Add files using upload-large-folder tool

temp_venv/lib/python3.13/site-packages/IPython/core/application.py

@@ -0,0 +1,492 @@
+# encoding: utf-8
+"""
+An application for IPython.
+
+All top-level applications should use the classes in this module for
+handling configuration and creating configurables.
+
+The job of an :class:`Application` is to create the master configuration
+object and then create the configurable objects, passing the config to them.
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import atexit
+from copy import deepcopy
+import logging
+import os
+import shutil
+import sys
+
+from pathlib import Path
+
+from traitlets.config.application import Application, catch_config_error
+from traitlets.config.loader import ConfigFileNotFound, PyFileConfigLoader
+from IPython.core import release, crashhandler
+from IPython.core.profiledir import ProfileDir, ProfileDirError
+from IPython.paths import get_ipython_dir, get_ipython_package_dir
+from IPython.utils.path import ensure_dir_exists
+from traitlets import (
+    List, Unicode, Type, Bool, Set, Instance, Undefined,
+    default, observe,
+)
+
+if os.name == "nt":
+    programdata = os.environ.get("PROGRAMDATA", None)
+    if programdata is not None:
+        SYSTEM_CONFIG_DIRS = [str(Path(programdata) / "ipython")]
+    else:  # PROGRAMDATA is not defined by default on XP.
+        SYSTEM_CONFIG_DIRS = []
+else:
+    SYSTEM_CONFIG_DIRS = [
+        "/usr/local/etc/ipython",
+        "/etc/ipython",
+    ]
+
+
+ENV_CONFIG_DIRS = []
+_env_config_dir = os.path.join(sys.prefix, 'etc', 'ipython')
+if _env_config_dir not in SYSTEM_CONFIG_DIRS:
+    # only add ENV_CONFIG if sys.prefix is not already included
+    ENV_CONFIG_DIRS.append(_env_config_dir)
+
+
+_envvar = os.environ.get('IPYTHON_SUPPRESS_CONFIG_ERRORS')
+if _envvar in {None, ''}:
+    IPYTHON_SUPPRESS_CONFIG_ERRORS = None
+else:
+    if _envvar.lower() in {'1','true'}:
+        IPYTHON_SUPPRESS_CONFIG_ERRORS = True
+    elif _envvar.lower() in {'0','false'} :
+        IPYTHON_SUPPRESS_CONFIG_ERRORS = False
+    else:
+        sys.exit("Unsupported value for environment variable: 'IPYTHON_SUPPRESS_CONFIG_ERRORS' is set to '%s' which is none of  {'0', '1', 'false', 'true', ''}."% _envvar )
+
+# aliases and flags
+
+base_aliases = {}
+if isinstance(Application.aliases, dict):
+    # traitlets 5
+    base_aliases.update(Application.aliases)
+base_aliases.update(
+    {
+        "profile-dir": "ProfileDir.location",
+        "profile": "BaseIPythonApplication.profile",
+        "ipython-dir": "BaseIPythonApplication.ipython_dir",
+        "log-level": "Application.log_level",
+        "config": "BaseIPythonApplication.extra_config_file",
+    }
+)
+
+base_flags = dict()
+if isinstance(Application.flags, dict):
+    # traitlets 5
+    base_flags.update(Application.flags)
+base_flags.update(
+    dict(
+        debug=(
+            {"Application": {"log_level": logging.DEBUG}},
+            "set log level to logging.DEBUG (maximize logging output)",
+        ),
+        quiet=(
+            {"Application": {"log_level": logging.CRITICAL}},
+            "set log level to logging.CRITICAL (minimize logging output)",
+        ),
+        init=(
+            {
+                "BaseIPythonApplication": {
+                    "copy_config_files": True,
+                    "auto_create": True,
+                }
+            },
+            """Initialize profile with default config files.  This is equivalent
+            to running `ipython profile create <profile>` prior to startup.
+            """,
+        ),
+    )
+)
+
+
+class ProfileAwareConfigLoader(PyFileConfigLoader):
+    """A Python file config loader that is aware of IPython profiles."""
+    def load_subconfig(self, fname, path=None, profile=None):
+        if profile is not None:
+            try:
+                profile_dir = ProfileDir.find_profile_dir_by_name(
+                        get_ipython_dir(),
+                        profile,
+                )
+            except ProfileDirError:
+                return
+            path = profile_dir.location
+        return super(ProfileAwareConfigLoader, self).load_subconfig(fname, path=path)
+
+class BaseIPythonApplication(Application):
+    name = "ipython"
+    description = "IPython: an enhanced interactive Python shell."
+    version = Unicode(release.version)
+
+    aliases = base_aliases
+    flags = base_flags
+    classes = List([ProfileDir])
+    
+    # enable `load_subconfig('cfg.py', profile='name')`
+    python_config_loader_class = ProfileAwareConfigLoader
+
+    # Track whether the config_file has changed,
+    # because some logic happens only if we aren't using the default.
+    config_file_specified = Set()
+
+    config_file_name = Unicode()
+    @default('config_file_name')
+    def _config_file_name_default(self):
+        return self.name.replace('-','_') + u'_config.py'
+    @observe('config_file_name')
+    def _config_file_name_changed(self, change):
+        if change['new'] != change['old']:
+            self.config_file_specified.add(change['new'])
+
+    # The directory that contains IPython's builtin profiles.
+    builtin_profile_dir = Unicode(
+        os.path.join(get_ipython_package_dir(), u'config', u'profile', u'default')
+    )
+    
+    config_file_paths = List(Unicode())
+    @default('config_file_paths')
+    def _config_file_paths_default(self):
+        return []
+
+    extra_config_file = Unicode(
+    help="""Path to an extra config file to load.
+    
+    If specified, load this config file in addition to any other IPython config.
+    """).tag(config=True)
+    @observe('extra_config_file')
+    def _extra_config_file_changed(self, change):
+        old = change['old']
+        new = change['new']
+        try:
+            self.config_files.remove(old)
+        except ValueError:
+            pass
+        self.config_file_specified.add(new)
+        self.config_files.append(new)
+
+    profile = Unicode(u'default',
+        help="""The IPython profile to use."""
+    ).tag(config=True)
+    
+    @observe('profile')
+    def _profile_changed(self, change):
+        self.builtin_profile_dir = os.path.join(
+                get_ipython_package_dir(), u'config', u'profile', change['new']
+        )
+
+    add_ipython_dir_to_sys_path = Bool(
+        False,
+        """Should the IPython profile directory be added to sys path ?
+
+        This option was non-existing before IPython 8.0, and ipython_dir was added to
+        sys path to allow import of extensions present there. This was historical
+        baggage from when pip did not exist. This now default to false,
+        but can be set to true for legacy reasons.
+        """,
+    ).tag(config=True)
+
+    ipython_dir = Unicode(
+        help="""
+        The name of the IPython directory. This directory is used for logging
+        configuration (through profiles), history storage, etc. The default
+        is usually $HOME/.ipython. This option can also be specified through
+        the environment variable IPYTHONDIR.
+        """
+    ).tag(config=True)
+    @default('ipython_dir')
+    def _ipython_dir_default(self):
+        d = get_ipython_dir()
+        self._ipython_dir_changed({
+            'name': 'ipython_dir',
+            'old': d,
+            'new': d,
+        })
+        return d
+    
+    _in_init_profile_dir = False
+
+    profile_dir = Instance(ProfileDir, allow_none=True)
+
+    @default('profile_dir')
+    def _profile_dir_default(self):
+        # avoid recursion
+        if self._in_init_profile_dir:
+            return
+        # profile_dir requested early, force initialization
+        self.init_profile_dir()
+        return self.profile_dir
+
+    overwrite = Bool(False,
+        help="""Whether to overwrite existing config files when copying"""
+    ).tag(config=True)
+
+    auto_create = Bool(False,
+        help="""Whether to create profile dir if it doesn't exist"""
+    ).tag(config=True)
+
+    config_files = List(Unicode())
+
+    @default('config_files')
+    def _config_files_default(self):
+        return [self.config_file_name]
+
+    copy_config_files = Bool(False,
+        help="""Whether to install the default config files into the profile dir.
+        If a new profile is being created, and IPython contains config files for that
+        profile, then they will be staged into the new directory.  Otherwise,
+        default config files will be automatically generated.
+        """).tag(config=True)
+    
+    verbose_crash = Bool(False,
+        help="""Create a massive crash report when IPython encounters what may be an
+        internal error.  The default is to append a short message to the
+        usual traceback""").tag(config=True)
+
+    # The class to use as the crash handler.
+    crash_handler_class = Type(crashhandler.CrashHandler)
+
+    @catch_config_error
+    def __init__(self, **kwargs):
+        super(BaseIPythonApplication, self).__init__(**kwargs)
+        # ensure current working directory exists
+        try:
+            os.getcwd()
+        except:
+            # exit if cwd doesn't exist
+            self.log.error("Current working directory doesn't exist.")
+            self.exit(1)
+
+    #-------------------------------------------------------------------------
+    # Various stages of Application creation
+    #-------------------------------------------------------------------------
+    
+    def init_crash_handler(self):
+        """Create a crash handler, typically setting sys.excepthook to it."""
+        self.crash_handler = self.crash_handler_class(self)
+        sys.excepthook = self.excepthook
+        def unset_crashhandler():
+            sys.excepthook = sys.__excepthook__
+        atexit.register(unset_crashhandler)
+    
+    def excepthook(self, etype, evalue, tb):
+        """this is sys.excepthook after init_crashhandler
+
+        set self.verbose_crash=True to use our full crashhandler, instead of
+        a regular traceback with a short message (crash_handler_lite)
+        """
+        
+        if self.verbose_crash:
+            return self.crash_handler(etype, evalue, tb)
+        else:
+            return crashhandler.crash_handler_lite(etype, evalue, tb)
+
+    @observe('ipython_dir')
+    def _ipython_dir_changed(self, change):
+        old = change['old']
+        new = change['new']
+        if old is not Undefined:
+            str_old = os.path.abspath(old)
+            if str_old in sys.path:
+                sys.path.remove(str_old)
+        if self.add_ipython_dir_to_sys_path:
+            str_path = os.path.abspath(new)
+            sys.path.append(str_path)
+            ensure_dir_exists(new)
+            readme = os.path.join(new, "README")
+            readme_src = os.path.join(
+                get_ipython_package_dir(), "config", "profile", "README"
+            )
+            if not os.path.exists(readme) and os.path.exists(readme_src):
+                shutil.copy(readme_src, readme)
+            for d in ("extensions", "nbextensions"):
+                path = os.path.join(new, d)
+                try:
+                    ensure_dir_exists(path)
+                except OSError as e:
+                    # this will not be EEXIST
+                    self.log.error("couldn't create path %s: %s", path, e)
+            self.log.debug("IPYTHONDIR set to: %s", new)
+
+    def load_config_file(self, suppress_errors=IPYTHON_SUPPRESS_CONFIG_ERRORS):
+        """Load the config file.
+
+        By default, errors in loading config are handled, and a warning
+        printed on screen. For testing, the suppress_errors option is set
+        to False, so errors will make tests fail.
+
+        `suppress_errors` default value is to be `None` in which case the
+        behavior default to the one of `traitlets.Application`.
+
+        The default value can be set :
+           - to `False` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '0', or 'false' (case insensitive).
+           - to `True` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '1' or 'true' (case insensitive).
+           - to `None` by setting 'IPYTHON_SUPPRESS_CONFIG_ERRORS' environment variable to '' (empty string) or leaving it unset.
+
+        Any other value are invalid, and will make IPython exit with a non-zero return code.
+        """
+
+
+        self.log.debug("Searching path %s for config files", self.config_file_paths)
+        base_config = 'ipython_config.py'
+        self.log.debug("Attempting to load config file: %s" %
+                       base_config)
+        try:
+            if suppress_errors is not None:
+                old_value = Application.raise_config_file_errors
+                Application.raise_config_file_errors = not suppress_errors
+            Application.load_config_file(
+                self,
+                base_config,
+                path=self.config_file_paths
+            )
+        except ConfigFileNotFound:
+            # ignore errors loading parent
+            self.log.debug("Config file %s not found", base_config)
+            pass
+        if suppress_errors is not None:
+            Application.raise_config_file_errors = old_value
+        
+        for config_file_name in self.config_files:
+            if not config_file_name or config_file_name == base_config:
+                continue
+            self.log.debug("Attempting to load config file: %s" %
+                           self.config_file_name)
+            try:
+                Application.load_config_file(
+                    self,
+                    config_file_name,
+                    path=self.config_file_paths
+                )
+            except ConfigFileNotFound:
+                # Only warn if the default config file was NOT being used.
+                if config_file_name in self.config_file_specified:
+                    msg = self.log.warning
+                else:
+                    msg = self.log.debug
+                msg("Config file not found, skipping: %s", config_file_name)
+            except Exception:
+                # For testing purposes.
+                if not suppress_errors:
+                    raise
+                self.log.warning("Error loading config file: %s" %
+                              self.config_file_name, exc_info=True)
+
+    def init_profile_dir(self):
+        """initialize the profile dir"""
+        self._in_init_profile_dir = True
+        if self.profile_dir is not None:
+            # already ran
+            return
+        if 'ProfileDir.location' not in self.config:
+            # location not specified, find by profile name
+            try:
+                p = ProfileDir.find_profile_dir_by_name(self.ipython_dir, self.profile, self.config)
+            except ProfileDirError:
+                # not found, maybe create it (always create default profile)
+                if self.auto_create or self.profile == 'default':
+                    try:
+                        p = ProfileDir.create_profile_dir_by_name(self.ipython_dir, self.profile, self.config)
+                    except ProfileDirError:
+                        self.log.fatal("Could not create profile: %r"%self.profile)
+                        self.exit(1)
+                    else:
+                        self.log.info("Created profile dir: %r"%p.location)
+                else:
+                    self.log.fatal("Profile %r not found."%self.profile)
+                    self.exit(1)
+            else:
+                self.log.debug("Using existing profile dir: %r", p.location)
+        else:
+            location = self.config.ProfileDir.location
+            # location is fully specified
+            try:
+                p = ProfileDir.find_profile_dir(location, self.config)
+            except ProfileDirError:
+                # not found, maybe create it
+                if self.auto_create:
+                    try:
+                        p = ProfileDir.create_profile_dir(location, self.config)
+                    except ProfileDirError:
+                        self.log.fatal("Could not create profile directory: %r"%location)
+                        self.exit(1)
+                    else:
+                        self.log.debug("Creating new profile dir: %r"%location)
+                else:
+                    self.log.fatal("Profile directory %r not found."%location)
+                    self.exit(1)
+            else:
+                self.log.debug("Using existing profile dir: %r", p.location)
+            # if profile_dir is specified explicitly, set profile name
+            dir_name = os.path.basename(p.location)
+            if dir_name.startswith('profile_'):
+                self.profile = dir_name[8:]
+
+        self.profile_dir = p
+        self.config_file_paths.append(p.location)
+        self._in_init_profile_dir = False
+
+    def init_config_files(self):
+        """[optionally] copy default config files into profile dir."""
+        self.config_file_paths.extend(ENV_CONFIG_DIRS)
+        self.config_file_paths.extend(SYSTEM_CONFIG_DIRS)
+        # copy config files
+        path = Path(self.builtin_profile_dir)
+        if self.copy_config_files:
+            src = self.profile
+
+            cfg = self.config_file_name
+            if path and (path / cfg).exists():
+                self.log.warning(
+                    "Staging %r from %s into %r [overwrite=%s]"
+                    % (cfg, src, self.profile_dir.location, self.overwrite)
+                )
+                self.profile_dir.copy_config_file(cfg, path=path, overwrite=self.overwrite)
+            else:
+                self.stage_default_config_file()
+        else:
+            # Still stage *bundled* config files, but not generated ones
+            # This is necessary for `ipython profile=sympy` to load the profile
+            # on the first go
+            files = path.glob("*.py")
+            for fullpath in files:
+                cfg = fullpath.name
+                if self.profile_dir.copy_config_file(cfg, path=path, overwrite=False):
+                    # file was copied
+                    self.log.warning("Staging bundled %s from %s into %r"%(
+                            cfg, self.profile, self.profile_dir.location)
+                    )
+
+
+    def stage_default_config_file(self):
+        """auto generate default config file, and stage it into the profile."""
+        s = self.generate_config_file()
+        config_file = Path(self.profile_dir.location) / self.config_file_name
+        if self.overwrite or not config_file.exists():
+            self.log.warning("Generating default config file: %r", (config_file))
+            config_file.write_text(s, encoding="utf-8")
+
+    @catch_config_error
+    def initialize(self, argv=None):
+        # don't hook up crash handler before parsing command-line
+        self.parse_command_line(argv)
+        self.init_crash_handler()
+        if self.subapp is not None:
+            # stop here if subapp is taking over
+            return
+        # save a copy of CLI config to re-load after config files
+        # so that it has highest priority
+        cl_config = deepcopy(self.config)
+        self.init_profile_dir()
+        self.init_config_files()
+        self.load_config_file()
+        # enforce cl-opts override configfile opts:
+        self.update_config(cl_config)

temp_venv/lib/python3.13/site-packages/IPython/core/autocall.py

@@ -0,0 +1,70 @@
+# encoding: utf-8
+"""
+Autocall capabilities for IPython.core.
+
+Authors:
+
+* Brian Granger
+* Fernando Perez
+* Thomas Kluyver
+
+Notes
+-----
+"""
+
+#-----------------------------------------------------------------------------
+#  Copyright (C) 2008-2011  The IPython Development Team
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+
+#-----------------------------------------------------------------------------
+# Code
+#-----------------------------------------------------------------------------
+
+class IPyAutocall:
+    """ Instances of this class are always autocalled
+    
+    This happens regardless of 'autocall' variable state. Use this to
+    develop macro-like mechanisms.
+    """
+    _ip = None
+    rewrite = True
+    def __init__(self, ip=None):
+        self._ip = ip
+    
+    def set_ip(self, ip):
+        """Will be used to set _ip point to current ipython instance b/f call
+
+        Override this method if you don't want this to happen.
+
+        """
+        self._ip = ip
+
+
+class ExitAutocall(IPyAutocall):
+    """An autocallable object which will be added to the user namespace so that
+    exit, exit(), quit or quit() are all valid ways to close the shell."""
+    rewrite = False
+    
+    def __call__(self):
+        self._ip.ask_exit()
+        
+class ZMQExitAutocall(ExitAutocall):
+    """Exit IPython. Autocallable, so it needn't be explicitly called.
+    
+    Parameters
+    ----------
+    keep_kernel : bool
+      If True, leave the kernel alive. Otherwise, tell the kernel to exit too
+      (default).
+    """
+    def __call__(self, keep_kernel=False):
+        self._ip.keepkernel_on_exit = keep_kernel
+        self._ip.ask_exit()

temp_venv/lib/python3.13/site-packages/IPython/core/builtin_trap.py

@@ -0,0 +1,93 @@
+"""
+A context manager for managing things injected into :mod:`builtins`.
+"""
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+import builtins as builtin_mod
+
+from traitlets.config.configurable import Configurable
+
+from traitlets import Instance
+
+
+class __BuiltinUndefined:
+    pass
+
+
+BuiltinUndefined = __BuiltinUndefined()
+
+
+class __HideBuiltin:
+    pass
+
+
+HideBuiltin = __HideBuiltin()
+
+
+class BuiltinTrap(Configurable):
+
+    shell = Instance('IPython.core.interactiveshell.InteractiveShellABC',
+                     allow_none=True)
+
+    def __init__(self, shell=None):
+        super(BuiltinTrap, self).__init__(shell=shell, config=None)
+        self._orig_builtins = {}
+        # We define this to track if a single BuiltinTrap is nested.
+        # Only turn off the trap when the outermost call to __exit__ is made.
+        self._nested_level = 0
+        self.shell = shell
+        # builtins we always add - if set to HideBuiltin, they will just
+        # be removed instead of being replaced by something else
+        self.auto_builtins = {'exit': HideBuiltin,
+                              'quit': HideBuiltin,
+                              'get_ipython': self.shell.get_ipython,
+                              }
+
+    def __enter__(self):
+        if self._nested_level == 0:
+            self.activate()
+        self._nested_level += 1
+        # I return self, so callers can use add_builtin in a with clause.
+        return self
+
+    def __exit__(self, type, value, traceback):
+        if self._nested_level == 1:
+            self.deactivate()
+        self._nested_level -= 1
+        # Returning False will cause exceptions to propagate
+        return False
+
+    def add_builtin(self, key, value):
+        """Add a builtin and save the original."""
+        bdict = builtin_mod.__dict__
+        orig = bdict.get(key, BuiltinUndefined)
+        if value is HideBuiltin:
+            if orig is not BuiltinUndefined: #same as 'key in bdict'
+                self._orig_builtins[key] = orig
+                del bdict[key]
+        else:
+            self._orig_builtins[key] = orig
+            bdict[key] = value
+
+    def remove_builtin(self, key, orig):
+        """Remove an added builtin and re-set the original."""
+        if orig is BuiltinUndefined:
+            del builtin_mod.__dict__[key]
+        else:
+            builtin_mod.__dict__[key] = orig
+
+    def activate(self):
+        """Store ipython references in the __builtin__ namespace."""
+
+        add_builtin = self.add_builtin
+        for name, func in self.auto_builtins.items():
+            add_builtin(name, func)
+
+    def deactivate(self):
+        """Remove any builtins which might have been added by add_builtins, or
+        restore overwritten ones to their previous values."""
+        remove_builtin = self.remove_builtin
+        for key, val in self._orig_builtins.items():
+            remove_builtin(key, val)
+        self._orig_builtins.clear()
+        self._builtins_added = False

temp_venv/lib/python3.13/site-packages/IPython/core/compilerop.py

@@ -0,0 +1,192 @@
+"""Compiler tools with improved interactive support.
+
+Provides compilation machinery similar to codeop, but with caching support so
+we can provide interactive tracebacks.
+
+Authors
+-------
+* Robert Kern
+* Fernando Perez
+* Thomas Kluyver
+"""
+
+# Note: though it might be more natural to name this module 'compiler', that
+# name is in the stdlib and name collisions with the stdlib tend to produce
+# weird problems (often with third-party tools).
+
+#-----------------------------------------------------------------------------
+#  Copyright (C) 2010-2011 The IPython Development Team.
+#
+#  Distributed under the terms of the BSD License.
+#
+#  The full license is in the file COPYING.txt, distributed with this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+# Stdlib imports
+import __future__
+from ast import PyCF_ONLY_AST
+import codeop
+import functools
+import hashlib
+import linecache
+import operator
+import time
+from contextlib import contextmanager
+
+#-----------------------------------------------------------------------------
+# Constants
+#-----------------------------------------------------------------------------
+
+# Roughly equal to PyCF_MASK | PyCF_MASK_OBSOLETE as defined in pythonrun.h,
+# this is used as a bitmask to extract future-related code flags.
+PyCF_MASK = functools.reduce(operator.or_,
+                             (getattr(__future__, fname).compiler_flag
+                              for fname in __future__.all_feature_names))
+
+#-----------------------------------------------------------------------------
+# Local utilities
+#-----------------------------------------------------------------------------
+
+def code_name(code, number=0):
+    """ Compute a (probably) unique name for code for caching.
+
+    This now expects code to be unicode.
+    """
+    hash_digest = hashlib.sha1(code.encode("utf-8")).hexdigest()
+    # Include the number and 12 characters of the hash in the name.  It's
+    # pretty much impossible that in a single session we'll have collisions
+    # even with truncated hashes, and the full one makes tracebacks too long
+    return '<ipython-input-{0}-{1}>'.format(number, hash_digest[:12])
+
+#-----------------------------------------------------------------------------
+# Classes and functions
+#-----------------------------------------------------------------------------
+
+class CachingCompiler(codeop.Compile):
+    """A compiler that caches code compiled from interactive statements.
+    """
+
+    def __init__(self):
+        codeop.Compile.__init__(self)
+
+        # Caching a dictionary { filename: execution_count } for nicely
+        # rendered tracebacks. The filename corresponds to the filename
+        # argument used for the builtins.compile function.
+        self._filename_map = {}
+
+    def ast_parse(self, source, filename='<unknown>', symbol='exec'):
+        """Parse code to an AST with the current compiler flags active.
+
+        Arguments are exactly the same as ast.parse (in the standard library),
+        and are passed to the built-in compile function."""
+        return compile(source, filename, symbol, self.flags | PyCF_ONLY_AST, 1)
+
+    def reset_compiler_flags(self):
+        """Reset compiler flags to default state."""
+        # This value is copied from codeop.Compile.__init__, so if that ever
+        # changes, it will need to be updated.
+        self.flags = codeop.PyCF_DONT_IMPLY_DEDENT
+
+    @property
+    def compiler_flags(self):
+        """Flags currently active in the compilation process.
+        """
+        return self.flags
+
+    def get_code_name(self, raw_code, transformed_code, number):
+        """Compute filename given the code, and the cell number.
+
+        Parameters
+        ----------
+        raw_code : str
+            The raw cell code.
+        transformed_code : str
+            The executable Python source code to cache and compile.
+        number : int
+            A number which forms part of the code's name. Used for the execution
+            counter.
+
+        Returns
+        -------
+        The computed filename.
+        """
+        return code_name(transformed_code, number)
+
+    def format_code_name(self, name):
+        """Return a user-friendly label and name for a code block.
+
+        Parameters
+        ----------
+        name : str
+            The name for the code block returned from get_code_name
+
+        Returns
+        -------
+        A (label, name) pair that can be used in tracebacks, or None if the default formatting should be used.
+        """
+        if name in self._filename_map:
+            return "Cell", "In[%s]" % self._filename_map[name]
+
+    def cache(self, transformed_code, number=0, raw_code=None):
+        """Make a name for a block of code, and cache the code.
+
+        Parameters
+        ----------
+        transformed_code : str
+            The executable Python source code to cache and compile.
+        number : int
+            A number which forms part of the code's name. Used for the execution
+            counter.
+        raw_code : str
+            The raw code before transformation, if None, set to `transformed_code`.
+
+        Returns
+        -------
+        The name of the cached code (as a string). Pass this as the filename
+        argument to compilation, so that tracebacks are correctly hooked up.
+        """
+        if raw_code is None:
+            raw_code = transformed_code
+
+        name = self.get_code_name(raw_code, transformed_code, number)
+
+        # Save the execution count
+        self._filename_map[name] = number
+
+        # Since Python 2.5, setting mtime to `None` means the lines will
+        # never be removed by `linecache.checkcache`.  This means all the
+        # monkeypatching has *never* been necessary, since this code was
+        # only added in 2010, at which point IPython had already stopped
+        # supporting Python 2.4.
+        #
+        # Note that `linecache.clearcache` and `linecache.updatecache` may
+        # still remove our code from the cache, but those show explicit
+        # intent, and we should not try to interfere.  Normally the former
+        # is never called except when out of memory, and the latter is only
+        # called for lines *not* in the cache.
+        entry = (
+            len(transformed_code),
+            None,
+            [line + "\n" for line in transformed_code.splitlines()],
+            name,
+        )
+        linecache.cache[name] = entry
+        return name
+
+    @contextmanager
+    def extra_flags(self, flags):
+        ## bits that we'll set to 1
+        turn_on_bits = ~self.flags & flags
+
+
+        self.flags = self.flags | flags
+        try:
+            yield
+        finally:
+            # turn off only the bits we turned on so that something like
+            # __future__ that set flags stays.
+            self.flags &= ~turn_on_bits

temp_venv/lib/python3.13/site-packages/IPython/core/crashhandler.py

@@ -0,0 +1,244 @@
+"""sys.excepthook for IPython itself, leaves a detailed report on disk.
+
+Authors:
+
+* Fernando Perez
+* Brian E. Granger
+"""
+
+#-----------------------------------------------------------------------------
+#  Copyright (C) 2001-2007 Fernando Perez. <[email protected]>
+#  Copyright (C) 2008-2011  The IPython Development Team
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+import sys
+import traceback
+from pprint import pformat
+from pathlib import Path
+
+import builtins as builtin_mod
+
+from IPython.core import ultratb
+from IPython.core.application import Application
+from IPython.core.release import author_email
+from IPython.utils.sysinfo import sys_info
+
+from IPython.core.release import __version__ as version
+
+from typing import Optional, Dict
+import types
+
+#-----------------------------------------------------------------------------
+# Code
+#-----------------------------------------------------------------------------
+
+# Template for the user message.
+_default_message_template = """\
+Oops, {app_name} crashed. We do our best to make it stable, but...
+
+A crash report was automatically generated with the following information:
+  - A verbatim copy of the crash traceback.
+  - A copy of your input history during this session.
+  - Data on your current {app_name} configuration.
+
+It was left in the file named:
+\t'{crash_report_fname}'
+If you can email this file to the developers, the information in it will help
+them in understanding and correcting the problem.
+
+You can mail it to: {contact_name} at {contact_email}
+with the subject '{app_name} Crash Report'.
+
+If you want to do it now, the following command will work (under Unix):
+mail -s '{app_name} Crash Report' {contact_email} < {crash_report_fname}
+
+In your email, please also include information about:
+- The operating system under which the crash happened: Linux, macOS, Windows,
+  other, and which exact version (for example: Ubuntu 16.04.3, macOS 10.13.2,
+  Windows 10 Pro), and whether it is 32-bit or 64-bit;
+- How {app_name} was installed: using pip or conda, from GitHub, as part of
+  a Docker container, or other, providing more detail if possible;
+- How to reproduce the crash: what exact sequence of instructions can one
+  input to get the same crash? Ideally, find a minimal yet complete sequence
+  of instructions that yields the crash.
+
+To ensure accurate tracking of this issue, please file a report about it at:
+{bug_tracker}
+"""
+
+_lite_message_template = """
+If you suspect this is an IPython {version} bug, please report it at:
+    https://github.com/ipython/ipython/issues
+or send an email to the mailing list at {email}
+
+You can print a more detailed traceback right now with "%tb", or use "%debug"
+to interactively debug it.
+
+Extra-detailed tracebacks for bug-reporting purposes can be enabled via:
+    {config}Application.verbose_crash=True
+"""
+
+
+class CrashHandler:
+    """Customizable crash handlers for IPython applications.
+
+    Instances of this class provide a :meth:`__call__` method which can be
+    used as a ``sys.excepthook``.  The :meth:`__call__` signature is::
+
+        def __call__(self, etype, evalue, etb)
+    """
+
+    message_template = _default_message_template
+    section_sep = '\n\n'+'*'*75+'\n\n'
+    info: Dict[str, Optional[str]]
+
+    def __init__(
+        self,
+        app: Application,
+        contact_name: Optional[str] = None,
+        contact_email: Optional[str] = None,
+        bug_tracker: Optional[str] = None,
+        show_crash_traceback: bool = True,
+        call_pdb: bool = False,
+    ):
+        """Create a new crash handler
+
+        Parameters
+        ----------
+        app : Application
+            A running :class:`Application` instance, which will be queried at
+            crash time for internal information.
+        contact_name : str
+            A string with the name of the person to contact.
+        contact_email : str
+            A string with the email address of the contact.
+        bug_tracker : str
+            A string with the URL for your project's bug tracker.
+        show_crash_traceback : bool
+            If false, don't print the crash traceback on stderr, only generate
+            the on-disk report
+        call_pdb
+            Whether to call pdb on crash
+
+        Attributes
+        ----------
+        These instances contain some non-argument attributes which allow for
+        further customization of the crash handler's behavior. Please see the
+        source for further details.
+
+        """
+        self.crash_report_fname = "Crash_report_%s.txt" % app.name
+        self.app = app
+        self.call_pdb = call_pdb
+        #self.call_pdb = True # dbg
+        self.show_crash_traceback = show_crash_traceback
+        self.info = dict(app_name = app.name,
+                    contact_name = contact_name,
+                    contact_email = contact_email,
+                    bug_tracker = bug_tracker,
+                    crash_report_fname = self.crash_report_fname)
+
+    def __call__(
+        self,
+        etype: type[BaseException],
+        evalue: BaseException,
+        etb: types.TracebackType,
+    ) -> None:
+        """Handle an exception, call for compatible with sys.excepthook"""
+
+        # do not allow the crash handler to be called twice without reinstalling it
+        # this prevents unlikely errors in the crash handling from entering an
+        # infinite loop.
+        sys.excepthook = sys.__excepthook__
+        
+
+        # Use this ONLY for developer debugging (keep commented out for release)
+        ipython_dir = getattr(self.app, "ipython_dir", None)
+        if ipython_dir is not None:
+            assert isinstance(ipython_dir, str)
+            rptdir = Path(ipython_dir)
+        else:
+            rptdir = Path.cwd()
+        if not rptdir.is_dir():
+            rptdir = Path.cwd()
+        report_name = rptdir / self.crash_report_fname
+        # write the report filename into the instance dict so it can get
+        # properly expanded out in the user message template
+        self.crash_report_fname = str(report_name)
+        self.info["crash_report_fname"] = str(report_name)
+        TBhandler = ultratb.VerboseTB(
+            theme_name="nocolor",
+            long_header=True,
+            call_pdb=self.call_pdb,
+        )
+        if self.call_pdb:
+            TBhandler(etype,evalue,etb)
+            return
+        else:
+            traceback = TBhandler.text(etype,evalue,etb,context=31)
+
+        # print traceback to screen
+        if self.show_crash_traceback:
+            print(traceback, file=sys.stderr)
+
+        # and generate a complete report on disk
+        try:
+            report = open(report_name, "w", encoding="utf-8")
+        except:
+            print('Could not create crash report on disk.', file=sys.stderr)
+            return
+
+        with report:
+            # Inform user on stderr of what happened
+            print('\n'+'*'*70+'\n', file=sys.stderr)
+            print(self.message_template.format(**self.info), file=sys.stderr)
+
+            # Construct report on disk
+            report.write(self.make_report(str(traceback)))
+
+        builtin_mod.input("Hit <Enter> to quit (your terminal may close):")
+
+    def make_report(self, traceback: str) -> str:
+        """Return a string containing a crash report."""
+
+        sec_sep = self.section_sep
+
+        report = ['*'*75+'\n\n'+'IPython post-mortem report\n\n']
+        rpt_add = report.append
+        rpt_add(sys_info())
+
+        try:
+            config = pformat(self.app.config)
+            rpt_add(sec_sep)
+            rpt_add("Application name: %s\n\n" % self.app.name)
+            rpt_add("Current user configuration structure:\n\n")
+            rpt_add(config)
+        except:
+            pass
+        rpt_add(sec_sep+'Crash traceback:\n\n' + traceback)
+
+        return ''.join(report)
+
+
+def crash_handler_lite(
+    etype: type[BaseException], evalue: BaseException, tb: types.TracebackType
+) -> None:
+    """a light excepthook, adding a small message to the usual traceback"""
+    traceback.print_exception(etype, evalue, tb)
+    
+    from IPython.core.interactiveshell import InteractiveShell
+    if InteractiveShell.initialized():
+        # we are in a Shell environment, give %magic example
+        config = "%config "
+    else:
+        # we are not in a shell, show generic config
+        config = "c."
+    print(_lite_message_template.format(email=author_email, config=config, version=version), file=sys.stderr)
+

