irnd = 1
+        tempa = a + beta
+        temp = tempa + betah
+        if irnd == 0 and any(temp-tempa != zero):
+            irnd = 2
+
+        # Determine negep and epsneg
+        negep = it + 3
+        betain = one / beta
+        a = one
+        for i in range(negep):
+            a = a * betain
+        b = a
+        for _ in range(max_iterN):
+            temp = one - a
+            if any(temp-one != zero):
+                break
+            a = a * beta
+            negep = negep - 1
+            # Prevent infinite loop on PPC with gcc 4.0:
+            if negep < 0:
+                raise RuntimeError("could not determine machine tolerance "
+                                   "for 'negep', locals() -> %s" % (locals()))
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        negep = -negep
+        epsneg = a
+
+        # Determine machep and eps
+        machep = - it - 3
+        a = b
+
+        for _ in range(max_iterN):
+            temp = one + a
+            if any(temp-one != zero):
+                break
+            a = a * beta
+            machep = machep + 1
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        eps = a
+
+        # Determine ngrd
+        ngrd = 0
+        temp = one + eps
+        if irnd == 0 and any(temp*one - one != zero):
+            ngrd = 1
+
+        # Determine iexp
+        i = 0
+        k = 1
+        z = betain
+        t = one + eps
+        nxres = 0
+        for _ in range(max_iterN):
+            y = z
+            z = y*y
+            a = z*one  # Check here for underflow
+            temp = z*t
+            if any(a+a == zero) or any(abs(z) >= y):
+                break
+            temp1 = temp * betain
+            if any(temp1*beta == z):
+                break
+            i = i + 1
+            k = k + k
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        if ibeta != 10:
+            iexp = i + 1
+            mx = k + k
+        else:
+            iexp = 2
+            iz = ibeta
+            while k >= iz:
+                iz = iz * ibeta
+                iexp = iexp + 1
+            mx = iz + iz - 1
+
+        # Determine minexp and xmin
+        for _ in range(max_iterN):
+            xmin = y
+            y = y * betain
+            a = y * one
+            temp = y * t
+            if any((a + a) != zero) and any(abs(y) < xmin):
+                k = k + 1
+                temp1 = temp * betain
+                if any(temp1*beta == y) and any(temp != y):
+                    nxres = 3
+                    xmin = y
+                    break
+            else:
+                break
+        else:
+            raise RuntimeError(msg % (_, one.dtype))
+        minexp = -k
+
+        # Determine maxexp, xmax
+        if mx <= k + k - 3 and ibeta != 10:
+            mx = mx + mx
+            iexp = iexp + 1
+        maxexp = mx + minexp
+        irnd = irnd + nxres
+        if irnd >= 2:
+            maxexp = maxexp - 2
+        i = maxexp + minexp
+        if ibeta == 2 and not i:
+            maxexp = maxexp - 1
+        if i > 20:
+            maxexp = maxexp - 1
+        if any(a != y):
+            maxexp = maxexp - 2
+        xmax = one - epsneg
+        if any(xmax*one != xmax):
+            xmax = one - beta*epsneg
+        xmax = xmax / (xmin*beta*beta*beta)
+        i = maxexp + minexp + 3
+        for j in range(i):
+            if ibeta == 2:
+                xmax = xmax + xmax
+            else:
+                xmax = xmax * beta
+
+        smallest_subnormal = abs(xmin / beta ** (it))
+
+        self.ibeta = ibeta
+        self.it = it
+        self.negep = negep
+        self.epsneg = float_to_float(epsneg)
+        self._str_epsneg = float_to_str(epsneg)
+        self.machep = machep
+        self.eps = float_to_float(eps)
+        self._str_eps = float_to_str(eps)
+        self.ngrd = ngrd
+        self.iexp = iexp
+        self.minexp = minexp
+        self.xmin = float_to_float(xmin)
+        self._str_xmin = float_to_str(xmin)
+        self.maxexp = maxexp
+        self.xmax = float_to_float(xmax)
+        self._str_xmax = float_to_str(xmax)
+        self.irnd = irnd
+
+        self.title = title
+        # Commonly used parameters
+        self.epsilon = self.eps
+        self.tiny = self.xmin
+        self.huge = self.xmax
+        self.smallest_normal = self.xmin
+        self._str_smallest_normal = float_to_str(self.xmin)
+        self.smallest_subnormal = float_to_float(smallest_subnormal)
+        self._str_smallest_subnormal = float_to_str(smallest_subnormal)
+
+        import math
+        self.precision = int(-math.log10(float_to_float(self.eps)))
+        ten = two + two + two + two + two
+        resolution = ten ** (-self.precision)
+        self.resolution = float_to_float(resolution)
+        self._str_resolution = float_to_str(resolution)
+
+    def __str__(self):
+        fmt = (
+           'Machine parameters for %(title)s\n'
+           '---------------------------------------------------------------------\n'
+           'ibeta=%(ibeta)s it=%(it)s iexp=%(iexp)s ngrd=%(ngrd)s irnd=%(irnd)s\n'
+           'machep=%(machep)s     eps=%(_str_eps)s (beta**machep == epsilon)\n'
+           'negep =%(negep)s  epsneg=%(_str_epsneg)s (beta**epsneg)\n'
+           'minexp=%(minexp)s   xmin=%(_str_xmin)s (beta**minexp == tiny)\n'
+           'maxexp=%(maxexp)s    xmax=%(_str_xmax)s ((1-epsneg)*beta**maxexp == huge)\n'
+           'smallest_normal=%(smallest_normal)s    '
+           'smallest_subnormal=%(smallest_subnormal)s\n'
+           '---------------------------------------------------------------------\n'
+           )
+        return fmt % self.__dict__
+
+
+if __name__ == '__main__':
+    print(MachAr())

env-llmeval/lib/python3.10/site-packages/numpy/core/_string_helpers.py

@@ -0,0 +1,100 @@
+"""
+String-handling utilities to avoid locale-dependence.
+
+Used primarily to generate type name aliases.
+"""
+# "import string" is costly to import!
+# Construct the translation tables directly
+#   "A" = chr(65), "a" = chr(97)
+_all_chars = tuple(map(chr, range(256)))
+_ascii_upper = _all_chars[65:65+26]
+_ascii_lower = _all_chars[97:97+26]
+LOWER_TABLE = "".join(_all_chars[:65] + _ascii_lower + _all_chars[65+26:])
+UPPER_TABLE = "".join(_all_chars[:97] + _ascii_upper + _all_chars[97+26:])
+
+
+def english_lower(s):
+    """ Apply English case rules to convert ASCII strings to all lower case.
+
+    This is an internal utility function to replace calls to str.lower() such
+    that we can avoid changing behavior with changing locales. In particular,
+    Turkish has distinct dotted and dotless variants of the Latin letter "I" in
+    both lowercase and uppercase. Thus, "I".lower() != "i" in a "tr" locale.
+
+    Parameters
+    ----------
+    s : str
+
+    Returns
+    -------
+    lowered : str
+
+    Examples
+    --------
+    >>> from numpy.core.numerictypes import english_lower
+    >>> english_lower('ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789_')
+    'abcdefghijklmnopqrstuvwxyzabcdefghijklmnopqrstuvwxyz0123456789_'
+    >>> english_lower('')
+    ''
+    """
+    lowered = s.translate(LOWER_TABLE)
+    return lowered
+
+
+def english_upper(s):
+    """ Apply English case rules to convert ASCII strings to all upper case.
+
+    This is an internal utility function to replace calls to str.upper() such
+    that we can avoid changing behavior with changing locales. In particular,
+    Turkish has distinct dotted and dotless variants of the Latin letter "I" in
+    both lowercase and uppercase. Thus, "i".upper() != "I" in a "tr" locale.
+
+    Parameters
+    ----------
+    s : str
+
+    Returns
+    -------
+    uppered : str
+
+    Examples
+    --------
+    >>> from numpy.core.numerictypes import english_upper
+    >>> english_upper('ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789_')
+    'ABCDEFGHIJKLMNOPQRSTUVWXYZABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789_'
+    >>> english_upper('')
+    ''
+    """
+    uppered = s.translate(UPPER_TABLE)
+    return uppered
+
+
+def english_capitalize(s):
+    """ Apply English case rules to convert the first character of an ASCII
+    string to upper case.
+
+    This is an internal utility function to replace calls to str.capitalize()
+    such that we can avoid changing behavior with changing locales.
+
+    Parameters
+    ----------
+    s : str
+
+    Returns
+    -------
+    capitalized : str
+
+    Examples
+    --------
+    >>> from numpy.core.numerictypes import english_capitalize
+    >>> english_capitalize('int8')
+    'Int8'
+    >>> english_capitalize('Int8')
+    'Int8'
+    >>> english_capitalize('')
+    ''
+    """
+    if s:
+        return english_upper(s[0]) + s[1:]
+    else:
+        return s

env-llmeval/lib/python3.10/site-packages/numpy/core/_ufunc_config.pyi

@@ -0,0 +1,37 @@
+from collections.abc import Callable
+from typing import Any, Literal, TypedDict
+
+from numpy import _SupportsWrite
+
+_ErrKind = Literal["ignore", "warn", "raise", "call", "print", "log"]
+_ErrFunc = Callable[[str, int], Any]
+
+class _ErrDict(TypedDict):
+    divide: _ErrKind
+    over: _ErrKind
+    under: _ErrKind
+    invalid: _ErrKind
+
+class _ErrDictOptional(TypedDict, total=False):
+    all: None | _ErrKind
+    divide: None | _ErrKind
+    over: None | _ErrKind
+    under: None | _ErrKind
+    invalid: None | _ErrKind
+
+def seterr(
+    all: None | _ErrKind = ...,
+    divide: None | _ErrKind = ...,
+    over: None | _ErrKind = ...,
+    under: None | _ErrKind = ...,
+    invalid: None | _ErrKind = ...,
+) -> _ErrDict: ...
+def geterr() -> _ErrDict: ...
+def setbufsize(size: int) -> int: ...
+def getbufsize() -> int: ...
+def seterrcall(
+    func: None | _ErrFunc | _SupportsWrite[str]
+) -> None | _ErrFunc | _SupportsWrite[str]: ...
+def geterrcall() -> None | _ErrFunc | _SupportsWrite[str]: ...
+
+# See `numpy/__init__.pyi` for the `errstate` class and `no_nep5_warnings`

env-llmeval/lib/python3.10/site-packages/numpy/core/arrayprint.py

@@ -0,0 +1,1725 @@
+"""Array printing function
+
+$Id: arrayprint.py,v 1.9 2005/09/13 13:58:44 teoliphant Exp $
+
+"""
+__all__ = ["array2string", "array_str", "array_repr", "set_string_function",
+           "set_printoptions", "get_printoptions", "printoptions",
+           "format_float_positional", "format_float_scientific"]
+__docformat__ = 'restructuredtext'
+
+#
+# Written by Konrad Hinsen <[email protected]>
+# last revision: 1996-3-13
+# modified by Jim Hugunin 1997-3-3 for repr's and str's (and other details)
+# and by Perry Greenfield 2000-4-1 for numarray
+# and by Travis Oliphant  2005-8-22 for numpy
+
+
+# Note: Both scalartypes.c.src and arrayprint.py implement strs for numpy
+# scalars but for different purposes. scalartypes.c.src has str/reprs for when
+# the scalar is printed on its own, while arrayprint.py has strs for when
+# scalars are printed inside an ndarray. Only the latter strs are currently
+# user-customizable.
+
+import functools
+import numbers
+import sys
+try:
+    from _thread import get_ident
+except ImportError:
+    from _dummy_thread import get_ident
+
+import numpy as np
+from . import numerictypes as _nt
+from .umath import absolute, isinf, isfinite, isnat
+from . import multiarray
+from .multiarray import (array, dragon4_positional, dragon4_scientific,
+                         datetime_as_string, datetime_data, ndarray,
+                         set_legacy_print_mode)
+from .fromnumeric import any
+from .numeric import concatenate, asarray, errstate
+from .numerictypes import (longlong, intc, int_, float_, complex_, bool_,
+                           flexible)
+from .overrides import array_function_dispatch, set_module
+import operator
+import warnings
+import contextlib
+
+_format_options = {
+    'edgeitems': 3,  # repr N leading and trailing items of each dimension
+    'threshold': 1000,  # total items > triggers array summarization
+    'floatmode': 'maxprec',
+    'precision': 8,  # precision of floating point representations
+    'suppress': False,  # suppress printing small floating values in exp format
+    'linewidth': 75,
+    'nanstr': 'nan',
+    'infstr': 'inf',
+    'sign': '-',
+    'formatter': None,
+    # Internally stored as an int to simplify comparisons; converted from/to
+    # str/False on the way in/out.
+    'legacy': sys.maxsize}
+
+def _make_options_dict(precision=None, threshold=None, edgeitems=None,
+                       linewidth=None, suppress=None, nanstr=None, infstr=None,
+                       sign=None, formatter=None, floatmode=None, legacy=None):
+    """
+    Make a dictionary out of the non-None arguments, plus conversion of
+    *legacy* and sanity checks.
+    """
+
+    options = {k: v for k, v in locals().items() if v is not None}
+
+    if suppress is not None:
+        options['suppress'] = bool(suppress)
+
+    modes = ['fixed', 'unique', 'maxprec', 'maxprec_equal']
+    if floatmode not in modes + [None]:
+        raise ValueError("floatmode option must be one of " +
+                         ", ".join('"{}"'.format(m) for m in modes))
+
+    if sign not in [None, '-', '+', ' ']:
+        raise ValueError("sign option must be one of ' ', '+', or '-'")
+
+    if legacy == False:
+        options['legacy'] = sys.maxsize
+    elif legacy == '1.13':
+        options['legacy'] = 113
+    elif legacy == '1.21':
+        options['legacy'] = 121
+    elif legacy is None:
+        pass  # OK, do nothing.
+    else:
+        warnings.warn(
+            "legacy printing option can currently only be '1.13', '1.21', or "
+            "`False`", stacklevel=3)
+
+    if threshold is not None:
+        # forbid the bad threshold arg suggested by stack overflow, gh-12351
+        if not isinstance(threshold, numbers.Number):
+            raise TypeError("threshold must be numeric")
+        if np.isnan(threshold):
+            raise ValueError("threshold must be non-NAN, try "
+                             "sys.maxsize for untruncated representation")
+
+    if precision is not None:
+        # forbid the bad precision arg as suggested by issue #18254
+        try:
+            options['precision'] = operator.index(precision)
+        except TypeError as e:
+            raise TypeError('precision must be an integer') from e
+
+    return options
+
+
+@set_module('numpy')
+def set_printoptions(precision=None, threshold=None, edgeitems=None,
+                     linewidth=None, suppress=None, nanstr=None, infstr=None,
+                     formatter=None, sign=None, floatmode=None, *, legacy=None):
+    """
+    Set printing options.
+
+    These options determine the way floating point numbers, arrays and
+    other NumPy objects are displayed.
+
+    Parameters
+    ----------
+    precision : int or None, optional
+        Number of digits of precision for floating point output (default 8).
+        May be None if `floatmode` is not `fixed`, to print as many digits as
+        necessary to uniquely specify the value.
+    threshold : int, optional
+        Total number of array elements which trigger summarization
+        rather than full repr (default 1000).
+        To always use the full repr without summarization, pass `sys.maxsize`.
+    edgeitems : int, optional
+        Number of array items in summary at beginning and end of
+        each dimension (default 3).
+    linewidth : int, optional
+        The number of characters per line for the purpose of inserting
+        line breaks (default 75).
+    suppress : bool, optional
+        If True, always print floating point numbers using fixed point
+        notation, in which case numbers equal to zero in the current precision
+        will print as zero.  If False, then scientific notation is used when
+        absolute value of the smallest number is < 1e-4 or the ratio of the
+        maximum absolute value to the minimum is > 1e3. The default is False.
+    nanstr : str, optional
+        String representation of floating point not-a-number (default nan).
+    infstr : str, optional
+        String representation of floating point infinity (default inf).
+    sign : string, either '-', '+', or ' ', optional
+        Controls printing of the sign of floating-point types. If '+', always
+        print the sign of positive values. If ' ', always prints a space
+        (whitespace character) in the sign position of positive values.  If
+        '-', omit the sign character of positive values. (default '-')
+    formatter : dict of callables, optional
+        If not None, the keys should indicate the type(s) that the respective
+        formatting function applies to.  Callables should return a string.
+        Types that are not specified (by their corresponding keys) are handled
+        by the default formatters.  Individual types for which a formatter
+        can be set are:
+
+        - 'bool'
+        - 'int'
+        - 'timedelta' : a `numpy.timedelta64`
+        - 'datetime' : a `numpy.datetime64`
+        - 'float'
+        - 'longfloat' : 128-bit floats
+        - 'complexfloat'
+        - 'longcomplexfloat' : composed of two 128-bit floats
+        - 'numpystr' : types `numpy.bytes_` and `numpy.str_`
+        - 'object' : `np.object_` arrays
+
+        Other keys that can be used to set a group of types at once are:
+
+        - 'all' : sets all types
+        - 'int_kind' : sets 'int'
+        - 'float_kind' : sets 'float' and 'longfloat'
+        - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat'
+        - 'str_kind' : sets 'numpystr'
+    floatmode : str, optional
+        Controls the interpretation of the `precision` option for
+        floating-point types. Can take the following values
+        (default maxprec_equal):
+
+        * 'fixed': Always print exactly `precision` fractional digits,
+                even if this would print more or fewer digits than
+                necessary to specify the value uniquely.
+        * 'unique': Print the minimum number of fractional digits necessary
+                to represent each value uniquely. Different elements may
+                have a different number of digits. The value of the
+                `precision` option is ignored.
+        * 'maxprec': Print at most `precision` fractional digits, but if
+                an element can be uniquely represented with fewer digits
+                only print it with that many.
+        * 'maxprec_equal': Print at most `precision` fractional digits,
+                but if every element in the array can be uniquely
+                represented with an equal number of fewer digits, use that
+                many digits for all elements.
+    legacy : string or `False`, optional
+        If set to the string `'1.13'` enables 1.13 legacy printing mode. This
+        approximates numpy 1.13 print output by including a space in the sign
+        position of floats and different behavior for 0d arrays. This also
+        enables 1.21 legacy printing mode (described below).
+
+        If set to the string `'1.21'` enables 1.21 legacy printing mode. This
+        approximates numpy 1.21 print output of complex structured dtypes
+        by not inserting spaces after commas that separate fields and after
+        colons.
+
+        If set to `False`, disables legacy mode.
+
+        Unrecognized strings will be ignored with a warning for forward
+        compatibility.
+
+        .. versionadded:: 1.14.0
+        .. versionchanged:: 1.22.0
+
+    See Also
+    --------
+    get_printoptions, printoptions, set_string_function, array2string
+
+    Notes
+    -----
+    `formatter` is always reset with a call to `set_printoptions`.
+
+    Use `printoptions` as a context manager to set the values temporarily.
+
+    Examples
+    --------
+    Floating point precision can be set:
+
+    >>> np.set_printoptions(precision=4)
+    >>> np.array([1.123456789])
+    [1.1235]
+
+    Long arrays can be summarised:
+
+    >>> np.set_printoptions(threshold=5)
+    >>> np.arange(10)
+    array([0, 1, 2, ..., 7, 8, 9])
+
+    Small results can be suppressed:
+
+    >>> eps = np.finfo(float).eps
+    >>> x = np.arange(4.)
+    >>> x**2 - (x + eps)**2
+    array([-4.9304e-32, -4.4409e-16,  0.0000e+00,  0.0000e+00])
+    >>> np.set_printoptions(suppress=True)
+    >>> x**2 - (x + eps)**2
+    array([-0., -0.,  0.,  0.])
+
+    A custom formatter can be used to display array elements as desired:
+
+    >>> np.set_printoptions(formatter={'all':lambda x: 'int: '+str(-x)})
+    >>> x = np.arange(3)
+    >>> x
+    array([int: 0, int: -1, int: -2])
+    >>> np.set_printoptions()  # formatter gets reset
+    >>> x
+    array([0, 1, 2])
+
+    To put back the default options, you can use:
+
+    >>> np.set_printoptions(edgeitems=3, infstr='inf',
+    ... linewidth=75, nanstr='nan', precision=8,
+    ... suppress=False, threshold=1000, formatter=None)
+
+    Also to temporarily override options, use `printoptions` as a context manager:
+
+    >>> with np.printoptions(precision=2, suppress=True, threshold=5):
+    ...     np.linspace(0, 10, 10)
+    array([ 0.  ,  1.11,  2.22, ...,  7.78,  8.89, 10.  ])
+
+    """
+    opt = _make_options_dict(precision, threshold, edgeitems, linewidth,
+                             suppress, nanstr, infstr, sign, formatter,
+                             floatmode, legacy)
+    # formatter is always reset
+    opt['formatter'] = formatter
+    _format_options.update(opt)
+
+    # set the C variable for legacy mode
+    if _format_options['legacy'] == 113:
+        set_legacy_print_mode(113)
+        # reset the sign option in legacy mode to avoid confusion
+        _format_options['sign'] = '-'
+    elif _format_options['legacy'] == 121:
+        set_legacy_print_mode(121)
+    elif _format_options['legacy'] == sys.maxsize:
+        set_legacy_print_mode(0)
+
+
+@set_module('numpy')
+def get_printoptions():
+    """
+    Return the current print options.
+
+    Returns
+    -------
+    print_opts : dict
+        Dictionary of current print options with keys
+
+          - precision : int
+          - threshold : int
+          - edgeitems : int
+          - linewidth : int
+          - suppress : bool
+          - nanstr : str
+          - infstr : str
+          - formatter : dict of callables
+          - sign : str
+
+        For a full description of these options, see `set_printoptions`.
+
+    See Also
+    --------
+    set_printoptions, printoptions, set_string_function
+
+    """
+    opts = _format_options.copy()
+    opts['legacy'] = {
+        113: '1.13', 121: '1.21', sys.maxsize: False,
+    }[opts['legacy']]
+    return opts
+
+
+def _get_legacy_print_mode():
+    """Return the legacy print mode as an int."""
+    return _format_options['legacy']
+
+
+@set_module('numpy')
+@contextlib.contextmanager
+def printoptions(*args, **kwargs):
+    """Context manager for setting print options.
+
+    Set print options for the scope of the `with` block, and restore the old
+    options at the end. See `set_printoptions` for the full description of
+    available options.
+
+    Examples
+    --------
+
+    >>> from numpy.testing import assert_equal
+    >>> with np.printoptions(precision=2):
+    ...     np.array([2.0]) / 3
+    array([0.67])
+
+    The `as`-clause of the `with`-statement gives the current print options:
+
+    >>> with np.printoptions(precision=2) as opts:
+    ...      assert_equal(opts, np.get_printoptions())
+
+    See Also
+    --------
+    set_printoptions, get_printoptions
+
+    """
+    opts = np.get_printoptions()
+    try:
+        np.set_printoptions(*args, **kwargs)
+        yield np.get_printoptions()
+    finally:
+        np.set_printoptions(**opts)
+
+
+def _leading_trailing(a, edgeitems, index=()):
+    """
+    Keep only the N-D corners (leading and trailing edges) of an array.
+
+    Should be passed a base-class ndarray, since it makes no guarantees about
+    preserving subclasses.
+    """
+    axis = len(index)
+    if axis == a.ndim:
+        return a[index]
+
+    if a.shape[axis] > 2*edgeitems:
+        return concatenate((
+            _leading_trailing(a, edgeitems, index + np.index_exp[ :edgeitems]),
+            _leading_trailing(a, edgeitems, index + np.index_exp[-edgeitems:])
+        ), axis=axis)
+    else:
+        return _leading_trailing(a, edgeitems, index + np.index_exp[:])
+
+
+def _object_format(o):
+    """ Object arrays containing lists should be printed unambiguously """
+    if type(o) is list:
+        fmt = 'list({!r})'
+    else:
+        fmt = '{!r}'
+    return fmt.format(o)
+
+def repr_format(x):
+    return repr(x)
+
+def str_format(x):
+    return str(x)
+
+def _get_formatdict(data, *, precision, floatmode, suppress, sign, legacy,
+                    formatter, **kwargs):
+    # note: extra arguments in kwargs are ignored
+
+    # wrapped in lambdas to avoid taking a code path with the wrong type of data
+    formatdict = {
+        'bool': lambda: BoolFormat(data),
+        'int': lambda: IntegerFormat(data),
+        'float': lambda: FloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'longfloat': lambda: FloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'complexfloat': lambda: ComplexFloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'longcomplexfloat': lambda: ComplexFloatingFormat(
+            data, precision, floatmode, suppress, sign, legacy=legacy),
+        'datetime': lambda: DatetimeFormat(data, legacy=legacy),
+        'timedelta': lambda: TimedeltaFormat(data),
+        'object': lambda: _object_format,
+        'void': lambda: str_format,
+        'numpystr': lambda: repr_format}
+
+    # we need to wrap values in `formatter` in a lambda, so that the interface
+    # is the same as the above values.
+    def indirect(x):
+        return lambda: x
+
+    if formatter is not None:
+        fkeys = [k for k in formatter.keys() if formatter[k] is not None]
+        if 'all' in fkeys:
+            for key in formatdict.keys():
+                formatdict[key] = indirect(formatter['all'])
+        if 'int_kind' in fkeys:
+            for key in ['int']:
+                formatdict[key] = indirect(formatter['int_kind'])
+        if 'float_kind' in fkeys:
+            for key in ['float', 'longfloat']:
+                formatdict[key] = indirect(formatter['float_kind'])
+        if 'complex_kind' in fkeys:
+            for key in ['complexfloat', 'longcomplexfloat']:
+                formatdict[key] = indirect(formatter['complex_kind'])
+        if 'str_kind' in fkeys:
+            formatdict['numpystr'] = indirect(formatter['str_kind'])
+        for key in formatdict.keys():
+            if key in fkeys:
+                formatdict[key] = indirect(formatter[key])
+
+    return formatdict
+
+def _get_format_function(data, **options):
+    """
+    find the right formatting function for the dtype_
+    """
+    dtype_ = data.dtype
+    dtypeobj = dtype_.type
+    formatdict = _get_formatdict(data, **options)
+    if dtypeobj is None:
+        return formatdict["numpystr"]()
+    elif issubclass(dtypeobj, _nt.bool_):
+        return formatdict['bool']()
+    elif issubclass(dtypeobj, _nt.integer):
+        if issubclass(dtypeobj, _nt.timedelta64):
+            return formatdict['timedelta']()
+        else:
+            return formatdict['int']()
+    elif issubclass(dtypeobj, _nt.floating):
+        if issubclass(dtypeobj, _nt.longfloat):
+            return formatdict['longfloat']()
+        else:
+            return formatdict['float']()
+    elif issubclass(dtypeobj, _nt.complexfloating):
+        if issubclass(dtypeobj, _nt.clongfloat):
+            return formatdict['longcomplexfloat']()
+        else:
+            return formatdict['complexfloat']()
+    elif issubclass(dtypeobj, (_nt.str_, _nt.bytes_)):
+        return formatdict['numpystr']()
+    elif issubclass(dtypeobj, _nt.datetime64):
+        return formatdict['datetime']()
+    elif issubclass(dtypeobj, _nt.object_):
+        return formatdict['object']()
+    elif issubclass(dtypeobj, _nt.void):
+        if dtype_.names is not None:
+            return StructuredVoidFormat.from_data(data, **options)
+        else:
+            return formatdict['void']()
+    else:
+        return formatdict['numpystr']()
+
+
+def _recursive_guard(fillvalue='...'):
+    """
+    Like the python 3.2 reprlib.recursive_repr, but forwards *args and **kwargs
+
+    Decorates a function such that if it calls itself with the same first
+    argument, it returns `fillvalue` instead of recursing.
+
+    Largely copied from reprlib.recursive_repr
+    """
+
+    def decorating_function(f):
+        repr_running = set()
+
+        @functools.wraps(f)
+        def wrapper(self, *args, **kwargs):
+            key = id(self), get_ident()
+            if key in repr_running:
+                return fillvalue
+            repr_running.add(key)
+            try:
+                return f(self, *args, **kwargs)
+            finally:
+                repr_running.discard(key)
+
+        return wrapper
+
+    return decorating_function
+
+
+# gracefully handle recursive calls, when object arrays contain themselves
+@_recursive_guard()
+def _array2string(a, options, separator=' ', prefix=""):
+    # The formatter __init__s in _get_format_function cannot deal with
+    # subclasses yet, and we also need to avoid recursion issues in
+    # _formatArray with subclasses which return 0d arrays in place of scalars
+    data = asarray(a)
+    if a.shape == ():
+        a = data
+
+    if a.size > options['threshold']:
+        summary_insert = "..."
+        data = _leading_trailing(data, options['edgeitems'])
+    else:
+        summary_insert = ""
+
+    # find the right formatting function for the array
+    format_function = _get_format_function(data, **options)
+
+    # skip over "["
+    next_line_prefix = " "
+    # skip over array(
+    next_line_prefix += " "*len(prefix)
+
+    lst = _formatArray(a, format_function, options['linewidth'],
+                       next_line_prefix, separator, options['edgeitems'],
+                       summary_insert, options['legacy'])
+    return lst
+
+
+def _array2string_dispatcher(
+        a, max_line_width=None, precision=None,
+        suppress_small=None, separator=None, prefix=None,
+        style=None, formatter=None, threshold=None,
+        edgeitems=None, sign=None, floatmode=None, suffix=None,
+        *, legacy=None):
+    return (a,)
+
+
+@array_function_dispatch(_array2string_dispatcher, module='numpy')
+def array2string(a, max_line_width=None, precision=None,
+                 suppress_small=None, separator=' ', prefix="",
+                 style=np._NoValue, formatter=None, threshold=None,
+                 edgeitems=None, sign=None, floatmode=None, suffix="",
+                 *, legacy=None):
+    """
+    Return a string representation of an array.
+
+    Parameters
+    ----------
+    a : ndarray
+        Input array.
+    max_line_width : int, optional
+        Inserts newlines if text is longer than `max_line_width`.
+        Defaults to ``numpy.get_printoptions()['linewidth']``.
+    precision : int or None, optional
+        Floating point precision.
+        Defaults to ``numpy.get_printoptions()['precision']``.
+    suppress_small : bool, optional
+        Represent numbers "very close" to zero as zero; default is False.
+        Very close is defined by precision: if the precision is 8, e.g.,
+        numbers smaller (in absolute value) than 5e-9 are represented as
+        zero.
+        Defaults to ``numpy.get_printoptions()['suppress']``.
+    separator : str, optional
+        Inserted between elements.
+    prefix : str, optional
+    suffix : str, optional
+        The length of the prefix and suffix strings are used to respectively
+        align and wrap the output. An array is typically printed as::
+
+          prefix + array2string(a) + suffix
+
+        The output is left-padded by the length of the prefix string, and
+        wrapping is forced at the column ``max_line_width - len(suffix)``.
+        It should be noted that the content of prefix and suffix strings are
+        not included in the output.
+    style : _NoValue, optional
+        Has no effect, do not use.
+
+        .. deprecated:: 1.14.0
+    formatter : dict of callables, optional
+        If not None, the keys should indicate the type(s) that the respective
+        formatting function applies to.  Callables should return a string.
+        Types that are not specified (by their corresponding keys) are handled
+        by the default formatters.  Individual types for which a formatter
+        can be set are:
+
+        - 'bool'
+        - 'int'
+        - 'timedelta' : a `numpy.timedelta64`
+        - 'datetime' : a `numpy.datetime64`
+        - 'float'
+        - 'longfloat' : 128-bit floats
+        - 'complexfloat'
+        - 'longcomplexfloat' : composed of two 128-bit floats
+        - 'void' : type `numpy.void`
+        - 'numpystr' : types `numpy.bytes_` and `numpy.str_`
+
+        Other keys that can be used to set a group of types at once are:
+
+        - 'all' : sets all types
+        - 'int_kind' : sets 'int'
+        - 'float_kind' : sets 'float' and 'longfloat'
+        - 'complex_kind' : sets 'complexfloat' and 'longcomplexfloat'
+        - 'str_kind' : sets 'numpystr'
+    threshold : int, optional
+        Total number of array elements which trigger summarization
+        rather than full repr.
+        Defaults to ``numpy.get_printoptions()['threshold']``.
+    edgeitems : int, optional
+        Number of array items in summary at beginning and end of
+        each dimension.
+        Defaults to ``numpy.get_printoptions()['edgeitems']``.
+    sign : string, either '-', '+', or ' ', optional
+        Controls printing of the sign of floating-point types. If '+', always
+        print the sign of positive values. If ' ', always prints a space
+        (whitespace character) in the sign position of positive values.  If
+        '-', omit the sign character of positive values.
+        Defaults to ``numpy.get_printoptions()['sign']``.
+    floatmode : str, optional
+        Controls the interpretation of the `precision` option for
+        floating-point types.
+        Defaults to ``numpy.get_printoptions()['floatmode']``.
+        Can take the following values:
+
+        - 'fixed': Always print exactly `precision` fractional digits,
+          even if this would print more or fewer digits than
+          necessary to specify the value uniquely.
+        - 'unique': Print the minimum number of fractional digits necessary
+          to represent each value uniquely. Different elements may
+          have a different number of digits.  The value of the
+          `precision` option is ignored.
+        - 'maxprec': Print at most `precision` fractional digits, but if
+          an element can be uniquely represented with fewer digits
+          only print it with that many.
+        - 'maxprec_equal': Print at most `precision` fractional digits,
+          but if every element in the array can be uniquely
+          represented with an equal number of fewer digits, use that
+          many digits for all elements.
+    legacy : string or `False`, optional
+        If set to the string `'1.13'` enables 1.13 legacy printing mode. This
+        approximates numpy 1.13 print output by including a space in the sign
+        position of floats and different behavior for 0d arrays. If set to
+        `False`, disables legacy mode. Unrecognized strings will be ignored
+        with a warning for forward compatibility.
+
+        .. versionadded:: 1.14.0
+
+    Returns
+    -------
+    array_str : str
+        String representation of the array.
+
+    Raises
+    ------
+    TypeError
+        if a callable in `formatter` does not return a string.
+
+    See Also
+    --------
+    array_str, array_repr, set_printoptions, get_printoptions
+
+    Notes
+    -----
+    If a formatter is specified for a certain type, the `precision` keyword is
+    ignored for that type.
+
+    This is a very flexible function; `array_repr` and `array_str` are using
+    `array2string` internally so keywords with the same name should work
+    identically in all three functions.
+
+    Examples
+    --------
+    >>> x = np.array([1e-16,1,2,3])
+    >>> np.array2string(x, precision=2, separator=',',
+    ...                       suppress_small=True)
+    '[0.,1.,2.,3.]'
+
+    >>> x  = np.arange(3.)
+    >>> np.array2string(x, formatter={'float_kind':lambda x: "%.2f" % x})
+    '[0.00 1.00 2.00]'
+
+    >>> x  = np.arange(3)
+    >>> np.array2string(x, formatter={'int':lambda x: hex(x)})
+    '[0x0 0x1 0x2]'
+
+    """
+
+    overrides = _make_options_dict(precision, threshold, edgeitems,
+                                   max_line_width, suppress_small, None, None,
+                                   sign, formatter, floatmode, legacy)
+    options = _format_options.copy()
+    options.update(overrides)
+
+    if options['legacy'] <= 113:
+        if style is np._NoValue:
+            style = repr
+
+        if a.shape == () and a.dtype.names is None:
+            return style(a.item())
+    elif style is not np._NoValue:
+        # Deprecation 11-9-2017  v1.14
+        warnings.warn("'style' argument is deprecated and no longer functional"
+                      " except in 1.13 'legacy' mode",
+                      DeprecationWarning, stacklevel=2)
+
+    if options['legacy'] > 113:
+        options['linewidth'] -= len(suffix)
+
+    # treat as a null array if any of shape elements == 0
+    if a.size == 0:
+        return "[]"
+
+    return _array2string(a, options, separator, prefix)
+
+
+def _extendLine(s, line, word, line_width, next_line_prefix, legacy):
+    needs_wrap = len(line) + len(word) > line_width
+    if legacy > 113:
+        # don't wrap lines if it won't help
+        if len(line) <= len(next_line_prefix):
+            needs_wrap = False
+
+    if needs_wrap:
+        s += line.rstrip() + "\n"
+        line = next_line_prefix
+    line += word
+    return s, line
+
+
+def _extendLine_pretty(s, line, word, line_width, next_line_prefix, legacy):
+    """
+    Extends line with nicely formatted (possibly multi-line) string ``word``.
+    """
+    words = word.splitlines()
+    if len(words) == 1 or legacy <= 113:
+        return _extendLine(s, line, word, line_width, next_line_prefix, legacy)
+
+    max_word_length = max(len(word) for word in words)
+    if (len(line) + max_word_length > line_width and
+            len(line) > len(next_line_prefix)):
+        s += line.rstrip() + '\n'
+        line = next_line_prefix + words[0]
+        indent = next_line_prefix
+    else:
+        indent = len(line)*' '
+        line += words[0]
+
+    for word in words[1::]:
+        s += line.rstrip() + '\n'
+        line = indent + word
+
+    suffix_length = max_word_length - len(words[-1])
+    line += suffix_length*' '
+
+    return s, line
+
+def _formatArray(a, format_function, line_width, next_line_prefix,
+                 separator, edge_items, summary_insert, legacy):
+    """formatArray is designed for two modes of operation:
+
+    1. Full output
+
+    2. Summarized output
+
+    """
+    def recurser(index, hanging_indent, curr_width):
+        """
+        By using this local function, we don't need to recurse with all the
+        arguments. Since this function is not created recursively, the cost is
+        not significant
+        """
+        axis = len(index)
+        axes_left = a.ndim - axis
+
+        if axes_left == 0:
+            return format_function(a[index])
+
+        # when recursing, add a space to align with the [ added, and reduce the
+        # length of the line by 1
+        next_hanging_indent = hanging_indent + ' '
+        if legacy <= 113:
+            next_width = curr_width
+        else:
+            next_width = curr_width - len(']')
+
+        a_len = a.shape[axis]
+        show_summary = summary_insert and 2*edge_items < a_len
+        if show_summary:
+            leading_items = edge_items
+            trailing_items = edge_items
+        else:
+            leading_items = 0
+            trailing_items = a_len
+
+        # stringify the array with the hanging indent on the first line too
+        s = ''
+
+        # last axis (rows) - wrap elements if they would not fit on one line
+        if axes_left == 1:
+            # the length up until the beginning of the separator / bracket
+            if legacy <= 113:
+                elem_width = curr_width - len(separator.rstrip())
+            else:
+                elem_width = curr_width - max(len(separator.rstrip()), len(']'))
+
+            line = hanging_indent
+            for i in range(leading_items):
+                word = recurser(index + (i,), next_hanging_indent, next_width)
+                s, line = _extendLine_pretty(
+                    s, line, word, elem_width, hanging_indent, legacy)
+                line += separator
+
+            if show_summary:
+                s, line = _extendLine(
+                    s, line, summary_insert, elem_width, hanging_indent, legacy)
+                if legacy <= 113:
+                    line += ", "
+                else:
+                    line += separator
+
+            for i in range(trailing_items, 1, -1):
+                word = recurser(index + (-i,), next_hanging_indent, next_width)
+                s, line = _extendLine_pretty(
+                    s, line, word, elem_width, hanging_indent, legacy)
+                line += separator
+
+            if legacy <= 113:
+                # width of the separator is not considered on 1.13
+                elem_width = curr_width
+            word = recurser(index + (-1,), next_hanging_indent, next_width)
+            s, line = _extendLine_pretty(
+                s, line, word, elem_width, hanging_indent, legacy)
+
+            s += line
+
+        # other axes - insert newlines between rows
+        else:
+            s = ''
+            line_sep = separator.rstrip() + '\n'*(axes_left - 1)
+
+            for i in range(leading_items):
+                nested = recurser(index + (i,), next_hanging_indent, next_width)
+                s += hanging_indent + nested + line_sep
+
+            if show_summary:
+                if legacy <= 113:
+                    # trailing space, fixed nbr of newlines, and fixed separator
+                    s += hanging_indent + summary_insert + ", \n"
+                else:
+                    s += hanging_indent + summary_insert + line_sep
+
+            for i in range(trailing_items, 1, -1):
+                nested = recurser(index + (-i,), next_hanging_indent,
+                                  next_width)
+                s += hanging_indent + nested + line_sep
+
+            nested = recurser(index + (-1,), next_hanging_indent, next_width)
+            s += hanging_indent + nested
+
+        # remove the hanging indent, and wrap in []
+        s = '[' + s[len(hanging_indent):] + ']'
+        return s
+
+    try:
+        # invoke the recursive part with an initial index and prefix
+        return recurser(index=(),
+                        hanging_indent=next_line_prefix,
+                        curr_width=line_width)
+    finally:
+        # recursive closures have a cyclic reference to themselves, which
+        # requires gc to collect (gh-10620). To avoid this problem, for
+        # performance and PyPy friendliness, we break the cycle:
+        recurser = None
+
+def _none_or_positive_arg(x, name):
+    if x is None:
+        return -1
+    if x < 0:
+        raise ValueError("{} must be >= 0".format(name))
+    return x
+
+class FloatingFormat:
+    """ Formatter for subtypes of np.floating """
+    def __init__(self, data, precision, floatmode, suppress_small, sign=False,
+                 *, legacy=None):
+        # for backcompatibility, accept bools
+        if isinstance(sign, bool):
+            sign = '+' if sign else '-'
+
+        self._legacy = legacy
+        if self._legacy <= 113:
+            # when not 0d, legacy does not support '-'
+            if data.shape != () and sign == '-':
+                sign = ' '
+
+        self.floatmode = floatmode
+        if floatmode == 'unique':
+            self.precision = None
+        else:
+            self.precision = precision
+
+        self.precision = _none_or_positive_arg(self.precision, 'precision')
+
+        self.suppress_small = suppress_small
+        self.sign = sign
+        self.exp_format = False
+        self.large_exponent = False
+
+        self.fillFormat(data)
+
+    def fillFormat(self, data):
+        # only the finite values are used to compute the number of digits
+        finite_vals = data[isfinite(data)]
+
+        # choose exponential mode based on the non-zero finite values:
+        abs_non_zero = absolute(finite_vals[finite_vals != 0])
+        if len(abs_non_zero) != 0:
+            max_val = np.max(abs_non_zero)
+            min_val = np.min(abs_non_zero)
+            with errstate(over='ignore'):  # division can overflow
+                if max_val >= 1.e8 or (not self.suppress_small and
+                        (min_val < 0.0001 or max_val/min_val > 1000.)):
+                    self.exp_format = True
+
+        # do a first pass of printing all the numbers, to determine sizes
+        if len(finite_vals) == 0:
+            self.pad_left = 0
+            self.pad_right = 0
+            self.trim = '.'
+            self.exp_size = -1
+            self.unique = True
+            self.min_digits = None
+        elif self.exp_format:
+            trim, unique = '.', True
+            if self.floatmode == 'fixed' or self._legacy <= 113:
+                trim, unique = 'k', False
+            strs = (dragon4_scientific(x, precision=self.precision,
+                               unique=unique, trim=trim, sign=self.sign == '+')
+                    for x in finite_vals)
+            frac_strs, _, exp_strs = zip(*(s.partition('e') for s in strs))
+            int_part, frac_part = zip(*(s.split('.') for s in frac_strs))
+            self.exp_size = max(len(s) for s in exp_strs) - 1
+
+            self.trim = 'k'
+            self.precision = max(len(s) for s in frac_part)
+            self.min_digits = self.precision
+            self.unique = unique
+
+            # for back-compat with np 1.13, use 2 spaces & sign and full prec
+            if self._legacy <= 113:
+                self.pad_left = 3
+            else:
+                # this should be only 1 or 2. Can be calculated from sign.
+                self.pad_left = max(len(s) for s in int_part)
+            # pad_right is only needed for nan length calculation
+            self.pad_right = self.exp_size + 2 + self.precision
+        else:
+            trim, unique = '.', True
+            if self.floatmode == 'fixed':
+                trim, unique = 'k', False
+            strs = (dragon4_positional(x, precision=self.precision,
+                                       fractional=True,
+                                       unique=unique, trim=trim,
+                                       sign=self.sign == '+')
+                    for x in finite_vals)
+            int_part, frac_part = zip(*(s.split('.') for s in strs))
+            if self._legacy <= 113:
+                self.pad_left = 1 + max(len(s.lstrip('-+')) for s in int_part)
+            else:
+                self.pad_left = max(len(s) for s in int_part)
+            self.pad_right = max(len(s) for s in frac_part)
+            self.exp_size = -1
+            self.unique = unique
+
+            if self.floatmode in ['fixed', 'maxprec_equal']:
+                self.precision = self.min_digits = self.pad_right
+                self.trim = 'k'
+            else:
+                self.trim = '.'
+                self.min_digits = 0
+
+        if self._legacy > 113:
+            # account for sign = ' ' by adding one to pad_left
+            if self.sign == ' ' and not any(np.signbit(finite_vals)):
+                self.pad_left += 1
+
+        # if there are non-finite values, may need to increase pad_left
+        if data.size != finite_vals.size:
+            neginf = self.sign != '-' or any(data[isinf(data)] < 0)
+            nanlen = len(_format_options['nanstr'])
+            inflen = len(_format_options['infstr']) + neginf
+            offset = self.pad_right + 1  # +1 for decimal pt
+            self.pad_left = max(self.pad_left, nanlen - offset, inflen - offset)
+
+    def __call__(self, x):
+        if not np.isfinite(x):
+            with errstate(invalid='ignore'):
+                if np.isnan(x):
+                    sign = '+' if self.sign == '+' else ''
+                    ret = sign + _format_options['nanstr']
+                else:  # isinf
+                    sign = '-' if x < 0 else '+' if self.sign == '+' else ''
+                    ret = sign + _format_options['infstr']
+                return ' '*(self.pad_left + self.pad_right + 1 - len(ret)) + ret
+
+        if self.exp_format:
+            return dragon4_scientific(x,
+                                      precision=self.precision,
+                                      min_digits=self.min_digits,
+                                      unique=self.unique,
+                                      trim=self.trim,
+                                      sign=self.sign == '+',
+                                      pad_left=self.pad_left,
+                                      exp_digits=self.exp_size)
+        else:
+            return dragon4_positional(x,
+                                      precision=self.precision,
+                                      min_digits=self.min_digits,
+                                      unique=self.unique,
+                                      fractional=True,
+                                      trim=self.trim,
+                                      sign=self.sign == '+',
+                                      pad_left=self.pad_left,
+                                      pad_right=self.pad_right)
+
+
+@set_module('numpy')
+def format_float_scientific(x, precision=None, unique=True, trim='k',
+                            sign=False, pad_left=None, exp_digits=None,
+                            min_digits=None):
+    """
+    Format a floating-point scalar as a decimal string in scientific notation.
+
+    Provides control over rounding, trimming and padding. Uses and assumes
+    IEEE unbiased rounding. Uses the "Dragon4" algorithm.
+
+    Parameters
+    ----------
+    x : python float or numpy floating scalar
+        Value to format.
+    precision : non-negative integer or None, optional
+        Maximum number of digits to print. May be None if `unique` is
+        `True`, but must be an integer if unique is `False`.
+    unique : boolean, optional
+        If `True`, use a digit-generation strategy which gives the shortest
+        representation which uniquely identifies the floating-point number from
+        other values of the same type, by judicious rounding. If `precision`
+        is given fewer digits than necessary can be printed. If `min_digits`
+        is given more can be printed, in which cases the last digit is rounded
+        with unbiased rounding.
+        If `False`, digits are generated as if printing an infinite-precision
+        value and stopping after `precision` digits, rounding the remaining
+        value with unbiased rounding
+    trim : one of 'k', '.', '0', '-', optional
+        Controls post-processing trimming of trailing digits, as follows:
+
+        * 'k' : keep trailing zeros, keep decimal point (no trimming)
+        * '.' : trim all trailing zeros, leave decimal point
+        * '0' : trim all but the zero before the decimal point. Insert the
+          zero if it is missing.
+        * '-' : trim trailing zeros and any trailing decimal point
+    sign : boolean, optional
+        Whether to show the sign for positive values.
+    pad_left : non-negative integer, optional
+        Pad the left side of the string with whitespace until at least that
+        many characters are to the left of the decimal point.
+    exp_digits : non-negative integer, optional
+        Pad the exponent with zeros until it contains at least this many digits.
+        If omitted, the exponent will be at least 2 digits.
+    min_digits : non-negative integer or None, optional
+        Minimum number of digits to print. This only has an effect for
+        `unique=True`. In that case more digits than necessary to uniquely
+        identify the value may be printed and rounded unbiased.
+
+        -- versionadded:: 1.21.0
+
+    Returns
+    -------
+    rep : string
+        The string representation of the floating point value
+
+    See Also
+    --------
+    format_float_positional
+
+    Examples
+    --------
+    >>> np.format_float_scientific(np.float32(np.pi))
+    '3.1415927e+00'
+    >>> s = np.float32(1.23e24)
+    >>> np.format_float_scientific(s, unique=False, precision=15)
+    '1.230000071797338e+24'
+    >>> np.format_float_scientific(s, exp_digits=4)
+    '1.23e+0024'
+    """
+    precision = _none_or_positive_arg(precision, 'precision')
+    pad_left = _none_or_positive_arg(pad_left, 'pad_left')
+    exp_digits = _none_or_positive_arg(exp_digits, 'exp_digits')
+    min_digits = _none_or_positive_arg(min_digits, 'min_digits')
+    if min_digits > 0 and precision > 0 and min_digits > precision:
+        raise ValueError("min_digits must be less than or equal to precision")
+    return dragon4_scientific(x, precision=precision, unique=unique,
+                              trim=trim, sign=sign, pad_left=pad_left,
+                              exp_digits=exp_digits, min_digits=min_digits)
+
+
+@set_module('numpy')
+def format_float_positional(x, precision=None, unique=True,
+                            fractional=True, trim='k', sign=False,
+                            pad_left=None, pad_right=None, min_digits=None):
+    """
+    Format a floating-point scalar as a decimal string in positional notation.
+
+    Provides control over rounding, trimming and padding. Uses and assumes
+    IEEE unbiased rounding. Uses the "Dragon4" algorithm.
+
+    Parameters
+    ----------
+    x : python float or numpy floating scalar
+        Value to format.
+    precision : non-negative integer or None, optional
+        Maximum number of digits to print. May be None if `unique` is
+        `True`, but must be an integer if unique is `False`.
+    unique : boolean, optional
+        If `True`, use a digit-generation strategy which gives the shortest
+        representation which uniquely identifies the floating-point number from
+        other values of the same type, by judicious rounding. If `precision`
+        is given fewer digits than necessary can be printed, or if `min_digits`
+        is given more can be printed, in which cases the last digit is rounded
+        with unbiased rounding.
+        If `False`, digits are generated as if printing an infinite-precision
+        value and stopping after `precision` digits, rounding the remaining
+        value with unbiased rounding
+    fractional : boolean, optional
+        If `True`, the cutoffs of `precision` and `min_digits` refer to the
+        total number of digits after the decimal point, including leading
+        zeros.
+        If `False`, `precision` and `min_digits` refer to the total number of
+        significant digits, before or after the decimal point, ignoring leading
+        zeros.
+    trim : one of 'k', '.', '0', '-', optional
+        Controls post-processing trimming of trailing digits, as follows:
+
+        * 'k' : keep trailing zeros, keep decimal point (no trimming)
+        * '.' : trim all trailing zeros, leave decimal point
+        * '0' : trim all but the zero before the decimal point. Insert the
+          zero if it is missing.
+        * '-' : trim trailing zeros and any trailing decimal point
+    sign : boolean, optional
+        Whether to show the sign for positive values.
+    pad_left : non-negative integer, optional
+        Pad the left side of the string with whitespace until at least that
+        many characters are to the left of the decimal point.
+    pad_right : non-negative integer, optional
+        Pad the right side of the string with whitespace until at least that
+        many characters are to the right of the decimal point.
+    min_digits : non-negative integer or None, optional
+        Minimum number of digits to print. Only has an effect if `unique=True`
+        in which case additional digits past those necessary to uniquely
+        identify the value may be printed, rounding the last additional digit.
+
+        -- versionadded:: 1.21.0
+
+    Returns
+    -------
+    rep : string
+        The string representation of the floating point value
+
+    See Also
+    --------
+    format_float_scientific
+
+    Examples
+    --------
+    >>> np.format_float_positional(np.float32(np.pi))
+    '3.1415927'
+    >>> np.format_float_positional(np.float16(np.pi))
+    '3.14'
+    >>> np.format_float_positional(np.float16(0.3))
+    '0.3'
+    >>> np.format_float_positional(np.float16(0.3), unique=False, precision=10)
+    '0.3000488281'
+    """
+    precision = _none_or_positive_arg(precision, 'precision')
+    pad_left = _none_or_positive_arg(pad_left, 'pad_left')
+    pad_right = _none_or_positive_arg(pad_right, 'pad_right')
+    min_digits = _none_or_positive_arg(min_digits, 'min_digits')
+    if not fractional and precision == 0:
+        raise ValueError("precision must be greater than 0 if "
+                         "fractional=False")
+    if min_digits > 0 and precision > 0 and min_digits > precision:
+        raise ValueError("min_digits must be less than or equal to precision")
+    return dragon4_positional(x, precision=precision, unique=unique,
+                              fractional=fractional, trim=trim,
+                              sign=sign, pad_left=pad_left,
+                              pad_right=pad_right, min_digits=min_digits)
+
+
+class IntegerFormat:
+    def __init__(self, data):
+        if data.size > 0:
+            max_str_len = max(len(str(np.max(data))),
+                              len(str(np.min(data))))
+        else:
+            max_str_len = 0
+        self.format = '%{}d'.format(max_str_len)
+
+    def __call__(self, x):
+        return self.format % x
+
+
+class BoolFormat:
+    def __init__(self, data, **kwargs):
+        # add an extra space so " True" and "False" have the same length and
+        # array elements align nicely when printed, except in 0d arrays
+        self.truestr = ' True' if data.shape != () else 'True'
+
+    def __call__(self, x):
+        return self.truestr if x else "False"
+
+
+class ComplexFloatingFormat:
+    """ Formatter for subtypes of np.complexfloating """
+    def __init__(self, x, precision, floatmode, suppress_small,
+                 sign=False, *, legacy=None):
+        # for backcompatibility, accept bools
+        if isinstance(sign, bool):
+            sign = '+' if sign else '-'
+
+        floatmode_real = floatmode_imag = floatmode
+        if legacy <= 113:
+            floatmode_real = 'maxprec_equal'
+            floatmode_imag = 'maxprec'
+
+        self.real_format = FloatingFormat(
+            x.real, precision, floatmode_real, suppress_small,
+            sign=sign, legacy=legacy
+        )
+        self.imag_format = FloatingFormat(
+            x.imag, precision, floatmode_imag, suppress_small,
+            sign='+', legacy=legacy
+        )
+
+    def __call__(self, x):
+        r = self.real_format(x.real)
+        i = self.imag_format(x.imag)
+
+        # add the 'j' before the terminal whitespace in i
+        sp = len(i.rstrip())
+        i = i[:sp] + 'j' + i[sp:]
+
+        return r + i
+
+
+class _TimelikeFormat:
+    def __init__(self, data):
+        non_nat = data[~isnat(data)]
+        if len(non_nat) > 0:
+            # Max str length of non-NaT elements
+            max_str_len = max(len(self._format_non_nat(np.max(non_nat))),
+                              len(self._format_non_nat(np.min(non_nat))))
+        else:
+            max_str_len = 0
+        if len(non_nat) < data.size:
+            # data contains a NaT
+            max_str_len = max(max_str_len, 5)
+        self._format = '%{}s'.format(max_str_len)
+        self._nat = "'NaT'".rjust(max_str_len)
+
+    def _format_non_nat(self, x):
+        # override in subclass
+        raise NotImplementedError
+
+    def __call__(self, x):
+        if isnat(x):
+            return self._nat
+        else:
+            return self._format % self._format_non_nat(x)
+
+
+class DatetimeFormat(_TimelikeFormat):
+    def __init__(self, x, unit=None, timezone=None, casting='same_kind',
+                 legacy=False):
+        # Get the unit from the dtype
+        if unit is None:
+            if x.dtype.kind == 'M':
+                unit = datetime_data(x.dtype)[0]
+            else:
+                unit = 's'
+
+        if timezone is None:
+            timezone = 'naive'
+        self.timezone = timezone
+        self.unit = unit
+        self.casting = casting
+        self.legacy = legacy
+
+        # must be called after the above are configured
+        super().__init__(x)
+
+    def __call__(self, x):
+        if self.legacy <= 113:
+            return self._format_non_nat(x)
+        return super().__call__(x)
+
+    def _format_non_nat(self, x):
+        return "'%s'" % datetime_as_string(x,
+                                    unit=self.unit,
+                                    timezone=self.timezone,
+                                    casting=self.casting)
+
+
+class TimedeltaFormat(_TimelikeFormat):
+    def _format_non_nat(self, x):
+        return str(x.astype('i8'))
+
+
+class SubArrayFormat:
+    def __init__(self, format_function, **options):
+        self.format_function = format_function
+        self.threshold = options['threshold']
+        self.edge_items = options['edgeitems']
+
+    def __call__(self, a):
+        self.summary_insert = "..." if a.size > self.threshold else ""
+        return self.format_array(a)
+
+    def format_array(self, a):
+        if np.ndim(a) == 0:
+            return self.format_function(a)
+
+        if self.summary_insert and a.shape[0] > 2*self.edge_items:
+            formatted = (
+                [self.format_array(a_) for a_ in a[:self.edge_items]]
+                + [self.summary_insert]
+                + [self.format_array(a_) for a_ in a[-self.edge_items:]]
+            )
+        else:
+            formatted = [self.format_array(a_) for a_ in a]
+
+        return "[" + ", ".join(formatted) + "]"
+
+
+class StructuredVoidFormat:
+    """
+    Formatter for structured np.void objects.
+
+    This does not work on structured alias types like np.dtype(('i4', 'i2,i2')),
+    as alias scalars lose their field information, and the implementation
+    relies upon np.void.__getitem__.
+    """
+    def __init__(self, format_functions):
+        self.format_functions = format_functions
+
+    @classmethod
+    def from_data(cls, data, **options):
+        """
+        This is a second way to initialize StructuredVoidFormat, using the raw data
+        as input. Added to avoid changing the signature of __init__.
+        """
+        format_functions = []
+        for field_name in data.dtype.names:
+            format_function = _get_format_function(data[field_name], **options)
+            if data.dtype[field_name].shape != ():
+                format_function = SubArrayFormat(format_function, **options)
+            format_functions.append(format_function)
+        return cls(format_functions)
+
+    def __call__(self, x):
+        str_fields = [
+            format_function(field)
+            for field, format_function in zip(x, self.format_functions)
+        ]
+        if len(str_fields) == 1:
+            return "({},)".format(str_fields[0])
+        else:
+            return "({})".format(", ".join(str_fields))
+
+
+def _void_scalar_repr(x):
+    """
+    Implements the repr for structured-void scalars. It is called from the
+    scalartypes.c.src code, and is placed here because it uses the elementwise
+    formatters defined above.
+    """
+    return StructuredVoidFormat.from_data(array(x), **_format_options)(x)
+
+
+_typelessdata = [int_, float_, complex_, bool_]
+
+
+def dtype_is_implied(dtype):
+    """
+    Determine if the given dtype is implied by the representation of its values.
+
+    Parameters
+    ----------
+    dtype : dtype
+        Data type
+
+    Returns
+    -------
+    implied : bool
+        True if the dtype is implied by the representation of its values.
+
+    Examples
+    --------
+    >>> np.core.arrayprint.dtype_is_implied(int)
+    True
+    >>> np.array([1, 2, 3], int)
+    array([1, 2, 3])
+    >>> np.core.arrayprint.dtype_is_implied(np.int8)
+    False
+    >>> np.array([1, 2, 3], np.int8)
+    array([1, 2, 3], dtype=int8)
+    """
+    dtype = np.dtype(dtype)
+    if _format_options['legacy'] <= 113 and dtype.type == bool_:
+        return False
+
+    # not just void types can be structured, and names are not part of the repr
+    if dtype.names is not None:
+        return False
+
+    # should care about endianness *unless size is 1* (e.g., int8, bool)
+    if not dtype.isnative:
+        return False
+
+    return dtype.type in _typelessdata
+
+
+def dtype_short_repr(dtype):
+    """
+    Convert a dtype to a short form which evaluates to the same dtype.
+
+    The intent is roughly that the following holds
+
+    >>> from numpy import *
+    >>> dt = np.int64([1, 2]).dtype
+    >>> assert eval(dtype_short_repr(dt)) == dt
+    """
+    if type(dtype).__repr__ != np.dtype.__repr__:
+        # TODO: Custom repr for user DTypes, logic should likely move.
+        return repr(dtype)
+    if dtype.names is not None:
+        # structured dtypes give a list or tuple repr
+        return str(dtype)
+    elif issubclass(dtype.type, flexible):
+        # handle these separately so they don't give garbage like str256
+        return "'%s'" % str(dtype)
+
+    typename = dtype.name
+    if not dtype.isnative:
+        # deal with cases like dtype('<u2') that are identical to an
+        # established dtype (in this case uint16)
+        # except that they have a different endianness.
+        return "'%s'" % str(dtype)
+    # quote typenames which can't be represented as python variable names
+    if typename and not (typename[0].isalpha() and typename.isalnum()):
+        typename = repr(typename)
+    return typename
+
+
+def _array_repr_implementation(
+        arr, max_line_width=None, precision=None, suppress_small=None,
+        array2string=array2string):
+    """Internal version of array_repr() that allows overriding array2string."""
+    if max_line_width is None:
+        max_line_width = _format_options['linewidth']
+
+    if type(arr) is not ndarray:
+        class_name = type(arr).__name__
+    else:
+        class_name = "array"
+
+    skipdtype = dtype_is_implied(arr.dtype) and arr.size > 0
+
+    prefix = class_name + "("
+    suffix = ")" if skipdtype else ","
+
+    if (_format_options['legacy'] <= 113 and
+            arr.shape == () and not arr.dtype.names):
+        lst = repr(arr.item())
+    elif arr.size > 0 or arr.shape == (0,):
+        lst = array2string(arr, max_line_width, precision, suppress_small,
+                           ', ', prefix, suffix=suffix)
+    else:  # show zero-length shape unless it is (0,)
+        lst = "[], shape=%s" % (repr(arr.shape),)
+
+    arr_str = prefix + lst + suffix
+
+    if skipdtype:
+        return arr_str
+
+    dtype_str = "dtype={})".format(dtype_short_repr(arr.dtype))
+
+    # compute whether we should put dtype on a new line: Do so if adding the
+    # dtype would extend the last line past max_line_width.
+    # Note: This line gives the correct result even when rfind returns -1.
+    last_line_len = len(arr_str) - (arr_str.rfind('\n') + 1)
+    spacer = " "
+    if _format_options['legacy'] <= 113:
+        if issubclass(arr.dtype.type, flexible):
+            spacer = '\n' + ' '*len(class_name + "(")
+    elif last_line_len + len(dtype_str) + 1 > max_line_width:
+        spacer = '\n' + ' '*len(class_name + "(")
+
+    return arr_str + spacer + dtype_str
+
+
+def _array_repr_dispatcher(
+        arr, max_line_width=None, precision=None, suppress_small=None):
+    return (arr,)
+
+
+@array_function_dispatch(_array_repr_dispatcher, module='numpy')
+def array_repr(arr, max_line_width=None, precision=None, suppress_small=None):
+    """
+    Return the string representation of an array.
+
+    Parameters
+    ----------
+    arr : ndarray
+        Input array.
+    max_line_width : int, optional
+        Inserts newlines if text is longer than `max_line_width`.
+        Defaults to ``numpy.get_printoptions()['linewidth']``.
+    precision : int, optional
+        Floating point precision.
+        Defaults to ``numpy.get_printoptions()['precision']``.
+    suppress_small : bool, optional
+        Represent numbers "very close" to zero as zero; default is False.
+        Very close is defined by precision: if the precision is 8, e.g.,
+        numbers smaller (in absolute value) than 5e-9 are represented as
+        zero.
+        Defaults to ``numpy.get_printoptions()['suppress']``.
+
+    Returns
+    -------
+    string : str
+      The string representation of an array.
+
+    See Also
+    --------
+    array_str, array2string, set_printoptions
+
+    Examples
+    --------
+    >>> np.array_repr(np.array([1,2]))
+    'array([1, 2])'
+    >>> np.array_repr(np.ma.array([0.]))
+    'MaskedArray([0.])'
+    >>> np.array_repr(np.array([], np.int32))
+    'array([], dtype=int32)'
+
+    >>> x = np.array([1e-6, 4e-7, 2, 3])
+    >>> np.array_repr(x, precision=6, suppress_small=True)
+    'array([0.000001,  0.      ,  2.      ,  3.      ])'
+
+    """
+    return _array_repr_implementation(
+        arr, max_line_width, precision, suppress_small)
+
+
+@_recursive_guard()
+def _guarded_repr_or_str(v):
+    if isinstance(v, bytes):
+        return repr(v)
+    return str(v)
+
+
+def _array_str_implementation(
+        a, max_line_width=None, precision=None, suppress_small=None,
+        array2string=array2string):
+    """Internal version of array_str() that allows overriding array2string."""
+    if (_format_options['legacy'] <= 113 and
+            a.shape == () and not a.dtype.names):
+        return str(a.item())
+
+    # the str of 0d arrays is a special case: It should appear like a scalar,
+    # so floats are not truncated by `precision`, and strings are not wrapped
+    # in quotes. So we return the str of the scalar value.
+    if a.shape == ():
+        # obtain a scalar and call str on it, avoiding problems for subclasses
+        # for which indexing with () returns a 0d instead of a scalar by using
+        # ndarray's getindex. Also guard against recursive 0d object arrays.
+        return _guarded_repr_or_str(np.ndarray.__getitem__(a, ()))
+
+    return array2string(a, max_line_width, precision, suppress_small, ' ', "")
+
+
+def _array_str_dispatcher(
+        a, max_line_width=None, precision=None, suppress_small=None):
+    return (a,)
+
+
+@array_function_dispatch(_array_str_dispatcher, module='numpy')
+def array_str(a, max_line_width=None, precision=None, suppress_small=None):
+    """
+    Return a string representation of the data in an array.
+
+    The data in the array is returned as a single string.  This function is
+    similar to `array_repr`, the difference being that `array_repr` also
+    returns information on the kind of array and its data type.
+
+    Parameters
+    ----------
+    a : ndarray
+        Input array.
+    max_line_width : int, optional
+        Inserts newlines if text is longer than `max_line_width`.
+        Defaults to ``numpy.get_printoptions()['linewidth']``.
+    precision : int, optional
+        Floating point precision.
+        Defaults to ``numpy.get_printoptions()['precision']``.
+    suppress_small : bool, optional
+        Represent numbers "very close" to zero as zero; default is False.
+        Very close is defined by precision: if the precision is 8, e.g.,
+        numbers smaller (in absolute value) than 5e-9 are represented as
+        zero.
+        Defaults to ``numpy.get_printoptions()['suppress']``.
+
+    See Also
+    --------
+    array2string, array_repr, set_printoptions
+
+    Examples
+    --------
+    >>> np.array_str(np.arange(3))
+    '[0 1 2]'
+
+    """
+    return _array_str_implementation(
+        a, max_line_width, precision, suppress_small)
+
+
+# needed if __array_function__ is disabled
+_array2string_impl = getattr(array2string, '__wrapped__', array2string)
+_default_array_str = functools.partial(_array_str_implementation,
+                                       array2string=_array2string_impl)
+_default_array_repr = functools.partial(_array_repr_implementation,
+                                        array2string=_array2string_impl)
+
+
+def set_string_function(f, repr=True):
+    """
+    Set a Python function to be used when pretty printing arrays.
+
+    Parameters
+    ----------
+    f : function or None
+        Function to be used to pretty print arrays. The function should expect
+        a single array argument and return a string of the representation of
+        the array. If None, the function is reset to the default NumPy function
+        to print arrays.
+    repr : bool, optional
+        If True (default), the function for pretty printing (``__repr__``)
+        is set, if False the function that returns the default string
+        representation (``__str__``) is set.
+
+    See Also
+    --------
+    set_printoptions, get_printoptions
+
+    Examples
+    --------
+    >>> def pprint(arr):
+    ...     return 'HA! - What are you going to do now?'
+    ...
+    >>> np.set_string_function(pprint)
+    >>> a = np.arange(10)
+    >>> a
+    HA! - What are you going to do now?
+    >>> _ = a
+    >>> # [0 1 2 3 4 5 6 7 8 9]
+
+    We can reset the function to the default:
+
+    >>> np.set_string_function(None)
+    >>> a
+    array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9])
+
+    `repr` affects either pretty printing or normal string representation.
+    Note that ``__repr__`` is still affected by setting ``__str__``
+    because the width of each array element in the returned string becomes
+    equal to the length of the result of ``__str__()``.
+
+    >>> x = np.arange(4)
+    >>> np.set_string_function(lambda x:'random', repr=False)
+    >>> x.__str__()
+    'random'
+    >>> x.__repr__()
+    'array([0, 1, 2, 3])'
+
+    """
+    if f is None:
+        if repr:
+            return multiarray.set_string_function(_default_array_repr, 1)
+        else:
+            return multiarray.set_string_function(_default_array_str, 0)
+    else:
+        return multiarray.set_string_function(f, repr)

