Question ID
int64 2.43k
30.2k
| Answer Type
stringclasses 1
value | Aggregation
bool 1
class | OnlyDBO
bool 1
class | Hybrid
bool 1
class | Question
stringlengths 1
976
| SPARQL Query
stringlengths 55
355
| Answer
stringlengths 33
40
| Label
stringlengths 1
161
|
---|---|---|---|---|---|---|---|---|
14,688 | resource | false | false | false | What was the primary profession of the author of "The Road to Serfdom?" | SELECT ?answer WHERE { wd:Q1638194 wdt:P50 ?X . ?X wdt:P106 ?answer} | http://www.wikidata.org/entity/Q4964182 | philosopher |
14,707 | resource | false | false | false | What do the authors of Needle in the Groove inform us about? | SELECT ?answer WHERE { wd:Q6986611 wdt:P50 ?X . ?X wdt:P737 ?answer} | http://www.wikidata.org/entity/Q909 | Jorge Luis Borges |
11,777 | resource | false | false | false | What lake of São Jorge Island has the Curoca River, a tributary? | SELECT ?answer WHERE { wd:Q743362 wdt:P206 ?answer . ?answer wdt:P974 wd:Q10361834} | http://www.wikidata.org/entity/Q97 | Atlantic Ocean |
4,031 | resource | false | false | false | What award did Emile Berliner receive on 1-1-1929? | SELECT ?obj WHERE { wd:Q71004 p:P166 ?s . ?s ps:P166 ?obj . ?s pq:P585 ?x filter(contains(YEAR(?x),'1929')) } | http://www.wikidata.org/entity/Q3141777 | Franklin Medal |
13,755 | resource | false | false | false | How is a bone fracture, a medical specialty in traumatology? | SELECT ?answer WHERE { wd:Q68833 wdt:P828 ?answer . ?answer wdt:P1995 wd:Q376680} | http://www.wikidata.org/entity/Q193078 | injury |
17,271 | resource | false | false | false | What's the name of the instrument used in clustering of scientific? | SELECT ?answer WHERE { wd:Q26857876 wdt:P2860 ?X . ?X wdt:P2283 ?answer} | http://www.wikidata.org/entity/Q185612 | regular expression |
21,063 | resource | false | false | false | What is the name of the ethical theory of movement by Jeremy Bentham? | select distinct ?obj where { wd:Q60887 wdt:P135 ?obj . ?obj wdt:P31 wd:Q58927801 } | http://www.wikidata.org/entity/Q160590 | utilitarianism |
14,561 | resource | false | false | false | Mention the border participants of Livonian War? | SELECT ?answer WHERE { wd:Q246863 wdt:P710 ?X . ?X wdt:P47 ?answer} | http://www.wikidata.org/entity/Q171150 | Kingdom of Hungary |
2,649 | resource | false | false | false | What is the CPU with the fastest FSB speed? | select ?ent where { ?ent wdt:P31 wd:Q5300 . ?ent wdt:P2150 ?obj } ORDER BY DESC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q51963118 | Core2 Duo P8600 |
17,912 | resource | false | false | false | What is Bill Falkinder's branch mascot? | SELECT ?answer WHERE { wd:Q4908944 wdt:P241 ?X . ?X wdt:P822 ?answer} | http://www.wikidata.org/entity/Q5070208 | kangaroo |
15,309 | resource | false | false | false | What is the name of the garrison sister town of Charles University in Prague? | SELECT ?answer WHERE { wd:Q31519 wdt:P159 ?X . ?X wdt:P190 ?answer} | http://www.wikidata.org/entity/Q1867 | Taipei |
14,056 | resource | false | false | false | Where is the location of birth of Antónia Ferreira subdivided into Galafura e Covelinhas? | SELECT ?answer WHERE { wd:Q591755 wdt:P19 ?answer . ?answer wdt:P150 wd:Q25438947} | http://www.wikidata.org/entity/Q757858 | Peso da Régua |