temp_venv/lib/python3.13/site-packages/IPython/core/debugger.py

@@ -0,0 +1,1240 @@
+"""
+Pdb debugger class.
+
+
+This is an extension to PDB which adds a number of new features.
+Note that there is also the `IPython.terminal.debugger` class which provides UI
+improvements.
+
+We also strongly recommend to use this via the `ipdb` package, which provides
+extra configuration options.
+
+Among other things, this subclass of PDB:
+ - supports many IPython magics like pdef/psource
+ - hide frames in tracebacks based on `__tracebackhide__`
+ - allows to skip frames based on `__debuggerskip__`
+
+
+Global Configuration
+--------------------
+
+The IPython debugger will by read the global ``~/.pdbrc`` file.
+That is to say you can list all commands supported by ipdb in your `~/.pdbrc`
+configuration file, to globally configure pdb.
+
+Example::
+
+   # ~/.pdbrc
+   skip_predicates debuggerskip false
+   skip_hidden false
+   context 25
+
+Features
+--------
+
+The IPython debugger can hide and skip frames when printing or moving through
+the stack. This can have a performance impact, so can be configures.
+
+The skipping and hiding frames are configurable via the `skip_predicates`
+command.
+
+By default, frames from readonly files will be hidden, frames containing
+``__tracebackhide__ = True`` will be hidden.
+
+Frames containing ``__debuggerskip__`` will be stepped over, frames whose parent
+frames value of ``__debuggerskip__`` is ``True`` will also be skipped.
+
+    >>> def helpers_helper():
+    ...     pass
+    ...
+    ... def helper_1():
+    ...     print("don't step in me")
+    ...     helpers_helpers() # will be stepped over unless breakpoint set.
+    ...
+    ...
+    ... def helper_2():
+    ...     print("in me neither")
+    ...
+
+One can define a decorator that wraps a function between the two helpers:
+
+    >>> def pdb_skipped_decorator(function):
+    ...
+    ...
+    ...     def wrapped_fn(*args, **kwargs):
+    ...         __debuggerskip__ = True
+    ...         helper_1()
+    ...         __debuggerskip__ = False
+    ...         result = function(*args, **kwargs)
+    ...         __debuggerskip__ = True
+    ...         helper_2()
+    ...         # setting __debuggerskip__ to False again is not necessary
+    ...         return result
+    ...
+    ...     return wrapped_fn
+
+When decorating a function, ipdb will directly step into ``bar()`` by
+default:
+
+    >>> @foo_decorator
+    ... def bar(x, y):
+    ...     return x * y
+
+
+You can toggle the behavior with
+
+    ipdb> skip_predicates debuggerskip false
+
+or configure it in your ``.pdbrc``
+
+
+
+License
+-------
+
+Modified from the standard pdb.Pdb class to avoid including readline, so that
+the command line completion of other programs which include this isn't
+damaged.
+
+In the future, this class will be expanded with improvements over the standard
+pdb.
+
+The original code in this file is mainly lifted out of cmd.py in Python 2.2,
+with minor changes. Licensing should therefore be under the standard Python
+terms.  For details on the PSF (Python Software Foundation) standard license,
+see:
+
+https://docs.python.org/2/license.html
+
+
+All the changes since then are under the same license as IPython.
+
+"""
+
+# *****************************************************************************
+#
+#       This file is licensed under the PSF license.
+#
+#       Copyright (C) 2001 Python Software Foundation, www.python.org
+#       Copyright (C) 2005-2006 Fernando Perez. <[email protected]>
+#
+#
+# *****************************************************************************
+
+from __future__ import annotations
+
+import inspect
+import linecache
+import os
+import re
+import sys
+import warnings
+from contextlib import contextmanager
+from functools import lru_cache
+
+from IPython import get_ipython
+from IPython.utils import PyColorize
+from IPython.utils.PyColorize import TokenStream
+
+from typing import TYPE_CHECKING
+from types import FrameType
+
+# We have to check this directly from sys.argv, config struct not yet available
+from pdb import Pdb as OldPdb
+from pygments.token import Token
+
+if TYPE_CHECKING:
+    # otherwise circular import
+    from IPython.core.interactiveshell import InteractiveShell
+
+# skip module docstests
+__skip_doctest__ = True
+
+prompt = "ipdb> "
+
+
+# Allow the set_trace code to operate outside of an ipython instance, even if
+# it does so with some limitations.  The rest of this support is implemented in
+# the Tracer constructor.
+
+DEBUGGERSKIP = "__debuggerskip__"
+
+
+# this has been implemented in Pdb in Python 3.13 (https://github.com/python/cpython/pull/106676
+# on lower python versions, we backported the feature.
+CHAIN_EXCEPTIONS = sys.version_info < (3, 13)
+
+
+def BdbQuit_excepthook(et, ev, tb, excepthook=None):
+    """Exception hook which handles `BdbQuit` exceptions.
+
+    All other exceptions are processed using the `excepthook`
+    parameter.
+    """
+    raise ValueError(
+        "`BdbQuit_excepthook` is deprecated since version 5.1. It is still around only because it is still imported by ipdb.",
+    )
+
+
+RGX_EXTRA_INDENT = re.compile(r"(?<=\n)\s+")
+
+
+def strip_indentation(multiline_string):
+    return RGX_EXTRA_INDENT.sub("", multiline_string)
+
+
+def decorate_fn_with_doc(new_fn, old_fn, additional_text=""):
+    """Make new_fn have old_fn's doc string. This is particularly useful
+    for the ``do_...`` commands that hook into the help system.
+    Adapted from from a comp.lang.python posting
+    by Duncan Booth."""
+
+    def wrapper(*args, **kw):
+        return new_fn(*args, **kw)
+
+    if old_fn.__doc__:
+        wrapper.__doc__ = strip_indentation(old_fn.__doc__) + additional_text
+    return wrapper
+
+
+class Pdb(OldPdb):
+    """Modified Pdb class, does not load readline.
+
+    for a standalone version that uses prompt_toolkit, see
+    `IPython.terminal.debugger.TerminalPdb` and
+    `IPython.terminal.debugger.set_trace()`
+
+
+    This debugger can hide and skip frames that are tagged according to some predicates.
+    See the `skip_predicates` commands.
+
+    """
+
+    shell: InteractiveShell
+    _theme_name: str
+    _context: int
+
+    _chained_exceptions: tuple[Exception, ...]
+    _chained_exception_index: int
+
+    if CHAIN_EXCEPTIONS:
+        MAX_CHAINED_EXCEPTION_DEPTH = 999
+
+    default_predicates = {
+        "tbhide": True,
+        "readonly": False,
+        "ipython_internal": True,
+        "debuggerskip": True,
+    }
+
+    def __init__(
+        self,
+        completekey=None,
+        stdin=None,
+        stdout=None,
+        context: int | None | str = 5,
+        **kwargs,
+    ):
+        """Create a new IPython debugger.
+
+        Parameters
+        ----------
+        completekey : default None
+            Passed to pdb.Pdb.
+        stdin : default None
+            Passed to pdb.Pdb.
+        stdout : default None
+            Passed to pdb.Pdb.
+        context : int
+            Number of lines of source code context to show when
+            displaying stacktrace information.
+        **kwargs
+            Passed to pdb.Pdb.
+
+        Notes
+        -----
+        The possibilities are python version dependent, see the python
+        docs for more info.
+        """
+        # ipdb issue, see https://github.com/ipython/ipython/issues/14811
+        if context is None:
+            context = 5
+        if isinstance(context, str):
+            context = int(context)
+        self.context = context
+
+        # `kwargs` ensures full compatibility with stdlib's `pdb.Pdb`.
+        OldPdb.__init__(self, completekey, stdin, stdout, **kwargs)
+
+        # IPython changes...
+        self.shell = get_ipython()
+
+        if self.shell is None:
+            save_main = sys.modules["__main__"]
+            # No IPython instance running, we must create one
+            from IPython.terminal.interactiveshell import TerminalInteractiveShell
+
+            self.shell = TerminalInteractiveShell.instance()
+            # needed by any code which calls __import__("__main__") after
+            # the debugger was entered. See also #9941.
+            sys.modules["__main__"] = save_main
+
+        self.aliases = {}
+
+        theme_name = self.shell.colors
+        assert isinstance(theme_name, str)
+        assert theme_name.lower() == theme_name
+
+        # Add a python parser so we can syntax highlight source while
+        # debugging.
+        self.parser = PyColorize.Parser(theme_name=theme_name)
+        self.set_theme_name(theme_name)
+
+        # Set the prompt - the default prompt is '(Pdb)'
+        self.prompt = prompt
+        self.skip_hidden = True
+        self.report_skipped = True
+
+        # list of predicates we use to skip frames
+        self._predicates = self.default_predicates
+
+        if CHAIN_EXCEPTIONS:
+            self._chained_exceptions = tuple()
+            self._chained_exception_index = 0
+
+    @property
+    def context(self) -> int:
+        return self._context
+
+    @context.setter
+    def context(self, value: int | str) -> None:
+        # ipdb issue see https://github.com/ipython/ipython/issues/14811
+        if not isinstance(value, int):
+            value = int(value)
+        assert isinstance(value, int)
+        assert value >= 0
+        self._context = value
+
+    def set_theme_name(self, name):
+        assert name.lower() == name
+        assert isinstance(name, str)
+        self._theme_name = name
+        self.parser.theme_name = name
+
+    @property
+    def theme(self):
+        return PyColorize.theme_table[self._theme_name]
+
+    #
+    def set_colors(self, scheme):
+        """Shorthand access to the color table scheme selector method."""
+        warnings.warn(
+            "set_colors is deprecated since IPython 9.0, use set_theme_name instead",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+        assert scheme == scheme.lower()
+        self._theme_name = scheme.lower()
+        self.parser.theme_name = scheme.lower()
+
+    def set_trace(self, frame=None):
+        if frame is None:
+            frame = sys._getframe().f_back
+        self.initial_frame = frame
+        return super().set_trace(frame)
+
+    def _hidden_predicate(self, frame):
+        """
+        Given a frame return whether it it should be hidden or not by IPython.
+        """
+
+        if self._predicates["readonly"]:
+            fname = frame.f_code.co_filename
+            # we need to check for file existence and interactively define
+            # function would otherwise appear as RO.
+            if os.path.isfile(fname) and not os.access(fname, os.W_OK):
+                return True
+
+        if self._predicates["tbhide"]:
+            if frame in (self.curframe, getattr(self, "initial_frame", None)):
+                return False
+            frame_locals = self._get_frame_locals(frame)
+            if "__tracebackhide__" not in frame_locals:
+                return False
+            return frame_locals["__tracebackhide__"]
+        return False
+
+    def hidden_frames(self, stack):
+        """
+        Given an index in the stack return whether it should be skipped.
+
+        This is used in up/down and where to skip frames.
+        """
+        # The f_locals dictionary is updated from the actual frame
+        # locals whenever the .f_locals accessor is called, so we
+        # avoid calling it here to preserve self.curframe_locals.
+        # Furthermore, there is no good reason to hide the current frame.
+        ip_hide = [self._hidden_predicate(s[0]) for s in stack]
+        ip_start = [i for i, s in enumerate(ip_hide) if s == "__ipython_bottom__"]
+        if ip_start and self._predicates["ipython_internal"]:
+            ip_hide = [h if i > ip_start[0] else True for (i, h) in enumerate(ip_hide)]
+        return ip_hide
+
+    if CHAIN_EXCEPTIONS:
+
+        def _get_tb_and_exceptions(self, tb_or_exc):
+            """
+            Given a tracecack or an exception, return a tuple of chained exceptions
+            and current traceback to inspect.
+            This will deal with selecting the right ``__cause__`` or ``__context__``
+            as well as handling cycles, and return a flattened list of exceptions we
+            can jump to with do_exceptions.
+            """
+            _exceptions = []
+            if isinstance(tb_or_exc, BaseException):
+                traceback, current = tb_or_exc.__traceback__, tb_or_exc
+
+                while current is not None:
+                    if current in _exceptions:
+                        break
+                    _exceptions.append(current)
+                    if current.__cause__ is not None:
+                        current = current.__cause__
+                    elif (
+                        current.__context__ is not None
+                        and not current.__suppress_context__
+                    ):
+                        current = current.__context__
+
+                    if len(_exceptions) >= self.MAX_CHAINED_EXCEPTION_DEPTH:
+                        self.message(
+                            f"More than {self.MAX_CHAINED_EXCEPTION_DEPTH}"
+                            " chained exceptions found, not all exceptions"
+                            "will be browsable with `exceptions`."
+                        )
+                        break
+            else:
+                traceback = tb_or_exc
+            return tuple(reversed(_exceptions)), traceback
+
+        @contextmanager
+        def _hold_exceptions(self, exceptions):
+            """
+            Context manager to ensure proper cleaning of exceptions references
+            When given a chained exception instead of a traceback,
+            pdb may hold references to many objects which may leak memory.
+            We use this context manager to make sure everything is properly cleaned
+            """
+            try:
+                self._chained_exceptions = exceptions
+                self._chained_exception_index = len(exceptions) - 1
+                yield
+            finally:
+                # we can't put those in forget as otherwise they would
+                # be cleared on exception change
+                self._chained_exceptions = tuple()
+                self._chained_exception_index = 0
+
+        def do_exceptions(self, arg):
+            """exceptions [number]
+            List or change current exception in an exception chain.
+            Without arguments, list all the current exception in the exception
+            chain. Exceptions will be numbered, with the current exception indicated
+            with an arrow.
+            If given an integer as argument, switch to the exception at that index.
+            """
+            if not self._chained_exceptions:
+                self.message(
+                    "Did not find chained exceptions. To move between"
+                    " exceptions, pdb/post_mortem must be given an exception"
+                    " object rather than a traceback."
+                )
+                return
+            if not arg:
+                for ix, exc in enumerate(self._chained_exceptions):
+                    prompt = ">" if ix == self._chained_exception_index else " "
+                    rep = repr(exc)
+                    if len(rep) > 80:
+                        rep = rep[:77] + "..."
+                    indicator = (
+                        "  -"
+                        if self._chained_exceptions[ix].__traceback__ is None
+                        else f"{ix:>3}"
+                    )
+                    self.message(f"{prompt} {indicator} {rep}")
+            else:
+                try:
+                    number = int(arg)
+                except ValueError:
+                    self.error("Argument must be an integer")
+                    return
+                if 0 <= number < len(self._chained_exceptions):
+                    if self._chained_exceptions[number].__traceback__ is None:
+                        self.error(
+                            "This exception does not have a traceback, cannot jump to it"
+                        )
+                        return
+
+                    self._chained_exception_index = number
+                    self.setup(None, self._chained_exceptions[number].__traceback__)
+                    self.print_stack_entry(self.stack[self.curindex])
+                else:
+                    self.error("No exception with that number")
+
+    def interaction(self, frame, tb_or_exc):
+        try:
+            if CHAIN_EXCEPTIONS:
+                # this context manager is part of interaction in 3.13
+                _chained_exceptions, tb = self._get_tb_and_exceptions(tb_or_exc)
+                if isinstance(tb_or_exc, BaseException):
+                    assert tb is not None, "main exception must have a traceback"
+                with self._hold_exceptions(_chained_exceptions):
+                    OldPdb.interaction(self, frame, tb)
+            else:
+                OldPdb.interaction(self, frame, tb_or_exc)
+
+        except KeyboardInterrupt:
+            self.stdout.write("\n" + self.shell.get_exception_only())
+
+    def precmd(self, line):
+        """Perform useful escapes on the command before it is executed."""
+
+        if line.endswith("??"):
+            line = "pinfo2 " + line[:-2]
+        elif line.endswith("?"):
+            line = "pinfo " + line[:-1]
+
+        line = super().precmd(line)
+
+        return line
+
+    def new_do_quit(self, arg):
+        return OldPdb.do_quit(self, arg)
+
+    do_q = do_quit = decorate_fn_with_doc(new_do_quit, OldPdb.do_quit)
+
+    def print_stack_trace(self, context: int | None = None):
+        if context is None:
+            context = self.context
+        try:
+            skipped = 0
+            to_print = ""
+            for hidden, frame_lineno in zip(self.hidden_frames(self.stack), self.stack):
+                if hidden and self.skip_hidden:
+                    skipped += 1
+                    continue
+                if skipped:
+                    to_print += self.theme.format(
+                        [
+                            (
+                                Token.ExcName,
+                                f"    [... skipping {skipped} hidden frame(s)]",
+                            ),
+                            (Token, "\n"),
+                        ]
+                    )
+
+                    skipped = 0
+                to_print += self.format_stack_entry(frame_lineno)
+            if skipped:
+                to_print += self.theme.format(
+                    [
+                        (
+                            Token.ExcName,
+                            f"    [... skipping {skipped} hidden frame(s)]",
+                        ),
+                        (Token, "\n"),
+                    ]
+                )
+            print(to_print, file=self.stdout)
+        except KeyboardInterrupt:
+            pass
+
+    def print_stack_entry(
+        self, frame_lineno: tuple[FrameType, int], prompt_prefix: str = "\n-> "
+    ) -> None:
+        """
+        Overwrite print_stack_entry from superclass (PDB)
+        """
+        print(self.format_stack_entry(frame_lineno, ""), file=self.stdout)
+
+        frame, lineno = frame_lineno
+        filename = frame.f_code.co_filename
+        self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
+
+    def _get_frame_locals(self, frame):
+        """ "
+        Accessing f_local of current frame reset the namespace, so we want to avoid
+        that or the following can happen
+
+        ipdb> foo
+        "old"
+        ipdb> foo = "new"
+        ipdb> foo
+        "new"
+        ipdb> where
+        ipdb> foo
+        "old"
+
+        So if frame is self.current_frame we instead return self.curframe_locals
+
+        """
+        if frame is getattr(self, "curframe", None):
+            return self.curframe_locals
+        else:
+            return frame.f_locals
+
+    def format_stack_entry(
+        self,
+        frame_lineno: tuple[FrameType, int],  # type: ignore[override] # stubs are wrong
+        lprefix: str = ": ",
+    ) -> str:
+        """
+        overwrite from super class so must -> str
+        """
+        context = self.context
+        try:
+            context = int(context)
+            if context <= 0:
+                print("Context must be a positive integer", file=self.stdout)
+        except (TypeError, ValueError):
+            print("Context must be a positive integer", file=self.stdout)
+
+        import reprlib
+
+        ret_tok = []
+
+        frame, lineno = frame_lineno
+
+        return_value = ""
+        loc_frame = self._get_frame_locals(frame)
+        if "__return__" in loc_frame:
+            rv = loc_frame["__return__"]
+            # return_value += '->'
+            return_value += reprlib.repr(rv) + "\n"
+            ret_tok.extend([(Token, return_value)])
+
+        # s = filename + '(' + `lineno` + ')'
+        filename = self.canonic(frame.f_code.co_filename)
+        link_tok = (Token.FilenameEm, filename)
+
+        if frame.f_code.co_name:
+            func = frame.f_code.co_name
+        else:
+            func = "<lambda>"
+
+        call_toks = []
+        if func != "?":
+            if "__args__" in loc_frame:
+                args = reprlib.repr(loc_frame["__args__"])
+            else:
+                args = "()"
+            call_toks = [(Token.VName, func), (Token.ValEm, args)]
+
+        # The level info should be generated in the same format pdb uses, to
+        # avoid breaking the pdbtrack functionality of python-mode in *emacs.
+        if frame is self.curframe:
+            ret_tok.append((Token.CurrentFrame, self.theme.make_arrow(2)))
+        else:
+            ret_tok.append((Token, "  "))
+
+        ret_tok.extend(
+            [
+                link_tok,
+                (Token, "("),
+                (Token.Lineno, str(lineno)),
+                (Token, ")"),
+                *call_toks,
+                (Token, "\n"),
+            ]
+        )
+
+        start = lineno - 1 - context // 2
+        lines = linecache.getlines(filename)
+        start = min(start, len(lines) - context)
+        start = max(start, 0)
+        lines = lines[start : start + context]
+
+        for i, line in enumerate(lines):
+            show_arrow = start + 1 + i == lineno
+
+            bp, num, colored_line = self.__line_content(
+                filename,
+                start + 1 + i,
+                line,
+                arrow=show_arrow,
+            )
+            if frame is self.curframe or show_arrow:
+                rlt = [
+                    bp,
+                    (Token.LinenoEm, num),
+                    (Token, " "),
+                    # TODO: investigate Toke.Line here, likely LineEm,
+                    # Token is problematic here as line is already colored, a
+                    # and this changes the full style of the colored line.
+                    # ideally, __line_content returns the token and we modify the style.
+                    (Token, colored_line),
+                ]
+            else:
+                rlt = [
+                    bp,
+                    (Token.Lineno, num),
+                    (Token, " "),
+                    # TODO: investigate Toke.Line here, likely Line
+                    # Token is problematic here as line is already colored, a
+                    # and this changes the full style of the colored line.
+                    # ideally, __line_content returns the token and we modify the style.
+                    (Token.Line, colored_line),
+                ]
+            ret_tok.extend(rlt)
+
+        return self.theme.format(ret_tok)
+
+    def __line_content(
+        self, filename: str, lineno: int, line: str, arrow: bool = False
+    ):
+        bp_mark = ""
+        BreakpointToken = Token.Breakpoint
+
+        new_line, err = self.parser.format2(line, "str")
+        if not err:
+            line = new_line
+
+        bp = None
+        if lineno in self.get_file_breaks(filename):
+            bps = self.get_breaks(filename, lineno)
+            bp = bps[-1]
+
+        if bp:
+            bp_mark = str(bp.number)
+            BreakpointToken = Token.Breakpoint.Enabled
+            if not bp.enabled:
+                BreakpointToken = Token.Breakpoint.Disabled
+        numbers_width = 7
+        if arrow:
+            # This is the line with the error
+            pad = numbers_width - len(str(lineno)) - len(bp_mark)
+            num = "%s%s" % (self.theme.make_arrow(pad), str(lineno))
+        else:
+            num = "%*s" % (numbers_width - len(bp_mark), str(lineno))
+        bp_str = (BreakpointToken, bp_mark)
+        return (bp_str, num, line)
+
+    def print_list_lines(self, filename: str, first: int, last: int) -> None:
+        """The printing (as opposed to the parsing part of a 'list'
+        command."""
+        toks: TokenStream = []
+        try:
+            if filename == "<string>" and hasattr(self, "_exec_filename"):
+                filename = self._exec_filename
+
+            for lineno in range(first, last + 1):
+                line = linecache.getline(filename, lineno)
+                if not line:
+                    break
+
+                assert self.curframe is not None
+
+                if lineno == self.curframe.f_lineno:
+                    bp, num, colored_line = self.__line_content(
+                        filename, lineno, line, arrow=True
+                    )
+                    toks.extend(
+                        [
+                            bp,
+                            (Token.LinenoEm, num),
+                            (Token, " "),
+                            # TODO: invsetigate Toke.Line here
+                            (Token, colored_line),
+                        ]
+                    )
+                else:
+                    bp, num, colored_line = self.__line_content(
+                        filename, lineno, line, arrow=False
+                    )
+                    toks.extend(
+                        [
+                            bp,
+                            (Token.Lineno, num),
+                            (Token, " "),
+                            (Token, colored_line),
+                        ]
+                    )
+
+                self.lineno = lineno
+
+            print(self.theme.format(toks), file=self.stdout)
+
+        except KeyboardInterrupt:
+            pass
+
+    def do_skip_predicates(self, args):
+        """
+        Turn on/off individual predicates as to whether a frame should be hidden/skip.
+
+        The global option to skip (or not) hidden frames is set with skip_hidden
+
+        To change the value of a predicate
+
+            skip_predicates key [true|false]
+
+        Call without arguments to see the current values.
+
+        To permanently change the value of an option add the corresponding
+        command to your ``~/.pdbrc`` file. If you are programmatically using the
+        Pdb instance you can also change the ``default_predicates`` class
+        attribute.
+        """
+        if not args.strip():
+            print("current predicates:")
+            for p, v in self._predicates.items():
+                print("   ", p, ":", v)
+            return
+        type_value = args.strip().split(" ")
+        if len(type_value) != 2:
+            print(
+                f"Usage: skip_predicates <type> <value>, with <type> one of {set(self._predicates.keys())}"
+            )
+            return
+
+        type_, value = type_value
+        if type_ not in self._predicates:
+            print(f"{type_!r} not in {set(self._predicates.keys())}")
+            return
+        if value.lower() not in ("true", "yes", "1", "no", "false", "0"):
+            print(
+                f"{value!r} is invalid - use one of ('true', 'yes', '1', 'no', 'false', '0')"
+            )
+            return
+
+        self._predicates[type_] = value.lower() in ("true", "yes", "1")
+        if not any(self._predicates.values()):
+            print(
+                "Warning, all predicates set to False, skip_hidden may not have any effects."
+            )
+
+    def do_skip_hidden(self, arg):
+        """
+        Change whether or not we should skip frames with the
+        __tracebackhide__ attribute.
+        """
+        if not arg.strip():
+            print(
+                f"skip_hidden = {self.skip_hidden}, use 'yes','no', 'true', or 'false' to change."
+            )
+        elif arg.strip().lower() in ("true", "yes"):
+            self.skip_hidden = True
+        elif arg.strip().lower() in ("false", "no"):
+            self.skip_hidden = False
+        if not any(self._predicates.values()):
+            print(
+                "Warning, all predicates set to False, skip_hidden may not have any effects."
+            )
+
+    def do_list(self, arg):
+        """Print lines of code from the current stack frame"""
+        self.lastcmd = "list"
+        last = None
+        if arg and arg != ".":
+            try:
+                x = eval(arg, {}, {})
+                if type(x) == type(()):
+                    first, last = x
+                    first = int(first)
+                    last = int(last)
+                    if last < first:
+                        # Assume it's a count
+                        last = first + last
+                else:
+                    first = max(1, int(x) - 5)
+            except:
+                print("*** Error in argument:", repr(arg), file=self.stdout)
+                return
+        elif self.lineno is None or arg == ".":
+            assert self.curframe is not None
+            first = max(1, self.curframe.f_lineno - 5)
+        else:
+            first = self.lineno + 1
+        if last is None:
+            last = first + 10
+        assert self.curframe is not None
+        self.print_list_lines(self.curframe.f_code.co_filename, first, last)
+
+        lineno = first
+        filename = self.curframe.f_code.co_filename
+        self.shell.hooks.synchronize_with_editor(filename, lineno, 0)
+
+    do_l = do_list
+
+    def getsourcelines(self, obj):
+        lines, lineno = inspect.findsource(obj)
+        if inspect.isframe(obj) and obj.f_globals is self._get_frame_locals(obj):
+            # must be a module frame: do not try to cut a block out of it
+            return lines, 1
+        elif inspect.ismodule(obj):
+            return lines, 1
+        return inspect.getblock(lines[lineno:]), lineno + 1
+
+    def do_longlist(self, arg):
+        """Print lines of code from the current stack frame.
+
+        Shows more lines than 'list' does.
+        """
+        self.lastcmd = "longlist"
+        try:
+            lines, lineno = self.getsourcelines(self.curframe)
+        except OSError as err:
+            self.error(str(err))
+            return
+        last = lineno + len(lines)
+        assert self.curframe is not None
+        self.print_list_lines(self.curframe.f_code.co_filename, lineno, last)
+
+    do_ll = do_longlist
+
+    def do_debug(self, arg):
+        """debug code
+        Enter a recursive debugger that steps through the code
+        argument (which is an arbitrary expression or statement to be
+        executed in the current environment).
+        """
+        trace_function = sys.gettrace()
+        sys.settrace(None)
+        assert self.curframe is not None
+        globals = self.curframe.f_globals
+        locals = self.curframe_locals
+        p = self.__class__(
+            completekey=self.completekey, stdin=self.stdin, stdout=self.stdout
+        )
+        p.use_rawinput = self.use_rawinput
+        p.prompt = "(%s) " % self.prompt.strip()
+        self.message("ENTERING RECURSIVE DEBUGGER")
+        sys.call_tracing(p.run, (arg, globals, locals))
+        self.message("LEAVING RECURSIVE DEBUGGER")
+        sys.settrace(trace_function)
+        self.lastcmd = p.lastcmd
+
+    def do_pdef(self, arg):
+        """Print the call signature for any callable object.
+
+        The debugger interface to %pdef"""
+        assert self.curframe is not None
+        namespaces = [
+            ("Locals", self.curframe_locals),
+            ("Globals", self.curframe.f_globals),
+        ]
+        self.shell.find_line_magic("pdef")(arg, namespaces=namespaces)
+
+    def do_pdoc(self, arg):
+        """Print the docstring for an object.
+
+        The debugger interface to %pdoc."""
+        assert self.curframe is not None
+        namespaces = [
+            ("Locals", self.curframe_locals),
+            ("Globals", self.curframe.f_globals),
+        ]
+        self.shell.find_line_magic("pdoc")(arg, namespaces=namespaces)
+
+    def do_pfile(self, arg):
+        """Print (or run through pager) the file where an object is defined.
+
+        The debugger interface to %pfile.
+        """
+        assert self.curframe is not None
+        namespaces = [
+            ("Locals", self.curframe_locals),
+            ("Globals", self.curframe.f_globals),
+        ]
+        self.shell.find_line_magic("pfile")(arg, namespaces=namespaces)
+
+    def do_pinfo(self, arg):
+        """Provide detailed information about an object.
+
+        The debugger interface to %pinfo, i.e., obj?."""
+        assert self.curframe is not None
+        namespaces = [
+            ("Locals", self.curframe_locals),
+            ("Globals", self.curframe.f_globals),
+        ]
+        self.shell.find_line_magic("pinfo")(arg, namespaces=namespaces)
+
+    def do_pinfo2(self, arg):
+        """Provide extra detailed information about an object.
+
+        The debugger interface to %pinfo2, i.e., obj??."""
+        assert self.curframe is not None
+        namespaces = [
+            ("Locals", self.curframe_locals),
+            ("Globals", self.curframe.f_globals),
+        ]
+        self.shell.find_line_magic("pinfo2")(arg, namespaces=namespaces)
+
+    def do_psource(self, arg):
+        """Print (or run through pager) the source code for an object."""
+        assert self.curframe is not None
+        namespaces = [
+            ("Locals", self.curframe_locals),
+            ("Globals", self.curframe.f_globals),
+        ]
+        self.shell.find_line_magic("psource")(arg, namespaces=namespaces)
+
+    def do_where(self, arg: str):
+        """w(here)
+        Print a stack trace, with the most recent frame at the bottom.
+        An arrow indicates the "current frame", which determines the
+        context of most commands. 'bt' is an alias for this command.
+
+        Take a number as argument as an (optional) number of context line to
+        print"""
+        if arg:
+            try:
+                context = int(arg)
+            except ValueError as err:
+                self.error(str(err))
+                return
+            self.print_stack_trace(context)
+        else:
+            self.print_stack_trace()
+
+    do_w = do_where
+
+    def break_anywhere(self, frame):
+        """
+        _stop_in_decorator_internals is overly restrictive, as we may still want
+        to trace function calls, so we need to also update break_anywhere so
+        that is we don't `stop_here`, because of debugger skip, we may still
+        stop at any point inside the function
+
+        """
+
+        sup = super().break_anywhere(frame)
+        if sup:
+            return sup
+        if self._predicates["debuggerskip"]:
+            if DEBUGGERSKIP in frame.f_code.co_varnames:
+                return True
+            if frame.f_back and self._get_frame_locals(frame.f_back).get(DEBUGGERSKIP):
+                return True
+        return False
+
+    def _is_in_decorator_internal_and_should_skip(self, frame):
+        """
+        Utility to tell us whether we are in a decorator internal and should stop.
+
+        """
+        # if we are disabled don't skip
+        if not self._predicates["debuggerskip"]:
+            return False
+
+        return self._cachable_skip(frame)
+
+    @lru_cache(1024)
+    def _cached_one_parent_frame_debuggerskip(self, frame):
+        """
+        Cache looking up for DEBUGGERSKIP on parent frame.
+
+        This should speedup walking through deep frame when one of the highest
+        one does have a debugger skip.
+
+        This is likely to introduce fake positive though.
+        """
+        while getattr(frame, "f_back", None):
+            frame = frame.f_back
+            if self._get_frame_locals(frame).get(DEBUGGERSKIP):
+                return True
+        return None
+
+    @lru_cache(1024)
+    def _cachable_skip(self, frame):
+        # if frame is tagged, skip by default.
+        if DEBUGGERSKIP in frame.f_code.co_varnames:
+            return True
+
+        # if one of the parent frame value set to True skip as well.
+        if self._cached_one_parent_frame_debuggerskip(frame):
+            return True
+
+        return False
+
+    def stop_here(self, frame):
+        if self._is_in_decorator_internal_and_should_skip(frame) is True:
+            return False
+
+        hidden = False
+        if self.skip_hidden:
+            hidden = self._hidden_predicate(frame)
+        if hidden:
+            if self.report_skipped:
+                print(
+                    self.theme.format(
+                        [
+                            (
+                                Token.ExcName,
+                                "    [... skipped 1 hidden frame(s)]",
+                            ),
+                            (Token, "\n"),
+                        ]
+                    )
+                )
+        return super().stop_here(frame)
+
+    def do_up(self, arg):
+        """u(p) [count]
+        Move the current frame count (default one) levels up in the
+        stack trace (to an older frame).
+
+        Will skip hidden frames.
+        """
+        # modified version of upstream that skips
+        # frames with __tracebackhide__
+        if self.curindex == 0:
+            self.error("Oldest frame")
+            return
+        try:
+            count = int(arg or 1)
+        except ValueError:
+            self.error("Invalid frame count (%s)" % arg)
+            return
+        skipped = 0
+        if count < 0:
+            _newframe = 0
+        else:
+            counter = 0
+            hidden_frames = self.hidden_frames(self.stack)
+            for i in range(self.curindex - 1, -1, -1):
+                if hidden_frames[i] and self.skip_hidden:
+                    skipped += 1
+                    continue
+                counter += 1
+                if counter >= count:
+                    break
+            else:
+                # if no break occurred.
+                self.error(
+                    "all frames above hidden, use `skip_hidden False` to get get into those."
+                )
+                return
+
+            _newframe = i
+        self._select_frame(_newframe)
+        if skipped:
+            print(
+                self.theme.format(
+                    [
+                        (
+                            Token.ExcName,
+                            f"    [... skipped {skipped} hidden frame(s)]",
+                        ),
+                        (Token, "\n"),
+                    ]
+                )
+            )
+
+    def do_down(self, arg):
+        """d(own) [count]
+        Move the current frame count (default one) levels down in the
+        stack trace (to a newer frame).
+
+        Will skip hidden frames.
+        """
+        if self.curindex + 1 == len(self.stack):
+            self.error("Newest frame")
+            return
+        try:
+            count = int(arg or 1)
+        except ValueError:
+            self.error("Invalid frame count (%s)" % arg)
+            return
+        if count < 0:
+            _newframe = len(self.stack) - 1
+        else:
+            counter = 0
+            skipped = 0
+            hidden_frames = self.hidden_frames(self.stack)
+            for i in range(self.curindex + 1, len(self.stack)):
+                if hidden_frames[i] and self.skip_hidden:
+                    skipped += 1
+                    continue
+                counter += 1
+                if counter >= count:
+                    break
+            else:
+                self.error(
+                    "all frames below hidden, use `skip_hidden False` to get get into those."
+                )
+                return
+
+            if skipped:
+                print(
+                    self.theme.format(
+                        [
+                            (
+                                Token.ExcName,
+                                f"    [... skipped {skipped} hidden frame(s)]",
+                            ),
+                            (Token, "\n"),
+                        ]
+                    )
+                )
+            _newframe = i
+
+        self._select_frame(_newframe)
+
+    do_d = do_down
+    do_u = do_up
+
+    def do_context(self, context: str):
+        """context number_of_lines
+        Set the number of lines of source code to show when displaying
+        stacktrace information.
+        """
+        try:
+            new_context = int(context)
+            if new_context <= 0:
+                raise ValueError()
+            self.context = new_context
+        except ValueError:
+            self.error(
+                f"The 'context' command requires a positive integer argument (current value {self.context})."
+            )
+
+
+class InterruptiblePdb(Pdb):
+    """Version of debugger where KeyboardInterrupt exits the debugger altogether."""
+
+    def cmdloop(self, intro=None):
+        """Wrap cmdloop() such that KeyboardInterrupt stops the debugger."""
+        try:
+            return OldPdb.cmdloop(self, intro=intro)
+        except KeyboardInterrupt:
+            self.stop_here = lambda frame: False  # type: ignore[method-assign]
+            self.do_quit("")
+            sys.settrace(None)
+            self.quitting = False
+            raise
+
+    def _cmdloop(self):
+        while True:
+            try:
+                # keyboard interrupts allow for an easy way to cancel
+                # the current command, so allow them during interactive input
+                self.allow_kbdint = True
+                self.cmdloop()
+                self.allow_kbdint = False
+                break
+            except KeyboardInterrupt:
+                self.message("--KeyboardInterrupt--")
+                raise
+
+
+def set_trace(frame=None, header=None):
+    """
+    Start debugging from `frame`.
+
+    If frame is not specified, debugging starts from caller's frame.
+    """
+    pdb = Pdb()
+    if header is not None:
+        pdb.message(header)
+    pdb.set_trace(frame or sys._getframe().f_back)

temp_venv/lib/python3.13/site-packages/IPython/core/display.py

@@ -0,0 +1,1266 @@
+"""Top-level display functions for displaying object in different formats."""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+
+from binascii import b2a_base64, hexlify
+import html
+import json
+import mimetypes
+import os
+import struct
+import warnings
+from copy import deepcopy
+from os.path import splitext
+from pathlib import Path, PurePath
+
+from typing import Optional
+
+from IPython.testing.skipdoctest import skip_doctest
+from . import display_functions
+
+
+__all__ = [
+    "display_pretty",
+    "display_html",
+    "display_markdown",
+    "display_svg",
+    "display_png",
+    "display_jpeg",
+    "display_webp",
+    "display_latex",
+    "display_json",
+    "display_javascript",
+    "display_pdf",
+    "DisplayObject",
+    "TextDisplayObject",
+    "Pretty",
+    "HTML",
+    "Markdown",
+    "Math",
+    "Latex",
+    "SVG",
+    "ProgressBar",
+    "JSON",
+    "GeoJSON",
+    "Javascript",
+    "Image",
+    "Video",
+]
+
+#-----------------------------------------------------------------------------
+# utility functions
+#-----------------------------------------------------------------------------
+
+def _safe_exists(path):
+    """Check path, but don't let exceptions raise"""
+    try:
+        return os.path.exists(path)
+    except Exception:
+        return False
+
+
+def _display_mimetype(mimetype, objs, raw=False, metadata=None):
+    """internal implementation of all display_foo methods
+
+    Parameters
+    ----------
+    mimetype : str
+        The mimetype to be published (e.g. 'image/png')
+    *objs : object
+        The Python objects to display, or if raw=True raw text data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    if metadata:
+        metadata = {mimetype: metadata}
+    if raw:
+        # turn list of pngdata into list of { 'image/png': pngdata }
+        objs = [ {mimetype: obj} for obj in objs ]
+    display_functions.display(*objs, raw=raw, metadata=metadata, include=[mimetype])
+
+#-----------------------------------------------------------------------------
+# Main functions
+#-----------------------------------------------------------------------------
+
+
+def display_pretty(*objs, **kwargs):
+    """Display the pretty (default) representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw text data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('text/plain', objs, **kwargs)
+
+
+def display_html(*objs, **kwargs):
+    """Display the HTML representation of an object.
+
+    Note: If raw=False and the object does not have a HTML
+    representation, no HTML will be shown.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw HTML data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('text/html', objs, **kwargs)
+
+
+def display_markdown(*objs, **kwargs):
+    """Displays the Markdown representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw markdown data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+
+    _display_mimetype('text/markdown', objs, **kwargs)
+
+
+def display_svg(*objs, **kwargs):
+    """Display the SVG representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw svg data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('image/svg+xml', objs, **kwargs)
+
+
+def display_png(*objs, **kwargs):
+    """Display the PNG representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw png data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('image/png', objs, **kwargs)
+
+
+def display_jpeg(*objs, **kwargs):
+    """Display the JPEG representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw JPEG data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('image/jpeg', objs, **kwargs)
+
+
+def display_webp(*objs, **kwargs):
+    """Display the WEBP representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw JPEG data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype("image/webp", objs, **kwargs)
+
+
+def display_latex(*objs, **kwargs):
+    """Display the LaTeX representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw latex data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('text/latex', objs, **kwargs)
+
+
+def display_json(*objs, **kwargs):
+    """Display the JSON representation of an object.
+
+    Note that not many frontends support displaying JSON.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw json data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('application/json', objs, **kwargs)
+
+
+def display_javascript(*objs, **kwargs):
+    """Display the Javascript representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw javascript data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('application/javascript', objs, **kwargs)
+
+
+def display_pdf(*objs, **kwargs):
+    """Display the PDF representation of an object.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display, or if raw=True raw javascript data to
+        display.
+    raw : bool
+        Are the data objects raw data or Python objects that need to be
+        formatted before display? [default: False]
+    metadata : dict (optional)
+        Metadata to be associated with the specific mimetype output.
+    """
+    _display_mimetype('application/pdf', objs, **kwargs)
+
+
+#-----------------------------------------------------------------------------
+# Smart classes
+#-----------------------------------------------------------------------------
+
+
+class DisplayObject:
+    """An object that wraps data to be displayed."""
+
+    _read_flags = 'r'
+    _show_mem_addr = False
+    metadata = None
+
+    def __init__(self, data=None, url=None, filename=None, metadata=None):
+        """Create a display object given raw data.
+
+        When this object is returned by an expression or passed to the
+        display function, it will result in the data being displayed
+        in the frontend. The MIME type of the data should match the
+        subclasses used, so the Png subclass should be used for 'image/png'
+        data. If the data is a URL, the data will first be downloaded
+        and then displayed.
+
+        Parameters
+        ----------
+        data : unicode, str or bytes
+            The raw data or a URL or file to load the data from
+        url : unicode
+            A URL to download the data from.
+        filename : unicode
+            Path to a local file to load the data from.
+        metadata : dict
+            Dict of metadata associated to be the object when displayed
+        """
+        if isinstance(data, (Path, PurePath)):
+            data = str(data)
+
+        if data is not None and isinstance(data, str):
+            if data.startswith('http') and url is None:
+                url = data
+                filename = None
+                data = None
+            elif _safe_exists(data) and filename is None:
+                url = None
+                filename = data
+                data = None
+
+        self.url = url
+        self.filename = filename
+        # because of @data.setter methods in
+        # subclasses ensure url and filename are set
+        # before assigning to self.data
+        self.data = data
+
+        if metadata is not None:
+            self.metadata = metadata
+        elif self.metadata is None:
+            self.metadata = {}
+
+        self.reload()
+        self._check_data()
+
+    def __repr__(self):
+        if not self._show_mem_addr:
+            cls = self.__class__
+            r = "<%s.%s object>" % (cls.__module__, cls.__name__)
+        else:
+            r = super(DisplayObject, self).__repr__()
+        return r
+
+    def _check_data(self):
+        """Override in subclasses if there's something to check."""
+        pass
+
+    def _data_and_metadata(self):
+        """shortcut for returning metadata with shape information, if defined"""
+        if self.metadata:
+            return self.data, deepcopy(self.metadata)
+        else:
+            return self.data
+
+    def reload(self):
+        """Reload the raw data from file or URL."""
+        if self.filename is not None:
+            encoding = None if "b" in self._read_flags else "utf-8"
+            with open(self.filename, self._read_flags, encoding=encoding) as f:
+                self.data = f.read()
+        elif self.url is not None:
+            # Deferred import
+            from urllib.request import urlopen
+            response = urlopen(self.url)
+            data = response.read()
+            # extract encoding from header, if there is one:
+            encoding = None
+            if 'content-type' in response.headers:
+                for sub in response.headers['content-type'].split(';'):
+                    sub = sub.strip()
+                    if sub.startswith('charset'):
+                        encoding = sub.split('=')[-1].strip()
+                        break
+            if 'content-encoding' in response.headers:
+                # TODO: do deflate?
+                if 'gzip' in response.headers['content-encoding']:
+                    import gzip
+                    from io import BytesIO
+
+                    # assume utf-8 if encoding is not specified
+                    with gzip.open(
+                        BytesIO(data), "rt", encoding=encoding or "utf-8"
+                    ) as fp:
+                        encoding = None
+                        data = fp.read()
+
+            # decode data, if an encoding was specified
+            # We only touch self.data once since
+            # subclasses such as SVG have @data.setter methods
+            # that transform self.data into ... well svg.
+            if encoding:
+                self.data = data.decode(encoding, 'replace')
+            else:
+                self.data = data
+
+
+class TextDisplayObject(DisplayObject):
+    """Create a text display object given raw data.
+
+    Parameters
+    ----------
+    data : str or unicode
+        The raw data or a URL or file to load the data from.
+    url : unicode
+        A URL to download the data from.
+    filename : unicode
+        Path to a local file to load the data from.
+    metadata : dict
+        Dict of metadata associated to be the object when displayed
+    """
+    def _check_data(self):
+        if self.data is not None and not isinstance(self.data, str):
+            raise TypeError("%s expects text, not %r" % (self.__class__.__name__, self.data))
+
+class Pretty(TextDisplayObject):
+
+    def _repr_pretty_(self, pp, cycle):
+        return pp.text(self.data)
+
+
+class HTML(TextDisplayObject):
+
+    def __init__(self, data=None, url=None, filename=None, metadata=None):
+        def warn():
+            if not data:
+                return False
+
+            #
+            # Avoid calling lower() on the entire data, because it could be a
+            # long string and we're only interested in its beginning and end.
+            #
+            prefix = data[:10].lower()
+            suffix = data[-10:].lower()
+            return prefix.startswith("<iframe ") and suffix.endswith("</iframe>")
+
+        if warn():
+            warnings.warn("Consider using IPython.display.IFrame instead")
+        super(HTML, self).__init__(data=data, url=url, filename=filename, metadata=metadata)
+
+    def _repr_html_(self):
+        return self._data_and_metadata()
+
+    def __html__(self):
+        """
+        This method exists to inform other HTML-using modules (e.g. Markupsafe,
+        htmltag, etc) that this object is HTML and does not need things like
+        special characters (<>&) escaped.
+        """
+        return self._repr_html_()
+
+
+class Markdown(TextDisplayObject):
+
+    def _repr_markdown_(self):
+        return self._data_and_metadata()
+
+
+class Math(TextDisplayObject):
+
+    def _repr_latex_(self):
+        s = r"$\displaystyle %s$" % self.data.strip('$')
+        if self.metadata:
+            return s, deepcopy(self.metadata)
+        else:
+            return s
+
+
+class Latex(TextDisplayObject):
+
+    def _repr_latex_(self):
+        return self._data_and_metadata()
+
+
+class SVG(DisplayObject):
+    """Embed an SVG into the display.
+
+    Note if you just want to view a svg image via a URL use `:class:Image` with
+    a url=URL keyword argument.
+    """
+
+    _read_flags = 'rb'
+    # wrap data in a property, which extracts the <svg> tag, discarding
+    # document headers
+    _data: Optional[str] = None
+
+    @property
+    def data(self):
+        return self._data
+
+    @data.setter
+    def data(self, svg):
+        if svg is None:
+            self._data = None
+            return
+        # parse into dom object
+        from xml.dom import minidom
+        x = minidom.parseString(svg)
+        # get svg tag (should be 1)
+        found_svg = x.getElementsByTagName('svg')
+        if found_svg:
+            svg = found_svg[0].toxml()
+        else:
+            # fallback on the input, trust the user
+            # but this is probably an error.
+            pass
+        if isinstance(svg, bytes):
+            self._data = svg.decode(errors="replace")
+        else:
+            self._data = svg
+
+    def _repr_svg_(self):
+        return self._data_and_metadata()
+
+class ProgressBar(DisplayObject):
+    """Progressbar supports displaying a progressbar like element
+    """
+    def __init__(self, total):
+        """Creates a new progressbar
+
+        Parameters
+        ----------
+        total : int
+            maximum size of the progressbar
+        """
+        self.total = total
+        self._progress = 0
+        self.html_width = '60ex'
+        self.text_width = 60
+        self._display_id = hexlify(os.urandom(8)).decode('ascii')
+
+    def __repr__(self):
+        fraction = self.progress / self.total
+        filled = '=' * int(fraction * self.text_width)
+        rest = ' ' * (self.text_width - len(filled))
+        return '[{}{}] {}/{}'.format(
+            filled, rest,
+            self.progress, self.total,
+        )
+
+    def _repr_html_(self):
+        return "<progress style='width:{}' max='{}' value='{}'></progress>".format(
+            self.html_width, self.total, self.progress)
+
+    def display(self):
+        display_functions.display(self, display_id=self._display_id)
+
+    def update(self):
+        display_functions.display(self, display_id=self._display_id, update=True)
+
+    @property
+    def progress(self):
+        return self._progress
+
+    @progress.setter
+    def progress(self, value):
+        self._progress = value
+        self.update()
+
+    def __iter__(self):
+        self.display()
+        self._progress = -1 # First iteration is 0
+        return self
+
+    def __next__(self):
+        """Returns current value and increments display by one."""
+        self.progress += 1
+        if self.progress < self.total:
+            return self.progress
+        else:
+            raise StopIteration()
+
+class JSON(DisplayObject):
+    """JSON expects a JSON-able dict or list
+
+    not an already-serialized JSON string.
+
+    Scalar types (None, number, string) are not allowed, only dict or list containers.
+    """
+    # wrap data in a property, which warns about passing already-serialized JSON
+    _data = None
+    def __init__(self, data=None, url=None, filename=None, expanded=False, metadata=None, root='root', **kwargs):
+        """Create a JSON display object given raw data.
+
+        Parameters
+        ----------
+        data : dict or list
+            JSON data to display. Not an already-serialized JSON string.
+            Scalar types (None, number, string) are not allowed, only dict
+            or list containers.
+        url : unicode
+            A URL to download the data from.
+        filename : unicode
+            Path to a local file to load the data from.
+        expanded : boolean
+            Metadata to control whether a JSON display component is expanded.
+        metadata : dict
+            Specify extra metadata to attach to the json display object.
+        root : str
+            The name of the root element of the JSON tree
+        """
+        self.metadata = {
+            'expanded': expanded,
+            'root': root,
+        }
+        if metadata:
+            self.metadata.update(metadata)
+        if kwargs:
+            self.metadata.update(kwargs)
+        super(JSON, self).__init__(data=data, url=url, filename=filename)
+
+    def _check_data(self):
+        if self.data is not None and not isinstance(self.data, (dict, list)):
+            raise TypeError("%s expects JSONable dict or list, not %r" % (self.__class__.__name__, self.data))
+
+    @property
+    def data(self):
+        return self._data
+
+    @data.setter
+    def data(self, data):
+        if isinstance(data, (Path, PurePath)):
+            data = str(data)
+
+        if isinstance(data, str):
+            if self.filename is None and self.url is None:
+                warnings.warn("JSON expects JSONable dict or list, not JSON strings")
+            data = json.loads(data)
+        self._data = data
+
+    def _data_and_metadata(self):
+        return self.data, self.metadata
+
+    def _repr_json_(self):
+        return self._data_and_metadata()
+
+
+_css_t = """var link = document.createElement("link");
+	link.rel = "stylesheet";
+	link.type = "text/css";
+	link.href = "%s";
+	document.head.appendChild(link);
+"""
+
+_lib_t1 = """new Promise(function(resolve, reject) {
+	var script = document.createElement("script");
+	script.onload = resolve;
+	script.onerror = reject;
+	script.src = "%s";
+	document.head.appendChild(script);
+}).then(() => {
+"""
+
+_lib_t2 = """
+});"""
+
+class GeoJSON(JSON):
+    """GeoJSON expects JSON-able dict
+
+    not an already-serialized JSON string.
+
+    Scalar types (None, number, string) are not allowed, only dict containers.
+    """
+
+    def __init__(self, *args, **kwargs):
+        """Create a GeoJSON display object given raw data.
+
+        Parameters
+        ----------
+        data : dict or list
+            VegaLite data. Not an already-serialized JSON string.
+            Scalar types (None, number, string) are not allowed, only dict
+            or list containers.
+        url_template : string
+            Leaflet TileLayer URL template: http://leafletjs.com/reference.html#url-template
+        layer_options : dict
+            Leaflet TileLayer options: http://leafletjs.com/reference.html#tilelayer-options
+        url : unicode
+            A URL to download the data from.
+        filename : unicode
+            Path to a local file to load the data from.
+        metadata : dict
+            Specify extra metadata to attach to the json display object.
+
+        Examples
+        --------
+        The following will display an interactive map of Mars with a point of
+        interest on frontend that do support GeoJSON display.
+
+            >>> from IPython.display import GeoJSON
+
+            >>> GeoJSON(data={
+            ...     "type": "Feature",
+            ...     "geometry": {
+            ...         "type": "Point",
+            ...         "coordinates": [-81.327, 296.038]
+            ...     }
+            ... },
+            ... url_template="http://s3-eu-west-1.amazonaws.com/whereonmars.cartodb.net/{basemap_id}/{z}/{x}/{y}.png",
+            ... layer_options={
+            ...     "basemap_id": "celestia_mars-shaded-16k_global",
+            ...     "attribution" : "Celestia/praesepe",
+            ...     "minZoom" : 0,
+            ...     "maxZoom" : 18,
+            ... })
+            <IPython.core.display.GeoJSON object>
+
+        In the terminal IPython, you will only see the text representation of
+        the GeoJSON object.
+
+        """
+
+        super(GeoJSON, self).__init__(*args, **kwargs)
+
+
+    def _ipython_display_(self):
+        bundle = {
+            'application/geo+json': self.data,
+            'text/plain': '<IPython.display.GeoJSON object>'
+        }
+        metadata = {
+            'application/geo+json': self.metadata
+        }
+        display_functions.display(bundle, metadata=metadata, raw=True)
+
+class Javascript(TextDisplayObject):
+
+    def __init__(self, data=None, url=None, filename=None, lib=None, css=None):
+        """Create a Javascript display object given raw data.
+
+        When this object is returned by an expression or passed to the
+        display function, it will result in the data being displayed
+        in the frontend. If the data is a URL, the data will first be
+        downloaded and then displayed.
+
+        In the Notebook, the containing element will be available as `element`,
+        and jQuery will be available.  Content appended to `element` will be
+        visible in the output area.
+
+        Parameters
+        ----------
+        data : unicode, str or bytes
+            The Javascript source code or a URL to download it from.
+        url : unicode
+            A URL to download the data from.
+        filename : unicode
+            Path to a local file to load the data from.
+        lib : list or str
+            A sequence of Javascript library URLs to load asynchronously before
+            running the source code. The full URLs of the libraries should
+            be given. A single Javascript library URL can also be given as a
+            string.
+        css : list or str
+            A sequence of css files to load before running the source code.
+            The full URLs of the css files should be given. A single css URL
+            can also be given as a string.
+        """
+        if isinstance(lib, str):
+            lib = [lib]
+        elif lib is None:
+            lib = []
+        if isinstance(css, str):
+            css = [css]
+        elif css is None:
+            css = []
+        if not isinstance(lib, (list,tuple)):
+            raise TypeError('expected sequence, got: %r' % lib)
+        if not isinstance(css, (list,tuple)):
+            raise TypeError('expected sequence, got: %r' % css)
+        self.lib = lib
+        self.css = css
+        super(Javascript, self).__init__(data=data, url=url, filename=filename)
+
+    def _repr_javascript_(self):
+        r = ''
+        for c in self.css:
+            r += _css_t % c
+        for l in self.lib:
+            r += _lib_t1 % l
+        r += self.data
+        r += _lib_t2*len(self.lib)
+        return r
+
+
+# constants for identifying png/jpeg/gif/webp data
+_PNG = b"\x89PNG\r\n\x1a\n"
+_JPEG = b"\xff\xd8"
+_GIF1 = b"GIF87a"
+_GIF2 = b"GIF89a"
+_WEBP = b"WEBP"
+
+
+def _pngxy(data):
+    """read the (width, height) from a PNG header"""
+    ihdr = data.index(b'IHDR')
+    # next 8 bytes are width/height
+    return struct.unpack('>ii', data[ihdr+4:ihdr+12])
+
+
+def _jpegxy(data):
+    """read the (width, height) from a JPEG header"""
+    # adapted from http://www.64lines.com/jpeg-width-height
+
+    idx = 4
+    while True:
+        block_size = struct.unpack('>H', data[idx:idx+2])[0]
+        idx = idx + block_size
+        if data[idx:idx+2] == b'\xFF\xC0':
+            # found Start of Frame
+            iSOF = idx
+            break
+        else:
+            # read another block
+            idx += 2
+
+    h, w = struct.unpack('>HH', data[iSOF+5:iSOF+9])
+    return w, h
+
+
+def _gifxy(data):
+    """read the (width, height) from a GIF header"""
+    return struct.unpack('<HH', data[6:10])
+
+
+def _webpxy(data):
+    """read the (width, height) from a WEBP header"""
+    if data[12:16] == b"VP8 ":
+        width, height = struct.unpack("<HH", data[24:30])
+        width = width & 0x3FFF
+        height = height & 0x3FFF
+        return (width, height)
+    elif data[12:16] == b"VP8L":
+        size_info = struct.unpack("<I", data[21:25])[0]
+        width = 1 + ((size_info & 0x3F) << 8) | (size_info >> 24)
+        height = 1 + (
+            (((size_info >> 8) & 0xF) << 10)
+            | (((size_info >> 14) & 0x3FC) << 2)
+            | ((size_info >> 22) & 0x3)
+        )
+        return (width, height)
+    else:
+        raise ValueError("Not a valid WEBP header")
+
+
+class Image(DisplayObject):
+
+    _read_flags = "rb"
+    _FMT_JPEG = "jpeg"
+    _FMT_PNG = "png"
+    _FMT_GIF = "gif"
+    _FMT_WEBP = "webp"
+    _ACCEPTABLE_EMBEDDINGS = [_FMT_JPEG, _FMT_PNG, _FMT_GIF, _FMT_WEBP]
+    _MIMETYPES = {
+        _FMT_PNG: "image/png",
+        _FMT_JPEG: "image/jpeg",
+        _FMT_GIF: "image/gif",
+        _FMT_WEBP: "image/webp",
+    }
+
+    def __init__(
+        self,
+        data=None,
+        url=None,
+        filename=None,
+        format=None,
+        embed=None,
+        width=None,
+        height=None,
+        retina=False,
+        unconfined=False,
+        metadata=None,
+        alt=None,
+    ):
+        """Create a PNG/JPEG/GIF/WEBP image object given raw data.
+
+        When this object is returned by an input cell or passed to the
+        display function, it will result in the image being displayed
+        in the frontend.
+
+        Parameters
+        ----------
+        data : unicode, str or bytes
+            The raw image data or a URL or filename to load the data from.
+            This always results in embedded image data.
+
+        url : unicode
+            A URL to download the data from. If you specify `url=`,
+            the image data will not be embedded unless you also specify `embed=True`.
+
+        filename : unicode
+            Path to a local file to load the data from.
+            Images from a file are always embedded.
+
+        format : unicode
+            The format of the image data (png/jpeg/jpg/gif/webp). If a filename or URL is given
+            for format will be inferred from the filename extension.
+
+        embed : bool
+            Should the image data be embedded using a data URI (True) or be
+            loaded using an <img> tag. Set this to True if you want the image
+            to be viewable later with no internet connection in the notebook.
+
+            Default is `True`, unless the keyword argument `url` is set, then
+            default value is `False`.
+
+            Note that QtConsole is not able to display images if `embed` is set to `False`
+
+        width : int
+            Width in pixels to which to constrain the image in html
+
+        height : int
+            Height in pixels to which to constrain the image in html
+
+        retina : bool
+            Automatically set the width and height to half of the measured
+            width and height.
+            This only works for embedded images because it reads the width/height
+            from image data.
+            For non-embedded images, you can just set the desired display width
+            and height directly.
+
+        unconfined : bool
+            Set unconfined=True to disable max-width confinement of the image.
+
+        metadata : dict
+            Specify extra metadata to attach to the image.
+
+        alt : unicode
+            Alternative text for the image, for use by screen readers.
+
+        Examples
+        --------
+        embedded image data, works in qtconsole and notebook
+        when passed positionally, the first arg can be any of raw image data,
+        a URL, or a filename from which to load image data.
+        The result is always embedding image data for inline images.
+
+        >>> Image('https://www.google.fr/images/srpr/logo3w.png') # doctest: +SKIP
+        <IPython.core.display.Image object>
+
+        >>> Image('/path/to/image.jpg')
+        <IPython.core.display.Image object>
+
+        >>> Image(b'RAW_PNG_DATA...')
+        <IPython.core.display.Image object>
+
+        Specifying Image(url=...) does not embed the image data,
+        it only generates ``<img>`` tag with a link to the source.
+        This will not work in the qtconsole or offline.
+
+        >>> Image(url='https://www.google.fr/images/srpr/logo3w.png')
+        <IPython.core.display.Image object>
+
+        """
+        if isinstance(data, (Path, PurePath)):
+            data = str(data)
+
+        if filename is not None:
+            ext = self._find_ext(filename)
+        elif url is not None:
+            ext = self._find_ext(url)
+        elif data is None:
+            raise ValueError("No image data found. Expecting filename, url, or data.")
+        elif isinstance(data, str) and (
+            data.startswith('http') or _safe_exists(data)
+        ):
+            ext = self._find_ext(data)
+        else:
+            ext = None
+
+        if format is None:
+            if ext is not None:
+                if ext == u'jpg' or ext == u'jpeg':
+                    format = self._FMT_JPEG
+                elif ext == u'png':
+                    format = self._FMT_PNG
+                elif ext == u'gif':
+                    format = self._FMT_GIF
+                elif ext == "webp":
+                    format = self._FMT_WEBP
+                else:
+                    format = ext.lower()
+            elif isinstance(data, bytes):
+                # infer image type from image data header,
+                # only if format has not been specified.
+                if data[:2] == _JPEG:
+                    format = self._FMT_JPEG
+                elif data[:8] == _PNG:
+                    format = self._FMT_PNG
+                elif data[8:12] == _WEBP:
+                    format = self._FMT_WEBP
+                elif data[:6] == _GIF1 or data[:6] == _GIF2:
+                    format = self._FMT_GIF
+
+        # failed to detect format, default png
+        if format is None:
+            format = self._FMT_PNG
+
+        if format.lower() == 'jpg':
+            # jpg->jpeg
+            format = self._FMT_JPEG
+
+        self.format = format.lower()
+        self.embed = embed if embed is not None else (url is None)
+
+        if self.embed and self.format not in self._ACCEPTABLE_EMBEDDINGS:
+            raise ValueError("Cannot embed the '%s' image format" % (self.format))
+        if self.embed:
+            self._mimetype = self._MIMETYPES.get(self.format)
+
+        self.width = width
+        self.height = height
+        self.retina = retina
+        self.unconfined = unconfined
+        self.alt = alt
+        super(Image, self).__init__(data=data, url=url, filename=filename,
+                metadata=metadata)
+
+        if self.width is None and self.metadata.get('width', {}):
+            self.width = metadata['width']
+
+        if self.height is None and self.metadata.get('height', {}):
+            self.height = metadata['height']
+
+        if self.alt is None and self.metadata.get("alt", {}):
+            self.alt = metadata["alt"]
+
+        if retina:
+            self._retina_shape()
+
+
+    def _retina_shape(self):
+        """load pixel-doubled width and height from image data"""
+        if not self.embed:
+            return
+        if self.format == self._FMT_PNG:
+            w, h = _pngxy(self.data)
+        elif self.format == self._FMT_JPEG:
+            w, h = _jpegxy(self.data)
+        elif self.format == self._FMT_GIF:
+            w, h = _gifxy(self.data)
+        else:
+            # retina only supports png
+            return
+        self.width = w // 2
+        self.height = h // 2
+
+    def reload(self):
+        """Reload the raw data from file or URL."""
+        if self.embed:
+            super(Image,self).reload()
+            if self.retina:
+                self._retina_shape()
+
+    def _repr_html_(self):
+        if not self.embed:
+            width = height = klass = alt = ""
+            if self.width:
+                width = ' width="%d"' % self.width
+            if self.height:
+                height = ' height="%d"' % self.height
+            if self.unconfined:
+                klass = ' class="unconfined"'
+            if self.alt:
+                alt = ' alt="%s"' % html.escape(self.alt)
+            return '<img src="{url}"{width}{height}{klass}{alt}/>'.format(
+                url=self.url,
+                width=width,
+                height=height,
+                klass=klass,
+                alt=alt,
+            )
+
+    def _repr_mimebundle_(self, include=None, exclude=None):
+        """Return the image as a mimebundle
+
+        Any new mimetype support should be implemented here.
+        """
+        if self.embed:
+            mimetype = self._mimetype
+            data, metadata = self._data_and_metadata(always_both=True)
+            if metadata:
+                metadata = {mimetype: metadata}
+            return {mimetype: data}, metadata
+        else:
+            return {'text/html': self._repr_html_()}
+
+    def _data_and_metadata(self, always_both=False):
+        """shortcut for returning metadata with shape information, if defined"""
+        try:
+            b64_data = b2a_base64(self.data, newline=False).decode("ascii")
+        except TypeError as e:
+            raise FileNotFoundError(
+                "No such file or directory: '%s'" % (self.data)) from e
+        md = {}
+        if self.metadata:
+            md.update(self.metadata)
+        if self.width:
+            md['width'] = self.width
+        if self.height:
+            md['height'] = self.height
+        if self.unconfined:
+            md['unconfined'] = self.unconfined
+        if self.alt:
+            md["alt"] = self.alt
+        if md or always_both:
+            return b64_data, md
+        else:
+            return b64_data
+
+    def _repr_png_(self):
+        if self.embed and self.format == self._FMT_PNG:
+            return self._data_and_metadata()
+
+    def _repr_jpeg_(self):
+        if self.embed and self.format == self._FMT_JPEG:
+            return self._data_and_metadata()
+
+    def _find_ext(self, s):
+        base, ext = splitext(s)
+
+        if not ext:
+            return base
+
+        # `splitext` includes leading period, so we skip it
+        return ext[1:].lower()
+
+
+class Video(DisplayObject):
+
+    def __init__(self, data=None, url=None, filename=None, embed=False,
+                 mimetype=None, width=None, height=None, html_attributes="controls"):
+        """Create a video object given raw data or an URL.
+
+        When this object is returned by an input cell or passed to the
+        display function, it will result in the video being displayed
+        in the frontend.
+
+        Parameters
+        ----------
+        data : unicode, str or bytes
+            The raw video data or a URL or filename to load the data from.
+            Raw data will require passing ``embed=True``.
+
+        url : unicode
+            A URL for the video. If you specify ``url=``,
+            the image data will not be embedded.
+
+        filename : unicode
+            Path to a local file containing the video.
+            Will be interpreted as a local URL unless ``embed=True``.
+
+        embed : bool
+            Should the video be embedded using a data URI (True) or be
+            loaded using a <video> tag (False).
+
+            Since videos are large, embedding them should be avoided, if possible.
+            You must confirm embedding as your intention by passing ``embed=True``.
+
+            Local files can be displayed with URLs without embedding the content, via::
+
+                Video('./video.mp4')
+
+        mimetype : unicode
+            Specify the mimetype for embedded videos.
+            Default will be guessed from file extension, if available.
+
+        width : int
+            Width in pixels to which to constrain the video in HTML.
+            If not supplied, defaults to the width of the video.
+
+        height : int
+            Height in pixels to which to constrain the video in html.
+            If not supplied, defaults to the height of the video.
+
+        html_attributes : str
+            Attributes for the HTML ``<video>`` block.
+            Default: ``"controls"`` to get video controls.
+            Other examples: ``"controls muted"`` for muted video with controls,
+            ``"loop autoplay"`` for looping autoplaying video without controls.
+
+        Examples
+        --------
+        ::
+
+            Video('https://archive.org/download/Sita_Sings_the_Blues/Sita_Sings_the_Blues_small.mp4')
+            Video('path/to/video.mp4')
+            Video('path/to/video.mp4', embed=True)
+            Video('path/to/video.mp4', embed=True, html_attributes="controls muted autoplay")
+            Video(b'raw-videodata', embed=True)
+        """
+        if isinstance(data, (Path, PurePath)):
+            data = str(data)
+
+        if url is None and isinstance(data, str) and data.startswith(('http:', 'https:')):
+            url = data
+            data = None
+        elif data is not None and os.path.exists(data):
+            filename = data
+            data = None
+
+        if data and not embed:
+            msg = ''.join([
+                "To embed videos, you must pass embed=True ",
+                "(this may make your notebook files huge)\n",
+                "Consider passing Video(url='...')",
+            ])
+            raise ValueError(msg)
+
+        self.mimetype = mimetype
+        self.embed = embed
+        self.width = width
+        self.height = height
+        self.html_attributes = html_attributes
+        super(Video, self).__init__(data=data, url=url, filename=filename)
+
+    def _repr_html_(self):
+        width = height = ''
+        if self.width:
+            width = ' width="%d"' % self.width
+        if self.height:
+            height = ' height="%d"' % self.height
+
+        # External URLs and potentially local files are not embedded into the
+        # notebook output.
+        if not self.embed:
+            url = self.url if self.url is not None else self.filename
+            output = """<video src="{0}" {1} {2} {3}>
+      Your browser does not support the <code>video</code> element.
+    </video>""".format(url, self.html_attributes, width, height)
+            return output
+
+        # Embedded videos are base64-encoded.
+        mimetype = self.mimetype
+        if self.filename is not None:
+            if not mimetype:
+                mimetype, _ = mimetypes.guess_type(self.filename)
+
+            with open(self.filename, 'rb') as f:
+                video = f.read()
+        else:
+            video = self.data
+        if isinstance(video, str):
+            # unicode input is already b64-encoded
+            b64_video = video
+        else:
+            b64_video = b2a_base64(video, newline=False).decode("ascii").rstrip()
+
+        output = """<video {0} {1} {2}>
+ <source src="data:{3};base64,{4}" type="{3}">
+ Your browser does not support the video tag.
+ </video>""".format(self.html_attributes, width, height, mimetype, b64_video)
+        return output
+
+    def reload(self):
+        # TODO
+        pass