env-llmeval/lib/python3.10/site-packages/numpy/core/defchararray.pyi

@@ -0,0 +1,421 @@
+from typing import (
+    Literal as L,
+    overload,
+    TypeVar,
+    Any,
+)
+
+from numpy import (
+    chararray as chararray,
+    dtype,
+    str_,
+    bytes_,
+    int_,
+    bool_,
+    object_,
+    _OrderKACF,
+)
+
+from numpy._typing import (
+    NDArray,
+    _ArrayLikeStr_co as U_co,
+    _ArrayLikeBytes_co as S_co,
+    _ArrayLikeInt_co as i_co,
+    _ArrayLikeBool_co as b_co,
+)
+
+from numpy.core.multiarray import compare_chararrays as compare_chararrays
+
+_SCT = TypeVar("_SCT", str_, bytes_)
+_CharArray = chararray[Any, dtype[_SCT]]
+
+__all__: list[str]
+
+# Comparison
+@overload
+def equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def not_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def not_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def greater_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def greater_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def less_equal(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def less_equal(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def greater(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def greater(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+@overload
+def less(x1: U_co, x2: U_co) -> NDArray[bool_]: ...
+@overload
+def less(x1: S_co, x2: S_co) -> NDArray[bool_]: ...
+
+# String operations
+@overload
+def add(x1: U_co, x2: U_co) -> NDArray[str_]: ...
+@overload
+def add(x1: S_co, x2: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def multiply(a: U_co, i: i_co) -> NDArray[str_]: ...
+@overload
+def multiply(a: S_co, i: i_co) -> NDArray[bytes_]: ...
+
+@overload
+def mod(a: U_co, value: Any) -> NDArray[str_]: ...
+@overload
+def mod(a: S_co, value: Any) -> NDArray[bytes_]: ...
+
+@overload
+def capitalize(a: U_co) -> NDArray[str_]: ...
+@overload
+def capitalize(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def center(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ...
+@overload
+def center(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ...
+
+def decode(
+    a: S_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[str_]: ...
+
+def encode(
+    a: U_co,
+    encoding: None | str = ...,
+    errors: None | str = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def expandtabs(a: U_co, tabsize: i_co = ...) -> NDArray[str_]: ...
+@overload
+def expandtabs(a: S_co, tabsize: i_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def join(sep: U_co, seq: U_co) -> NDArray[str_]: ...
+@overload
+def join(sep: S_co, seq: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def ljust(a: U_co, width: i_co, fillchar: U_co = ...) -> NDArray[str_]: ...
+@overload
+def ljust(a: S_co, width: i_co, fillchar: S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def lower(a: U_co) -> NDArray[str_]: ...
+@overload
+def lower(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def lstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def lstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def partition(a: U_co, sep: U_co) -> NDArray[str_]: ...
+@overload
+def partition(a: S_co, sep: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def replace(
+    a: U_co,
+    old: U_co,
+    new: U_co,
+    count: None | i_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def replace(
+    a: S_co,
+    old: S_co,
+    new: S_co,
+    count: None | i_co = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def rjust(
+    a: U_co,
+    width: i_co,
+    fillchar: U_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def rjust(
+    a: S_co,
+    width: i_co,
+    fillchar: S_co = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def rpartition(a: U_co, sep: U_co) -> NDArray[str_]: ...
+@overload
+def rpartition(a: S_co, sep: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def rsplit(
+    a: U_co,
+    sep: None | U_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def rsplit(
+    a: S_co,
+    sep: None | S_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def rstrip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def rstrip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def split(
+    a: U_co,
+    sep: None | U_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+@overload
+def split(
+    a: S_co,
+    sep: None | S_co = ...,
+    maxsplit: None | i_co = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def splitlines(a: U_co, keepends: None | b_co = ...) -> NDArray[object_]: ...
+@overload
+def splitlines(a: S_co, keepends: None | b_co = ...) -> NDArray[object_]: ...
+
+@overload
+def strip(a: U_co, chars: None | U_co = ...) -> NDArray[str_]: ...
+@overload
+def strip(a: S_co, chars: None | S_co = ...) -> NDArray[bytes_]: ...
+
+@overload
+def swapcase(a: U_co) -> NDArray[str_]: ...
+@overload
+def swapcase(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def title(a: U_co) -> NDArray[str_]: ...
+@overload
+def title(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def translate(
+    a: U_co,
+    table: U_co,
+    deletechars: None | U_co = ...,
+) -> NDArray[str_]: ...
+@overload
+def translate(
+    a: S_co,
+    table: S_co,
+    deletechars: None | S_co = ...,
+) -> NDArray[bytes_]: ...
+
+@overload
+def upper(a: U_co) -> NDArray[str_]: ...
+@overload
+def upper(a: S_co) -> NDArray[bytes_]: ...
+
+@overload
+def zfill(a: U_co, width: i_co) -> NDArray[str_]: ...
+@overload
+def zfill(a: S_co, width: i_co) -> NDArray[bytes_]: ...
+
+# String information
+@overload
+def count(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def count(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def endswith(
+    a: U_co,
+    suffix: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+@overload
+def endswith(
+    a: S_co,
+    suffix: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+
+@overload
+def find(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def find(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def index(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def index(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+def isalpha(a: U_co | S_co) -> NDArray[bool_]: ...
+def isalnum(a: U_co | S_co) -> NDArray[bool_]: ...
+def isdecimal(a: U_co | S_co) -> NDArray[bool_]: ...
+def isdigit(a: U_co | S_co) -> NDArray[bool_]: ...
+def islower(a: U_co | S_co) -> NDArray[bool_]: ...
+def isnumeric(a: U_co | S_co) -> NDArray[bool_]: ...
+def isspace(a: U_co | S_co) -> NDArray[bool_]: ...
+def istitle(a: U_co | S_co) -> NDArray[bool_]: ...
+def isupper(a: U_co | S_co) -> NDArray[bool_]: ...
+
+@overload
+def rfind(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rfind(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def rindex(
+    a: U_co,
+    sub: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+@overload
+def rindex(
+    a: S_co,
+    sub: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[int_]: ...
+
+@overload
+def startswith(
+    a: U_co,
+    prefix: U_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+@overload
+def startswith(
+    a: S_co,
+    prefix: S_co,
+    start: i_co = ...,
+    end: None | i_co = ...,
+) -> NDArray[bool_]: ...
+
+def str_len(A: U_co | S_co) -> NDArray[int_]: ...
+
+# Overload 1 and 2: str- or bytes-based array-likes
+# overload 3: arbitrary object with unicode=False  (-> bytes_)
+# overload 4: arbitrary object with unicode=True  (-> str_)
+@overload
+def array(
+    obj: U_co,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+@overload
+def array(
+    obj: S_co,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def array(
+    obj: object,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def array(
+    obj: object,
+    itemsize: None | int = ...,
+    copy: bool = ...,
+    unicode: L[True] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+
+@overload
+def asarray(
+    obj: U_co,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...
+@overload
+def asarray(
+    obj: S_co,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def asarray(
+    obj: object,
+    itemsize: None | int = ...,
+    unicode: L[False] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[bytes_]: ...
+@overload
+def asarray(
+    obj: object,
+    itemsize: None | int = ...,
+    unicode: L[True] = ...,
+    order: _OrderKACF = ...,
+) -> _CharArray[str_]: ...