22,640 | resource | false | false | false | Who is the narrator in On the Road? | select distinct ?obj where { wd:Q743180 wdt:P2438 ?obj . ?obj wdt:P31 wd:Q3658341 } | http://www.wikidata.org/entity/Q3469432 | Sal Paradise |
4,564 | resource | false | false | false | For what award was Jo Van Fleet nominated for in 1958? | SELECT ?obj WHERE { wd:Q233832 p:P1411 ?s . ?s ps:P1411 ?obj . ?s pq:P585 ?x filter(contains(YEAR(?x),'1958')) } | http://www.wikidata.org/entity/Q185299 | Tony Award for Best Actress in a Play |
6,013 | resource | false | false | false | What position did Philip Noel-Baker, Baron Noel-Baker, hold that ended in 1964? | SELECT ?obj WHERE { wd:Q211856 p:P39 ?s . ?s ps:P39 ?obj . ?s pq:P582 ?x filter(contains(YEAR(?x),'1964')) } | http://www.wikidata.org/entity/Q41582606 | member of the 42nd Parliament of the United Kingdom |
16,679 | resource | false | false | false | Who was the chairman of the event producer in the 2017 Masters? | SELECT ?answer WHERE { wd:Q28114247 wdt:P664 ?X . ?X wdt:P488 ?answer} | http://www.wikidata.org/entity/Q809044 | Barry Hearn |
20,412 | resource | false | false | false | In Exodus, a mountain serves as a narrative location--where is it? | select distinct ?obj where { wd:Q9190 wdt:P840 ?obj . ?obj wdt:P31 wd:Q8502 } | http://www.wikidata.org/entity/Q377485 | Mount Sinai |
2,887 | resource | false | false | false | Name the barque with the most masts ? | select ?ent where { ?ent wdt:P31 wd:Q216057 . ?ent wdt:P1099 ?obj . ?ent wdt:P31 wd:Q216057 } ORDER BY DESC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q80223413 | Dundee |
11,928 | resource | false | false | false | Methanol | CH3OH or CH4O | CID 887 - structure, chemical names, physical and chemical ... The air odor threshold for methanol has been reported as 100 ppm. ...... Following intake of large amounts of methanol (50 mL), methanol was found in the .... Elimination of methanol from the blood appears to be slow in all species, ... | SELECT ?answer WHERE { wd:Q14982 wdt:P703 ?answer . ?answer wdt:P1843 ?x FILTER(contains(?x,'Manusia'))} | http://www.wikidata.org/entity/Q15978631 | Homo sapiens |
21,952 | resource | false | false | false | Which department is responsible for the city of Paris | select distinct ?obj where { wd:Q90 wdt:P194 ?obj . ?obj wdt:P31 wd:Q19758733 } | http://www.wikidata.org/entity/Q775994 | Council of Paris |
3,697 | resource | false | false | false | Who did Anna of Russia marry on 1710-11-11? | SELECT ?obj WHERE { wd:Q160165 p:P26 ?s . ?s ps:P26 ?obj . ?s pq:P580 ?x filter(contains(YEAR(?x),'1710')) } | http://www.wikidata.org/entity/Q63494 | Frederick William Kettler |
26,687 | resource | false | false | false | What is the exhibition history of Pomona College? | select distinct ?answer where { ?answer wdt:P608 wd:Q7227384} | http://www.wikidata.org/entity/Q15991813 | Judie Bamber |
20,859 | resource | false | false | false | What music from Loretta Lynn received an award? | select distinct ?sbj where { ?sbj wdt:P1346 wd:Q272931 . ?sbj wdt:P31 wd:Q1364556 } | http://www.wikidata.org/entity/Q18149622 | Country Music Association Award for Entertainer of the Year |