temp_venv/lib/python3.13/site-packages/IPython/core/display_functions.py

@@ -0,0 +1,371 @@
+"""Top-level display functions for displaying object in different formats."""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+
+from binascii import b2a_hex
+import os
+import sys
+import warnings
+
+__all__ = ['display', 'clear_output', 'publish_display_data', 'update_display', 'DisplayHandle']
+
+#-----------------------------------------------------------------------------
+# utility functions
+#-----------------------------------------------------------------------------
+
+
+def _merge(d1, d2):
+    """Like update, but merges sub-dicts instead of clobbering at the top level.
+
+    Updates d1 in-place
+    """
+
+    if not isinstance(d2, dict) or not isinstance(d1, dict):
+        return d2
+    for key, value in d2.items():
+        d1[key] = _merge(d1.get(key), value)
+    return d1
+
+
+#-----------------------------------------------------------------------------
+# Main functions
+#-----------------------------------------------------------------------------
+
+# use * to indicate transient is keyword-only
+def publish_display_data(data, metadata=None, *, transient=None, **kwargs):
+    """Publish data and metadata to all frontends.
+
+    See the ``display_data`` message in the messaging documentation for
+    more details about this message type.
+
+    Keys of data and metadata can be any mime-type.
+
+    Parameters
+    ----------
+    data : dict
+        A dictionary having keys that are valid MIME types (like
+        'text/plain' or 'image/svg+xml') and values that are the data for
+        that MIME type. The data itself must be a JSON'able data
+        structure. Minimally all data should have the 'text/plain' data,
+        which can be displayed by all frontends. If more than the plain
+        text is given, it is up to the frontend to decide which
+        representation to use.
+    metadata : dict
+        A dictionary for metadata related to the data. This can contain
+        arbitrary key, value pairs that frontends can use to interpret
+        the data. mime-type keys matching those in data can be used
+        to specify metadata about particular representations.
+    transient : dict, keyword-only
+        A dictionary of transient data, such as display_id.
+    """
+    from IPython.core.interactiveshell import InteractiveShell
+
+    display_pub = InteractiveShell.instance().display_pub
+
+    # only pass transient if supplied,
+    # to avoid errors with older ipykernel.
+    # TODO: We could check for ipykernel version and provide a detailed upgrade message.
+    if transient:
+        kwargs['transient'] = transient
+
+    display_pub.publish(
+        data=data,
+        metadata=metadata,
+        **kwargs
+    )
+
+
+def _new_id():
+    """Generate a new random text id with urandom"""
+    return b2a_hex(os.urandom(16)).decode('ascii')
+
+
+def display(
+    *objs,
+    include=None,
+    exclude=None,
+    metadata=None,
+    transient=None,
+    display_id=None,
+    raw=False,
+    clear=False,
+    **kwargs,
+):
+    """Display a Python object in all frontends.
+
+    By default all representations will be computed and sent to the frontends.
+    Frontends can decide which representation is used and how.
+
+    In terminal IPython this will be similar to using :func:`print`, for use in richer
+    frontends see Jupyter notebook examples with rich display logic.
+
+    Parameters
+    ----------
+    *objs : object
+        The Python objects to display.
+    raw : bool, optional
+        Are the objects to be displayed already mimetype-keyed dicts of raw display data,
+        or Python objects that need to be formatted before display? [default: False]
+    include : list, tuple or set, optional
+        A list of format type strings (MIME types) to include in the
+        format data dict. If this is set *only* the format types included
+        in this list will be computed.
+    exclude : list, tuple or set, optional
+        A list of format type strings (MIME types) to exclude in the format
+        data dict. If this is set all format types will be computed,
+        except for those included in this argument.
+    metadata : dict, optional
+        A dictionary of metadata to associate with the output.
+        mime-type keys in this dictionary will be associated with the individual
+        representation formats, if they exist.
+    transient : dict, optional
+        A dictionary of transient data to associate with the output.
+        Data in this dict should not be persisted to files (e.g. notebooks).
+    display_id : str, bool optional
+        Set an id for the display.
+        This id can be used for updating this display area later via update_display.
+        If given as `True`, generate a new `display_id`
+    clear : bool, optional
+        Should the output area be cleared before displaying anything? If True,
+        this will wait for additional output before clearing. [default: False]
+    **kwargs : additional keyword-args, optional
+        Additional keyword-arguments are passed through to the display publisher.
+
+    Returns
+    -------
+    handle: DisplayHandle
+        Returns a handle on updatable displays for use with :func:`update_display`,
+        if `display_id` is given. Returns :any:`None` if no `display_id` is given
+        (default).
+
+    Examples
+    --------
+    >>> class Json(object):
+    ...     def __init__(self, json):
+    ...         self.json = json
+    ...     def _repr_pretty_(self, pp, cycle):
+    ...         import json
+    ...         pp.text(json.dumps(self.json, indent=2))
+    ...     def __repr__(self):
+    ...         return str(self.json)
+    ...
+
+    >>> d = Json({1:2, 3: {4:5}})
+
+    >>> print(d)
+    {1: 2, 3: {4: 5}}
+
+    >>> display(d)
+    {
+      "1": 2,
+      "3": {
+        "4": 5
+      }
+    }
+
+    >>> def int_formatter(integer, pp, cycle):
+    ...     pp.text('I'*integer)
+
+    >>> plain = get_ipython().display_formatter.formatters['text/plain']
+    >>> plain.for_type(int, int_formatter)
+    <function _repr_pprint at 0x...>
+    >>> display(7-5)
+    II
+
+    >>> del plain.type_printers[int]
+    >>> display(7-5)
+    2
+
+    See Also
+    --------
+    :func:`update_display`
+
+    Notes
+    -----
+    In Python, objects can declare their textual representation using the
+    `__repr__` method. IPython expands on this idea and allows objects to declare
+    other, rich representations including:
+
+      - HTML
+      - JSON
+      - PNG
+      - JPEG
+      - SVG
+      - LaTeX
+
+    A single object can declare some or all of these representations; all are
+    handled by IPython's display system.
+
+    The main idea of the first approach is that you have to implement special
+    display methods when you define your class, one for each representation you
+    want to use. Here is a list of the names of the special methods and the
+    values they must return:
+
+      - `_repr_html_`: return raw HTML as a string, or a tuple (see below).
+      - `_repr_json_`: return a JSONable dict, or a tuple (see below).
+      - `_repr_jpeg_`: return raw JPEG data, or a tuple (see below).
+      - `_repr_png_`: return raw PNG data, or a tuple (see below).
+      - `_repr_svg_`: return raw SVG data as a string, or a tuple (see below).
+      - `_repr_latex_`: return LaTeX commands in a string surrounded by "$",
+                        or a tuple (see below).
+      - `_repr_mimebundle_`: return a full mimebundle containing the mapping
+                             from all mimetypes to data.
+                             Use this for any mime-type not listed above.
+
+    The above functions may also return the object's metadata alonside the
+    data.  If the metadata is available, the functions will return a tuple
+    containing the data and metadata, in that order.  If there is no metadata
+    available, then the functions will return the data only.
+
+    When you are directly writing your own classes, you can adapt them for
+    display in IPython by following the above approach. But in practice, you
+    often need to work with existing classes that you can't easily modify.
+
+    You can refer to the documentation on integrating with the display system in
+    order to register custom formatters for already existing types
+    (:ref:`integrating_rich_display`).
+
+    .. versionadded:: 5.4 display available without import
+    .. versionadded:: 6.1 display available without import
+
+    Since IPython 5.4 and 6.1 :func:`display` is automatically made available to
+    the user without import. If you are using display in a document that might
+    be used in a pure python context or with older version of IPython, use the
+    following import at the top of your file::
+
+        from IPython.display import display
+
+    """
+    from IPython.core.interactiveshell import InteractiveShell
+
+    if not InteractiveShell.initialized():
+        # Directly print objects.
+        print(*objs)
+        return
+
+    if transient is None:
+        transient = {}
+    if metadata is None:
+        metadata={}
+    if display_id:
+        if display_id is True:
+            display_id = _new_id()
+        transient['display_id'] = display_id
+    if kwargs.get('update') and 'display_id' not in transient:
+        raise TypeError('display_id required for update_display')
+    if transient:
+        kwargs['transient'] = transient
+
+    if not objs and display_id:
+        # if given no objects, but still a request for a display_id,
+        # we assume the user wants to insert an empty output that
+        # can be updated later
+        objs = [{}]
+        raw = True
+
+    if not raw:
+        format = InteractiveShell.instance().display_formatter.format
+
+    if clear:
+        clear_output(wait=True)
+
+    for obj in objs:
+        if raw:
+            publish_display_data(data=obj, metadata=metadata, **kwargs)
+        else:
+            format_dict, md_dict = format(obj, include=include, exclude=exclude)
+            if not format_dict:
+                # nothing to display (e.g. _ipython_display_ took over)
+                continue
+            if metadata:
+                # kwarg-specified metadata gets precedence
+                _merge(md_dict, metadata)
+            publish_display_data(data=format_dict, metadata=md_dict, **kwargs)
+    if display_id:
+        return DisplayHandle(display_id)
+
+
+# use * for keyword-only display_id arg
+def update_display(obj, *, display_id, **kwargs):
+    """Update an existing display by id
+
+    Parameters
+    ----------
+    obj
+        The object with which to update the display
+    display_id : keyword-only
+        The id of the display to update
+
+    See Also
+    --------
+    :func:`display`
+    """
+    kwargs['update'] = True
+    display(obj, display_id=display_id, **kwargs)
+
+
+class DisplayHandle:
+    """A handle on an updatable display
+
+    Call `.update(obj)` to display a new object.
+
+    Call `.display(obj`) to add a new instance of this display,
+    and update existing instances.
+
+    See Also
+    --------
+
+        :func:`display`, :func:`update_display`
+
+    """
+
+    def __init__(self, display_id=None):
+        if display_id is None:
+            display_id = _new_id()
+        self.display_id = display_id
+
+    def __repr__(self):
+        return "<%s display_id=%s>" % (self.__class__.__name__, self.display_id)
+
+    def display(self, obj, **kwargs):
+        """Make a new display with my id, updating existing instances.
+
+        Parameters
+        ----------
+        obj
+            object to display
+        **kwargs
+            additional keyword arguments passed to display
+        """
+        display(obj, display_id=self.display_id, **kwargs)
+
+    def update(self, obj, **kwargs):
+        """Update existing displays with my id
+
+        Parameters
+        ----------
+        obj
+            object to display
+        **kwargs
+            additional keyword arguments passed to update_display
+        """
+        update_display(obj, display_id=self.display_id, **kwargs)
+
+
+def clear_output(wait=False):
+    """Clear the output of the current cell receiving output.
+
+    Parameters
+    ----------
+    wait : bool [default: false]
+        Wait to clear the output until new output is available to replace it."""
+    from IPython.core.interactiveshell import InteractiveShell
+    if InteractiveShell.initialized():
+        InteractiveShell.instance().display_pub.clear_output(wait)
+    else:
+        print('\033[2K\r', end='')
+        sys.stdout.flush()
+        print('\033[2K\r', end='')
+        sys.stderr.flush()

temp_venv/lib/python3.13/site-packages/IPython/core/displayhook.py

@@ -0,0 +1,346 @@
+# -*- coding: utf-8 -*-
+"""Displayhook for IPython.
+
+This defines a callable class that IPython uses for `sys.displayhook`.
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import builtins as builtin_mod
+import sys
+import io as _io
+import tokenize
+
+from traitlets.config.configurable import Configurable
+from traitlets import Instance, Float
+from warnings import warn
+
+from .history import HistoryOutput
+
+# TODO: Move the various attributes (cache_size, [others now moved]). Some
+# of these are also attributes of InteractiveShell. They should be on ONE object
+# only and the other objects should ask that one object for their values.
+
+class DisplayHook(Configurable):
+    """The custom IPython displayhook to replace sys.displayhook.
+
+    This class does many things, but the basic idea is that it is a callable
+    that gets called anytime user code returns a value.
+    """
+
+    shell = Instance('IPython.core.interactiveshell.InteractiveShellABC',
+                     allow_none=True)
+    exec_result = Instance('IPython.core.interactiveshell.ExecutionResult',
+                           allow_none=True)
+    cull_fraction = Float(0.2)
+
+    def __init__(self, shell=None, cache_size=1000, **kwargs):
+        super(DisplayHook, self).__init__(shell=shell, **kwargs)
+        self._is_active = False
+        cache_size_min = 3
+        if cache_size <= 0:
+            self.do_full_cache = 0
+            cache_size = 0
+        elif cache_size < cache_size_min:
+            self.do_full_cache = 0
+            cache_size = 0
+            warn('caching was disabled (min value for cache size is %s).' %
+                 cache_size_min,stacklevel=3)
+        else:
+            self.do_full_cache = 1
+
+        self.cache_size = cache_size
+
+        # we need a reference to the user-level namespace
+        self.shell = shell
+
+        self._,self.__,self.___ = '','',''
+
+        # these are deliberately global:
+        to_user_ns = {'_':self._,'__':self.__,'___':self.___}
+        self.shell.user_ns.update(to_user_ns)
+
+    @property
+    def prompt_count(self):
+        return self.shell.execution_count
+
+    #-------------------------------------------------------------------------
+    # Methods used in __call__. Override these methods to modify the behavior
+    # of the displayhook.
+    #-------------------------------------------------------------------------
+
+    def check_for_underscore(self):
+        """Check if the user has set the '_' variable by hand."""
+        # If something injected a '_' variable in __builtin__, delete
+        # ipython's automatic one so we don't clobber that.  gettext() in
+        # particular uses _, so we need to stay away from it.
+        if '_' in builtin_mod.__dict__:
+            try:
+                user_value = self.shell.user_ns['_']
+                if user_value is not self._:
+                    return
+                del self.shell.user_ns['_']
+            except KeyError:
+                pass
+
+    def quiet(self):
+        """Should we silence the display hook because of ';'?"""
+        # do not print output if input ends in ';'
+
+        try:
+            cell = self.shell.history_manager.input_hist_parsed[-1]
+        except IndexError:
+            # some uses of ipshellembed may fail here
+            return False
+
+        return self.semicolon_at_end_of_expression(cell)
+
+    @staticmethod
+    def semicolon_at_end_of_expression(expression):
+        """Parse Python expression and detects whether last token is ';'"""
+
+        sio = _io.StringIO(expression)
+        tokens = list(tokenize.generate_tokens(sio.readline))
+
+        for token in reversed(tokens):
+            if token[0] in (tokenize.ENDMARKER, tokenize.NL, tokenize.NEWLINE, tokenize.COMMENT):
+                continue
+            if (token[0] == tokenize.OP) and (token[1] == ';'):
+                return True
+            else:
+                return False
+
+    def start_displayhook(self):
+        """Start the displayhook, initializing resources."""
+        self._is_active = True
+
+    @property
+    def is_active(self):
+        return self._is_active
+
+    def write_output_prompt(self):
+        """Write the output prompt.
+
+        The default implementation simply writes the prompt to
+        ``sys.stdout``.
+        """
+        # Use write, not print which adds an extra space.
+        sys.stdout.write(self.shell.separate_out)
+        outprompt = 'Out[{}]: '.format(self.shell.execution_count)
+        if self.do_full_cache:
+            sys.stdout.write(outprompt)
+
+    def compute_format_data(self, result):
+        """Compute format data of the object to be displayed.
+
+        The format data is a generalization of the :func:`repr` of an object.
+        In the default implementation the format data is a :class:`dict` of
+        key value pair where the keys are valid MIME types and the values
+        are JSON'able data structure containing the raw data for that MIME
+        type. It is up to frontends to determine pick a MIME to to use and
+        display that data in an appropriate manner.
+
+        This method only computes the format data for the object and should
+        NOT actually print or write that to a stream.
+
+        Parameters
+        ----------
+        result : object
+            The Python object passed to the display hook, whose format will be
+            computed.
+
+        Returns
+        -------
+        (format_dict, md_dict) : dict
+            format_dict is a :class:`dict` whose keys are valid MIME types and values are
+            JSON'able raw data for that MIME type. It is recommended that
+            all return values of this should always include the "text/plain"
+            MIME type representation of the object.
+            md_dict is a :class:`dict` with the same MIME type keys
+            of metadata associated with each output.
+
+        """
+        return self.shell.display_formatter.format(result)
+
+    # This can be set to True by the write_output_prompt method in a subclass
+    prompt_end_newline = False
+
+    def write_format_data(self, format_dict, md_dict=None) -> None:
+        """Write the format data dict to the frontend.
+
+        This default version of this method simply writes the plain text
+        representation of the object to ``sys.stdout``. Subclasses should
+        override this method to send the entire `format_dict` to the
+        frontends.
+
+        Parameters
+        ----------
+        format_dict : dict
+            The format dict for the object passed to `sys.displayhook`.
+        md_dict : dict (optional)
+            The metadata dict to be associated with the display data.
+        """
+        if 'text/plain' not in format_dict:
+            # nothing to do
+            return
+        # We want to print because we want to always make sure we have a
+        # newline, even if all the prompt separators are ''. This is the
+        # standard IPython behavior.
+        result_repr = format_dict['text/plain']
+        if '\n' in result_repr:
+            # So that multi-line strings line up with the left column of
+            # the screen, instead of having the output prompt mess up
+            # their first line.
+            # We use the prompt template instead of the expanded prompt
+            # because the expansion may add ANSI escapes that will interfere
+            # with our ability to determine whether or not we should add
+            # a newline.
+            if not self.prompt_end_newline:
+                # But avoid extraneous empty lines.
+                result_repr = '\n' + result_repr
+
+        try:
+            print(result_repr)
+        except UnicodeEncodeError:
+            # If a character is not supported by the terminal encoding replace
+            # it with its \u or \x representation
+            print(result_repr.encode(sys.stdout.encoding,'backslashreplace').decode(sys.stdout.encoding))
+
+    def update_user_ns(self, result):
+        """Update user_ns with various things like _, __, _1, etc."""
+
+        # Avoid recursive reference when displaying _oh/Out
+        if self.cache_size and result is not self.shell.user_ns['_oh']:
+            if len(self.shell.user_ns['_oh']) >= self.cache_size and self.do_full_cache:
+                self.cull_cache()
+
+            # Don't overwrite '_' and friends if '_' is in __builtin__
+            # (otherwise we cause buggy behavior for things like gettext). and
+            # do not overwrite _, __ or ___ if one of these has been assigned
+            # by the user.
+            update_unders = True
+            for unders in ['_'*i for i in range(1,4)]:
+                if unders not in self.shell.user_ns:
+                    continue
+                if getattr(self, unders) is not self.shell.user_ns.get(unders):
+                    update_unders = False
+
+            self.___ = self.__
+            self.__ = self._
+            self._ = result
+
+            if ('_' not in builtin_mod.__dict__) and (update_unders):
+                self.shell.push({'_':self._,
+                                 '__':self.__,
+                                '___':self.___}, interactive=False)
+
+            # hackish access to top-level  namespace to create _1,_2... dynamically
+            to_main = {}
+            if self.do_full_cache:
+                new_result = '_%s' % self.prompt_count
+                to_main[new_result] = result
+                self.shell.push(to_main, interactive=False)
+                self.shell.user_ns['_oh'][self.prompt_count] = result
+
+    def fill_exec_result(self, result):
+        if self.exec_result is not None:
+            self.exec_result.result = result
+
+    def log_output(self, format_dict):
+        """Log the output."""
+        self.shell.history_manager.outputs[self.prompt_count].append(
+            HistoryOutput(output_type="execute_result", bundle=format_dict)
+        )
+        if "text/plain" not in format_dict:
+            # nothing to do
+            return
+        if self.shell.logger.log_output:
+            self.shell.logger.log_write(format_dict['text/plain'], 'output')
+        self.shell.history_manager.output_hist_reprs[self.prompt_count] = \
+                                                    format_dict['text/plain']
+
+    def finish_displayhook(self):
+        """Finish up all displayhook activities."""
+        sys.stdout.write(self.shell.separate_out2)
+        sys.stdout.flush()
+        self._is_active = False
+
+    def __call__(self, result=None):
+        """Printing with history cache management.
+
+        This is invoked every time the interpreter needs to print, and is
+        activated by setting the variable sys.displayhook to it.
+        """
+        self.check_for_underscore()
+        if result is not None and not self.quiet():
+            self.start_displayhook()
+            self.write_output_prompt()
+            format_dict, md_dict = self.compute_format_data(result)
+            self.update_user_ns(result)
+            self.fill_exec_result(result)
+            if format_dict:
+                self.write_format_data(format_dict, md_dict)
+                self.log_output(format_dict)
+            self.finish_displayhook()
+
+    def cull_cache(self):
+        """Output cache is full, cull the oldest entries"""
+        oh = self.shell.user_ns.get('_oh', {})
+        sz = len(oh)
+        cull_count = max(int(sz * self.cull_fraction), 2)
+        warn('Output cache limit (currently {sz} entries) hit.\n'
+             'Flushing oldest {cull_count} entries.'.format(sz=sz, cull_count=cull_count))
+
+        for i, n in enumerate(sorted(oh)):
+            if i >= cull_count:
+                break
+            self.shell.user_ns.pop('_%i' % n, None)
+            oh.pop(n, None)
+
+    def flush(self):
+        if not self.do_full_cache:
+            raise ValueError("You shouldn't have reached the cache flush "
+                             "if full caching is not enabled!")
+        # delete auto-generated vars from global namespace
+
+        for n in range(1,self.prompt_count + 1):
+            key = '_'+repr(n)
+            try:
+                del self.shell.user_ns_hidden[key]
+            except KeyError:
+                pass
+            try:
+                del self.shell.user_ns[key]
+            except KeyError:
+                pass
+        # In some embedded circumstances, the user_ns doesn't have the
+        # '_oh' key set up.
+        oh = self.shell.user_ns.get('_oh', None)
+        if oh is not None:
+            oh.clear()
+
+        # Release our own references to objects:
+        self._, self.__, self.___ = '', '', ''
+
+        if '_' not in builtin_mod.__dict__:
+            self.shell.user_ns.update({'_':self._,'__':self.__,'___':self.___})
+        import gc
+        # TODO: Is this really needed?
+        # IronPython blocks here forever
+        if sys.platform != "cli":
+            gc.collect()
+
+
+class CapturingDisplayHook:
+    def __init__(self, shell, outputs=None):
+        self.shell = shell
+        if outputs is None:
+            outputs = []
+        self.outputs = outputs
+
+    def __call__(self, result=None):
+        if result is None:
+            return
+        format_dict, md_dict = self.shell.display_formatter.format(result)
+        self.outputs.append({ 'data': format_dict, 'metadata': md_dict })

temp_venv/lib/python3.13/site-packages/IPython/core/displaypub.py

@@ -0,0 +1,183 @@
+"""An interface for publishing rich data to frontends.
+
+There are two components of the display system:
+
+* Display formatters, which take a Python object and compute the
+  representation of the object in various formats (text, HTML, SVG, etc.).
+* The display publisher that is used to send the representation data to the
+  various frontends.
+
+This module defines the logic display publishing. The display publisher uses
+the ``display_data`` message type that is defined in the IPython messaging
+spec.
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import sys
+
+from traitlets.config.configurable import Configurable
+from traitlets import List
+
+# This used to be defined here - it is imported for backwards compatibility
+from .display_functions import publish_display_data
+from .history import HistoryOutput
+
+import typing as t
+
+# -----------------------------------------------------------------------------
+# Main payload class
+# -----------------------------------------------------------------------------
+
+_sentinel = object()
+
+
+class DisplayPublisher(Configurable):
+    """A traited class that publishes display data to frontends.
+
+    Instances of this class are created by the main IPython object and should
+    be accessed there.
+    """
+
+    def __init__(self, shell=None, *args, **kwargs):
+        self.shell = shell
+        self._is_publishing = False
+        super().__init__(*args, **kwargs)
+
+    def _validate_data(self, data, metadata=None):
+        """Validate the display data.
+
+        Parameters
+        ----------
+        data : dict
+            The formata data dictionary.
+        metadata : dict
+            Any metadata for the data.
+        """
+
+        if not isinstance(data, dict):
+            raise TypeError("data must be a dict, got: %r" % data)
+        if metadata is not None:
+            if not isinstance(metadata, dict):
+                raise TypeError("metadata must be a dict, got: %r" % data)
+
+    # use * to indicate transient, update are keyword-only
+    def publish(
+        self,
+        data,
+        metadata=None,
+        source=_sentinel,
+        *,
+        transient=None,
+        update=False,
+        **kwargs,
+    ) -> None:
+        """Publish data and metadata to all frontends.
+
+        See the ``display_data`` message in the messaging documentation for
+        more details about this message type.
+
+        The following MIME types are currently implemented:
+
+        * text/plain
+        * text/html
+        * text/markdown
+        * text/latex
+        * application/json
+        * application/javascript
+        * image/png
+        * image/jpeg
+        * image/svg+xml
+
+        Parameters
+        ----------
+        data : dict
+            A dictionary having keys that are valid MIME types (like
+            'text/plain' or 'image/svg+xml') and values that are the data for
+            that MIME type. The data itself must be a JSON'able data
+            structure. Minimally all data should have the 'text/plain' data,
+            which can be displayed by all frontends. If more than the plain
+            text is given, it is up to the frontend to decide which
+            representation to use.
+        metadata : dict
+            A dictionary for metadata related to the data. This can contain
+            arbitrary key, value pairs that frontends can use to interpret
+            the data.  Metadata specific to each mime-type can be specified
+            in the metadata dict with the same mime-type keys as
+            the data itself.
+        source : str, deprecated
+            Unused.
+        transient : dict, keyword-only
+            A dictionary for transient data.
+            Data in this dictionary should not be persisted as part of saving this output.
+            Examples include 'display_id'.
+        update : bool, keyword-only, default: False
+            If True, only update existing outputs with the same display_id,
+            rather than creating a new output.
+        """
+
+        if source is not _sentinel:
+            import warnings
+
+            warnings.warn(
+                "The 'source' parameter is deprecated since IPython 3.0 and will be ignored "
+                "(this warning is present since 9.0). `source` parameter will be removed in the future.",
+                DeprecationWarning,
+                stacklevel=2,
+            )
+
+        handlers: t.Dict = {}
+        if self.shell is not None:
+            handlers = getattr(self.shell, "mime_renderers", {})
+
+        outputs = self.shell.history_manager.outputs
+
+        outputs[self.shell.execution_count].append(
+            HistoryOutput(output_type="display_data", bundle=data)
+        )
+
+        for mime, handler in handlers.items():
+            if mime in data:
+                handler(data[mime], metadata.get(mime, None))
+                return
+
+        self._is_publishing = True
+        if "text/plain" in data:
+            print(data["text/plain"])
+        self._is_publishing = False
+
+    @property
+    def is_publishing(self):
+        return self._is_publishing
+
+    def clear_output(self, wait=False):
+        """Clear the output of the cell receiving output."""
+        print("\033[2K\r", end="")
+        sys.stdout.flush()
+        print("\033[2K\r", end="")
+        sys.stderr.flush()
+
+
+class CapturingDisplayPublisher(DisplayPublisher):
+    """A DisplayPublisher that stores"""
+
+    outputs: List = List()
+
+    def publish(
+        self, data, metadata=None, source=None, *, transient=None, update=False
+    ):
+        self.outputs.append(
+            {
+                "data": data,
+                "metadata": metadata,
+                "transient": transient,
+                "update": update,
+            }
+        )
+
+    def clear_output(self, wait=False):
+        super(CapturingDisplayPublisher, self).clear_output(wait)
+
+        # empty the list, *do not* reassign a new list
+        self.outputs.clear()