env-llmeval/lib/python3.10/site-packages/numpy/core/einsumfunc.py

@@ -0,0 +1,1443 @@
+"""
+Implementation of optimized einsum.
+
+"""
+import itertools
+import operator
+
+from numpy.core.multiarray import c_einsum
+from numpy.core.numeric import asanyarray, tensordot
+from numpy.core.overrides import array_function_dispatch
+
+__all__ = ['einsum', 'einsum_path']
+
+einsum_symbols = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ'
+einsum_symbols_set = set(einsum_symbols)
+
+
+def _flop_count(idx_contraction, inner, num_terms, size_dictionary):
+    """
+    Computes the number of FLOPS in the contraction.
+
+    Parameters
+    ----------
+    idx_contraction : iterable
+        The indices involved in the contraction
+    inner : bool
+        Does this contraction require an inner product?
+    num_terms : int
+        The number of terms in a contraction
+    size_dictionary : dict
+        The size of each of the indices in idx_contraction
+
+    Returns
+    -------
+    flop_count : int
+        The total number of FLOPS required for the contraction.
+
+    Examples
+    --------
+
+    >>> _flop_count('abc', False, 1, {'a': 2, 'b':3, 'c':5})
+    30
+
+    >>> _flop_count('abc', True, 2, {'a': 2, 'b':3, 'c':5})
+    60
+
+    """
+
+    overall_size = _compute_size_by_dict(idx_contraction, size_dictionary)
+    op_factor = max(1, num_terms - 1)
+    if inner:
+        op_factor += 1
+
+    return overall_size * op_factor
+
+def _compute_size_by_dict(indices, idx_dict):
+    """
+    Computes the product of the elements in indices based on the dictionary
+    idx_dict.
+
+    Parameters
+    ----------
+    indices : iterable
+        Indices to base the product on.
+    idx_dict : dictionary
+        Dictionary of index sizes
+
+    Returns
+    -------
+    ret : int
+        The resulting product.
+
+    Examples
+    --------
+    >>> _compute_size_by_dict('abbc', {'a': 2, 'b':3, 'c':5})
+    90
+
+    """
+    ret = 1
+    for i in indices:
+        ret *= idx_dict[i]
+    return ret
+
+
+def _find_contraction(positions, input_sets, output_set):
+    """
+    Finds the contraction for a given set of input and output sets.
+
+    Parameters
+    ----------
+    positions : iterable
+        Integer positions of terms used in the contraction.
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+
+    Returns
+    -------
+    new_result : set
+        The indices of the resulting contraction
+    remaining : list
+        List of sets that have not been contracted, the new set is appended to
+        the end of this list
+    idx_removed : set
+        Indices removed from the entire contraction
+    idx_contraction : set
+        The indices used in the current contraction
+
+    Examples
+    --------
+
+    # A simple dot product test case
+    >>> pos = (0, 1)
+    >>> isets = [set('ab'), set('bc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}], {'b'}, {'a', 'b', 'c'})
+
+    # A more complex case with additional terms in the contraction
+    >>> pos = (0, 2)
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set('ac')
+    >>> _find_contraction(pos, isets, oset)
+    ({'a', 'c'}, [{'a', 'c'}, {'a', 'c'}], {'b', 'd'}, {'a', 'b', 'c', 'd'})
+    """
+
+    idx_contract = set()
+    idx_remain = output_set.copy()
+    remaining = []
+    for ind, value in enumerate(input_sets):
+        if ind in positions:
+            idx_contract |= value
+        else:
+            remaining.append(value)
+            idx_remain |= value
+
+    new_result = idx_remain & idx_contract
+    idx_removed = (idx_contract - new_result)
+    remaining.append(new_result)
+
+    return (new_result, remaining, idx_removed, idx_contract)
+
+
+def _optimal_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Computes all possible pair contractions, sieves the results based
+    on ``memory_limit`` and returns the lowest cost path. This algorithm
+    scales factorial with respect to the elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The optimal contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _optimal_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    full_results = [(0, [], input_sets)]
+    for iteration in range(len(input_sets) - 1):
+        iter_results = []
+
+        # Compute all unique pairs
+        for curr in full_results:
+            cost, positions, remaining = curr
+            for con in itertools.combinations(range(len(input_sets) - iteration), 2):
+
+                # Find the contraction
+                cont = _find_contraction(con, remaining, output_set)
+                new_result, new_input_sets, idx_removed, idx_contract = cont
+
+                # Sieve the results based on memory_limit
+                new_size = _compute_size_by_dict(new_result, idx_dict)
+                if new_size > memory_limit:
+                    continue
+
+                # Build (total_cost, positions, indices_remaining)
+                total_cost =  cost + _flop_count(idx_contract, idx_removed, len(con), idx_dict)
+                new_pos = positions + [con]
+                iter_results.append((total_cost, new_pos, new_input_sets))
+
+        # Update combinatorial list, if we did not find anything return best
+        # path + remaining contractions
+        if iter_results:
+            full_results = iter_results
+        else:
+            path = min(full_results, key=lambda x: x[0])[1]
+            path += [tuple(range(len(input_sets) - iteration))]
+            return path
+
+    # If we have not found anything return single einsum contraction
+    if len(full_results) == 0:
+        return [tuple(range(len(input_sets)))]
+
+    path = min(full_results, key=lambda x: x[0])[1]
+    return path
+
+def _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit, path_cost, naive_cost):
+    """Compute the cost (removed size + flops) and resultant indices for
+    performing the contraction specified by ``positions``.
+
+    Parameters
+    ----------
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    input_sets : list of sets
+        The indices found on each tensors.
+    output_set : set
+        The output indices of the expression.
+    idx_dict : dict
+        Mapping of each index to its size.
+    memory_limit : int
+        The total allowed size for an intermediary tensor.
+    path_cost : int
+        The contraction cost so far.
+    naive_cost : int
+        The cost of the unoptimized expression.
+
+    Returns
+    -------
+    cost : (int, int)
+        A tuple containing the size of any indices removed, and the flop cost.
+    positions : tuple of int
+        The locations of the proposed tensors to contract.
+    new_input_sets : list of sets
+        The resulting new list of indices if this proposed contraction is performed.
+
+    """
+
+    # Find the contraction
+    contract = _find_contraction(positions, input_sets, output_set)
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+
+    # Sieve the results based on memory_limit
+    new_size = _compute_size_by_dict(idx_result, idx_dict)
+    if new_size > memory_limit:
+        return None
+
+    # Build sort tuple
+    old_sizes = (_compute_size_by_dict(input_sets[p], idx_dict) for p in positions)
+    removed_size = sum(old_sizes) - new_size
+
+    # NB: removed_size used to be just the size of any removed indices i.e.:
+    #     helpers.compute_size_by_dict(idx_removed, idx_dict)
+    cost = _flop_count(idx_contract, idx_removed, len(positions), idx_dict)
+    sort = (-removed_size, cost)
+
+    # Sieve based on total cost as well
+    if (path_cost + cost) > naive_cost:
+        return None
+
+    # Add contraction to possible choices
+    return [sort, positions, new_input_sets]
+
+
+def _update_other_results(results, best):
+    """Update the positions and provisional input_sets of ``results`` based on
+    performing the contraction result ``best``. Remove any involving the tensors
+    contracted.
+
+    Parameters
+    ----------
+    results : list
+        List of contraction results produced by ``_parse_possible_contraction``.
+    best : list
+        The best contraction of ``results`` i.e. the one that will be performed.
+
+    Returns
+    -------
+    mod_results : list
+        The list of modified results, updated with outcome of ``best`` contraction.
+    """
+
+    best_con = best[1]
+    bx, by = best_con
+    mod_results = []
+
+    for cost, (x, y), con_sets in results:
+
+        # Ignore results involving tensors just contracted
+        if x in best_con or y in best_con:
+            continue
+
+        # Update the input_sets
+        del con_sets[by - int(by > x) - int(by > y)]
+        del con_sets[bx - int(bx > x) - int(bx > y)]
+        con_sets.insert(-1, best[2][-1])
+
+        # Update the position indices
+        mod_con = x - int(x > bx) - int(x > by), y - int(y > bx) - int(y > by)
+        mod_results.append((cost, mod_con, con_sets))
+
+    return mod_results
+
+def _greedy_path(input_sets, output_set, idx_dict, memory_limit):
+    """
+    Finds the path by contracting the best pair until the input list is
+    exhausted. The best pair is found by minimizing the tuple
+    ``(-prod(indices_removed), cost)``.  What this amounts to is prioritizing
+    matrix multiplication or inner product operations, then Hadamard like
+    operations, and finally outer operations. Outer products are limited by
+    ``memory_limit``. This algorithm scales cubically with respect to the
+    number of elements in the list ``input_sets``.
+
+    Parameters
+    ----------
+    input_sets : list
+        List of sets that represent the lhs side of the einsum subscript
+    output_set : set
+        Set that represents the rhs side of the overall einsum subscript
+    idx_dict : dictionary
+        Dictionary of index sizes
+    memory_limit : int
+        The maximum number of elements in a temporary array
+
+    Returns
+    -------
+    path : list
+        The greedy contraction order within the memory limit constraint.
+
+    Examples
+    --------
+    >>> isets = [set('abd'), set('ac'), set('bdc')]
+    >>> oset = set()
+    >>> idx_sizes = {'a': 1, 'b':2, 'c':3, 'd':4}
+    >>> _greedy_path(isets, oset, idx_sizes, 5000)
+    [(0, 2), (0, 1)]
+    """
+
+    # Handle trivial cases that leaked through
+    if len(input_sets) == 1:
+        return [(0,)]
+    elif len(input_sets) == 2:
+        return [(0, 1)]
+
+    # Build up a naive cost
+    contract = _find_contraction(range(len(input_sets)), input_sets, output_set)
+    idx_result, new_input_sets, idx_removed, idx_contract = contract
+    naive_cost = _flop_count(idx_contract, idx_removed, len(input_sets), idx_dict)
+
+    # Initially iterate over all pairs
+    comb_iter = itertools.combinations(range(len(input_sets)), 2)
+    known_contractions = []
+
+    path_cost = 0
+    path = []
+
+    for iteration in range(len(input_sets) - 1):
+
+        # Iterate over all pairs on first step, only previously found pairs on subsequent steps
+        for positions in comb_iter:
+
+            # Always initially ignore outer products
+            if input_sets[positions[0]].isdisjoint(input_sets[positions[1]]):
+                continue
+
+            result = _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit, path_cost,
+                                                 naive_cost)
+            if result is not None:
+                known_contractions.append(result)
+
+        # If we do not have a inner contraction, rescan pairs including outer products
+        if len(known_contractions) == 0:
+
+            # Then check the outer products
+            for positions in itertools.combinations(range(len(input_sets)), 2):
+                result = _parse_possible_contraction(positions, input_sets, output_set, idx_dict, memory_limit,
+                                                     path_cost, naive_cost)
+                if result is not None:
+                    known_contractions.append(result)
+
+            # If we still did not find any remaining contractions, default back to einsum like behavior
+            if len(known_contractions) == 0:
+                path.append(tuple(range(len(input_sets))))
+                break
+
+        # Sort based on first index
+        best = min(known_contractions, key=lambda x: x[0])
+
+        # Now propagate as many unused contractions as possible to next iteration
+        known_contractions = _update_other_results(known_contractions, best)
+
+        # Next iteration only compute contractions with the new tensor
+        # All other contractions have been accounted for
+        input_sets = best[2]
+        new_tensor_pos = len(input_sets) - 1
+        comb_iter = ((i, new_tensor_pos) for i in range(new_tensor_pos))
+
+        # Update path and total cost
+        path.append(best[1])
+        path_cost += best[0][1]
+
+    return path
+
+
+def _can_dot(inputs, result, idx_removed):
+    """
+    Checks if we can use BLAS (np.tensordot) call and its beneficial to do so.
+
+    Parameters
+    ----------
+    inputs : list of str
+        Specifies the subscripts for summation.
+    result : str
+        Resulting summation.
+    idx_removed : set
+        Indices that are removed in the summation
+
+
+    Returns
+    -------
+    type : bool
+        Returns true if BLAS should and can be used, else False
+
+    Notes
+    -----
+    If the operations is BLAS level 1 or 2 and is not already aligned
+    we default back to einsum as the memory movement to copy is more
+    costly than the operation itself.
+
+
+    Examples
+    --------
+
+    # Standard GEMM operation
+    >>> _can_dot(['ij', 'jk'], 'ik', set('j'))
+    True
+
+    # Can use the standard BLAS, but requires odd data movement
+    >>> _can_dot(['ijj', 'jk'], 'ik', set('j'))
+    False
+
+    # DDOT where the memory is not aligned
+    >>> _can_dot(['ijk', 'ikj'], '', set('ijk'))
+    False
+
+    """
+
+    # All `dot` calls remove indices
+    if len(idx_removed) == 0:
+        return False
+
+    # BLAS can only handle two operands
+    if len(inputs) != 2:
+        return False
+
+    input_left, input_right = inputs
+
+    for c in set(input_left + input_right):
+        # can't deal with repeated indices on same input or more than 2 total
+        nl, nr = input_left.count(c), input_right.count(c)
+        if (nl > 1) or (nr > 1) or (nl + nr > 2):
+            return False
+
+        # can't do implicit summation or dimension collapse e.g.
+        #     "ab,bc->c" (implicitly sum over 'a')
+        #     "ab,ca->ca" (take diagonal of 'a')
+        if nl + nr - 1 == int(c in result):
+            return False
+
+    # Build a few temporaries
+    set_left = set(input_left)
+    set_right = set(input_right)
+    keep_left = set_left - idx_removed
+    keep_right = set_right - idx_removed
+    rs = len(idx_removed)
+
+    # At this point we are a DOT, GEMV, or GEMM operation
+
+    # Handle inner products
+
+    # DDOT with aligned data
+    if input_left == input_right:
+        return True
+
+    # DDOT without aligned data (better to use einsum)
+    if set_left == set_right:
+        return False
+
+    # Handle the 4 possible (aligned) GEMV or GEMM cases
+
+    # GEMM or GEMV no transpose
+    if input_left[-rs:] == input_right[:rs]:
+        return True
+
+    # GEMM or GEMV transpose both
+    if input_left[:rs] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose right
+    if input_left[-rs:] == input_right[-rs:]:
+        return True
+
+    # GEMM or GEMV transpose left
+    if input_left[:rs] == input_right[:rs]:
+        return True
+
+    # Einsum is faster than GEMV if we have to copy data
+    if not keep_left or not keep_right:
+        return False
+
+    # We are a matrix-matrix product, but we need to copy data
+    return True
+
+
+def _parse_einsum_input(operands):
+    """
+    A reproduction of einsum c side einsum parsing in python.
+
+    Returns
+    -------
+    input_strings : str
+        Parsed input strings
+    output_string : str
+        Parsed output string
+    operands : list of array_like
+        The operands to use in the numpy contraction
+
+    Examples
+    --------
+    The operand list is simplified to reduce printing:
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(4, 4)
+    >>> b = np.random.rand(4, 4, 4)
+    >>> _parse_einsum_input(('...a,...a->...', a, b))
+    ('za,xza', 'xz', [a, b]) # may vary
+
+    >>> _parse_einsum_input((a, [Ellipsis, 0], b, [Ellipsis, 0]))
+    ('za,xza', 'xz', [a, b]) # may vary
+    """
+
+    if len(operands) == 0:
+        raise ValueError("No input operands")
+
+    if isinstance(operands[0], str):
+        subscripts = operands[0].replace(" ", "")
+        operands = [asanyarray(v) for v in operands[1:]]
+
+        # Ensure all characters are valid
+        for s in subscripts:
+            if s in '.,->':
+                continue
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+
+    else:
+        tmp_operands = list(operands)
+        operand_list = []
+        subscript_list = []
+        for p in range(len(operands) // 2):
+            operand_list.append(tmp_operands.pop(0))
+            subscript_list.append(tmp_operands.pop(0))
+
+        output_list = tmp_operands[-1] if len(tmp_operands) else None
+        operands = [asanyarray(v) for v in operand_list]
+        subscripts = ""
+        last = len(subscript_list) - 1
+        for num, sub in enumerate(subscript_list):
+            for s in sub:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError("For this input type lists must contain "
+                                        "either int or Ellipsis") from e
+                    subscripts += einsum_symbols[s]
+            if num != last:
+                subscripts += ","
+
+        if output_list is not None:
+            subscripts += "->"
+            for s in output_list:
+                if s is Ellipsis:
+                    subscripts += "..."
+                else:
+                    try:
+                        s = operator.index(s)
+                    except TypeError as e:
+                        raise TypeError("For this input type lists must contain "
+                                        "either int or Ellipsis") from e
+                    subscripts += einsum_symbols[s]
+    # Check for proper "->"
+    if ("-" in subscripts) or (">" in subscripts):
+        invalid = (subscripts.count("-") > 1) or (subscripts.count(">") > 1)
+        if invalid or (subscripts.count("->") != 1):
+            raise ValueError("Subscripts can only contain one '->'.")
+
+    # Parse ellipses
+    if "." in subscripts:
+        used = subscripts.replace(".", "").replace(",", "").replace("->", "")
+        unused = list(einsum_symbols_set - set(used))
+        ellipse_inds = "".join(unused)
+        longest = 0
+
+        if "->" in subscripts:
+            input_tmp, output_sub = subscripts.split("->")
+            split_subscripts = input_tmp.split(",")
+            out_sub = True
+        else:
+            split_subscripts = subscripts.split(',')
+            out_sub = False
+
+        for num, sub in enumerate(split_subscripts):
+            if "." in sub:
+                if (sub.count(".") != 3) or (sub.count("...") != 1):
+                    raise ValueError("Invalid Ellipses.")
+
+                # Take into account numerical values
+                if operands[num].shape == ():
+                    ellipse_count = 0
+                else:
+                    ellipse_count = max(operands[num].ndim, 1)
+                    ellipse_count -= (len(sub) - 3)
+
+                if ellipse_count > longest:
+                    longest = ellipse_count
+
+                if ellipse_count < 0:
+                    raise ValueError("Ellipses lengths do not match.")
+                elif ellipse_count == 0:
+                    split_subscripts[num] = sub.replace('...', '')
+                else:
+                    rep_inds = ellipse_inds[-ellipse_count:]
+                    split_subscripts[num] = sub.replace('...', rep_inds)
+
+        subscripts = ",".join(split_subscripts)
+        if longest == 0:
+            out_ellipse = ""
+        else:
+            out_ellipse = ellipse_inds[-longest:]
+
+        if out_sub:
+            subscripts += "->" + output_sub.replace("...", out_ellipse)
+        else:
+            # Special care for outputless ellipses
+            output_subscript = ""
+            tmp_subscripts = subscripts.replace(",", "")
+            for s in sorted(set(tmp_subscripts)):
+                if s not in (einsum_symbols):
+                    raise ValueError("Character %s is not a valid symbol." % s)
+                if tmp_subscripts.count(s) == 1:
+                    output_subscript += s
+            normal_inds = ''.join(sorted(set(output_subscript) -
+                                         set(out_ellipse)))
+
+            subscripts += "->" + out_ellipse + normal_inds
+
+    # Build output string if does not exist
+    if "->" in subscripts:
+        input_subscripts, output_subscript = subscripts.split("->")
+    else:
+        input_subscripts = subscripts
+        # Build output subscripts
+        tmp_subscripts = subscripts.replace(",", "")
+        output_subscript = ""
+        for s in sorted(set(tmp_subscripts)):
+            if s not in einsum_symbols:
+                raise ValueError("Character %s is not a valid symbol." % s)
+            if tmp_subscripts.count(s) == 1:
+                output_subscript += s
+
+    # Make sure output subscripts are in the input
+    for char in output_subscript:
+        if char not in input_subscripts:
+            raise ValueError("Output character %s did not appear in the input"
+                             % char)
+
+    # Make sure number operands is equivalent to the number of terms
+    if len(input_subscripts.split(',')) != len(operands):
+        raise ValueError("Number of einsum subscripts must be equal to the "
+                         "number of operands.")
+
+    return (input_subscripts, output_subscript, operands)
+
+
+def _einsum_path_dispatcher(*operands, optimize=None, einsum_call=None):
+    # NOTE: technically, we should only dispatch on array-like arguments, not
+    # subscripts (given as strings). But separating operands into
+    # arrays/subscripts is a little tricky/slow (given einsum's two supported
+    # signatures), so as a practical shortcut we dispatch on everything.
+    # Strings will be ignored for dispatching since they don't define
+    # __array_function__.
+    return operands
+
+
+@array_function_dispatch(_einsum_path_dispatcher, module='numpy')
+def einsum_path(*operands, optimize='greedy', einsum_call=False):
+    """
+    einsum_path(subscripts, *operands, optimize='greedy')
+
+    Evaluates the lowest cost contraction order for an einsum expression by
+    considering the creation of intermediate arrays.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation.
+    *operands : list of array_like
+        These are the arrays for the operation.
+    optimize : {bool, list, tuple, 'greedy', 'optimal'}
+        Choose the type of path. If a tuple is provided, the second argument is
+        assumed to be the maximum intermediate size created. If only a single
+        argument is provided the largest input or output array size is used
+        as a maximum intermediate size.
+
+        * if a list is given that starts with ``einsum_path``, uses this as the
+          contraction path
+        * if False no optimization is taken
+        * if True defaults to the 'greedy' algorithm
+        * 'optimal' An algorithm that combinatorially explores all possible
+          ways of contracting the listed tensors and chooses the least costly
+          path. Scales exponentially with the number of terms in the
+          contraction.
+        * 'greedy' An algorithm that chooses the best pair contraction
+          at each step. Effectively, this algorithm searches the largest inner,
+          Hadamard, and then outer products at each step. Scales cubically with
+          the number of terms in the contraction. Equivalent to the 'optimal'
+          path for most contractions.
+
+        Default is 'greedy'.
+
+    Returns
+    -------
+    path : list of tuples
+        A list representation of the einsum path.
+    string_repr : str
+        A printable representation of the einsum path.
+
+    Notes
+    -----
+    The resulting path indicates which terms of the input contraction should be
+    contracted first, the result of this contraction is then appended to the
+    end of the contraction list. This list can then be iterated over until all
+    intermediate contractions are complete.
+
+    See Also
+    --------
+    einsum, linalg.multi_dot
+
+    Examples
+    --------
+
+    We can begin with a chain dot example. In this case, it is optimal to
+    contract the ``b`` and ``c`` tensors first as represented by the first
+    element of the path ``(1, 2)``. The resulting tensor is added to the end
+    of the contraction and the remaining contraction ``(0, 1)`` is then
+    completed.
+
+    >>> np.random.seed(123)
+    >>> a = np.random.rand(2, 2)
+    >>> b = np.random.rand(2, 5)
+    >>> c = np.random.rand(5, 2)
+    >>> path_info = np.einsum_path('ij,jk,kl->il', a, b, c, optimize='greedy')
+    >>> print(path_info[0])
+    ['einsum_path', (1, 2), (0, 1)]
+    >>> print(path_info[1])
+      Complete contraction:  ij,jk,kl->il # may vary
+             Naive scaling:  4
+         Optimized scaling:  3
+          Naive FLOP count:  1.600e+02
+      Optimized FLOP count:  5.600e+01
+       Theoretical speedup:  2.857
+      Largest intermediate:  4.000e+00 elements
+    -------------------------------------------------------------------------
+    scaling                  current                                remaining
+    -------------------------------------------------------------------------
+       3                   kl,jk->jl                                ij,jl->il
+       3                   jl,ij->il                                   il->il
+
+
+    A more complex index transformation example.
+
+    >>> I = np.random.rand(10, 10, 10, 10)
+    >>> C = np.random.rand(10, 10)
+    >>> path_info = np.einsum_path('ea,fb,abcd,gc,hd->efgh', C, C, I, C, C,
+    ...                            optimize='greedy')
+
+    >>> print(path_info[0])
+    ['einsum_path', (0, 2), (0, 3), (0, 2), (0, 1)]
+    >>> print(path_info[1]) 
+      Complete contraction:  ea,fb,abcd,gc,hd->efgh # may vary
+             Naive scaling:  8
+         Optimized scaling:  5
+          Naive FLOP count:  8.000e+08
+      Optimized FLOP count:  8.000e+05
+       Theoretical speedup:  1000.000
+      Largest intermediate:  1.000e+04 elements
+    --------------------------------------------------------------------------
+    scaling                  current                                remaining
+    --------------------------------------------------------------------------
+       5               abcd,ea->bcde                      fb,gc,hd,bcde->efgh
+       5               bcde,fb->cdef                         gc,hd,cdef->efgh
+       5               cdef,gc->defg                            hd,defg->efgh
+       5               defg,hd->efgh                               efgh->efgh
+    """
+
+    # Figure out what the path really is
+    path_type = optimize
+    if path_type is True:
+        path_type = 'greedy'
+    if path_type is None:
+        path_type = False
+
+    explicit_einsum_path = False
+    memory_limit = None
+
+    # No optimization or a named path algorithm
+    if (path_type is False) or isinstance(path_type, str):
+        pass
+
+    # Given an explicit path
+    elif len(path_type) and (path_type[0] == 'einsum_path'):
+        explicit_einsum_path = True
+
+    # Path tuple with memory limit
+    elif ((len(path_type) == 2) and isinstance(path_type[0], str) and
+            isinstance(path_type[1], (int, float))):
+        memory_limit = int(path_type[1])
+        path_type = path_type[0]
+
+    else:
+        raise TypeError("Did not understand the path: %s" % str(path_type))
+
+    # Hidden option, only einsum should call this
+    einsum_call_arg = einsum_call
+
+    # Python side parsing
+    input_subscripts, output_subscript, operands = _parse_einsum_input(operands)
+
+    # Build a few useful list and sets
+    input_list = input_subscripts.split(',')
+    input_sets = [set(x) for x in input_list]
+    output_set = set(output_subscript)
+    indices = set(input_subscripts.replace(',', ''))
+
+    # Get length of each unique dimension and ensure all dimensions are correct
+    dimension_dict = {}
+    broadcast_indices = [[] for x in range(len(input_list))]
+    for tnum, term in enumerate(input_list):
+        sh = operands[tnum].shape
+        if len(sh) != len(term):
+            raise ValueError("Einstein sum subscript %s does not contain the "
+                             "correct number of indices for operand %d."
+                             % (input_subscripts[tnum], tnum))
+        for cnum, char in enumerate(term):
+            dim = sh[cnum]
+
+            # Build out broadcast indices
+            if dim == 1:
+                broadcast_indices[tnum].append(char)
+
+            if char in dimension_dict.keys():
+                # For broadcasting cases we always want the largest dim size
+                if dimension_dict[char] == 1:
+                    dimension_dict[char] = dim
+                elif dim not in (1, dimension_dict[char]):
+                    raise ValueError("Size of label '%s' for operand %d (%d) "
+                                     "does not match previous terms (%d)."
+                                     % (char, tnum, dimension_dict[char], dim))
+            else:
+                dimension_dict[char] = dim
+
+    # Convert broadcast inds to sets
+    broadcast_indices = [set(x) for x in broadcast_indices]
+
+    # Compute size of each input array plus the output array
+    size_list = [_compute_size_by_dict(term, dimension_dict)
+                 for term in input_list + [output_subscript]]
+    max_size = max(size_list)
+
+    if memory_limit is None:
+        memory_arg = max_size
+    else:
+        memory_arg = memory_limit
+
+    # Compute naive cost
+    # This isn't quite right, need to look into exactly how einsum does this
+    inner_product = (sum(len(x) for x in input_sets) - len(indices)) > 0
+    naive_cost = _flop_count(indices, inner_product, len(input_list), dimension_dict)
+
+    # Compute the path
+    if explicit_einsum_path:
+        path = path_type[1:]
+    elif (
+        (path_type is False)
+        or (len(input_list) in [1, 2])
+        or (indices == output_set)
+    ):
+        # Nothing to be optimized, leave it to einsum
+        path = [tuple(range(len(input_list)))]
+    elif path_type == "greedy":
+        path = _greedy_path(input_sets, output_set, dimension_dict, memory_arg)
+    elif path_type == "optimal":
+        path = _optimal_path(input_sets, output_set, dimension_dict, memory_arg)
+    else:
+        raise KeyError("Path name %s not found", path_type)
+
+    cost_list, scale_list, size_list, contraction_list = [], [], [], []
+
+    # Build contraction tuple (positions, gemm, einsum_str, remaining)
+    for cnum, contract_inds in enumerate(path):
+        # Make sure we remove inds from right to left
+        contract_inds = tuple(sorted(list(contract_inds), reverse=True))
+
+        contract = _find_contraction(contract_inds, input_sets, output_set)
+        out_inds, input_sets, idx_removed, idx_contract = contract
+
+        cost = _flop_count(idx_contract, idx_removed, len(contract_inds), dimension_dict)
+        cost_list.append(cost)
+        scale_list.append(len(idx_contract))
+        size_list.append(_compute_size_by_dict(out_inds, dimension_dict))
+
+        bcast = set()
+        tmp_inputs = []
+        for x in contract_inds:
+            tmp_inputs.append(input_list.pop(x))
+            bcast |= broadcast_indices.pop(x)
+
+        new_bcast_inds = bcast - idx_removed
+
+        # If we're broadcasting, nix blas
+        if not len(idx_removed & bcast):
+            do_blas = _can_dot(tmp_inputs, out_inds, idx_removed)
+        else:
+            do_blas = False
+
+        # Last contraction
+        if (cnum - len(path)) == -1:
+            idx_result = output_subscript
+        else:
+            sort_result = [(dimension_dict[ind], ind) for ind in out_inds]
+            idx_result = "".join([x[1] for x in sorted(sort_result)])
+
+        input_list.append(idx_result)
+        broadcast_indices.append(new_bcast_inds)
+        einsum_str = ",".join(tmp_inputs) + "->" + idx_result
+
+        contraction = (contract_inds, idx_removed, einsum_str, input_list[:], do_blas)
+        contraction_list.append(contraction)
+
+    opt_cost = sum(cost_list) + 1
+
+    if len(input_list) != 1:
+        # Explicit "einsum_path" is usually trusted, but we detect this kind of
+        # mistake in order to prevent from returning an intermediate value.
+        raise RuntimeError(
+            "Invalid einsum_path is specified: {} more operands has to be "
+            "contracted.".format(len(input_list) - 1))
+
+    if einsum_call_arg:
+        return (operands, contraction_list)
+
+    # Return the path along with a nice string representation
+    overall_contraction = input_subscripts + "->" + output_subscript
+    header = ("scaling", "current", "remaining")
+
+    speedup = naive_cost / opt_cost
+    max_i = max(size_list)
+
+    path_print  = "  Complete contraction:  %s\n" % overall_contraction
+    path_print += "         Naive scaling:  %d\n" % len(indices)
+    path_print += "     Optimized scaling:  %d\n" % max(scale_list)
+    path_print += "      Naive FLOP count:  %.3e\n" % naive_cost
+    path_print += "  Optimized FLOP count:  %.3e\n" % opt_cost
+    path_print += "   Theoretical speedup:  %3.3f\n" % speedup
+    path_print += "  Largest intermediate:  %.3e elements\n" % max_i
+    path_print += "-" * 74 + "\n"
+    path_print += "%6s %24s %40s\n" % header
+    path_print += "-" * 74
+
+    for n, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        remaining_str = ",".join(remaining) + "->" + output_subscript
+        path_run = (scale_list[n], einsum_str, remaining_str)
+        path_print += "\n%4d    %24s %40s" % path_run
+
+    path = ['einsum_path'] + path
+    return (path, path_print)
+
+
+def _einsum_dispatcher(*operands, out=None, optimize=None, **kwargs):
+    # Arguably we dispatch on more arguments than we really should; see note in
+    # _einsum_path_dispatcher for why.
+    yield from operands
+    yield out
+
+
+# Rewrite einsum to handle different cases
+@array_function_dispatch(_einsum_dispatcher, module='numpy')
+def einsum(*operands, out=None, optimize=False, **kwargs):
+    """
+    einsum(subscripts, *operands, out=None, dtype=None, order='K',
+           casting='safe', optimize=False)
+
+    Evaluates the Einstein summation convention on the operands.
+
+    Using the Einstein summation convention, many common multi-dimensional,
+    linear algebraic array operations can be represented in a simple fashion.
+    In *implicit* mode `einsum` computes these values.
+
+    In *explicit* mode, `einsum` provides further flexibility to compute
+    other array operations that might not be considered classical Einstein
+    summation operations, by disabling, or forcing summation over specified
+    subscript labels.
+
+    See the notes and examples for clarification.
+
+    Parameters
+    ----------
+    subscripts : str
+        Specifies the subscripts for summation as comma separated list of
+        subscript labels. An implicit (classical Einstein summation)
+        calculation is performed unless the explicit indicator '->' is
+        included as well as subscript labels of the precise output form.
+    operands : list of array_like
+        These are the arrays for the operation.
+    out : ndarray, optional
+        If provided, the calculation is done into this array.
+    dtype : {data-type, None}, optional
+        If provided, forces the calculation to use the data type specified.
+        Note that you may have to also give a more liberal `casting`
+        parameter to allow the conversions. Default is None.
+    order : {'C', 'F', 'A', 'K'}, optional
+        Controls the memory layout of the output. 'C' means it should
+        be C contiguous. 'F' means it should be Fortran contiguous,
+        'A' means it should be 'F' if the inputs are all 'F', 'C' otherwise.
+        'K' means it should be as close to the layout as the inputs as
+        is possible, including arbitrarily permuted axes.
+        Default is 'K'.
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur.  Setting this to
+        'unsafe' is not recommended, as it can adversely affect accumulations.
+
+          * 'no' means the data types should not be cast at all.
+          * 'equiv' means only byte-order changes are allowed.
+          * 'safe' means only casts which can preserve values are allowed.
+          * 'same_kind' means only safe casts or casts within a kind,
+            like float64 to float32, are allowed.
+          * 'unsafe' means any data conversions may be done.
+
+        Default is 'safe'.
+    optimize : {False, True, 'greedy', 'optimal'}, optional
+        Controls if intermediate optimization should occur. No optimization
+        will occur if False and True will default to the 'greedy' algorithm.
+        Also accepts an explicit contraction list from the ``np.einsum_path``
+        function. See ``np.einsum_path`` for more details. Defaults to False.
+
+    Returns
+    -------
+    output : ndarray
+        The calculation based on the Einstein summation convention.
+
+    See Also
+    --------
+    einsum_path, dot, inner, outer, tensordot, linalg.multi_dot
+    einops :
+        similar verbose interface is provided by
+        `einops <https://github.com/arogozhnikov/einops>`_ package to cover
+        additional operations: transpose, reshape/flatten, repeat/tile,
+        squeeze/unsqueeze and reductions.
+    opt_einsum :
+        `opt_einsum <https://optimized-einsum.readthedocs.io/en/stable/>`_
+        optimizes contraction order for einsum-like expressions
+        in backend-agnostic manner.
+
+    Notes
+    -----
+    .. versionadded:: 1.6.0
+
+    The Einstein summation convention can be used to compute
+    many multi-dimensional, linear algebraic array operations. `einsum`
+    provides a succinct way of representing these.
+
+    A non-exhaustive list of these operations,
+    which can be computed by `einsum`, is shown below along with examples:
+
+    * Trace of an array, :py:func:`numpy.trace`.
+    * Return a diagonal, :py:func:`numpy.diag`.
+    * Array axis summations, :py:func:`numpy.sum`.
+    * Transpositions and permutations, :py:func:`numpy.transpose`.
+    * Matrix multiplication and dot product, :py:func:`numpy.matmul` :py:func:`numpy.dot`.
+    * Vector inner and outer products, :py:func:`numpy.inner` :py:func:`numpy.outer`.
+    * Broadcasting, element-wise and scalar multiplication, :py:func:`numpy.multiply`.
+    * Tensor contractions, :py:func:`numpy.tensordot`.
+    * Chained array operations, in efficient calculation order, :py:func:`numpy.einsum_path`.
+
+    The subscripts string is a comma-separated list of subscript labels,
+    where each label refers to a dimension of the corresponding operand.
+    Whenever a label is repeated it is summed, so ``np.einsum('i,i', a, b)``
+    is equivalent to :py:func:`np.inner(a,b) <numpy.inner>`. If a label
+    appears only once, it is not summed, so ``np.einsum('i', a)`` produces a
+    view of ``a`` with no changes. A further example ``np.einsum('ij,jk', a, b)``
+    describes traditional matrix multiplication and is equivalent to
+    :py:func:`np.matmul(a,b) <numpy.matmul>`. Repeated subscript labels in one
+    operand take the diagonal. For example, ``np.einsum('ii', a)`` is equivalent
+    to :py:func:`np.trace(a) <numpy.trace>`.
+
+    In *implicit mode*, the chosen subscripts are important
+    since the axes of the output are reordered alphabetically.  This
+    means that ``np.einsum('ij', a)`` doesn't affect a 2D array, while
+    ``np.einsum('ji', a)`` takes its transpose. Additionally,
+    ``np.einsum('ij,jk', a, b)`` returns a matrix multiplication, while,
+    ``np.einsum('ij,jh', a, b)`` returns the transpose of the
+    multiplication since subscript 'h' precedes subscript 'i'.
+
+    In *explicit mode* the output can be directly controlled by
+    specifying output subscript labels.  This requires the
+    identifier '->' as well as the list of output subscript labels.
+    This feature increases the flexibility of the function since
+    summing can be disabled or forced when required. The call
+    ``np.einsum('i->', a)`` is like :py:func:`np.sum(a, axis=-1) <numpy.sum>`,
+    and ``np.einsum('ii->i', a)`` is like :py:func:`np.diag(a) <numpy.diag>`.
+    The difference is that `einsum` does not allow broadcasting by default.
+    Additionally ``np.einsum('ij,jh->ih', a, b)`` directly specifies the
+    order of the output subscript labels and therefore returns matrix
+    multiplication, unlike the example above in implicit mode.
+
+    To enable and control broadcasting, use an ellipsis.  Default
+    NumPy-style broadcasting is done by adding an ellipsis
+    to the left of each term, like ``np.einsum('...ii->...i', a)``.
+    To take the trace along the first and last axes,
+    you can do ``np.einsum('i...i', a)``, or to do a matrix-matrix
+    product with the left-most indices instead of rightmost, one can do
+    ``np.einsum('ij...,jk...->ik...', a, b)``.
+
+    When there is only one operand, no axes are summed, and no output
+    parameter is provided, a view into the operand is returned instead
+    of a new array.  Thus, taking the diagonal as ``np.einsum('ii->i', a)``
+    produces a view (changed in version 1.10.0).
+
+    `einsum` also provides an alternative way to provide the subscripts
+    and operands as ``einsum(op0, sublist0, op1, sublist1, ..., [sublistout])``.
+    If the output shape is not provided in this format `einsum` will be
+    calculated in implicit mode, otherwise it will be performed explicitly.
+    The examples below have corresponding `einsum` calls with the two
+    parameter methods.
+
+    .. versionadded:: 1.10.0
+
+    Views returned from einsum are now writeable whenever the input array
+    is writeable. For example, ``np.einsum('ijk...->kji...', a)`` will now
+    have the same effect as :py:func:`np.swapaxes(a, 0, 2) <numpy.swapaxes>`
+    and ``np.einsum('ii->i', a)`` will return a writeable view of the diagonal
+    of a 2D array.
+
+    .. versionadded:: 1.12.0
+
+    Added the ``optimize`` argument which will optimize the contraction order
+    of an einsum expression. For a contraction with three or more operands this
+    can greatly increase the computational efficiency at the cost of a larger
+    memory footprint during computation.
+
+    Typically a 'greedy' algorithm is applied which empirical tests have shown
+    returns the optimal path in the majority of cases. In some cases 'optimal'
+    will return the superlative path through a more expensive, exhaustive search.
+    For iterative calculations it may be advisable to calculate the optimal path
+    once and reuse that path by supplying it as an argument. An example is given
+    below.
+
+    See :py:func:`numpy.einsum_path` for more details.
+
+    Examples
+    --------
+    >>> a = np.arange(25).reshape(5,5)
+    >>> b = np.arange(5)
+    >>> c = np.arange(6).reshape(2,3)
+
+    Trace of a matrix:
+
+    >>> np.einsum('ii', a)
+    60
+    >>> np.einsum(a, [0,0])
+    60
+    >>> np.trace(a)
+    60
+
+    Extract the diagonal (requires explicit form):
+
+    >>> np.einsum('ii->i', a)
+    array([ 0,  6, 12, 18, 24])
+    >>> np.einsum(a, [0,0], [0])
+    array([ 0,  6, 12, 18, 24])
+    >>> np.diag(a)
+    array([ 0,  6, 12, 18, 24])
+
+    Sum over an axis (requires explicit form):
+
+    >>> np.einsum('ij->i', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [0,1], [0])
+    array([ 10,  35,  60,  85, 110])
+    >>> np.sum(a, axis=1)
+    array([ 10,  35,  60,  85, 110])
+
+    For higher dimensional arrays summing a single axis can be done with ellipsis:
+
+    >>> np.einsum('...j->...', a)
+    array([ 10,  35,  60,  85, 110])
+    >>> np.einsum(a, [Ellipsis,1], [Ellipsis])
+    array([ 10,  35,  60,  85, 110])
+
+    Compute a matrix transpose, or reorder any number of axes:
+
+    >>> np.einsum('ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum('ij->ji', c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.einsum(c, [1,0])
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+    >>> np.transpose(c)
+    array([[0, 3],
+           [1, 4],
+           [2, 5]])
+
+    Vector inner products:
+
+    >>> np.einsum('i,i', b, b)
+    30
+    >>> np.einsum(b, [0], b, [0])
+    30
+    >>> np.inner(b,b)
+    30
+
+    Matrix vector multiplication:
+
+    >>> np.einsum('ij,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum(a, [0,1], b, [1])
+    array([ 30,  80, 130, 180, 230])
+    >>> np.dot(a, b)
+    array([ 30,  80, 130, 180, 230])
+    >>> np.einsum('...j,j', a, b)
+    array([ 30,  80, 130, 180, 230])
+
+    Broadcasting and scalar multiplication:
+
+    >>> np.einsum('..., ...', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(',ij', 3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.einsum(3, [Ellipsis], c, [Ellipsis])
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+    >>> np.multiply(3, c)
+    array([[ 0,  3,  6],
+           [ 9, 12, 15]])
+
+    Vector outer product:
+
+    >>> np.einsum('i,j', np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.einsum(np.arange(2)+1, [0], b, [1])
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+    >>> np.outer(np.arange(2)+1, b)
+    array([[0, 1, 2, 3, 4],
+           [0, 2, 4, 6, 8]])
+
+    Tensor contraction:
+
+    >>> a = np.arange(60.).reshape(3,4,5)
+    >>> b = np.arange(24.).reshape(4,3,2)
+    >>> np.einsum('ijk,jil->kl', a, b)
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.einsum(a, [0,1,2], b, [1,0,3], [2,3])
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> np.tensordot(a,b, axes=([1,0],[0,1]))
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+
+    Writeable returned arrays (since version 1.10.0):
+
+    >>> a = np.zeros((3, 3))
+    >>> np.einsum('ii->i', a)[:] = 1
+    >>> a
+    array([[1., 0., 0.],
+           [0., 1., 0.],
+           [0., 0., 1.]])
+
+    Example of ellipsis use:
+
+    >>> a = np.arange(6).reshape((3,2))
+    >>> b = np.arange(12).reshape((4,3))
+    >>> np.einsum('ki,jk->ij', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('ki,...k->i...', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+    >>> np.einsum('k...,jk', a, b)
+    array([[10, 28, 46, 64],
+           [13, 40, 67, 94]])
+
+    Chained array operations. For more complicated contractions, speed ups
+    might be achieved by repeatedly computing a 'greedy' path or pre-computing the
+    'optimal' path and repeatedly applying it, using an
+    `einsum_path` insertion (since version 1.12.0). Performance improvements can be
+    particularly significant with larger arrays:
+
+    >>> a = np.ones(64).reshape(2,4,8)
+
+    Basic `einsum`: ~1520ms  (benchmarked on 3.1GHz Intel i5.)
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a)
+
+    Sub-optimal `einsum` (due to repeated path calculation time): ~330ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='optimal')
+
+    Greedy `einsum` (faster optimal path approximation): ~160ms
+
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='greedy')
+
+    Optimal `einsum` (best usage pattern in some use cases): ~110ms
+
+    >>> path = np.einsum_path('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize='optimal')[0]
+    >>> for iteration in range(500):
+    ...     _ = np.einsum('ijk,ilm,njm,nlk,abc->',a,a,a,a,a, optimize=path)
+
+    """
+    # Special handling if out is specified
+    specified_out = out is not None
+
+    # If no optimization, run pure einsum
+    if optimize is False:
+        if specified_out:
+            kwargs['out'] = out
+        return c_einsum(*operands, **kwargs)
+
+    # Check the kwargs to avoid a more cryptic error later, without having to
+    # repeat default values here
+    valid_einsum_kwargs = ['dtype', 'order', 'casting']
+    unknown_kwargs = [k for (k, v) in kwargs.items() if
+                      k not in valid_einsum_kwargs]
+    if len(unknown_kwargs):
+        raise TypeError("Did not understand the following kwargs: %s"
+                        % unknown_kwargs)
+
+    # Build the contraction list and operand
+    operands, contraction_list = einsum_path(*operands, optimize=optimize,
+                                             einsum_call=True)
+
+    # Handle order kwarg for output array, c_einsum allows mixed case
+    output_order = kwargs.pop('order', 'K')
+    if output_order.upper() == 'A':
+        if all(arr.flags.f_contiguous for arr in operands):
+            output_order = 'F'
+        else:
+            output_order = 'C'
+
+    # Start contraction loop
+    for num, contraction in enumerate(contraction_list):
+        inds, idx_rm, einsum_str, remaining, blas = contraction
+        tmp_operands = [operands.pop(x) for x in inds]
+
+        # Do we need to deal with the output?
+        handle_out = specified_out and ((num + 1) == len(contraction_list))
+
+        # Call tensordot if still possible
+        if blas:
+            # Checks have already been handled
+            input_str, results_index = einsum_str.split('->')
+            input_left, input_right = input_str.split(',')
+
+            tensor_result = input_left + input_right
+            for s in idx_rm:
+                tensor_result = tensor_result.replace(s, "")
+
+            # Find indices to contract over
+            left_pos, right_pos = [], []
+            for s in sorted(idx_rm):
+                left_pos.append(input_left.find(s))
+                right_pos.append(input_right.find(s))
+
+            # Contract!
+            new_view = tensordot(*tmp_operands, axes=(tuple(left_pos), tuple(right_pos)))
+
+            # Build a new view if needed
+            if (tensor_result != results_index) or handle_out:
+                if handle_out:
+                    kwargs["out"] = out
+                new_view = c_einsum(tensor_result + '->' + results_index, new_view, **kwargs)
+
+        # Call einsum
+        else:
+            # If out was specified
+            if handle_out:
+                kwargs["out"] = out
+
+            # Do the contraction
+            new_view = c_einsum(einsum_str, *tmp_operands, **kwargs)
+
+        # Append new items and dereference what we can
+        operands.append(new_view)
+        del tmp_operands, new_view
+
+    if specified_out:
+        return out
+    else:
+        return asanyarray(operands[0], order=output_order)