20,619 | resource | false | false | false | Who is Johann Wolfgang von Goethe's partner? | select distinct ?sbj where { ?sbj wdt:P451 wd:Q5879 . ?sbj wdt:P31 wd:Q5 } | http://www.wikidata.org/entity/Q96902 | Lili Schönemann |
11,908 | resource | false | false | false | What is the death location of Saul on the continent of Asia? | SELECT ?answer WHERE { wd:Q28730 wdt:P20 ?answer . ?answer wdt:P30 wd:Q48} | http://www.wikidata.org/entity/Q1161616 | Mount Gilboa |
16,915 | resource | false | false | false | Who is the inventor of Titan? | SELECT ?answer WHERE { wd:Q2565 wdt:P61 ?X . ?X wdt:P184 ?answer} | http://www.wikidata.org/entity/Q2353318 | Jan Jansz de Jonge Stampioen |
15,560 | resource | false | false | false | who champion of awarded of jan tinbergen ? | SELECT ?answer WHERE { wd:Q183181 wdt:P166 ?X . ?X wdt:P1346 ?answer} | http://www.wikidata.org/entity/Q237534 | Austrians |
22,107 | resource | false | false | false | In which country is the Kingdom of Wessex located? | select distinct ?sbj where { ?sbj wdt:P17 wd:Q105313 . ?sbj wdt:P31 wd:Q4164871 } | http://www.wikidata.org/entity/Q21715287 | king of Wessex |
20,933 | resource | false | false | false | What is the opposite of 0? | select distinct ?sbj where { ?sbj wdt:P461 wd:Q204 . ?sbj wdt:P31 wd:Q47371099 } | http://www.wikidata.org/entity/Q204 | zero |
20,239 | resource | false | false | false | who aircraft family for item operated of Air India? | select distinct ?obj where { wd:Q69906 wdt:P121 ?obj . ?obj wdt:P31 wd:Q15056993 } | http://www.wikidata.org/entity/Q6475 | Airbus A320 family |
21,234 | resource | false | false | false | What is the main sequence star G - type for Jupiter's child astronomical body? | select distinct ?sbj where { ?sbj wdt:P398 wd:Q319 . ?sbj wdt:P31 wd:Q5864 } | http://www.wikidata.org/entity/Q525 | Sun |
22,006 | resource | false | false | false | na | select distinct ?sbj where { ?sbj wdt:P4147 wd:Q130336 . ?sbj wdt:P31 wd:Q55523986 } | http://www.wikidata.org/entity/Q27122100 | phenolate |
12,511 | resource | false | false | false | Which treatment of hepatis C, identified as {C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N}, is represented by smiles? | SELECT ?answer WHERE { wd:Q154869 wdt:P2176 ?answer . ?answer wdt:P233 ?x FILTER(contains(?x,'C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N'))} | http://www.wikidata.org/entity/Q421862 | ribavirin |
21,912 | resource | false | false | false | Who edited the movie The Birth of a Nation ? | select distinct ?obj where { wd:Q220394 wdt:P1040 ?obj . ?obj wdt:P31 wd:Q5 } | http://www.wikidata.org/entity/Q51123 | D. W. Griffith |
23,028 | resource | false | false | false | Name a song composed by Pete Townshend. | select distinct ?sbj where { ?sbj wdt:P86 wd:Q26933 . ?sbj wdt:P31 wd:Q7366 } | http://www.wikidata.org/entity/Q3102128 | I'm a Boy |
19,946 | resource | false | false | false | Claude Monet belonged to which art movement? | select distinct ?obj where { wd:Q296 wdt:P135 ?obj . ?obj wdt:P31 wd:Q968159 } | http://www.wikidata.org/entity/Q40415 | Impressionism |
5,316 | resource | false | false | false | What Ghost in the Shell character was voiced by actor Kōichi Yamadera? | SELECT ?value WHERE { wd:Q1066948 p:P725 ?s . ?s ps:P725 wd:Q333194 . ?s pq:P453 ?value} | http://www.wikidata.org/entity/Q7813242 | Togusa |