temp_venv/lib/python3.13/site-packages/IPython/core/doctb.py

@@ -0,0 +1,444 @@
+import inspect
+import linecache
+import sys
+from collections.abc import Sequence
+from types import TracebackType
+from typing import Any, Callable, Optional
+
+import stack_data
+from pygments.formatters.terminal256 import Terminal256Formatter
+from pygments.token import Token
+
+from IPython.utils.PyColorize import Theme, TokenStream, theme_table
+from IPython.utils.terminal import get_terminal_size
+
+from .tbtools import (
+    FrameInfo,
+    TBTools,
+    _safe_string,
+    _tokens_filename,
+    eqrepr,
+    get_line_number_of_frame,
+    nullrepr,
+)
+
+INDENT_SIZE = 8
+
+
+def _format_traceback_lines(
+    lines: list[stack_data.Line],
+    theme: Theme,
+    has_colors: bool,
+    lvals_toks: list[TokenStream],
+) -> TokenStream:
+    """
+    Format tracebacks lines with pointing arrow, leading numbers,
+    this assumes the stack have been extracted using stackdata.
+
+
+    Parameters
+    ----------
+    lines : list[Line]
+    """
+    numbers_width = INDENT_SIZE - 1
+    tokens: TokenStream = [(Token, "\n")]
+
+    for stack_line in lines:
+        if stack_line is stack_data.LINE_GAP:
+            toks = [(Token.LinenoEm, "   (...)")]
+            tokens.extend(toks)
+            continue
+
+        lineno = stack_line.lineno
+        line = stack_line.render(pygmented=has_colors).rstrip("\n") + "\n"
+        if stack_line.is_current:
+            # This is the line with the error
+            pad = numbers_width - len(str(lineno))
+            toks = [
+                (Token.Prompt, theme.make_arrow(3)),
+                (Token, " "),
+                (Token, line),
+            ]
+        else:
+            # num = "%*s" % (numbers_width, lineno)
+            toks = [
+                # (Token.LinenoEm, str(num)),
+                (Token, "..."),
+                (Token, " "),
+                (Token, line),
+            ]
+
+        tokens.extend(toks)
+        if lvals_toks and stack_line.is_current:
+            for lv in lvals_toks:
+                tokens.append((Token, " " * INDENT_SIZE))
+                tokens.extend(lv)
+                tokens.append((Token, "\n"))
+            # strip the last newline
+            tokens = tokens[:-1]
+
+    return tokens
+
+
+class DocTB(TBTools):
+    """
+
+    A stripped down version of Verbose TB, simplified to not have too much information when
+    running doctests
+
+    """
+
+    tb_highlight = ""
+    tb_highlight_style = "default"
+    tb_offset: int
+    long_header: bool
+    include_vars: bool
+
+    _mode: str
+
+    def __init__(
+        self,
+        # TODO: no default ?
+        theme_name: str = "linux",
+        call_pdb: bool = False,
+        ostream: Any = None,
+        tb_offset: int = 0,
+        long_header: bool = False,
+        include_vars: bool = True,
+        check_cache: Callable[[], None] | None = None,
+        debugger_cls: type | None = None,
+    ):
+        """Specify traceback offset, headers and color scheme.
+
+        Define how many frames to drop from the tracebacks. Calling it with
+        tb_offset=1 allows use of this handler in interpreters which will have
+        their own code at the top of the traceback (VerboseTB will first
+        remove that frame before printing the traceback info)."""
+        assert isinstance(theme_name, str)
+        super().__init__(
+            theme_name=theme_name,
+            call_pdb=call_pdb,
+            ostream=ostream,
+            debugger_cls=debugger_cls,
+        )
+        self.tb_offset = tb_offset
+        self.long_header = long_header
+        self.include_vars = include_vars
+        # By default we use linecache.checkcache, but the user can provide a
+        # different check_cache implementation.  This was formerly used by the
+        # IPython kernel for interactive code, but is no longer necessary.
+        if check_cache is None:
+            check_cache = linecache.checkcache
+        self.check_cache = check_cache
+
+        self.skip_hidden = True
+
+    def format_record(self, frame_info: FrameInfo) -> str:
+        """Format a single stack frame"""
+        assert isinstance(frame_info, FrameInfo)
+
+        if isinstance(frame_info._sd, stack_data.RepeatedFrames):
+            return theme_table[self._theme_name].format(
+                [
+                    (Token, "    "),
+                    (
+                        Token.ExcName,
+                        "[... skipping similar frames: %s]" % frame_info.description,
+                    ),
+                    (Token, "\n"),
+                ]
+            )
+
+        indent: str = " " * INDENT_SIZE
+
+        assert isinstance(frame_info.lineno, int)
+        args, varargs, varkw, locals_ = inspect.getargvalues(frame_info.frame)
+        if frame_info.executing is not None:
+            func = frame_info.executing.code_qualname()
+        else:
+            func = "?"
+        if func == "<module>":
+            call = ""
+        else:
+            # Decide whether to include variable details or not
+            var_repr = eqrepr if self.include_vars else nullrepr
+            try:
+                scope = inspect.formatargvalues(
+                    args, varargs, varkw, locals_, formatvalue=var_repr
+                )
+                assert isinstance(scope, str)
+                call = theme_table[self._theme_name].format(
+                    [(Token, "in "), (Token.VName, func), (Token.ValEm, scope)]
+                )
+            except KeyError:
+                # This happens in situations like errors inside generator
+                # expressions, where local variables are listed in the
+                # line, but can't be extracted from the frame.  I'm not
+                # 100% sure this isn't actually a bug in inspect itself,
+                # but since there's no info for us to compute with, the
+                # best we can do is report the failure and move on.  Here
+                # we must *not* call any traceback construction again,
+                # because that would mess up use of %debug later on.  So we
+                # simply report the failure and move on.  The only
+                # limitation will be that this frame won't have locals
+                # listed in the call signature.  Quite subtle problem...
+                # I can't think of a good way to validate this in a unit
+                # test, but running a script consisting of:
+                #  dict( (k,v.strip()) for (k,v) in range(10) )
+                # will illustrate the error, if this exception catch is
+                # disabled.
+                call = theme_table[self._theme_name].format(
+                    [
+                        (Token, "in "),
+                        (Token.VName, func),
+                        (Token.ValEm, "(***failed resolving arguments***)"),
+                    ]
+                )
+
+        lvals_toks: list[TokenStream] = []
+        if self.include_vars:
+            try:
+                # we likely want to fix stackdata at some point, but
+                # still need a workaround.
+                fibp = frame_info.variables_in_executing_piece
+                for var in fibp:
+                    lvals_toks.append(
+                        [
+                            (Token, var.name),
+                            (Token, " "),
+                            (Token.ValEm, "= "),
+                            (Token.ValEm, repr(var.value)),
+                        ]
+                    )
+            except Exception:
+                lvals_toks.append(
+                    [
+                        (
+                            Token,
+                            "Exception trying to inspect frame. No more locals available.",
+                        ),
+                    ]
+                )
+
+        assert frame_info._sd is not None
+        result = theme_table[self._theme_name].format(
+            _tokens_filename(True, frame_info.filename, lineno=frame_info.lineno)
+        )
+        result += ", " if call else ""
+        result += f"{call}\n"
+        result += theme_table[self._theme_name].format(
+            _format_traceback_lines(
+                frame_info.lines,
+                theme_table[self._theme_name],
+                self.has_colors,
+                lvals_toks,
+            )
+        )
+        return result
+
+    def prepare_header(self, etype: str) -> str:
+        width = min(75, get_terminal_size()[0])
+        head = theme_table[self._theme_name].format(
+            [
+                (
+                    Token,
+                    "Traceback (most recent call last):",
+                ),
+                (Token, " "),
+            ]
+        )
+
+        return head
+
+    def format_exception(self, etype: Any, evalue: Any) -> Any:
+        # Get (safely) a string form of the exception info
+        try:
+            etype_str, evalue_str = map(str, (etype, evalue))
+        except:
+            # User exception is improperly defined.
+            etype, evalue = str, sys.exc_info()[:2]
+            etype_str, evalue_str = map(str, (etype, evalue))
+
+        # PEP-678 notes
+        notes = getattr(evalue, "__notes__", [])
+        if not isinstance(notes, Sequence) or isinstance(notes, (str, bytes)):
+            notes = [_safe_string(notes, "__notes__", func=repr)]
+
+        # ... and format it
+        return [
+            theme_table[self._theme_name].format(
+                [(Token.ExcName, etype_str), (Token, ": "), (Token, evalue_str)]
+            ),
+            *(
+                theme_table[self._theme_name].format([(Token, _safe_string(n, "note"))])
+                for n in notes
+            ),
+        ]
+
+    def format_exception_as_a_whole(
+        self,
+        etype: type,
+        evalue: Optional[BaseException],
+        etb: Optional[TracebackType],
+        context: int,
+        tb_offset: Optional[int],
+    ) -> list[list[str]]:
+        """Formats the header, traceback and exception message for a single exception.
+
+        This may be called multiple times by Python 3 exception chaining
+        (PEP 3134).
+        """
+        # some locals
+        orig_etype = etype
+        try:
+            etype = etype.__name__  # type: ignore[assignment]
+        except AttributeError:
+            pass
+
+        tb_offset = self.tb_offset if tb_offset is None else tb_offset
+        assert isinstance(tb_offset, int)
+        head = self.prepare_header(str(etype))
+        assert context == 1, context
+        records = self.get_records(etb, context, tb_offset) if etb else []
+
+        frames = []
+        skipped = 0
+        nskipped = len(records) - 1
+        frames.append(self.format_record(records[0]))
+        if nskipped:
+            frames.append(
+                theme_table[self._theme_name].format(
+                    [
+                        (Token, "\n"),
+                        (Token, "    "),
+                        (Token, "[... %s skipped frames]" % nskipped),
+                        (Token, "\n"),
+                        (Token, "\n"),
+                    ]
+                )
+            )
+
+        formatted_exception = self.format_exception(etype, evalue)
+        return [[head] + frames + formatted_exception]
+
+    def get_records(self, etb: TracebackType, context: int, tb_offset: int) -> Any:
+        assert context == 1, context
+        assert etb is not None
+        context = context - 1
+        after = context // 2
+        before = context - after
+        if self.has_colors:
+            base_style = theme_table[self._theme_name].as_pygments_style()
+            style = stack_data.style_with_executing_node(base_style, self.tb_highlight)
+            formatter = Terminal256Formatter(style=style)
+        else:
+            formatter = None
+        options = stack_data.Options(
+            before=before,
+            after=after,
+            pygments_formatter=formatter,
+        )
+
+        # Let's estimate the amount of code we will have to parse/highlight.
+        cf: Optional[TracebackType] = etb
+        max_len = 0
+        tbs = []
+        while cf is not None:
+            try:
+                mod = inspect.getmodule(cf.tb_frame)
+                if mod is not None:
+                    mod_name = mod.__name__
+                    root_name, *_ = mod_name.split(".")
+                    if root_name == "IPython":
+                        cf = cf.tb_next
+                        continue
+                max_len = get_line_number_of_frame(cf.tb_frame)
+
+            except OSError:
+                max_len = 0
+            max_len = max(max_len, max_len)
+            tbs.append(cf)
+            cf = getattr(cf, "tb_next", None)
+
+        res = list(stack_data.FrameInfo.stack_data(etb, options=options))[tb_offset:]
+        res2 = [FrameInfo._from_stack_data_FrameInfo(r) for r in res]
+        return res2
+
+    def structured_traceback(
+        self,
+        etype: type,
+        evalue: Optional[BaseException],
+        etb: Optional[TracebackType] = None,
+        tb_offset: Optional[int] = None,
+        context: int = 1,
+    ) -> list[str]:
+        """Return a nice text document describing the traceback."""
+        assert context > 0
+        assert context == 1, context
+        formatted_exceptions: list[list[str]] = self.format_exception_as_a_whole(
+            etype, evalue, etb, context, tb_offset
+        )
+
+        termsize = min(75, get_terminal_size()[0])
+        theme = theme_table[self._theme_name]
+        structured_traceback_parts: list[str] = []
+        chained_exceptions_tb_offset = 0
+        lines_of_context = 3
+        exception = self.get_parts_of_chained_exception(evalue)
+        if exception:
+            assert evalue is not None
+            formatted_exceptions += self.prepare_chained_exception_message(
+                evalue.__cause__
+            )
+            etype, evalue, etb = exception
+        else:
+            evalue = None
+        chained_exc_ids = set()
+        while evalue:
+            formatted_exceptions += self.format_exception_as_a_whole(
+                etype, evalue, etb, lines_of_context, chained_exceptions_tb_offset
+            )
+            exception = self.get_parts_of_chained_exception(evalue)
+
+            if exception and id(exception[1]) not in chained_exc_ids:
+                chained_exc_ids.add(
+                    id(exception[1])
+                )  # trace exception to avoid infinite 'cause' loop
+                formatted_exceptions += self.prepare_chained_exception_message(
+                    evalue.__cause__
+                )
+                etype, evalue, etb = exception
+            else:
+                evalue = None
+
+        # we want to see exceptions in a reversed order:
+        # the first exception should be on top
+        for fx in reversed(formatted_exceptions):
+            structured_traceback_parts += fx
+
+        return structured_traceback_parts
+
+    def debugger(self, force: bool = False) -> None:
+        raise RuntimeError("canot rundebugger in Docs mode")
+
+    def handler(self, info: tuple[Any, Any, Any] | None = None) -> None:
+        (etype, evalue, etb) = info or sys.exc_info()
+        self.tb = etb
+        ostream = self.ostream
+        ostream.flush()
+        ostream.write(self.text(etype, evalue, etb))  # type:ignore[arg-type]
+        ostream.write("\n")
+        ostream.flush()
+
+    # Changed so an instance can just be called as VerboseTB_inst() and print
+    # out the right info on its own.
+    def __call__(self, etype: Any = None, evalue: Any = None, etb: Any = None) -> None:
+        """This hook can replace sys.excepthook (for Python 2.1 or higher)."""
+        if etb is None:
+            self.handler()
+        else:
+            self.handler((etype, evalue, etb))
+        try:
+            self.debugger()
+        except KeyboardInterrupt:
+            print("\nKeyboardInterrupt")

temp_venv/lib/python3.13/site-packages/IPython/core/events.py

@@ -0,0 +1,158 @@
+"""Infrastructure for registering and firing callbacks on application events.
+
+Unlike :mod:`IPython.core.hooks`, which lets end users set single functions to
+be called at specific times, or a collection of alternative methods to try,
+callbacks are designed to be used by extension authors. A number of callbacks
+can be registered for the same event without needing to be aware of one another.
+
+The functions defined in this module are no-ops indicating the names of available
+events and the arguments which will be passed to them.
+
+.. note::
+
+   This API is experimental in IPython 2.0, and may be revised in future versions.
+"""
+
+
+class EventManager:
+    """Manage a collection of events and a sequence of callbacks for each.
+    
+    This is attached to :class:`~IPython.core.interactiveshell.InteractiveShell`
+    instances as an ``events`` attribute.
+    
+    .. note::
+
+       This API is experimental in IPython 2.0, and may be revised in future versions.
+    """
+
+    def __init__(self, shell, available_events, print_on_error=True):
+        """Initialise the :class:`CallbackManager`.
+
+        Parameters
+        ----------
+        shell
+            The :class:`~IPython.core.interactiveshell.InteractiveShell` instance
+        available_events
+            An iterable of names for callback events.
+        print_on_error:
+            A boolean flag to set whether the EventManager will print a warning which a event errors.
+        """
+        self.shell = shell
+        self.callbacks = {n:[] for n in available_events}
+        self.print_on_error = print_on_error
+    
+    def register(self, event, function):
+        """Register a new event callback.
+
+        Parameters
+        ----------
+        event : str
+            The event for which to register this callback.
+        function : callable
+            A function to be called on the given event. It should take the same
+            parameters as the appropriate callback prototype.
+
+        Raises
+        ------
+        TypeError
+            If ``function`` is not callable.
+        KeyError
+            If ``event`` is not one of the known events.
+        """
+        if not callable(function):
+            raise TypeError('Need a callable, got %r' % function)
+        if function not in self.callbacks[event]:
+            self.callbacks[event].append(function)
+    
+    def unregister(self, event, function):
+        """Remove a callback from the given event."""
+        if function in self.callbacks[event]:
+            return self.callbacks[event].remove(function)
+
+        raise ValueError('Function {!r} is not registered as a {} callback'.format(function, event))
+
+    def trigger(self, event, *args, **kwargs):
+        """Call callbacks for ``event``.
+
+        Any additional arguments are passed to all callbacks registered for this
+        event. Exceptions raised by callbacks are caught, and a message printed.
+        """
+        for func in self.callbacks[event][:]:
+            try:
+                func(*args, **kwargs)
+            except (Exception, KeyboardInterrupt):
+                if self.print_on_error:
+                    print(
+                        "Error in callback {} (for {}), with arguments args {},kwargs {}:".format(
+                            func, event, args, kwargs
+                        )
+                    )
+                self.shell.showtraceback()
+
+# event_name -> prototype mapping
+available_events = {}
+
+def _define_event(callback_function):
+    available_events[callback_function.__name__] = callback_function
+    return callback_function
+
+# ------------------------------------------------------------------------------
+# Callback prototypes
+#
+# No-op functions which describe the names of available events and the
+# signatures of callbacks for those events.
+# ------------------------------------------------------------------------------
+
+@_define_event
+def pre_execute():
+    """Fires before code is executed in response to user/frontend action.
+
+    This includes comm and widget messages and silent execution, as well as user
+    code cells.
+    """
+    pass
+
+@_define_event
+def pre_run_cell(info):
+    """Fires before user-entered code runs.
+
+    Parameters
+    ----------
+    info : :class:`~IPython.core.interactiveshell.ExecutionInfo`
+        An object containing information used for the code execution.
+    """
+    pass
+
+@_define_event
+def post_execute():
+    """Fires after code is executed in response to user/frontend action.
+
+    This includes comm and widget messages and silent execution, as well as user
+    code cells.
+    """
+    pass
+
+@_define_event
+def post_run_cell(result):
+    """Fires after user-entered code runs.
+
+    Parameters
+    ----------
+    result : :class:`~IPython.core.interactiveshell.ExecutionResult`
+        The object which will be returned as the execution result.
+    """
+    pass
+
+@_define_event
+def shell_initialized(ip):
+    """Fires after initialisation of :class:`~IPython.core.interactiveshell.InteractiveShell`.
+
+    This is before extensions and startup scripts are loaded, so it can only be
+    set by subclassing.
+
+    Parameters
+    ----------
+    ip : :class:`~IPython.core.interactiveshell.InteractiveShell`
+        The newly initialised shell.
+    """
+    pass

temp_venv/lib/python3.13/site-packages/IPython/core/extensions.py

@@ -0,0 +1,135 @@
+# encoding: utf-8
+"""A class for managing IPython extensions."""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import os
+import os.path
+import sys
+from importlib import import_module, reload
+
+from traitlets.config.configurable import Configurable
+from IPython.utils.path import ensure_dir_exists
+from traitlets import Instance
+
+
+#-----------------------------------------------------------------------------
+# Main class
+#-----------------------------------------------------------------------------
+
+BUILTINS_EXTS = {"storemagic": False, "autoreload": False}
+
+
+class ExtensionManager(Configurable):
+    """A class to manage IPython extensions.
+
+    An IPython extension is an importable Python module that has
+    a function with the signature::
+
+        def load_ipython_extension(ipython):
+            # Do things with ipython
+
+    This function is called after your extension is imported and the
+    currently active :class:`InteractiveShell` instance is passed as
+    the only argument.  You can do anything you want with IPython at
+    that point, including defining new magic and aliases, adding new
+    components, etc.
+
+    You can also optionally define an :func:`unload_ipython_extension(ipython)`
+    function, which will be called if the user unloads or reloads the extension.
+    The extension manager will only call :func:`load_ipython_extension` again
+    if the extension is reloaded.
+
+    You can put your extension modules anywhere you want, as long as
+    they can be imported by Python's standard import mechanism.
+    """
+
+    shell = Instance('IPython.core.interactiveshell.InteractiveShellABC', allow_none=True)
+
+    def __init__(self, shell=None, **kwargs):
+        super(ExtensionManager, self).__init__(shell=shell, **kwargs)
+        self.loaded = set()
+
+    def load_extension(self, module_str: str):
+        """Load an IPython extension by its module name.
+
+        Returns the string "already loaded" if the extension is already loaded,
+        "no load function" if the module doesn't have a load_ipython_extension
+        function, or None if it succeeded.
+        """
+        try:
+            return self._load_extension(module_str)
+        except ModuleNotFoundError:
+            if module_str in BUILTINS_EXTS:
+                BUILTINS_EXTS[module_str] = True
+                return self._load_extension("IPython.extensions." + module_str)
+            raise
+
+    def _load_extension(self, module_str: str):
+        if module_str in self.loaded:
+            return "already loaded"
+
+        assert self.shell is not None
+
+        with self.shell.builtin_trap:
+            if module_str not in sys.modules:
+                mod = import_module(module_str)
+            mod = sys.modules[module_str]
+            if self._call_load_ipython_extension(mod):
+                self.loaded.add(module_str)
+            else:
+                return "no load function"
+
+    def unload_extension(self, module_str: str):
+        """Unload an IPython extension by its module name.
+
+        This function looks up the extension's name in ``sys.modules`` and
+        simply calls ``mod.unload_ipython_extension(self)``.
+
+        Returns the string "no unload function" if the extension doesn't define
+        a function to unload itself, "not loaded" if the extension isn't loaded,
+        otherwise None.
+        """
+        if BUILTINS_EXTS.get(module_str, False) is True:
+            module_str = "IPython.extensions." + module_str
+        if module_str not in self.loaded:
+            return "not loaded"
+
+        if module_str in sys.modules:
+            mod = sys.modules[module_str]
+            if self._call_unload_ipython_extension(mod):
+                self.loaded.discard(module_str)
+            else:
+                return "no unload function"
+
+    def reload_extension(self, module_str: str):
+        """Reload an IPython extension by calling reload.
+
+        If the module has not been loaded before,
+        :meth:`InteractiveShell.load_extension` is called. Otherwise
+        :func:`reload` is called and then the :func:`load_ipython_extension`
+        function of the module, if it exists is called.
+        """
+
+        if BUILTINS_EXTS.get(module_str, False) is True:
+            module_str = "IPython.extensions." + module_str
+
+        if (module_str in self.loaded) and (module_str in sys.modules):
+            self.unload_extension(module_str)
+            mod = sys.modules[module_str]
+            reload(mod)
+            if self._call_load_ipython_extension(mod):
+                self.loaded.add(module_str)
+        else:
+            self.load_extension(module_str)
+
+    def _call_load_ipython_extension(self, mod):
+        if hasattr(mod, 'load_ipython_extension'):
+            mod.load_ipython_extension(self.shell)
+            return True
+
+    def _call_unload_ipython_extension(self, mod):
+        if hasattr(mod, 'unload_ipython_extension'):
+            mod.unload_ipython_extension(self.shell)
+            return True

temp_venv/lib/python3.13/site-packages/IPython/core/formatters.py

@@ -0,0 +1,1090 @@
+# -*- coding: utf-8 -*-
+"""Display formatters.
+
+This module defines the base instances in order to implement custom
+formatters/mimetypes
+got objects:
+
+As we want to see internal IPython working we are going to use the following
+function to diaply objects instead of the normal print or display method:
+
+    >>> ip = get_ipython()
+    >>> ip.display_formatter.format(...)
+    ({'text/plain': 'Ellipsis'}, {})
+
+This return a tuple with the mimebumdle for the current object, and the
+associated metadata.
+
+
+We can now define our own formatter and register it:
+
+
+    >>> from IPython.core.formatters import BaseFormatter, FormatterABC
+
+
+    >>> class LLMFormatter(BaseFormatter):
+    ...
+    ...     format_type = 'x-vendor/llm'
+    ...     print_method = '_repr_llm_'
+    ...     _return_type = (dict, str)
+
+    >>> llm_formatter = LLMFormatter(parent=ip.display_formatter)
+
+    >>> ip.display_formatter.formatters[LLMFormatter.format_type] = llm_formatter
+
+Now any class that define `_repr_llm_` will return a x-vendor/llm as part of
+it's display data:
+
+    >>> class A:
+    ...
+    ...     def _repr_llm_(self, *kwargs):
+    ...         return 'This a A'
+    ...
+
+    >>> ip.display_formatter.format(A())
+    ({'text/plain': '<IPython.core.formatters.A at ...>', 'x-vendor/llm': 'This a A'}, {})
+
+As usual, you can register methods for third party types (see
+:ref:`third_party_formatting`)
+
+    >>> def llm_int(obj):
+    ...      return 'This is the integer %s, in between %s and %s'%(obj, obj-1, obj+1)
+
+    >>> llm_formatter.for_type(int, llm_int)
+
+    >>> ip.display_formatter.format(42)
+    ({'text/plain': '42', 'x-vendor/llm': 'This is the integer 42, in between 41 and 43'}, {})
+
+
+Inheritance diagram:
+
+.. inheritance-diagram:: IPython.core.formatters
+   :parts: 3
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import abc
+import sys
+import traceback
+import warnings
+from io import StringIO
+
+from decorator import decorator
+
+from traitlets.config.configurable import Configurable
+from .getipython import get_ipython
+from ..utils.sentinel import Sentinel
+from ..utils.dir2 import get_real_method
+from ..lib import pretty
+from traitlets import (
+    Bool, Dict, Integer, Unicode, CUnicode, ObjectName, List,
+    ForwardDeclaredInstance,
+    default, observe,
+)
+
+from typing import Any
+
+
+class DisplayFormatter(Configurable):
+
+    active_types = List(Unicode(),
+        help="""List of currently active mime-types to display.
+        You can use this to set a white-list for formats to display.
+
+        Most users will not need to change this value.
+        """,
+    ).tag(config=True)
+
+    @default('active_types')
+    def _active_types_default(self):
+        return self.format_types
+
+    @observe('active_types')
+    def _active_types_changed(self, change):
+        for key, formatter in self.formatters.items():
+            if key in change['new']:
+                formatter.enabled = True
+            else:
+                formatter.enabled = False
+
+    ipython_display_formatter = ForwardDeclaredInstance("FormatterABC")  # type: ignore
+
+    @default("ipython_display_formatter")
+    def _default_formatter(self):
+        return IPythonDisplayFormatter(parent=self)
+
+    mimebundle_formatter = ForwardDeclaredInstance("FormatterABC")  # type: ignore
+
+    @default("mimebundle_formatter")
+    def _default_mime_formatter(self):
+        return MimeBundleFormatter(parent=self)
+
+    # A dict of formatter whose keys are format types (MIME types) and whose
+    # values are subclasses of BaseFormatter.
+    formatters = Dict()
+
+    @default("formatters")
+    def _formatters_default(self):
+        """Activate the default formatters."""
+        formatter_classes = [
+            PlainTextFormatter,
+            HTMLFormatter,
+            MarkdownFormatter,
+            SVGFormatter,
+            PNGFormatter,
+            PDFFormatter,
+            JPEGFormatter,
+            LatexFormatter,
+            JSONFormatter,
+            JavascriptFormatter
+        ]
+        d = {}
+        for cls in formatter_classes:
+            f = cls(parent=self)
+            d[f.format_type] = f
+        return d
+
+    def format(self, obj, include=None, exclude=None):
+        """Return a format data dict for an object.
+
+        By default all format types will be computed.
+
+        The following MIME types are usually implemented:
+
+        * text/plain
+        * text/html
+        * text/markdown
+        * text/latex
+        * application/json
+        * application/javascript
+        * application/pdf
+        * image/png
+        * image/jpeg
+        * image/svg+xml
+
+        Parameters
+        ----------
+        obj : object
+            The Python object whose format data will be computed.
+        include : list, tuple or set; optional
+            A list of format type strings (MIME types) to include in the
+            format data dict. If this is set *only* the format types included
+            in this list will be computed.
+        exclude : list, tuple or set; optional
+            A list of format type string (MIME types) to exclude in the format
+            data dict. If this is set all format types will be computed,
+            except for those included in this argument.
+            Mimetypes present in exclude will take precedence over the ones in include
+
+        Returns
+        -------
+        (format_dict, metadata_dict) : tuple of two dicts
+            format_dict is a dictionary of key/value pairs, one of each format that was
+            generated for the object. The keys are the format types, which
+            will usually be MIME type strings and the values and JSON'able
+            data structure containing the raw data for the representation in
+            that format.
+
+            metadata_dict is a dictionary of metadata about each mime-type output.
+            Its keys will be a strict subset of the keys in format_dict.
+
+        Notes
+        -----
+            If an object implement `_repr_mimebundle_` as well as various
+            `_repr_*_`, the data returned by `_repr_mimebundle_` will take
+            precedence and the corresponding `_repr_*_` for this mimetype will
+            not be called.
+
+        """
+        format_dict = {}
+        md_dict = {}
+
+        if self.ipython_display_formatter(obj):
+            # object handled itself, don't proceed
+            return {}, {}
+
+        format_dict, md_dict = self.mimebundle_formatter(obj, include=include, exclude=exclude)
+
+        if format_dict or md_dict:
+            if include:
+                format_dict = {k:v for k,v in format_dict.items() if k in include}
+                md_dict = {k:v for k,v in md_dict.items() if k in include}
+            if exclude:
+                format_dict = {k:v for k,v in format_dict.items() if k not in exclude}
+                md_dict = {k:v for k,v in md_dict.items() if k not in exclude}
+
+        for format_type, formatter in self.formatters.items():
+            if format_type in format_dict:
+                # already got it from mimebundle, maybe don't render again.
+                # exception: manually registered per-mime renderer
+                # check priority:
+                # 1. user-registered per-mime formatter
+                # 2. mime-bundle (user-registered or repr method)
+                # 3. default per-mime formatter (e.g. repr method)
+                try:
+                    formatter.lookup(obj)
+                except KeyError:
+                    # no special formatter, use mime-bundle-provided value
+                    continue
+            if include and format_type not in include:
+                continue
+            if exclude and format_type in exclude:
+                continue
+
+            md = None
+            try:
+                data = formatter(obj)
+            except:
+                # FIXME: log the exception
+                raise
+
+            # formatters can return raw data or (data, metadata)
+            if isinstance(data, tuple) and len(data) == 2:
+                data, md = data
+
+            if data is not None:
+                format_dict[format_type] = data
+            if md is not None:
+                md_dict[format_type] = md
+        return format_dict, md_dict
+
+    @property
+    def format_types(self):
+        """Return the format types (MIME types) of the active formatters."""
+        return list(self.formatters.keys())
+
+
+#-----------------------------------------------------------------------------
+# Formatters for specific format types (text, html, svg, etc.)
+#-----------------------------------------------------------------------------
+
+
+def _safe_repr(obj):
+    """Try to return a repr of an object
+
+    always returns a string, at least.
+    """
+    try:
+        return repr(obj)
+    except Exception as e:
+        return "un-repr-able object (%r)" % e
+
+
+class FormatterWarning(UserWarning):
+    """Warning class for errors in formatters"""
+
+@decorator
+def catch_format_error(method, self, *args, **kwargs):
+    """show traceback on failed format call"""
+    try:
+        r = method(self, *args, **kwargs)
+    except NotImplementedError:
+        # don't warn on NotImplementedErrors
+        return self._check_return(None, args[0])
+    except Exception:
+        exc_info = sys.exc_info()
+        ip = get_ipython()
+        if ip is not None:
+            ip.showtraceback(exc_info)
+        else:
+            traceback.print_exception(*exc_info)
+        return self._check_return(None, args[0])
+    return self._check_return(r, args[0])
+
+
+class FormatterABC(metaclass=abc.ABCMeta):
+    """ Abstract base class for Formatters.
+
+    A formatter is a callable class that is responsible for computing the
+    raw format data for a particular format type (MIME type). For example,
+    an HTML formatter would have a format type of `text/html` and would return
+    the HTML representation of the object when called.
+    """
+
+    # The format type of the data returned, usually a MIME type.
+    format_type = 'text/plain'
+
+    # Is the formatter enabled...
+    enabled = True
+
+    @abc.abstractmethod
+    def __call__(self, obj):
+        """Return a JSON'able representation of the object.
+
+        If the object cannot be formatted by this formatter,
+        warn and return None.
+        """
+        return repr(obj)
+
+
+def _mod_name_key(typ):
+    """Return a (__module__, __name__) tuple for a type.
+
+    Used as key in Formatter.deferred_printers.
+    """
+    module = getattr(typ, '__module__', None)
+    name = getattr(typ, '__name__', None)
+    return (module, name)
+
+
+def _get_type(obj):
+    """Return the type of an instance (old and new-style)"""
+    return getattr(obj, '__class__', None) or type(obj)
+
+
+_raise_key_error = Sentinel(
+    "_raise_key_error",
+    __name__,
+    """
+Special value to raise a KeyError
+
+Raise KeyError in `BaseFormatter.pop` if passed as the default value to `pop`
+""",
+)
+
+
+class BaseFormatter(Configurable):
+    """A base formatter class that is configurable.
+
+    This formatter should usually be used as the base class of all formatters.
+    It is a traited :class:`Configurable` class and includes an extensible
+    API for users to determine how their objects are formatted. The following
+    logic is used to find a function to format an given object.
+
+    1. The object is introspected to see if it has a method with the name
+       :attr:`print_method`. If is does, that object is passed to that method
+       for formatting.
+    2. If no print method is found, three internal dictionaries are consulted
+       to find print method: :attr:`singleton_printers`, :attr:`type_printers`
+       and :attr:`deferred_printers`.
+
+    Users should use these dictionaries to register functions that will be
+    used to compute the format data for their objects (if those objects don't
+    have the special print methods). The easiest way of using these
+    dictionaries is through the :meth:`for_type` and :meth:`for_type_by_name`
+    methods.
+
+    If no function/callable is found to compute the format data, ``None`` is
+    returned and this format type is not used.
+    """
+
+    format_type = Unicode("text/plain")
+    _return_type: Any = str
+
+    enabled = Bool(True).tag(config=True)
+
+    print_method = ObjectName('__repr__')
+
+    # The singleton printers.
+    # Maps the IDs of the builtin singleton objects to the format functions.
+    singleton_printers = Dict().tag(config=True)
+
+    # The type-specific printers.
+    # Map type objects to the format functions.
+    type_printers = Dict().tag(config=True)
+
+    # The deferred-import type-specific printers.
+    # Map (modulename, classname) pairs to the format functions.
+    deferred_printers = Dict().tag(config=True)
+
+    @catch_format_error
+    def __call__(self, obj):
+        """Compute the format for an object."""
+        if self.enabled:
+            # lookup registered printer
+            try:
+                printer = self.lookup(obj)
+            except KeyError:
+                pass
+            else:
+                return printer(obj)
+            # Finally look for special method names
+            method = get_real_method(obj, self.print_method)
+            if method is not None:
+                return method()
+            return None
+        else:
+            return None
+
+    def __contains__(self, typ):
+        """map in to lookup_by_type"""
+        try:
+            self.lookup_by_type(typ)
+        except KeyError:
+            return False
+        else:
+            return True
+
+    def _check_return(self, r, obj):
+        """Check that a return value is appropriate
+
+        Return the value if so, None otherwise, warning if invalid.
+        """
+        if r is None or isinstance(r, self._return_type) or \
+            (isinstance(r, tuple) and r and isinstance(r[0], self._return_type)):
+            return r
+        else:
+            warnings.warn(
+                "%s formatter returned invalid type %s (expected %s) for object: %s" % \
+                (self.format_type, type(r), self._return_type, _safe_repr(obj)),
+                FormatterWarning
+            )
+
+    def lookup(self, obj):
+        """Look up the formatter for a given instance.
+
+        Parameters
+        ----------
+        obj : object instance
+
+        Returns
+        -------
+        f : callable
+            The registered formatting callable for the type.
+
+        Raises
+        ------
+        KeyError if the type has not been registered.
+        """
+        # look for singleton first
+        obj_id = id(obj)
+        if obj_id in self.singleton_printers:
+            return self.singleton_printers[obj_id]
+        # then lookup by type
+        return self.lookup_by_type(_get_type(obj))
+
+    def lookup_by_type(self, typ):
+        """Look up the registered formatter for a type.
+
+        Parameters
+        ----------
+        typ : type or '__module__.__name__' string for a type
+
+        Returns
+        -------
+        f : callable
+            The registered formatting callable for the type.
+
+        Raises
+        ------
+        KeyError if the type has not been registered.
+        """
+        if isinstance(typ, str):
+            typ_key = tuple(typ.rsplit('.',1))
+            if typ_key not in self.deferred_printers:
+                # We may have it cached in the type map. We will have to
+                # iterate over all of the types to check.
+                for cls in self.type_printers:
+                    if _mod_name_key(cls) == typ_key:
+                        return self.type_printers[cls]
+            else:
+                return self.deferred_printers[typ_key]
+        else:
+            for cls in pretty._get_mro(typ):
+                if cls in self.type_printers or self._in_deferred_types(cls):
+                    return self.type_printers[cls]
+
+        # If we have reached here, the lookup failed.
+        raise KeyError("No registered printer for {0!r}".format(typ))
+
+    def for_type(self, typ, func=None):
+        """Add a format function for a given type.
+
+        Parameters
+        ----------
+        typ : type or '__module__.__name__' string for a type
+            The class of the object that will be formatted using `func`.
+
+        func : callable
+            A callable for computing the format data.
+            `func` will be called with the object to be formatted,
+            and will return the raw data in this formatter's format.
+            Subclasses may use a different call signature for the
+            `func` argument.
+
+            If `func` is None or not specified, there will be no change,
+            only returning the current value.
+
+        Returns
+        -------
+        oldfunc : callable
+            The currently registered callable.
+            If you are registering a new formatter,
+            this will be the previous value (to enable restoring later).
+        """
+        # if string given, interpret as 'pkg.module.class_name'
+        if isinstance(typ, str):
+            type_module, type_name = typ.rsplit('.', 1)
+            return self.for_type_by_name(type_module, type_name, func)
+
+        try:
+            oldfunc = self.lookup_by_type(typ)
+        except KeyError:
+            oldfunc = None
+
+        if func is not None:
+            self.type_printers[typ] = func
+
+        return oldfunc
+
+    def for_type_by_name(self, type_module, type_name, func=None):
+        """Add a format function for a type specified by the full dotted
+        module and name of the type, rather than the type of the object.
+
+        Parameters
+        ----------
+        type_module : str
+            The full dotted name of the module the type is defined in, like
+            ``numpy``.
+
+        type_name : str
+            The name of the type (the class name), like ``dtype``
+
+        func : callable
+            A callable for computing the format data.
+            `func` will be called with the object to be formatted,
+            and will return the raw data in this formatter's format.
+            Subclasses may use a different call signature for the
+            `func` argument.
+
+            If `func` is None or unspecified, there will be no change,
+            only returning the current value.
+
+        Returns
+        -------
+        oldfunc : callable
+            The currently registered callable.
+            If you are registering a new formatter,
+            this will be the previous value (to enable restoring later).
+        """
+        key = (type_module, type_name)
+
+        try:
+            oldfunc = self.lookup_by_type("%s.%s" % key)
+        except KeyError:
+            oldfunc = None
+
+        if func is not None:
+            self.deferred_printers[key] = func
+        return oldfunc
+
+    def pop(self, typ, default=_raise_key_error):
+        """Pop a formatter for the given type.
+
+        Parameters
+        ----------
+        typ : type or '__module__.__name__' string for a type
+        default : object
+            value to be returned if no formatter is registered for typ.
+
+        Returns
+        -------
+        obj : object
+            The last registered object for the type.
+
+        Raises
+        ------
+        KeyError if the type is not registered and default is not specified.
+        """
+
+        if isinstance(typ, str):
+            typ_key = tuple(typ.rsplit('.',1))
+            if typ_key not in self.deferred_printers:
+                # We may have it cached in the type map. We will have to
+                # iterate over all of the types to check.
+                for cls in self.type_printers:
+                    if _mod_name_key(cls) == typ_key:
+                        old = self.type_printers.pop(cls)
+                        break
+                else:
+                    old = default
+            else:
+                old = self.deferred_printers.pop(typ_key)
+        else:
+            if typ in self.type_printers:
+                old = self.type_printers.pop(typ)
+            else:
+                old = self.deferred_printers.pop(_mod_name_key(typ), default)
+        if old is _raise_key_error:
+            raise KeyError("No registered value for {0!r}".format(typ))
+        return old
+
+    def _in_deferred_types(self, cls):
+        """
+        Check if the given class is specified in the deferred type registry.
+
+        Successful matches will be moved to the regular type registry for future use.
+        """
+        mod = getattr(cls, '__module__', None)
+        name = getattr(cls, '__name__', None)
+        key = (mod, name)
+        if key in self.deferred_printers:
+            # Move the printer over to the regular registry.
+            printer = self.deferred_printers.pop(key)
+            self.type_printers[cls] = printer
+            return True
+        return False
+
+
+class PlainTextFormatter(BaseFormatter):
+    """The default pretty-printer.
+
+    This uses :mod:`IPython.lib.pretty` to compute the format data of
+    the object. If the object cannot be pretty printed, :func:`repr` is used.
+    See the documentation of :mod:`IPython.lib.pretty` for details on
+    how to write pretty printers.  Here is a simple example::
+
+        def dtype_pprinter(obj, p, cycle):
+            if cycle:
+                return p.text('dtype(...)')
+            if hasattr(obj, 'fields'):
+                if obj.fields is None:
+                    p.text(repr(obj))
+                else:
+                    p.begin_group(7, 'dtype([')
+                    for i, field in enumerate(obj.descr):
+                        if i > 0:
+                            p.text(',')
+                            p.breakable()
+                        p.pretty(field)
+                    p.end_group(7, '])')
+    """
+
+    # The format type of data returned.
+    format_type = Unicode('text/plain')
+
+    # This subclass ignores this attribute as it always need to return
+    # something.
+    enabled = Bool(True).tag(config=False)
+
+    max_seq_length = Integer(pretty.MAX_SEQ_LENGTH,
+        help="""Truncate large collections (lists, dicts, tuples, sets) to this size.
+
+        Set to 0 to disable truncation.
+        """,
+    ).tag(config=True)
+
+    # Look for a _repr_pretty_ methods to use for pretty printing.
+    print_method = ObjectName('_repr_pretty_')
+
+    # Whether to pretty-print or not.
+    pprint = Bool(True).tag(config=True)
+
+    # Whether to be verbose or not.
+    verbose = Bool(False).tag(config=True)
+
+    # The maximum width.
+    max_width = Integer(79).tag(config=True)
+
+    # The newline character.
+    newline = Unicode('\n').tag(config=True)
+
+    # format-string for pprinting floats
+    float_format = Unicode('%r')
+    # setter for float precision, either int or direct format-string
+    float_precision = CUnicode('').tag(config=True)
+
+    @observe('float_precision')
+    def _float_precision_changed(self, change):
+        """float_precision changed, set float_format accordingly.
+
+        float_precision can be set by int or str.
+        This will set float_format, after interpreting input.
+        If numpy has been imported, numpy print precision will also be set.
+
+        integer `n` sets format to '%.nf', otherwise, format set directly.
+
+        An empty string returns to defaults (repr for float, 8 for numpy).
+
+        This parameter can be set via the '%precision' magic.
+        """
+        new = change['new']
+        if '%' in new:
+            # got explicit format string
+            fmt = new
+            try:
+                fmt%3.14159
+            except Exception as e:
+                raise ValueError("Precision must be int or format string, not %r"%new) from e
+        elif new:
+            # otherwise, should be an int
+            try:
+                i = int(new)
+                assert i >= 0
+            except ValueError as e:
+                raise ValueError("Precision must be int or format string, not %r"%new) from e
+            except AssertionError as e:
+                raise ValueError("int precision must be non-negative, not %r"%i) from e
+
+            fmt = '%%.%if'%i
+            if 'numpy' in sys.modules:
+                # set numpy precision if it has been imported
+                import numpy
+                numpy.set_printoptions(precision=i)
+        else:
+            # default back to repr
+            fmt = '%r'
+            if 'numpy' in sys.modules:
+                import numpy
+                # numpy default is 8
+                numpy.set_printoptions(precision=8)
+        self.float_format = fmt
+
+    # Use the default pretty printers from IPython.lib.pretty.
+    @default('singleton_printers')
+    def _singleton_printers_default(self):
+        return pretty._singleton_pprinters.copy()
+
+    @default('type_printers')
+    def _type_printers_default(self):
+        d = pretty._type_pprinters.copy()
+        d[float] = lambda obj,p,cycle: p.text(self.float_format%obj)
+        # if NumPy is used, set precision for its float64 type
+        if "numpy" in sys.modules:
+            import numpy
+
+            d[numpy.float64] = lambda obj, p, cycle: p.text(self.float_format % obj)
+        return d
+
+    @default('deferred_printers')
+    def _deferred_printers_default(self):
+        return pretty._deferred_type_pprinters.copy()
+
+    #### FormatterABC interface ####
+
+    @catch_format_error
+    def __call__(self, obj):
+        """Compute the pretty representation of the object."""
+        if not self.pprint:
+            return repr(obj)
+        else:
+            stream = StringIO()
+            printer = pretty.RepresentationPrinter(stream, self.verbose,
+                self.max_width, self.newline,
+                max_seq_length=self.max_seq_length,
+                singleton_pprinters=self.singleton_printers,
+                type_pprinters=self.type_printers,
+                deferred_pprinters=self.deferred_printers)
+            printer.pretty(obj)
+            printer.flush()
+            return stream.getvalue()
+
+
+class HTMLFormatter(BaseFormatter):
+    """An HTML formatter.
+
+    To define the callables that compute the HTML representation of your
+    objects, define a :meth:`_repr_html_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be a valid HTML snippet that
+    could be injected into an existing DOM. It should *not* include the
+    ```<html>`` or ```<body>`` tags.
+    """
+    format_type = Unicode('text/html')
+
+    print_method = ObjectName('_repr_html_')
+
+
+class MarkdownFormatter(BaseFormatter):
+    """A Markdown formatter.
+
+    To define the callables that compute the Markdown representation of your
+    objects, define a :meth:`_repr_markdown_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be a valid Markdown.
+    """
+    format_type = Unicode('text/markdown')
+
+    print_method = ObjectName('_repr_markdown_')
+
+class SVGFormatter(BaseFormatter):
+    """An SVG formatter.
+
+    To define the callables that compute the SVG representation of your
+    objects, define a :meth:`_repr_svg_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be valid SVG enclosed in
+    ```<svg>``` tags, that could be injected into an existing DOM. It should
+    *not* include the ```<html>`` or ```<body>`` tags.
+    """
+    format_type = Unicode('image/svg+xml')
+
+    print_method = ObjectName('_repr_svg_')
+
+
+class PNGFormatter(BaseFormatter):
+    """A PNG formatter.
+
+    To define the callables that compute the PNG representation of your
+    objects, define a :meth:`_repr_png_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be raw PNG data, *not*
+    base64 encoded.
+    """
+    format_type = Unicode('image/png')
+
+    print_method = ObjectName('_repr_png_')
+
+    _return_type = (bytes, str)
+
+
+class JPEGFormatter(BaseFormatter):
+    """A JPEG formatter.
+
+    To define the callables that compute the JPEG representation of your
+    objects, define a :meth:`_repr_jpeg_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be raw JPEG data, *not*
+    base64 encoded.
+    """
+    format_type = Unicode('image/jpeg')
+
+    print_method = ObjectName('_repr_jpeg_')
+
+    _return_type = (bytes, str)
+
+
+class LatexFormatter(BaseFormatter):
+    """A LaTeX formatter.
+
+    To define the callables that compute the LaTeX representation of your
+    objects, define a :meth:`_repr_latex_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be a valid LaTeX equation,
+    enclosed in either ```$```, ```$$``` or another LaTeX equation
+    environment.
+    """
+    format_type = Unicode('text/latex')
+
+    print_method = ObjectName('_repr_latex_')
+
+
+class JSONFormatter(BaseFormatter):
+    """A JSON string formatter.
+
+    To define the callables that compute the JSONable representation of
+    your objects, define a :meth:`_repr_json_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be a JSONable list or dict.
+    JSON scalars (None, number, string) are not allowed, only dict or list containers.
+    """
+    format_type = Unicode('application/json')
+    _return_type = (list, dict)
+
+    print_method = ObjectName('_repr_json_')
+
+    def _check_return(self, r, obj):
+        """Check that a return value is appropriate
+
+        Return the value if so, None otherwise, warning if invalid.
+        """
+        if r is None:
+            return
+        md = None
+        if isinstance(r, tuple):
+            # unpack data, metadata tuple for type checking on first element
+            r, md = r
+
+        assert not isinstance(
+            r, str
+        ), "JSON-as-string has been deprecated since IPython < 3"
+
+        if md is not None:
+            # put the tuple back together
+            r = (r, md)
+        return super(JSONFormatter, self)._check_return(r, obj)
+
+
+class JavascriptFormatter(BaseFormatter):
+    """A Javascript formatter.
+
+    To define the callables that compute the Javascript representation of
+    your objects, define a :meth:`_repr_javascript_` method or use the
+    :meth:`for_type` or :meth:`for_type_by_name` methods to register functions
+    that handle this.
+
+    The return value of this formatter should be valid Javascript code and
+    should *not* be enclosed in ```<script>``` tags.
+    """
+    format_type = Unicode('application/javascript')
+
+    print_method = ObjectName('_repr_javascript_')
+
+
+class PDFFormatter(BaseFormatter):
+    """A PDF formatter.
+
+    To define the callables that compute the PDF representation of your
+    objects, define a :meth:`_repr_pdf_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    The return value of this formatter should be raw PDF data, *not*
+    base64 encoded.
+    """
+    format_type = Unicode('application/pdf')
+
+    print_method = ObjectName('_repr_pdf_')
+
+    _return_type = (bytes, str)
+
+class IPythonDisplayFormatter(BaseFormatter):
+    """An escape-hatch Formatter for objects that know how to display themselves.
+
+    To define the callables that compute the representation of your
+    objects, define a :meth:`_ipython_display_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this. Unlike mime-type displays, this method should not return anything,
+    instead calling any appropriate display methods itself.
+
+    This display formatter has highest priority.
+    If it fires, no other display formatter will be called.
+
+    Prior to IPython 6.1, `_ipython_display_` was the only way to display custom mime-types
+    without registering a new Formatter.
+
+    IPython 6.1 introduces `_repr_mimebundle_` for displaying custom mime-types,
+    so `_ipython_display_` should only be used for objects that require unusual
+    display patterns, such as multiple display calls.
+    """
+    print_method = ObjectName('_ipython_display_')
+    _return_type = (type(None), bool)
+
+    @catch_format_error
+    def __call__(self, obj):
+        """Compute the format for an object."""
+        if self.enabled:
+            # lookup registered printer
+            try:
+                printer = self.lookup(obj)
+            except KeyError:
+                pass
+            else:
+                printer(obj)
+                return True
+            # Finally look for special method names
+            method = get_real_method(obj, self.print_method)
+            if method is not None:
+                method()
+                return True
+
+
+class MimeBundleFormatter(BaseFormatter):
+    """A Formatter for arbitrary mime-types.
+
+    Unlike other `_repr_<mimetype>_` methods,
+    `_repr_mimebundle_` should return mime-bundle data,
+    either the mime-keyed `data` dictionary or the tuple `(data, metadata)`.
+    Any mime-type is valid.
+
+    To define the callables that compute the mime-bundle representation of your
+    objects, define a :meth:`_repr_mimebundle_` method or use the :meth:`for_type`
+    or :meth:`for_type_by_name` methods to register functions that handle
+    this.
+
+    .. versionadded:: 6.1
+    """
+    print_method = ObjectName('_repr_mimebundle_')
+    _return_type = dict
+
+    def _check_return(self, r, obj):
+        r = super(MimeBundleFormatter, self)._check_return(r, obj)
+        # always return (data, metadata):
+        if r is None:
+            return {}, {}
+        if not isinstance(r, tuple):
+            return r, {}
+        return r
+
+    @catch_format_error
+    def __call__(self, obj, include=None, exclude=None):
+        """Compute the format for an object.
+
+        Identical to parent's method but we pass extra parameters to the method.
+
+        Unlike other _repr_*_ `_repr_mimebundle_` should allow extra kwargs, in
+        particular `include` and `exclude`.
+        """
+        if self.enabled:
+            # lookup registered printer
+            try:
+                printer = self.lookup(obj)
+            except KeyError:
+                pass
+            else:
+                return printer(obj)
+            # Finally look for special method names
+            method = get_real_method(obj, self.print_method)
+
+            if method is not None:
+                return method(include=include, exclude=exclude)
+            return None
+        else:
+            return None
+
+
+FormatterABC.register(BaseFormatter)
+FormatterABC.register(PlainTextFormatter)
+FormatterABC.register(HTMLFormatter)
+FormatterABC.register(MarkdownFormatter)
+FormatterABC.register(SVGFormatter)
+FormatterABC.register(PNGFormatter)
+FormatterABC.register(PDFFormatter)
+FormatterABC.register(JPEGFormatter)
+FormatterABC.register(LatexFormatter)
+FormatterABC.register(JSONFormatter)
+FormatterABC.register(JavascriptFormatter)
+FormatterABC.register(IPythonDisplayFormatter)
+FormatterABC.register(MimeBundleFormatter)
+
+
+def format_display_data(obj, include=None, exclude=None):
+    """Return a format data dict for an object.
+
+    By default all format types will be computed.
+
+    Parameters
+    ----------
+    obj : object
+        The Python object whose format data will be computed.
+
+    Returns
+    -------
+    format_dict : dict
+        A dictionary of key/value pairs, one or each format that was
+        generated for the object. The keys are the format types, which
+        will usually be MIME type strings and the values and JSON'able
+        data structure containing the raw data for the representation in
+        that format.
+    include : list or tuple, optional
+        A list of format type strings (MIME types) to include in the
+        format data dict. If this is set *only* the format types included
+        in this list will be computed.
+    exclude : list or tuple, optional
+        A list of format type string (MIME types) to exclude in the format
+        data dict. If this is set all format types will be computed,
+        except for those included in this argument.
+    """
+    from .interactiveshell import InteractiveShell
+
+    return InteractiveShell.instance().display_formatter.format(
+        obj,
+        include,
+        exclude
+    )