env-llmeval/lib/python3.10/site-packages/numpy/core/getlimits.py

@@ -0,0 +1,735 @@
+"""Machine limits for Float32 and Float64 and (long double) if available...
+
+"""
+__all__ = ['finfo', 'iinfo']
+
+import warnings
+
+from .._utils import set_module
+from ._machar import MachAr
+from . import numeric
+from . import numerictypes as ntypes
+from .numeric import array, inf, NaN
+from .umath import log10, exp2, nextafter, isnan
+
+
+def _fr0(a):
+    """fix rank-0 --> rank-1"""
+    if a.ndim == 0:
+        a = a.copy()
+        a.shape = (1,)
+    return a
+
+
+def _fr1(a):
+    """fix rank > 0 --> rank-0"""
+    if a.size == 1:
+        a = a.copy()
+        a.shape = ()
+    return a
+
+
+class MachArLike:
+    """ Object to simulate MachAr instance """
+    def __init__(self, ftype, *, eps, epsneg, huge, tiny,
+                 ibeta, smallest_subnormal=None, **kwargs):
+        self.params = _MACHAR_PARAMS[ftype]
+        self.ftype = ftype
+        self.title = self.params['title']
+        # Parameter types same as for discovered MachAr object.
+        if not smallest_subnormal:
+            self._smallest_subnormal = nextafter(
+                self.ftype(0), self.ftype(1), dtype=self.ftype)
+        else:
+            self._smallest_subnormal = smallest_subnormal
+        self.epsilon = self.eps = self._float_to_float(eps)
+        self.epsneg = self._float_to_float(epsneg)
+        self.xmax = self.huge = self._float_to_float(huge)
+        self.xmin = self._float_to_float(tiny)
+        self.smallest_normal = self.tiny = self._float_to_float(tiny)
+        self.ibeta = self.params['itype'](ibeta)
+        self.__dict__.update(kwargs)
+        self.precision = int(-log10(self.eps))
+        self.resolution = self._float_to_float(
+            self._float_conv(10) ** (-self.precision))
+        self._str_eps = self._float_to_str(self.eps)
+        self._str_epsneg = self._float_to_str(self.epsneg)
+        self._str_xmin = self._float_to_str(self.xmin)
+        self._str_xmax = self._float_to_str(self.xmax)
+        self._str_resolution = self._float_to_str(self.resolution)
+        self._str_smallest_normal = self._float_to_str(self.xmin)
+
+    @property
+    def smallest_subnormal(self):
+        """Return the value for the smallest subnormal.
+
+        Returns
+        -------
+        smallest_subnormal : float
+            value for the smallest subnormal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest subnormal is zero.
+        """
+        # Check that the calculated value is not zero, in case it raises a
+        # warning.
+        value = self._smallest_subnormal
+        if self.ftype(0) == value:
+            warnings.warn(
+                'The value of the smallest subnormal for {} type '
+                'is zero.'.format(self.ftype), UserWarning, stacklevel=2)
+
+        return self._float_to_float(value)
+
+    @property
+    def _str_smallest_subnormal(self):
+        """Return the string representation of the smallest subnormal."""
+        return self._float_to_str(self.smallest_subnormal)
+
+    def _float_to_float(self, value):
+        """Converts float to float.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return _fr1(self._float_conv(value))
+
+    def _float_conv(self, value):
+        """Converts float to conv.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return array([value], self.ftype)
+
+    def _float_to_str(self, value):
+        """Converts float to str.
+
+        Parameters
+        ----------
+        value : float
+            value to be converted.
+        """
+        return self.params['fmt'] % array(_fr0(value)[0], self.ftype)
+
+
+_convert_to_float = {
+    ntypes.csingle: ntypes.single,
+    ntypes.complex_: ntypes.float_,
+    ntypes.clongfloat: ntypes.longfloat
+    }
+
+# Parameters for creating MachAr / MachAr-like objects
+_title_fmt = 'numpy {} precision floating point number'
+_MACHAR_PARAMS = {
+    ntypes.double: dict(
+        itype = ntypes.int64,
+        fmt = '%24.16e',
+        title = _title_fmt.format('double')),
+    ntypes.single: dict(
+        itype = ntypes.int32,
+        fmt = '%15.7e',
+        title = _title_fmt.format('single')),
+    ntypes.longdouble: dict(
+        itype = ntypes.longlong,
+        fmt = '%s',
+        title = _title_fmt.format('long double')),
+    ntypes.half: dict(
+        itype = ntypes.int16,
+        fmt = '%12.5e',
+        title = _title_fmt.format('half'))}
+
+# Key to identify the floating point type.  Key is result of
+# ftype('-0.1').newbyteorder('<').tobytes()
+#
+# 20230201 - use (ftype(-1.0) / ftype(10.0)).newbyteorder('<').tobytes()
+#            instead because stold may have deficiencies on some platforms.
+# See:
+# https://perl5.git.perl.org/perl.git/blob/3118d7d684b56cbeb702af874f4326683c45f045:/Configure
+
+_KNOWN_TYPES = {}
+def _register_type(machar, bytepat):
+    _KNOWN_TYPES[bytepat] = machar
+_float_ma = {}
+
+
+def _register_known_types():
+    # Known parameters for float16
+    # See docstring of MachAr class for description of parameters.
+    f16 = ntypes.float16
+    float16_ma = MachArLike(f16,
+                            machep=-10,
+                            negep=-11,
+                            minexp=-14,
+                            maxexp=16,
+                            it=10,
+                            iexp=5,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(f16(-10)),
+                            epsneg=exp2(f16(-11)),
+                            huge=f16(65504),
+                            tiny=f16(2 ** -14))
+    _register_type(float16_ma, b'f\xae')
+    _float_ma[16] = float16_ma
+
+    # Known parameters for float32
+    f32 = ntypes.float32
+    float32_ma = MachArLike(f32,
+                            machep=-23,
+                            negep=-24,
+                            minexp=-126,
+                            maxexp=128,
+                            it=23,
+                            iexp=8,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(f32(-23)),
+                            epsneg=exp2(f32(-24)),
+                            huge=f32((1 - 2 ** -24) * 2**128),
+                            tiny=exp2(f32(-126)))
+    _register_type(float32_ma, b'\xcd\xcc\xcc\xbd')
+    _float_ma[32] = float32_ma
+
+    # Known parameters for float64
+    f64 = ntypes.float64
+    epsneg_f64 = 2.0 ** -53.0
+    tiny_f64 = 2.0 ** -1022.0
+    float64_ma = MachArLike(f64,
+                            machep=-52,
+                            negep=-53,
+                            minexp=-1022,
+                            maxexp=1024,
+                            it=52,
+                            iexp=11,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=2.0 ** -52.0,
+                            epsneg=epsneg_f64,
+                            huge=(1.0 - epsneg_f64) / tiny_f64 * f64(4),
+                            tiny=tiny_f64)
+    _register_type(float64_ma, b'\x9a\x99\x99\x99\x99\x99\xb9\xbf')
+    _float_ma[64] = float64_ma
+
+    # Known parameters for IEEE 754 128-bit binary float
+    ld = ntypes.longdouble
+    epsneg_f128 = exp2(ld(-113))
+    tiny_f128 = exp2(ld(-16382))
+    # Ignore runtime error when this is not f128
+    with numeric.errstate(all='ignore'):
+        huge_f128 = (ld(1) - epsneg_f128) / tiny_f128 * ld(4)
+    float128_ma = MachArLike(ld,
+                             machep=-112,
+                             negep=-113,
+                             minexp=-16382,
+                             maxexp=16384,
+                             it=112,
+                             iexp=15,
+                             ibeta=2,
+                             irnd=5,
+                             ngrd=0,
+                             eps=exp2(ld(-112)),
+                             epsneg=epsneg_f128,
+                             huge=huge_f128,
+                             tiny=tiny_f128)
+    # IEEE 754 128-bit binary float
+    _register_type(float128_ma,
+        b'\x9a\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\x99\xfb\xbf')
+    _float_ma[128] = float128_ma
+
+    # Known parameters for float80 (Intel 80-bit extended precision)
+    epsneg_f80 = exp2(ld(-64))
+    tiny_f80 = exp2(ld(-16382))
+    # Ignore runtime error when this is not f80
+    with numeric.errstate(all='ignore'):
+        huge_f80 = (ld(1) - epsneg_f80) / tiny_f80 * ld(4)
+    float80_ma = MachArLike(ld,
+                            machep=-63,
+                            negep=-64,
+                            minexp=-16382,
+                            maxexp=16384,
+                            it=63,
+                            iexp=15,
+                            ibeta=2,
+                            irnd=5,
+                            ngrd=0,
+                            eps=exp2(ld(-63)),
+                            epsneg=epsneg_f80,
+                            huge=huge_f80,
+                            tiny=tiny_f80)
+    # float80, first 10 bytes containing actual storage
+    _register_type(float80_ma, b'\xcd\xcc\xcc\xcc\xcc\xcc\xcc\xcc\xfb\xbf')
+    _float_ma[80] = float80_ma
+
+    # Guessed / known parameters for double double; see:
+    # https://en.wikipedia.org/wiki/Quadruple-precision_floating-point_format#Double-double_arithmetic
+    # These numbers have the same exponent range as float64, but extended number of
+    # digits in the significand.
+    huge_dd = nextafter(ld(inf), ld(0), dtype=ld)
+    # As the smallest_normal in double double is so hard to calculate we set
+    # it to NaN.
+    smallest_normal_dd = NaN
+    # Leave the same value for the smallest subnormal as double
+    smallest_subnormal_dd = ld(nextafter(0., 1.))
+    float_dd_ma = MachArLike(ld,
+                             machep=-105,
+                             negep=-106,
+                             minexp=-1022,
+                             maxexp=1024,
+                             it=105,
+                             iexp=11,
+                             ibeta=2,
+                             irnd=5,
+                             ngrd=0,
+                             eps=exp2(ld(-105)),
+                             epsneg=exp2(ld(-106)),
+                             huge=huge_dd,
+                             tiny=smallest_normal_dd,
+                             smallest_subnormal=smallest_subnormal_dd)
+    # double double; low, high order (e.g. PPC 64)
+    _register_type(float_dd_ma,
+        b'\x9a\x99\x99\x99\x99\x99Y<\x9a\x99\x99\x99\x99\x99\xb9\xbf')
+    # double double; high, low order (e.g. PPC 64 le)
+    _register_type(float_dd_ma,
+        b'\x9a\x99\x99\x99\x99\x99\xb9\xbf\x9a\x99\x99\x99\x99\x99Y<')
+    _float_ma['dd'] = float_dd_ma
+
+
+def _get_machar(ftype):
+    """ Get MachAr instance or MachAr-like instance
+
+    Get parameters for floating point type, by first trying signatures of
+    various known floating point types, then, if none match, attempting to
+    identify parameters by analysis.
+
+    Parameters
+    ----------
+    ftype : class
+        Numpy floating point type class (e.g. ``np.float64``)
+
+    Returns
+    -------
+    ma_like : instance of :class:`MachAr` or :class:`MachArLike`
+        Object giving floating point parameters for `ftype`.
+
+    Warns
+    -----
+    UserWarning
+        If the binary signature of the float type is not in the dictionary of
+        known float types.
+    """
+    params = _MACHAR_PARAMS.get(ftype)
+    if params is None:
+        raise ValueError(repr(ftype))
+    # Detect known / suspected types
+    # ftype(-1.0) / ftype(10.0) is better than ftype('-0.1') because stold
+    # may be deficient
+    key = (ftype(-1.0) / ftype(10.)).newbyteorder('<').tobytes()
+    ma_like = None
+    if ftype == ntypes.longdouble:
+        # Could be 80 bit == 10 byte extended precision, where last bytes can
+        # be random garbage.
+        # Comparing first 10 bytes to pattern first to avoid branching on the
+        # random garbage.
+        ma_like = _KNOWN_TYPES.get(key[:10])
+    if ma_like is None:
+        # see if the full key is known.
+        ma_like = _KNOWN_TYPES.get(key)
+    if ma_like is None and len(key) == 16:
+        # machine limits could be f80 masquerading as np.float128,
+        # find all keys with length 16 and make new dict, but make the keys
+        # only 10 bytes long, the last bytes can be random garbage
+        _kt = {k[:10]: v for k, v in _KNOWN_TYPES.items() if len(k) == 16}
+        ma_like = _kt.get(key[:10])
+    if ma_like is not None:
+        return ma_like
+    # Fall back to parameter discovery
+    warnings.warn(
+        f'Signature {key} for {ftype} does not match any known type: '
+        'falling back to type probe function.\n'
+        'This warnings indicates broken support for the dtype!',
+        UserWarning, stacklevel=2)
+    return _discovered_machar(ftype)
+
+
+def _discovered_machar(ftype):
+    """ Create MachAr instance with found information on float types
+
+    TODO: MachAr should be retired completely ideally.  We currently only
+          ever use it system with broken longdouble (valgrind, WSL).
+    """
+    params = _MACHAR_PARAMS[ftype]
+    return MachAr(lambda v: array([v], ftype),
+                  lambda v:_fr0(v.astype(params['itype']))[0],
+                  lambda v:array(_fr0(v)[0], ftype),
+                  lambda v: params['fmt'] % array(_fr0(v)[0], ftype),
+                  params['title'])
+
+
+@set_module('numpy')
+class finfo:
+    """
+    finfo(dtype)
+
+    Machine limits for floating point types.
+
+    Attributes
+    ----------
+    bits : int
+        The number of bits occupied by the type.
+    dtype : dtype
+        Returns the dtype for which `finfo` returns information. For complex
+        input, the returned dtype is the associated ``float*`` dtype for its
+        real and complex components.
+    eps : float
+        The difference between 1.0 and the next smallest representable float
+        larger than 1.0. For example, for 64-bit binary floats in the IEEE-754
+        standard, ``eps = 2**-52``, approximately 2.22e-16.
+    epsneg : float
+        The difference between 1.0 and the next smallest representable float
+        less than 1.0. For example, for 64-bit binary floats in the IEEE-754
+        standard, ``epsneg = 2**-53``, approximately 1.11e-16.
+    iexp : int
+        The number of bits in the exponent portion of the floating point
+        representation.
+    machep : int
+        The exponent that yields `eps`.
+    max : floating point number of the appropriate type
+        The largest representable number.
+    maxexp : int
+        The smallest positive power of the base (2) that causes overflow.
+    min : floating point number of the appropriate type
+        The smallest representable number, typically ``-max``.
+    minexp : int
+        The most negative power of the base (2) consistent with there
+        being no leading 0's in the mantissa.
+    negep : int
+        The exponent that yields `epsneg`.
+    nexp : int
+        The number of bits in the exponent including its sign and bias.
+    nmant : int
+        The number of bits in the mantissa.
+    precision : int
+        The approximate number of decimal digits to which this kind of
+        float is precise.
+    resolution : floating point number of the appropriate type
+        The approximate decimal resolution of this type, i.e.,
+        ``10**-precision``.
+    tiny : float
+        An alias for `smallest_normal`, kept for backwards compatibility.
+    smallest_normal : float
+        The smallest positive floating point number with 1 as leading bit in
+        the mantissa following IEEE-754 (see Notes).
+    smallest_subnormal : float
+        The smallest positive floating point number with 0 as leading bit in
+        the mantissa following IEEE-754.
+
+    Parameters
+    ----------
+    dtype : float, dtype, or instance
+        Kind of floating point or complex floating point
+        data-type about which to get information.
+
+    See Also
+    --------
+    iinfo : The equivalent for integer data types.
+    spacing : The distance between a value and the nearest adjacent number
+    nextafter : The next floating point value after x1 towards x2
+
+    Notes
+    -----
+    For developers of NumPy: do not instantiate this at the module level.
+    The initial calculation of these parameters is expensive and negatively
+    impacts import times.  These objects are cached, so calling ``finfo()``
+    repeatedly inside your functions is not a problem.
+
+    Note that ``smallest_normal`` is not actually the smallest positive
+    representable value in a NumPy floating point type. As in the IEEE-754
+    standard [1]_, NumPy floating point types make use of subnormal numbers to
+    fill the gap between 0 and ``smallest_normal``. However, subnormal numbers
+    may have significantly reduced precision [2]_.
+
+    This function can also be used for complex data types as well. If used,
+    the output will be the same as the corresponding real float type
+    (e.g. numpy.finfo(numpy.csingle) is the same as numpy.finfo(numpy.single)).
+    However, the output is true for the real and imaginary components.
+
+    References
+    ----------
+    .. [1] IEEE Standard for Floating-Point Arithmetic, IEEE Std 754-2008,
+           pp.1-70, 2008, http://www.doi.org/10.1109/IEEESTD.2008.4610935
+    .. [2] Wikipedia, "Denormal Numbers",
+           https://en.wikipedia.org/wiki/Denormal_number
+
+    Examples
+    --------
+    >>> np.finfo(np.float64).dtype
+    dtype('float64')
+    >>> np.finfo(np.complex64).dtype
+    dtype('float32')
+
+    """
+
+    _finfo_cache = {}
+
+    def __new__(cls, dtype):
+        try:
+            obj = cls._finfo_cache.get(dtype)  # most common path
+            if obj is not None:
+                return obj
+        except TypeError:
+            pass
+
+        if dtype is None:
+            # Deprecated in NumPy 1.25, 2023-01-16
+            warnings.warn(
+                "finfo() dtype cannot be None. This behavior will "
+                "raise an error in the future. (Deprecated in NumPy 1.25)",
+                DeprecationWarning,
+                stacklevel=2
+            )
+
+        try:
+            dtype = numeric.dtype(dtype)
+        except TypeError:
+            # In case a float instance was given
+            dtype = numeric.dtype(type(dtype))
+
+        obj = cls._finfo_cache.get(dtype)
+        if obj is not None:
+            return obj
+        dtypes = [dtype]
+        newdtype = numeric.obj2sctype(dtype)
+        if newdtype is not dtype:
+            dtypes.append(newdtype)
+            dtype = newdtype
+        if not issubclass(dtype, numeric.inexact):
+            raise ValueError("data type %r not inexact" % (dtype))
+        obj = cls._finfo_cache.get(dtype)
+        if obj is not None:
+            return obj
+        if not issubclass(dtype, numeric.floating):
+            newdtype = _convert_to_float[dtype]
+            if newdtype is not dtype:
+                # dtype changed, for example from complex128 to float64
+                dtypes.append(newdtype)
+                dtype = newdtype
+
+                obj = cls._finfo_cache.get(dtype, None)
+                if obj is not None:
+                    # the original dtype was not in the cache, but the new
+                    # dtype is in the cache. we add the original dtypes to
+                    # the cache and return the result
+                    for dt in dtypes:
+                        cls._finfo_cache[dt] = obj
+                    return obj
+        obj = object.__new__(cls)._init(dtype)
+        for dt in dtypes:
+            cls._finfo_cache[dt] = obj
+        return obj
+
+    def _init(self, dtype):
+        self.dtype = numeric.dtype(dtype)
+        machar = _get_machar(dtype)
+
+        for word in ['precision', 'iexp',
+                     'maxexp', 'minexp', 'negep',
+                     'machep']:
+            setattr(self, word, getattr(machar, word))
+        for word in ['resolution', 'epsneg', 'smallest_subnormal']:
+            setattr(self, word, getattr(machar, word).flat[0])
+        self.bits = self.dtype.itemsize * 8
+        self.max = machar.huge.flat[0]
+        self.min = -self.max
+        self.eps = machar.eps.flat[0]
+        self.nexp = machar.iexp
+        self.nmant = machar.it
+        self._machar = machar
+        self._str_tiny = machar._str_xmin.strip()
+        self._str_max = machar._str_xmax.strip()
+        self._str_epsneg = machar._str_epsneg.strip()
+        self._str_eps = machar._str_eps.strip()
+        self._str_resolution = machar._str_resolution.strip()
+        self._str_smallest_normal = machar._str_smallest_normal.strip()
+        self._str_smallest_subnormal = machar._str_smallest_subnormal.strip()
+        return self
+
+    def __str__(self):
+        fmt = (
+            'Machine parameters for %(dtype)s\n'
+            '---------------------------------------------------------------\n'
+            'precision = %(precision)3s   resolution = %(_str_resolution)s\n'
+            'machep = %(machep)6s   eps =        %(_str_eps)s\n'
+            'negep =  %(negep)6s   epsneg =     %(_str_epsneg)s\n'
+            'minexp = %(minexp)6s   tiny =       %(_str_tiny)s\n'
+            'maxexp = %(maxexp)6s   max =        %(_str_max)s\n'
+            'nexp =   %(nexp)6s   min =        -max\n'
+            'smallest_normal = %(_str_smallest_normal)s   '
+            'smallest_subnormal = %(_str_smallest_subnormal)s\n'
+            '---------------------------------------------------------------\n'
+            )
+        return fmt % self.__dict__
+
+    def __repr__(self):
+        c = self.__class__.__name__
+        d = self.__dict__.copy()
+        d['klass'] = c
+        return (("%(klass)s(resolution=%(resolution)s, min=-%(_str_max)s,"
+                 " max=%(_str_max)s, dtype=%(dtype)s)") % d)
+
+    @property
+    def smallest_normal(self):
+        """Return the value for the smallest normal.
+
+        Returns
+        -------
+        smallest_normal : float
+            Value for the smallest normal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest normal is requested for
+            double-double.
+        """
+        # This check is necessary because the value for smallest_normal is
+        # platform dependent for longdouble types.
+        if isnan(self._machar.smallest_normal.flat[0]):
+            warnings.warn(
+                'The value of smallest normal is undefined for double double',
+                UserWarning, stacklevel=2)
+        return self._machar.smallest_normal.flat[0]
+
+    @property
+    def tiny(self):
+        """Return the value for tiny, alias of smallest_normal.
+
+        Returns
+        -------
+        tiny : float
+            Value for the smallest normal, alias of smallest_normal.
+
+        Warns
+        -----
+        UserWarning
+            If the calculated value for the smallest normal is requested for
+            double-double.
+        """
+        return self.smallest_normal
+
+
+@set_module('numpy')
+class iinfo:
+    """
+    iinfo(type)
+
+    Machine limits for integer types.
+
+    Attributes
+    ----------
+    bits : int
+        The number of bits occupied by the type.
+    dtype : dtype
+        Returns the dtype for which `iinfo` returns information.
+    min : int
+        The smallest integer expressible by the type.
+    max : int
+        The largest integer expressible by the type.
+
+    Parameters
+    ----------
+    int_type : integer type, dtype, or instance
+        The kind of integer data type to get information about.
+
+    See Also
+    --------
+    finfo : The equivalent for floating point data types.
+
+    Examples
+    --------
+    With types:
+
+    >>> ii16 = np.iinfo(np.int16)
+    >>> ii16.min
+    -32768
+    >>> ii16.max
+    32767
+    >>> ii32 = np.iinfo(np.int32)
+    >>> ii32.min
+    -2147483648
+    >>> ii32.max
+    2147483647
+
+    With instances:
+
+    >>> ii32 = np.iinfo(np.int32(10))
+    >>> ii32.min
+    -2147483648
+    >>> ii32.max
+    2147483647
+
+    """
+
+    _min_vals = {}
+    _max_vals = {}
+
+    def __init__(self, int_type):
+        try:
+            self.dtype = numeric.dtype(int_type)
+        except TypeError:
+            self.dtype = numeric.dtype(type(int_type))
+        self.kind = self.dtype.kind
+        self.bits = self.dtype.itemsize * 8
+        self.key = "%s%d" % (self.kind, self.bits)
+        if self.kind not in 'iu':
+            raise ValueError("Invalid integer data type %r." % (self.kind,))
+
+    @property
+    def min(self):
+        """Minimum value of given dtype."""
+        if self.kind == 'u':
+            return 0
+        else:
+            try:
+                val = iinfo._min_vals[self.key]
+            except KeyError:
+                val = int(-(1 << (self.bits-1)))
+                iinfo._min_vals[self.key] = val
+            return val
+
+    @property
+    def max(self):
+        """Maximum value of given dtype."""
+        try:
+            val = iinfo._max_vals[self.key]
+        except KeyError:
+            if self.kind == 'u':
+                val = int((1 << self.bits) - 1)
+            else:
+                val = int((1 << (self.bits-1)) - 1)
+            iinfo._max_vals[self.key] = val
+        return val
+
+    def __str__(self):
+        """String representation."""
+        fmt = (
+            'Machine parameters for %(dtype)s\n'
+            '---------------------------------------------------------------\n'
+            'min = %(min)s\n'
+            'max = %(max)s\n'
+            '---------------------------------------------------------------\n'
+            )
+        return fmt % {'dtype': self.dtype, 'min': self.min, 'max': self.max}
+
+    def __repr__(self):
+        return "%s(min=%s, max=%s, dtype=%s)" % (self.__class__.__name__,
+                                    self.min, self.max, self.dtype)

env-llmeval/lib/python3.10/site-packages/numpy/core/getlimits.pyi

@@ -0,0 +1,6 @@
+from numpy import (
+    finfo as finfo,
+    iinfo as iinfo,
+)
+
+__all__: list[str]