21,359 | resource | false | false | false | Who is the {tilting train} for {item operated} of {Amtrak} | select distinct ?obj where { wd:Q23239 wdt:P121 ?obj . ?obj wdt:P31 wd:Q671188 } | http://www.wikidata.org/entity/Q481759 | Acela |
7,796 | resource | false | false | false | Where did Yayoi Kusama stop working in 2015? | SELECT ?obj WHERE { wd:Q231121 p:P937 ?s . ?s ps:P937 ?obj . ?s pq:P582 ?x filter(contains(YEAR(?x),'2015')) } | http://www.wikidata.org/entity/Q1490 | Tokyo |
7,002 | resource | false | false | false | Who was Galileo Galilei's employer in 1592? | SELECT ?obj WHERE { wd:Q307 p:P108 ?s . ?s ps:P108 ?obj . ?s pq:P580 ?x filter(contains(YEAR(?x),'1592')) } | http://www.wikidata.org/entity/Q193510 | University of Padua |
5,811 | resource | false | false | false | Joss Whedon has been nominated for a Nebula Award for Best Script, for what piece of work? | SELECT ?value WHERE { wd:Q298025 p:P1411 ?s . ?s ps:P1411 wd:Q644077 . ?s pq:P1686 ?value} | http://www.wikidata.org/entity/Q183513 | Buffy the Vampire Slayer |
21,681 | resource | false | false | false | What is the {aspect of history} that {follows} {apartheid}? | select distinct ?sbj where { ?sbj wdt:P155 wd:Q11409 . ?sbj wdt:P31 wd:Q17524420 } | http://www.wikidata.org/entity/Q3136857 | history of South Africa (1944–present) |
10,396 | resource | false | false | false | What is the next movie in the Godfather trilogy, after The Godfather Part II? | SELECT ?value1 ?value2 WHERE { wd:Q184768 p:P179 ?s . ?s ps:P179 wd:Q3225260 . ?s pq:P156 ?value1 . ?s pq:P155 ?value2 } | http://www.wikidata.org/entity/Q202326 | The Godfather Part III |
22,555 | resource | false | false | false | Which films did Mike Myers write? | select distinct ?sbj where { ?sbj wdt:P58 wd:Q185724 . ?sbj wdt:P31 wd:Q11424 } | http://www.wikidata.org/entity/Q501703 | Austin Powers: International Man of Mystery |
4,669 | resource | false | false | false | What is the { criterion used } for { pole vault } { record held } as { Eliza McCartney }? | SELECT ?value WHERE { wd:Q185027 p:P1000 ?s . ?s ps:P1000 wd:Q18011042 . ?s pq:P1013 ?value} | http://www.wikidata.org/entity/Q2762528 | list of Oceanian records in athletics |
17,559 | resource | false | false | false | In part of the series of The Bachelor, season 18, who is the director of the script? | SELECT ?answer WHERE { wd:Q15706907 wdt:P179 ?X . ?X wdt:P136 ?answer} | http://www.wikidata.org/entity/Q182415 | reality television |
16,490 | resource | false | false | false | Who is the spouse of the person who painted Glorious victory? | SELECT ?answer WHERE { wd:Q21512830 wdt:P170 ?X . ?X wdt:P26 ?answer} | http://www.wikidata.org/entity/Q5588 | Frida Kahlo |
28,792 | resource | false | false | false | What is recorded at Revolver? | select distinct ?answer where { wd:Q185121 wdt:P483 ?answer} | http://www.wikidata.org/entity/Q209651 | Abbey Road Studios |
15,345 | resource | false | false | false | Who is the leader of party membership for Martin Dinha? | SELECT ?answer WHERE { wd:Q6775305 wdt:P102 ?X . ?X wdt:P488 ?answer} | http://www.wikidata.org/entity/Q510523 | Emmerson Mnangagwa |