temp_venv/lib/python3.13/site-packages/IPython/core/getipython.py

@@ -0,0 +1,23 @@
+"""Simple function to call to get the current InteractiveShell instance
+"""
+
+#-----------------------------------------------------------------------------
+#  Copyright (C) 2013  The IPython Development Team
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Classes and functions
+#-----------------------------------------------------------------------------
+
+
+def get_ipython():
+    """Get the global InteractiveShell instance.
+
+    Returns None if no InteractiveShell instance is registered.
+    """
+    from IPython.core.interactiveshell import InteractiveShell
+    if InteractiveShell.initialized():
+        return InteractiveShell.instance()

temp_venv/lib/python3.13/site-packages/IPython/core/guarded_eval.py

@@ -0,0 +1,893 @@
+from inspect import isclass, signature, Signature
+from pygments.formatters.terminal256 import Terminal256Formatter
+from typing import (
+    Annotated,
+    AnyStr,
+    Callable,
+    Dict,
+    Literal,
+    NamedTuple,
+    NewType,
+    Optional,
+    Protocol,
+    Set,
+    Sequence,
+    Tuple,
+    Type,
+    TypeGuard,
+    Union,
+    get_args,
+    get_origin,
+    is_typeddict,
+)
+import ast
+import builtins
+import collections
+import operator
+import sys
+from functools import cached_property
+from dataclasses import dataclass, field
+from types import MethodDescriptorType, ModuleType
+
+from IPython.utils.decorators import undoc
+
+
+from typing import Self, LiteralString
+
+if sys.version_info < (3, 12):
+    from typing_extensions import TypeAliasType
+else:
+    from typing import TypeAliasType
+
+
+@undoc
+class HasGetItem(Protocol):
+    def __getitem__(self, key) -> None: ...
+
+
+@undoc
+class InstancesHaveGetItem(Protocol):
+    def __call__(self, *args, **kwargs) -> HasGetItem: ...
+
+
+@undoc
+class HasGetAttr(Protocol):
+    def __getattr__(self, key) -> None: ...
+
+
+@undoc
+class DoesNotHaveGetAttr(Protocol):
+    pass
+
+
+# By default `__getattr__` is not explicitly implemented on most objects
+MayHaveGetattr = Union[HasGetAttr, DoesNotHaveGetAttr]
+
+
+def _unbind_method(func: Callable) -> Union[Callable, None]:
+    """Get unbound method for given bound method.
+
+    Returns None if cannot get unbound method, or method is already unbound.
+    """
+    owner = getattr(func, "__self__", None)
+    owner_class = type(owner)
+    name = getattr(func, "__name__", None)
+    instance_dict_overrides = getattr(owner, "__dict__", None)
+    if (
+        owner is not None
+        and name
+        and (
+            not instance_dict_overrides
+            or (instance_dict_overrides and name not in instance_dict_overrides)
+        )
+    ):
+        return getattr(owner_class, name)
+    return None
+
+
+@undoc
+@dataclass
+class EvaluationPolicy:
+    """Definition of evaluation policy."""
+
+    allow_locals_access: bool = False
+    allow_globals_access: bool = False
+    allow_item_access: bool = False
+    allow_attr_access: bool = False
+    allow_builtins_access: bool = False
+    allow_all_operations: bool = False
+    allow_any_calls: bool = False
+    allowed_calls: set[Callable] = field(default_factory=set)
+
+    def can_get_item(self, value, item):
+        return self.allow_item_access
+
+    def can_get_attr(self, value, attr):
+        return self.allow_attr_access
+
+    def can_operate(self, dunders: tuple[str, ...], a, b=None):
+        if self.allow_all_operations:
+            return True
+
+    def can_call(self, func):
+        if self.allow_any_calls:
+            return True
+
+        if func in self.allowed_calls:
+            return True
+
+        owner_method = _unbind_method(func)
+
+        if owner_method and owner_method in self.allowed_calls:
+            return True
+
+
+def _get_external(module_name: str, access_path: Sequence[str]):
+    """Get value from external module given a dotted access path.
+
+    Raises:
+    * `KeyError` if module is removed not found, and
+    * `AttributeError` if access path does not match an exported object
+    """
+    member_type = sys.modules[module_name]
+    for attr in access_path:
+        member_type = getattr(member_type, attr)
+    return member_type
+
+
+def _has_original_dunder_external(
+    value,
+    module_name: str,
+    access_path: Sequence[str],
+    method_name: str,
+):
+    if module_name not in sys.modules:
+        # LBYLB as it is faster
+        return False
+    try:
+        member_type = _get_external(module_name, access_path)
+        value_type = type(value)
+        if type(value) == member_type:
+            return True
+        if method_name == "__getattribute__":
+            # we have to short-circuit here due to an unresolved issue in
+            # `isinstance` implementation: https://bugs.python.org/issue32683
+            return False
+        if isinstance(value, member_type):
+            method = getattr(value_type, method_name, None)
+            member_method = getattr(member_type, method_name, None)
+            if member_method == method:
+                return True
+    except (AttributeError, KeyError):
+        return False
+
+
+def _has_original_dunder(
+    value, allowed_types, allowed_methods, allowed_external, method_name
+):
+    # note: Python ignores `__getattr__`/`__getitem__` on instances,
+    # we only need to check at class level
+    value_type = type(value)
+
+    # strict type check passes → no need to check method
+    if value_type in allowed_types:
+        return True
+
+    method = getattr(value_type, method_name, None)
+
+    if method is None:
+        return None
+
+    if method in allowed_methods:
+        return True
+
+    for module_name, *access_path in allowed_external:
+        if _has_original_dunder_external(value, module_name, access_path, method_name):
+            return True
+
+    return False
+
+
+@undoc
+@dataclass
+class SelectivePolicy(EvaluationPolicy):
+    allowed_getitem: set[InstancesHaveGetItem] = field(default_factory=set)
+    allowed_getitem_external: set[tuple[str, ...]] = field(default_factory=set)
+
+    allowed_getattr: set[MayHaveGetattr] = field(default_factory=set)
+    allowed_getattr_external: set[tuple[str, ...]] = field(default_factory=set)
+
+    allowed_operations: set = field(default_factory=set)
+    allowed_operations_external: set[tuple[str, ...]] = field(default_factory=set)
+
+    _operation_methods_cache: dict[str, set[Callable]] = field(
+        default_factory=dict, init=False
+    )
+
+    def can_get_attr(self, value, attr):
+        has_original_attribute = _has_original_dunder(
+            value,
+            allowed_types=self.allowed_getattr,
+            allowed_methods=self._getattribute_methods,
+            allowed_external=self.allowed_getattr_external,
+            method_name="__getattribute__",
+        )
+        has_original_attr = _has_original_dunder(
+            value,
+            allowed_types=self.allowed_getattr,
+            allowed_methods=self._getattr_methods,
+            allowed_external=self.allowed_getattr_external,
+            method_name="__getattr__",
+        )
+
+        accept = False
+
+        # Many objects do not have `__getattr__`, this is fine.
+        if has_original_attr is None and has_original_attribute:
+            accept = True
+        else:
+            # Accept objects without modifications to `__getattr__` and `__getattribute__`
+            accept = has_original_attr and has_original_attribute
+
+        if accept:
+            # We still need to check for overridden properties.
+
+            value_class = type(value)
+            if not hasattr(value_class, attr):
+                return True
+
+            class_attr_val = getattr(value_class, attr)
+            is_property = isinstance(class_attr_val, property)
+
+            if not is_property:
+                return True
+
+            # Properties in allowed types are ok (although we do not include any
+            # properties in our default allow list currently).
+            if type(value) in self.allowed_getattr:
+                return True  # pragma: no cover
+
+            # Properties in subclasses of allowed types may be ok if not changed
+            for module_name, *access_path in self.allowed_getattr_external:
+                try:
+                    external_class = _get_external(module_name, access_path)
+                    external_class_attr_val = getattr(external_class, attr)
+                except (KeyError, AttributeError):
+                    return False  # pragma: no cover
+                return class_attr_val == external_class_attr_val
+
+        return False
+
+    def can_get_item(self, value, item):
+        """Allow accessing `__getiitem__` of allow-listed instances unless it was not modified."""
+        return _has_original_dunder(
+            value,
+            allowed_types=self.allowed_getitem,
+            allowed_methods=self._getitem_methods,
+            allowed_external=self.allowed_getitem_external,
+            method_name="__getitem__",
+        )
+
+    def can_operate(self, dunders: tuple[str, ...], a, b=None):
+        objects = [a]
+        if b is not None:
+            objects.append(b)
+        return all(
+            [
+                _has_original_dunder(
+                    obj,
+                    allowed_types=self.allowed_operations,
+                    allowed_methods=self._operator_dunder_methods(dunder),
+                    allowed_external=self.allowed_operations_external,
+                    method_name=dunder,
+                )
+                for dunder in dunders
+                for obj in objects
+            ]
+        )
+
+    def _operator_dunder_methods(self, dunder: str) -> set[Callable]:
+        if dunder not in self._operation_methods_cache:
+            self._operation_methods_cache[dunder] = self._safe_get_methods(
+                self.allowed_operations, dunder
+            )
+        return self._operation_methods_cache[dunder]
+
+    @cached_property
+    def _getitem_methods(self) -> set[Callable]:
+        return self._safe_get_methods(self.allowed_getitem, "__getitem__")
+
+    @cached_property
+    def _getattr_methods(self) -> set[Callable]:
+        return self._safe_get_methods(self.allowed_getattr, "__getattr__")
+
+    @cached_property
+    def _getattribute_methods(self) -> set[Callable]:
+        return self._safe_get_methods(self.allowed_getattr, "__getattribute__")
+
+    def _safe_get_methods(self, classes, name) -> set[Callable]:
+        return {
+            method
+            for class_ in classes
+            for method in [getattr(class_, name, None)]
+            if method
+        }
+
+
+class _DummyNamedTuple(NamedTuple):
+    """Used internally to retrieve methods of named tuple instance."""
+
+
+class EvaluationContext(NamedTuple):
+    #: Local namespace
+    locals: dict
+    #: Global namespace
+    globals: dict
+    #: Evaluation policy identifier
+    evaluation: Literal["forbidden", "minimal", "limited", "unsafe", "dangerous"] = (
+        "forbidden"
+    )
+    #: Whether the evaluation of code takes place inside of a subscript.
+    #: Useful for evaluating ``:-1, 'col'`` in ``df[:-1, 'col']``.
+    in_subscript: bool = False
+
+
+class _IdentitySubscript:
+    """Returns the key itself when item is requested via subscript."""
+
+    def __getitem__(self, key):
+        return key
+
+
+IDENTITY_SUBSCRIPT = _IdentitySubscript()
+SUBSCRIPT_MARKER = "__SUBSCRIPT_SENTINEL__"
+UNKNOWN_SIGNATURE = Signature()
+NOT_EVALUATED = object()
+
+
+class GuardRejection(Exception):
+    """Exception raised when guard rejects evaluation attempt."""
+
+    pass
+
+
+def guarded_eval(code: str, context: EvaluationContext):
+    """Evaluate provided code in the evaluation context.
+
+    If evaluation policy given by context is set to ``forbidden``
+    no evaluation will be performed; if it is set to ``dangerous``
+    standard :func:`eval` will be used; finally, for any other,
+    policy :func:`eval_node` will be called on parsed AST.
+    """
+    locals_ = context.locals
+
+    if context.evaluation == "forbidden":
+        raise GuardRejection("Forbidden mode")
+
+    # note: not using `ast.literal_eval` as it does not implement
+    # getitem at all, for example it fails on simple `[0][1]`
+
+    if context.in_subscript:
+        # syntactic sugar for ellipsis (:) is only available in subscripts
+        # so we need to trick the ast parser into thinking that we have
+        # a subscript, but we need to be able to later recognise that we did
+        # it so we can ignore the actual __getitem__ operation
+        if not code:
+            return tuple()
+        locals_ = locals_.copy()
+        locals_[SUBSCRIPT_MARKER] = IDENTITY_SUBSCRIPT
+        code = SUBSCRIPT_MARKER + "[" + code + "]"
+        context = EvaluationContext(**{**context._asdict(), **{"locals": locals_}})
+
+    if context.evaluation == "dangerous":
+        return eval(code, context.globals, context.locals)
+
+    expression = ast.parse(code, mode="eval")
+
+    return eval_node(expression, context)
+
+
+BINARY_OP_DUNDERS: dict[type[ast.operator], tuple[str]] = {
+    ast.Add: ("__add__",),
+    ast.Sub: ("__sub__",),
+    ast.Mult: ("__mul__",),
+    ast.Div: ("__truediv__",),
+    ast.FloorDiv: ("__floordiv__",),
+    ast.Mod: ("__mod__",),
+    ast.Pow: ("__pow__",),
+    ast.LShift: ("__lshift__",),
+    ast.RShift: ("__rshift__",),
+    ast.BitOr: ("__or__",),
+    ast.BitXor: ("__xor__",),
+    ast.BitAnd: ("__and__",),
+    ast.MatMult: ("__matmul__",),
+}
+
+COMP_OP_DUNDERS: dict[type[ast.cmpop], tuple[str, ...]] = {
+    ast.Eq: ("__eq__",),
+    ast.NotEq: ("__ne__", "__eq__"),
+    ast.Lt: ("__lt__", "__gt__"),
+    ast.LtE: ("__le__", "__ge__"),
+    ast.Gt: ("__gt__", "__lt__"),
+    ast.GtE: ("__ge__", "__le__"),
+    ast.In: ("__contains__",),
+    # Note: ast.Is, ast.IsNot, ast.NotIn are handled specially
+}
+
+UNARY_OP_DUNDERS: dict[type[ast.unaryop], tuple[str, ...]] = {
+    ast.USub: ("__neg__",),
+    ast.UAdd: ("__pos__",),
+    # we have to check both __inv__ and __invert__!
+    ast.Invert: ("__invert__", "__inv__"),
+    ast.Not: ("__not__",),
+}
+
+
+class ImpersonatingDuck:
+    """A dummy class used to create objects of other classes without calling their ``__init__``"""
+
+    # no-op: override __class__ to impersonate
+
+
+class _Duck:
+    """A dummy class used to create objects pretending to have given attributes"""
+
+    def __init__(self, attributes: Optional[dict] = None, items: Optional[dict] = None):
+        self.attributes = attributes or {}
+        self.items = items or {}
+
+    def __getattr__(self, attr: str):
+        return self.attributes[attr]
+
+    def __hasattr__(self, attr: str):
+        return attr in self.attributes
+
+    def __dir__(self):
+        return [*dir(super), *self.attributes]
+
+    def __getitem__(self, key: str):
+        return self.items[key]
+
+    def __hasitem__(self, key: str):
+        return self.items[key]
+
+    def _ipython_key_completions_(self):
+        return self.items.keys()
+
+
+def _find_dunder(node_op, dunders) -> Union[tuple[str, ...], None]:
+    dunder = None
+    for op, candidate_dunder in dunders.items():
+        if isinstance(node_op, op):
+            dunder = candidate_dunder
+    return dunder
+
+
+def eval_node(node: Union[ast.AST, None], context: EvaluationContext):
+    """Evaluate AST node in provided context.
+
+    Applies evaluation restrictions defined in the context. Currently does not support evaluation of functions with keyword arguments.
+
+    Does not evaluate actions that always have side effects:
+
+    - class definitions (``class sth: ...``)
+    - function definitions (``def sth: ...``)
+    - variable assignments (``x = 1``)
+    - augmented assignments (``x += 1``)
+    - deletions (``del x``)
+
+    Does not evaluate operations which do not return values:
+
+    - assertions (``assert x``)
+    - pass (``pass``)
+    - imports (``import x``)
+    - control flow:
+
+        - conditionals (``if x:``) except for ternary IfExp (``a if x else b``)
+        - loops (``for`` and ``while``)
+        - exception handling
+
+    The purpose of this function is to guard against unwanted side-effects;
+    it does not give guarantees on protection from malicious code execution.
+    """
+    policy = EVALUATION_POLICIES[context.evaluation]
+    if node is None:
+        return None
+    if isinstance(node, ast.Expression):
+        return eval_node(node.body, context)
+    if isinstance(node, ast.BinOp):
+        left = eval_node(node.left, context)
+        right = eval_node(node.right, context)
+        dunders = _find_dunder(node.op, BINARY_OP_DUNDERS)
+        if dunders:
+            if policy.can_operate(dunders, left, right):
+                return getattr(left, dunders[0])(right)
+            else:
+                raise GuardRejection(
+                    f"Operation (`{dunders}`) for",
+                    type(left),
+                    f"not allowed in {context.evaluation} mode",
+                )
+    if isinstance(node, ast.Compare):
+        left = eval_node(node.left, context)
+        all_true = True
+        negate = False
+        for op, right in zip(node.ops, node.comparators):
+            right = eval_node(right, context)
+            dunder = None
+            dunders = _find_dunder(op, COMP_OP_DUNDERS)
+            if not dunders:
+                if isinstance(op, ast.NotIn):
+                    dunders = COMP_OP_DUNDERS[ast.In]
+                    negate = True
+                if isinstance(op, ast.Is):
+                    dunder = "is_"
+                if isinstance(op, ast.IsNot):
+                    dunder = "is_"
+                    negate = True
+            if not dunder and dunders:
+                dunder = dunders[0]
+            if dunder:
+                a, b = (right, left) if dunder == "__contains__" else (left, right)
+                if dunder == "is_" or dunders and policy.can_operate(dunders, a, b):
+                    result = getattr(operator, dunder)(a, b)
+                    if negate:
+                        result = not result
+                    if not result:
+                        all_true = False
+                    left = right
+                else:
+                    raise GuardRejection(
+                        f"Comparison (`{dunder}`) for",
+                        type(left),
+                        f"not allowed in {context.evaluation} mode",
+                    )
+            else:
+                raise ValueError(
+                    f"Comparison `{dunder}` not supported"
+                )  # pragma: no cover
+        return all_true
+    if isinstance(node, ast.Constant):
+        return node.value
+    if isinstance(node, ast.Tuple):
+        return tuple(eval_node(e, context) for e in node.elts)
+    if isinstance(node, ast.List):
+        return [eval_node(e, context) for e in node.elts]
+    if isinstance(node, ast.Set):
+        return {eval_node(e, context) for e in node.elts}
+    if isinstance(node, ast.Dict):
+        return dict(
+            zip(
+                [eval_node(k, context) for k in node.keys],
+                [eval_node(v, context) for v in node.values],
+            )
+        )
+    if isinstance(node, ast.Slice):
+        return slice(
+            eval_node(node.lower, context),
+            eval_node(node.upper, context),
+            eval_node(node.step, context),
+        )
+    if isinstance(node, ast.UnaryOp):
+        value = eval_node(node.operand, context)
+        dunders = _find_dunder(node.op, UNARY_OP_DUNDERS)
+        if dunders:
+            if policy.can_operate(dunders, value):
+                return getattr(value, dunders[0])()
+            else:
+                raise GuardRejection(
+                    f"Operation (`{dunders}`) for",
+                    type(value),
+                    f"not allowed in {context.evaluation} mode",
+                )
+    if isinstance(node, ast.Subscript):
+        value = eval_node(node.value, context)
+        slice_ = eval_node(node.slice, context)
+        if policy.can_get_item(value, slice_):
+            return value[slice_]
+        raise GuardRejection(
+            "Subscript access (`__getitem__`) for",
+            type(value),  # not joined to avoid calling `repr`
+            f" not allowed in {context.evaluation} mode",
+        )
+    if isinstance(node, ast.Name):
+        return _eval_node_name(node.id, context)
+    if isinstance(node, ast.Attribute):
+        value = eval_node(node.value, context)
+        if policy.can_get_attr(value, node.attr):
+            return getattr(value, node.attr)
+        raise GuardRejection(
+            "Attribute access (`__getattr__`) for",
+            type(value),  # not joined to avoid calling `repr`
+            f"not allowed in {context.evaluation} mode",
+        )
+    if isinstance(node, ast.IfExp):
+        test = eval_node(node.test, context)
+        if test:
+            return eval_node(node.body, context)
+        else:
+            return eval_node(node.orelse, context)
+    if isinstance(node, ast.Call):
+        func = eval_node(node.func, context)
+        if policy.can_call(func) and not node.keywords:
+            args = [eval_node(arg, context) for arg in node.args]
+            return func(*args)
+        if isclass(func):
+            # this code path gets entered when calling class e.g. `MyClass()`
+            # or `my_instance.__class__()` - in both cases `func` is `MyClass`.
+            # Should return `MyClass` if `__new__` is not overridden,
+            # otherwise whatever `__new__` return type is.
+            overridden_return_type = _eval_return_type(func.__new__, node, context)
+            if overridden_return_type is not NOT_EVALUATED:
+                return overridden_return_type
+            return _create_duck_for_heap_type(func)
+        else:
+            return_type = _eval_return_type(func, node, context)
+            if return_type is not NOT_EVALUATED:
+                return return_type
+        raise GuardRejection(
+            "Call for",
+            func,  # not joined to avoid calling `repr`
+            f"not allowed in {context.evaluation} mode",
+        )
+    raise ValueError("Unhandled node", ast.dump(node))
+
+
+def _eval_return_type(func: Callable, node: ast.Call, context: EvaluationContext):
+    """Evaluate return type of a given callable function.
+
+    Returns the built-in type, a duck or NOT_EVALUATED sentinel.
+    """
+    try:
+        sig = signature(func)
+    except ValueError:
+        sig = UNKNOWN_SIGNATURE
+    # if annotation was not stringized, or it was stringized
+    # but resolved by signature call we know the return type
+    not_empty = sig.return_annotation is not Signature.empty
+    if not_empty:
+        return _resolve_annotation(sig.return_annotation, sig, func, node, context)
+    return NOT_EVALUATED
+
+
+def _resolve_annotation(
+    annotation,
+    sig: Signature,
+    func: Callable,
+    node: ast.Call,
+    context: EvaluationContext,
+):
+    """Resolve annotation created by user with `typing` module and custom objects."""
+    annotation = (
+        _eval_node_name(annotation, context)
+        if isinstance(annotation, str)
+        else annotation
+    )
+    origin = get_origin(annotation)
+    if annotation is Self and hasattr(func, "__self__"):
+        return func.__self__
+    elif origin is Literal:
+        type_args = get_args(annotation)
+        if len(type_args) == 1:
+            return type_args[0]
+    elif annotation is LiteralString:
+        return ""
+    elif annotation is AnyStr:
+        index = None
+        for i, (key, value) in enumerate(sig.parameters.items()):
+            if value.annotation is AnyStr:
+                index = i
+                break
+        if index is not None and index < len(node.args):
+            return eval_node(node.args[index], context)
+    elif origin is TypeGuard:
+        return False
+    elif origin is Union:
+        attributes = [
+            attr
+            for type_arg in get_args(annotation)
+            for attr in dir(_resolve_annotation(type_arg, sig, func, node, context))
+        ]
+        return _Duck(attributes=dict.fromkeys(attributes))
+    elif is_typeddict(annotation):
+        return _Duck(
+            attributes=dict.fromkeys(dir(dict())),
+            items={
+                k: _resolve_annotation(v, sig, func, node, context)
+                for k, v in annotation.__annotations__.items()
+            },
+        )
+    elif hasattr(annotation, "_is_protocol"):
+        return _Duck(attributes=dict.fromkeys(dir(annotation)))
+    elif origin is Annotated:
+        type_arg = get_args(annotation)[0]
+        return _resolve_annotation(type_arg, sig, func, node, context)
+    elif isinstance(annotation, NewType):
+        return _eval_or_create_duck(annotation.__supertype__, node, context)
+    elif isinstance(annotation, TypeAliasType):
+        return _eval_or_create_duck(annotation.__value__, node, context)
+    else:
+        return _eval_or_create_duck(annotation, node, context)
+
+
+def _eval_node_name(node_id: str, context: EvaluationContext):
+    policy = EVALUATION_POLICIES[context.evaluation]
+    if policy.allow_locals_access and node_id in context.locals:
+        return context.locals[node_id]
+    if policy.allow_globals_access and node_id in context.globals:
+        return context.globals[node_id]
+    if policy.allow_builtins_access and hasattr(builtins, node_id):
+        # note: do not use __builtins__, it is implementation detail of cPython
+        return getattr(builtins, node_id)
+    if not policy.allow_globals_access and not policy.allow_locals_access:
+        raise GuardRejection(
+            f"Namespace access not allowed in {context.evaluation} mode"
+        )
+    else:
+        raise NameError(f"{node_id} not found in locals, globals, nor builtins")
+
+
+def _eval_or_create_duck(duck_type, node: ast.Call, context: EvaluationContext):
+    policy = EVALUATION_POLICIES[context.evaluation]
+    # if allow-listed builtin is on type annotation, instantiate it
+    if policy.can_call(duck_type) and not node.keywords:
+        args = [eval_node(arg, context) for arg in node.args]
+        return duck_type(*args)
+    # if custom class is in type annotation, mock it
+    return _create_duck_for_heap_type(duck_type)
+
+
+def _create_duck_for_heap_type(duck_type):
+    """Create an imitation of an object of a given type (a duck).
+
+    Returns the duck or NOT_EVALUATED sentinel if duck could not be created.
+    """
+    duck = ImpersonatingDuck()
+    try:
+        # this only works for heap types, not builtins
+        duck.__class__ = duck_type
+        return duck
+    except TypeError:
+        pass
+    return NOT_EVALUATED
+
+
+SUPPORTED_EXTERNAL_GETITEM = {
+    ("pandas", "core", "indexing", "_iLocIndexer"),
+    ("pandas", "core", "indexing", "_LocIndexer"),
+    ("pandas", "DataFrame"),
+    ("pandas", "Series"),
+    ("numpy", "ndarray"),
+    ("numpy", "void"),
+}
+
+
+BUILTIN_GETITEM: set[InstancesHaveGetItem] = {
+    dict,
+    str,  # type: ignore[arg-type]
+    bytes,  # type: ignore[arg-type]
+    list,
+    tuple,
+    collections.defaultdict,
+    collections.deque,
+    collections.OrderedDict,
+    collections.ChainMap,
+    collections.UserDict,
+    collections.UserList,
+    collections.UserString,  # type: ignore[arg-type]
+    _DummyNamedTuple,
+    _IdentitySubscript,
+}
+
+
+def _list_methods(cls, source=None):
+    """For use on immutable objects or with methods returning a copy"""
+    return [getattr(cls, k) for k in (source if source else dir(cls))]
+
+
+dict_non_mutating_methods = ("copy", "keys", "values", "items")
+list_non_mutating_methods = ("copy", "index", "count")
+set_non_mutating_methods = set(dir(set)) & set(dir(frozenset))
+
+
+dict_keys: type[collections.abc.KeysView] = type({}.keys())
+
+NUMERICS = {int, float, complex}
+
+ALLOWED_CALLS = {
+    bytes,
+    *_list_methods(bytes),
+    dict,
+    *_list_methods(dict, dict_non_mutating_methods),
+    dict_keys.isdisjoint,
+    list,
+    *_list_methods(list, list_non_mutating_methods),
+    set,
+    *_list_methods(set, set_non_mutating_methods),
+    frozenset,
+    *_list_methods(frozenset),
+    range,
+    str,
+    *_list_methods(str),
+    tuple,
+    *_list_methods(tuple),
+    *NUMERICS,
+    *[method for numeric_cls in NUMERICS for method in _list_methods(numeric_cls)],
+    collections.deque,
+    *_list_methods(collections.deque, list_non_mutating_methods),
+    collections.defaultdict,
+    *_list_methods(collections.defaultdict, dict_non_mutating_methods),
+    collections.OrderedDict,
+    *_list_methods(collections.OrderedDict, dict_non_mutating_methods),
+    collections.UserDict,
+    *_list_methods(collections.UserDict, dict_non_mutating_methods),
+    collections.UserList,
+    *_list_methods(collections.UserList, list_non_mutating_methods),
+    collections.UserString,
+    *_list_methods(collections.UserString, dir(str)),
+    collections.Counter,
+    *_list_methods(collections.Counter, dict_non_mutating_methods),
+    collections.Counter.elements,
+    collections.Counter.most_common,
+}
+
+BUILTIN_GETATTR: set[MayHaveGetattr] = {
+    *BUILTIN_GETITEM,
+    set,
+    frozenset,
+    object,
+    type,  # `type` handles a lot of generic cases, e.g. numbers as in `int.real`.
+    *NUMERICS,
+    dict_keys,
+    MethodDescriptorType,
+    ModuleType,
+}
+
+
+BUILTIN_OPERATIONS = {*BUILTIN_GETATTR}
+
+EVALUATION_POLICIES = {
+    "minimal": EvaluationPolicy(
+        allow_builtins_access=True,
+        allow_locals_access=False,
+        allow_globals_access=False,
+        allow_item_access=False,
+        allow_attr_access=False,
+        allowed_calls=set(),
+        allow_any_calls=False,
+        allow_all_operations=False,
+    ),
+    "limited": SelectivePolicy(
+        allowed_getitem=BUILTIN_GETITEM,
+        allowed_getitem_external=SUPPORTED_EXTERNAL_GETITEM,
+        allowed_getattr=BUILTIN_GETATTR,
+        allowed_getattr_external={
+            # pandas Series/Frame implements custom `__getattr__`
+            ("pandas", "DataFrame"),
+            ("pandas", "Series"),
+        },
+        allowed_operations=BUILTIN_OPERATIONS,
+        allow_builtins_access=True,
+        allow_locals_access=True,
+        allow_globals_access=True,
+        allowed_calls=ALLOWED_CALLS,
+    ),
+    "unsafe": EvaluationPolicy(
+        allow_builtins_access=True,
+        allow_locals_access=True,
+        allow_globals_access=True,
+        allow_attr_access=True,
+        allow_item_access=True,
+        allow_any_calls=True,
+        allow_all_operations=True,
+    ),
+}
+
+
+__all__ = [
+    "guarded_eval",
+    "eval_node",
+    "GuardRejection",
+    "EvaluationContext",
+    "_unbind_method",
+]