env-llmeval/lib/python3.10/site-packages/numpy/core/multiarray.py

@@ -0,0 +1,1715 @@
+"""
+Create the numpy.core.multiarray namespace for backward compatibility. In v1.16
+the multiarray and umath c-extension modules were merged into a single
+_multiarray_umath extension module. So we replicate the old namespace
+by importing from the extension module.
+
+"""
+
+import functools
+from . import overrides
+from . import _multiarray_umath
+from ._multiarray_umath import *  # noqa: F403
+# These imports are needed for backward compatibility,
+# do not change them. issue gh-15518
+# _get_ndarray_c_version is semi-public, on purpose not added to __all__
+from ._multiarray_umath import (
+    fastCopyAndTranspose, _flagdict, from_dlpack, _place, _reconstruct,
+    _vec_string, _ARRAY_API, _monotonicity, _get_ndarray_c_version,
+    _get_madvise_hugepage, _set_madvise_hugepage,
+    _get_promotion_state, _set_promotion_state, _using_numpy2_behavior
+    )
+
+__all__ = [
+    '_ARRAY_API', 'ALLOW_THREADS', 'BUFSIZE', 'CLIP', 'DATETIMEUNITS',
+    'ITEM_HASOBJECT', 'ITEM_IS_POINTER', 'LIST_PICKLE', 'MAXDIMS',
+    'MAY_SHARE_BOUNDS', 'MAY_SHARE_EXACT', 'NEEDS_INIT', 'NEEDS_PYAPI',
+    'RAISE', 'USE_GETITEM', 'USE_SETITEM', 'WRAP',
+    '_flagdict', 'from_dlpack', '_place', '_reconstruct', '_vec_string',
+    '_monotonicity', 'add_docstring', 'arange', 'array', 'asarray',
+    'asanyarray', 'ascontiguousarray', 'asfortranarray', 'bincount',
+    'broadcast', 'busday_count', 'busday_offset', 'busdaycalendar', 'can_cast',
+    'compare_chararrays', 'concatenate', 'copyto', 'correlate', 'correlate2',
+    'count_nonzero', 'c_einsum', 'datetime_as_string', 'datetime_data',
+    'dot', 'dragon4_positional', 'dragon4_scientific', 'dtype',
+    'empty', 'empty_like', 'error', 'flagsobj', 'flatiter', 'format_longfloat',
+    'frombuffer', 'fromfile', 'fromiter', 'fromstring',
+    'get_handler_name', 'get_handler_version', 'inner', 'interp',
+    'interp_complex', 'is_busday', 'lexsort', 'matmul', 'may_share_memory',
+    'min_scalar_type', 'ndarray', 'nditer', 'nested_iters',
+    'normalize_axis_index', 'packbits', 'promote_types', 'putmask',
+    'ravel_multi_index', 'result_type', 'scalar', 'set_datetimeparse_function',
+    'set_legacy_print_mode', 'set_numeric_ops', 'set_string_function',
+    'set_typeDict', 'shares_memory', 'tracemalloc_domain', 'typeinfo',
+    'unpackbits', 'unravel_index', 'vdot', 'where', 'zeros',
+    '_get_promotion_state', '_set_promotion_state', '_using_numpy2_behavior']
+
+# For backward compatibility, make sure pickle imports these functions from here
+_reconstruct.__module__ = 'numpy.core.multiarray'
+scalar.__module__ = 'numpy.core.multiarray'
+
+
+from_dlpack.__module__ = 'numpy'
+arange.__module__ = 'numpy'
+array.__module__ = 'numpy'
+asarray.__module__ = 'numpy'
+asanyarray.__module__ = 'numpy'
+ascontiguousarray.__module__ = 'numpy'
+asfortranarray.__module__ = 'numpy'
+datetime_data.__module__ = 'numpy'
+empty.__module__ = 'numpy'
+frombuffer.__module__ = 'numpy'
+fromfile.__module__ = 'numpy'
+fromiter.__module__ = 'numpy'
+frompyfunc.__module__ = 'numpy'
+fromstring.__module__ = 'numpy'
+geterrobj.__module__ = 'numpy'
+may_share_memory.__module__ = 'numpy'
+nested_iters.__module__ = 'numpy'
+promote_types.__module__ = 'numpy'
+set_numeric_ops.__module__ = 'numpy'
+seterrobj.__module__ = 'numpy'
+zeros.__module__ = 'numpy'
+_get_promotion_state.__module__ = 'numpy'
+_set_promotion_state.__module__ = 'numpy'
+_using_numpy2_behavior.__module__ = 'numpy'
+
+
+# We can't verify dispatcher signatures because NumPy's C functions don't
+# support introspection.
+array_function_from_c_func_and_dispatcher = functools.partial(
+    overrides.array_function_from_dispatcher,
+    module='numpy', docs_from_dispatcher=True, verify=False)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.empty_like)
+def empty_like(prototype, dtype=None, order=None, subok=None, shape=None):
+    """
+    empty_like(prototype, dtype=None, order='K', subok=True, shape=None)
+
+    Return a new array with the same shape and type as a given array.
+
+    Parameters
+    ----------
+    prototype : array_like
+        The shape and data-type of `prototype` define these same attributes
+        of the returned array.
+    dtype : data-type, optional
+        Overrides the data type of the result.
+
+        .. versionadded:: 1.6.0
+    order : {'C', 'F', 'A', or 'K'}, optional
+        Overrides the memory layout of the result. 'C' means C-order,
+        'F' means F-order, 'A' means 'F' if `prototype` is Fortran
+        contiguous, 'C' otherwise. 'K' means match the layout of `prototype`
+        as closely as possible.
+
+        .. versionadded:: 1.6.0
+    subok : bool, optional.
+        If True, then the newly created array will use the sub-class
+        type of `prototype`, otherwise it will be a base-class array. Defaults
+        to True.
+    shape : int or sequence of ints, optional.
+        Overrides the shape of the result. If order='K' and the number of
+        dimensions is unchanged, will try to keep order, otherwise,
+        order='C' is implied.
+
+        .. versionadded:: 1.17.0
+
+    Returns
+    -------
+    out : ndarray
+        Array of uninitialized (arbitrary) data with the same
+        shape and type as `prototype`.
+
+    See Also
+    --------
+    ones_like : Return an array of ones with shape and type of input.
+    zeros_like : Return an array of zeros with shape and type of input.
+    full_like : Return a new array with shape of input filled with value.
+    empty : Return a new uninitialized array.
+
+    Notes
+    -----
+    This function does *not* initialize the returned array; to do that use
+    `zeros_like` or `ones_like` instead.  It may be marginally faster than
+    the functions that do set the array values.
+
+    Examples
+    --------
+    >>> a = ([1,2,3], [4,5,6])                         # a is array-like
+    >>> np.empty_like(a)
+    array([[-1073741821, -1073741821,           3],    # uninitialized
+           [          0,           0, -1073741821]])
+    >>> a = np.array([[1., 2., 3.],[4.,5.,6.]])
+    >>> np.empty_like(a)
+    array([[ -2.00000715e+000,   1.48219694e-323,  -2.00000572e+000], # uninitialized
+           [  4.38791518e-305,  -2.00000715e+000,   4.17269252e-309]])
+
+    """
+    return (prototype,)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.concatenate)
+def concatenate(arrays, axis=None, out=None, *, dtype=None, casting=None):
+    """
+    concatenate((a1, a2, ...), axis=0, out=None, dtype=None, casting="same_kind")
+
+    Join a sequence of arrays along an existing axis.
+
+    Parameters
+    ----------
+    a1, a2, ... : sequence of array_like
+        The arrays must have the same shape, except in the dimension
+        corresponding to `axis` (the first, by default).
+    axis : int, optional
+        The axis along which the arrays will be joined.  If axis is None,
+        arrays are flattened before use.  Default is 0.
+    out : ndarray, optional
+        If provided, the destination to place the result. The shape must be
+        correct, matching that of what concatenate would have returned if no
+        out argument were specified.
+    dtype : str or dtype
+        If provided, the destination array will have this dtype. Cannot be
+        provided together with `out`.
+
+        .. versionadded:: 1.20.0
+
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur. Defaults to 'same_kind'.
+
+        .. versionadded:: 1.20.0
+
+    Returns
+    -------
+    res : ndarray
+        The concatenated array.
+
+    See Also
+    --------
+    ma.concatenate : Concatenate function that preserves input masks.
+    array_split : Split an array into multiple sub-arrays of equal or
+                  near-equal size.
+    split : Split array into a list of multiple sub-arrays of equal size.
+    hsplit : Split array into multiple sub-arrays horizontally (column wise).
+    vsplit : Split array into multiple sub-arrays vertically (row wise).
+    dsplit : Split array into multiple sub-arrays along the 3rd axis (depth).
+    stack : Stack a sequence of arrays along a new axis.
+    block : Assemble arrays from blocks.
+    hstack : Stack arrays in sequence horizontally (column wise).
+    vstack : Stack arrays in sequence vertically (row wise).
+    dstack : Stack arrays in sequence depth wise (along third dimension).
+    column_stack : Stack 1-D arrays as columns into a 2-D array.
+
+    Notes
+    -----
+    When one or more of the arrays to be concatenated is a MaskedArray,
+    this function will return a MaskedArray object instead of an ndarray,
+    but the input masks are *not* preserved. In cases where a MaskedArray
+    is expected as input, use the ma.concatenate function from the masked
+    array module instead.
+
+    Examples
+    --------
+    >>> a = np.array([[1, 2], [3, 4]])
+    >>> b = np.array([[5, 6]])
+    >>> np.concatenate((a, b), axis=0)
+    array([[1, 2],
+           [3, 4],
+           [5, 6]])
+    >>> np.concatenate((a, b.T), axis=1)
+    array([[1, 2, 5],
+           [3, 4, 6]])
+    >>> np.concatenate((a, b), axis=None)
+    array([1, 2, 3, 4, 5, 6])
+
+    This function will not preserve masking of MaskedArray inputs.
+
+    >>> a = np.ma.arange(3)
+    >>> a[1] = np.ma.masked
+    >>> b = np.arange(2, 5)
+    >>> a
+    masked_array(data=[0, --, 2],
+                 mask=[False,  True, False],
+           fill_value=999999)
+    >>> b
+    array([2, 3, 4])
+    >>> np.concatenate([a, b])
+    masked_array(data=[0, 1, 2, 2, 3, 4],
+                 mask=False,
+           fill_value=999999)
+    >>> np.ma.concatenate([a, b])
+    masked_array(data=[0, --, 2, 2, 3, 4],
+                 mask=[False,  True, False, False, False, False],
+           fill_value=999999)
+
+    """
+    if out is not None:
+        # optimize for the typical case where only arrays is provided
+        arrays = list(arrays)
+        arrays.append(out)
+    return arrays
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.inner)
+def inner(a, b):
+    """
+    inner(a, b, /)
+
+    Inner product of two arrays.
+
+    Ordinary inner product of vectors for 1-D arrays (without complex
+    conjugation), in higher dimensions a sum product over the last axes.
+
+    Parameters
+    ----------
+    a, b : array_like
+        If `a` and `b` are nonscalar, their last dimensions must match.
+
+    Returns
+    -------
+    out : ndarray
+        If `a` and `b` are both
+        scalars or both 1-D arrays then a scalar is returned; otherwise
+        an array is returned.
+        ``out.shape = (*a.shape[:-1], *b.shape[:-1])``
+
+    Raises
+    ------
+    ValueError
+        If both `a` and `b` are nonscalar and their last dimensions have
+        different sizes.
+
+    See Also
+    --------
+    tensordot : Sum products over arbitrary axes.
+    dot : Generalised matrix product, using second last dimension of `b`.
+    einsum : Einstein summation convention.
+
+    Notes
+    -----
+    For vectors (1-D arrays) it computes the ordinary inner-product::
+
+        np.inner(a, b) = sum(a[:]*b[:])
+
+    More generally, if ``ndim(a) = r > 0`` and ``ndim(b) = s > 0``::
+
+        np.inner(a, b) = np.tensordot(a, b, axes=(-1,-1))
+
+    or explicitly::
+
+        np.inner(a, b)[i0,...,ir-2,j0,...,js-2]
+             = sum(a[i0,...,ir-2,:]*b[j0,...,js-2,:])
+
+    In addition `a` or `b` may be scalars, in which case::
+
+       np.inner(a,b) = a*b
+
+    Examples
+    --------
+    Ordinary inner product for vectors:
+
+    >>> a = np.array([1,2,3])
+    >>> b = np.array([0,1,0])
+    >>> np.inner(a, b)
+    2
+
+    Some multidimensional examples:
+
+    >>> a = np.arange(24).reshape((2,3,4))
+    >>> b = np.arange(4)
+    >>> c = np.inner(a, b)
+    >>> c.shape
+    (2, 3)
+    >>> c
+    array([[ 14,  38,  62],
+           [ 86, 110, 134]])
+
+    >>> a = np.arange(2).reshape((1,1,2))
+    >>> b = np.arange(6).reshape((3,2))
+    >>> c = np.inner(a, b)
+    >>> c.shape
+    (1, 1, 3)
+    >>> c
+    array([[[1, 3, 5]]])
+
+    An example where `b` is a scalar:
+
+    >>> np.inner(np.eye(2), 7)
+    array([[7., 0.],
+           [0., 7.]])
+
+    """
+    return (a, b)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.where)
+def where(condition, x=None, y=None):
+    """
+    where(condition, [x, y], /)
+
+    Return elements chosen from `x` or `y` depending on `condition`.
+
+    .. note::
+        When only `condition` is provided, this function is a shorthand for
+        ``np.asarray(condition).nonzero()``. Using `nonzero` directly should be
+        preferred, as it behaves correctly for subclasses. The rest of this
+        documentation covers only the case where all three arguments are
+        provided.
+
+    Parameters
+    ----------
+    condition : array_like, bool
+        Where True, yield `x`, otherwise yield `y`.
+    x, y : array_like
+        Values from which to choose. `x`, `y` and `condition` need to be
+        broadcastable to some shape.
+
+    Returns
+    -------
+    out : ndarray
+        An array with elements from `x` where `condition` is True, and elements
+        from `y` elsewhere.
+
+    See Also
+    --------
+    choose
+    nonzero : The function that is called when x and y are omitted
+
+    Notes
+    -----
+    If all the arrays are 1-D, `where` is equivalent to::
+
+        [xv if c else yv
+         for c, xv, yv in zip(condition, x, y)]
+
+    Examples
+    --------
+    >>> a = np.arange(10)
+    >>> a
+    array([0, 1, 2, 3, 4, 5, 6, 7, 8, 9])
+    >>> np.where(a < 5, a, 10*a)
+    array([ 0,  1,  2,  3,  4, 50, 60, 70, 80, 90])
+
+    This can be used on multidimensional arrays too:
+
+    >>> np.where([[True, False], [True, True]],
+    ...          [[1, 2], [3, 4]],
+    ...          [[9, 8], [7, 6]])
+    array([[1, 8],
+           [3, 4]])
+
+    The shapes of x, y, and the condition are broadcast together:
+
+    >>> x, y = np.ogrid[:3, :4]
+    >>> np.where(x < y, x, 10 + y)  # both x and 10+y are broadcast
+    array([[10,  0,  0,  0],
+           [10, 11,  1,  1],
+           [10, 11, 12,  2]])
+
+    >>> a = np.array([[0, 1, 2],
+    ...               [0, 2, 4],
+    ...               [0, 3, 6]])
+    >>> np.where(a < 4, a, -1)  # -1 is broadcast
+    array([[ 0,  1,  2],
+           [ 0,  2, -1],
+           [ 0,  3, -1]])
+    """
+    return (condition, x, y)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.lexsort)
+def lexsort(keys, axis=None):
+    """
+    lexsort(keys, axis=-1)
+
+    Perform an indirect stable sort using a sequence of keys.
+
+    Given multiple sorting keys, which can be interpreted as columns in a
+    spreadsheet, lexsort returns an array of integer indices that describes
+    the sort order by multiple columns. The last key in the sequence is used
+    for the primary sort order, the second-to-last key for the secondary sort
+    order, and so on. The keys argument must be a sequence of objects that
+    can be converted to arrays of the same shape. If a 2D array is provided
+    for the keys argument, its rows are interpreted as the sorting keys and
+    sorting is according to the last row, second last row etc.
+
+    Parameters
+    ----------
+    keys : (k, N) array or tuple containing k (N,)-shaped sequences
+        The `k` different "columns" to be sorted.  The last column (or row if
+        `keys` is a 2D array) is the primary sort key.
+    axis : int, optional
+        Axis to be indirectly sorted.  By default, sort over the last axis.
+
+    Returns
+    -------
+    indices : (N,) ndarray of ints
+        Array of indices that sort the keys along the specified axis.
+
+    See Also
+    --------
+    argsort : Indirect sort.
+    ndarray.sort : In-place sort.
+    sort : Return a sorted copy of an array.
+
+    Examples
+    --------
+    Sort names: first by surname, then by name.
+
+    >>> surnames =    ('Hertz',    'Galilei', 'Hertz')
+    >>> first_names = ('Heinrich', 'Galileo', 'Gustav')
+    >>> ind = np.lexsort((first_names, surnames))
+    >>> ind
+    array([1, 2, 0])
+
+    >>> [surnames[i] + ", " + first_names[i] for i in ind]
+    ['Galilei, Galileo', 'Hertz, Gustav', 'Hertz, Heinrich']
+
+    Sort two columns of numbers:
+
+    >>> a = [1,5,1,4,3,4,4] # First column
+    >>> b = [9,4,0,4,0,2,1] # Second column
+    >>> ind = np.lexsort((b,a)) # Sort by a, then by b
+    >>> ind
+    array([2, 0, 4, 6, 5, 3, 1])
+
+    >>> [(a[i],b[i]) for i in ind]
+    [(1, 0), (1, 9), (3, 0), (4, 1), (4, 2), (4, 4), (5, 4)]
+
+    Note that sorting is first according to the elements of ``a``.
+    Secondary sorting is according to the elements of ``b``.
+
+    A normal ``argsort`` would have yielded:
+
+    >>> [(a[i],b[i]) for i in np.argsort(a)]
+    [(1, 9), (1, 0), (3, 0), (4, 4), (4, 2), (4, 1), (5, 4)]
+
+    Structured arrays are sorted lexically by ``argsort``:
+
+    >>> x = np.array([(1,9), (5,4), (1,0), (4,4), (3,0), (4,2), (4,1)],
+    ...              dtype=np.dtype([('x', int), ('y', int)]))
+
+    >>> np.argsort(x) # or np.argsort(x, order=('x', 'y'))
+    array([2, 0, 4, 6, 5, 3, 1])
+
+    """
+    if isinstance(keys, tuple):
+        return keys
+    else:
+        return (keys,)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.can_cast)
+def can_cast(from_, to, casting=None):
+    """
+    can_cast(from_, to, casting='safe')
+
+    Returns True if cast between data types can occur according to the
+    casting rule.  If from is a scalar or array scalar, also returns
+    True if the scalar value can be cast without overflow or truncation
+    to an integer.
+
+    Parameters
+    ----------
+    from_ : dtype, dtype specifier, scalar, or array
+        Data type, scalar, or array to cast from.
+    to : dtype or dtype specifier
+        Data type to cast to.
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur.
+
+          * 'no' means the data types should not be cast at all.
+          * 'equiv' means only byte-order changes are allowed.
+          * 'safe' means only casts which can preserve values are allowed.
+          * 'same_kind' means only safe casts or casts within a kind,
+            like float64 to float32, are allowed.
+          * 'unsafe' means any data conversions may be done.
+
+    Returns
+    -------
+    out : bool
+        True if cast can occur according to the casting rule.
+
+    Notes
+    -----
+    .. versionchanged:: 1.17.0
+       Casting between a simple data type and a structured one is possible only
+       for "unsafe" casting.  Casting to multiple fields is allowed, but
+       casting from multiple fields is not.
+
+    .. versionchanged:: 1.9.0
+       Casting from numeric to string types in 'safe' casting mode requires
+       that the string dtype length is long enough to store the maximum
+       integer/float value converted.
+
+    See also
+    --------
+    dtype, result_type
+
+    Examples
+    --------
+    Basic examples
+
+    >>> np.can_cast(np.int32, np.int64)
+    True
+    >>> np.can_cast(np.float64, complex)
+    True
+    >>> np.can_cast(complex, float)
+    False
+
+    >>> np.can_cast('i8', 'f8')
+    True
+    >>> np.can_cast('i8', 'f4')
+    False
+    >>> np.can_cast('i4', 'S4')
+    False
+
+    Casting scalars
+
+    >>> np.can_cast(100, 'i1')
+    True
+    >>> np.can_cast(150, 'i1')
+    False
+    >>> np.can_cast(150, 'u1')
+    True
+
+    >>> np.can_cast(3.5e100, np.float32)
+    False
+    >>> np.can_cast(1000.0, np.float32)
+    True
+
+    Array scalar checks the value, array does not
+
+    >>> np.can_cast(np.array(1000.0), np.float32)
+    True
+    >>> np.can_cast(np.array([1000.0]), np.float32)
+    False
+
+    Using the casting rules
+
+    >>> np.can_cast('i8', 'i8', 'no')
+    True
+    >>> np.can_cast('<i8', '>i8', 'no')
+    False
+
+    >>> np.can_cast('<i8', '>i8', 'equiv')
+    True
+    >>> np.can_cast('<i4', '>i8', 'equiv')
+    False
+
+    >>> np.can_cast('<i4', '>i8', 'safe')
+    True
+    >>> np.can_cast('<i8', '>i4', 'safe')
+    False
+
+    >>> np.can_cast('<i8', '>i4', 'same_kind')
+    True
+    >>> np.can_cast('<i8', '>u4', 'same_kind')
+    False
+
+    >>> np.can_cast('<i8', '>u4', 'unsafe')
+    True
+
+    """
+    return (from_,)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.min_scalar_type)
+def min_scalar_type(a):
+    """
+    min_scalar_type(a, /)
+
+    For scalar ``a``, returns the data type with the smallest size
+    and smallest scalar kind which can hold its value.  For non-scalar
+    array ``a``, returns the vector's dtype unmodified.
+
+    Floating point values are not demoted to integers,
+    and complex values are not demoted to floats.
+
+    Parameters
+    ----------
+    a : scalar or array_like
+        The value whose minimal data type is to be found.
+
+    Returns
+    -------
+    out : dtype
+        The minimal data type.
+
+    Notes
+    -----
+    .. versionadded:: 1.6.0
+
+    See Also
+    --------
+    result_type, promote_types, dtype, can_cast
+
+    Examples
+    --------
+    >>> np.min_scalar_type(10)
+    dtype('uint8')
+
+    >>> np.min_scalar_type(-260)
+    dtype('int16')
+
+    >>> np.min_scalar_type(3.1)
+    dtype('float16')
+
+    >>> np.min_scalar_type(1e50)
+    dtype('float64')
+
+    >>> np.min_scalar_type(np.arange(4,dtype='f8'))
+    dtype('float64')
+
+    """
+    return (a,)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.result_type)
+def result_type(*arrays_and_dtypes):
+    """
+    result_type(*arrays_and_dtypes)
+
+    Returns the type that results from applying the NumPy
+    type promotion rules to the arguments.
+
+    Type promotion in NumPy works similarly to the rules in languages
+    like C++, with some slight differences.  When both scalars and
+    arrays are used, the array's type takes precedence and the actual value
+    of the scalar is taken into account.
+
+    For example, calculating 3*a, where a is an array of 32-bit floats,
+    intuitively should result in a 32-bit float output.  If the 3 is a
+    32-bit integer, the NumPy rules indicate it can't convert losslessly
+    into a 32-bit float, so a 64-bit float should be the result type.
+    By examining the value of the constant, '3', we see that it fits in
+    an 8-bit integer, which can be cast losslessly into the 32-bit float.
+
+    Parameters
+    ----------
+    arrays_and_dtypes : list of arrays and dtypes
+        The operands of some operation whose result type is needed.
+
+    Returns
+    -------
+    out : dtype
+        The result type.
+
+    See also
+    --------
+    dtype, promote_types, min_scalar_type, can_cast
+
+    Notes
+    -----
+    .. versionadded:: 1.6.0
+
+    The specific algorithm used is as follows.
+
+    Categories are determined by first checking which of boolean,
+    integer (int/uint), or floating point (float/complex) the maximum
+    kind of all the arrays and the scalars are.
+
+    If there are only scalars or the maximum category of the scalars
+    is higher than the maximum category of the arrays,
+    the data types are combined with :func:`promote_types`
+    to produce the return value.
+
+    Otherwise, `min_scalar_type` is called on each scalar, and
+    the resulting data types are all combined with :func:`promote_types`
+    to produce the return value.
+
+    The set of int values is not a subset of the uint values for types
+    with the same number of bits, something not reflected in
+    :func:`min_scalar_type`, but handled as a special case in `result_type`.
+
+    Examples
+    --------
+    >>> np.result_type(3, np.arange(7, dtype='i1'))
+    dtype('int8')
+
+    >>> np.result_type('i4', 'c8')
+    dtype('complex128')
+
+    >>> np.result_type(3.0, -2)
+    dtype('float64')
+
+    """
+    return arrays_and_dtypes
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.dot)
+def dot(a, b, out=None):
+    """
+    dot(a, b, out=None)
+
+    Dot product of two arrays. Specifically,
+
+    - If both `a` and `b` are 1-D arrays, it is inner product of vectors
+      (without complex conjugation).
+
+    - If both `a` and `b` are 2-D arrays, it is matrix multiplication,
+      but using :func:`matmul` or ``a @ b`` is preferred.
+
+    - If either `a` or `b` is 0-D (scalar), it is equivalent to
+      :func:`multiply` and using ``numpy.multiply(a, b)`` or ``a * b`` is
+      preferred.
+
+    - If `a` is an N-D array and `b` is a 1-D array, it is a sum product over
+      the last axis of `a` and `b`.
+
+    - If `a` is an N-D array and `b` is an M-D array (where ``M>=2``), it is a
+      sum product over the last axis of `a` and the second-to-last axis of
+      `b`::
+
+        dot(a, b)[i,j,k,m] = sum(a[i,j,:] * b[k,:,m])
+
+    It uses an optimized BLAS library when possible (see `numpy.linalg`).
+
+    Parameters
+    ----------
+    a : array_like
+        First argument.
+    b : array_like
+        Second argument.
+    out : ndarray, optional
+        Output argument. This must have the exact kind that would be returned
+        if it was not used. In particular, it must have the right type, must be
+        C-contiguous, and its dtype must be the dtype that would be returned
+        for `dot(a,b)`. This is a performance feature. Therefore, if these
+        conditions are not met, an exception is raised, instead of attempting
+        to be flexible.
+
+    Returns
+    -------
+    output : ndarray
+        Returns the dot product of `a` and `b`.  If `a` and `b` are both
+        scalars or both 1-D arrays then a scalar is returned; otherwise
+        an array is returned.
+        If `out` is given, then it is returned.
+
+    Raises
+    ------
+    ValueError
+        If the last dimension of `a` is not the same size as
+        the second-to-last dimension of `b`.
+
+    See Also
+    --------
+    vdot : Complex-conjugating dot product.
+    tensordot : Sum products over arbitrary axes.
+    einsum : Einstein summation convention.
+    matmul : '@' operator as method with out parameter.
+    linalg.multi_dot : Chained dot product.
+
+    Examples
+    --------
+    >>> np.dot(3, 4)
+    12
+
+    Neither argument is complex-conjugated:
+
+    >>> np.dot([2j, 3j], [2j, 3j])
+    (-13+0j)
+
+    For 2-D arrays it is the matrix product:
+
+    >>> a = [[1, 0], [0, 1]]
+    >>> b = [[4, 1], [2, 2]]
+    >>> np.dot(a, b)
+    array([[4, 1],
+           [2, 2]])
+
+    >>> a = np.arange(3*4*5*6).reshape((3,4,5,6))
+    >>> b = np.arange(3*4*5*6)[::-1].reshape((5,4,6,3))
+    >>> np.dot(a, b)[2,3,2,1,2,2]
+    499128
+    >>> sum(a[2,3,2,:] * b[1,2,:,2])
+    499128
+
+    """
+    return (a, b, out)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.vdot)
+def vdot(a, b):
+    """
+    vdot(a, b, /)
+
+    Return the dot product of two vectors.
+
+    The vdot(`a`, `b`) function handles complex numbers differently than
+    dot(`a`, `b`).  If the first argument is complex the complex conjugate
+    of the first argument is used for the calculation of the dot product.
+
+    Note that `vdot` handles multidimensional arrays differently than `dot`:
+    it does *not* perform a matrix product, but flattens input arguments
+    to 1-D vectors first. Consequently, it should only be used for vectors.
+
+    Parameters
+    ----------
+    a : array_like
+        If `a` is complex the complex conjugate is taken before calculation
+        of the dot product.
+    b : array_like
+        Second argument to the dot product.
+
+    Returns
+    -------
+    output : ndarray
+        Dot product of `a` and `b`.  Can be an int, float, or
+        complex depending on the types of `a` and `b`.
+
+    See Also
+    --------
+    dot : Return the dot product without using the complex conjugate of the
+          first argument.
+
+    Examples
+    --------
+    >>> a = np.array([1+2j,3+4j])
+    >>> b = np.array([5+6j,7+8j])
+    >>> np.vdot(a, b)
+    (70-8j)
+    >>> np.vdot(b, a)
+    (70+8j)
+
+    Note that higher-dimensional arrays are flattened!
+
+    >>> a = np.array([[1, 4], [5, 6]])
+    >>> b = np.array([[4, 1], [2, 2]])
+    >>> np.vdot(a, b)
+    30
+    >>> np.vdot(b, a)
+    30
+    >>> 1*4 + 4*1 + 5*2 + 6*2
+    30
+
+    """
+    return (a, b)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.bincount)
+def bincount(x, weights=None, minlength=None):
+    """
+    bincount(x, /, weights=None, minlength=0)
+
+    Count number of occurrences of each value in array of non-negative ints.
+
+    The number of bins (of size 1) is one larger than the largest value in
+    `x`. If `minlength` is specified, there will be at least this number
+    of bins in the output array (though it will be longer if necessary,
+    depending on the contents of `x`).
+    Each bin gives the number of occurrences of its index value in `x`.
+    If `weights` is specified the input array is weighted by it, i.e. if a
+    value ``n`` is found at position ``i``, ``out[n] += weight[i]`` instead
+    of ``out[n] += 1``.
+
+    Parameters
+    ----------
+    x : array_like, 1 dimension, nonnegative ints
+        Input array.
+    weights : array_like, optional
+        Weights, array of the same shape as `x`.
+    minlength : int, optional
+        A minimum number of bins for the output array.
+
+        .. versionadded:: 1.6.0
+
+    Returns
+    -------
+    out : ndarray of ints
+        The result of binning the input array.
+        The length of `out` is equal to ``np.amax(x)+1``.
+
+    Raises
+    ------
+    ValueError
+        If the input is not 1-dimensional, or contains elements with negative
+        values, or if `minlength` is negative.
+    TypeError
+        If the type of the input is float or complex.
+
+    See Also
+    --------
+    histogram, digitize, unique
+
+    Examples
+    --------
+    >>> np.bincount(np.arange(5))
+    array([1, 1, 1, 1, 1])
+    >>> np.bincount(np.array([0, 1, 1, 3, 2, 1, 7]))
+    array([1, 3, 1, 1, 0, 0, 0, 1])
+
+    >>> x = np.array([0, 1, 1, 3, 2, 1, 7, 23])
+    >>> np.bincount(x).size == np.amax(x)+1
+    True
+
+    The input array needs to be of integer dtype, otherwise a
+    TypeError is raised:
+
+    >>> np.bincount(np.arange(5, dtype=float))
+    Traceback (most recent call last):
+      ...
+    TypeError: Cannot cast array data from dtype('float64') to dtype('int64')
+    according to the rule 'safe'
+
+    A possible use of ``bincount`` is to perform sums over
+    variable-size chunks of an array, using the ``weights`` keyword.
+
+    >>> w = np.array([0.3, 0.5, 0.2, 0.7, 1., -0.6]) # weights
+    >>> x = np.array([0, 1, 1, 2, 2, 2])
+    >>> np.bincount(x,  weights=w)
+    array([ 0.3,  0.7,  1.1])
+
+    """
+    return (x, weights)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.ravel_multi_index)
+def ravel_multi_index(multi_index, dims, mode=None, order=None):
+    """
+    ravel_multi_index(multi_index, dims, mode='raise', order='C')
+
+    Converts a tuple of index arrays into an array of flat
+    indices, applying boundary modes to the multi-index.
+
+    Parameters
+    ----------
+    multi_index : tuple of array_like
+        A tuple of integer arrays, one array for each dimension.
+    dims : tuple of ints
+        The shape of array into which the indices from ``multi_index`` apply.
+    mode : {'raise', 'wrap', 'clip'}, optional
+        Specifies how out-of-bounds indices are handled.  Can specify
+        either one mode or a tuple of modes, one mode per index.
+
+        * 'raise' -- raise an error (default)
+        * 'wrap' -- wrap around
+        * 'clip' -- clip to the range
+
+        In 'clip' mode, a negative index which would normally
+        wrap will clip to 0 instead.
+    order : {'C', 'F'}, optional
+        Determines whether the multi-index should be viewed as
+        indexing in row-major (C-style) or column-major
+        (Fortran-style) order.
+
+    Returns
+    -------
+    raveled_indices : ndarray
+        An array of indices into the flattened version of an array
+        of dimensions ``dims``.
+
+    See Also
+    --------
+    unravel_index
+
+    Notes
+    -----
+    .. versionadded:: 1.6.0
+
+    Examples
+    --------
+    >>> arr = np.array([[3,6,6],[4,5,1]])
+    >>> np.ravel_multi_index(arr, (7,6))
+    array([22, 41, 37])
+    >>> np.ravel_multi_index(arr, (7,6), order='F')
+    array([31, 41, 13])
+    >>> np.ravel_multi_index(arr, (4,6), mode='clip')
+    array([22, 23, 19])
+    >>> np.ravel_multi_index(arr, (4,4), mode=('clip','wrap'))
+    array([12, 13, 13])
+
+    >>> np.ravel_multi_index((3,1,4,1), (6,7,8,9))
+    1621
+    """
+    return multi_index
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.unravel_index)
+def unravel_index(indices, shape=None, order=None):
+    """
+    unravel_index(indices, shape, order='C')
+
+    Converts a flat index or array of flat indices into a tuple
+    of coordinate arrays.
+
+    Parameters
+    ----------
+    indices : array_like
+        An integer array whose elements are indices into the flattened
+        version of an array of dimensions ``shape``. Before version 1.6.0,
+        this function accepted just one index value.
+    shape : tuple of ints
+        The shape of the array to use for unraveling ``indices``.
+
+        .. versionchanged:: 1.16.0
+            Renamed from ``dims`` to ``shape``.
+
+    order : {'C', 'F'}, optional
+        Determines whether the indices should be viewed as indexing in
+        row-major (C-style) or column-major (Fortran-style) order.
+
+        .. versionadded:: 1.6.0
+
+    Returns
+    -------
+    unraveled_coords : tuple of ndarray
+        Each array in the tuple has the same shape as the ``indices``
+        array.
+
+    See Also
+    --------
+    ravel_multi_index
+
+    Examples
+    --------
+    >>> np.unravel_index([22, 41, 37], (7,6))
+    (array([3, 6, 6]), array([4, 5, 1]))
+    >>> np.unravel_index([31, 41, 13], (7,6), order='F')
+    (array([3, 6, 6]), array([4, 5, 1]))
+
+    >>> np.unravel_index(1621, (6,7,8,9))
+    (3, 1, 4, 1)
+
+    """
+    return (indices,)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.copyto)
+def copyto(dst, src, casting=None, where=None):
+    """
+    copyto(dst, src, casting='same_kind', where=True)
+
+    Copies values from one array to another, broadcasting as necessary.
+
+    Raises a TypeError if the `casting` rule is violated, and if
+    `where` is provided, it selects which elements to copy.
+
+    .. versionadded:: 1.7.0
+
+    Parameters
+    ----------
+    dst : ndarray
+        The array into which values are copied.
+    src : array_like
+        The array from which values are copied.
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}, optional
+        Controls what kind of data casting may occur when copying.
+
+          * 'no' means the data types should not be cast at all.
+          * 'equiv' means only byte-order changes are allowed.
+          * 'safe' means only casts which can preserve values are allowed.
+          * 'same_kind' means only safe casts or casts within a kind,
+            like float64 to float32, are allowed.
+          * 'unsafe' means any data conversions may be done.
+    where : array_like of bool, optional
+        A boolean array which is broadcasted to match the dimensions
+        of `dst`, and selects elements to copy from `src` to `dst`
+        wherever it contains the value True.
+
+    Examples
+    --------
+    >>> A = np.array([4, 5, 6])
+    >>> B = [1, 2, 3]
+    >>> np.copyto(A, B)
+    >>> A
+    array([1, 2, 3])
+
+    >>> A = np.array([[1, 2, 3], [4, 5, 6]])
+    >>> B = [[4, 5, 6], [7, 8, 9]]
+    >>> np.copyto(A, B)
+    >>> A
+    array([[4, 5, 6],
+           [7, 8, 9]])
+
+    """
+    return (dst, src, where)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.putmask)
+def putmask(a, /, mask, values):
+    """
+    putmask(a, mask, values)
+
+    Changes elements of an array based on conditional and input values.
+
+    Sets ``a.flat[n] = values[n]`` for each n where ``mask.flat[n]==True``.
+
+    If `values` is not the same size as `a` and `mask` then it will repeat.
+    This gives behavior different from ``a[mask] = values``.
+
+    Parameters
+    ----------
+    a : ndarray
+        Target array.
+    mask : array_like
+        Boolean mask array. It has to be the same shape as `a`.
+    values : array_like
+        Values to put into `a` where `mask` is True. If `values` is smaller
+        than `a` it will be repeated.
+
+    See Also
+    --------
+    place, put, take, copyto
+
+    Examples
+    --------
+    >>> x = np.arange(6).reshape(2, 3)
+    >>> np.putmask(x, x>2, x**2)
+    >>> x
+    array([[ 0,  1,  2],
+           [ 9, 16, 25]])
+
+    If `values` is smaller than `a` it is repeated:
+
+    >>> x = np.arange(5)
+    >>> np.putmask(x, x>1, [-33, -44])
+    >>> x
+    array([  0,   1, -33, -44, -33])
+
+    """
+    return (a, mask, values)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.packbits)
+def packbits(a, axis=None, bitorder='big'):
+    """
+    packbits(a, /, axis=None, bitorder='big')
+
+    Packs the elements of a binary-valued array into bits in a uint8 array.
+
+    The result is padded to full bytes by inserting zero bits at the end.
+
+    Parameters
+    ----------
+    a : array_like
+        An array of integers or booleans whose elements should be packed to
+        bits.
+    axis : int, optional
+        The dimension over which bit-packing is done.
+        ``None`` implies packing the flattened array.
+    bitorder : {'big', 'little'}, optional
+        The order of the input bits. 'big' will mimic bin(val),
+        ``[0, 0, 0, 0, 0, 0, 1, 1] => 3 = 0b00000011``, 'little' will
+        reverse the order so ``[1, 1, 0, 0, 0, 0, 0, 0] => 3``.
+        Defaults to 'big'.
+
+        .. versionadded:: 1.17.0
+
+    Returns
+    -------
+    packed : ndarray
+        Array of type uint8 whose elements represent bits corresponding to the
+        logical (0 or nonzero) value of the input elements. The shape of
+        `packed` has the same number of dimensions as the input (unless `axis`
+        is None, in which case the output is 1-D).
+
+    See Also
+    --------
+    unpackbits: Unpacks elements of a uint8 array into a binary-valued output
+                array.
+
+    Examples
+    --------
+    >>> a = np.array([[[1,0,1],
+    ...                [0,1,0]],
+    ...               [[1,1,0],
+    ...                [0,0,1]]])
+    >>> b = np.packbits(a, axis=-1)
+    >>> b
+    array([[[160],
+            [ 64]],
+           [[192],
+            [ 32]]], dtype=uint8)
+
+    Note that in binary 160 = 1010 0000, 64 = 0100 0000, 192 = 1100 0000,
+    and 32 = 0010 0000.
+
+    """
+    return (a,)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.unpackbits)
+def unpackbits(a, axis=None, count=None, bitorder='big'):
+    """
+    unpackbits(a, /, axis=None, count=None, bitorder='big')
+
+    Unpacks elements of a uint8 array into a binary-valued output array.
+
+    Each element of `a` represents a bit-field that should be unpacked
+    into a binary-valued output array. The shape of the output array is
+    either 1-D (if `axis` is ``None``) or the same shape as the input
+    array with unpacking done along the axis specified.
+
+    Parameters
+    ----------
+    a : ndarray, uint8 type
+       Input array.
+    axis : int, optional
+        The dimension over which bit-unpacking is done.
+        ``None`` implies unpacking the flattened array.
+    count : int or None, optional
+        The number of elements to unpack along `axis`, provided as a way
+        of undoing the effect of packing a size that is not a multiple
+        of eight. A non-negative number means to only unpack `count`
+        bits. A negative number means to trim off that many bits from
+        the end. ``None`` means to unpack the entire array (the
+        default). Counts larger than the available number of bits will
+        add zero padding to the output. Negative counts must not
+        exceed the available number of bits.
+
+        .. versionadded:: 1.17.0
+
+    bitorder : {'big', 'little'}, optional
+        The order of the returned bits. 'big' will mimic bin(val),
+        ``3 = 0b00000011 => [0, 0, 0, 0, 0, 0, 1, 1]``, 'little' will reverse
+        the order to ``[1, 1, 0, 0, 0, 0, 0, 0]``.
+        Defaults to 'big'.
+
+        .. versionadded:: 1.17.0
+
+    Returns
+    -------
+    unpacked : ndarray, uint8 type
+       The elements are binary-valued (0 or 1).
+
+    See Also
+    --------
+    packbits : Packs the elements of a binary-valued array into bits in
+               a uint8 array.
+
+    Examples
+    --------
+    >>> a = np.array([[2], [7], [23]], dtype=np.uint8)
+    >>> a
+    array([[ 2],
+           [ 7],
+           [23]], dtype=uint8)
+    >>> b = np.unpackbits(a, axis=1)
+    >>> b
+    array([[0, 0, 0, 0, 0, 0, 1, 0],
+           [0, 0, 0, 0, 0, 1, 1, 1],
+           [0, 0, 0, 1, 0, 1, 1, 1]], dtype=uint8)
+    >>> c = np.unpackbits(a, axis=1, count=-3)
+    >>> c
+    array([[0, 0, 0, 0, 0],
+           [0, 0, 0, 0, 0],
+           [0, 0, 0, 1, 0]], dtype=uint8)
+
+    >>> p = np.packbits(b, axis=0)
+    >>> np.unpackbits(p, axis=0)
+    array([[0, 0, 0, 0, 0, 0, 1, 0],
+           [0, 0, 0, 0, 0, 1, 1, 1],
+           [0, 0, 0, 1, 0, 1, 1, 1],
+           [0, 0, 0, 0, 0, 0, 0, 0],
+           [0, 0, 0, 0, 0, 0, 0, 0],
+           [0, 0, 0, 0, 0, 0, 0, 0],
+           [0, 0, 0, 0, 0, 0, 0, 0],
+           [0, 0, 0, 0, 0, 0, 0, 0]], dtype=uint8)
+    >>> np.array_equal(b, np.unpackbits(p, axis=0, count=b.shape[0]))
+    True
+
+    """
+    return (a,)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.shares_memory)
+def shares_memory(a, b, max_work=None):
+    """
+    shares_memory(a, b, /, max_work=None)
+
+    Determine if two arrays share memory.
+
+    .. warning::
+
+       This function can be exponentially slow for some inputs, unless
+       `max_work` is set to a finite number or ``MAY_SHARE_BOUNDS``.
+       If in doubt, use `numpy.may_share_memory` instead.
+
+    Parameters
+    ----------
+    a, b : ndarray
+        Input arrays
+    max_work : int, optional
+        Effort to spend on solving the overlap problem (maximum number
+        of candidate solutions to consider). The following special
+        values are recognized:
+
+        max_work=MAY_SHARE_EXACT  (default)
+            The problem is solved exactly. In this case, the function returns
+            True only if there is an element shared between the arrays. Finding
+            the exact solution may take extremely long in some cases.
+        max_work=MAY_SHARE_BOUNDS
+            Only the memory bounds of a and b are checked.
+
+    Raises
+    ------
+    numpy.exceptions.TooHardError
+        Exceeded max_work.
+
+    Returns
+    -------
+    out : bool
+
+    See Also
+    --------
+    may_share_memory
+
+    Examples
+    --------
+    >>> x = np.array([1, 2, 3, 4])
+    >>> np.shares_memory(x, np.array([5, 6, 7]))
+    False
+    >>> np.shares_memory(x[::2], x)
+    True
+    >>> np.shares_memory(x[::2], x[1::2])
+    False
+
+    Checking whether two arrays share memory is NP-complete, and
+    runtime may increase exponentially in the number of
+    dimensions. Hence, `max_work` should generally be set to a finite
+    number, as it is possible to construct examples that take
+    extremely long to run:
+
+    >>> from numpy.lib.stride_tricks import as_strided
+    >>> x = np.zeros([192163377], dtype=np.int8)
+    >>> x1 = as_strided(x, strides=(36674, 61119, 85569), shape=(1049, 1049, 1049))
+    >>> x2 = as_strided(x[64023025:], strides=(12223, 12224, 1), shape=(1049, 1049, 1))
+    >>> np.shares_memory(x1, x2, max_work=1000)
+    Traceback (most recent call last):
+    ...
+    numpy.exceptions.TooHardError: Exceeded max_work
+
+    Running ``np.shares_memory(x1, x2)`` without `max_work` set takes
+    around 1 minute for this case. It is possible to find problems
+    that take still significantly longer.
+
+    """
+    return (a, b)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.may_share_memory)
+def may_share_memory(a, b, max_work=None):
+    """
+    may_share_memory(a, b, /, max_work=None)
+
+    Determine if two arrays might share memory
+
+    A return of True does not necessarily mean that the two arrays
+    share any element.  It just means that they *might*.
+
+    Only the memory bounds of a and b are checked by default.
+
+    Parameters
+    ----------
+    a, b : ndarray
+        Input arrays
+    max_work : int, optional
+        Effort to spend on solving the overlap problem.  See
+        `shares_memory` for details.  Default for ``may_share_memory``
+        is to do a bounds check.
+
+    Returns
+    -------
+    out : bool
+
+    See Also
+    --------
+    shares_memory
+
+    Examples
+    --------
+    >>> np.may_share_memory(np.array([1,2]), np.array([5,8,9]))
+    False
+    >>> x = np.zeros([3, 4])
+    >>> np.may_share_memory(x[:,0], x[:,1])
+    True
+
+    """
+    return (a, b)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.is_busday)
+def is_busday(dates, weekmask=None, holidays=None, busdaycal=None, out=None):
+    """
+    is_busday(dates, weekmask='1111100', holidays=None, busdaycal=None, out=None)
+
+    Calculates which of the given dates are valid days, and which are not.
+
+    .. versionadded:: 1.7.0
+
+    Parameters
+    ----------
+    dates : array_like of datetime64[D]
+        The array of dates to process.
+    weekmask : str or array_like of bool, optional
+        A seven-element array indicating which of Monday through Sunday are
+        valid days. May be specified as a length-seven list or array, like
+        [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string
+        like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for
+        weekdays, optionally separated by white space. Valid abbreviations
+        are: Mon Tue Wed Thu Fri Sat Sun
+    holidays : array_like of datetime64[D], optional
+        An array of dates to consider as invalid dates.  They may be
+        specified in any order, and NaT (not-a-time) dates are ignored.
+        This list is saved in a normalized form that is suited for
+        fast calculations of valid days.
+    busdaycal : busdaycalendar, optional
+        A `busdaycalendar` object which specifies the valid days. If this
+        parameter is provided, neither weekmask nor holidays may be
+        provided.
+    out : array of bool, optional
+        If provided, this array is filled with the result.
+
+    Returns
+    -------
+    out : array of bool
+        An array with the same shape as ``dates``, containing True for
+        each valid day, and False for each invalid day.
+
+    See Also
+    --------
+    busdaycalendar : An object that specifies a custom set of valid days.
+    busday_offset : Applies an offset counted in valid days.
+    busday_count : Counts how many valid days are in a half-open date range.
+
+    Examples
+    --------
+    >>> # The weekdays are Friday, Saturday, and Monday
+    ... np.is_busday(['2011-07-01', '2011-07-02', '2011-07-18'],
+    ...                 holidays=['2011-07-01', '2011-07-04', '2011-07-17'])
+    array([False, False,  True])
+    """
+    return (dates, weekmask, holidays, out)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.busday_offset)
+def busday_offset(dates, offsets, roll=None, weekmask=None, holidays=None,
+                  busdaycal=None, out=None):
+    """
+    busday_offset(dates, offsets, roll='raise', weekmask='1111100', holidays=None, busdaycal=None, out=None)
+
+    First adjusts the date to fall on a valid day according to
+    the ``roll`` rule, then applies offsets to the given dates
+    counted in valid days.
+
+    .. versionadded:: 1.7.0
+
+    Parameters
+    ----------
+    dates : array_like of datetime64[D]
+        The array of dates to process.
+    offsets : array_like of int
+        The array of offsets, which is broadcast with ``dates``.
+    roll : {'raise', 'nat', 'forward', 'following', 'backward', 'preceding', 'modifiedfollowing', 'modifiedpreceding'}, optional
+        How to treat dates that do not fall on a valid day. The default
+        is 'raise'.
+
+          * 'raise' means to raise an exception for an invalid day.
+          * 'nat' means to return a NaT (not-a-time) for an invalid day.
+          * 'forward' and 'following' mean to take the first valid day
+            later in time.
+          * 'backward' and 'preceding' mean to take the first valid day
+            earlier in time.
+          * 'modifiedfollowing' means to take the first valid day
+            later in time unless it is across a Month boundary, in which
+            case to take the first valid day earlier in time.
+          * 'modifiedpreceding' means to take the first valid day
+            earlier in time unless it is across a Month boundary, in which
+            case to take the first valid day later in time.
+    weekmask : str or array_like of bool, optional
+        A seven-element array indicating which of Monday through Sunday are
+        valid days. May be specified as a length-seven list or array, like
+        [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string
+        like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for
+        weekdays, optionally separated by white space. Valid abbreviations
+        are: Mon Tue Wed Thu Fri Sat Sun
+    holidays : array_like of datetime64[D], optional
+        An array of dates to consider as invalid dates.  They may be
+        specified in any order, and NaT (not-a-time) dates are ignored.
+        This list is saved in a normalized form that is suited for
+        fast calculations of valid days.
+    busdaycal : busdaycalendar, optional
+        A `busdaycalendar` object which specifies the valid days. If this
+        parameter is provided, neither weekmask nor holidays may be
+        provided.
+    out : array of datetime64[D], optional
+        If provided, this array is filled with the result.
+
+    Returns
+    -------
+    out : array of datetime64[D]
+        An array with a shape from broadcasting ``dates`` and ``offsets``
+        together, containing the dates with offsets applied.
+
+    See Also
+    --------
+    busdaycalendar : An object that specifies a custom set of valid days.
+    is_busday : Returns a boolean array indicating valid days.
+    busday_count : Counts how many valid days are in a half-open date range.
+
+    Examples
+    --------
+    >>> # First business day in October 2011 (not accounting for holidays)
+    ... np.busday_offset('2011-10', 0, roll='forward')
+    numpy.datetime64('2011-10-03')
+    >>> # Last business day in February 2012 (not accounting for holidays)
+    ... np.busday_offset('2012-03', -1, roll='forward')
+    numpy.datetime64('2012-02-29')
+    >>> # Third Wednesday in January 2011
+    ... np.busday_offset('2011-01', 2, roll='forward', weekmask='Wed')
+    numpy.datetime64('2011-01-19')
+    >>> # 2012 Mother's Day in Canada and the U.S.
+    ... np.busday_offset('2012-05', 1, roll='forward', weekmask='Sun')
+    numpy.datetime64('2012-05-13')
+
+    >>> # First business day on or after a date
+    ... np.busday_offset('2011-03-20', 0, roll='forward')
+    numpy.datetime64('2011-03-21')
+    >>> np.busday_offset('2011-03-22', 0, roll='forward')
+    numpy.datetime64('2011-03-22')
+    >>> # First business day after a date
+    ... np.busday_offset('2011-03-20', 1, roll='backward')
+    numpy.datetime64('2011-03-21')
+    >>> np.busday_offset('2011-03-22', 1, roll='backward')
+    numpy.datetime64('2011-03-23')
+    """
+    return (dates, offsets, weekmask, holidays, out)
+
+
+@array_function_from_c_func_and_dispatcher(_multiarray_umath.busday_count)
+def busday_count(begindates, enddates, weekmask=None, holidays=None,
+                 busdaycal=None, out=None):
+    """
+    busday_count(begindates, enddates, weekmask='1111100', holidays=[], busdaycal=None, out=None)
+
+    Counts the number of valid days between `begindates` and
+    `enddates`, not including the day of `enddates`.
+
+    If ``enddates`` specifies a date value that is earlier than the
+    corresponding ``begindates`` date value, the count will be negative.
+
+    .. versionadded:: 1.7.0
+
+    Parameters
+    ----------
+    begindates : array_like of datetime64[D]
+        The array of the first dates for counting.
+    enddates : array_like of datetime64[D]
+        The array of the end dates for counting, which are excluded
+        from the count themselves.
+    weekmask : str or array_like of bool, optional
+        A seven-element array indicating which of Monday through Sunday are
+        valid days. May be specified as a length-seven list or array, like
+        [1,1,1,1,1,0,0]; a length-seven string, like '1111100'; or a string
+        like "Mon Tue Wed Thu Fri", made up of 3-character abbreviations for
+        weekdays, optionally separated by white space. Valid abbreviations
+        are: Mon Tue Wed Thu Fri Sat Sun
+    holidays : array_like of datetime64[D], optional
+        An array of dates to consider as invalid dates.  They may be
+        specified in any order, and NaT (not-a-time) dates are ignored.
+        This list is saved in a normalized form that is suited for
+        fast calculations of valid days.
+    busdaycal : busdaycalendar, optional
+        A `busdaycalendar` object which specifies the valid days. If this
+        parameter is provided, neither weekmask nor holidays may be
+        provided.
+    out : array of int, optional
+        If provided, this array is filled with the result.
+
+    Returns
+    -------
+    out : array of int
+        An array with a shape from broadcasting ``begindates`` and ``enddates``
+        together, containing the number of valid days between
+        the begin and end dates.
+
+    See Also
+    --------
+    busdaycalendar : An object that specifies a custom set of valid days.
+    is_busday : Returns a boolean array indicating valid days.
+    busday_offset : Applies an offset counted in valid days.
+
+    Examples
+    --------
+    >>> # Number of weekdays in January 2011
+    ... np.busday_count('2011-01', '2011-02')
+    21
+    >>> # Number of weekdays in 2011
+    >>> np.busday_count('2011', '2012')
+    260
+    >>> # Number of Saturdays in 2011
+    ... np.busday_count('2011', '2012', weekmask='Sat')
+    53
+    """
+    return (begindates, enddates, weekmask, holidays, out)
+
+
+@array_function_from_c_func_and_dispatcher(
+    _multiarray_umath.datetime_as_string)
+def datetime_as_string(arr, unit=None, timezone=None, casting=None):
+    """
+    datetime_as_string(arr, unit=None, timezone='naive', casting='same_kind')
+
+    Convert an array of datetimes into an array of strings.
+
+    Parameters
+    ----------
+    arr : array_like of datetime64
+        The array of UTC timestamps to format.
+    unit : str
+        One of None, 'auto', or a :ref:`datetime unit <arrays.dtypes.dateunits>`.
+    timezone : {'naive', 'UTC', 'local'} or tzinfo
+        Timezone information to use when displaying the datetime. If 'UTC', end
+        with a Z to indicate UTC time. If 'local', convert to the local timezone
+        first, and suffix with a +-#### timezone offset. If a tzinfo object,
+        then do as with 'local', but use the specified timezone.
+    casting : {'no', 'equiv', 'safe', 'same_kind', 'unsafe'}
+        Casting to allow when changing between datetime units.
+
+    Returns
+    -------
+    str_arr : ndarray
+        An array of strings the same shape as `arr`.
+
+    Examples
+    --------
+    >>> import pytz
+    >>> d = np.arange('2002-10-27T04:30', 4*60, 60, dtype='M8[m]')
+    >>> d
+    array(['2002-10-27T04:30', '2002-10-27T05:30', '2002-10-27T06:30',
+           '2002-10-27T07:30'], dtype='datetime64[m]')
+
+    Setting the timezone to UTC shows the same information, but with a Z suffix
+
+    >>> np.datetime_as_string(d, timezone='UTC')
+    array(['2002-10-27T04:30Z', '2002-10-27T05:30Z', '2002-10-27T06:30Z',
+           '2002-10-27T07:30Z'], dtype='<U35')
+
+    Note that we picked datetimes that cross a DST boundary. Passing in a
+    ``pytz`` timezone object will print the appropriate offset
+
+    >>> np.datetime_as_string(d, timezone=pytz.timezone('US/Eastern'))
+    array(['2002-10-27T00:30-0400', '2002-10-27T01:30-0400',
+           '2002-10-27T01:30-0500', '2002-10-27T02:30-0500'], dtype='<U39')
+
+    Passing in a unit will change the precision
+
+    >>> np.datetime_as_string(d, unit='h')
+    array(['2002-10-27T04', '2002-10-27T05', '2002-10-27T06', '2002-10-27T07'],
+          dtype='<U32')
+    >>> np.datetime_as_string(d, unit='s')
+    array(['2002-10-27T04:30:00', '2002-10-27T05:30:00', '2002-10-27T06:30:00',
+           '2002-10-27T07:30:00'], dtype='<U38')
+
+    'casting' can be used to specify whether precision can be changed
+
+    >>> np.datetime_as_string(d, unit='h', casting='safe')
+    Traceback (most recent call last):
+        ...
+    TypeError: Cannot create a datetime string as units 'h' from a NumPy
+    datetime with units 'm' according to the rule 'safe'
+    """
+    return (arr,)