4,843 | resource | false | false | false | What award did Maggie Smith win on 4/9/1979? | SELECT ?obj WHERE { wd:Q172653 p:P166 ?s . ?s ps:P166 ?obj . ?s pq:P585 ?x filter(contains(YEAR(?x),'1979')) } | http://www.wikidata.org/entity/Q1011564 | Golden Globe Award for Best Actress – Motion Picture Musical or Comedy |
20,770 | resource | false | false | false | What is Julian Assange's occupant's embassy? | select distinct ?sbj where { ?sbj wdt:P466 wd:Q360 . ?sbj wdt:P31 wd:Q3917681 } | http://www.wikidata.org/entity/Q1803773 | Embassy of Ecuador, London |
2,844 | resource | false | false | false | Name the underground station with the most tracks in Finland? | select ?ent where { ?ent wdt:P31 wd:Q22808403 . ?ent wdt:P1103 ?obj . ?ent wdt:P17 wd:Q33 } ORDER BY DESC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q1801025 | Itäkeskus metro station |
22,454 | resource | false | false | false | What does the Coca-Cola Company manufacture? | select distinct ?sbj where { ?sbj wdt:P176 wd:Q3295867 . ?sbj wdt:P31 wd:Q431289 } | http://www.wikidata.org/entity/Q934273 | Powerade |
2,939 | resource | false | false | false | What is the asteroid with the highest longitude of ascending node whose site of astronomical discovery is Vienna Observatory? | select ?ent where { ?ent wdt:P31 wd:Q3863 . ?ent wdt:P2213 ?obj . ?ent wdt:P65 wd:Q532127 } ORDER BY DESC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q148360 | 224 Oceana |
9,592 | resource | false | false | false | What is Michael Owen's league, position and specialty on his team? | SELECT ?ans_1 ?ans_2 WHERE { wd:Q128829 wdt:P118 ?ans_1 . wd:Q128829 wdt:P413 ?ans_2 } | http://www.wikidata.org/entity/Q280658 | forward |
3,380 | resource | false | false | false | Which company in Russia has the lowest total equity? | select ?ent where { ?ent wdt:P31 wd:Q13641190 . ?ent wdt:P2137 ?obj . ?ent wdt:P17 wd:Q159. } ORDER BY ASC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q809985 | Bashneft |
11,366 | resource | false | false | false | Tell me about occupation of Bettie Page and followed by? | SELECT ?value1 ?obj WHERE { wd:Q61898 p:P106 ?s . ?s ps:P106 ?obj . ?s pq:P156 ?value1 . } | http://www.wikidata.org/entity/Q229507 | Jayne Mansfield |
22,720 | resource | false | false | false | Which archaeological site was the former capitol of the Achaemenid Empire? | select distinct ?obj where { wd:Q389688 wdt:P36 ?obj . ?obj wdt:P31 wd:Q839954 } | http://www.wikidata.org/entity/Q129072 | Persepolis |
28,429 | resource | false | false | false | Which is legislative body of Cook Islands? | select distinct ?answer where { wd:Q26988 wdt:P194 ?answer} | http://www.wikidata.org/entity/Q7138950 | Parliament of the Cook Islands |
29,868 | resource | false | false | false | Which 3D film was Sarah Silverman a voice actor for? | select distinct ?sbj where { ?sbj wdt:P725 wd:Q229013 . ?sbj wdt:P31 wd:Q229390 } | http://www.wikidata.org/entity/Q28891 | Wreck-It Ralph |
20,354 | resource | false | false | false | In which famous spaceflight Neil Armstrong was involved ? | select distinct ?sbj where { ?sbj wdt:P1029 wd:Q1615 . ?sbj wdt:P31 wd:Q752783 } | http://www.wikidata.org/entity/Q617651 | Gemini 8 |
30,027 | resource | false | false | false | Name a Roman province located in the Roman Empire. | select distinct ?sbj where { ?sbj wdt:P131 wd:Q2277 . ?sbj wdt:P31 wd:Q182547 } | http://www.wikidata.org/entity/Q202311 | Roman Egypt |