temp_venv/lib/python3.13/site-packages/IPython/core/history.py

@@ -0,0 +1,1218 @@
+"""History related magics and functionality"""
+
+from __future__ import annotations
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+
+import atexit
+import datetime
+import re
+
+
+import threading
+from pathlib import Path
+
+from collections import defaultdict
+from contextlib import contextmanager
+from dataclasses import dataclass
+from decorator import decorator
+from traitlets import (
+    Any,
+    Bool,
+    Dict,
+    Instance,
+    Integer,
+    List,
+    TraitError,
+    Unicode,
+    Union,
+    default,
+    observe,
+)
+from traitlets.config.configurable import LoggingConfigurable
+
+from IPython.paths import locate_profile
+from IPython.utils.decorators import undoc
+from typing import Iterable, Tuple, Optional, TYPE_CHECKING
+import typing
+from warnings import warn
+from weakref import ref, WeakSet
+
+if TYPE_CHECKING:
+    from IPython.core.interactiveshell import InteractiveShell
+    from IPython.config.Configuration import Configuration
+
+try:
+    from sqlite3 import DatabaseError, OperationalError
+    import sqlite3
+
+    sqlite3.register_converter(
+        "timestamp", lambda val: datetime.datetime.fromisoformat(val.decode())
+    )
+
+    sqlite3_found = True
+except ModuleNotFoundError:
+    sqlite3_found = False
+
+    class DatabaseError(Exception):  # type: ignore [no-redef]
+        pass
+
+    class OperationalError(Exception):  # type: ignore [no-redef]
+        pass
+
+
+InOrInOut = typing.Union[str, tuple[str, Optional[str]]]
+
+# -----------------------------------------------------------------------------
+# Classes and functions
+# -----------------------------------------------------------------------------
+
+
+@undoc
+class DummyDB:
+    """Dummy DB that will act as a black hole for history.
+
+    Only used in the absence of sqlite"""
+
+    def execute(*args: typing.Any, **kwargs: typing.Any) -> list:
+        return []
+
+    def commit(self, *args, **kwargs):  # type: ignore [no-untyped-def]
+        pass
+
+    def __enter__(self, *args, **kwargs):  # type: ignore [no-untyped-def]
+        pass
+
+    def __exit__(self, *args, **kwargs):  # type: ignore [no-untyped-def]
+        pass
+
+
+@decorator
+def only_when_enabled(f, self, *a, **kw):  # type: ignore [no-untyped-def]
+    """Decorator: return an empty list in the absence of sqlite."""
+    if not self.enabled:
+        return []
+    else:
+        return f(self, *a, **kw)
+
+
+# use 16kB as threshold for whether a corrupt history db should be saved
+# that should be at least 100 entries or so
+_SAVE_DB_SIZE = 16384
+
+
+@decorator
+def catch_corrupt_db(f, self, *a, **kw):  # type: ignore [no-untyped-def]
+    """A decorator which wraps HistoryAccessor method calls to catch errors from
+    a corrupt SQLite database, move the old database out of the way, and create
+    a new one.
+
+    We avoid clobbering larger databases because this may be triggered due to filesystem issues,
+    not just a corrupt file.
+    """
+    try:
+        return f(self, *a, **kw)
+    except (DatabaseError, OperationalError) as e:
+        self._corrupt_db_counter += 1
+        self.log.error("Failed to open SQLite history %s (%s).", self.hist_file, e)
+        if self.hist_file != ":memory:":
+            if self._corrupt_db_counter > self._corrupt_db_limit:
+                self.hist_file = ":memory:"
+                self.log.error(
+                    "Failed to load history too many times, history will not be saved."
+                )
+            elif self.hist_file.is_file():
+                # move the file out of the way
+                base = str(self.hist_file.parent / self.hist_file.stem)
+                ext = self.hist_file.suffix
+                size = self.hist_file.stat().st_size
+                if size >= _SAVE_DB_SIZE:
+                    # if there's significant content, avoid clobbering
+                    now = (
+                        datetime.datetime.now(datetime.timezone.utc)
+                        .isoformat()
+                        .replace(":", ".")
+                    )
+                    newpath = base + "-corrupt-" + now + ext
+                    # don't clobber previous corrupt backups
+                    for i in range(100):
+                        if not Path(newpath).exists():
+                            break
+                        else:
+                            newpath = base + "-corrupt-" + now + ("-%i" % i) + ext
+                else:
+                    # not much content, possibly empty; don't worry about clobbering
+                    # maybe we should just delete it?
+                    newpath = base + "-corrupt" + ext
+                self.hist_file.rename(newpath)
+                self.log.error(
+                    "History file was moved to %s and a new file created.", newpath
+                )
+            self.init_db()
+            return []
+        else:
+            # Failed with :memory:, something serious is wrong
+            raise
+
+
+class HistoryAccessorBase(LoggingConfigurable):
+    """An abstract class for History Accessors"""
+
+    def get_tail(
+        self,
+        n: int = 10,
+        raw: bool = True,
+        output: bool = False,
+        include_latest: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        raise NotImplementedError
+
+    def search(
+        self,
+        pattern: str = "*",
+        raw: bool = True,
+        search_raw: bool = True,
+        output: bool = False,
+        n: Optional[int] = None,
+        unique: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        raise NotImplementedError
+
+    def get_range(
+        self,
+        session: int,
+        start: int = 1,
+        stop: Optional[int] = None,
+        raw: bool = True,
+        output: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        raise NotImplementedError
+
+    def get_range_by_str(
+        self, rangestr: str, raw: bool = True, output: bool = False
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        raise NotImplementedError
+
+
+class HistoryAccessor(HistoryAccessorBase):
+    """Access the history database without adding to it.
+
+    This is intended for use by standalone history tools. IPython shells use
+    HistoryManager, below, which is a subclass of this."""
+
+    # counter for init_db retries, so we don't keep trying over and over
+    _corrupt_db_counter = 0
+    # after two failures, fallback on :memory:
+    _corrupt_db_limit = 2
+
+    # String holding the path to the history file
+    hist_file = Union(
+        [Instance(Path), Unicode()],
+        help="""Path to file to use for SQLite history database.
+
+        By default, IPython will put the history database in the IPython
+        profile directory.  If you would rather share one history among
+        profiles, you can set this value in each, so that they are consistent.
+
+        Due to an issue with fcntl, SQLite is known to misbehave on some NFS
+        mounts.  If you see IPython hanging, try setting this to something on a
+        local disk, e.g::
+
+            ipython --HistoryManager.hist_file=/tmp/ipython_hist.sqlite
+
+        you can also use the specific value `:memory:` (including the colon
+        at both end but not the back ticks), to avoid creating an history file.
+
+        """,
+    ).tag(config=True)
+
+    enabled = Bool(
+        sqlite3_found,
+        help="""enable the SQLite history
+
+        set enabled=False to disable the SQLite history,
+        in which case there will be no stored history, no SQLite connection,
+        and no background saving thread.  This may be necessary in some
+        threaded environments where IPython is embedded.
+        """,
+    ).tag(config=True)
+
+    connection_options = Dict(
+        help="""Options for configuring the SQLite connection
+
+        These options are passed as keyword args to sqlite3.connect
+        when establishing database connections.
+        """
+    ).tag(config=True)
+
+    @default("connection_options")
+    def _default_connection_options(self) -> dict[str, bool]:
+        return dict(check_same_thread=False)
+
+    # The SQLite database
+    db = Any()
+
+    @observe("db")
+    @only_when_enabled
+    def _db_changed(self, change):  # type: ignore [no-untyped-def]
+        """validate the db, since it can be an Instance of two different types"""
+        new = change["new"]
+        connection_types = (DummyDB, sqlite3.Connection)
+        if not isinstance(new, connection_types):
+            msg = "%s.db must be sqlite3 Connection or DummyDB, not %r" % (
+                self.__class__.__name__,
+                new,
+            )
+            raise TraitError(msg)
+
+    def __init__(
+        self, profile: str = "default", hist_file: str = "", **traits: typing.Any
+    ) -> None:
+        """Create a new history accessor.
+
+        Parameters
+        ----------
+        profile : str
+            The name of the profile from which to open history.
+        hist_file : str
+            Path to an SQLite history database stored by IPython. If specified,
+            hist_file overrides profile.
+        config : :class:`~traitlets.config.loader.Config`
+            Config object. hist_file can also be set through this.
+        """
+        super(HistoryAccessor, self).__init__(**traits)
+        # defer setting hist_file from kwarg until after init,
+        # otherwise the default kwarg value would clobber any value
+        # set by config
+        if hist_file:
+            self.hist_file = hist_file
+
+        try:
+            self.hist_file
+        except TraitError:
+            # No one has set the hist_file, yet.
+            self.hist_file = self._get_hist_file_name(profile)
+
+        self.init_db()
+
+    def _get_hist_file_name(self, profile: str = "default") -> Path:
+        """Find the history file for the given profile name.
+
+        This is overridden by the HistoryManager subclass, to use the shell's
+        active profile.
+
+        Parameters
+        ----------
+        profile : str
+            The name of a profile which has a history file.
+        """
+        return Path(locate_profile(profile)) / "history.sqlite"
+
+    @catch_corrupt_db
+    def init_db(self) -> None:
+        """Connect to the database, and create tables if necessary."""
+        if not self.enabled:
+            self.db = DummyDB()
+            return
+
+        # use detect_types so that timestamps return datetime objects
+        kwargs = dict(detect_types=sqlite3.PARSE_DECLTYPES | sqlite3.PARSE_COLNAMES)
+        kwargs.update(self.connection_options)
+        self.db = sqlite3.connect(str(self.hist_file), **kwargs)  # type: ignore [call-overload]
+        with self.db:
+            self.db.execute(
+                """CREATE TABLE IF NOT EXISTS sessions (session integer
+                            primary key autoincrement, start timestamp,
+                            end timestamp, num_cmds integer, remark text)"""
+            )
+            self.db.execute(
+                """CREATE TABLE IF NOT EXISTS history
+                    (session integer, line integer, source text, source_raw text,
+                    PRIMARY KEY (session, line))"""
+            )
+            # Output history is optional, but ensure the table's there so it can be
+            # enabled later.
+            self.db.execute(
+                """CREATE TABLE IF NOT EXISTS output_history
+                            (session integer, line integer, output text,
+                            PRIMARY KEY (session, line))"""
+            )
+        # success! reset corrupt db count
+        self._corrupt_db_counter = 0
+
+    def writeout_cache(self) -> None:
+        """Overridden by HistoryManager to dump the cache before certain
+        database lookups."""
+        pass
+
+    ## -------------------------------
+    ## Methods for retrieving history:
+    ## -------------------------------
+    def _run_sql(
+        self,
+        sql: str,
+        params: tuple,
+        raw: bool = True,
+        output: bool = False,
+        latest: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Prepares and runs an SQL query for the history database.
+
+        Parameters
+        ----------
+        sql : str
+            Any filtering expressions to go after SELECT ... FROM ...
+        params : tuple
+            Parameters passed to the SQL query (to replace "?")
+        raw, output : bool
+            See :meth:`get_range`
+        latest : bool
+            Select rows with max (session, line)
+
+        Returns
+        -------
+        Tuples as :meth:`get_range`
+        """
+        toget = "source_raw" if raw else "source"
+        sqlfrom = "history"
+        if output:
+            sqlfrom = "history LEFT JOIN output_history USING (session, line)"
+            toget = "history.%s, output_history.output" % toget
+        if latest:
+            toget += ", MAX(session * 128 * 1024 + line)"
+        this_querry = "SELECT session, line, %s FROM %s " % (toget, sqlfrom) + sql
+        cur = self.db.execute(this_querry, params)
+        if latest:
+            cur = (row[:-1] for row in cur)
+        if output:  # Regroup into 3-tuples, and parse JSON
+            return ((ses, lin, (inp, out)) for ses, lin, inp, out in cur)
+        return cur
+
+    @only_when_enabled
+    @catch_corrupt_db
+    def get_session_info(
+        self, session: int
+    ) -> tuple[int, datetime.datetime, Optional[datetime.datetime], Optional[int], str]:
+        """Get info about a session.
+
+        Parameters
+        ----------
+        session : int
+            Session number to retrieve.
+
+        Returns
+        -------
+        session_id : int
+            Session ID number
+        start : datetime
+            Timestamp for the start of the session.
+        end : datetime
+            Timestamp for the end of the session, or None if IPython crashed.
+        num_cmds : int
+            Number of commands run, or None if IPython crashed.
+        remark : str
+            A manually set description.
+        """
+        query = "SELECT * from sessions where session == ?"
+        return self.db.execute(query, (session,)).fetchone()
+
+    @catch_corrupt_db
+    def get_last_session_id(self) -> Optional[int]:
+        """Get the last session ID currently in the database.
+
+        Within IPython, this should be the same as the value stored in
+        :attr:`HistoryManager.session_number`.
+        """
+        for record in self.get_tail(n=1, include_latest=True):
+            return record[0]
+        return None
+
+    @catch_corrupt_db
+    def get_tail(
+        self,
+        n: int = 10,
+        raw: bool = True,
+        output: bool = False,
+        include_latest: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Get the last n lines from the history database.
+
+        Parameters
+        ----------
+        n : int
+            The number of lines to get
+        raw, output : bool
+            See :meth:`get_range`
+        include_latest : bool
+            If False (default), n+1 lines are fetched, and the latest one
+            is discarded. This is intended to be used where the function
+            is called by a user command, which it should not return.
+
+        Returns
+        -------
+        Tuples as :meth:`get_range`
+        """
+        self.writeout_cache()
+        if not include_latest:
+            n += 1
+        cur = self._run_sql(
+            "ORDER BY session DESC, line DESC LIMIT ?", (n,), raw=raw, output=output
+        )
+        if not include_latest:
+            return reversed(list(cur)[1:])
+        return reversed(list(cur))
+
+    @catch_corrupt_db
+    def search(
+        self,
+        pattern: str = "*",
+        raw: bool = True,
+        search_raw: bool = True,
+        output: bool = False,
+        n: Optional[int] = None,
+        unique: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Search the database using unix glob-style matching (wildcards
+        * and ?).
+
+        Parameters
+        ----------
+        pattern : str
+            The wildcarded pattern to match when searching
+        search_raw : bool
+            If True, search the raw input, otherwise, the parsed input
+        raw, output : bool
+            See :meth:`get_range`
+        n : None or int
+            If an integer is given, it defines the limit of
+            returned entries.
+        unique : bool
+            When it is true, return only unique entries.
+
+        Returns
+        -------
+        Tuples as :meth:`get_range`
+        """
+        tosearch = "source_raw" if search_raw else "source"
+        if output:
+            tosearch = "history." + tosearch
+        self.writeout_cache()
+        sqlform = "WHERE %s GLOB ?" % tosearch
+        params: tuple[typing.Any, ...] = (pattern,)
+        if unique:
+            sqlform += " GROUP BY {0}".format(tosearch)
+        if n is not None:
+            sqlform += " ORDER BY session DESC, line DESC LIMIT ?"
+            params += (n,)
+        elif unique:
+            sqlform += " ORDER BY session, line"
+        cur = self._run_sql(sqlform, params, raw=raw, output=output, latest=unique)
+        if n is not None:
+            return reversed(list(cur))
+        return cur
+
+    @catch_corrupt_db
+    def get_range(
+        self,
+        session: int,
+        start: int = 1,
+        stop: Optional[int] = None,
+        raw: bool = True,
+        output: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Retrieve input by session.
+
+        Parameters
+        ----------
+        session : int
+            Session number to retrieve.
+        start : int
+            First line to retrieve.
+        stop : int
+            End of line range (excluded from output itself). If None, retrieve
+            to the end of the session.
+        raw : bool
+            If True, return untranslated input
+        output : bool
+            If True, attempt to include output. This will be 'real' Python
+            objects for the current session, or text reprs from previous
+            sessions if db_log_output was enabled at the time. Where no output
+            is found, None is used.
+
+        Returns
+        -------
+        entries
+            An iterator over the desired lines. Each line is a 3-tuple, either
+            (session, line, input) if output is False, or
+            (session, line, (input, output)) if output is True.
+        """
+        params: tuple[typing.Any, ...]
+        if stop:
+            lineclause = "line >= ? AND line < ?"
+            params = (session, start, stop)
+        else:
+            lineclause = "line>=?"
+            params = (session, start)
+
+        return self._run_sql(
+            "WHERE session==? AND %s" % lineclause, params, raw=raw, output=output
+        )
+
+    def get_range_by_str(
+        self, rangestr: str, raw: bool = True, output: bool = False
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Get lines of history from a string of ranges, as used by magic
+        commands %hist, %save, %macro, etc.
+
+        Parameters
+        ----------
+        rangestr : str
+            A string specifying ranges, e.g. "5 ~2/1-4". If empty string is used,
+            this will return everything from current session's history.
+
+            See the documentation of :func:`%history` for the full details.
+
+        raw, output : bool
+            As :meth:`get_range`
+
+        Returns
+        -------
+        Tuples as :meth:`get_range`
+        """
+        for sess, s, e in extract_hist_ranges(rangestr):
+            yield from self.get_range(sess, s, e, raw=raw, output=output)
+
+
+@dataclass
+class HistoryOutput:
+    output_type: typing.Literal[
+        "out_stream", "err_stream", "display_data", "execute_result"
+    ]
+    bundle: typing.Dict[str, str]
+
+
+class HistoryManager(HistoryAccessor):
+    """A class to organize all history-related functionality in one place."""
+
+    # Public interface
+
+    # An instance of the IPython shell we are attached to
+    shell = Instance(
+        "IPython.core.interactiveshell.InteractiveShellABC", allow_none=False
+    )
+    # Lists to hold processed and raw history. These start with a blank entry
+    # so that we can index them starting from 1
+    input_hist_parsed = List([""])
+    input_hist_raw = List([""])
+    # A list of directories visited during session
+    dir_hist: List = List()
+
+    @default("dir_hist")
+    def _dir_hist_default(self) -> list[Path]:
+        try:
+            return [Path.cwd()]
+        except OSError:
+            return []
+
+    # A dict of output history, keyed with ints from the shell's
+    # execution count.
+    output_hist = Dict()
+    # The text/plain repr of outputs.
+    output_hist_reprs: typing.Dict[int, str] = Dict()  # type: ignore [assignment]
+    # Maps execution_count to MIME bundles
+    outputs: typing.Dict[int, typing.List[HistoryOutput]] = defaultdict(list)
+    # Maps execution_count to exception tracebacks
+    exceptions: typing.Dict[int, typing.Dict[str, Any]] = Dict()  # type: ignore [assignment]
+
+    # The number of the current session in the history database
+    session_number: int = Integer()  # type: ignore [assignment]
+
+    db_log_output = Bool(
+        False, help="Should the history database include output? (default: no)"
+    ).tag(config=True)
+    db_cache_size = Integer(
+        0,
+        help="Write to database every x commands (higher values save disk access & power).\n"
+        "Values of 1 or less effectively disable caching.",
+    ).tag(config=True)
+    # The input and output caches
+    db_input_cache: List[tuple[int, str, str]] = List()
+    db_output_cache: List[tuple[int, str]] = List()
+
+    # History saving in separate thread
+    save_thread = Instance("IPython.core.history.HistorySavingThread", allow_none=True)
+
+    @property
+    def save_flag(self) -> threading.Event | None:
+        if self.save_thread is not None:
+            return self.save_thread.save_flag
+        return None
+
+    # Private interface
+    # Variables used to store the three last inputs from the user.  On each new
+    # history update, we populate the user's namespace with these, shifted as
+    # necessary.
+    _i00 = Unicode("")
+    _i = Unicode("")
+    _ii = Unicode("")
+    _iii = Unicode("")
+
+    # A regex matching all forms of the exit command, so that we don't store
+    # them in the history (it's annoying to rewind the first entry and land on
+    # an exit call).
+    _exit_re = re.compile(r"(exit|quit)(\s*\(.*\))?$")
+
+    _instances: WeakSet[HistoryManager] = WeakSet()
+    _max_inst: int | float = float("inf")
+
+    def __init__(
+        self,
+        shell: InteractiveShell,
+        config: Optional[Configuration] = None,
+        **traits: typing.Any,
+    ):
+        """Create a new history manager associated with a shell instance."""
+        super().__init__(shell=shell, config=config, **traits)
+        self.db_input_cache_lock = threading.Lock()
+        self.db_output_cache_lock = threading.Lock()
+
+        try:
+            self.new_session()
+        except OperationalError:
+            self.log.error(
+                "Failed to create history session in %s. History will not be saved.",
+                self.hist_file,
+                exc_info=True,
+            )
+            self.hist_file = ":memory:"
+
+        if self.enabled and self.hist_file != ":memory:":
+            self.save_thread = HistorySavingThread(self)
+            try:
+                self.save_thread.start()
+            except RuntimeError:
+                self.log.error(
+                    "Failed to start history saving thread. History will not be saved.",
+                    exc_info=True,
+                )
+                self.hist_file = ":memory:"
+        self._instances.add(self)
+        assert len(HistoryManager._instances) <= HistoryManager._max_inst, (
+            len(HistoryManager._instances),
+            HistoryManager._max_inst,
+        )
+
+    def __del__(self) -> None:
+        if self.save_thread is not None:
+            self.save_thread.stop()
+
+    def _get_hist_file_name(self, profile: Optional[str] = None) -> Path:
+        """Get default history file name based on the Shell's profile.
+
+        The profile parameter is ignored, but must exist for compatibility with
+        the parent class."""
+        profile_dir = self.shell.profile_dir.location
+        return Path(profile_dir) / "history.sqlite"
+
+    @only_when_enabled
+    def new_session(self, conn: Optional[sqlite3.Connection] = None) -> None:
+        """Get a new session number."""
+        if conn is None:
+            conn = self.db
+
+        with conn:
+            cur = conn.execute(
+                """INSERT INTO sessions VALUES (NULL, ?, NULL,
+                            NULL, '') """,
+                (datetime.datetime.now().isoformat(" "),),
+            )
+            assert isinstance(cur.lastrowid, int)
+            self.session_number = cur.lastrowid
+
+    def end_session(self) -> None:
+        """Close the database session, filling in the end time and line count."""
+        self.writeout_cache()
+        with self.db:
+            self.db.execute(
+                """UPDATE sessions SET end=?, num_cmds=? WHERE
+                            session==?""",
+                (
+                    datetime.datetime.now(datetime.timezone.utc).isoformat(" "),
+                    len(self.input_hist_parsed) - 1,
+                    self.session_number,
+                ),
+            )
+        self.session_number = 0
+
+    def name_session(self, name: str) -> None:
+        """Give the current session a name in the history database."""
+        warn(
+            "name_session is deprecated in IPython 9.0 and will be removed in future versions",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+        with self.db:
+            self.db.execute(
+                "UPDATE sessions SET remark=? WHERE session==?",
+                (name, self.session_number),
+            )
+
+    def reset(self, new_session: bool = True) -> None:
+        """Clear the session history, releasing all object references, and
+        optionally open a new session."""
+        self.output_hist.clear()
+        self.outputs.clear()
+        self.exceptions.clear()
+
+        # The directory history can't be completely empty
+        self.dir_hist[:] = [Path.cwd()]
+
+        if new_session:
+            if self.session_number:
+                self.end_session()
+            self.input_hist_parsed[:] = [""]
+            self.input_hist_raw[:] = [""]
+            self.new_session()
+
+    # ------------------------------
+    # Methods for retrieving history
+    # ------------------------------
+    def get_session_info(
+        self, session: int = 0
+    ) -> tuple[int, datetime.datetime, Optional[datetime.datetime], Optional[int], str]:
+        """Get info about a session.
+
+        Parameters
+        ----------
+        session : int
+            Session number to retrieve. The current session is 0, and negative
+            numbers count back from current session, so -1 is the previous session.
+
+        Returns
+        -------
+        session_id : int
+            Session ID number
+        start : datetime
+            Timestamp for the start of the session.
+        end : datetime
+            Timestamp for the end of the session, or None if IPython crashed.
+        num_cmds : int
+            Number of commands run, or None if IPython crashed.
+        remark : str
+            A manually set description.
+        """
+        if session <= 0:
+            session += self.session_number
+
+        return super(HistoryManager, self).get_session_info(session=session)
+
+    @catch_corrupt_db
+    def get_tail(
+        self,
+        n: int = 10,
+        raw: bool = True,
+        output: bool = False,
+        include_latest: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Get the last n lines from the history database.
+
+        Most recent entry last.
+
+        Completion will be reordered so that that the last ones are when
+        possible from current session.
+
+        Parameters
+        ----------
+        n : int
+            The number of lines to get
+        raw, output : bool
+            See :meth:`get_range`
+        include_latest : bool
+            If False (default), n+1 lines are fetched, and the latest one
+            is discarded. This is intended to be used where the function
+            is called by a user command, which it should not return.
+
+        Returns
+        -------
+        Tuples as :meth:`get_range`
+        """
+        self.writeout_cache()
+        if not include_latest:
+            n += 1
+        # cursor/line/entry
+        this_cur = list(
+            self._run_sql(
+                "WHERE session == ? ORDER BY line DESC LIMIT ?  ",
+                (self.session_number, n),
+                raw=raw,
+                output=output,
+            )
+        )
+        other_cur = list(
+            self._run_sql(
+                "WHERE session != ? ORDER BY session DESC, line DESC LIMIT ?",
+                (self.session_number, n),
+                raw=raw,
+                output=output,
+            )
+        )
+
+        everything: list[tuple[int, int, InOrInOut]] = this_cur + other_cur
+
+        everything = everything[:n]
+
+        if not include_latest:
+            return list(everything)[:0:-1]
+        return list(everything)[::-1]
+
+    def _get_range_session(
+        self,
+        start: int = 1,
+        stop: Optional[int] = None,
+        raw: bool = True,
+        output: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Get input and output history from the current session. Called by
+        get_range, and takes similar parameters."""
+        input_hist = self.input_hist_raw if raw else self.input_hist_parsed
+
+        n = len(input_hist)
+        if start < 0:
+            start += n
+        if not stop or (stop > n):
+            stop = n
+        elif stop < 0:
+            stop += n
+        line: InOrInOut
+        for i in range(start, stop):
+            if output:
+                line = (input_hist[i], self.output_hist_reprs.get(i))
+            else:
+                line = input_hist[i]
+            yield (0, i, line)
+
+    def get_range(
+        self,
+        session: int = 0,
+        start: int = 1,
+        stop: Optional[int] = None,
+        raw: bool = True,
+        output: bool = False,
+    ) -> Iterable[tuple[int, int, InOrInOut]]:
+        """Retrieve input by session.
+
+        Parameters
+        ----------
+        session : int
+            Session number to retrieve. The current session is 0, and negative
+            numbers count back from current session, so -1 is previous session.
+        start : int
+            First line to retrieve.
+        stop : int
+            End of line range (excluded from output itself). If None, retrieve
+            to the end of the session.
+        raw : bool
+            If True, return untranslated input
+        output : bool
+            If True, attempt to include output. This will be 'real' Python
+            objects for the current session, or text reprs from previous
+            sessions if db_log_output was enabled at the time. Where no output
+            is found, None is used.
+
+        Returns
+        -------
+        entries
+            An iterator over the desired lines. Each line is a 3-tuple, either
+            (session, line, input) if output is False, or
+            (session, line, (input, output)) if output is True.
+        """
+        if session <= 0:
+            session += self.session_number
+        if session == self.session_number:  # Current session
+            return self._get_range_session(start, stop, raw, output)
+        return super(HistoryManager, self).get_range(session, start, stop, raw, output)
+
+    ## ----------------------------
+    ## Methods for storing history:
+    ## ----------------------------
+    def store_inputs(
+        self, line_num: int, source: str, source_raw: Optional[str] = None
+    ) -> None:
+        """Store source and raw input in history and create input cache
+        variables ``_i*``.
+
+        Parameters
+        ----------
+        line_num : int
+            The prompt number of this input.
+        source : str
+            Python input.
+        source_raw : str, optional
+            If given, this is the raw input without any IPython transformations
+            applied to it.  If not given, ``source`` is used.
+        """
+        if source_raw is None:
+            source_raw = source
+        source = source.rstrip("\n")
+        source_raw = source_raw.rstrip("\n")
+
+        # do not store exit/quit commands
+        if self._exit_re.match(source_raw.strip()):
+            return
+
+        self.input_hist_parsed.append(source)
+        self.input_hist_raw.append(source_raw)
+
+        with self.db_input_cache_lock:
+            self.db_input_cache.append((line_num, source, source_raw))
+            # Trigger to flush cache and write to DB.
+            if len(self.db_input_cache) >= self.db_cache_size:
+                if self.save_flag:
+                    self.save_flag.set()
+
+        # update the auto _i variables
+        self._iii = self._ii
+        self._ii = self._i
+        self._i = self._i00
+        self._i00 = source_raw
+
+        # hackish access to user namespace to create _i1,_i2... dynamically
+        new_i = "_i%s" % line_num
+        to_main = {"_i": self._i, "_ii": self._ii, "_iii": self._iii, new_i: self._i00}
+
+        if self.shell is not None:
+            self.shell.push(to_main, interactive=False)
+
+    def store_output(self, line_num: int) -> None:
+        """If database output logging is enabled, this saves all the
+        outputs from the indicated prompt number to the database. It's
+        called by run_cell after code has been executed.
+
+        Parameters
+        ----------
+        line_num : int
+            The line number from which to save outputs
+        """
+        if (not self.db_log_output) or (line_num not in self.output_hist_reprs):
+            return
+        lnum: int = line_num
+        output = self.output_hist_reprs[line_num]
+
+        with self.db_output_cache_lock:
+            self.db_output_cache.append((line_num, output))
+        if self.db_cache_size <= 1 and self.save_flag is not None:
+            self.save_flag.set()
+
+    def _writeout_input_cache(self, conn: sqlite3.Connection) -> None:
+        with conn:
+            for line in self.db_input_cache:
+                conn.execute(
+                    "INSERT INTO history VALUES (?, ?, ?, ?)",
+                    (self.session_number,) + line,
+                )
+
+    def _writeout_output_cache(self, conn: sqlite3.Connection) -> None:
+        with conn:
+            for line in self.db_output_cache:
+                conn.execute(
+                    "INSERT INTO output_history VALUES (?, ?, ?)",
+                    (self.session_number,) + line,
+                )
+
+    @only_when_enabled
+    def writeout_cache(self, conn: Optional[sqlite3.Connection] = None) -> None:
+        """Write any entries in the cache to the database."""
+        if conn is None:
+            conn = self.db
+
+        with self.db_input_cache_lock:
+            try:
+                self._writeout_input_cache(conn)
+            except sqlite3.IntegrityError:
+                self.new_session(conn)
+                print(
+                    "ERROR! Session/line number was not unique in",
+                    "database. History logging moved to new session",
+                    self.session_number,
+                )
+                try:
+                    # Try writing to the new session. If this fails, don't
+                    # recurse
+                    self._writeout_input_cache(conn)
+                except sqlite3.IntegrityError:
+                    pass
+            finally:
+                self.db_input_cache = []
+
+        with self.db_output_cache_lock:
+            try:
+                self._writeout_output_cache(conn)
+            except sqlite3.IntegrityError:
+                print(
+                    "!! Session/line number for output was not unique",
+                    "in database. Output will not be stored.",
+                )
+            finally:
+                self.db_output_cache = []
+
+
+from typing import Callable, Iterator
+from weakref import ReferenceType
+
+
+@contextmanager
+def hold(ref: ReferenceType[HistoryManager]) -> Iterator[ReferenceType[HistoryManager]]:
+    """
+    Context manger that hold a reference to a weak ref to make sure it
+    is not GC'd during it's context.
+    """
+    r = ref()
+    yield ref
+    del r
+
+
+class HistorySavingThread(threading.Thread):
+    """This thread takes care of writing history to the database, so that
+    the UI isn't held up while that happens.
+
+    It waits for the HistoryManager's save_flag to be set, then writes out
+    the history cache. The main thread is responsible for setting the flag when
+    the cache size reaches a defined threshold."""
+
+    save_flag: threading.Event
+    daemon: bool = True
+    _stop_now: bool = False
+    enabled: bool = True
+    history_manager: ref[HistoryManager]
+    _stopped = False
+
+    def __init__(self, history_manager: HistoryManager) -> None:
+        super(HistorySavingThread, self).__init__(name="IPythonHistorySavingThread")
+        self.history_manager = ref(history_manager)
+        self.enabled = history_manager.enabled
+        self.save_flag = threading.Event()
+
+    @only_when_enabled
+    def run(self) -> None:
+        atexit.register(self.stop)
+        # We need a separate db connection per thread:
+        try:
+            hm: ReferenceType[HistoryManager]
+            with hold(self.history_manager) as hm:
+                if hm() is not None:
+                    self.db = sqlite3.connect(
+                        str(hm().hist_file),  # type: ignore [union-attr]
+                        **hm().connection_options,  # type: ignore [union-attr]
+                    )
+            while True:
+                self.save_flag.wait()
+                with hold(self.history_manager) as hm:
+                    if hm() is None:
+                        self._stop_now = True
+                    if self._stop_now:
+                        self.db.close()
+                        return
+                    self.save_flag.clear()
+                    if hm() is not None:
+                        hm().writeout_cache(self.db)  # type: ignore [union-attr]
+
+        except Exception as e:
+            print(
+                (
+                    "The history saving thread hit an unexpected error (%s)."
+                    "History will not be written to the database."
+                )
+                % repr(e)
+            )
+        finally:
+            atexit.unregister(self.stop)
+
+    def stop(self) -> None:
+        """This can be called from the main thread to safely stop this thread.
+
+        Note that it does not attempt to write out remaining history before
+        exiting. That should be done by calling the HistoryManager's
+        end_session method."""
+        if self._stopped:
+            return
+        self._stop_now = True
+
+        self.save_flag.set()
+        self._stopped = True
+        if self != threading.current_thread():
+            self.join()
+
+    def __del__(self) -> None:
+        self.stop()
+
+
+# To match, e.g. ~5/8-~2/3
+range_re = re.compile(
+    r"""
+((?P<startsess>~?\d+)/)?
+(?P<start>\d+)?
+((?P<sep>[\-:])
+ ((?P<endsess>~?\d+)/)?
+ (?P<end>\d+))?
+$""",
+    re.VERBOSE,
+)
+
+
+def extract_hist_ranges(ranges_str: str) -> Iterable[tuple[int, int, Optional[int]]]:
+    """Turn a string of history ranges into 3-tuples of (session, start, stop).
+
+    Empty string results in a `[(0, 1, None)]`, i.e. "everything from current
+    session".
+
+    Examples
+    --------
+    >>> list(extract_hist_ranges("~8/5-~7/4 2"))
+    [(-8, 5, None), (-7, 1, 5), (0, 2, 3)]
+    """
+    if ranges_str == "":
+        yield (0, 1, None)  # Everything from current session
+        return
+
+    for range_str in ranges_str.split():
+        rmatch = range_re.match(range_str)
+        if not rmatch:
+            continue
+        start = rmatch.group("start")
+        if start:
+            start = int(start)
+            end = rmatch.group("end")
+            # If no end specified, get (a, a + 1)
+            end = int(end) if end else start + 1
+        else:  # start not specified
+            if not rmatch.group("startsess"):  # no startsess
+                continue
+            start = 1
+            end = None  # provide the entire session hist
+
+        if rmatch.group("sep") == "-":  # 1-3 == 1:4 --> [1, 2, 3]
+            assert end is not None
+            end += 1
+        startsess = rmatch.group("startsess") or "0"
+        endsess = rmatch.group("endsess") or startsess
+        startsess = int(startsess.replace("~", "-"))
+        endsess = int(endsess.replace("~", "-"))
+        assert endsess >= startsess, "start session must be earlier than end session"
+
+        if endsess == startsess:
+            yield (startsess, start, end)
+            continue
+        # Multiple sessions in one range:
+        yield (startsess, start, None)
+        for sess in range(startsess + 1, endsess):
+            yield (sess, 1, None)
+        yield (endsess, 1, end)
+
+
+def _format_lineno(session: int, line: int) -> str:
+    """Helper function to format line numbers properly."""
+    if session == 0:
+        return str(line)
+    return "%s#%s" % (session, line)

temp_venv/lib/python3.13/site-packages/IPython/core/inputtransformer2.py

@@ -0,0 +1,808 @@
+"""Input transformer machinery to support IPython special syntax.
+
+This includes the machinery to recognise and transform ``%magic`` commands,
+``!system`` commands, ``help?`` querying, prompt stripping, and so forth.
+
+Added: IPython 7.0. Replaces inputsplitter and inputtransformer which were
+deprecated in 7.0 and removed in 9.0
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import ast
+from codeop import CommandCompiler, Compile
+import re
+import sys
+import tokenize
+from typing import List, Tuple, Optional, Any
+import warnings
+from textwrap import dedent
+
+from IPython.utils import tokenutil
+
+_indent_re = re.compile(r'^[ \t]+')
+
+def leading_empty_lines(lines):
+    """Remove leading empty lines
+
+    If the leading lines are empty or contain only whitespace, they will be
+    removed.
+    """
+    if not lines:
+        return lines
+    for i, line in enumerate(lines):
+        if line and not line.isspace():
+            return lines[i:]
+    return lines
+
+def leading_indent(lines):
+    """Remove leading indentation.
+
+    Removes the minimum common leading indentation from all lines.
+    """
+    if not lines:
+        return lines
+    return dedent("".join(lines)).splitlines(keepends=True)
+
+class PromptStripper:
+    """Remove matching input prompts from a block of input.
+
+    Parameters
+    ----------
+    prompt_re : regular expression
+        A regular expression matching any input prompt (including continuation,
+        e.g. ``...``)
+    initial_re : regular expression, optional
+        A regular expression matching only the initial prompt, but not continuation.
+        If no initial expression is given, prompt_re will be used everywhere.
+        Used mainly for plain Python prompts (``>>>``), where the continuation prompt
+        ``...`` is a valid Python expression in Python 3, so shouldn't be stripped.
+
+    Notes
+    -----
+
+    If initial_re and prompt_re differ,
+    only initial_re will be tested against the first line.
+    If any prompt is found on the first two lines,
+    prompts will be stripped from the rest of the block.
+    """
+    def __init__(self, prompt_re, initial_re=None):
+        self.prompt_re = prompt_re
+        self.initial_re = initial_re or prompt_re
+
+    def _strip(self, lines):
+        return [self.prompt_re.sub('', l, count=1) for l in lines]
+
+    def __call__(self, lines):
+        if not lines:
+            return lines
+        if self.initial_re.match(lines[0]) or \
+                (len(lines) > 1 and self.prompt_re.match(lines[1])):
+            return self._strip(lines)
+        return lines
+
+classic_prompt = PromptStripper(
+    prompt_re=re.compile(r'^(>>>|\.\.\.)( |$)'),
+    initial_re=re.compile(r'^>>>( |$)')
+)
+
+ipython_prompt = PromptStripper(
+    re.compile(
+        r"""
+        ^(                         # Match from the beginning of a line, either:
+
+                                   # 1. First-line prompt:
+        ((\[nav\]|\[ins\])?\ )?    # Vi editing mode prompt, if it's there
+        In\                        # The 'In' of the prompt, with a space
+        \[\d+\]:                   # Command index, as displayed in the prompt
+        \                          # With a mandatory trailing space
+
+        |                          # ... or ...
+
+                                   # 2. The three dots of the multiline prompt
+        \s*                        # All leading whitespace characters
+        \.{3,}:                    # The three (or more) dots
+        \ ?                        # With an optional trailing space
+
+        )
+        """,
+        re.VERBOSE,
+    )
+)
+
+
+def cell_magic(lines):
+    if not lines or not lines[0].startswith('%%'):
+        return lines
+    if re.match(r'%%\w+\?', lines[0]):
+        # This case will be handled by help_end
+        return lines
+    magic_name, _, first_line = lines[0][2:].rstrip().partition(' ')
+    body = ''.join(lines[1:])
+    return ['get_ipython().run_cell_magic(%r, %r, %r)\n'
+            % (magic_name, first_line, body)]
+
+
+def _find_assign_op(token_line) -> Optional[int]:
+    """Get the index of the first assignment in the line ('=' not inside brackets)
+
+    Note: We don't try to support multiple special assignment (a = b = %foo)
+    """
+    paren_level = 0
+    for i, ti in enumerate(token_line):
+        s = ti.string
+        if s == '=' and paren_level == 0:
+            return i
+        if s in {'(','[','{'}:
+            paren_level += 1
+        elif s in {')', ']', '}'}:
+            if paren_level > 0:
+                paren_level -= 1
+    return None
+
+def find_end_of_continued_line(lines, start_line: int):
+    """Find the last line of a line explicitly extended using backslashes.
+
+    Uses 0-indexed line numbers.
+    """
+    end_line = start_line
+    while lines[end_line].endswith('\\\n'):
+        end_line += 1
+        if end_line >= len(lines):
+            break
+    return end_line
+
+def assemble_continued_line(lines, start: Tuple[int, int], end_line: int):
+    r"""Assemble a single line from multiple continued line pieces
+
+    Continued lines are lines ending in ``\``, and the line following the last
+    ``\`` in the block.
+
+    For example, this code continues over multiple lines::
+
+        if (assign_ix is not None) \
+             and (len(line) >= assign_ix + 2) \
+             and (line[assign_ix+1].string == '%') \
+             and (line[assign_ix+2].type == tokenize.NAME):
+
+    This statement contains four continued line pieces.
+    Assembling these pieces into a single line would give::
+
+        if (assign_ix is not None) and (len(line) >= assign_ix + 2) and (line[...
+
+    This uses 0-indexed line numbers. *start* is (lineno, colno).
+
+    Used to allow ``%magic`` and ``!system`` commands to be continued over
+    multiple lines.
+    """
+    parts = [lines[start[0]][start[1]:]] + lines[start[0]+1:end_line+1]
+    return ' '.join([p.rstrip()[:-1] for p in parts[:-1]]  # Strip backslash+newline
+                    + [parts[-1].rstrip()])         # Strip newline from last line
+
+class TokenTransformBase:
+    """Base class for transformations which examine tokens.
+
+    Special syntax should not be transformed when it occurs inside strings or
+    comments. This is hard to reliably avoid with regexes. The solution is to
+    tokenise the code as Python, and recognise the special syntax in the tokens.
+
+    IPython's special syntax is not valid Python syntax, so tokenising may go
+    wrong after the special syntax starts. These classes therefore find and
+    transform *one* instance of special syntax at a time into regular Python
+    syntax. After each transformation, tokens are regenerated to find the next
+    piece of special syntax.
+
+    Subclasses need to implement one class method (find)
+    and one regular method (transform).
+
+    The priority attribute can select which transformation to apply if multiple
+    transformers match in the same place. Lower numbers have higher priority.
+    This allows "%magic?" to be turned into a help call rather than a magic call.
+    """
+    # Lower numbers -> higher priority (for matches in the same location)
+    priority = 10
+
+    def sortby(self):
+        return self.start_line, self.start_col, self.priority
+
+    def __init__(self, start):
+        self.start_line = start[0] - 1   # Shift from 1-index to 0-index
+        self.start_col = start[1]
+
+    @classmethod
+    def find(cls, tokens_by_line):
+        """Find one instance of special syntax in the provided tokens.
+
+        Tokens are grouped into logical lines for convenience,
+        so it is easy to e.g. look at the first token of each line.
+        *tokens_by_line* is a list of lists of tokenize.TokenInfo objects.
+
+        This should return an instance of its class, pointing to the start
+        position it has found, or None if it found no match.
+        """
+        raise NotImplementedError
+
+    def transform(self, lines: List[str]):
+        """Transform one instance of special syntax found by ``find()``
+
+        Takes a list of strings representing physical lines,
+        returns a similar list of transformed lines.
+        """
+        raise NotImplementedError
+
+class MagicAssign(TokenTransformBase):
+    """Transformer for assignments from magics (a = %foo)"""
+    @classmethod
+    def find(cls, tokens_by_line):
+        """Find the first magic assignment (a = %foo) in the cell.
+        """
+        for line in tokens_by_line:
+            assign_ix = _find_assign_op(line)
+            if (assign_ix is not None) \
+                    and (len(line) >= assign_ix + 2) \
+                    and (line[assign_ix+1].string == '%') \
+                    and (line[assign_ix+2].type == tokenize.NAME):
+                return cls(line[assign_ix+1].start)
+
+    def transform(self, lines: List[str]):
+        """Transform a magic assignment found by the ``find()`` classmethod.
+        """
+        start_line, start_col = self.start_line, self.start_col
+        lhs = lines[start_line][:start_col]
+        end_line = find_end_of_continued_line(lines, start_line)
+        rhs = assemble_continued_line(lines, (start_line, start_col), end_line)
+        assert rhs.startswith('%'), rhs
+        magic_name, _, args = rhs[1:].partition(' ')
+
+        lines_before = lines[:start_line]
+        call = "get_ipython().run_line_magic({!r}, {!r})".format(magic_name, args)
+        new_line = lhs + call + '\n'
+        lines_after = lines[end_line+1:]
+
+        return lines_before + [new_line] + lines_after
+
+
+class SystemAssign(TokenTransformBase):
+    """Transformer for assignments from system commands (a = !foo)"""
+    @classmethod
+    def find_pre_312(cls, tokens_by_line):
+        for line in tokens_by_line:
+            assign_ix = _find_assign_op(line)
+            if (assign_ix is not None) \
+                    and not line[assign_ix].line.strip().startswith('=') \
+                    and (len(line) >= assign_ix + 2) \
+                    and (line[assign_ix + 1].type == tokenize.ERRORTOKEN):
+                ix = assign_ix + 1
+
+                while ix < len(line) and line[ix].type == tokenize.ERRORTOKEN:
+                    if line[ix].string == '!':
+                        return cls(line[ix].start)
+                    elif not line[ix].string.isspace():
+                        break
+                    ix += 1
+
+    @classmethod
+    def find_post_312(cls, tokens_by_line):
+        for line in tokens_by_line:
+            assign_ix = _find_assign_op(line)
+            if (
+                (assign_ix is not None)
+                and not line[assign_ix].line.strip().startswith("=")
+                and (len(line) >= assign_ix + 2)
+                and (line[assign_ix + 1].type == tokenize.OP)
+                and (line[assign_ix + 1].string == "!")
+            ):
+                return cls(line[assign_ix + 1].start)
+
+    @classmethod
+    def find(cls, tokens_by_line):
+        """Find the first system assignment (a = !foo) in the cell."""
+        if sys.version_info < (3, 12):
+            return cls.find_pre_312(tokens_by_line)
+        return cls.find_post_312(tokens_by_line)
+
+    def transform(self, lines: List[str]):
+        """Transform a system assignment found by the ``find()`` classmethod.
+        """
+        start_line, start_col = self.start_line, self.start_col
+
+        lhs = lines[start_line][:start_col]
+        end_line = find_end_of_continued_line(lines, start_line)
+        rhs = assemble_continued_line(lines, (start_line, start_col), end_line)
+        assert rhs.startswith('!'), rhs
+        cmd = rhs[1:]
+
+        lines_before = lines[:start_line]
+        call = "get_ipython().getoutput({!r})".format(cmd)
+        new_line = lhs + call + '\n'
+        lines_after = lines[end_line + 1:]
+
+        return lines_before + [new_line] + lines_after
+
+# The escape sequences that define the syntax transformations IPython will
+# apply to user input.  These can NOT be just changed here: many regular
+# expressions and other parts of the code may use their hardcoded values, and
+# for all intents and purposes they constitute the 'IPython syntax', so they
+# should be considered fixed.
+
+ESC_SHELL  = '!'     # Send line to underlying system shell
+ESC_SH_CAP = '!!'    # Send line to system shell and capture output
+ESC_HELP   = '?'     # Find information about object
+ESC_HELP2  = '??'    # Find extra-detailed information about object
+ESC_MAGIC  = '%'     # Call magic function
+ESC_MAGIC2 = '%%'    # Call cell-magic function
+ESC_QUOTE  = ','     # Split args on whitespace, quote each as string and call
+ESC_QUOTE2 = ';'     # Quote all args as a single string, call
+ESC_PAREN  = '/'     # Call first argument with rest of line as arguments
+
+ESCAPE_SINGLES = {'!', '?', '%', ',', ';', '/'}
+ESCAPE_DOUBLES = {'!!', '??'}  # %% (cell magic) is handled separately
+
+def _make_help_call(target, esc):
+    """Prepares a pinfo(2)/psearch call from a target name and the escape
+    (i.e. ? or ??)"""
+    method  = 'pinfo2' if esc == '??' \
+                else 'psearch' if '*' in target \
+                else 'pinfo'
+    arg = " ".join([method, target])
+    #Prepare arguments for get_ipython().run_line_magic(magic_name, magic_args)
+    t_magic_name, _, t_magic_arg_s = arg.partition(' ')
+    t_magic_name = t_magic_name.lstrip(ESC_MAGIC)
+    return "get_ipython().run_line_magic(%r, %r)" % (t_magic_name, t_magic_arg_s)
+
+
+def _tr_help(content):
+    """Translate lines escaped with: ?
+
+    A naked help line should fire the intro help screen (shell.show_usage())
+    """
+    if not content:
+        return 'get_ipython().show_usage()'
+
+    return _make_help_call(content, '?')
+
+def _tr_help2(content):
+    """Translate lines escaped with: ??
+
+    A naked help line should fire the intro help screen (shell.show_usage())
+    """
+    if not content:
+        return 'get_ipython().show_usage()'
+
+    return _make_help_call(content, '??')
+
+def _tr_magic(content):
+    "Translate lines escaped with a percent sign: %"
+    name, _, args = content.partition(' ')
+    return 'get_ipython().run_line_magic(%r, %r)' % (name, args)
+
+def _tr_quote(content):
+    "Translate lines escaped with a comma: ,"
+    name, _, args = content.partition(' ')
+    return '%s("%s")' % (name, '", "'.join(args.split()) )
+
+def _tr_quote2(content):
+    "Translate lines escaped with a semicolon: ;"
+    name, _, args = content.partition(' ')
+    return '%s("%s")' % (name, args)
+
+def _tr_paren(content):
+    "Translate lines escaped with a slash: /"
+    name, _, args = content.partition(" ")
+    if name == "":
+        raise SyntaxError(f'"{ESC_SHELL}" must be followed by a callable name')
+
+    return '%s(%s)' % (name, ", ".join(args.split()))
+
+tr = { ESC_SHELL  : 'get_ipython().system({!r})'.format,
+       ESC_SH_CAP : 'get_ipython().getoutput({!r})'.format,
+       ESC_HELP   : _tr_help,
+       ESC_HELP2  : _tr_help2,
+       ESC_MAGIC  : _tr_magic,
+       ESC_QUOTE  : _tr_quote,
+       ESC_QUOTE2 : _tr_quote2,
+       ESC_PAREN  : _tr_paren }
+
+class EscapedCommand(TokenTransformBase):
+    """Transformer for escaped commands like %foo, !foo, or /foo"""
+    @classmethod
+    def find(cls, tokens_by_line):
+        """Find the first escaped command (%foo, !foo, etc.) in the cell.
+        """
+        for line in tokens_by_line:
+            if not line:
+                continue
+            ix = 0
+            ll = len(line)
+            while ll > ix and line[ix].type in {tokenize.INDENT, tokenize.DEDENT}:
+                ix += 1
+            if ix >= ll:
+                continue
+            if line[ix].string in ESCAPE_SINGLES:
+                return cls(line[ix].start)
+
+    def transform(self, lines):
+        """Transform an escaped line found by the ``find()`` classmethod.
+        """
+        start_line, start_col = self.start_line, self.start_col
+
+        indent = lines[start_line][:start_col]
+        end_line = find_end_of_continued_line(lines, start_line)
+        line = assemble_continued_line(lines, (start_line, start_col), end_line)
+
+        if len(line) > 1 and line[:2] in ESCAPE_DOUBLES:
+            escape, content = line[:2], line[2:]
+        else:
+            escape, content = line[:1], line[1:]
+
+        if escape in tr:
+            call = tr[escape](content)
+        else:
+            call = ''
+
+        lines_before = lines[:start_line]
+        new_line = indent + call + '\n'
+        lines_after = lines[end_line + 1:]
+
+        return lines_before + [new_line] + lines_after
+
+
+_help_end_re = re.compile(
+    r"""(%{0,2}
+    (?!\d)[\w*]+            # Variable name
+    (\.(?!\d)[\w*]+|\[-?[0-9]+\])*       # .etc.etc or [0], we only support literal integers.
+    )
+    (\?\??)$                # ? or ??
+    """,
+    re.VERBOSE,
+)
+
+
+class HelpEnd(TokenTransformBase):
+    """Transformer for help syntax: obj? and obj??"""
+    # This needs to be higher priority (lower number) than EscapedCommand so
+    # that inspecting magics (%foo?) works.
+    priority = 5
+
+    def __init__(self, start, q_locn):
+        super().__init__(start)
+        self.q_line = q_locn[0] - 1  # Shift from 1-indexed to 0-indexed
+        self.q_col = q_locn[1]
+
+    @classmethod
+    def find(cls, tokens_by_line):
+        """Find the first help command (foo?) in the cell.
+        """
+        for line in tokens_by_line:
+            # Last token is NEWLINE; look at last but one
+            if len(line) > 2 and line[-2].string == '?':
+                # Find the first token that's not INDENT/DEDENT
+                ix = 0
+                while line[ix].type in {tokenize.INDENT, tokenize.DEDENT}:
+                    ix += 1
+                return cls(line[ix].start, line[-2].start)
+
+    def transform(self, lines):
+        """Transform a help command found by the ``find()`` classmethod.
+        """
+
+        piece = "".join(lines[self.start_line : self.q_line + 1])
+        indent, content = piece[: self.start_col], piece[self.start_col :]
+        lines_before = lines[: self.start_line]
+        lines_after = lines[self.q_line + 1 :]
+
+        m = _help_end_re.search(content)
+        if not m:
+            raise SyntaxError(content)
+        assert m is not None, content
+        target = m.group(1)
+        esc = m.group(3)
+
+
+        call = _make_help_call(target, esc)
+        new_line = indent + call + '\n'
+
+        return lines_before + [new_line] + lines_after
+
+def make_tokens_by_line(lines:List[str]):
+    """Tokenize a series of lines and group tokens by line.
+
+    The tokens for a multiline Python string or expression are grouped as one
+    line. All lines except the last lines should keep their line ending ('\\n',
+    '\\r\\n') for this to properly work. Use `.splitlines(keeplineending=True)`
+    for example when passing block of text to this function.
+
+    """
+    # NL tokens are used inside multiline expressions, but also after blank
+    # lines or comments. This is intentional - see https://bugs.python.org/issue17061
+    # We want to group the former case together but split the latter, so we
+    # track parentheses level, similar to the internals of tokenize.
+
+    #   reexported from token on 3.7+
+    NEWLINE, NL = tokenize.NEWLINE, tokenize.NL  # type: ignore
+    tokens_by_line: List[List[Any]] = [[]]
+    if len(lines) > 1 and not lines[0].endswith(("\n", "\r", "\r\n", "\x0b", "\x0c")):
+        warnings.warn(
+            "`make_tokens_by_line` received a list of lines which do not have lineending markers ('\\n', '\\r', '\\r\\n', '\\x0b', '\\x0c'), behavior will be unspecified",
+            stacklevel=2,
+        )
+    parenlev = 0
+    try:
+        for token in tokenutil.generate_tokens_catch_errors(
+            iter(lines).__next__, extra_errors_to_catch=["expected EOF"]
+        ):
+            tokens_by_line[-1].append(token)
+            if (token.type == NEWLINE) \
+                    or ((token.type == NL) and (parenlev <= 0)):
+                tokens_by_line.append([])
+            elif token.string in {'(', '[', '{'}:
+                parenlev += 1
+            elif token.string in {')', ']', '}'}:
+                if parenlev > 0:
+                    parenlev -= 1
+    except tokenize.TokenError:
+        # Input ended in a multiline string or expression. That's OK for us.
+        pass
+
+
+    if not tokens_by_line[-1]:
+        tokens_by_line.pop()
+
+
+    return tokens_by_line
+
+
+def has_sunken_brackets(tokens: List[tokenize.TokenInfo]):
+    """Check if the depth of brackets in the list of tokens drops below 0"""
+    parenlev = 0
+    for token in tokens:
+        if token.string in {"(", "[", "{"}:
+            parenlev += 1
+        elif token.string in {")", "]", "}"}:
+            parenlev -= 1
+            if parenlev < 0:
+                return True
+    return False
+
+# Arbitrary limit to prevent getting stuck in infinite loops
+TRANSFORM_LOOP_LIMIT = 500
+
+class TransformerManager:
+    """Applies various transformations to a cell or code block.
+
+    The key methods for external use are ``transform_cell()``
+    and ``check_complete()``.
+    """
+    def __init__(self):
+        self.cleanup_transforms = [
+            leading_empty_lines,
+            leading_indent,
+            classic_prompt,
+            ipython_prompt,
+        ]
+        self.line_transforms = [
+            cell_magic,
+        ]
+        self.token_transformers = [
+            MagicAssign,
+            SystemAssign,
+            EscapedCommand,
+            HelpEnd,
+        ]
+
+    def do_one_token_transform(self, lines):
+        """Find and run the transform earliest in the code.
+
+        Returns (changed, lines).
+
+        This method is called repeatedly until changed is False, indicating
+        that all available transformations are complete.
+
+        The tokens following IPython special syntax might not be valid, so
+        the transformed code is retokenised every time to identify the next
+        piece of special syntax. Hopefully long code cells are mostly valid
+        Python, not using lots of IPython special syntax, so this shouldn't be
+        a performance issue.
+        """
+        tokens_by_line = make_tokens_by_line(lines)
+        candidates = []
+        for transformer_cls in self.token_transformers:
+            transformer = transformer_cls.find(tokens_by_line)
+            if transformer:
+                candidates.append(transformer)
+
+        if not candidates:
+            # Nothing to transform
+            return False, lines
+        ordered_transformers = sorted(candidates, key=TokenTransformBase.sortby)
+        for transformer in ordered_transformers:
+            try:
+                return True, transformer.transform(lines)
+            except SyntaxError:
+                pass
+        return False, lines
+
+    def do_token_transforms(self, lines):
+        for _ in range(TRANSFORM_LOOP_LIMIT):
+            changed, lines = self.do_one_token_transform(lines)
+            if not changed:
+                return lines
+
+        raise RuntimeError("Input transformation still changing after "
+                           "%d iterations. Aborting." % TRANSFORM_LOOP_LIMIT)
+
+    def transform_cell(self, cell: str) -> str:
+        """Transforms a cell of input code"""
+        if not cell.endswith('\n'):
+            cell += '\n'  # Ensure the cell has a trailing newline
+        lines = cell.splitlines(keepends=True)
+        for transform in self.cleanup_transforms + self.line_transforms:
+            lines = transform(lines)
+
+        lines = self.do_token_transforms(lines)
+        return ''.join(lines)
+
+    def check_complete(self, cell: str):
+        """Return whether a block of code is ready to execute, or should be continued
+
+        Parameters
+        ----------
+        cell : string
+            Python input code, which can be multiline.
+
+        Returns
+        -------
+        status : str
+            One of 'complete', 'incomplete', or 'invalid' if source is not a
+            prefix of valid code.
+        indent_spaces : int or None
+            The number of spaces by which to indent the next line of code. If
+            status is not 'incomplete', this is None.
+        """
+        # Remember if the lines ends in a new line.
+        ends_with_newline = False
+        for character in reversed(cell):
+            if character == '\n':
+                ends_with_newline = True
+                break
+            elif character.strip():
+                break
+            else:
+                continue
+
+        if not ends_with_newline:
+            # Append an newline for consistent tokenization
+            # See https://bugs.python.org/issue33899
+            cell += '\n'
+
+        lines = cell.splitlines(keepends=True)
+
+        if not lines:
+            return 'complete', None
+
+        for line in reversed(lines):
+            if not line.strip():
+                continue
+            elif line.strip("\n").endswith("\\"):
+                return "incomplete", find_last_indent(lines)
+            else:
+                break
+
+        try:
+            for transform in self.cleanup_transforms:
+                if not getattr(transform, 'has_side_effects', False):
+                    lines = transform(lines)
+        except SyntaxError:
+            return 'invalid', None
+
+        if lines[0].startswith('%%'):
+            # Special case for cell magics - completion marked by blank line
+            if lines[-1].strip():
+                return 'incomplete', find_last_indent(lines)
+            else:
+                return 'complete', None
+
+        try:
+            for transform in self.line_transforms:
+                if not getattr(transform, 'has_side_effects', False):
+                    lines = transform(lines)
+            lines = self.do_token_transforms(lines)
+        except SyntaxError:
+            return 'invalid', None
+
+        tokens_by_line = make_tokens_by_line(lines)
+
+        # Bail if we got one line and there are more closing parentheses than
+        # the opening ones
+        if (
+            len(lines) == 1
+            and tokens_by_line
+            and has_sunken_brackets(tokens_by_line[0])
+        ):
+            return "invalid", None
+
+        if not tokens_by_line:
+            return 'incomplete', find_last_indent(lines)
+
+        if (
+            tokens_by_line[-1][-1].type != tokenize.ENDMARKER
+            and tokens_by_line[-1][-1].type != tokenize.ERRORTOKEN
+        ):
+            # We're in a multiline string or expression
+            return 'incomplete', find_last_indent(lines)
+
+        newline_types = {tokenize.NEWLINE, tokenize.COMMENT, tokenize.ENDMARKER} # type: ignore
+
+        # Pop the last line which only contains DEDENTs and ENDMARKER
+        last_token_line = None
+        if {t.type for t in tokens_by_line[-1]} in [
+            {tokenize.DEDENT, tokenize.ENDMARKER},
+            {tokenize.ENDMARKER}
+        ] and len(tokens_by_line) > 1:
+            last_token_line = tokens_by_line.pop()
+
+        while tokens_by_line[-1] and tokens_by_line[-1][-1].type in newline_types:
+            tokens_by_line[-1].pop()
+
+        if not tokens_by_line[-1]:
+            return 'incomplete', find_last_indent(lines)
+
+        if tokens_by_line[-1][-1].string == ':':
+            # The last line starts a block (e.g. 'if foo:')
+            ix = 0
+            while tokens_by_line[-1][ix].type in {tokenize.INDENT, tokenize.DEDENT}:
+                ix += 1
+
+            indent = tokens_by_line[-1][ix].start[1]
+            return 'incomplete', indent + 4
+
+        if tokens_by_line[-1][0].line.endswith('\\'):
+            return 'incomplete', None
+
+        # At this point, our checks think the code is complete (or invalid).
+        # We'll use codeop.compile_command to check this with the real parser
+        try:
+            with warnings.catch_warnings():
+                warnings.simplefilter('error', SyntaxWarning)
+                res = compile_command(''.join(lines), symbol='exec')
+        except (SyntaxError, OverflowError, ValueError, TypeError,
+                MemoryError, SyntaxWarning):
+            return 'invalid', None
+        else:
+            if res is None:
+                return 'incomplete', find_last_indent(lines)
+
+        if last_token_line and last_token_line[0].type == tokenize.DEDENT:
+            if ends_with_newline:
+                return 'complete', None
+            return 'incomplete', find_last_indent(lines)
+
+        # If there's a blank line at the end, assume we're ready to execute
+        if not lines[-1].strip():
+            return 'complete', None
+
+        return 'complete', None
+
+
+def find_last_indent(lines):
+    m = _indent_re.match(lines[-1])
+    if not m:
+        return 0
+    return len(m.group(0).replace('\t', ' '*4))
+
+
+class MaybeAsyncCompile(Compile):
+    def __init__(self, extra_flags=0):
+        super().__init__()
+        self.flags |= extra_flags
+
+
+class MaybeAsyncCommandCompiler(CommandCompiler):
+    def __init__(self, extra_flags=0):
+        self.compiler = MaybeAsyncCompile(extra_flags=extra_flags)
+
+
+_extra_flags = ast.PyCF_ALLOW_TOP_LEVEL_AWAIT
+
+compile_command = MaybeAsyncCommandCompiler(extra_flags=_extra_flags)