env-llmeval/lib/python3.10/site-packages/numpy/core/numeric.py

@@ -0,0 +1,2530 @@
+import functools
+import itertools
+import operator
+import sys
+import warnings
+import numbers
+import builtins
+
+import numpy as np
+from . import multiarray
+from .multiarray import (
+    fastCopyAndTranspose, ALLOW_THREADS,
+    BUFSIZE, CLIP, MAXDIMS, MAY_SHARE_BOUNDS, MAY_SHARE_EXACT, RAISE,
+    WRAP, arange, array, asarray, asanyarray, ascontiguousarray,
+    asfortranarray, broadcast, can_cast, compare_chararrays,
+    concatenate, copyto, dot, dtype, empty,
+    empty_like, flatiter, frombuffer, from_dlpack, fromfile, fromiter,
+    fromstring, inner, lexsort, matmul, may_share_memory,
+    min_scalar_type, ndarray, nditer, nested_iters, promote_types,
+    putmask, result_type, set_numeric_ops, shares_memory, vdot, where,
+    zeros, normalize_axis_index, _get_promotion_state, _set_promotion_state,
+    _using_numpy2_behavior)
+
+from . import overrides
+from . import umath
+from . import shape_base
+from .overrides import set_array_function_like_doc, set_module
+from .umath import (multiply, invert, sin, PINF, NAN)
+from . import numerictypes
+from .numerictypes import longlong, intc, int_, float_, complex_, bool_
+from ..exceptions import ComplexWarning, TooHardError, AxisError
+from ._ufunc_config import errstate, _no_nep50_warning
+
+bitwise_not = invert
+ufunc = type(sin)
+newaxis = None
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy')
+
+
+__all__ = [
+    'newaxis', 'ndarray', 'flatiter', 'nditer', 'nested_iters', 'ufunc',
+    'arange', 'array', 'asarray', 'asanyarray', 'ascontiguousarray',
+    'asfortranarray', 'zeros', 'count_nonzero', 'empty', 'broadcast', 'dtype',
+    'fromstring', 'fromfile', 'frombuffer', 'from_dlpack', 'where',
+    'argwhere', 'copyto', 'concatenate', 'fastCopyAndTranspose', 'lexsort',
+    'set_numeric_ops', 'can_cast', 'promote_types', 'min_scalar_type',
+    'result_type', 'isfortran', 'empty_like', 'zeros_like', 'ones_like',
+    'correlate', 'convolve', 'inner', 'dot', 'outer', 'vdot', 'roll',
+    'rollaxis', 'moveaxis', 'cross', 'tensordot', 'little_endian',
+    'fromiter', 'array_equal', 'array_equiv', 'indices', 'fromfunction',
+    'isclose', 'isscalar', 'binary_repr', 'base_repr', 'ones',
+    'identity', 'allclose', 'compare_chararrays', 'putmask',
+    'flatnonzero', 'Inf', 'inf', 'infty', 'Infinity', 'nan', 'NaN',
+    'False_', 'True_', 'bitwise_not', 'CLIP', 'RAISE', 'WRAP', 'MAXDIMS',
+    'BUFSIZE', 'ALLOW_THREADS', 'full', 'full_like',
+    'matmul', 'shares_memory', 'may_share_memory', 'MAY_SHARE_BOUNDS',
+    'MAY_SHARE_EXACT', '_get_promotion_state', '_set_promotion_state',
+    '_using_numpy2_behavior']
+
+
+def _zeros_like_dispatcher(a, dtype=None, order=None, subok=None, shape=None):
+    return (a,)
+
+
+@array_function_dispatch(_zeros_like_dispatcher)
+def zeros_like(a, dtype=None, order='K', subok=True, shape=None):
+    """
+    Return an array of zeros with the same shape and type as a given array.
+
+    Parameters
+    ----------
+    a : array_like
+        The shape and data-type of `a` define these same attributes of
+        the returned array.
+    dtype : data-type, optional
+        Overrides the data type of the result.
+
+        .. versionadded:: 1.6.0
+    order : {'C', 'F', 'A', or 'K'}, optional
+        Overrides the memory layout of the result. 'C' means C-order,
+        'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous,
+        'C' otherwise. 'K' means match the layout of `a` as closely
+        as possible.
+
+        .. versionadded:: 1.6.0
+    subok : bool, optional.
+        If True, then the newly created array will use the sub-class
+        type of `a`, otherwise it will be a base-class array. Defaults
+        to True.
+    shape : int or sequence of ints, optional.
+        Overrides the shape of the result. If order='K' and the number of
+        dimensions is unchanged, will try to keep order, otherwise,
+        order='C' is implied.
+
+        .. versionadded:: 1.17.0
+
+    Returns
+    -------
+    out : ndarray
+        Array of zeros with the same shape and type as `a`.
+
+    See Also
+    --------
+    empty_like : Return an empty array with shape and type of input.
+    ones_like : Return an array of ones with shape and type of input.
+    full_like : Return a new array with shape of input filled with value.
+    zeros : Return a new array setting values to zero.
+
+    Examples
+    --------
+    >>> x = np.arange(6)
+    >>> x = x.reshape((2, 3))
+    >>> x
+    array([[0, 1, 2],
+           [3, 4, 5]])
+    >>> np.zeros_like(x)
+    array([[0, 0, 0],
+           [0, 0, 0]])
+
+    >>> y = np.arange(3, dtype=float)
+    >>> y
+    array([0., 1., 2.])
+    >>> np.zeros_like(y)
+    array([0.,  0.,  0.])
+
+    """
+    res = empty_like(a, dtype=dtype, order=order, subok=subok, shape=shape)
+    # needed instead of a 0 to get same result as zeros for string dtypes
+    z = zeros(1, dtype=res.dtype)
+    multiarray.copyto(res, z, casting='unsafe')
+    return res
+
+
+@set_array_function_like_doc
+@set_module('numpy')
+def ones(shape, dtype=None, order='C', *, like=None):
+    """
+    Return a new array of given shape and type, filled with ones.
+
+    Parameters
+    ----------
+    shape : int or sequence of ints
+        Shape of the new array, e.g., ``(2, 3)`` or ``2``.
+    dtype : data-type, optional
+        The desired data-type for the array, e.g., `numpy.int8`.  Default is
+        `numpy.float64`.
+    order : {'C', 'F'}, optional, default: C
+        Whether to store multi-dimensional data in row-major
+        (C-style) or column-major (Fortran-style) order in
+        memory.
+    ${ARRAY_FUNCTION_LIKE}
+
+        .. versionadded:: 1.20.0
+
+    Returns
+    -------
+    out : ndarray
+        Array of ones with the given shape, dtype, and order.
+
+    See Also
+    --------
+    ones_like : Return an array of ones with shape and type of input.
+    empty : Return a new uninitialized array.
+    zeros : Return a new array setting values to zero.
+    full : Return a new array of given shape filled with value.
+
+
+    Examples
+    --------
+    >>> np.ones(5)
+    array([1., 1., 1., 1., 1.])
+
+    >>> np.ones((5,), dtype=int)
+    array([1, 1, 1, 1, 1])
+
+    >>> np.ones((2, 1))
+    array([[1.],
+           [1.]])
+
+    >>> s = (2,2)
+    >>> np.ones(s)
+    array([[1.,  1.],
+           [1.,  1.]])
+
+    """
+    if like is not None:
+        return _ones_with_like(like, shape, dtype=dtype, order=order)
+
+    a = empty(shape, dtype, order)
+    multiarray.copyto(a, 1, casting='unsafe')
+    return a
+
+
+_ones_with_like = array_function_dispatch()(ones)
+
+
+def _ones_like_dispatcher(a, dtype=None, order=None, subok=None, shape=None):
+    return (a,)
+
+
+@array_function_dispatch(_ones_like_dispatcher)
+def ones_like(a, dtype=None, order='K', subok=True, shape=None):
+    """
+    Return an array of ones with the same shape and type as a given array.
+
+    Parameters
+    ----------
+    a : array_like
+        The shape and data-type of `a` define these same attributes of
+        the returned array.
+    dtype : data-type, optional
+        Overrides the data type of the result.
+
+        .. versionadded:: 1.6.0
+    order : {'C', 'F', 'A', or 'K'}, optional
+        Overrides the memory layout of the result. 'C' means C-order,
+        'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous,
+        'C' otherwise. 'K' means match the layout of `a` as closely
+        as possible.
+
+        .. versionadded:: 1.6.0
+    subok : bool, optional.
+        If True, then the newly created array will use the sub-class
+        type of `a`, otherwise it will be a base-class array. Defaults
+        to True.
+    shape : int or sequence of ints, optional.
+        Overrides the shape of the result. If order='K' and the number of
+        dimensions is unchanged, will try to keep order, otherwise,
+        order='C' is implied.
+
+        .. versionadded:: 1.17.0
+
+    Returns
+    -------
+    out : ndarray
+        Array of ones with the same shape and type as `a`.
+
+    See Also
+    --------
+    empty_like : Return an empty array with shape and type of input.
+    zeros_like : Return an array of zeros with shape and type of input.
+    full_like : Return a new array with shape of input filled with value.
+    ones : Return a new array setting values to one.
+
+    Examples
+    --------
+    >>> x = np.arange(6)
+    >>> x = x.reshape((2, 3))
+    >>> x
+    array([[0, 1, 2],
+           [3, 4, 5]])
+    >>> np.ones_like(x)
+    array([[1, 1, 1],
+           [1, 1, 1]])
+
+    >>> y = np.arange(3, dtype=float)
+    >>> y
+    array([0., 1., 2.])
+    >>> np.ones_like(y)
+    array([1.,  1.,  1.])
+
+    """
+    res = empty_like(a, dtype=dtype, order=order, subok=subok, shape=shape)
+    multiarray.copyto(res, 1, casting='unsafe')
+    return res
+
+
+def _full_dispatcher(shape, fill_value, dtype=None, order=None, *, like=None):
+    return(like,)
+
+
+@set_array_function_like_doc
+@set_module('numpy')
+def full(shape, fill_value, dtype=None, order='C', *, like=None):
+    """
+    Return a new array of given shape and type, filled with `fill_value`.
+
+    Parameters
+    ----------
+    shape : int or sequence of ints
+        Shape of the new array, e.g., ``(2, 3)`` or ``2``.
+    fill_value : scalar or array_like
+        Fill value.
+    dtype : data-type, optional
+        The desired data-type for the array  The default, None, means
+         ``np.array(fill_value).dtype``.
+    order : {'C', 'F'}, optional
+        Whether to store multidimensional data in C- or Fortran-contiguous
+        (row- or column-wise) order in memory.
+    ${ARRAY_FUNCTION_LIKE}
+
+        .. versionadded:: 1.20.0
+
+    Returns
+    -------
+    out : ndarray
+        Array of `fill_value` with the given shape, dtype, and order.
+
+    See Also
+    --------
+    full_like : Return a new array with shape of input filled with value.
+    empty : Return a new uninitialized array.
+    ones : Return a new array setting values to one.
+    zeros : Return a new array setting values to zero.
+
+    Examples
+    --------
+    >>> np.full((2, 2), np.inf)
+    array([[inf, inf],
+           [inf, inf]])
+    >>> np.full((2, 2), 10)
+    array([[10, 10],
+           [10, 10]])
+
+    >>> np.full((2, 2), [1, 2])
+    array([[1, 2],
+           [1, 2]])
+
+    """
+    if like is not None:
+        return _full_with_like(
+                like, shape, fill_value, dtype=dtype, order=order)
+
+    if dtype is None:
+        fill_value = asarray(fill_value)
+        dtype = fill_value.dtype
+    a = empty(shape, dtype, order)
+    multiarray.copyto(a, fill_value, casting='unsafe')
+    return a
+
+
+_full_with_like = array_function_dispatch()(full)
+
+
+def _full_like_dispatcher(a, fill_value, dtype=None, order=None, subok=None, shape=None):
+    return (a,)
+
+
+@array_function_dispatch(_full_like_dispatcher)
+def full_like(a, fill_value, dtype=None, order='K', subok=True, shape=None):
+    """
+    Return a full array with the same shape and type as a given array.
+
+    Parameters
+    ----------
+    a : array_like
+        The shape and data-type of `a` define these same attributes of
+        the returned array.
+    fill_value : array_like
+        Fill value.
+    dtype : data-type, optional
+        Overrides the data type of the result.
+    order : {'C', 'F', 'A', or 'K'}, optional
+        Overrides the memory layout of the result. 'C' means C-order,
+        'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous,
+        'C' otherwise. 'K' means match the layout of `a` as closely
+        as possible.
+    subok : bool, optional.
+        If True, then the newly created array will use the sub-class
+        type of `a`, otherwise it will be a base-class array. Defaults
+        to True.
+    shape : int or sequence of ints, optional.
+        Overrides the shape of the result. If order='K' and the number of
+        dimensions is unchanged, will try to keep order, otherwise,
+        order='C' is implied.
+
+        .. versionadded:: 1.17.0
+
+    Returns
+    -------
+    out : ndarray
+        Array of `fill_value` with the same shape and type as `a`.
+
+    See Also
+    --------
+    empty_like : Return an empty array with shape and type of input.
+    ones_like : Return an array of ones with shape and type of input.
+    zeros_like : Return an array of zeros with shape and type of input.
+    full : Return a new array of given shape filled with value.
+
+    Examples
+    --------
+    >>> x = np.arange(6, dtype=int)
+    >>> np.full_like(x, 1)
+    array([1, 1, 1, 1, 1, 1])
+    >>> np.full_like(x, 0.1)
+    array([0, 0, 0, 0, 0, 0])
+    >>> np.full_like(x, 0.1, dtype=np.double)
+    array([0.1, 0.1, 0.1, 0.1, 0.1, 0.1])
+    >>> np.full_like(x, np.nan, dtype=np.double)
+    array([nan, nan, nan, nan, nan, nan])
+
+    >>> y = np.arange(6, dtype=np.double)
+    >>> np.full_like(y, 0.1)
+    array([0.1, 0.1, 0.1, 0.1, 0.1, 0.1])
+
+    >>> y = np.zeros([2, 2, 3], dtype=int)
+    >>> np.full_like(y, [0, 0, 255])
+    array([[[  0,   0, 255],
+            [  0,   0, 255]],
+           [[  0,   0, 255],
+            [  0,   0, 255]]])
+    """
+    res = empty_like(a, dtype=dtype, order=order, subok=subok, shape=shape)
+    multiarray.copyto(res, fill_value, casting='unsafe')
+    return res
+
+
+def _count_nonzero_dispatcher(a, axis=None, *, keepdims=None):
+    return (a,)
+
+
+@array_function_dispatch(_count_nonzero_dispatcher)
+def count_nonzero(a, axis=None, *, keepdims=False):
+    """
+    Counts the number of non-zero values in the array ``a``.
+
+    The word "non-zero" is in reference to the Python 2.x
+    built-in method ``__nonzero__()`` (renamed ``__bool__()``
+    in Python 3.x) of Python objects that tests an object's
+    "truthfulness". For example, any number is considered
+    truthful if it is nonzero, whereas any string is considered
+    truthful if it is not the empty string. Thus, this function
+    (recursively) counts how many elements in ``a`` (and in
+    sub-arrays thereof) have their ``__nonzero__()`` or ``__bool__()``
+    method evaluated to ``True``.
+
+    Parameters
+    ----------
+    a : array_like
+        The array for which to count non-zeros.
+    axis : int or tuple, optional
+        Axis or tuple of axes along which to count non-zeros.
+        Default is None, meaning that non-zeros will be counted
+        along a flattened version of ``a``.
+
+        .. versionadded:: 1.12.0
+
+    keepdims : bool, optional
+        If this is set to True, the axes that are counted are left
+        in the result as dimensions with size one. With this option,
+        the result will broadcast correctly against the input array.
+
+        .. versionadded:: 1.19.0
+
+    Returns
+    -------
+    count : int or array of int
+        Number of non-zero values in the array along a given axis.
+        Otherwise, the total number of non-zero values in the array
+        is returned.
+
+    See Also
+    --------
+    nonzero : Return the coordinates of all the non-zero values.
+
+    Examples
+    --------
+    >>> np.count_nonzero(np.eye(4))
+    4
+    >>> a = np.array([[0, 1, 7, 0],
+    ...               [3, 0, 2, 19]])
+    >>> np.count_nonzero(a)
+    5
+    >>> np.count_nonzero(a, axis=0)
+    array([1, 1, 2, 1])
+    >>> np.count_nonzero(a, axis=1)
+    array([2, 3])
+    >>> np.count_nonzero(a, axis=1, keepdims=True)
+    array([[2],
+           [3]])
+    """
+    if axis is None and not keepdims:
+        return multiarray.count_nonzero(a)
+
+    a = asanyarray(a)
+
+    # TODO: this works around .astype(bool) not working properly (gh-9847)
+    if np.issubdtype(a.dtype, np.character):
+        a_bool = a != a.dtype.type()
+    else:
+        a_bool = a.astype(np.bool_, copy=False)
+
+    return a_bool.sum(axis=axis, dtype=np.intp, keepdims=keepdims)
+
+
+@set_module('numpy')
+def isfortran(a):
+    """
+    Check if the array is Fortran contiguous but *not* C contiguous.
+
+    This function is obsolete and, because of changes due to relaxed stride
+    checking, its return value for the same array may differ for versions
+    of NumPy >= 1.10.0 and previous versions. If you only want to check if an
+    array is Fortran contiguous use ``a.flags.f_contiguous`` instead.
+
+    Parameters
+    ----------
+    a : ndarray
+        Input array.
+
+    Returns
+    -------
+    isfortran : bool
+        Returns True if the array is Fortran contiguous but *not* C contiguous.
+
+
+    Examples
+    --------
+
+    np.array allows to specify whether the array is written in C-contiguous
+    order (last index varies the fastest), or FORTRAN-contiguous order in
+    memory (first index varies the fastest).
+
+    >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C')
+    >>> a
+    array([[1, 2, 3],
+           [4, 5, 6]])
+    >>> np.isfortran(a)
+    False
+
+    >>> b = np.array([[1, 2, 3], [4, 5, 6]], order='F')
+    >>> b
+    array([[1, 2, 3],
+           [4, 5, 6]])
+    >>> np.isfortran(b)
+    True
+
+
+    The transpose of a C-ordered array is a FORTRAN-ordered array.
+
+    >>> a = np.array([[1, 2, 3], [4, 5, 6]], order='C')
+    >>> a
+    array([[1, 2, 3],
+           [4, 5, 6]])
+    >>> np.isfortran(a)
+    False
+    >>> b = a.T
+    >>> b
+    array([[1, 4],
+           [2, 5],
+           [3, 6]])
+    >>> np.isfortran(b)
+    True
+
+    C-ordered arrays evaluate as False even if they are also FORTRAN-ordered.
+
+    >>> np.isfortran(np.array([1, 2], order='F'))
+    False
+
+    """
+    return a.flags.fnc
+
+
+def _argwhere_dispatcher(a):
+    return (a,)
+
+
+@array_function_dispatch(_argwhere_dispatcher)
+def argwhere(a):
+    """
+    Find the indices of array elements that are non-zero, grouped by element.
+
+    Parameters
+    ----------
+    a : array_like
+        Input data.
+
+    Returns
+    -------
+    index_array : (N, a.ndim) ndarray
+        Indices of elements that are non-zero. Indices are grouped by element.
+        This array will have shape ``(N, a.ndim)`` where ``N`` is the number of
+        non-zero items.
+
+    See Also
+    --------
+    where, nonzero
+
+    Notes
+    -----
+    ``np.argwhere(a)`` is almost the same as ``np.transpose(np.nonzero(a))``,
+    but produces a result of the correct shape for a 0D array.
+
+    The output of ``argwhere`` is not suitable for indexing arrays.
+    For this purpose use ``nonzero(a)`` instead.
+
+    Examples
+    --------
+    >>> x = np.arange(6).reshape(2,3)
+    >>> x
+    array([[0, 1, 2],
+           [3, 4, 5]])
+    >>> np.argwhere(x>1)
+    array([[0, 2],
+           [1, 0],
+           [1, 1],
+           [1, 2]])
+
+    """
+    # nonzero does not behave well on 0d, so promote to 1d
+    if np.ndim(a) == 0:
+        a = shape_base.atleast_1d(a)
+        # then remove the added dimension
+        return argwhere(a)[:,:0]
+    return transpose(nonzero(a))
+
+
+def _flatnonzero_dispatcher(a):
+    return (a,)
+
+
+@array_function_dispatch(_flatnonzero_dispatcher)
+def flatnonzero(a):
+    """
+    Return indices that are non-zero in the flattened version of a.
+
+    This is equivalent to ``np.nonzero(np.ravel(a))[0]``.
+
+    Parameters
+    ----------
+    a : array_like
+        Input data.
+
+    Returns
+    -------
+    res : ndarray
+        Output array, containing the indices of the elements of ``a.ravel()``
+        that are non-zero.
+
+    See Also
+    --------
+    nonzero : Return the indices of the non-zero elements of the input array.
+    ravel : Return a 1-D array containing the elements of the input array.
+
+    Examples
+    --------
+    >>> x = np.arange(-2, 3)
+    >>> x
+    array([-2, -1,  0,  1,  2])
+    >>> np.flatnonzero(x)
+    array([0, 1, 3, 4])
+
+    Use the indices of the non-zero elements as an index array to extract
+    these elements:
+
+    >>> x.ravel()[np.flatnonzero(x)]
+    array([-2, -1,  1,  2])
+
+    """
+    return np.nonzero(np.ravel(a))[0]
+
+
+def _correlate_dispatcher(a, v, mode=None):
+    return (a, v)
+
+
+@array_function_dispatch(_correlate_dispatcher)
+def correlate(a, v, mode='valid'):
+    r"""
+    Cross-correlation of two 1-dimensional sequences.
+
+    This function computes the correlation as generally defined in signal
+    processing texts:
+
+    .. math:: c_k = \sum_n a_{n+k} \cdot \overline{v}_n
+
+    with a and v sequences being zero-padded where necessary and
+    :math:`\overline x` denoting complex conjugation.
+
+    Parameters
+    ----------
+    a, v : array_like
+        Input sequences.
+    mode : {'valid', 'same', 'full'}, optional
+        Refer to the `convolve` docstring.  Note that the default
+        is 'valid', unlike `convolve`, which uses 'full'.
+    old_behavior : bool
+        `old_behavior` was removed in NumPy 1.10. If you need the old
+        behavior, use `multiarray.correlate`.
+
+    Returns
+    -------
+    out : ndarray
+        Discrete cross-correlation of `a` and `v`.
+
+    See Also
+    --------
+    convolve : Discrete, linear convolution of two one-dimensional sequences.
+    multiarray.correlate : Old, no conjugate, version of correlate.
+    scipy.signal.correlate : uses FFT which has superior performance on large arrays.
+
+    Notes
+    -----
+    The definition of correlation above is not unique and sometimes correlation
+    may be defined differently. Another common definition is:
+
+    .. math:: c'_k = \sum_n a_{n} \cdot \overline{v_{n+k}}
+
+    which is related to :math:`c_k` by :math:`c'_k = c_{-k}`.
+
+    `numpy.correlate` may perform slowly in large arrays (i.e. n = 1e5) because it does
+    not use the FFT to compute the convolution; in that case, `scipy.signal.correlate` might
+    be preferable.
+
+
+    Examples
+    --------
+    >>> np.correlate([1, 2, 3], [0, 1, 0.5])
+    array([3.5])
+    >>> np.correlate([1, 2, 3], [0, 1, 0.5], "same")
+    array([2. ,  3.5,  3. ])
+    >>> np.correlate([1, 2, 3], [0, 1, 0.5], "full")
+    array([0.5,  2. ,  3.5,  3. ,  0. ])
+
+    Using complex sequences:
+
+    >>> np.correlate([1+1j, 2, 3-1j], [0, 1, 0.5j], 'full')
+    array([ 0.5-0.5j,  1.0+0.j ,  1.5-1.5j,  3.0-1.j ,  0.0+0.j ])
+
+    Note that you get the time reversed, complex conjugated result
+    (:math:`\overline{c_{-k}}`) when the two input sequences a and v change
+    places:
+
+    >>> np.correlate([0, 1, 0.5j], [1+1j, 2, 3-1j], 'full')
+    array([ 0.0+0.j ,  3.0+1.j ,  1.5+1.5j,  1.0+0.j ,  0.5+0.5j])
+
+    """
+    return multiarray.correlate2(a, v, mode)
+
+
+def _convolve_dispatcher(a, v, mode=None):
+    return (a, v)
+
+
+@array_function_dispatch(_convolve_dispatcher)
+def convolve(a, v, mode='full'):
+    """
+    Returns the discrete, linear convolution of two one-dimensional sequences.
+
+    The convolution operator is often seen in signal processing, where it
+    models the effect of a linear time-invariant system on a signal [1]_.  In
+    probability theory, the sum of two independent random variables is
+    distributed according to the convolution of their individual
+    distributions.
+
+    If `v` is longer than `a`, the arrays are swapped before computation.
+
+    Parameters
+    ----------
+    a : (N,) array_like
+        First one-dimensional input array.
+    v : (M,) array_like
+        Second one-dimensional input array.
+    mode : {'full', 'valid', 'same'}, optional
+        'full':
+          By default, mode is 'full'.  This returns the convolution
+          at each point of overlap, with an output shape of (N+M-1,). At
+          the end-points of the convolution, the signals do not overlap
+          completely, and boundary effects may be seen.
+
+        'same':
+          Mode 'same' returns output of length ``max(M, N)``.  Boundary
+          effects are still visible.
+
+        'valid':
+          Mode 'valid' returns output of length
+          ``max(M, N) - min(M, N) + 1``.  The convolution product is only given
+          for points where the signals overlap completely.  Values outside
+          the signal boundary have no effect.
+
+    Returns
+    -------
+    out : ndarray
+        Discrete, linear convolution of `a` and `v`.
+
+    See Also
+    --------
+    scipy.signal.fftconvolve : Convolve two arrays using the Fast Fourier
+                               Transform.
+    scipy.linalg.toeplitz : Used to construct the convolution operator.
+    polymul : Polynomial multiplication. Same output as convolve, but also
+              accepts poly1d objects as input.
+
+    Notes
+    -----
+    The discrete convolution operation is defined as
+
+    .. math:: (a * v)_n = \\sum_{m = -\\infty}^{\\infty} a_m v_{n - m}
+
+    It can be shown that a convolution :math:`x(t) * y(t)` in time/space
+    is equivalent to the multiplication :math:`X(f) Y(f)` in the Fourier
+    domain, after appropriate padding (padding is necessary to prevent
+    circular convolution).  Since multiplication is more efficient (faster)
+    than convolution, the function `scipy.signal.fftconvolve` exploits the
+    FFT to calculate the convolution of large data-sets.
+
+    References
+    ----------
+    .. [1] Wikipedia, "Convolution",
+        https://en.wikipedia.org/wiki/Convolution
+
+    Examples
+    --------
+    Note how the convolution operator flips the second array
+    before "sliding" the two across one another:
+
+    >>> np.convolve([1, 2, 3], [0, 1, 0.5])
+    array([0. , 1. , 2.5, 4. , 1.5])
+
+    Only return the middle values of the convolution.
+    Contains boundary effects, where zeros are taken
+    into account:
+
+    >>> np.convolve([1,2,3],[0,1,0.5], 'same')
+    array([1. ,  2.5,  4. ])
+
+    The two arrays are of the same length, so there
+    is only one position where they completely overlap:
+
+    >>> np.convolve([1,2,3],[0,1,0.5], 'valid')
+    array([2.5])
+
+    """
+    a, v = array(a, copy=False, ndmin=1), array(v, copy=False, ndmin=1)
+    if (len(v) > len(a)):
+        a, v = v, a
+    if len(a) == 0:
+        raise ValueError('a cannot be empty')
+    if len(v) == 0:
+        raise ValueError('v cannot be empty')
+    return multiarray.correlate(a, v[::-1], mode)
+
+
+def _outer_dispatcher(a, b, out=None):
+    return (a, b, out)
+
+
+@array_function_dispatch(_outer_dispatcher)
+def outer(a, b, out=None):
+    """
+    Compute the outer product of two vectors.
+
+    Given two vectors `a` and `b` of length ``M`` and ``N``, repsectively,
+    the outer product [1]_ is::
+
+      [[a_0*b_0  a_0*b_1 ... a_0*b_{N-1} ]
+       [a_1*b_0    .
+       [ ...          .
+       [a_{M-1}*b_0            a_{M-1}*b_{N-1} ]]
+
+    Parameters
+    ----------
+    a : (M,) array_like
+        First input vector.  Input is flattened if
+        not already 1-dimensional.
+    b : (N,) array_like
+        Second input vector.  Input is flattened if
+        not already 1-dimensional.
+    out : (M, N) ndarray, optional
+        A location where the result is stored
+
+        .. versionadded:: 1.9.0
+
+    Returns
+    -------
+    out : (M, N) ndarray
+        ``out[i, j] = a[i] * b[j]``
+
+    See also
+    --------
+    inner
+    einsum : ``einsum('i,j->ij', a.ravel(), b.ravel())`` is the equivalent.
+    ufunc.outer : A generalization to dimensions other than 1D and other
+                  operations. ``np.multiply.outer(a.ravel(), b.ravel())``
+                  is the equivalent.
+    tensordot : ``np.tensordot(a.ravel(), b.ravel(), axes=((), ()))``
+                is the equivalent.
+
+    References
+    ----------
+    .. [1] G. H. Golub and C. F. Van Loan, *Matrix Computations*, 3rd
+           ed., Baltimore, MD, Johns Hopkins University Press, 1996,
+           pg. 8.
+
+    Examples
+    --------
+    Make a (*very* coarse) grid for computing a Mandelbrot set:
+
+    >>> rl = np.outer(np.ones((5,)), np.linspace(-2, 2, 5))
+    >>> rl
+    array([[-2., -1.,  0.,  1.,  2.],
+           [-2., -1.,  0.,  1.,  2.],
+           [-2., -1.,  0.,  1.,  2.],
+           [-2., -1.,  0.,  1.,  2.],
+           [-2., -1.,  0.,  1.,  2.]])
+    >>> im = np.outer(1j*np.linspace(2, -2, 5), np.ones((5,)))
+    >>> im
+    array([[0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j, 0.+2.j],
+           [0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j, 0.+1.j],
+           [0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j, 0.+0.j],
+           [0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j, 0.-1.j],
+           [0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j, 0.-2.j]])
+    >>> grid = rl + im
+    >>> grid
+    array([[-2.+2.j, -1.+2.j,  0.+2.j,  1.+2.j,  2.+2.j],
+           [-2.+1.j, -1.+1.j,  0.+1.j,  1.+1.j,  2.+1.j],
+           [-2.+0.j, -1.+0.j,  0.+0.j,  1.+0.j,  2.+0.j],
+           [-2.-1.j, -1.-1.j,  0.-1.j,  1.-1.j,  2.-1.j],
+           [-2.-2.j, -1.-2.j,  0.-2.j,  1.-2.j,  2.-2.j]])
+
+    An example using a "vector" of letters:
+
+    >>> x = np.array(['a', 'b', 'c'], dtype=object)
+    >>> np.outer(x, [1, 2, 3])
+    array([['a', 'aa', 'aaa'],
+           ['b', 'bb', 'bbb'],
+           ['c', 'cc', 'ccc']], dtype=object)
+
+    """
+    a = asarray(a)
+    b = asarray(b)
+    return multiply(a.ravel()[:, newaxis], b.ravel()[newaxis, :], out)
+
+
+def _tensordot_dispatcher(a, b, axes=None):
+    return (a, b)
+
+
+@array_function_dispatch(_tensordot_dispatcher)
+def tensordot(a, b, axes=2):
+    """
+    Compute tensor dot product along specified axes.
+
+    Given two tensors, `a` and `b`, and an array_like object containing
+    two array_like objects, ``(a_axes, b_axes)``, sum the products of
+    `a`'s and `b`'s elements (components) over the axes specified by
+    ``a_axes`` and ``b_axes``. The third argument can be a single non-negative
+    integer_like scalar, ``N``; if it is such, then the last ``N`` dimensions
+    of `a` and the first ``N`` dimensions of `b` are summed over.
+
+    Parameters
+    ----------
+    a, b : array_like
+        Tensors to "dot".
+
+    axes : int or (2,) array_like
+        * integer_like
+          If an int N, sum over the last N axes of `a` and the first N axes
+          of `b` in order. The sizes of the corresponding axes must match.
+        * (2,) array_like
+          Or, a list of axes to be summed over, first sequence applying to `a`,
+          second to `b`. Both elements array_like must be of the same length.
+
+    Returns
+    -------
+    output : ndarray
+        The tensor dot product of the input.
+
+    See Also
+    --------
+    dot, einsum
+
+    Notes
+    -----
+    Three common use cases are:
+        * ``axes = 0`` : tensor product :math:`a\\otimes b`
+        * ``axes = 1`` : tensor dot product :math:`a\\cdot b`
+        * ``axes = 2`` : (default) tensor double contraction :math:`a:b`
+
+    When `axes` is integer_like, the sequence for evaluation will be: first
+    the -Nth axis in `a` and 0th axis in `b`, and the -1th axis in `a` and
+    Nth axis in `b` last.
+
+    When there is more than one axis to sum over - and they are not the last
+    (first) axes of `a` (`b`) - the argument `axes` should consist of
+    two sequences of the same length, with the first axis to sum over given
+    first in both sequences, the second axis second, and so forth.
+
+    The shape of the result consists of the non-contracted axes of the
+    first tensor, followed by the non-contracted axes of the second.
+
+    Examples
+    --------
+    A "traditional" example:
+
+    >>> a = np.arange(60.).reshape(3,4,5)
+    >>> b = np.arange(24.).reshape(4,3,2)
+    >>> c = np.tensordot(a,b, axes=([1,0],[0,1]))
+    >>> c.shape
+    (5, 2)
+    >>> c
+    array([[4400., 4730.],
+           [4532., 4874.],
+           [4664., 5018.],
+           [4796., 5162.],
+           [4928., 5306.]])
+    >>> # A slower but equivalent way of computing the same...
+    >>> d = np.zeros((5,2))
+    >>> for i in range(5):
+    ...   for j in range(2):
+    ...     for k in range(3):
+    ...       for n in range(4):
+    ...         d[i,j] += a[k,n,i] * b[n,k,j]
+    >>> c == d
+    array([[ True,  True],
+           [ True,  True],
+           [ True,  True],
+           [ True,  True],
+           [ True,  True]])
+
+    An extended example taking advantage of the overloading of + and \\*:
+
+    >>> a = np.array(range(1, 9))
+    >>> a.shape = (2, 2, 2)
+    >>> A = np.array(('a', 'b', 'c', 'd'), dtype=object)
+    >>> A.shape = (2, 2)
+    >>> a; A
+    array([[[1, 2],
+            [3, 4]],
+           [[5, 6],
+            [7, 8]]])
+    array([['a', 'b'],
+           ['c', 'd']], dtype=object)
+
+    >>> np.tensordot(a, A) # third argument default is 2 for double-contraction
+    array(['abbcccdddd', 'aaaaabbbbbbcccccccdddddddd'], dtype=object)
+
+    >>> np.tensordot(a, A, 1)
+    array([[['acc', 'bdd'],
+            ['aaacccc', 'bbbdddd']],
+           [['aaaaacccccc', 'bbbbbdddddd'],
+            ['aaaaaaacccccccc', 'bbbbbbbdddddddd']]], dtype=object)
+
+    >>> np.tensordot(a, A, 0) # tensor product (result too long to incl.)
+    array([[[[['a', 'b'],
+              ['c', 'd']],
+              ...
+
+    >>> np.tensordot(a, A, (0, 1))
+    array([[['abbbbb', 'cddddd'],
+            ['aabbbbbb', 'ccdddddd']],
+           [['aaabbbbbbb', 'cccddddddd'],
+            ['aaaabbbbbbbb', 'ccccdddddddd']]], dtype=object)
+
+    >>> np.tensordot(a, A, (2, 1))
+    array([[['abb', 'cdd'],
+            ['aaabbbb', 'cccdddd']],
+           [['aaaaabbbbbb', 'cccccdddddd'],
+            ['aaaaaaabbbbbbbb', 'cccccccdddddddd']]], dtype=object)
+
+    >>> np.tensordot(a, A, ((0, 1), (0, 1)))
+    array(['abbbcccccddddddd', 'aabbbbccccccdddddddd'], dtype=object)
+
+    >>> np.tensordot(a, A, ((2, 1), (1, 0)))
+    array(['acccbbdddd', 'aaaaacccccccbbbbbbdddddddd'], dtype=object)
+
+    """
+    try:
+        iter(axes)
+    except Exception:
+        axes_a = list(range(-axes, 0))
+        axes_b = list(range(0, axes))
+    else:
+        axes_a, axes_b = axes
+    try:
+        na = len(axes_a)
+        axes_a = list(axes_a)
+    except TypeError:
+        axes_a = [axes_a]
+        na = 1
+    try:
+        nb = len(axes_b)
+        axes_b = list(axes_b)
+    except TypeError:
+        axes_b = [axes_b]
+        nb = 1
+
+    a, b = asarray(a), asarray(b)
+    as_ = a.shape
+    nda = a.ndim
+    bs = b.shape
+    ndb = b.ndim
+    equal = True
+    if na != nb:
+        equal = False
+    else:
+        for k in range(na):
+            if as_[axes_a[k]] != bs[axes_b[k]]:
+                equal = False
+                break
+            if axes_a[k] < 0:
+                axes_a[k] += nda
+            if axes_b[k] < 0:
+                axes_b[k] += ndb
+    if not equal:
+        raise ValueError("shape-mismatch for sum")
+
+    # Move the axes to sum over to the end of "a"
+    # and to the front of "b"
+    notin = [k for k in range(nda) if k not in axes_a]
+    newaxes_a = notin + axes_a
+    N2 = 1
+    for axis in axes_a:
+        N2 *= as_[axis]
+    newshape_a = (int(multiply.reduce([as_[ax] for ax in notin])), N2)
+    olda = [as_[axis] for axis in notin]
+
+    notin = [k for k in range(ndb) if k not in axes_b]
+    newaxes_b = axes_b + notin
+    N2 = 1
+    for axis in axes_b:
+        N2 *= bs[axis]
+    newshape_b = (N2, int(multiply.reduce([bs[ax] for ax in notin])))
+    oldb = [bs[axis] for axis in notin]
+
+    at = a.transpose(newaxes_a).reshape(newshape_a)
+    bt = b.transpose(newaxes_b).reshape(newshape_b)
+    res = dot(at, bt)
+    return res.reshape(olda + oldb)
+
+
+def _roll_dispatcher(a, shift, axis=None):
+    return (a,)
+
+
+@array_function_dispatch(_roll_dispatcher)
+def roll(a, shift, axis=None):
+    """
+    Roll array elements along a given axis.
+
+    Elements that roll beyond the last position are re-introduced at
+    the first.
+
+    Parameters
+    ----------
+    a : array_like
+        Input array.
+    shift : int or tuple of ints
+        The number of places by which elements are shifted.  If a tuple,
+        then `axis` must be a tuple of the same size, and each of the
+        given axes is shifted by the corresponding number.  If an int
+        while `axis` is a tuple of ints, then the same value is used for
+        all given axes.
+    axis : int or tuple of ints, optional
+        Axis or axes along which elements are shifted.  By default, the
+        array is flattened before shifting, after which the original
+        shape is restored.
+
+    Returns
+    -------
+    res : ndarray
+        Output array, with the same shape as `a`.
+
+    See Also
+    --------
+    rollaxis : Roll the specified axis backwards, until it lies in a
+               given position.
+
+    Notes
+    -----
+    .. versionadded:: 1.12.0
+
+    Supports rolling over multiple dimensions simultaneously.
+
+    Examples
+    --------
+    >>> x = np.arange(10)
+    >>> np.roll(x, 2)
+    array([8, 9, 0, 1, 2, 3, 4, 5, 6, 7])
+    >>> np.roll(x, -2)
+    array([2, 3, 4, 5, 6, 7, 8, 9, 0, 1])
+
+    >>> x2 = np.reshape(x, (2, 5))
+    >>> x2
+    array([[0, 1, 2, 3, 4],
+           [5, 6, 7, 8, 9]])
+    >>> np.roll(x2, 1)
+    array([[9, 0, 1, 2, 3],
+           [4, 5, 6, 7, 8]])
+    >>> np.roll(x2, -1)
+    array([[1, 2, 3, 4, 5],
+           [6, 7, 8, 9, 0]])
+    >>> np.roll(x2, 1, axis=0)
+    array([[5, 6, 7, 8, 9],
+           [0, 1, 2, 3, 4]])
+    >>> np.roll(x2, -1, axis=0)
+    array([[5, 6, 7, 8, 9],
+           [0, 1, 2, 3, 4]])
+    >>> np.roll(x2, 1, axis=1)
+    array([[4, 0, 1, 2, 3],
+           [9, 5, 6, 7, 8]])
+    >>> np.roll(x2, -1, axis=1)
+    array([[1, 2, 3, 4, 0],
+           [6, 7, 8, 9, 5]])
+    >>> np.roll(x2, (1, 1), axis=(1, 0))
+    array([[9, 5, 6, 7, 8],
+           [4, 0, 1, 2, 3]])
+    >>> np.roll(x2, (2, 1), axis=(1, 0))
+    array([[8, 9, 5, 6, 7],
+           [3, 4, 0, 1, 2]])
+
+    """
+    a = asanyarray(a)
+    if axis is None:
+        return roll(a.ravel(), shift, 0).reshape(a.shape)
+
+    else:
+        axis = normalize_axis_tuple(axis, a.ndim, allow_duplicate=True)
+        broadcasted = broadcast(shift, axis)
+        if broadcasted.ndim > 1:
+            raise ValueError(
+                "'shift' and 'axis' should be scalars or 1D sequences")
+        shifts = {ax: 0 for ax in range(a.ndim)}
+        for sh, ax in broadcasted:
+            shifts[ax] += sh
+
+        rolls = [((slice(None), slice(None)),)] * a.ndim
+        for ax, offset in shifts.items():
+            offset %= a.shape[ax] or 1  # If `a` is empty, nothing matters.
+            if offset:
+                # (original, result), (original, result)
+                rolls[ax] = ((slice(None, -offset), slice(offset, None)),
+                             (slice(-offset, None), slice(None, offset)))
+
+        result = empty_like(a)
+        for indices in itertools.product(*rolls):
+            arr_index, res_index = zip(*indices)
+            result[res_index] = a[arr_index]
+
+        return result
+
+
+def _rollaxis_dispatcher(a, axis, start=None):
+    return (a,)
+
+
+@array_function_dispatch(_rollaxis_dispatcher)
+def rollaxis(a, axis, start=0):
+    """
+    Roll the specified axis backwards, until it lies in a given position.
+
+    This function continues to be supported for backward compatibility, but you
+    should prefer `moveaxis`. The `moveaxis` function was added in NumPy
+    1.11.
+
+    Parameters
+    ----------
+    a : ndarray
+        Input array.
+    axis : int
+        The axis to be rolled. The positions of the other axes do not
+        change relative to one another.
+    start : int, optional
+        When ``start <= axis``, the axis is rolled back until it lies in