16,833 | resource | false | false | false | Which {streak color} is {solid solution series with} of {fayalite} ? | SELECT ?answer WHERE { wd:Q411130 wdt:P2155 ?X . ?X wdt:P534 ?answer} | http://www.wikidata.org/entity/Q23444 | white |
17,249 | resource | false | false | false | WHICH IS CAPABLE OF INHIBITING OR PREVENING PATHOLOGICAL PROCESS OF PRESCRIBED DRUG OF INFLAMMATION | SELECT ?answer WHERE { wd:Q101991 wdt:P2176 ?X . ?X wdt:P2175 ?answer} | http://www.wikidata.org/entity/Q3931183 | drug reaction with eosinophilia and systemic symptoms |
5,220 | resource | false | false | false | What was Davor Šuker's team in 1996? | SELECT ?obj WHERE { wd:Q189217 p:P54 ?s . ?s ps:P54 ?obj . ?s pq:P582 ?x filter(contains(YEAR(?x),'1996')) } | http://www.wikidata.org/entity/Q10329 | Sevilla FC |
22,967 | resource | false | false | false | who constitutional republic for ethnic group of Indigenous peoples of the United States? | select distinct ?sbj where { ?sbj wdt:P172 wd:Q49297 . ?sbj wdt:P31 wd:Q1520223 } | http://www.wikidata.org/entity/Q30 | United States of America |
21,423 | resource | false | false | false | Who is the person that was student of Gottfried Wilhelm Leibniz? | select distinct ?obj where { wd:Q9047 wdt:P1066 ?obj . ?obj wdt:P31 wd:Q5 } | http://www.wikidata.org/entity/Q67323 | Jakob Thomasius |
21,583 | resource | false | false | false | What group is opium in? | select distinct ?obj where { wd:Q46452 wdt:P1582 ?obj . ?obj wdt:P31 wd:Q16521 } | http://www.wikidata.org/entity/Q131584 | Papaver somniferum |
17,900 | resource | false | false | false | What is a cause of botulism? | SELECT ?answer WHERE { wd:Q18553251 wdt:P828 ?X . ?X wdt:P171 ?answer} | http://www.wikidata.org/entity/Q327663 | Clostridium |
26,251 | resource | false | false | false | What is from Dungeons & Dragons' fictional universe? | select distinct ?answer where { ?answer wdt:P1080 wd:Q1375} | http://www.wikidata.org/entity/Q7810021 | Titivilus |
15,150 | resource | false | false | false | Who is the prime minister that came from Barfoot Gen? | SELECT ?answer WHERE { wd:Q4347 wdt:P495 ?X . ?X wdt:P6 ?answer} | http://www.wikidata.org/entity/Q122465 | Yoshihide Suga |
14,206 | resource | false | false | false | Did Barbados have a diplomatic relationship with Nigeria in the past? | SELECT ?answer WHERE { wd:Q2206741 wdt:P1269 ?answer . ?answer wdt:P530 wd:Q1033} | http://www.wikidata.org/entity/Q244 | Barbados |
16,489 | resource | false | false | false | who desired outcome of remake of half moon replica ? | SELECT ?answer WHERE { wd:Q42173625 wdt:P144 ?X . ?X wdt:P3712 ?answer} | http://www.wikidata.org/entity/Q81136 | Northwest Passage |
13,827 | resource | false | false | false | What writer, born in Hamburg, wrote Curious George? | SELECT ?answer WHERE { wd:Q5194776 wdt:P50 ?answer . ?answer wdt:P19 wd:Q1055} | http://www.wikidata.org/entity/Q2604208 | Margret Rey |
4,454 | resource | false | false | false | What award did Cherry Jones achieve in the 49th Tony Awards? | SELECT ?obj WHERE { wd:Q239046 p:P166 ?s . ?s ps:P166 ?obj . ?s pq:P805 wd:Q4638847 } | http://www.wikidata.org/entity/Q185299 | Tony Award for Best Actress in a Play |