temp_venv/lib/python3.13/site-packages/IPython/core/latex_symbols.py

@@ -0,0 +1,1306 @@
+# encoding: utf-8
+
+# DO NOT EDIT THIS FILE BY HAND.
+
+# To update this file, run the script /tools/gen_latex_symbols.py using Python 3
+
+# This file is autogenerated from the file:
+# https://raw.githubusercontent.com/JuliaLang/julia/master/stdlib/REPL/src/latex_symbols.jl
+# This original list is filtered to remove any unicode characters that are not valid
+# Python identifiers.
+
+latex_symbols = {
+    "\\euler": "ℯ",
+    "\\ohm": "Ω",
+    "\\^a": "ᵃ",
+    "\\^b": "ᵇ",
+    "\\^c": "ᶜ",
+    "\\^d": "ᵈ",
+    "\\^e": "ᵉ",
+    "\\^f": "ᶠ",
+    "\\^g": "ᵍ",
+    "\\^h": "ʰ",
+    "\\^i": "ⁱ",
+    "\\^j": "ʲ",
+    "\\^k": "ᵏ",
+    "\\^l": "ˡ",
+    "\\^m": "ᵐ",
+    "\\^n": "ⁿ",
+    "\\^o": "ᵒ",
+    "\\^p": "ᵖ",
+    "\\^r": "ʳ",
+    "\\^s": "ˢ",
+    "\\^t": "ᵗ",
+    "\\^u": "ᵘ",
+    "\\^v": "ᵛ",
+    "\\^w": "ʷ",
+    "\\^x": "ˣ",
+    "\\^y": "ʸ",
+    "\\^z": "ᶻ",
+    "\\^A": "ᴬ",
+    "\\^B": "ᴮ",
+    "\\^D": "ᴰ",
+    "\\^E": "ᴱ",
+    "\\^G": "ᴳ",
+    "\\^H": "ᴴ",
+    "\\^I": "ᴵ",
+    "\\^J": "ᴶ",
+    "\\^K": "ᴷ",
+    "\\^L": "ᴸ",
+    "\\^M": "ᴹ",
+    "\\^N": "ᴺ",
+    "\\^O": "ᴼ",
+    "\\^P": "ᴾ",
+    "\\^R": "ᴿ",
+    "\\^T": "ᵀ",
+    "\\^U": "ᵁ",
+    "\\^V": "ⱽ",
+    "\\^W": "ᵂ",
+    "\\^alpha": "ᵅ",
+    "\\^beta": "ᵝ",
+    "\\^gamma": "ᵞ",
+    "\\^delta": "ᵟ",
+    "\\^epsilon": "ᵋ",
+    "\\^theta": "ᶿ",
+    "\\^iota": "ᶥ",
+    "\\^phi": "ᵠ",
+    "\\^chi": "ᵡ",
+    "\\^ltphi": "ᶲ",
+    "\\^uparrow": "ꜛ",
+    "\\^downarrow": "ꜜ",
+    "\\^!": "ꜝ",
+    "\\_a": "ₐ",
+    "\\_e": "ₑ",
+    "\\_h": "ₕ",
+    "\\_i": "ᵢ",
+    "\\_j": "ⱼ",
+    "\\_k": "ₖ",
+    "\\_l": "ₗ",
+    "\\_m": "ₘ",
+    "\\_n": "ₙ",
+    "\\_o": "ₒ",
+    "\\_p": "ₚ",
+    "\\_r": "ᵣ",
+    "\\_s": "ₛ",
+    "\\_t": "ₜ",
+    "\\_u": "ᵤ",
+    "\\_v": "ᵥ",
+    "\\_x": "ₓ",
+    "\\_schwa": "ₔ",
+    "\\_beta": "ᵦ",
+    "\\_gamma": "ᵧ",
+    "\\_rho": "ᵨ",
+    "\\_phi": "ᵩ",
+    "\\_chi": "ᵪ",
+    "\\hbar": "ħ",
+    "\\sout": "̶",
+    "\\ordfeminine": "ª",
+    "\\cdotp": "·",
+    "\\ordmasculine": "º",
+    "\\AA": "Å",
+    "\\AE": "Æ",
+    "\\DH": "Ð",
+    "\\O": "Ø",
+    "\\TH": "Þ",
+    "\\ss": "ß",
+    "\\aa": "å",
+    "\\ae": "æ",
+    "\\eth": "ð",
+    "\\dh": "ð",
+    "\\o": "ø",
+    "\\th": "þ",
+    "\\DJ": "Đ",
+    "\\dj": "đ",
+    "\\imath": "ı",
+    "\\jmath": "ȷ",
+    "\\L": "Ł",
+    "\\l": "ł",
+    "\\NG": "Ŋ",
+    "\\ng": "ŋ",
+    "\\OE": "Œ",
+    "\\oe": "œ",
+    "\\hvlig": "ƕ",
+    "\\nrleg": "ƞ",
+    "\\doublepipe": "ǂ",
+    "\\trna": "ɐ",
+    "\\trnsa": "ɒ",
+    "\\openo": "ɔ",
+    "\\rtld": "ɖ",
+    "\\schwa": "ə",
+    "\\varepsilon": "ε",
+    "\\pgamma": "ɣ",
+    "\\pbgam": "ɤ",
+    "\\trnh": "ɥ",
+    "\\btdl": "ɬ",
+    "\\rtll": "ɭ",
+    "\\trnm": "ɯ",
+    "\\trnmlr": "ɰ",
+    "\\ltlmr": "ɱ",
+    "\\ltln": "ɲ",
+    "\\rtln": "ɳ",
+    "\\clomeg": "ɷ",
+    "\\ltphi": "ɸ",
+    "\\trnr": "ɹ",
+    "\\trnrl": "ɺ",
+    "\\rttrnr": "ɻ",
+    "\\rl": "ɼ",
+    "\\rtlr": "ɽ",
+    "\\fhr": "ɾ",
+    "\\rtls": "ʂ",
+    "\\esh": "ʃ",
+    "\\trnt": "ʇ",
+    "\\rtlt": "ʈ",
+    "\\pupsil": "ʊ",
+    "\\pscrv": "ʋ",
+    "\\invv": "ʌ",
+    "\\invw": "ʍ",
+    "\\trny": "ʎ",
+    "\\rtlz": "ʐ",
+    "\\yogh": "ʒ",
+    "\\glst": "ʔ",
+    "\\reglst": "ʕ",
+    "\\inglst": "ʖ",
+    "\\turnk": "ʞ",
+    "\\dyogh": "ʤ",
+    "\\tesh": "ʧ",
+    "\\rasp": "ʼ",
+    "\\verts": "ˈ",
+    "\\verti": "ˌ",
+    "\\lmrk": "ː",
+    "\\hlmrk": "ˑ",
+    "\\grave": "̀",
+    "\\acute": "́",
+    "\\hat": "̂",
+    "\\tilde": "̃",
+    "\\bar": "̄",
+    "\\breve": "̆",
+    "\\dot": "̇",
+    "\\ddot": "̈",
+    "\\ocirc": "̊",
+    "\\H": "̋",
+    "\\check": "̌",
+    "\\palh": "̡",
+    "\\rh": "̢",
+    "\\c": "̧",
+    "\\k": "̨",
+    "\\sbbrg": "̪",
+    "\\strike": "̶",
+    "\\Alpha": "Α",
+    "\\Beta": "Β",
+    "\\Gamma": "Γ",
+    "\\Delta": "Δ",
+    "\\Epsilon": "Ε",
+    "\\Zeta": "Ζ",
+    "\\Eta": "Η",
+    "\\Theta": "Θ",
+    "\\Iota": "Ι",
+    "\\Kappa": "Κ",
+    "\\Lambda": "Λ",
+    "\\Xi": "Ξ",
+    "\\Pi": "Π",
+    "\\Rho": "Ρ",
+    "\\Sigma": "Σ",
+    "\\Tau": "Τ",
+    "\\Upsilon": "Υ",
+    "\\Phi": "Φ",
+    "\\Chi": "Χ",
+    "\\Psi": "Ψ",
+    "\\Omega": "Ω",
+    "\\alpha": "α",
+    "\\beta": "β",
+    "\\gamma": "γ",
+    "\\delta": "δ",
+    "\\zeta": "ζ",
+    "\\eta": "η",
+    "\\theta": "θ",
+    "\\iota": "ι",
+    "\\kappa": "κ",
+    "\\lambda": "λ",
+    "\\mu": "μ",
+    "\\nu": "ν",
+    "\\xi": "ξ",
+    "\\pi": "π",
+    "\\rho": "ρ",
+    "\\varsigma": "ς",
+    "\\sigma": "σ",
+    "\\tau": "τ",
+    "\\upsilon": "υ",
+    "\\varphi": "φ",
+    "\\chi": "χ",
+    "\\psi": "ψ",
+    "\\omega": "ω",
+    "\\vartheta": "ϑ",
+    "\\phi": "ϕ",
+    "\\varpi": "ϖ",
+    "\\Stigma": "Ϛ",
+    "\\Digamma": "Ϝ",
+    "\\digamma": "ϝ",
+    "\\Koppa": "Ϟ",
+    "\\Sampi": "Ϡ",
+    "\\varkappa": "ϰ",
+    "\\varrho": "ϱ",
+    "\\varTheta": "ϴ",
+    "\\epsilon": "ϵ",
+    "\\dddot": "⃛",
+    "\\ddddot": "⃜",
+    "\\hslash": "ℏ",
+    "\\Im": "ℑ",
+    "\\ell": "ℓ",
+    "\\wp": "℘",
+    "\\Re": "ℜ",
+    "\\aleph": "ℵ",
+    "\\beth": "ℶ",
+    "\\gimel": "ℷ",
+    "\\daleth": "ℸ",
+    "\\bbPi": "ℿ",
+    "\\Zbar": "Ƶ",
+    "\\overbar": "̅",
+    "\\ovhook": "̉",
+    "\\candra": "̐",
+    "\\oturnedcomma": "̒",
+    "\\ocommatopright": "̕",
+    "\\droang": "̚",
+    "\\wideutilde": "̰",
+    "\\not": "̸",
+    "\\Mu": "Μ",
+    "\\Nu": "Ν",
+    "\\Omicron": "Ο",
+    "\\omicron": "ο",
+    "\\varbeta": "ϐ",
+    "\\oldKoppa": "Ϙ",
+    "\\oldkoppa": "ϙ",
+    "\\stigma": "ϛ",
+    "\\koppa": "ϟ",
+    "\\sampi": "ϡ",
+    "\\tieconcat": "⁀",
+    "\\leftharpoonaccent": "⃐",
+    "\\rightharpoonaccent": "⃑",
+    "\\vertoverlay": "⃒",
+    "\\overleftarrow": "⃖",
+    "\\vec": "⃗",
+    "\\overleftrightarrow": "⃡",
+    "\\annuity": "⃧",
+    "\\threeunderdot": "⃨",
+    "\\widebridgeabove": "⃩",
+    "\\bbC": "ℂ",
+    "\\eulermascheroni": "ℇ",
+    "\\scrg": "ℊ",
+    "\\scrH": "ℋ",
+    "\\frakH": "ℌ",
+    "\\bbH": "ℍ",
+    "\\planck": "ℎ",
+    "\\scrI": "ℐ",
+    "\\scrL": "ℒ",
+    "\\bbN": "ℕ",
+    "\\bbP": "ℙ",
+    "\\bbQ": "ℚ",
+    "\\scrR": "ℛ",
+    "\\bbR": "ℝ",
+    "\\bbZ": "ℤ",
+    "\\frakZ": "ℨ",
+    "\\Angstrom": "Å",
+    "\\scrB": "ℬ",
+    "\\frakC": "ℭ",
+    "\\scre": "ℯ",
+    "\\scrE": "ℰ",
+    "\\scrF": "ℱ",
+    "\\Finv": "Ⅎ",
+    "\\scrM": "ℳ",
+    "\\scro": "ℴ",
+    "\\bbgamma": "ℽ",
+    "\\bbGamma": "ℾ",
+    "\\bbiD": "ⅅ",
+    "\\bbid": "ⅆ",
+    "\\bbie": "ⅇ",
+    "\\bbii": "ⅈ",
+    "\\bbij": "ⅉ",
+    "\\bfA": "𝐀",
+    "\\bfB": "𝐁",
+    "\\bfC": "𝐂",
+    "\\bfD": "𝐃",
+    "\\bfE": "𝐄",
+    "\\bfF": "𝐅",
+    "\\bfG": "𝐆",
+    "\\bfH": "𝐇",
+    "\\bfI": "𝐈",
+    "\\bfJ": "𝐉",
+    "\\bfK": "𝐊",
+    "\\bfL": "𝐋",
+    "\\bfM": "𝐌",
+    "\\bfN": "𝐍",
+    "\\bfO": "𝐎",
+    "\\bfP": "𝐏",
+    "\\bfQ": "𝐐",
+    "\\bfR": "𝐑",
+    "\\bfS": "𝐒",
+    "\\bfT": "𝐓",
+    "\\bfU": "𝐔",
+    "\\bfV": "𝐕",
+    "\\bfW": "𝐖",
+    "\\bfX": "𝐗",
+    "\\bfY": "𝐘",
+    "\\bfZ": "𝐙",
+    "\\bfa": "𝐚",
+    "\\bfb": "𝐛",
+    "\\bfc": "𝐜",
+    "\\bfd": "𝐝",
+    "\\bfe": "𝐞",
+    "\\bff": "𝐟",
+    "\\bfg": "𝐠",
+    "\\bfh": "𝐡",
+    "\\bfi": "𝐢",
+    "\\bfj": "𝐣",
+    "\\bfk": "𝐤",
+    "\\bfl": "𝐥",
+    "\\bfm": "𝐦",
+    "\\bfn": "𝐧",
+    "\\bfo": "𝐨",
+    "\\bfp": "𝐩",
+    "\\bfq": "𝐪",
+    "\\bfr": "𝐫",
+    "\\bfs": "𝐬",
+    "\\bft": "𝐭",
+    "\\bfu": "𝐮",
+    "\\bfv": "𝐯",
+    "\\bfw": "𝐰",
+    "\\bfx": "𝐱",
+    "\\bfy": "𝐲",
+    "\\bfz": "𝐳",
+    "\\itA": "𝐴",
+    "\\itB": "𝐵",
+    "\\itC": "𝐶",
+    "\\itD": "𝐷",
+    "\\itE": "𝐸",
+    "\\itF": "𝐹",
+    "\\itG": "𝐺",
+    "\\itH": "𝐻",
+    "\\itI": "𝐼",
+    "\\itJ": "𝐽",
+    "\\itK": "𝐾",
+    "\\itL": "𝐿",
+    "\\itM": "𝑀",
+    "\\itN": "𝑁",
+    "\\itO": "𝑂",
+    "\\itP": "𝑃",
+    "\\itQ": "𝑄",
+    "\\itR": "𝑅",
+    "\\itS": "𝑆",
+    "\\itT": "𝑇",
+    "\\itU": "𝑈",
+    "\\itV": "𝑉",
+    "\\itW": "𝑊",
+    "\\itX": "𝑋",
+    "\\itY": "𝑌",
+    "\\itZ": "𝑍",
+    "\\ita": "𝑎",
+    "\\itb": "𝑏",
+    "\\itc": "𝑐",
+    "\\itd": "𝑑",
+    "\\ite": "𝑒",
+    "\\itf": "𝑓",
+    "\\itg": "𝑔",
+    "\\ith": "ℎ",
+    "\\iti": "𝑖",
+    "\\itj": "𝑗",
+    "\\itk": "𝑘",
+    "\\itl": "𝑙",
+    "\\itm": "𝑚",
+    "\\itn": "𝑛",
+    "\\ito": "𝑜",
+    "\\itp": "𝑝",
+    "\\itq": "𝑞",
+    "\\itr": "𝑟",
+    "\\its": "𝑠",
+    "\\itt": "𝑡",
+    "\\itu": "𝑢",
+    "\\itv": "𝑣",
+    "\\itw": "𝑤",
+    "\\itx": "𝑥",
+    "\\ity": "𝑦",
+    "\\itz": "𝑧",
+    "\\biA": "𝑨",
+    "\\biB": "𝑩",
+    "\\biC": "𝑪",
+    "\\biD": "𝑫",
+    "\\biE": "𝑬",
+    "\\biF": "𝑭",
+    "\\biG": "𝑮",
+    "\\biH": "𝑯",
+    "\\biI": "𝑰",
+    "\\biJ": "𝑱",
+    "\\biK": "𝑲",
+    "\\biL": "𝑳",
+    "\\biM": "𝑴",
+    "\\biN": "𝑵",
+    "\\biO": "𝑶",
+    "\\biP": "𝑷",
+    "\\biQ": "𝑸",
+    "\\biR": "𝑹",
+    "\\biS": "𝑺",
+    "\\biT": "𝑻",
+    "\\biU": "𝑼",
+    "\\biV": "𝑽",
+    "\\biW": "𝑾",
+    "\\biX": "𝑿",
+    "\\biY": "𝒀",
+    "\\biZ": "𝒁",
+    "\\bia": "𝒂",
+    "\\bib": "𝒃",
+    "\\bic": "𝒄",
+    "\\bid": "𝒅",
+    "\\bie": "𝒆",
+    "\\bif": "𝒇",
+    "\\big": "𝒈",
+    "\\bih": "𝒉",
+    "\\bii": "𝒊",
+    "\\bij": "𝒋",
+    "\\bik": "𝒌",
+    "\\bil": "𝒍",
+    "\\bim": "𝒎",
+    "\\bin": "𝒏",
+    "\\bio": "𝒐",
+    "\\bip": "𝒑",
+    "\\biq": "𝒒",
+    "\\bir": "𝒓",
+    "\\bis": "𝒔",
+    "\\bit": "𝒕",
+    "\\biu": "𝒖",
+    "\\biv": "𝒗",
+    "\\biw": "𝒘",
+    "\\bix": "𝒙",
+    "\\biy": "𝒚",
+    "\\biz": "𝒛",
+    "\\scrA": "𝒜",
+    "\\scrC": "𝒞",
+    "\\scrD": "𝒟",
+    "\\scrG": "𝒢",
+    "\\scrJ": "𝒥",
+    "\\scrK": "𝒦",
+    "\\scrN": "𝒩",
+    "\\scrO": "𝒪",
+    "\\scrP": "𝒫",
+    "\\scrQ": "𝒬",
+    "\\scrS": "𝒮",
+    "\\scrT": "𝒯",
+    "\\scrU": "𝒰",
+    "\\scrV": "𝒱",
+    "\\scrW": "𝒲",
+    "\\scrX": "𝒳",
+    "\\scrY": "𝒴",
+    "\\scrZ": "𝒵",
+    "\\scra": "𝒶",
+    "\\scrb": "𝒷",
+    "\\scrc": "𝒸",
+    "\\scrd": "𝒹",
+    "\\scrf": "𝒻",
+    "\\scrh": "𝒽",
+    "\\scri": "𝒾",
+    "\\scrj": "𝒿",
+    "\\scrk": "𝓀",
+    "\\scrm": "𝓂",
+    "\\scrn": "𝓃",
+    "\\scrp": "𝓅",
+    "\\scrq": "𝓆",
+    "\\scrr": "𝓇",
+    "\\scrs": "𝓈",
+    "\\scrt": "𝓉",
+    "\\scru": "𝓊",
+    "\\scrv": "𝓋",
+    "\\scrw": "𝓌",
+    "\\scrx": "𝓍",
+    "\\scry": "𝓎",
+    "\\scrz": "𝓏",
+    "\\bscrA": "𝓐",
+    "\\bscrB": "𝓑",
+    "\\bscrC": "𝓒",
+    "\\bscrD": "𝓓",
+    "\\bscrE": "𝓔",
+    "\\bscrF": "𝓕",
+    "\\bscrG": "𝓖",
+    "\\bscrH": "𝓗",
+    "\\bscrI": "𝓘",
+    "\\bscrJ": "𝓙",
+    "\\bscrK": "𝓚",
+    "\\bscrL": "𝓛",
+    "\\bscrM": "𝓜",
+    "\\bscrN": "𝓝",
+    "\\bscrO": "𝓞",
+    "\\bscrP": "𝓟",
+    "\\bscrQ": "𝓠",
+    "\\bscrR": "𝓡",
+    "\\bscrS": "𝓢",
+    "\\bscrT": "𝓣",
+    "\\bscrU": "𝓤",
+    "\\bscrV": "𝓥",
+    "\\bscrW": "𝓦",
+    "\\bscrX": "𝓧",
+    "\\bscrY": "𝓨",
+    "\\bscrZ": "𝓩",
+    "\\bscra": "𝓪",
+    "\\bscrb": "𝓫",
+    "\\bscrc": "𝓬",
+    "\\bscrd": "𝓭",
+    "\\bscre": "𝓮",
+    "\\bscrf": "𝓯",
+    "\\bscrg": "𝓰",
+    "\\bscrh": "𝓱",
+    "\\bscri": "𝓲",
+    "\\bscrj": "𝓳",
+    "\\bscrk": "𝓴",
+    "\\bscrl": "𝓵",
+    "\\bscrm": "𝓶",
+    "\\bscrn": "𝓷",
+    "\\bscro": "𝓸",
+    "\\bscrp": "𝓹",
+    "\\bscrq": "𝓺",
+    "\\bscrr": "𝓻",
+    "\\bscrs": "𝓼",
+    "\\bscrt": "𝓽",
+    "\\bscru": "𝓾",
+    "\\bscrv": "𝓿",
+    "\\bscrw": "𝔀",
+    "\\bscrx": "𝔁",
+    "\\bscry": "𝔂",
+    "\\bscrz": "𝔃",
+    "\\frakA": "𝔄",
+    "\\frakB": "𝔅",
+    "\\frakD": "𝔇",
+    "\\frakE": "𝔈",
+    "\\frakF": "𝔉",
+    "\\frakG": "𝔊",
+    "\\frakI": "ℑ",
+    "\\frakJ": "𝔍",
+    "\\frakK": "𝔎",
+    "\\frakL": "𝔏",
+    "\\frakM": "𝔐",
+    "\\frakN": "𝔑",
+    "\\frakO": "𝔒",
+    "\\frakP": "𝔓",
+    "\\frakQ": "𝔔",
+    "\\frakR": "ℜ",
+    "\\frakS": "𝔖",
+    "\\frakT": "𝔗",
+    "\\frakU": "𝔘",
+    "\\frakV": "𝔙",
+    "\\frakW": "𝔚",
+    "\\frakX": "𝔛",
+    "\\frakY": "𝔜",
+    "\\fraka": "𝔞",
+    "\\frakb": "𝔟",
+    "\\frakc": "𝔠",
+    "\\frakd": "𝔡",
+    "\\frake": "𝔢",
+    "\\frakf": "𝔣",
+    "\\frakg": "𝔤",
+    "\\frakh": "𝔥",
+    "\\fraki": "𝔦",
+    "\\frakj": "𝔧",
+    "\\frakk": "𝔨",
+    "\\frakl": "𝔩",
+    "\\frakm": "𝔪",
+    "\\frakn": "𝔫",
+    "\\frako": "𝔬",
+    "\\frakp": "𝔭",
+    "\\frakq": "𝔮",
+    "\\frakr": "𝔯",
+    "\\fraks": "𝔰",
+    "\\frakt": "𝔱",
+    "\\fraku": "𝔲",
+    "\\frakv": "𝔳",
+    "\\frakw": "𝔴",
+    "\\frakx": "𝔵",
+    "\\fraky": "𝔶",
+    "\\frakz": "𝔷",
+    "\\bbA": "𝔸",
+    "\\bbB": "𝔹",
+    "\\bbD": "𝔻",
+    "\\bbE": "𝔼",
+    "\\bbF": "𝔽",
+    "\\bbG": "𝔾",
+    "\\bbI": "𝕀",
+    "\\bbJ": "𝕁",
+    "\\bbK": "𝕂",
+    "\\bbL": "𝕃",
+    "\\bbM": "𝕄",
+    "\\bbO": "𝕆",
+    "\\bbS": "𝕊",
+    "\\bbT": "𝕋",
+    "\\bbU": "𝕌",
+    "\\bbV": "𝕍",
+    "\\bbW": "𝕎",
+    "\\bbX": "𝕏",
+    "\\bbY": "𝕐",
+    "\\bba": "𝕒",
+    "\\bbb": "𝕓",
+    "\\bbc": "𝕔",
+    "\\bbd": "𝕕",
+    "\\bbe": "𝕖",
+    "\\bbf": "𝕗",
+    "\\bbg": "𝕘",
+    "\\bbh": "𝕙",
+    "\\bbi": "𝕚",
+    "\\bbj": "𝕛",
+    "\\bbk": "𝕜",
+    "\\bbl": "𝕝",
+    "\\bbm": "𝕞",
+    "\\bbn": "𝕟",
+    "\\bbo": "𝕠",
+    "\\bbp": "𝕡",
+    "\\bbq": "𝕢",
+    "\\bbr": "𝕣",
+    "\\bbs": "𝕤",
+    "\\bbt": "𝕥",
+    "\\bbu": "𝕦",
+    "\\bbv": "𝕧",
+    "\\bbw": "𝕨",
+    "\\bbx": "𝕩",
+    "\\bby": "𝕪",
+    "\\bbz": "𝕫",
+    "\\bfrakA": "𝕬",
+    "\\bfrakB": "𝕭",
+    "\\bfrakC": "𝕮",
+    "\\bfrakD": "𝕯",
+    "\\bfrakE": "𝕰",
+    "\\bfrakF": "𝕱",
+    "\\bfrakG": "𝕲",
+    "\\bfrakH": "𝕳",
+    "\\bfrakI": "𝕴",
+    "\\bfrakJ": "𝕵",
+    "\\bfrakK": "𝕶",
+    "\\bfrakL": "𝕷",
+    "\\bfrakM": "𝕸",
+    "\\bfrakN": "𝕹",
+    "\\bfrakO": "𝕺",
+    "\\bfrakP": "𝕻",
+    "\\bfrakQ": "𝕼",
+    "\\bfrakR": "𝕽",
+    "\\bfrakS": "𝕾",
+    "\\bfrakT": "𝕿",
+    "\\bfrakU": "𝖀",
+    "\\bfrakV": "𝖁",
+    "\\bfrakW": "𝖂",
+    "\\bfrakX": "𝖃",
+    "\\bfrakY": "𝖄",
+    "\\bfrakZ": "𝖅",
+    "\\bfraka": "𝖆",
+    "\\bfrakb": "𝖇",
+    "\\bfrakc": "𝖈",
+    "\\bfrakd": "𝖉",
+    "\\bfrake": "𝖊",
+    "\\bfrakf": "𝖋",
+    "\\bfrakg": "𝖌",
+    "\\bfrakh": "𝖍",
+    "\\bfraki": "𝖎",
+    "\\bfrakj": "𝖏",
+    "\\bfrakk": "𝖐",
+    "\\bfrakl": "𝖑",
+    "\\bfrakm": "𝖒",
+    "\\bfrakn": "𝖓",
+    "\\bfrako": "𝖔",
+    "\\bfrakp": "𝖕",
+    "\\bfrakq": "𝖖",
+    "\\bfrakr": "𝖗",
+    "\\bfraks": "𝖘",
+    "\\bfrakt": "𝖙",
+    "\\bfraku": "𝖚",
+    "\\bfrakv": "𝖛",
+    "\\bfrakw": "𝖜",
+    "\\bfrakx": "𝖝",
+    "\\bfraky": "𝖞",
+    "\\bfrakz": "𝖟",
+    "\\sansA": "𝖠",
+    "\\sansB": "𝖡",
+    "\\sansC": "𝖢",
+    "\\sansD": "𝖣",
+    "\\sansE": "𝖤",
+    "\\sansF": "𝖥",
+    "\\sansG": "𝖦",
+    "\\sansH": "𝖧",
+    "\\sansI": "𝖨",
+    "\\sansJ": "𝖩",
+    "\\sansK": "𝖪",
+    "\\sansL": "𝖫",
+    "\\sansM": "𝖬",
+    "\\sansN": "𝖭",
+    "\\sansO": "𝖮",
+    "\\sansP": "𝖯",
+    "\\sansQ": "𝖰",
+    "\\sansR": "𝖱",
+    "\\sansS": "𝖲",
+    "\\sansT": "𝖳",
+    "\\sansU": "𝖴",
+    "\\sansV": "𝖵",
+    "\\sansW": "𝖶",
+    "\\sansX": "𝖷",
+    "\\sansY": "𝖸",
+    "\\sansZ": "𝖹",
+    "\\sansa": "𝖺",
+    "\\sansb": "𝖻",
+    "\\sansc": "𝖼",
+    "\\sansd": "𝖽",
+    "\\sanse": "𝖾",
+    "\\sansf": "𝖿",
+    "\\sansg": "𝗀",
+    "\\sansh": "𝗁",
+    "\\sansi": "𝗂",
+    "\\sansj": "𝗃",
+    "\\sansk": "𝗄",
+    "\\sansl": "𝗅",
+    "\\sansm": "𝗆",
+    "\\sansn": "𝗇",
+    "\\sanso": "𝗈",
+    "\\sansp": "𝗉",
+    "\\sansq": "𝗊",
+    "\\sansr": "𝗋",
+    "\\sanss": "𝗌",
+    "\\sanst": "𝗍",
+    "\\sansu": "𝗎",
+    "\\sansv": "𝗏",
+    "\\sansw": "𝗐",
+    "\\sansx": "𝗑",
+    "\\sansy": "𝗒",
+    "\\sansz": "𝗓",
+    "\\bsansA": "𝗔",
+    "\\bsansB": "𝗕",
+    "\\bsansC": "𝗖",
+    "\\bsansD": "𝗗",
+    "\\bsansE": "𝗘",
+    "\\bsansF": "𝗙",
+    "\\bsansG": "𝗚",
+    "\\bsansH": "𝗛",
+    "\\bsansI": "𝗜",
+    "\\bsansJ": "𝗝",
+    "\\bsansK": "𝗞",
+    "\\bsansL": "𝗟",
+    "\\bsansM": "𝗠",
+    "\\bsansN": "𝗡",
+    "\\bsansO": "𝗢",
+    "\\bsansP": "𝗣",
+    "\\bsansQ": "𝗤",
+    "\\bsansR": "𝗥",
+    "\\bsansS": "𝗦",
+    "\\bsansT": "𝗧",
+    "\\bsansU": "𝗨",
+    "\\bsansV": "𝗩",
+    "\\bsansW": "𝗪",
+    "\\bsansX": "𝗫",
+    "\\bsansY": "𝗬",
+    "\\bsansZ": "𝗭",
+    "\\bsansa": "𝗮",
+    "\\bsansb": "𝗯",
+    "\\bsansc": "𝗰",
+    "\\bsansd": "𝗱",
+    "\\bsanse": "𝗲",
+    "\\bsansf": "𝗳",
+    "\\bsansg": "𝗴",
+    "\\bsansh": "𝗵",
+    "\\bsansi": "𝗶",
+    "\\bsansj": "𝗷",
+    "\\bsansk": "𝗸",
+    "\\bsansl": "𝗹",
+    "\\bsansm": "𝗺",
+    "\\bsansn": "𝗻",
+    "\\bsanso": "𝗼",
+    "\\bsansp": "𝗽",
+    "\\bsansq": "𝗾",
+    "\\bsansr": "𝗿",
+    "\\bsanss": "𝘀",
+    "\\bsanst": "𝘁",
+    "\\bsansu": "𝘂",
+    "\\bsansv": "𝘃",
+    "\\bsansw": "𝘄",
+    "\\bsansx": "𝘅",
+    "\\bsansy": "𝘆",
+    "\\bsansz": "𝘇",
+    "\\isansA": "𝘈",
+    "\\isansB": "𝘉",
+    "\\isansC": "𝘊",
+    "\\isansD": "𝘋",
+    "\\isansE": "𝘌",
+    "\\isansF": "𝘍",
+    "\\isansG": "𝘎",
+    "\\isansH": "𝘏",
+    "\\isansI": "𝘐",
+    "\\isansJ": "𝘑",
+    "\\isansK": "𝘒",
+    "\\isansL": "𝘓",
+    "\\isansM": "𝘔",
+    "\\isansN": "𝘕",
+    "\\isansO": "𝘖",
+    "\\isansP": "𝘗",
+    "\\isansQ": "𝘘",
+    "\\isansR": "𝘙",
+    "\\isansS": "𝘚",
+    "\\isansT": "𝘛",
+    "\\isansU": "𝘜",
+    "\\isansV": "𝘝",
+    "\\isansW": "𝘞",
+    "\\isansX": "𝘟",
+    "\\isansY": "𝘠",
+    "\\isansZ": "𝘡",
+    "\\isansa": "𝘢",
+    "\\isansb": "𝘣",
+    "\\isansc": "𝘤",
+    "\\isansd": "𝘥",
+    "\\isanse": "𝘦",
+    "\\isansf": "𝘧",
+    "\\isansg": "𝘨",
+    "\\isansh": "𝘩",
+    "\\isansi": "𝘪",
+    "\\isansj": "𝘫",
+    "\\isansk": "𝘬",
+    "\\isansl": "𝘭",
+    "\\isansm": "𝘮",
+    "\\isansn": "𝘯",
+    "\\isanso": "𝘰",
+    "\\isansp": "𝘱",
+    "\\isansq": "𝘲",
+    "\\isansr": "𝘳",
+    "\\isanss": "𝘴",
+    "\\isanst": "𝘵",
+    "\\isansu": "𝘶",
+    "\\isansv": "𝘷",
+    "\\isansw": "𝘸",
+    "\\isansx": "𝘹",
+    "\\isansy": "𝘺",
+    "\\isansz": "𝘻",
+    "\\bisansA": "𝘼",
+    "\\bisansB": "𝘽",
+    "\\bisansC": "𝘾",
+    "\\bisansD": "𝘿",
+    "\\bisansE": "𝙀",
+    "\\bisansF": "𝙁",
+    "\\bisansG": "𝙂",
+    "\\bisansH": "𝙃",
+    "\\bisansI": "𝙄",
+    "\\bisansJ": "𝙅",
+    "\\bisansK": "𝙆",
+    "\\bisansL": "𝙇",
+    "\\bisansM": "𝙈",
+    "\\bisansN": "𝙉",
+    "\\bisansO": "𝙊",
+    "\\bisansP": "𝙋",
+    "\\bisansQ": "𝙌",
+    "\\bisansR": "𝙍",
+    "\\bisansS": "𝙎",
+    "\\bisansT": "𝙏",
+    "\\bisansU": "𝙐",
+    "\\bisansV": "𝙑",
+    "\\bisansW": "𝙒",
+    "\\bisansX": "𝙓",
+    "\\bisansY": "𝙔",
+    "\\bisansZ": "𝙕",
+    "\\bisansa": "𝙖",
+    "\\bisansb": "𝙗",
+    "\\bisansc": "𝙘",
+    "\\bisansd": "𝙙",
+    "\\bisanse": "𝙚",
+    "\\bisansf": "𝙛",
+    "\\bisansg": "𝙜",
+    "\\bisansh": "𝙝",
+    "\\bisansi": "𝙞",
+    "\\bisansj": "𝙟",
+    "\\bisansk": "𝙠",
+    "\\bisansl": "𝙡",
+    "\\bisansm": "𝙢",
+    "\\bisansn": "𝙣",
+    "\\bisanso": "𝙤",
+    "\\bisansp": "𝙥",
+    "\\bisansq": "𝙦",
+    "\\bisansr": "𝙧",
+    "\\bisanss": "𝙨",
+    "\\bisanst": "𝙩",
+    "\\bisansu": "𝙪",
+    "\\bisansv": "𝙫",
+    "\\bisansw": "𝙬",
+    "\\bisansx": "𝙭",
+    "\\bisansy": "𝙮",
+    "\\bisansz": "𝙯",
+    "\\ttA": "𝙰",
+    "\\ttB": "𝙱",
+    "\\ttC": "𝙲",
+    "\\ttD": "𝙳",
+    "\\ttE": "𝙴",
+    "\\ttF": "𝙵",
+    "\\ttG": "𝙶",
+    "\\ttH": "𝙷",
+    "\\ttI": "𝙸",
+    "\\ttJ": "𝙹",
+    "\\ttK": "𝙺",
+    "\\ttL": "𝙻",
+    "\\ttM": "𝙼",
+    "\\ttN": "𝙽",
+    "\\ttO": "𝙾",
+    "\\ttP": "𝙿",
+    "\\ttQ": "𝚀",
+    "\\ttR": "𝚁",
+    "\\ttS": "𝚂",
+    "\\ttT": "𝚃",
+    "\\ttU": "𝚄",
+    "\\ttV": "𝚅",
+    "\\ttW": "𝚆",
+    "\\ttX": "𝚇",
+    "\\ttY": "𝚈",
+    "\\ttZ": "𝚉",
+    "\\tta": "𝚊",
+    "\\ttb": "𝚋",
+    "\\ttc": "𝚌",
+    "\\ttd": "𝚍",
+    "\\tte": "𝚎",
+    "\\ttf": "𝚏",
+    "\\ttg": "𝚐",
+    "\\tth": "𝚑",
+    "\\tti": "𝚒",
+    "\\ttj": "𝚓",
+    "\\ttk": "𝚔",
+    "\\ttl": "𝚕",
+    "\\ttm": "𝚖",
+    "\\ttn": "𝚗",
+    "\\tto": "𝚘",
+    "\\ttp": "𝚙",
+    "\\ttq": "𝚚",
+    "\\ttr": "𝚛",
+    "\\tts": "𝚜",
+    "\\ttt": "𝚝",
+    "\\ttu": "𝚞",
+    "\\ttv": "𝚟",
+    "\\ttw": "𝚠",
+    "\\ttx": "𝚡",
+    "\\tty": "𝚢",
+    "\\ttz": "𝚣",
+    "\\bfAlpha": "𝚨",
+    "\\bfBeta": "𝚩",
+    "\\bfGamma": "𝚪",
+    "\\bfDelta": "𝚫",
+    "\\bfEpsilon": "𝚬",
+    "\\bfZeta": "𝚭",
+    "\\bfEta": "𝚮",
+    "\\bfTheta": "𝚯",
+    "\\bfIota": "𝚰",
+    "\\bfKappa": "𝚱",
+    "\\bfLambda": "𝚲",
+    "\\bfMu": "𝚳",
+    "\\bfNu": "𝚴",
+    "\\bfXi": "𝚵",
+    "\\bfOmicron": "𝚶",
+    "\\bfPi": "𝚷",
+    "\\bfRho": "𝚸",
+    "\\bfvarTheta": "𝚹",
+    "\\bfSigma": "𝚺",
+    "\\bfTau": "𝚻",
+    "\\bfUpsilon": "𝚼",
+    "\\bfPhi": "𝚽",
+    "\\bfChi": "𝚾",
+    "\\bfPsi": "𝚿",
+    "\\bfOmega": "𝛀",
+    "\\bfalpha": "𝛂",
+    "\\bfbeta": "𝛃",
+    "\\bfgamma": "𝛄",
+    "\\bfdelta": "𝛅",
+    "\\bfvarepsilon": "𝛆",
+    "\\bfzeta": "𝛇",
+    "\\bfeta": "𝛈",
+    "\\bftheta": "𝛉",
+    "\\bfiota": "𝛊",
+    "\\bfkappa": "𝛋",
+    "\\bflambda": "𝛌",
+    "\\bfmu": "𝛍",
+    "\\bfnu": "𝛎",
+    "\\bfxi": "𝛏",
+    "\\bfomicron": "𝛐",
+    "\\bfpi": "𝛑",
+    "\\bfrho": "𝛒",
+    "\\bfvarsigma": "𝛓",
+    "\\bfsigma": "𝛔",
+    "\\bftau": "𝛕",
+    "\\bfupsilon": "𝛖",
+    "\\bfvarphi": "𝛗",
+    "\\bfchi": "𝛘",
+    "\\bfpsi": "𝛙",
+    "\\bfomega": "𝛚",
+    "\\bfepsilon": "𝛜",
+    "\\bfvartheta": "𝛝",
+    "\\bfvarkappa": "𝛞",
+    "\\bfphi": "𝛟",
+    "\\bfvarrho": "𝛠",
+    "\\bfvarpi": "𝛡",
+    "\\itAlpha": "𝛢",
+    "\\itBeta": "𝛣",
+    "\\itGamma": "𝛤",
+    "\\itDelta": "𝛥",
+    "\\itEpsilon": "𝛦",
+    "\\itZeta": "𝛧",
+    "\\itEta": "𝛨",
+    "\\itTheta": "𝛩",
+    "\\itIota": "𝛪",
+    "\\itKappa": "𝛫",
+    "\\itLambda": "𝛬",
+    "\\itMu": "𝛭",
+    "\\itNu": "𝛮",
+    "\\itXi": "𝛯",
+    "\\itOmicron": "𝛰",
+    "\\itPi": "𝛱",
+    "\\itRho": "𝛲",
+    "\\itvarTheta": "𝛳",
+    "\\itSigma": "𝛴",
+    "\\itTau": "𝛵",
+    "\\itUpsilon": "𝛶",
+    "\\itPhi": "𝛷",
+    "\\itChi": "𝛸",
+    "\\itPsi": "𝛹",
+    "\\itOmega": "𝛺",
+    "\\italpha": "𝛼",
+    "\\itbeta": "𝛽",
+    "\\itgamma": "𝛾",
+    "\\itdelta": "𝛿",
+    "\\itvarepsilon": "𝜀",
+    "\\itzeta": "𝜁",
+    "\\iteta": "𝜂",
+    "\\ittheta": "𝜃",
+    "\\itiota": "𝜄",
+    "\\itkappa": "𝜅",
+    "\\itlambda": "𝜆",
+    "\\itmu": "𝜇",
+    "\\itnu": "𝜈",
+    "\\itxi": "𝜉",
+    "\\itomicron": "𝜊",
+    "\\itpi": "𝜋",
+    "\\itrho": "𝜌",
+    "\\itvarsigma": "𝜍",
+    "\\itsigma": "𝜎",
+    "\\ittau": "𝜏",
+    "\\itupsilon": "𝜐",
+    "\\itvarphi": "𝜑",
+    "\\itchi": "𝜒",
+    "\\itpsi": "𝜓",
+    "\\itomega": "𝜔",
+    "\\itepsilon": "𝜖",
+    "\\itvartheta": "𝜗",
+    "\\itvarkappa": "𝜘",
+    "\\itphi": "𝜙",
+    "\\itvarrho": "𝜚",
+    "\\itvarpi": "𝜛",
+    "\\biAlpha": "𝜜",
+    "\\biBeta": "𝜝",
+    "\\biGamma": "𝜞",
+    "\\biDelta": "𝜟",
+    "\\biEpsilon": "𝜠",
+    "\\biZeta": "𝜡",
+    "\\biEta": "𝜢",
+    "\\biTheta": "𝜣",
+    "\\biIota": "𝜤",
+    "\\biKappa": "𝜥",
+    "\\biLambda": "����",
+    "\\biMu": "𝜧",
+    "\\biNu": "𝜨",
+    "\\biXi": "𝜩",
+    "\\biOmicron": "𝜪",
+    "\\biPi": "𝜫",
+    "\\biRho": "𝜬",
+    "\\bivarTheta": "𝜭",
+    "\\biSigma": "𝜮",
+    "\\biTau": "𝜯",
+    "\\biUpsilon": "𝜰",
+    "\\biPhi": "𝜱",
+    "\\biChi": "𝜲",
+    "\\biPsi": "𝜳",
+    "\\biOmega": "𝜴",
+    "\\bialpha": "𝜶",
+    "\\bibeta": "𝜷",
+    "\\bigamma": "𝜸",
+    "\\bidelta": "𝜹",
+    "\\bivarepsilon": "𝜺",
+    "\\bizeta": "𝜻",
+    "\\bieta": "𝜼",
+    "\\bitheta": "𝜽",
+    "\\biiota": "𝜾",
+    "\\bikappa": "𝜿",
+    "\\bilambda": "𝝀",
+    "\\bimu": "𝝁",
+    "\\binu": "𝝂",
+    "\\bixi": "𝝃",
+    "\\biomicron": "𝝄",
+    "\\bipi": "𝝅",
+    "\\birho": "𝝆",
+    "\\bivarsigma": "𝝇",
+    "\\bisigma": "𝝈",
+    "\\bitau": "𝝉",
+    "\\biupsilon": "𝝊",
+    "\\bivarphi": "𝝋",
+    "\\bichi": "𝝌",
+    "\\bipsi": "𝝍",
+    "\\biomega": "𝝎",
+    "\\biepsilon": "𝝐",
+    "\\bivartheta": "𝝑",
+    "\\bivarkappa": "𝝒",
+    "\\biphi": "𝝓",
+    "\\bivarrho": "𝝔",
+    "\\bivarpi": "𝝕",
+    "\\bsansAlpha": "𝝖",
+    "\\bsansBeta": "𝝗",
+    "\\bsansGamma": "𝝘",
+    "\\bsansDelta": "𝝙",
+    "\\bsansEpsilon": "𝝚",
+    "\\bsansZeta": "𝝛",
+    "\\bsansEta": "𝝜",
+    "\\bsansTheta": "𝝝",
+    "\\bsansIota": "𝝞",
+    "\\bsansKappa": "𝝟",
+    "\\bsansLambda": "𝝠",
+    "\\bsansMu": "𝝡",
+    "\\bsansNu": "𝝢",
+    "\\bsansXi": "𝝣",
+    "\\bsansOmicron": "𝝤",
+    "\\bsansPi": "𝝥",
+    "\\bsansRho": "𝝦",
+    "\\bsansvarTheta": "𝝧",
+    "\\bsansSigma": "𝝨",
+    "\\bsansTau": "𝝩",
+    "\\bsansUpsilon": "𝝪",
+    "\\bsansPhi": "𝝫",
+    "\\bsansChi": "𝝬",
+    "\\bsansPsi": "𝝭",
+    "\\bsansOmega": "𝝮",
+    "\\bsansalpha": "𝝰",
+    "\\bsansbeta": "𝝱",
+    "\\bsansgamma": "𝝲",
+    "\\bsansdelta": "𝝳",
+    "\\bsansvarepsilon": "𝝴",
+    "\\bsanszeta": "𝝵",
+    "\\bsanseta": "𝝶",
+    "\\bsanstheta": "𝝷",
+    "\\bsansiota": "𝝸",
+    "\\bsanskappa": "𝝹",
+    "\\bsanslambda": "𝝺",
+    "\\bsansmu": "𝝻",
+    "\\bsansnu": "𝝼",
+    "\\bsansxi": "𝝽",
+    "\\bsansomicron": "𝝾",
+    "\\bsanspi": "𝝿",
+    "\\bsansrho": "𝞀",
+    "\\bsansvarsigma": "𝞁",
+    "\\bsanssigma": "𝞂",
+    "\\bsanstau": "𝞃",
+    "\\bsansupsilon": "𝞄",
+    "\\bsansvarphi": "𝞅",
+    "\\bsanschi": "𝞆",
+    "\\bsanspsi": "𝞇",
+    "\\bsansomega": "𝞈",
+    "\\bsansepsilon": "𝞊",
+    "\\bsansvartheta": "𝞋",
+    "\\bsansvarkappa": "𝞌",
+    "\\bsansphi": "𝞍",
+    "\\bsansvarrho": "𝞎",
+    "\\bsansvarpi": "𝞏",
+    "\\bisansAlpha": "𝞐",
+    "\\bisansBeta": "𝞑",
+    "\\bisansGamma": "𝞒",
+    "\\bisansDelta": "𝞓",
+    "\\bisansEpsilon": "𝞔",
+    "\\bisansZeta": "𝞕",
+    "\\bisansEta": "𝞖",
+    "\\bisansTheta": "𝞗",
+    "\\bisansIota": "𝞘",
+    "\\bisansKappa": "𝞙",
+    "\\bisansLambda": "𝞚",
+    "\\bisansMu": "𝞛",
+    "\\bisansNu": "𝞜",
+    "\\bisansXi": "𝞝",
+    "\\bisansOmicron": "𝞞",
+    "\\bisansPi": "𝞟",
+    "\\bisansRho": "𝞠",
+    "\\bisansvarTheta": "𝞡",
+    "\\bisansSigma": "𝞢",
+    "\\bisansTau": "𝞣",
+    "\\bisansUpsilon": "𝞤",
+    "\\bisansPhi": "𝞥",
+    "\\bisansChi": "𝞦",
+    "\\bisansPsi": "𝞧",
+    "\\bisansOmega": "𝞨",
+    "\\bisansalpha": "𝞪",
+    "\\bisansbeta": "𝞫",
+    "\\bisansgamma": "𝞬",
+    "\\bisansdelta": "𝞭",
+    "\\bisansvarepsilon": "𝞮",
+    "\\bisanszeta": "𝞯",
+    "\\bisanseta": "𝞰",
+    "\\bisanstheta": "𝞱",
+    "\\bisansiota": "𝞲",
+    "\\bisanskappa": "𝞳",
+    "\\bisanslambda": "𝞴",
+    "\\bisansmu": "𝞵",
+    "\\bisansnu": "𝞶",
+    "\\bisansxi": "𝞷",
+    "\\bisansomicron": "𝞸",
+    "\\bisanspi": "𝞹",
+    "\\bisansrho": "𝞺",
+    "\\bisansvarsigma": "𝞻",
+    "\\bisanssigma": "𝞼",
+    "\\bisanstau": "𝞽",
+    "\\bisansupsilon": "𝞾",
+    "\\bisansvarphi": "𝞿",
+    "\\bisanschi": "𝟀",
+    "\\bisanspsi": "𝟁",
+    "\\bisansomega": "𝟂",
+    "\\bisansepsilon": "𝟄",
+    "\\bisansvartheta": "𝟅",
+    "\\bisansvarkappa": "𝟆",
+    "\\bisansphi": "𝟇",
+    "\\bisansvarrho": "𝟈",
+    "\\bisansvarpi": "𝟉",
+    "\\bfzero": "𝟎",
+    "\\bfone": "𝟏",
+    "\\bftwo": "𝟐",
+    "\\bfthree": "𝟑",
+    "\\bffour": "𝟒",
+    "\\bffive": "𝟓",
+    "\\bfsix": "𝟔",
+    "\\bfseven": "𝟕",
+    "\\bfeight": "𝟖",
+    "\\bfnine": "𝟗",
+    "\\bbzero": "𝟘",
+    "\\bbone": "𝟙",
+    "\\bbtwo": "𝟚",
+    "\\bbthree": "𝟛",
+    "\\bbfour": "𝟜",
+    "\\bbfive": "𝟝",
+    "\\bbsix": "𝟞",
+    "\\bbseven": "𝟟",
+    "\\bbeight": "𝟠",
+    "\\bbnine": "𝟡",
+    "\\sanszero": "𝟢",
+    "\\sansone": "𝟣",
+    "\\sanstwo": "𝟤",
+    "\\sansthree": "𝟥",
+    "\\sansfour": "𝟦",
+    "\\sansfive": "𝟧",
+    "\\sanssix": "𝟨",
+    "\\sansseven": "𝟩",
+    "\\sanseight": "𝟪",
+    "\\sansnine": "𝟫",
+    "\\bsanszero": "𝟬",
+    "\\bsansone": "𝟭",
+    "\\bsanstwo": "𝟮",
+    "\\bsansthree": "𝟯",
+    "\\bsansfour": "𝟰",
+    "\\bsansfive": "𝟱",
+    "\\bsanssix": "𝟲",
+    "\\bsansseven": "𝟳",
+    "\\bsanseight": "𝟴",
+    "\\bsansnine": "𝟵",
+    "\\ttzero": "𝟶",
+    "\\ttone": "𝟷",
+    "\\tttwo": "𝟸",
+    "\\ttthree": "𝟹",
+    "\\ttfour": "𝟺",
+    "\\ttfive": "𝟻",
+    "\\ttsix": "𝟼",
+    "\\ttseven": "𝟽",
+    "\\tteight": "𝟾",
+    "\\ttnine": "𝟿",
+    "\\underbar": "̲",
+    "\\underleftrightarrow": "͍",
+}
+
+
+reverse_latex_symbol = {v: k for k, v in latex_symbols.items()}