+        this position. When ``start > axis``, the axis is rolled until it
+        lies before this position. The default, 0, results in a "complete"
+        roll. The following table describes how negative values of ``start``
+        are interpreted:
+
+        .. table::
+           :align: left
+
+           +-------------------+----------------------+
+           |     ``start``     | Normalized ``start`` |
+           +===================+======================+
+           | ``-(arr.ndim+1)`` | raise ``AxisError``  |
+           +-------------------+----------------------+
+           | ``-arr.ndim``     | 0                    |
+           +-------------------+----------------------+
+           | |vdots|           | |vdots|              |
+           +-------------------+----------------------+
+           | ``-1``            | ``arr.ndim-1``       |
+           +-------------------+----------------------+
+           | ``0``             | ``0``                |
+           +-------------------+----------------------+
+           | |vdots|           | |vdots|              |
+           +-------------------+----------------------+
+           | ``arr.ndim``      | ``arr.ndim``         |
+           +-------------------+----------------------+
+           | ``arr.ndim + 1``  | raise ``AxisError``  |
+           +-------------------+----------------------+
+
+        .. |vdots|   unicode:: U+22EE .. Vertical Ellipsis
+
+    Returns
+    -------
+    res : ndarray
+        For NumPy >= 1.10.0 a view of `a` is always returned. For earlier
+        NumPy versions a view of `a` is returned only if the order of the
+        axes is changed, otherwise the input array is returned.
+
+    See Also
+    --------
+    moveaxis : Move array axes to new positions.
+    roll : Roll the elements of an array by a number of positions along a
+        given axis.
+
+    Examples
+    --------
+    >>> a = np.ones((3,4,5,6))
+    >>> np.rollaxis(a, 3, 1).shape
+    (3, 6, 4, 5)
+    >>> np.rollaxis(a, 2).shape
+    (5, 3, 4, 6)
+    >>> np.rollaxis(a, 1, 4).shape
+    (3, 5, 6, 4)
+
+    """
+    n = a.ndim
+    axis = normalize_axis_index(axis, n)
+    if start < 0:
+        start += n
+    msg = "'%s' arg requires %d <= %s < %d, but %d was passed in"
+    if not (0 <= start < n + 1):
+        raise AxisError(msg % ('start', -n, 'start', n + 1, start))
+    if axis < start:
+        # it's been removed
+        start -= 1
+    if axis == start:
+        return a[...]
+    axes = list(range(0, n))
+    axes.remove(axis)
+    axes.insert(start, axis)
+    return a.transpose(axes)
+
+
+def normalize_axis_tuple(axis, ndim, argname=None, allow_duplicate=False):
+    """
+    Normalizes an axis argument into a tuple of non-negative integer axes.
+
+    This handles shorthands such as ``1`` and converts them to ``(1,)``,
+    as well as performing the handling of negative indices covered by
+    `normalize_axis_index`.
+
+    By default, this forbids axes from being specified multiple times.
+
+    Used internally by multi-axis-checking logic.
+
+    .. versionadded:: 1.13.0
+
+    Parameters
+    ----------
+    axis : int, iterable of int
+        The un-normalized index or indices of the axis.
+    ndim : int
+        The number of dimensions of the array that `axis` should be normalized
+        against.
+    argname : str, optional
+        A prefix to put before the error message, typically the name of the
+        argument.
+    allow_duplicate : bool, optional
+        If False, the default, disallow an axis from being specified twice.
+
+    Returns
+    -------
+    normalized_axes : tuple of int
+        The normalized axis index, such that `0 <= normalized_axis < ndim`
+
+    Raises
+    ------
+    AxisError
+        If any axis provided is out of range
+    ValueError
+        If an axis is repeated
+
+    See also
+    --------
+    normalize_axis_index : normalizing a single scalar axis
+    """
+    # Optimization to speed-up the most common cases.
+    if type(axis) not in (tuple, list):
+        try:
+            axis = [operator.index(axis)]
+        except TypeError:
+            pass
+    # Going via an iterator directly is slower than via list comprehension.
+    axis = tuple([normalize_axis_index(ax, ndim, argname) for ax in axis])
+    if not allow_duplicate and len(set(axis)) != len(axis):
+        if argname:
+            raise ValueError('repeated axis in `{}` argument'.format(argname))
+        else:
+            raise ValueError('repeated axis')
+    return axis
+
+
+def _moveaxis_dispatcher(a, source, destination):
+    return (a,)
+
+
+@array_function_dispatch(_moveaxis_dispatcher)
+def moveaxis(a, source, destination):
+    """
+    Move axes of an array to new positions.
+
+    Other axes remain in their original order.
+
+    .. versionadded:: 1.11.0
+
+    Parameters
+    ----------
+    a : np.ndarray
+        The array whose axes should be reordered.
+    source : int or sequence of int
+        Original positions of the axes to move. These must be unique.
+    destination : int or sequence of int
+        Destination positions for each of the original axes. These must also be
+        unique.
+
+    Returns
+    -------
+    result : np.ndarray
+        Array with moved axes. This array is a view of the input array.
+
+    See Also
+    --------
+    transpose : Permute the dimensions of an array.
+    swapaxes : Interchange two axes of an array.
+
+    Examples
+    --------
+    >>> x = np.zeros((3, 4, 5))
+    >>> np.moveaxis(x, 0, -1).shape
+    (4, 5, 3)
+    >>> np.moveaxis(x, -1, 0).shape
+    (5, 3, 4)
+
+    These all achieve the same result:
+
+    >>> np.transpose(x).shape
+    (5, 4, 3)
+    >>> np.swapaxes(x, 0, -1).shape
+    (5, 4, 3)
+    >>> np.moveaxis(x, [0, 1], [-1, -2]).shape
+    (5, 4, 3)
+    >>> np.moveaxis(x, [0, 1, 2], [-1, -2, -3]).shape
+    (5, 4, 3)
+
+    """
+    try:
+        # allow duck-array types if they define transpose
+        transpose = a.transpose
+    except AttributeError:
+        a = asarray(a)
+        transpose = a.transpose
+
+    source = normalize_axis_tuple(source, a.ndim, 'source')
+    destination = normalize_axis_tuple(destination, a.ndim, 'destination')
+    if len(source) != len(destination):
+        raise ValueError('`source` and `destination` arguments must have '
+                         'the same number of elements')
+
+    order = [n for n in range(a.ndim) if n not in source]
+
+    for dest, src in sorted(zip(destination, source)):
+        order.insert(dest, src)
+
+    result = transpose(order)
+    return result
+
+
+def _cross_dispatcher(a, b, axisa=None, axisb=None, axisc=None, axis=None):
+    return (a, b)
+
+
+@array_function_dispatch(_cross_dispatcher)
+def cross(a, b, axisa=-1, axisb=-1, axisc=-1, axis=None):
+    """
+    Return the cross product of two (arrays of) vectors.
+
+    The cross product of `a` and `b` in :math:`R^3` is a vector perpendicular
+    to both `a` and `b`.  If `a` and `b` are arrays of vectors, the vectors
+    are defined by the last axis of `a` and `b` by default, and these axes
+    can have dimensions 2 or 3.  Where the dimension of either `a` or `b` is
+    2, the third component of the input vector is assumed to be zero and the
+    cross product calculated accordingly.  In cases where both input vectors
+    have dimension 2, the z-component of the cross product is returned.
+
+    Parameters
+    ----------
+    a : array_like
+        Components of the first vector(s).
+    b : array_like
+        Components of the second vector(s).
+    axisa : int, optional
+        Axis of `a` that defines the vector(s).  By default, the last axis.
+    axisb : int, optional
+        Axis of `b` that defines the vector(s).  By default, the last axis.
+    axisc : int, optional
+        Axis of `c` containing the cross product vector(s).  Ignored if
+        both input vectors have dimension 2, as the return is scalar.
+        By default, the last axis.
+    axis : int, optional
+        If defined, the axis of `a`, `b` and `c` that defines the vector(s)
+        and cross product(s).  Overrides `axisa`, `axisb` and `axisc`.
+
+    Returns
+    -------
+    c : ndarray
+        Vector cross product(s).
+
+    Raises
+    ------
+    ValueError
+        When the dimension of the vector(s) in `a` and/or `b` does not
+        equal 2 or 3.
+
+    See Also
+    --------
+    inner : Inner product
+    outer : Outer product.
+    ix_ : Construct index arrays.
+
+    Notes
+    -----
+    .. versionadded:: 1.9.0
+
+    Supports full broadcasting of the inputs.
+
+    Examples
+    --------
+    Vector cross-product.
+
+    >>> x = [1, 2, 3]
+    >>> y = [4, 5, 6]
+    >>> np.cross(x, y)
+    array([-3,  6, -3])
+
+    One vector with dimension 2.
+
+    >>> x = [1, 2]
+    >>> y = [4, 5, 6]
+    >>> np.cross(x, y)
+    array([12, -6, -3])
+
+    Equivalently:
+
+    >>> x = [1, 2, 0]
+    >>> y = [4, 5, 6]
+    >>> np.cross(x, y)
+    array([12, -6, -3])
+
+    Both vectors with dimension 2.
+
+    >>> x = [1,2]
+    >>> y = [4,5]
+    >>> np.cross(x, y)
+    array(-3)
+
+    Multiple vector cross-products. Note that the direction of the cross
+    product vector is defined by the *right-hand rule*.
+
+    >>> x = np.array([[1,2,3], [4,5,6]])
+    >>> y = np.array([[4,5,6], [1,2,3]])
+    >>> np.cross(x, y)
+    array([[-3,  6, -3],
+           [ 3, -6,  3]])
+
+    The orientation of `c` can be changed using the `axisc` keyword.
+
+    >>> np.cross(x, y, axisc=0)
+    array([[-3,  3],
+           [ 6, -6],
+           [-3,  3]])
+
+    Change the vector definition of `x` and `y` using `axisa` and `axisb`.
+
+    >>> x = np.array([[1,2,3], [4,5,6], [7, 8, 9]])
+    >>> y = np.array([[7, 8, 9], [4,5,6], [1,2,3]])
+    >>> np.cross(x, y)
+    array([[ -6,  12,  -6],
+           [  0,   0,   0],
+           [  6, -12,   6]])
+    >>> np.cross(x, y, axisa=0, axisb=0)
+    array([[-24,  48, -24],
+           [-30,  60, -30],
+           [-36,  72, -36]])
+
+    """
+    if axis is not None:
+        axisa, axisb, axisc = (axis,) * 3
+    a = asarray(a)
+    b = asarray(b)
+    # Check axisa and axisb are within bounds
+    axisa = normalize_axis_index(axisa, a.ndim, msg_prefix='axisa')
+    axisb = normalize_axis_index(axisb, b.ndim, msg_prefix='axisb')
+
+    # Move working axis to the end of the shape
+    a = moveaxis(a, axisa, -1)
+    b = moveaxis(b, axisb, -1)
+    msg = ("incompatible dimensions for cross product\n"
+           "(dimension must be 2 or 3)")
+    if a.shape[-1] not in (2, 3) or b.shape[-1] not in (2, 3):
+        raise ValueError(msg)
+
+    # Create the output array
+    shape = broadcast(a[..., 0], b[..., 0]).shape
+    if a.shape[-1] == 3 or b.shape[-1] == 3:
+        shape += (3,)
+        # Check axisc is within bounds
+        axisc = normalize_axis_index(axisc, len(shape), msg_prefix='axisc')
+    dtype = promote_types(a.dtype, b.dtype)
+    cp = empty(shape, dtype)
+
+    # recast arrays as dtype
+    a = a.astype(dtype)
+    b = b.astype(dtype)
+
+    # create local aliases for readability
+    a0 = a[..., 0]
+    a1 = a[..., 1]
+    if a.shape[-1] == 3:
+        a2 = a[..., 2]
+    b0 = b[..., 0]
+    b1 = b[..., 1]
+    if b.shape[-1] == 3:
+        b2 = b[..., 2]
+    if cp.ndim != 0 and cp.shape[-1] == 3:
+        cp0 = cp[..., 0]
+        cp1 = cp[..., 1]
+        cp2 = cp[..., 2]
+
+    if a.shape[-1] == 2:
+        if b.shape[-1] == 2:
+            # a0 * b1 - a1 * b0
+            multiply(a0, b1, out=cp)
+            cp -= a1 * b0
+            return cp
+        else:
+            assert b.shape[-1] == 3
+            # cp0 = a1 * b2 - 0  (a2 = 0)
+            # cp1 = 0 - a0 * b2  (a2 = 0)
+            # cp2 = a0 * b1 - a1 * b0
+            multiply(a1, b2, out=cp0)
+            multiply(a0, b2, out=cp1)
+            negative(cp1, out=cp1)
+            multiply(a0, b1, out=cp2)
+            cp2 -= a1 * b0
+    else:
+        assert a.shape[-1] == 3
+        if b.shape[-1] == 3:
+            # cp0 = a1 * b2 - a2 * b1
+            # cp1 = a2 * b0 - a0 * b2
+            # cp2 = a0 * b1 - a1 * b0
+            multiply(a1, b2, out=cp0)
+            tmp = array(a2 * b1)
+            cp0 -= tmp
+            multiply(a2, b0, out=cp1)
+            multiply(a0, b2, out=tmp)
+            cp1 -= tmp
+            multiply(a0, b1, out=cp2)
+            multiply(a1, b0, out=tmp)
+            cp2 -= tmp
+        else:
+            assert b.shape[-1] == 2
+            # cp0 = 0 - a2 * b1  (b2 = 0)
+            # cp1 = a2 * b0 - 0  (b2 = 0)
+            # cp2 = a0 * b1 - a1 * b0
+            multiply(a2, b1, out=cp0)
+            negative(cp0, out=cp0)
+            multiply(a2, b0, out=cp1)
+            multiply(a0, b1, out=cp2)
+            cp2 -= a1 * b0
+
+    return moveaxis(cp, -1, axisc)
+
+
+little_endian = (sys.byteorder == 'little')
+
+
+@set_module('numpy')
+def indices(dimensions, dtype=int, sparse=False):
+    """
+    Return an array representing the indices of a grid.
+
+    Compute an array where the subarrays contain index values 0, 1, ...
+    varying only along the corresponding axis.
+
+    Parameters
+    ----------
+    dimensions : sequence of ints
+        The shape of the grid.
+    dtype : dtype, optional
+        Data type of the result.
+    sparse : boolean, optional
+        Return a sparse representation of the grid instead of a dense
+        representation. Default is False.
+
+        .. versionadded:: 1.17
+
+    Returns
+    -------
+    grid : one ndarray or tuple of ndarrays
+        If sparse is False:
+            Returns one array of grid indices,
+            ``grid.shape = (len(dimensions),) + tuple(dimensions)``.
+        If sparse is True:
+            Returns a tuple of arrays, with
+            ``grid[i].shape = (1, ..., 1, dimensions[i], 1, ..., 1)`` with
+            dimensions[i] in the ith place
+
+    See Also
+    --------
+    mgrid, ogrid, meshgrid
+
+    Notes
+    -----
+    The output shape in the dense case is obtained by prepending the number
+    of dimensions in front of the tuple of dimensions, i.e. if `dimensions`
+    is a tuple ``(r0, ..., rN-1)`` of length ``N``, the output shape is
+    ``(N, r0, ..., rN-1)``.
+
+    The subarrays ``grid[k]`` contains the N-D array of indices along the
+    ``k-th`` axis. Explicitly::
+
+        grid[k, i0, i1, ..., iN-1] = ik
+
+    Examples
+    --------
+    >>> grid = np.indices((2, 3))
+    >>> grid.shape
+    (2, 2, 3)
+    >>> grid[0]        # row indices
+    array([[0, 0, 0],
+           [1, 1, 1]])
+    >>> grid[1]        # column indices
+    array([[0, 1, 2],
+           [0, 1, 2]])
+
+    The indices can be used as an index into an array.
+
+    >>> x = np.arange(20).reshape(5, 4)
+    >>> row, col = np.indices((2, 3))
+    >>> x[row, col]
+    array([[0, 1, 2],
+           [4, 5, 6]])
+
+    Note that it would be more straightforward in the above example to
+    extract the required elements directly with ``x[:2, :3]``.
+
+    If sparse is set to true, the grid will be returned in a sparse
+    representation.
+
+    >>> i, j = np.indices((2, 3), sparse=True)
+    >>> i.shape
+    (2, 1)
+    >>> j.shape
+    (1, 3)
+    >>> i        # row indices
+    array([[0],
+           [1]])
+    >>> j        # column indices
+    array([[0, 1, 2]])
+
+    """
+    dimensions = tuple(dimensions)
+    N = len(dimensions)
+    shape = (1,)*N
+    if sparse:
+        res = tuple()
+    else:
+        res = empty((N,)+dimensions, dtype=dtype)
+    for i, dim in enumerate(dimensions):
+        idx = arange(dim, dtype=dtype).reshape(
+            shape[:i] + (dim,) + shape[i+1:]
+        )
+        if sparse:
+            res = res + (idx,)
+        else:
+            res[i] = idx
+    return res
+
+
+@set_array_function_like_doc
+@set_module('numpy')
+def fromfunction(function, shape, *, dtype=float, like=None, **kwargs):
+    """
+    Construct an array by executing a function over each coordinate.
+
+    The resulting array therefore has a value ``fn(x, y, z)`` at
+    coordinate ``(x, y, z)``.
+
+    Parameters
+    ----------
+    function : callable
+        The function is called with N parameters, where N is the rank of
+        `shape`.  Each parameter represents the coordinates of the array
+        varying along a specific axis.  For example, if `shape`
+        were ``(2, 2)``, then the parameters would be
+        ``array([[0, 0], [1, 1]])`` and ``array([[0, 1], [0, 1]])``
+    shape : (N,) tuple of ints
+        Shape of the output array, which also determines the shape of
+        the coordinate arrays passed to `function`.
+    dtype : data-type, optional
+        Data-type of the coordinate arrays passed to `function`.
+        By default, `dtype` is float.
+    ${ARRAY_FUNCTION_LIKE}
+
+        .. versionadded:: 1.20.0
+
+    Returns
+    -------
+    fromfunction : any
+        The result of the call to `function` is passed back directly.
+        Therefore the shape of `fromfunction` is completely determined by
+        `function`.  If `function` returns a scalar value, the shape of
+        `fromfunction` would not match the `shape` parameter.
+
+    See Also
+    --------
+    indices, meshgrid
+
+    Notes
+    -----
+    Keywords other than `dtype` and `like` are passed to `function`.
+
+    Examples
+    --------
+    >>> np.fromfunction(lambda i, j: i, (2, 2), dtype=float)
+    array([[0., 0.],
+           [1., 1.]])
+
+    >>> np.fromfunction(lambda i, j: j, (2, 2), dtype=float)
+    array([[0., 1.],
+           [0., 1.]])
+
+    >>> np.fromfunction(lambda i, j: i == j, (3, 3), dtype=int)
+    array([[ True, False, False],
+           [False,  True, False],
+           [False, False,  True]])
+
+    >>> np.fromfunction(lambda i, j: i + j, (3, 3), dtype=int)
+    array([[0, 1, 2],
+           [1, 2, 3],
+           [2, 3, 4]])
+
+    """
+    if like is not None:
+        return _fromfunction_with_like(
+                like, function, shape, dtype=dtype, **kwargs)
+
+    args = indices(shape, dtype=dtype)
+    return function(*args, **kwargs)
+
+
+_fromfunction_with_like = array_function_dispatch()(fromfunction)
+
+
+def _frombuffer(buf, dtype, shape, order):
+    return frombuffer(buf, dtype=dtype).reshape(shape, order=order)
+
+
+@set_module('numpy')
+def isscalar(element):
+    """
+    Returns True if the type of `element` is a scalar type.
+
+    Parameters
+    ----------
+    element : any
+        Input argument, can be of any type and shape.
+
+    Returns
+    -------
+    val : bool
+        True if `element` is a scalar type, False if it is not.
+
+    See Also
+    --------
+    ndim : Get the number of dimensions of an array
+
+    Notes
+    -----
+    If you need a stricter way to identify a *numerical* scalar, use
+    ``isinstance(x, numbers.Number)``, as that returns ``False`` for most
+    non-numerical elements such as strings.
+
+    In most cases ``np.ndim(x) == 0`` should be used instead of this function,
+    as that will also return true for 0d arrays. This is how numpy overloads
+    functions in the style of the ``dx`` arguments to `gradient` and the ``bins``
+    argument to `histogram`. Some key differences:
+
+    +--------------------------------------+---------------+-------------------+
+    | x                                    |``isscalar(x)``|``np.ndim(x) == 0``|
+    +======================================+===============+===================+
+    | PEP 3141 numeric objects (including  | ``True``      | ``True``          |
+    | builtins)                            |               |                   |
+    +--------------------------------------+---------------+-------------------+
+    | builtin string and buffer objects    | ``True``      | ``True``          |
+    +--------------------------------------+---------------+-------------------+
+    | other builtin objects, like          | ``False``     | ``True``          |
+    | `pathlib.Path`, `Exception`,         |               |                   |
+    | the result of `re.compile`           |               |                   |
+    +--------------------------------------+---------------+-------------------+
+    | third-party objects like             | ``False``     | ``True``          |
+    | `matplotlib.figure.Figure`           |               |                   |
+    +--------------------------------------+---------------+-------------------+
+    | zero-dimensional numpy arrays        | ``False``     | ``True``          |
+    +--------------------------------------+---------------+-------------------+
+    | other numpy arrays                   | ``False``     | ``False``         |
+    +--------------------------------------+---------------+-------------------+
+    | `list`, `tuple`, and other sequence  | ``False``     | ``False``         |
+    | objects                              |               |                   |
+    +--------------------------------------+---------------+-------------------+
+
+    Examples
+    --------
+    >>> np.isscalar(3.1)
+    True
+    >>> np.isscalar(np.array(3.1))
+    False
+    >>> np.isscalar([3.1])
+    False
+    >>> np.isscalar(False)
+    True
+    >>> np.isscalar('numpy')
+    True
+
+    NumPy supports PEP 3141 numbers:
+
+    >>> from fractions import Fraction
+    >>> np.isscalar(Fraction(5, 17))
+    True
+    >>> from numbers import Number
+    >>> np.isscalar(Number())
+    True
+
+    """
+    return (isinstance(element, generic)
+            or type(element) in ScalarType
+            or isinstance(element, numbers.Number))
+
+
+@set_module('numpy')
+def binary_repr(num, width=None):
+    """
+    Return the binary representation of the input number as a string.
+
+    For negative numbers, if width is not given, a minus sign is added to the
+    front. If width is given, the two's complement of the number is
+    returned, with respect to that width.
+
+    In a two's-complement system negative numbers are represented by the two's
+    complement of the absolute value. This is the most common method of
+    representing signed integers on computers [1]_. A N-bit two's-complement
+    system can represent every integer in the range
+    :math:`-2^{N-1}` to :math:`+2^{N-1}-1`.
+
+    Parameters
+    ----------
+    num : int
+        Only an integer decimal number can be used.
+    width : int, optional
+        The length of the returned string if `num` is positive, or the length
+        of the two's complement if `num` is negative, provided that `width` is
+        at least a sufficient number of bits for `num` to be represented in the
+        designated form.
+
+        If the `width` value is insufficient, it will be ignored, and `num` will
+        be returned in binary (`num` > 0) or two's complement (`num` < 0) form
+        with its width equal to the minimum number of bits needed to represent
+        the number in the designated form. This behavior is deprecated and will
+        later raise an error.
+
+        .. deprecated:: 1.12.0
+
+    Returns
+    -------
+    bin : str
+        Binary representation of `num` or two's complement of `num`.
+
+    See Also
+    --------
+    base_repr: Return a string representation of a number in the given base
+               system.
+    bin: Python's built-in binary representation generator of an integer.
+
+    Notes
+    -----
+    `binary_repr` is equivalent to using `base_repr` with base 2, but about 25x
+    faster.
+
+    References
+    ----------
+    .. [1] Wikipedia, "Two's complement",
+        https://en.wikipedia.org/wiki/Two's_complement
+
+    Examples
+    --------
+    >>> np.binary_repr(3)
+    '11'
+    >>> np.binary_repr(-3)
+    '-11'
+    >>> np.binary_repr(3, width=4)
+    '0011'
+
+    The two's complement is returned when the input number is negative and
+    width is specified:
+
+    >>> np.binary_repr(-3, width=3)
+    '101'
+    >>> np.binary_repr(-3, width=5)
+    '11101'
+
+    """
+    def warn_if_insufficient(width, binwidth):
+        if width is not None and width < binwidth:
+            warnings.warn(
+                "Insufficient bit width provided. This behavior "
+                "will raise an error in the future.", DeprecationWarning,
+                stacklevel=3)
+
+    # Ensure that num is a Python integer to avoid overflow or unwanted
+    # casts to floating point.
+    num = operator.index(num)
+
+    if num == 0:
+        return '0' * (width or 1)
+
+    elif num > 0:
+        binary = bin(num)[2:]
+        binwidth = len(binary)
+        outwidth = (binwidth if width is None
+                    else builtins.max(binwidth, width))
+        warn_if_insufficient(width, binwidth)
+        return binary.zfill(outwidth)
+
+    else:
+        if width is None:
+            return '-' + bin(-num)[2:]
+
+        else:
+            poswidth = len(bin(-num)[2:])
+
+            # See gh-8679: remove extra digit
+            # for numbers at boundaries.
+            if 2**(poswidth - 1) == -num:
+                poswidth -= 1
+
+            twocomp = 2**(poswidth + 1) + num
+            binary = bin(twocomp)[2:]
+            binwidth = len(binary)
+
+            outwidth = builtins.max(binwidth, width)
+            warn_if_insufficient(width, binwidth)
+            return '1' * (outwidth - binwidth) + binary
+
+
+@set_module('numpy')
+def base_repr(number, base=2, padding=0):
+    """
+    Return a string representation of a number in the given base system.
+
+    Parameters
+    ----------
+    number : int
+        The value to convert. Positive and negative values are handled.
+    base : int, optional
+        Convert `number` to the `base` number system. The valid range is 2-36,
+        the default value is 2.
+    padding : int, optional
+        Number of zeros padded on the left. Default is 0 (no padding).
+
+    Returns
+    -------
+    out : str
+        String representation of `number` in `base` system.
+
+    See Also
+    --------
+    binary_repr : Faster version of `base_repr` for base 2.
+
+    Examples
+    --------
+    >>> np.base_repr(5)
+    '101'
+    >>> np.base_repr(6, 5)
+    '11'
+    >>> np.base_repr(7, base=5, padding=3)
+    '00012'
+
+    >>> np.base_repr(10, base=16)
+    'A'
+    >>> np.base_repr(32, base=16)
+    '20'
+
+    """
+    digits = '0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ'
+    if base > len(digits):
+        raise ValueError("Bases greater than 36 not handled in base_repr.")
+    elif base < 2:
+        raise ValueError("Bases less than 2 not handled in base_repr.")
+
+    num = abs(number)
+    res = []
+    while num:
+        res.append(digits[num % base])
+        num //= base
+    if padding:
+        res.append('0' * padding)
+    if number < 0:
+        res.append('-')
+    return ''.join(reversed(res or '0'))
+
+
+# These are all essentially abbreviations
+# These might wind up in a special abbreviations module
+
+
+def _maketup(descr, val):
+    dt = dtype(descr)
+    # Place val in all scalar tuples:
+    fields = dt.fields
+    if fields is None:
+        return val
+    else:
+        res = [_maketup(fields[name][0], val) for name in dt.names]
+        return tuple(res)
+
+
+@set_array_function_like_doc
+@set_module('numpy')
+def identity(n, dtype=None, *, like=None):
+    """
+    Return the identity array.
+
+    The identity array is a square array with ones on
+    the main diagonal.
+
+    Parameters
+    ----------
+    n : int
+        Number of rows (and columns) in `n` x `n` output.
+    dtype : data-type, optional
+        Data-type of the output.  Defaults to ``float``.
+    ${ARRAY_FUNCTION_LIKE}
+
+        .. versionadded:: 1.20.0
+
+    Returns
+    -------
+    out : ndarray
+        `n` x `n` array with its main diagonal set to one,
+        and all other elements 0.
+
+    Examples
+    --------
+    >>> np.identity(3)
+    array([[1.,  0.,  0.],
+           [0.,  1.,  0.],
+           [0.,  0.,  1.]])
+
+    """
+    if like is not None:
+        return _identity_with_like(like, n, dtype=dtype)
+
+    from numpy import eye
+    return eye(n, dtype=dtype, like=like)
+
+
+_identity_with_like = array_function_dispatch()(identity)
+
+
+def _allclose_dispatcher(a, b, rtol=None, atol=None, equal_nan=None):
+    return (a, b)
+
+
+@array_function_dispatch(_allclose_dispatcher)
+def allclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False):
+    """
+    Returns True if two arrays are element-wise equal within a tolerance.
+
+    The tolerance values are positive, typically very small numbers.  The
+    relative difference (`rtol` * abs(`b`)) and the absolute difference
+    `atol` are added together to compare against the absolute difference
+    between `a` and `b`.
+
+    NaNs are treated as equal if they are in the same place and if
+    ``equal_nan=True``.  Infs are treated as equal if they are in the same
+    place and of the same sign in both arrays.
+
+    Parameters
+    ----------
+    a, b : array_like
+        Input arrays to compare.
+    rtol : float
+        The relative tolerance parameter (see Notes).
+    atol : float
+        The absolute tolerance parameter (see Notes).
+    equal_nan : bool
+        Whether to compare NaN's as equal.  If True, NaN's in `a` will be
+        considered equal to NaN's in `b` in the output array.
+
+        .. versionadded:: 1.10.0
+
+    Returns
+    -------
+    allclose : bool
+        Returns True if the two arrays are equal within the given
+        tolerance; False otherwise.
+
+    See Also
+    --------
+    isclose, all, any, equal
+
+    Notes
+    -----
+    If the following equation is element-wise True, then allclose returns
+    True.
+
+     absolute(`a` - `b`) <= (`atol` + `rtol` * absolute(`b`))
+
+    The above equation is not symmetric in `a` and `b`, so that
+    ``allclose(a, b)`` might be different from ``allclose(b, a)`` in
+    some rare cases.
+
+    The comparison of `a` and `b` uses standard broadcasting, which
+    means that `a` and `b` need not have the same shape in order for
+    ``allclose(a, b)`` to evaluate to True.  The same is true for
+    `equal` but not `array_equal`.
+
+    `allclose` is not defined for non-numeric data types.
+    `bool` is considered a numeric data-type for this purpose.
+
+    Examples
+    --------
+    >>> np.allclose([1e10,1e-7], [1.00001e10,1e-8])
+    False
+    >>> np.allclose([1e10,1e-8], [1.00001e10,1e-9])
+    True
+    >>> np.allclose([1e10,1e-8], [1.0001e10,1e-9])
+    False
+    >>> np.allclose([1.0, np.nan], [1.0, np.nan])
+    False
+    >>> np.allclose([1.0, np.nan], [1.0, np.nan], equal_nan=True)
+    True
+
+    """
+    res = all(isclose(a, b, rtol=rtol, atol=atol, equal_nan=equal_nan))
+    return bool(res)
+
+
+def _isclose_dispatcher(a, b, rtol=None, atol=None, equal_nan=None):
+    return (a, b)
+
+
+@array_function_dispatch(_isclose_dispatcher)
+def isclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False):
+    """
+    Returns a boolean array where two arrays are element-wise equal within a
+    tolerance.
+
+    The tolerance values are positive, typically very small numbers.  The
+    relative difference (`rtol` * abs(`b`)) and the absolute difference
+    `atol` are added together to compare against the absolute difference
+    between `a` and `b`.
+
+    .. warning:: The default `atol` is not appropriate for comparing numbers
+                 that are much smaller than one (see Notes).
+
+    Parameters
+    ----------
+    a, b : array_like
+        Input arrays to compare.
+    rtol : float
+        The relative tolerance parameter (see Notes).
+    atol : float
+        The absolute tolerance parameter (see Notes).
+    equal_nan : bool
+        Whether to compare NaN's as equal.  If True, NaN's in `a` will be
+        considered equal to NaN's in `b` in the output array.
+
+    Returns
+    -------
+    y : array_like
+        Returns a boolean array of where `a` and `b` are equal within the
+        given tolerance. If both `a` and `b` are scalars, returns a single
+        boolean value.
+
+    See Also
+    --------
+    allclose
+    math.isclose
+
+    Notes
+    -----
+    .. versionadded:: 1.7.0
+
+    For finite values, isclose uses the following equation to test whether
+    two floating point values are equivalent.
+
+     absolute(`a` - `b`) <= (`atol` + `rtol` * absolute(`b`))
+
+    Unlike the built-in `math.isclose`, the above equation is not symmetric
+    in `a` and `b` -- it assumes `b` is the reference value -- so that
+    `isclose(a, b)` might be different from `isclose(b, a)`. Furthermore,
+    the default value of atol is not zero, and is used to determine what
+    small values should be considered close to zero. The default value is
+    appropriate for expected values of order unity: if the expected values
+    are significantly smaller than one, it can result in false positives.
+    `atol` should be carefully selected for the use case at hand. A zero value
+    for `atol` will result in `False` if either `a` or `b` is zero.
+
+    `isclose` is not defined for non-numeric data types.
+    `bool` is considered a numeric data-type for this purpose.
+
+    Examples
+    --------
+    >>> np.isclose([1e10,1e-7], [1.00001e10,1e-8])
+    array([ True, False])
+    >>> np.isclose([1e10,1e-8], [1.00001e10,1e-9])
+    array([ True, True])
+    >>> np.isclose([1e10,1e-8], [1.0001e10,1e-9])
+    array([False,  True])
+    >>> np.isclose([1.0, np.nan], [1.0, np.nan])
+    array([ True, False])
+    >>> np.isclose([1.0, np.nan], [1.0, np.nan], equal_nan=True)
+    array([ True, True])
+    >>> np.isclose([1e-8, 1e-7], [0.0, 0.0])
+    array([ True, False])
+    >>> np.isclose([1e-100, 1e-7], [0.0, 0.0], atol=0.0)
+    array([False, False])
+    >>> np.isclose([1e-10, 1e-10], [1e-20, 0.0])
+    array([ True,  True])
+    >>> np.isclose([1e-10, 1e-10], [1e-20, 0.999999e-10], atol=0.0)
+    array([False,  True])
+    """
+    def within_tol(x, y, atol, rtol):
+        with errstate(invalid='ignore'), _no_nep50_warning():
+            return less_equal(abs(x-y), atol + rtol * abs(y))
+
+    x = asanyarray(a)
+    y = asanyarray(b)
+
+    # Make sure y is an inexact type to avoid bad behavior on abs(MIN_INT).
+    # This will cause casting of x later. Also, make sure to allow subclasses
+    # (e.g., for numpy.ma).
+    # NOTE: We explicitly allow timedelta, which used to work. This could
+    #       possibly be deprecated. See also gh-18286.
+    #       timedelta works if `atol` is an integer or also a timedelta.
+    #       Although, the default tolerances are unlikely to be useful
+    if y.dtype.kind != "m":
+        dt = multiarray.result_type(y, 1.)
+        y = asanyarray(y, dtype=dt)
+
+    xfin = isfinite(x)
+    yfin = isfinite(y)
+    if all(xfin) and all(yfin):
+        return within_tol(x, y, atol, rtol)
+    else:
+        finite = xfin & yfin
+        cond = zeros_like(finite, subok=True)
+        # Because we're using boolean indexing, x & y must be the same shape.
+        # Ideally, we'd just do x, y = broadcast_arrays(x, y). It's in
+        # lib.stride_tricks, though, so we can't import it here.
+        x = x * ones_like(cond)
+        y = y * ones_like(cond)
+        # Avoid subtraction with infinite/nan values...
+        cond[finite] = within_tol(x[finite], y[finite], atol, rtol)
+        # Check for equality of infinite values...
+        cond[~finite] = (x[~finite] == y[~finite])
+        if equal_nan:
+            # Make NaN == NaN
+            both_nan = isnan(x) & isnan(y)
+
+            # Needed to treat masked arrays correctly. = True would not work.
+            cond[both_nan] = both_nan[both_nan]
+
+        return cond[()]  # Flatten 0d arrays to scalars
+
+
+def _array_equal_dispatcher(a1, a2, equal_nan=None):
+    return (a1, a2)
+
+
+@array_function_dispatch(_array_equal_dispatcher)
+def array_equal(a1, a2, equal_nan=False):
+    """
+    True if two arrays have the same shape and elements, False otherwise.
+
+    Parameters
+    ----------
+    a1, a2 : array_like
+        Input arrays.
+    equal_nan : bool
+        Whether to compare NaN's as equal. If the dtype of a1 and a2 is
+        complex, values will be considered equal if either the real or the
+        imaginary component of a given value is ``nan``.
+
+        .. versionadded:: 1.19.0
+
+    Returns
+    -------
+    b : bool
+        Returns True if the arrays are equal.
+
+    See Also
+    --------
+    allclose: Returns True if two arrays are element-wise equal within a
+              tolerance.
+    array_equiv: Returns True if input arrays are shape consistent and all
+                 elements equal.
+
+    Examples
+    --------
+    >>> np.array_equal([1, 2], [1, 2])
+    True
+    >>> np.array_equal(np.array([1, 2]), np.array([1, 2]))
+    True
+    >>> np.array_equal([1, 2], [1, 2, 3])
+    False
+    >>> np.array_equal([1, 2], [1, 4])
+    False
+    >>> a = np.array([1, np.nan])
+    >>> np.array_equal(a, a)
+    False
+    >>> np.array_equal(a, a, equal_nan=True)
+    True
+
+    When ``equal_nan`` is True, complex values with nan components are
+    considered equal if either the real *or* the imaginary components are nan.
+
+    >>> a = np.array([1 + 1j])
+    >>> b = a.copy()
+    >>> a.real = np.nan
+    >>> b.imag = np.nan
+    >>> np.array_equal(a, b, equal_nan=True)
+    True
+    """
+    try:
+        a1, a2 = asarray(a1), asarray(a2)
+    except Exception:
+        return False
+    if a1.shape != a2.shape:
+        return False
+    if not equal_nan:
+        return bool(asarray(a1 == a2).all())
+    # Handling NaN values if equal_nan is True
+    a1nan, a2nan = isnan(a1), isnan(a2)
+    # NaN's occur at different locations
+    if not (a1nan == a2nan).all():
+        return False
+    # Shapes of a1, a2 and masks are guaranteed to be consistent by this point
+    return bool(asarray(a1[~a1nan] == a2[~a1nan]).all())
+
+
+def _array_equiv_dispatcher(a1, a2):
+    return (a1, a2)
+
+
+@array_function_dispatch(_array_equiv_dispatcher)
+def array_equiv(a1, a2):
+    """
+    Returns True if input arrays are shape consistent and all elements equal.
+
+    Shape consistent means they are either the same shape, or one input array
+    can be broadcasted to create the same shape as the other one.
+
+    Parameters
+    ----------
+    a1, a2 : array_like
+        Input arrays.
+
+    Returns
+    -------
+    out : bool
+        True if equivalent, False otherwise.
+
+    Examples
+    --------
+    >>> np.array_equiv([1, 2], [1, 2])
+    True
+    >>> np.array_equiv([1, 2], [1, 3])
+    False
+
+    Showing the shape equivalence:
+
+    >>> np.array_equiv([1, 2], [[1, 2], [1, 2]])
+    True
+    >>> np.array_equiv([1, 2], [[1, 2, 1, 2], [1, 2, 1, 2]])
+    False
+
+    >>> np.array_equiv([1, 2], [[1, 2], [1, 3]])
+    False
+
+    """
+    try:
+        a1, a2 = asarray(a1), asarray(a2)
+    except Exception:
+        return False
+    try:
+        multiarray.broadcast(a1, a2)
+    except Exception:
+        return False
+
+    return bool(asarray(a1 == a2).all())
+
+
+Inf = inf = infty = Infinity = PINF
+nan = NaN = NAN
+False_ = bool_(False)
+True_ = bool_(True)
+
+
+def extend_all(module):
+    existing = set(__all__)
+    mall = getattr(module, '__all__')
+    for a in mall:
+        if a not in existing:
+            __all__.append(a)
+
+
+from .umath import *
+from .numerictypes import *
+from . import fromnumeric
+from .fromnumeric import *
+from . import arrayprint
+from .arrayprint import *
+from . import _asarray
+from ._asarray import *
+from . import _ufunc_config
+from ._ufunc_config import *
+extend_all(fromnumeric)
+extend_all(umath)
+extend_all(numerictypes)
+extend_all(arrayprint)
+extend_all(_asarray)
+extend_all(_ufunc_config)