29,894 | resource | false | false | false | Alexander McQueen is the employer of what fashion label? | select distinct ?obj where { wd:Q207939 wdt:P108 ?obj . ?obj wdt:P31 wd:Q1618899 } | http://www.wikidata.org/entity/Q178516 | Gucci |
17,353 | resource | false | false | false | What nomination was received by the inventor of the oscilloscope? | SELECT ?answer WHERE { wd:Q174320 wdt:P61 ?X . ?X wdt:P1411 ?answer} | http://www.wikidata.org/entity/Q38104 | Nobel Prize in Physics |
7,437 | resource | false | false | false | Who was married to Walter Sickert in 1911? | SELECT ?obj WHERE { wd:Q703369 p:P26 ?s . ?s ps:P26 ?obj . ?s pq:P580 ?x filter(contains(YEAR(?x),'1911')) } | http://www.wikidata.org/entity/Q19398574 | Christine Angus |
29,955 | resource | false | false | false | Which video game publisher manufactured the Commodore 64? | select distinct ?obj where { wd:Q99775 wdt:P176 ?obj . ?obj wdt:P31 wd:Q1137109 } | http://www.wikidata.org/entity/Q208305 | Commodore International |
3,222 | resource | false | false | false | What stepper motor has the least torque? | select ?ent where { ?ent wdt:P31 wd:Q235790 . ?ent wdt:P2230 ?obj . ?ent wdt:P31 wd:Q235790. } ORDER BY ASC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q25909319 | NEMA 17 Stepper motor Model 42SHD0404-22 |
15,283 | resource | false | false | false | Which {coat of arms} {is in the administrative region of} of {Western Canada} ? | SELECT ?answer WHERE { wd:Q1145847 wdt:P131 ?X . ?X wdt:P237 ?answer} | http://www.wikidata.org/entity/Q2060668 | coat of arms of Alberta |
27,687 | resource | false | false | false | What is playing hand of Novak Djokovic ? | select distinct ?answer where { wd:Q5812 wdt:P741 ?answer} | http://www.wikidata.org/entity/Q14420068 | two-handed backhand |
3,499 | resource | false | false | false | Name the Wikidata property known as Bulgarian Antarctic with the least amount of records? | select ?ent where { ?ent wdt:P31 wd:Q1006160 . ?ent wdt:P4876 ?obj . ?ent wdt:P1687 wd:P5388} ORDER BY ASC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q35486866 | Bulgarian Antarctic Gazetteer |
3,356 | resource | false | false | false | Name the submarine power cable with the least throughput whose CEO is Nasos Ktorides | select ?ent where { ?ent wdt:P31 wd:Q4117949 . ?ent wdt:P2957 ?obj . ?ent wdt:P169 wd:Q47459088} ORDER BY ASC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q5411505 | EuroAsia Interconnector |
10,200 | resource | false | false | false | What is the {sexual orientation} and the {sex or gender} of {Deadpool} ? | SELECT ?ans_1 ?ans_2 WHERE { wd:Q1631090 wdt:P91 ?ans_1 . wd:Q1631090 wdt:P21 ?ans_2 } | http://www.wikidata.org/entity/Q271534 | pansexuality |
20,606 | resource | false | false | false | What is the athlete Zinedine Zidane's business | select distinct ?obj where { wd:Q1835 wdt:P54 ?obj . ?obj wdt:P31 wd:Q4830453 } | http://www.wikidata.org/entity/Q1422 | Juventus F.C. |
29,820 | resource | false | false | false | Tell me about talk show for presenter of Ellen DeGeneres? | select distinct ?sbj where { ?sbj wdt:P371 wd:Q483325 . ?sbj wdt:P31 wd:Q622812 } | http://www.wikidata.org/entity/Q839150 | The Ellen DeGeneres Show |