env-llmeval/lib/python3.10/site-packages/numpy/core/numeric.pyi

@@ -0,0 +1,660 @@
+from collections.abc import Callable, Sequence
+from typing import (
+    Any,
+    overload,
+    TypeVar,
+    Literal,
+    SupportsAbs,
+    SupportsIndex,
+    NoReturn,
+)
+if sys.version_info >= (3, 10):
+    from typing import TypeGuard
+else:
+    from typing_extensions import TypeGuard
+
+from numpy import (
+    ComplexWarning as ComplexWarning,
+    generic,
+    unsignedinteger,
+    signedinteger,
+    floating,
+    complexfloating,
+    bool_,
+    int_,
+    intp,
+    float64,
+    timedelta64,
+    object_,
+    _OrderKACF,
+    _OrderCF,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    DTypeLike,
+    _ShapeLike,
+    _DTypeLike,
+    _ArrayLike,
+    _SupportsArrayFunc,
+    _ScalarLike_co,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeTD64_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeUnknown,
+)
+
+_T = TypeVar("_T")
+_SCT = TypeVar("_SCT", bound=generic)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+_CorrelateMode = Literal["valid", "same", "full"]
+
+__all__: list[str]
+
+@overload
+def zeros_like(
+    a: _ArrayType,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: Literal[True] = ...,
+    shape: None = ...,
+) -> _ArrayType: ...
+@overload
+def zeros_like(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def zeros_like(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+@overload
+def zeros_like(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[_SCT]: ...
+@overload
+def zeros_like(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+
+@overload
+def ones(
+    shape: _ShapeLike,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def ones(
+    shape: _ShapeLike,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones(
+    shape: _ShapeLike,
+    dtype: DTypeLike,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def ones_like(
+    a: _ArrayType,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: Literal[True] = ...,
+    shape: None = ...,
+) -> _ArrayType: ...
+@overload
+def ones_like(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones_like(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+@overload
+def ones_like(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[_SCT]: ...
+@overload
+def ones_like(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full(
+    shape: _ShapeLike,
+    fill_value: Any,
+    dtype: DTypeLike,
+    order: _OrderCF = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def full_like(
+    a: _ArrayType,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: Literal[True] = ...,
+    shape: None = ...,
+) -> _ArrayType: ...
+@overload
+def full_like(
+    a: _ArrayLike[_SCT],
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full_like(
+    a: object,
+    fill_value: Any,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+@overload
+def full_like(
+    a: Any,
+    fill_value: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[_SCT]: ...
+@overload
+def full_like(
+    a: Any,
+    fill_value: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+    subok: bool = ...,
+    shape: None | _ShapeLike= ...,
+) -> NDArray[Any]: ...
+
+@overload
+def count_nonzero(
+    a: ArrayLike,
+    axis: None = ...,
+    *,
+    keepdims: Literal[False] = ...,
+) -> int: ...
+@overload
+def count_nonzero(
+    a: ArrayLike,
+    axis: _ShapeLike = ...,
+    *,
+    keepdims: bool = ...,
+) -> Any: ...  # TODO: np.intp or ndarray[np.intp]
+
+def isfortran(a: NDArray[Any] | generic) -> bool: ...
+
+def argwhere(a: ArrayLike) -> NDArray[intp]: ...
+
+def flatnonzero(a: ArrayLike) -> NDArray[intp]: ...
+
+@overload
+def correlate(
+    a: _ArrayLikeUnknown,
+    v: _ArrayLikeUnknown,
+    mode: _CorrelateMode = ...,
+) -> NDArray[Any]: ...
+@overload
+def correlate(
+    a: _ArrayLikeBool_co,
+    v: _ArrayLikeBool_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[bool_]: ...
+@overload
+def correlate(
+    a: _ArrayLikeUInt_co,
+    v: _ArrayLikeUInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeInt_co,
+    v: _ArrayLikeInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def correlate(
+    a: _ArrayLikeTD64_co,
+    v: _ArrayLikeTD64_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def correlate(
+    a: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def convolve(
+    a: _ArrayLikeUnknown,
+    v: _ArrayLikeUnknown,
+    mode: _CorrelateMode = ...,
+) -> NDArray[Any]: ...
+@overload
+def convolve(
+    a: _ArrayLikeBool_co,
+    v: _ArrayLikeBool_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[bool_]: ...
+@overload
+def convolve(
+    a: _ArrayLikeUInt_co,
+    v: _ArrayLikeUInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeInt_co,
+    v: _ArrayLikeInt_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def convolve(
+    a: _ArrayLikeTD64_co,
+    v: _ArrayLikeTD64_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def convolve(
+    a: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+    mode: _CorrelateMode = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def outer(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    out: None = ...,
+) -> NDArray[Any]: ...
+@overload
+def outer(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    out: None = ...,
+) -> NDArray[bool_]: ...
+@overload
+def outer(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    out: None = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    out: None = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    out: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    out: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def outer(
+    a: _ArrayLikeTD64_co,
+    b: _ArrayLikeTD64_co,
+    out: None = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def outer(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    out: None = ...,
+) -> NDArray[object_]: ...
+@overload
+def outer(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    b: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    out: _ArrayType,
+) -> _ArrayType: ...
+
+@overload
+def tensordot(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[Any]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[bool_]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeTD64_co,
+    b: _ArrayLikeTD64_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def tensordot(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    axes: int | tuple[_ShapeLike, _ShapeLike] = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def roll(
+    a: _ArrayLike[_SCT],
+    shift: _ShapeLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def roll(
+    a: ArrayLike,
+    shift: _ShapeLike,
+    axis: None | _ShapeLike = ...,
+) -> NDArray[Any]: ...
+
+def rollaxis(
+    a: NDArray[_SCT],
+    axis: int,
+    start: int = ...,
+) -> NDArray[_SCT]: ...
+
+def moveaxis(
+    a: NDArray[_SCT],
+    source: _ShapeLike,
+    destination: _ShapeLike,
+) -> NDArray[_SCT]: ...
+
+@overload
+def cross(
+    a: _ArrayLikeUnknown,
+    b: _ArrayLikeUnknown,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[Any]: ...
+@overload
+def cross(
+    a: _ArrayLikeBool_co,
+    b: _ArrayLikeBool_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NoReturn: ...
+@overload
+def cross(
+    a: _ArrayLikeUInt_co,
+    b: _ArrayLikeUInt_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeInt_co,
+    b: _ArrayLikeInt_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeFloat_co,
+    b: _ArrayLikeFloat_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeComplex_co,
+    b: _ArrayLikeComplex_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cross(
+    a: _ArrayLikeObject_co,
+    b: _ArrayLikeObject_co,
+    axisa: int = ...,
+    axisb: int = ...,
+    axisc: int = ...,
+    axis: None | int = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: type[int] = ...,
+    sparse: Literal[False] = ...,
+) -> NDArray[int_]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: type[int] = ...,
+    sparse: Literal[True] = ...,
+) -> tuple[NDArray[int_], ...]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: _DTypeLike[_SCT],
+    sparse: Literal[False] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: _DTypeLike[_SCT],
+    sparse: Literal[True],
+) -> tuple[NDArray[_SCT], ...]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: DTypeLike,
+    sparse: Literal[False] = ...,
+) -> NDArray[Any]: ...
+@overload
+def indices(
+    dimensions: Sequence[int],
+    dtype: DTypeLike,
+    sparse: Literal[True],
+) -> tuple[NDArray[Any], ...]: ...
+
+def fromfunction(
+    function: Callable[..., _T],
+    shape: Sequence[int],
+    *,
+    dtype: DTypeLike = ...,
+    like: _SupportsArrayFunc = ...,
+    **kwargs: Any,
+) -> _T: ...
+
+def isscalar(element: object) -> TypeGuard[
+    generic | bool | int | float | complex | str | bytes | memoryview
+]: ...
+
+def binary_repr(num: SupportsIndex, width: None | int = ...) -> str: ...
+
+def base_repr(
+    number: SupportsAbs[float],
+    base: float = ...,
+    padding: SupportsIndex = ...,
+) -> str: ...
+
+@overload
+def identity(
+    n: int,
+    dtype: None = ...,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def identity(
+    n: int,
+    dtype: _DTypeLike[_SCT],
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def identity(
+    n: int,
+    dtype: DTypeLike,
+    *,
+    like: _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+def allclose(
+    a: ArrayLike,
+    b: ArrayLike,
+    rtol: float = ...,
+    atol: float = ...,
+    equal_nan: bool = ...,
+) -> bool: ...
+
+@overload
+def isclose(
+    a: _ScalarLike_co,
+    b: _ScalarLike_co,
+    rtol: float = ...,
+    atol: float = ...,
+    equal_nan: bool = ...,
+) -> bool_: ...
+@overload
+def isclose(
+    a: ArrayLike,
+    b: ArrayLike,
+    rtol: float = ...,
+    atol: float = ...,
+    equal_nan: bool = ...,
+) -> NDArray[bool_]: ...
+
+def array_equal(a1: ArrayLike, a2: ArrayLike, equal_nan: bool = ...) -> bool: ...
+
+def array_equiv(a1: ArrayLike, a2: ArrayLike) -> bool: ...

env-llmeval/lib/python3.10/site-packages/numpy/core/shape_base.pyi

@@ -0,0 +1,123 @@
+from collections.abc import Sequence
+from typing import TypeVar, overload, Any, SupportsIndex
+
+from numpy import generic, _CastingKind
+from numpy._typing import (
+    NDArray,
+    ArrayLike,
+    DTypeLike,
+    _ArrayLike,
+    _DTypeLike,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+__all__: list[str]
+
+@overload
+def atleast_1d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_1d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_1d(*arys: ArrayLike) -> list[NDArray[Any]]: ...
+
+@overload
+def atleast_2d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_2d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_2d(*arys: ArrayLike) -> list[NDArray[Any]]: ...
+
+@overload
+def atleast_3d(arys: _ArrayLike[_SCT], /) -> NDArray[_SCT]: ...
+@overload
+def atleast_3d(arys: ArrayLike, /) -> NDArray[Any]: ...
+@overload
+def atleast_3d(*arys: ArrayLike) -> list[NDArray[Any]]: ...
+
+@overload
+def vstack(
+    tup: Sequence[_ArrayLike[_SCT]],
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def vstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def vstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+
+@overload
+def hstack(
+    tup: Sequence[_ArrayLike[_SCT]],
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def hstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def hstack(
+    tup: Sequence[ArrayLike],
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+
+@overload
+def stack(
+    arrays: Sequence[_ArrayLike[_SCT]],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: None = ...,
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+    casting: _CastingKind = ...
+) -> NDArray[_SCT]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: None = ...,
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> NDArray[Any]: ...
+@overload
+def stack(
+    arrays: Sequence[ArrayLike],
+    axis: SupportsIndex = ...,
+    out: _ArrayType = ...,
+    *,
+    dtype: DTypeLike = ...,
+    casting: _CastingKind = ...
+) -> _ArrayType: ...
+
+@overload
+def block(arrays: _ArrayLike[_SCT]) -> NDArray[_SCT]: ...
+@overload
+def block(arrays: ArrayLike) -> NDArray[Any]: ...

env-llmeval/lib/python3.10/site-packages/numpy/core/umath.py

@@ -0,0 +1,36 @@
+"""
+Create the numpy.core.umath namespace for backward compatibility. In v1.16
+the multiarray and umath c-extension modules were merged into a single
+_multiarray_umath extension module. So we replicate the old namespace
+by importing from the extension module.
+
+"""
+
+from . import _multiarray_umath
+from ._multiarray_umath import *  # noqa: F403
+# These imports are needed for backward compatibility,
+# do not change them. issue gh-11862
+# _ones_like is semi-public, on purpose not added to __all__
+from ._multiarray_umath import _UFUNC_API, _add_newdoc_ufunc, _ones_like
+
+__all__ = [
+    '_UFUNC_API', 'ERR_CALL', 'ERR_DEFAULT', 'ERR_IGNORE', 'ERR_LOG',
+    'ERR_PRINT', 'ERR_RAISE', 'ERR_WARN', 'FLOATING_POINT_SUPPORT',
+    'FPE_DIVIDEBYZERO', 'FPE_INVALID', 'FPE_OVERFLOW', 'FPE_UNDERFLOW', 'NAN',
+    'NINF', 'NZERO', 'PINF', 'PZERO', 'SHIFT_DIVIDEBYZERO', 'SHIFT_INVALID',
+    'SHIFT_OVERFLOW', 'SHIFT_UNDERFLOW', 'UFUNC_BUFSIZE_DEFAULT',
+    'UFUNC_PYVALS_NAME', '_add_newdoc_ufunc', 'absolute', 'add',
+    'arccos', 'arccosh', 'arcsin', 'arcsinh', 'arctan', 'arctan2', 'arctanh',
+    'bitwise_and', 'bitwise_or', 'bitwise_xor', 'cbrt', 'ceil', 'conj',
+    'conjugate', 'copysign', 'cos', 'cosh', 'deg2rad', 'degrees', 'divide',
+    'divmod', 'e', 'equal', 'euler_gamma', 'exp', 'exp2', 'expm1', 'fabs',
+    'floor', 'floor_divide', 'float_power', 'fmax', 'fmin', 'fmod', 'frexp',
+    'frompyfunc', 'gcd', 'geterrobj', 'greater', 'greater_equal', 'heaviside',
+    'hypot', 'invert', 'isfinite', 'isinf', 'isnan', 'isnat', 'lcm', 'ldexp',
+    'left_shift', 'less', 'less_equal', 'log', 'log10', 'log1p', 'log2',
+    'logaddexp', 'logaddexp2', 'logical_and', 'logical_not', 'logical_or',
+    'logical_xor', 'maximum', 'minimum', 'mod', 'modf', 'multiply', 'negative',
+    'nextafter', 'not_equal', 'pi', 'positive', 'power', 'rad2deg', 'radians',
+    'reciprocal', 'remainder', 'right_shift', 'rint', 'seterrobj', 'sign',
+    'signbit', 'sin', 'sinh', 'spacing', 'sqrt', 'square', 'subtract', 'tan',
+    'tanh', 'true_divide', 'trunc']

env-llmeval/lib/python3.10/site-packages/numpy/core/umath_tests.py

@@ -0,0 +1,13 @@
+"""
+Shim for _umath_tests to allow a deprecation period for the new name.
+
+"""
+import warnings
+
+# 2018-04-04, numpy 1.15.0
+warnings.warn(("numpy.core.umath_tests is an internal NumPy "
+               "module and should not be imported. It will "
+               "be removed in a future NumPy release."),
+              category=DeprecationWarning, stacklevel=2)
+
+from ._umath_tests import *

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_asimd.c

@@ -0,0 +1,27 @@
+#ifdef _MSC_VER
+    #include <Intrin.h>
+#endif
+#include <arm_neon.h>
+
+int main(int argc, char **argv)
+{
+    float *src = (float*)argv[argc-1];
+    float32x4_t v1 = vdupq_n_f32(src[0]), v2 = vdupq_n_f32(src[1]);
+    /* MAXMIN */
+    int ret  = (int)vgetq_lane_f32(vmaxnmq_f32(v1, v2), 0);
+        ret += (int)vgetq_lane_f32(vminnmq_f32(v1, v2), 0);
+    /* ROUNDING */
+    ret += (int)vgetq_lane_f32(vrndq_f32(v1), 0);
+#ifdef __aarch64__
+    {
+        double *src2 = (double*)argv[argc-1];
+        float64x2_t vd1 = vdupq_n_f64(src2[0]), vd2 = vdupq_n_f64(src2[1]);
+        /* MAXMIN */
+        ret += (int)vgetq_lane_f64(vmaxnmq_f64(vd1, vd2), 0);
+        ret += (int)vgetq_lane_f64(vminnmq_f64(vd1, vd2), 0);
+        /* ROUNDING */
+        ret += (int)vgetq_lane_f64(vrndq_f64(vd1), 0);
+    }
+#endif
+    return ret;
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_asimdhp.c

@@ -0,0 +1,15 @@
+#ifdef _MSC_VER
+    #include <Intrin.h>
+#endif
+#include <arm_neon.h>
+
+int main(int argc, char **argv)
+{
+    float16_t *src = (float16_t*)argv[argc-1];
+    float16x8_t vhp  = vdupq_n_f16(src[0]);
+    float16x4_t vlhp = vdup_n_f16(src[1]);
+
+    int ret  =  (int)vgetq_lane_f16(vabdq_f16(vhp, vhp), 0);
+        ret  += (int)vget_lane_f16(vabd_f16(vlhp, vlhp), 0);
+    return ret;
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __AVX__
+        #error "HOST/ARCH doesn't support AVX"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m256 a = _mm256_add_ps(_mm256_loadu_ps((const float*)argv[argc-1]), _mm256_loadu_ps((const float*)argv[1]));
+    return (int)_mm_cvtss_f32(_mm256_castps256_ps128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx2.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __AVX2__
+        #error "HOST/ARCH doesn't support AVX2"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m256i a = _mm256_abs_epi16(_mm256_loadu_si256((const __m256i*)argv[argc-1]));
+    return _mm_cvtsi128_si32(_mm256_castsi256_si128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512_clx.c

@@ -0,0 +1,22 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __AVX512VNNI__
+        #error "HOST/ARCH doesn't support CascadeLake AVX512 features"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    /* VNNI */
+    __m512i a = _mm512_loadu_si512((const __m512i*)argv[argc-1]);
+            a = _mm512_dpbusd_epi32(a, _mm512_setzero_si512(), a);
+    return _mm_cvtsi128_si32(_mm512_castsi512_si128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512_cnl.c

@@ -0,0 +1,24 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #if !defined(__AVX512VBMI__) || !defined(__AVX512IFMA__)
+        #error "HOST/ARCH doesn't support CannonLake AVX512 features"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m512i a = _mm512_loadu_si512((const __m512i*)argv[argc-1]);
+    /* IFMA */
+    a = _mm512_madd52hi_epu64(a, a, _mm512_setzero_si512());
+    /* VMBI */
+    a = _mm512_permutex2var_epi8(a, _mm512_setzero_si512(), a);
+    return _mm_cvtsi128_si32(_mm512_castsi512_si128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512_icl.c

@@ -0,0 +1,26 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #if !defined(__AVX512VPOPCNTDQ__) || !defined(__AVX512BITALG__) || !defined(__AVX512VPOPCNTDQ__)
+        #error "HOST/ARCH doesn't support IceLake AVX512 features"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m512i a = _mm512_loadu_si512((const __m512i*)argv[argc-1]);
+    /* VBMI2 */
+    a = _mm512_shrdv_epi64(a, a, _mm512_setzero_si512());
+    /* BITLAG */
+    a = _mm512_popcnt_epi8(a);
+    /* VPOPCNTDQ */
+    a = _mm512_popcnt_epi64(a);
+    return _mm_cvtsi128_si32(_mm512_castsi512_si128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512_knl.c

@@ -0,0 +1,25 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #if !defined(__AVX512ER__) || !defined(__AVX512PF__)
+        #error "HOST/ARCH doesn't support Knights Landing AVX512 features"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    int base[128]={};
+    __m512d ad = _mm512_loadu_pd((const __m512d*)argv[argc-1]);
+    /* ER */
+    __m512i a = _mm512_castpd_si512(_mm512_exp2a23_pd(ad));
+    /* PF */
+    _mm512_mask_prefetch_i64scatter_pd(base, _mm512_cmpeq_epi64_mask(a, a), a, 1, _MM_HINT_T1);
+    return base[0];
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512_knm.c

@@ -0,0 +1,30 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #if !defined(__AVX5124FMAPS__) || !defined(__AVX5124VNNIW__) || !defined(__AVX512VPOPCNTDQ__)
+        #error "HOST/ARCH doesn't support Knights Mill AVX512 features"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m512i a = _mm512_loadu_si512((const __m512i*)argv[argc-1]);
+    __m512 b = _mm512_loadu_ps((const __m512*)argv[argc-2]);
+
+    /* 4FMAPS */
+    b = _mm512_4fmadd_ps(b, b, b, b, b, NULL);
+    /* 4VNNIW */
+    a = _mm512_4dpwssd_epi32(a, a, a, a, a, NULL);
+    /* VPOPCNTDQ */
+    a = _mm512_popcnt_epi64(a);
+
+    a = _mm512_add_epi32(a, _mm512_castps_si512(b));
+    return _mm_cvtsi128_si32(_mm512_castsi512_si128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512_skx.c

@@ -0,0 +1,26 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #if !defined(__AVX512VL__) || !defined(__AVX512BW__) || !defined(__AVX512DQ__)
+        #error "HOST/ARCH doesn't support SkyLake AVX512 features"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m512i aa = _mm512_abs_epi32(_mm512_loadu_si512((const __m512i*)argv[argc-1]));
+    /* VL */
+    __m256i a = _mm256_abs_epi64(_mm512_extracti64x4_epi64(aa, 1));
+    /* DQ */
+    __m512i b = _mm512_broadcast_i32x8(a);
+    /* BW */
+    b = _mm512_abs_epi16(b);
+    return _mm_cvtsi128_si32(_mm512_castsi512_si128(b));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512cd.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __AVX512CD__
+        #error "HOST/ARCH doesn't support AVX512CD"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m512i a = _mm512_lzcnt_epi32(_mm512_loadu_si512((const __m512i*)argv[argc-1]));
+    return _mm_cvtsi128_si32(_mm512_castsi512_si128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_avx512f.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __AVX512F__
+        #error "HOST/ARCH doesn't support AVX512F"
+    #endif
+#endif
+
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m512i a = _mm512_abs_epi32(_mm512_loadu_si512((const __m512i*)argv[argc-1]));
+    return _mm_cvtsi128_si32(_mm512_castsi512_si128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_f16c.c

@@ -0,0 +1,22 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __F16C__
+        #error "HOST/ARCH doesn't support F16C"
+    #endif
+#endif
+
+#include <emmintrin.h>
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m128 a  = _mm_cvtph_ps(_mm_loadu_si128((const __m128i*)argv[argc-1]));
+    __m256 a8 = _mm256_cvtph_ps(_mm_loadu_si128((const __m128i*)argv[argc-2]));
+    return (int)(_mm_cvtss_f32(a) + _mm_cvtss_f32(_mm256_castps256_ps128(a8)));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_fma3.c

@@ -0,0 +1,22 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #if !defined(__FMA__) && !defined(__AVX2__)
+        #error "HOST/ARCH doesn't support FMA3"
+    #endif
+#endif
+
+#include <xmmintrin.h>
+#include <immintrin.h>
+
+int main(int argc, char **argv)
+{
+    __m256 a = _mm256_loadu_ps((const float*)argv[argc-1]);
+           a = _mm256_fmadd_ps(a, a, a);
+    return (int)_mm_cvtss_f32(_mm256_castps256_ps128(a));
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_neon.c

@@ -0,0 +1,19 @@
+#ifdef _MSC_VER
+    #include <Intrin.h>
+#endif
+#include <arm_neon.h>
+
+int main(int argc, char **argv)
+{
+    // passing from untraced pointers to avoid optimizing out any constants
+    // so we can test against the linker.
+    float *src = (float*)argv[argc-1];
+    float32x4_t v1 = vdupq_n_f32(src[0]), v2 = vdupq_n_f32(src[1]);
+    int ret = (int)vgetq_lane_f32(vmulq_f32(v1, v2), 0);
+#ifdef __aarch64__
+    double *src2 = (double*)argv[argc-2];
+    float64x2_t vd1 = vdupq_n_f64(src2[0]), vd2 = vdupq_n_f64(src2[1]);
+    ret += (int)vgetq_lane_f64(vmulq_f64(vd1, vd2), 0);
+#endif
+    return ret;
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_neon_fp16.c

@@ -0,0 +1,11 @@
+#ifdef _MSC_VER
+    #include <Intrin.h>
+#endif
+#include <arm_neon.h>
+
+int main(int argc, char **argv)
+{
+    short *src = (short*)argv[argc-1];
+    float32x4_t v_z4 = vcvt_f32_f16((float16x4_t)vld1_s16(src));
+    return (int)vgetq_lane_f32(v_z4, 0);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_neon_vfpv4.c

@@ -0,0 +1,21 @@
+#ifdef _MSC_VER
+    #include <Intrin.h>
+#endif
+#include <arm_neon.h>
+
+int main(int argc, char **argv)
+{
+    float *src = (float*)argv[argc-1];
+    float32x4_t v1 = vdupq_n_f32(src[0]);
+    float32x4_t v2 = vdupq_n_f32(src[1]);
+    float32x4_t v3 = vdupq_n_f32(src[2]);
+    int ret = (int)vgetq_lane_f32(vfmaq_f32(v1, v2, v3), 0);
+#ifdef __aarch64__
+    double *src2 = (double*)argv[argc-2];
+    float64x2_t vd1 = vdupq_n_f64(src2[0]);
+    float64x2_t vd2 = vdupq_n_f64(src2[1]);
+    float64x2_t vd3 = vdupq_n_f64(src2[2]);
+    ret += (int)vgetq_lane_f64(vfmaq_f64(vd1, vd2, vd3), 0);
+#endif
+    return ret;
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_popcnt.c

@@ -0,0 +1,32 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env vr `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #if !defined(__SSE4_2__) && !defined(__POPCNT__)
+        #error "HOST/ARCH doesn't support POPCNT"
+    #endif
+#endif
+
+#ifdef _MSC_VER
+    #include <nmmintrin.h>
+#else
+    #include <popcntintrin.h>
+#endif
+
+int main(int argc, char **argv)
+{
+    // To make sure popcnt instructions are generated
+    // and been tested against the assembler
+    unsigned long long a = *((unsigned long long*)argv[argc-1]);
+    unsigned int b = *((unsigned int*)argv[argc-2]);
+
+#if defined(_M_X64) || defined(__x86_64__)
+    a = _mm_popcnt_u64(a);
+#endif
+    b = _mm_popcnt_u32(b);
+    return (int)a + b;
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_sse.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __SSE__
+        #error "HOST/ARCH doesn't support SSE"
+    #endif
+#endif
+
+#include <xmmintrin.h>
+
+int main(void)
+{
+    __m128 a = _mm_add_ps(_mm_setzero_ps(), _mm_setzero_ps());
+    return (int)_mm_cvtss_f32(a);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_sse2.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __SSE2__
+        #error "HOST/ARCH doesn't support SSE2"
+    #endif
+#endif
+
+#include <emmintrin.h>
+
+int main(void)
+{
+    __m128i a = _mm_add_epi16(_mm_setzero_si128(), _mm_setzero_si128());
+    return _mm_cvtsi128_si32(a);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_sse3.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __SSE3__
+        #error "HOST/ARCH doesn't support SSE3"
+    #endif
+#endif
+
+#include <pmmintrin.h>
+
+int main(void)
+{
+    __m128 a = _mm_hadd_ps(_mm_setzero_ps(), _mm_setzero_ps());
+    return (int)_mm_cvtss_f32(a);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_sse41.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __SSE4_1__
+        #error "HOST/ARCH doesn't support SSE41"
+    #endif
+#endif
+
+#include <smmintrin.h>
+
+int main(void)
+{
+    __m128 a = _mm_floor_ps(_mm_setzero_ps());
+    return (int)_mm_cvtss_f32(a);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_ssse3.c

@@ -0,0 +1,20 @@
+#if defined(DETECT_FEATURES) && defined(__INTEL_COMPILER)
+    /*
+     * Unlike GCC and CLANG, Intel Compiler exposes all supported intrinsics,
+     * whether or not the build options for those features are specified.
+     * Therefore, we must test #definitions of CPU features when option native/host
+     * is enabled via `--cpu-baseline` or through env var `CFLAGS` otherwise
+     * the test will be broken and leads to enable all possible features.
+     */
+    #ifndef __SSSE3__
+        #error "HOST/ARCH doesn't support SSSE3"
+    #endif
+#endif
+
+#include <tmmintrin.h>
+
+int main(void)
+{
+    __m128i a = _mm_hadd_epi16(_mm_setzero_si128(), _mm_setzero_si128());
+    return (int)_mm_cvtsi128_si32(a);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_vsx.c

@@ -0,0 +1,21 @@
+#ifndef __VSX__
+    #error "VSX is not supported"
+#endif
+#include <altivec.h>
+
+#if (defined(__GNUC__) && !defined(vec_xl)) || (defined(__clang__) && !defined(__IBMC__))
+    #define vsx_ld  vec_vsx_ld
+    #define vsx_st  vec_vsx_st
+#else
+    #define vsx_ld  vec_xl
+    #define vsx_st  vec_xst
+#endif
+
+int main(void)
+{
+    unsigned int zout[4];
+    unsigned int z4[] = {0, 0, 0, 0};
+    __vector unsigned int v_z4 = vsx_ld(0, z4);
+    vsx_st(v_z4, 0, zout);
+    return zout[0];
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_vsx3.c

@@ -0,0 +1,13 @@
+#ifndef __VSX__
+    #error "VSX is not supported"
+#endif
+#include <altivec.h>
+
+typedef __vector unsigned int v_uint32x4;
+
+int main(void)
+{
+    v_uint32x4 z4 = (v_uint32x4){0, 0, 0, 0};
+    z4 = vec_absd(z4, z4);
+    return (int)vec_extract(z4, 0);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_vsx4.c

@@ -0,0 +1,14 @@
+#ifndef __VSX__
+    #error "VSX is not supported"
+#endif
+#include <altivec.h>
+
+typedef __vector unsigned int v_uint32x4;
+
+int main(void)
+{
+    v_uint32x4 v1 = (v_uint32x4){2, 4, 8, 16};
+    v_uint32x4 v2 = (v_uint32x4){2, 2, 2, 2};
+    v_uint32x4 v3 = vec_mod(v1, v2);
+    return (int)vec_extractm(v3);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_vx.c

@@ -0,0 +1,16 @@
+#if (__VEC__ < 10301) || (__ARCH__ < 11)
+    #error VX not supported
+#endif
+
+#include <vecintrin.h>
+int main(int argc, char **argv)
+{
+    __vector double x = vec_abs(vec_xl(argc, (double*)argv));
+    __vector double y = vec_load_len((double*)argv, (unsigned int)argc);
+
+    x = vec_round(vec_ceil(x) + vec_floor(y));
+    __vector bool long long m = vec_cmpge(x, y);
+    __vector long long i = vec_signed(vec_sel(x, y, m));
+
+    return (int)vec_extract(i, 0);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_vxe2.c

@@ -0,0 +1,21 @@
+#if (__VEC__ < 10303) || (__ARCH__ < 13)
+    #error VXE2 not supported
+#endif
+
+#include <vecintrin.h>
+
+int main(int argc, char **argv)
+{
+    int val;
+    __vector signed short large = { 'a', 'b', 'c', 'a', 'g', 'h', 'g', 'o' };
+    __vector signed short search = { 'g', 'h', 'g', 'o' };
+    __vector unsigned char len = { 0 };
+    __vector unsigned char res = vec_search_string_cc(large, search, len, &val);
+    __vector float x = vec_xl(argc, (float*)argv);
+    __vector int i = vec_signed(x);
+
+    i = vec_srdb(vec_sldb(i, i, 2), i, 3);
+    val += (int)vec_extract(res, 1);
+    val += vec_extract(i, 0);
+    return val;
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/cpu_xop.c

@@ -0,0 +1,12 @@
+#include <immintrin.h>
+#ifdef _MSC_VER
+    #include <ammintrin.h>
+#else
+    #include <x86intrin.h>
+#endif
+
+int main(void)
+{
+    __m128i a = _mm_comge_epu32(_mm_setzero_si128(), _mm_setzero_si128());
+    return _mm_cvtsi128_si32(a);
+}

env-llmeval/lib/python3.10/site-packages/numpy/distutils/checks/extra_avx512bw_mask.c

@@ -0,0 +1,18 @@
+#include <immintrin.h>
+/**
+ * Test BW mask operations due to:
+ *  - MSVC has supported it since vs2019 see,
+ *    https://developercommunity.visualstudio.com/content/problem/518298/missing-avx512bw-mask-intrinsics.html
+ *  - Clang >= v8.0
+ *  - GCC >= v7.1
+ */
+int main(void)
+{
+    __mmask64 m64 = _mm512_cmpeq_epi8_mask(_mm512_set1_epi8((char)1), _mm512_set1_epi8((char)1));
+    m64 = _kor_mask64(m64, m64);
+    m64 = _kxor_mask64(m64, m64);
+    m64 = _cvtu64_mask64(_cvtmask64_u64(m64));
+    m64 = _mm512_kunpackd(m64, m64);
+    m64 = (__mmask64)_mm512_kunpackw((__mmask32)m64, (__mmask32)m64);
+    return (int)_cvtmask64_u64(m64);
+}