23,038 | resource | false | false | false | What is the name of the Patron saint Anthony of Padua's ruins? | select distinct ?sbj where { ?sbj wdt:P417 wd:Q167477 . ?sbj wdt:P31 wd:Q109607 } | http://www.wikidata.org/entity/Q61727395 | Capela de Santo António dos Índios |
17,382 | resource | false | false | false | What is list of characters from narrative of Mario ? | SELECT ?answer WHERE { wd:Q12379 wdt:P1441 ?X . ?X wdt:P1881 ?answer} | http://www.wikidata.org/entity/Q603432 | list of Mario franchise characters |
22,575 | resource | false | false | false | Which films did screenwriter Andrew Lloyd Webber produce? | select distinct ?sbj where { ?sbj wdt:P58 wd:Q180975 . ?sbj wdt:P31 wd:Q11424 } | http://www.wikidata.org/entity/Q276407 | The Phantom of the Opera |
22,132 | resource | false | false | false | What is the Japanese word for anime? | select distinct ?sbj where { ?sbj wdt:P407 wd:Q5287 . ?sbj wdt:P31 wd:Q1107 } | http://www.wikidata.org/entity/Q495472 | The Garden of Sinners |
27,953 | resource | false | false | false | What is the topic's main category for divination? | select distinct ?answer where { wd:Q1043197 wdt:P910 ?answer} | http://www.wikidata.org/entity/Q7012544 | Category:Divination |
6,481 | resource | false | false | false | Do Asian elephants have self-awareness? | SELECT ?value WHERE { wd:Q133006 p:P2283 ?s . ?s ps:P2283 wd:Q1314553 . ?s pq:P805 ?value} | http://www.wikidata.org/entity/Q1430725 | mirror test |
14,893 | resource | false | false | false | What would be the competing bibliography of all mankind? | SELECT ?answer WHERE { wd:Q4162673 wdt:P161 ?X . ?X wdt:P800 ?answer} | http://www.wikidata.org/entity/Q843864 | Earthrise |
20,590 | resource | false | false | false | Name an actor in Friends | select distinct ?obj where { wd:Q79784 wdt:P161 ?obj . ?obj wdt:P31 wd:Q5 } | http://www.wikidata.org/entity/Q236766 | Maggie Wheeler |
13,484 | resource | false | false | false | Who is the namesake of the Planck constant, who was a member of the Licean Academy? | SELECT ?answer WHERE { wd:Q122894 wdt:P138 ?answer . ?answer wdt:P463 wd:Q338432} | http://www.wikidata.org/entity/Q9021 | Max Planck |
3,460 | resource | false | false | false | What insecticide has the lowest combustion point? | select ?ent where { ?ent wdt:P31 wd:Q21073024 . ?ent wdt:P2107 ?obj . ?ent wdt:P31 wd:Q181322} ORDER BY ASC(?obj)LIMIT 5 | http://www.wikidata.org/entity/Q163648 | DDT |
13,259 | resource | false | false | false | Palauli forms part of the capital of Apia, give the complete place name. | SELECT ?answer WHERE { wd:Q36260 wdt:P1376 ?answer . ?answer wdt:P150 wd:Q1147216} | http://www.wikidata.org/entity/Q683 | Samoa |
5,950 | resource | false | false | false | What is the award received by Ansel Adams followed by Lennart Nilsson? | SELECT ?obj WHERE { wd:Q60809 p:P166 ?s . ?s ps:P166 ?obj . ?s pq:P155 wd:Q568506 } | http://www.wikidata.org/entity/Q1324112 | Hasselblad Award |
5,699 | resource | false | false | false | What award did Yaşar Kemal receive from Günter Grass? | SELECT ?obj WHERE { wd:Q327142 p:P166 ?s . ?s ps:P166 ?obj . ?s pq:P823 wd:Q6538 } | http://www.wikidata.org/entity/Q265920 | Peace Prize of the German Publishers' and Booksellers' Association |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.