temp_venv/lib/python3.13/site-packages/IPython/core/logger.py

@@ -0,0 +1,231 @@
+"""Logger class for IPython's logging facilities.
+"""
+
+#*****************************************************************************
+#       Copyright (C) 2001 Janko Hauser <[email protected]> and
+#       Copyright (C) 2001-2006 Fernando Perez <[email protected]>
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#*****************************************************************************
+
+#****************************************************************************
+# Modules and globals
+
+# Python standard modules
+import glob
+import io
+import logging
+import os
+import time
+
+
+# prevent jedi/parso's debug messages pipe into interactiveshell
+logging.getLogger("parso").setLevel(logging.WARNING)
+
+#****************************************************************************
+# FIXME: This class isn't a mixin anymore, but it still needs attributes from
+# ipython and does input cache management.  Finish cleanup later...
+
+class Logger:
+    """A Logfile class with different policies for file creation"""
+
+    def __init__(self, home_dir, logfname='Logger.log', loghead=u'',
+                 logmode='over'):
+
+        # this is the full ipython instance, we need some attributes from it
+        # which won't exist until later. What a mess, clean up later...
+        self.home_dir = home_dir
+
+        self.logfname = logfname
+        self.loghead = loghead
+        self.logmode = logmode
+        self.logfile = None
+
+        # Whether to log raw or processed input
+        self.log_raw_input = False
+
+        # whether to also log output
+        self.log_output = False
+
+        # whether to put timestamps before each log entry
+        self.timestamp = False
+
+        # activity control flags
+        self.log_active = False
+
+    # logmode is a validated property
+    def _set_mode(self,mode):
+        if mode not in ['append','backup','global','over','rotate']:
+            raise ValueError('invalid log mode %s given' % mode)
+        self._logmode = mode
+
+    def _get_mode(self):
+        return self._logmode
+
+    logmode = property(_get_mode,_set_mode)
+
+    def logstart(self, logfname=None, loghead=None, logmode=None,
+                 log_output=False, timestamp=False, log_raw_input=False):
+        """Generate a new log-file with a default header.
+
+        Raises RuntimeError if the log has already been started"""
+
+        if self.logfile is not None:
+            raise RuntimeError('Log file is already active: %s' %
+                               self.logfname)
+
+        # The parameters can override constructor defaults
+        if logfname is not None: self.logfname = logfname
+        if loghead is not None: self.loghead = loghead
+        if logmode is not None: self.logmode = logmode
+
+        # Parameters not part of the constructor
+        self.timestamp = timestamp
+        self.log_output = log_output
+        self.log_raw_input = log_raw_input
+
+        # init depending on the log mode requested
+        isfile = os.path.isfile
+        logmode = self.logmode
+
+        if logmode == 'append':
+            self.logfile = io.open(self.logfname, 'a', encoding='utf-8')
+
+        elif logmode == 'backup':
+            if isfile(self.logfname):
+                backup_logname = self.logfname+'~'
+                # Manually remove any old backup, since os.rename may fail
+                # under Windows.
+                if isfile(backup_logname):
+                    os.remove(backup_logname)
+                os.rename(self.logfname,backup_logname)
+            self.logfile = io.open(self.logfname, 'w', encoding='utf-8')
+
+        elif logmode == 'global':
+            self.logfname = os.path.join(self.home_dir,self.logfname)
+            self.logfile = io.open(self.logfname, 'a', encoding='utf-8')
+
+        elif logmode == 'over':
+            if isfile(self.logfname):
+                os.remove(self.logfname)
+            self.logfile = io.open(self.logfname,'w', encoding='utf-8')
+
+        elif logmode == 'rotate':
+            if isfile(self.logfname):
+                if isfile(self.logfname+'.001~'):
+                    old = glob.glob(self.logfname+'.*~')
+                    old.sort()
+                    old.reverse()
+                    for f in old:
+                        root, ext = os.path.splitext(f)
+                        num = int(ext[1:-1])+1
+                        os.rename(f, root+'.'+repr(num).zfill(3)+'~')
+                os.rename(self.logfname, self.logfname+'.001~')
+            self.logfile = io.open(self.logfname, 'w', encoding='utf-8')
+
+        if logmode != 'append':
+            self.logfile.write(self.loghead)
+
+        self.logfile.flush()
+        self.log_active = True
+
+    def switch_log(self,val):
+        """Switch logging on/off. val should be ONLY a boolean."""
+
+        if val not in [False,True,0,1]:
+            raise ValueError('Call switch_log ONLY with a boolean argument, '
+                             'not with: %s' % val)
+
+        label = {0:'OFF',1:'ON',False:'OFF',True:'ON'}
+
+        if self.logfile is None:
+            print("""
+Logging hasn't been started yet (use logstart for that).
+
+%logon/%logoff are for temporarily starting and stopping logging for a logfile
+which already exists. But you must first start the logging process with
+%logstart (optionally giving a logfile name).""")
+
+        else:
+            if self.log_active == val:
+                print('Logging is already',label[val])
+            else:
+                print('Switching logging',label[val])
+                self.log_active = not self.log_active
+                self.log_active_out = self.log_active
+
+    def logstate(self):
+        """Print a status message about the logger."""
+        if self.logfile is None:
+            print('Logging has not been activated.')
+        else:
+            state = self.log_active and 'active' or 'temporarily suspended'
+            print('Filename       :', self.logfname)
+            print('Mode           :', self.logmode)
+            print('Output logging :', self.log_output)
+            print('Raw input log  :', self.log_raw_input)
+            print('Timestamping   :', self.timestamp)
+            print('State          :', state)
+
+    def log(self, line_mod, line_ori):
+        """Write the sources to a log.
+
+        Inputs:
+
+        - line_mod: possibly modified input, such as the transformations made
+          by input prefilters or input handlers of various kinds. This should
+          always be valid Python.
+
+        - line_ori: unmodified input line from the user. This is not
+          necessarily valid Python.
+        """
+
+        # Write the log line, but decide which one according to the
+        # log_raw_input flag, set when the log is started.
+        if self.log_raw_input:
+            self.log_write(line_ori)
+        else:
+            self.log_write(line_mod)
+
+    def log_write(self, data, kind='input'):
+        """Write data to the log file, if active"""
+
+        # print('data: %r' % data)  # dbg
+        if self.log_active and data:
+            write = self.logfile.write
+            if kind=='input':
+                if self.timestamp:
+                    write(time.strftime('# %a, %d %b %Y %H:%M:%S\n', time.localtime()))
+                write(data)
+            elif kind=='output' and self.log_output:
+                odata = u'\n'.join([u'#[Out]# %s' % s
+                                   for s in data.splitlines()])
+                write(u'%s\n' % odata)
+            try:
+                self.logfile.flush()
+            except OSError:
+                print("Failed to flush the log file.")
+                print(
+                    f"Please check that {self.logfname} exists and have the right permissions."
+                )
+                print(
+                    "Also consider turning off the log with `%logstop` to avoid this warning."
+                )
+
+    def logstop(self):
+        """Fully stop logging and close log file.
+
+        In order to start logging again, a new logstart() call needs to be
+        made, possibly (though not necessarily) with a new filename, mode and
+        other options."""
+
+        if self.logfile is not None:
+            self.logfile.close()
+            self.logfile = None
+        else:
+            print("Logging hadn't been started.")
+        self.log_active = False
+
+    # For backwards compatibility, in case anyone was using this.
+    close_log = logstop

temp_venv/lib/python3.13/site-packages/IPython/core/macro.py

@@ -0,0 +1,53 @@
+"""Support for interactive macros in IPython"""
+
+#*****************************************************************************
+#       Copyright (C) 2001-2005 Fernando Perez <[email protected]>
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#*****************************************************************************
+
+import re
+
+from IPython.utils.encoding import DEFAULT_ENCODING
+
+coding_declaration = re.compile(r"#\s*coding[:=]\s*([-\w.]+)")
+
+class Macro:
+    """Simple class to store the value of macros as strings.
+
+    Macro is just a callable that executes a string of IPython
+    input when called.
+    """
+
+    def __init__(self,code):
+        """store the macro value, as a single string which can be executed"""
+        lines = []
+        enc = None
+        for line in code.splitlines():
+            coding_match = coding_declaration.match(line)
+            if coding_match:
+                enc = coding_match.group(1)
+            else:
+                lines.append(line)
+        code = "\n".join(lines)
+        if isinstance(code, bytes):
+            code = code.decode(enc or DEFAULT_ENCODING)
+        self.value = code + '\n'
+    
+    def __str__(self):
+        return self.value
+
+    def __repr__(self):
+        return 'IPython.macro.Macro(%s)' % repr(self.value)
+    
+    def __getstate__(self):
+        """ needed for safe pickling via %store """
+        return {'value': self.value}
+    
+    def __add__(self, other):
+        if isinstance(other, Macro):
+            return Macro(self.value + other.value)
+        elif isinstance(other, str):
+            return Macro(self.value + other)
+        raise TypeError

temp_venv/lib/python3.13/site-packages/IPython/core/magic_arguments.py

@@ -0,0 +1,310 @@
+'''A decorator-based method of constructing IPython magics with `argparse`
+option handling.
+
+New magic functions can be defined like so::
+
+    from IPython.core.magic_arguments import (argument, magic_arguments,
+        parse_argstring)
+
+    @magic_arguments()
+    @argument('-o', '--option', help='An optional argument.')
+    @argument('arg', type=int, help='An integer positional argument.')
+    def magic_cool(self, arg):
+        """ A really cool magic command.
+
+    """
+        args = parse_argstring(magic_cool, arg)
+        ...
+
+The `@magic_arguments` decorator marks the function as having argparse arguments.
+The `@argument` decorator adds an argument using the same syntax as argparse's
+`add_argument()` method. More sophisticated uses may also require the
+`@argument_group` or `@kwds` decorator to customize the formatting and the
+parsing.
+
+Help text for the magic is automatically generated from the docstring and the
+arguments::
+
+    In[1]: %cool?
+        %cool [-o OPTION] arg
+
+        A really cool magic command.
+
+        positional arguments:
+          arg                   An integer positional argument.
+
+        optional arguments:
+          -o OPTION, --option OPTION
+                                An optional argument.
+
+Here is an elaborated example that uses default parameters in `argument` and calls the `args` in the cell magic::
+
+    from IPython.core.magic import register_cell_magic
+    from IPython.core.magic_arguments import (argument, magic_arguments,
+                                            parse_argstring)
+
+
+    @magic_arguments()
+    @argument(
+        "--option",
+        "-o",
+        help=("Add an option here"),
+    )
+    @argument(
+        "--style",
+        "-s",
+        default="foo",
+        help=("Add some style arguments"),
+    )
+    @register_cell_magic
+    def my_cell_magic(line, cell):
+        args = parse_argstring(my_cell_magic, line)
+        print(f"{args.option=}")
+        print(f"{args.style=}")
+        print(f"{cell=}")
+
+In a jupyter notebook, this cell magic can be executed like this::
+
+    %%my_cell_magic -o Hello
+    print("bar")
+    i = 42
+
+Inheritance diagram:
+
+.. inheritance-diagram:: IPython.core.magic_arguments
+   :parts: 3
+
+'''
+#-----------------------------------------------------------------------------
+# Copyright (C) 2010-2011, IPython Development Team.
+#
+# Distributed under the terms of the Modified BSD License.
+#
+# The full license is in the file COPYING.txt, distributed with this software.
+#-----------------------------------------------------------------------------
+import argparse
+import re
+
+# Our own imports
+from IPython.core.error import UsageError
+from IPython.utils.decorators import undoc
+from IPython.utils.process import arg_split
+from IPython.utils.text import dedent
+
+NAME_RE = re.compile(r"[a-zA-Z][a-zA-Z0-9_-]*$")
+
+@undoc
+class MagicHelpFormatter(argparse.RawDescriptionHelpFormatter):
+    """A HelpFormatter with a couple of changes to meet our needs.
+    """
+    # Modified to dedent text.
+    def _fill_text(self, text, width, indent):
+        return argparse.RawDescriptionHelpFormatter._fill_text(self, dedent(text), width, indent)
+
+    # Modified to wrap argument placeholders in <> where necessary.
+    def _format_action_invocation(self, action):
+        if not action.option_strings:
+            metavar, = self._metavar_formatter(action, action.dest)(1)
+            return metavar
+
+        else:
+            parts = []
+
+            # if the Optional doesn't take a value, format is:
+            #    -s, --long
+            if action.nargs == 0:
+                parts.extend(action.option_strings)
+
+            # if the Optional takes a value, format is:
+            #    -s ARGS, --long ARGS
+            else:
+                default = action.dest.upper()
+                args_string = self._format_args(action, default)
+                # IPYTHON MODIFICATION: If args_string is not a plain name, wrap
+                # it in <> so it's valid RST.
+                if not NAME_RE.match(args_string):
+                    args_string = "<%s>" % args_string
+                for option_string in action.option_strings:
+                    parts.append('%s %s' % (option_string, args_string))
+
+            return ', '.join(parts)
+
+    # Override the default prefix ('usage') to our % magic escape,
+    # in a code block.
+    def add_usage(self, usage, actions, groups, prefix="::\n\n  %"):
+        super(MagicHelpFormatter, self).add_usage(usage, actions, groups, prefix)
+
+class MagicArgumentParser(argparse.ArgumentParser):
+    """ An ArgumentParser tweaked for use by IPython magics.
+    """
+    def __init__(self,
+                 prog=None,
+                 usage=None,
+                 description=None,
+                 epilog=None,
+                 parents=None,
+                 formatter_class=MagicHelpFormatter,
+                 prefix_chars='-',
+                 argument_default=None,
+                 conflict_handler='error',
+                 add_help=False):
+        if parents is None:
+            parents = []
+        super(MagicArgumentParser, self).__init__(prog=prog, usage=usage,
+            description=description, epilog=epilog,
+            parents=parents, formatter_class=formatter_class,
+            prefix_chars=prefix_chars, argument_default=argument_default,
+            conflict_handler=conflict_handler, add_help=add_help)
+
+    def error(self, message):
+        """ Raise a catchable error instead of exiting.
+        """
+        raise UsageError(message)
+
+    def parse_argstring(self, argstring):
+        """ Split a string into an argument list and parse that argument list.
+        """
+        argv = arg_split(argstring)
+        return self.parse_args(argv)
+
+
+def construct_parser(magic_func):
+    """ Construct an argument parser using the function decorations.
+    """
+    kwds = getattr(magic_func, 'argcmd_kwds', {})
+    if 'description' not in kwds:
+        kwds['description'] = getattr(magic_func, '__doc__', None)
+    arg_name = real_name(magic_func)
+    parser = MagicArgumentParser(arg_name, **kwds)
+    # Reverse the list of decorators in order to apply them in the
+    # order in which they appear in the source.
+    group = None
+    for deco in magic_func.decorators[::-1]:
+        result = deco.add_to_parser(parser, group)
+        if result is not None:
+            group = result
+
+    # Replace the magic function's docstring with the full help text.
+    magic_func.__doc__ = parser.format_help()
+
+    return parser
+
+
+def parse_argstring(magic_func, argstring):
+    """ Parse the string of arguments for the given magic function.
+    """
+    return magic_func.parser.parse_argstring(argstring)
+
+
+def real_name(magic_func):
+    """ Find the real name of the magic.
+    """
+    magic_name = magic_func.__name__
+    if magic_name.startswith('magic_'):
+        magic_name = magic_name[len('magic_'):]
+    return getattr(magic_func, 'argcmd_name', magic_name)
+
+
+class ArgDecorator:
+    """ Base class for decorators to add ArgumentParser information to a method.
+    """
+
+    def __call__(self, func):
+        if not getattr(func, 'has_arguments', False):
+            func.has_arguments = True
+            func.decorators = []
+        func.decorators.append(self)
+        return func
+
+    def add_to_parser(self, parser, group):
+        """ Add this object's information to the parser, if necessary.
+        """
+        pass
+
+
+class magic_arguments(ArgDecorator):
+    """ Mark the magic as having argparse arguments and possibly adjust the
+    name.
+    """
+
+    def __init__(self, name=None):
+        self.name = name
+
+    def __call__(self, func):
+        if not getattr(func, 'has_arguments', False):
+            func.has_arguments = True
+            func.decorators = []
+        if self.name is not None:
+            func.argcmd_name = self.name
+        # This should be the first decorator in the list of decorators, thus the
+        # last to execute. Build the parser.
+        func.parser = construct_parser(func)
+        return func
+
+
+class ArgMethodWrapper(ArgDecorator):
+
+    """
+    Base class to define a wrapper for ArgumentParser method.
+
+    Child class must define either `_method_name` or `add_to_parser`.
+
+    """
+
+    _method_name: str
+
+    def __init__(self, *args, **kwds):
+        self.args = args
+        self.kwds = kwds
+
+    def add_to_parser(self, parser, group):
+        """ Add this object's information to the parser.
+        """
+        if group is not None:
+            parser = group
+        getattr(parser, self._method_name)(*self.args, **self.kwds)
+        return None
+
+
+class argument(ArgMethodWrapper):
+    """ Store arguments and keywords to pass to add_argument().
+
+    Instances also serve to decorate command methods.
+    """
+    _method_name = 'add_argument'
+
+
+class defaults(ArgMethodWrapper):
+    """ Store arguments and keywords to pass to set_defaults().
+
+    Instances also serve to decorate command methods.
+    """
+    _method_name = 'set_defaults'
+
+
+class argument_group(ArgMethodWrapper):
+    """ Store arguments and keywords to pass to add_argument_group().
+
+    Instances also serve to decorate command methods.
+    """
+
+    def add_to_parser(self, parser, group):
+        """ Add this object's information to the parser.
+        """
+        return parser.add_argument_group(*self.args, **self.kwds)
+
+
+class kwds(ArgDecorator):
+    """ Provide other keywords to the sub-parser constructor.
+    """
+    def __init__(self, **kwds):
+        self.kwds = kwds
+
+    def __call__(self, func):
+        func = super(kwds, self).__call__(func)
+        func.argcmd_kwds = self.kwds
+        return func
+
+
+__all__ = ['magic_arguments', 'argument', 'argument_group', 'kwds',
+    'parse_argstring']

temp_venv/lib/python3.13/site-packages/IPython/core/oinspect.py

@@ -0,0 +1,1216 @@
+"""Tools for inspecting Python objects.
+
+Uses syntax highlighting for presenting the various information elements.
+
+Similar in spirit to the inspect module, but all calls take a name argument to
+reference the name under which an object is being read.
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+__all__ = ["Inspector"]
+
+# stdlib modules
+from dataclasses import dataclass
+from inspect import signature
+from textwrap import dedent
+import ast
+import html
+import inspect
+import io as stdlib_io
+import linecache
+import os
+import types
+import warnings
+from pygments.token import Token
+
+
+from typing import (
+    cast,
+    Any,
+    Optional,
+    Dict,
+    Union,
+    List,
+    TypedDict,
+    TypeAlias,
+    Tuple,
+)
+
+import traitlets
+from traitlets.config import Configurable
+
+# IPython's own
+from IPython.core import page
+from IPython.lib.pretty import pretty
+from IPython.testing.skipdoctest import skip_doctest
+from IPython.utils import PyColorize, openpy
+from IPython.utils.dir2 import safe_hasattr
+from IPython.utils.path import compress_user
+from IPython.utils.text import indent
+from IPython.utils.wildcard import list_namespace, typestr2type
+from IPython.utils.decorators import undoc
+
+from pygments import highlight
+from pygments.lexers import PythonLexer
+from pygments.formatters import HtmlFormatter
+
+HOOK_NAME = "__custom_documentations__"
+
+
+UnformattedBundle: TypeAlias = Dict[str, List[Tuple[str, str]]]  # List of (title, body)
+Bundle: TypeAlias = Dict[str, str]
+
+
+@dataclass
+class OInfo:
+    ismagic: bool
+    isalias: bool
+    found: bool
+    namespace: Optional[str]
+    parent: Any
+    obj: Any
+
+    def get(self, field):
+        """Get a field from the object for backward compatibility with before 8.12
+
+        see https://github.com/h5py/h5py/issues/2253
+        """
+        # We need to deprecate this at some point, but the warning will show in completion.
+        # Let's comment this for now and uncomment end of 2023 ish
+        # Jan 2025: decomenting for IPython 9.0
+        warnings.warn(
+            f"OInfo dataclass with fields access since IPython 8.12 please use OInfo.{field} instead."
+            "OInfo used to be a dict but a dataclass provide static fields verification with mypy."
+            "This warning and backward compatibility `get()` method were added in 8.13.",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+        return getattr(self, field)
+
+
+def pylight(code):
+    return highlight(code, PythonLexer(), HtmlFormatter(noclasses=True))
+
+# builtin docstrings to ignore
+_func_call_docstring = types.FunctionType.__call__.__doc__
+_object_init_docstring = object.__init__.__doc__
+_builtin_type_docstrings = {
+    inspect.getdoc(t) for t in (types.ModuleType, types.MethodType,
+                                types.FunctionType, property)
+}
+
+_builtin_func_type = type(all)
+_builtin_meth_type = type(str.upper)  # Bound methods have the same type as builtin functions
+#****************************************************************************
+# Builtin color schemes
+
+
+#****************************************************************************
+# Auxiliary functions and objects
+
+
+class InfoDict(TypedDict):
+    type_name: Optional[str]
+    base_class: Optional[str]
+    string_form: Optional[str]
+    namespace: Optional[str]
+    length: Optional[str]
+    file: Optional[str]
+    definition: Optional[str]
+    docstring: Optional[str]
+    source: Optional[str]
+    init_definition: Optional[str]
+    class_docstring: Optional[str]
+    init_docstring: Optional[str]
+    call_def: Optional[str]
+    call_docstring: Optional[str]
+    subclasses: Optional[str]
+    # These won't be printed but will be used to determine how to
+    # format the object
+    ismagic: bool
+    isalias: bool
+    isclass: bool
+    found: bool
+    name: str
+
+
+_info_fields = list(InfoDict.__annotations__.keys())
+
+
+def __getattr__(name):
+    if name == "info_fields":
+        warnings.warn(
+            "IPython.core.oinspect's `info_fields` is considered for deprecation and may be removed in the Future. ",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+        return _info_fields
+
+    raise AttributeError(f"module {__name__!r} has no attribute {name!r}")
+
+
+@dataclass
+class InspectorHookData:
+    """Data passed to the mime hook"""
+
+    obj: Any
+    info: Optional[OInfo]
+    info_dict: InfoDict
+    detail_level: int
+    omit_sections: list[str]
+
+
+@undoc
+def object_info(
+    *,
+    name: str,
+    found: bool,
+    isclass: bool = False,
+    isalias: bool = False,
+    ismagic: bool = False,
+    **kw,
+) -> InfoDict:
+    """Make an object info dict with all fields present."""
+    infodict = dict(kw)
+    infodict.update({k: None for k in _info_fields if k not in infodict})
+    infodict["name"] = name  # type: ignore
+    infodict["found"] = found  # type: ignore
+    infodict["isclass"] = isclass  # type: ignore
+    infodict["isalias"] = isalias  # type: ignore
+    infodict["ismagic"] = ismagic  # type: ignore
+
+    return InfoDict(**infodict)  # type:ignore
+
+
+def get_encoding(obj):
+    """Get encoding for python source file defining obj
+
+    Returns None if obj is not defined in a sourcefile.
+    """
+    ofile = find_file(obj)
+    # run contents of file through pager starting at line where the object
+    # is defined, as long as the file isn't binary and is actually on the
+    # filesystem.
+    if ofile is None:
+        return None
+    elif ofile.endswith(('.so', '.dll', '.pyd')):
+        return None
+    elif not os.path.isfile(ofile):
+        return None
+    else:
+        # Print only text files, not extension binaries.  Note that
+        # getsourcelines returns lineno with 1-offset and page() uses
+        # 0-offset, so we must adjust.
+        with stdlib_io.open(ofile, 'rb') as buffer:   # Tweaked to use io.open for Python 2
+            encoding, _lines = openpy.detect_encoding(buffer.readline)
+        return encoding
+
+
+def getdoc(obj) -> Union[str, None]:
+    """Stable wrapper around inspect.getdoc.
+
+    This can't crash because of attribute problems.
+
+    It also attempts to call a getdoc() method on the given object.  This
+    allows objects which provide their docstrings via non-standard mechanisms
+    (like Pyro proxies) to still be inspected by ipython's ? system.
+    """
+    # Allow objects to offer customized documentation via a getdoc method:
+    try:
+        ds = obj.getdoc()
+    except Exception:
+        pass
+    else:
+        if isinstance(ds, str):
+            return inspect.cleandoc(ds)
+    docstr = inspect.getdoc(obj)
+    return docstr
+
+
+def getsource(obj, oname='') -> Union[str,None]:
+    """Wrapper around inspect.getsource.
+
+    This can be modified by other projects to provide customized source
+    extraction.
+
+    Parameters
+    ----------
+    obj : object
+        an object whose source code we will attempt to extract
+    oname : str
+        (optional) a name under which the object is known
+
+    Returns
+    -------
+    src : unicode or None
+
+    """
+
+    if isinstance(obj, property):
+        sources = []
+        for attrname in ['fget', 'fset', 'fdel']:
+            fn = getattr(obj, attrname)
+            if fn is not None:
+                oname_prefix = ('%s.' % oname) if oname else ''
+                sources.append(''.join(('# ', oname_prefix, attrname)))
+                if inspect.isfunction(fn):
+                    _src = getsource(fn)
+                    if _src:
+                        # assert _src is not None, "please mypy"
+                        sources.append(dedent(_src))
+                else:
+                    # Default str/repr only prints function name,
+                    # pretty.pretty prints module name too.
+                    sources.append(
+                        '%s%s = %s\n' % (oname_prefix, attrname, pretty(fn))
+                    )
+        if sources:
+            return '\n'.join(sources)
+        else:
+            return None
+
+    else:
+        # Get source for non-property objects.
+
+        obj = _get_wrapped(obj)
+
+        try:
+            src = inspect.getsource(obj)
+        except TypeError:
+            # The object itself provided no meaningful source, try looking for
+            # its class definition instead.
+            try:
+                src = inspect.getsource(obj.__class__)
+            except (OSError, TypeError):
+                return None
+        except OSError:
+            return None
+
+        return src
+
+
+def is_simple_callable(obj):
+    """True if obj is a function ()"""
+    return (inspect.isfunction(obj) or inspect.ismethod(obj) or \
+            isinstance(obj, _builtin_func_type) or isinstance(obj, _builtin_meth_type))
+
+def _get_wrapped(obj):
+    """Get the original object if wrapped in one or more @decorators
+
+    Some objects automatically construct similar objects on any unrecognised
+    attribute access (e.g. unittest.mock.call). To protect against infinite loops,
+    this will arbitrarily cut off after 100 levels of obj.__wrapped__
+    attribute access. --TK, Jan 2016
+    """
+    orig_obj = obj
+    i = 0
+    while safe_hasattr(obj, '__wrapped__'):
+        obj = obj.__wrapped__
+        i += 1
+        if i > 100:
+            # __wrapped__ is probably a lie, so return the thing we started with
+            return orig_obj
+    return obj
+
+def find_file(obj) -> Optional[str]:
+    """Find the absolute path to the file where an object was defined.
+
+    This is essentially a robust wrapper around `inspect.getabsfile`.
+
+    Returns None if no file can be found.
+
+    Parameters
+    ----------
+    obj : any Python object
+
+    Returns
+    -------
+    fname : str
+        The absolute path to the file where the object was defined.
+    """
+    obj = _get_wrapped(obj)
+
+    fname: Optional[str] = None
+    try:
+        fname = inspect.getabsfile(obj)
+    except TypeError:
+        # For an instance, the file that matters is where its class was
+        # declared.
+        try:
+            fname = inspect.getabsfile(obj.__class__)
+        except (OSError, TypeError):
+            # Can happen for builtins
+            pass
+    except OSError:
+        pass
+
+    return fname
+
+
+def find_source_lines(obj):
+    """Find the line number in a file where an object was defined.
+
+    This is essentially a robust wrapper around `inspect.getsourcelines`.
+
+    Returns None if no file can be found.
+
+    Parameters
+    ----------
+    obj : any Python object
+
+    Returns
+    -------
+    lineno : int
+        The line number where the object definition starts.
+    """
+    obj = _get_wrapped(obj)
+
+    try:
+        lineno = inspect.getsourcelines(obj)[1]
+    except TypeError:
+        # For instances, try the class object like getsource() does
+        try:
+            lineno = inspect.getsourcelines(obj.__class__)[1]
+        except (OSError, TypeError):
+            return None
+    except OSError:
+        return None
+
+    return lineno
+
+
+_sentinel = object()
+
+
+class Inspector(Configurable):
+
+    mime_hooks = traitlets.Dict(
+        config=True,
+        help="dictionary of mime to callable to add information into help mimebundle dict",
+    ).tag(config=True)
+
+    _theme_name: str
+
+    def __init__(
+        self,
+        *,
+        theme_name: str,
+        str_detail_level=0,
+        parent=None,
+        config=None,
+    ):
+        if theme_name in ["Linux", "LightBG", "Neutral", "NoColor"]:
+            warnings.warn(
+                f"Theme names and color schemes are lowercase in IPython 9.0 use {theme_name.lower()} instead",
+                DeprecationWarning,
+                stacklevel=2,
+            )
+            theme_name = theme_name.lower()
+        self._theme_name = theme_name
+        super(Inspector, self).__init__(parent=parent, config=config)
+        self.parser = PyColorize.Parser(out="str", theme_name=theme_name)
+        self.str_detail_level = str_detail_level
+        self.set_theme_name(theme_name)
+
+    def format(self, *args, **kwargs):
+        return self.parser.format(*args, **kwargs)
+
+    def _getdef(self,obj,oname='') -> Union[str,None]:
+        """Return the call signature for any callable object.
+
+        If any exception is generated, None is returned instead and the
+        exception is suppressed."""
+        if not callable(obj):
+            return None
+        try:
+            return _render_signature(signature(obj), oname)
+        except:
+            return None
+
+    def __head(self, h: str) -> str:
+        """Return a header string with proper colors."""
+        return PyColorize.theme_table[self._theme_name].format([(Token.Header, h)])
+
+    def set_theme_name(self, name: str):
+        assert name == name.lower()
+        assert name in PyColorize.theme_table.keys()
+        self._theme_name = name
+        self.parser.theme_name = name
+
+    def set_active_scheme(self, scheme: str):
+        warnings.warn(
+            "set_active_scheme is deprecated and replaced by set_theme_name as of IPython 9.0",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+        assert scheme == scheme.lower()
+        if scheme is not None and self._theme_name != scheme:
+            self._theme_name = scheme
+            self.parser.theme_name = scheme
+
+    def noinfo(self, msg, oname):
+        """Generic message when no information is found."""
+        print('No %s found' % msg, end=' ')
+        if oname:
+            print('for %s' % oname)
+        else:
+            print()
+
+    def pdef(self, obj, oname=''):
+        """Print the call signature for any callable object.
+
+        If the object is a class, print the constructor information."""
+
+        if not callable(obj):
+            print('Object is not callable.')
+            return
+
+        header = ''
+
+        if inspect.isclass(obj):
+            header = self.__head('Class constructor information:\n')
+
+
+        output = self._getdef(obj,oname)
+        if output is None:
+            self.noinfo('definition header',oname)
+        else:
+            print(header,self.format(output), end=' ')
+
+    # In Python 3, all classes are new-style, so they all have __init__.
+    @skip_doctest
+    def pdoc(self, obj, oname='', formatter=None):
+        """Print the docstring for any object.
+
+        Optional:
+        -formatter: a function to run the docstring through for specially
+        formatted docstrings.
+
+        Examples
+        --------
+        In [1]: class NoInit:
+           ...:     pass
+
+        In [2]: class NoDoc:
+           ...:     def __init__(self):
+           ...:         pass
+
+        In [3]: %pdoc NoDoc
+        No documentation found for NoDoc
+
+        In [4]: %pdoc NoInit
+        No documentation found for NoInit
+
+        In [5]: obj = NoInit()
+
+        In [6]: %pdoc obj
+        No documentation found for obj
+
+        In [5]: obj2 = NoDoc()
+
+        In [6]: %pdoc obj2
+        No documentation found for obj2
+        """
+
+        lines = []
+        ds = getdoc(obj)
+        if formatter:
+            ds = formatter(ds).get('plain/text', ds)
+        if ds:
+            lines.append(self.__head("Class docstring:"))
+            lines.append(indent(ds))
+        if inspect.isclass(obj) and hasattr(obj, '__init__'):
+            init_ds = getdoc(obj.__init__)
+            if init_ds is not None:
+                lines.append(self.__head("Init docstring:"))
+                lines.append(indent(init_ds))
+        elif hasattr(obj,'__call__'):
+            call_ds = getdoc(obj.__call__)
+            if call_ds:
+                lines.append(self.__head("Call docstring:"))
+                lines.append(indent(call_ds))
+
+        if not lines:
+            self.noinfo('documentation',oname)
+        else:
+            page.page('\n'.join(lines))
+
+    def psource(self, obj, oname=''):
+        """Print the source code for an object."""
+
+        # Flush the source cache because inspect can return out-of-date source
+        linecache.checkcache()
+        try:
+            src = getsource(obj, oname=oname)
+        except Exception:
+            src = None
+
+        if src is None:
+            self.noinfo('source', oname)
+        else:
+            page.page(self.format(src))
+
+    def pfile(self, obj, oname=''):
+        """Show the whole file where an object was defined."""
+
+        lineno = find_source_lines(obj)
+        if lineno is None:
+            self.noinfo('file', oname)
+            return
+
+        ofile = find_file(obj)
+        # run contents of file through pager starting at line where the object
+        # is defined, as long as the file isn't binary and is actually on the
+        # filesystem.
+        if ofile is None:
+            print("Could not find file for object")
+        elif ofile.endswith((".so", ".dll", ".pyd")):
+            print("File %r is binary, not printing." % ofile)
+        elif not os.path.isfile(ofile):
+            print('File %r does not exist, not printing.' % ofile)
+        else:
+            # Print only text files, not extension binaries.  Note that
+            # getsourcelines returns lineno with 1-offset and page() uses
+            # 0-offset, so we must adjust.
+            page.page(self.format(openpy.read_py_file(ofile, skip_encoding_cookie=False)), lineno - 1)
+
+
+    def _mime_format(self, text:str, formatter=None) -> dict:
+        """Return a mime bundle representation of the input text.
+
+        - if `formatter` is None, the returned mime bundle has
+           a ``text/plain`` field, with the input text.
+           a ``text/html`` field with a ``<pre>`` tag containing the input text.
+
+        - if ``formatter`` is not None, it must be a callable transforming the
+          input text into a mime bundle. Default values for ``text/plain`` and
+          ``text/html`` representations are the ones described above.
+
+        Note:
+
+        Formatters returning strings are supported but this behavior is deprecated.
+
+        """
+        defaults = {
+            "text/plain": text,
+            "text/html": f"<pre>{html.escape(text)}</pre>",
+        }
+
+        if formatter is None:
+            return defaults
+        else:
+            formatted = formatter(text)
+
+            if not isinstance(formatted, dict):
+                # Handle the deprecated behavior of a formatter returning
+                # a string instead of a mime bundle.
+                return {"text/plain": formatted, "text/html": f"<pre>{formatted}</pre>"}
+
+            else:
+                return dict(defaults, **formatted)
+
+    def format_mime(self, bundle: UnformattedBundle) -> Bundle:
+        """Format a mimebundle being created by _make_info_unformatted into a real mimebundle"""
+        # Format text/plain mimetype
+        assert isinstance(bundle["text/plain"], list)
+        for item in bundle["text/plain"]:
+            assert isinstance(item, tuple)
+
+        new_b: Bundle = {}
+        lines = []
+        _len = max(len(h) for h, _ in bundle["text/plain"])
+
+        for head, body in bundle["text/plain"]:
+            body = body.strip("\n")
+            delim = "\n" if "\n" in body else " "
+            lines.append(
+                f"{self.__head(head+':')}{(_len - len(head))*' '}{delim}{body}"
+            )
+
+        new_b["text/plain"] = "\n".join(lines)
+
+        if "text/html" in bundle:
+            assert isinstance(bundle["text/html"], list)
+            for item in bundle["text/html"]:
+                assert isinstance(item, tuple)
+            # Format the text/html mimetype
+            if isinstance(bundle["text/html"], (list, tuple)):
+                # bundle['text/html'] is a list of (head, formatted body) pairs
+                new_b["text/html"] = "\n".join(
+                    f"<h1>{head}</h1>\n{body}" for (head, body) in bundle["text/html"]
+                )
+
+        for k in bundle.keys():
+            if k in ("text/html", "text/plain"):
+                continue
+            else:
+                new_b[k] = bundle[k]  # type:ignore
+        return new_b
+
+    def _append_info_field(
+        self,
+        bundle: UnformattedBundle,
+        title: str,
+        key: str,
+        info,
+        omit_sections: List[str],
+        formatter,
+    ):
+        """Append an info value to the unformatted mimebundle being constructed by _make_info_unformatted"""
+        if title in omit_sections or key in omit_sections:
+            return
+        field = info[key]
+        if field is not None:
+            formatted_field = self._mime_format(field, formatter)
+            bundle["text/plain"].append((title, formatted_field["text/plain"]))
+            bundle["text/html"].append((title, formatted_field["text/html"]))
+
+    def _make_info_unformatted(
+        self, obj, info, formatter, detail_level, omit_sections
+    ) -> UnformattedBundle:
+        """Assemble the mimebundle as unformatted lists of information"""
+        bundle: UnformattedBundle = {
+            "text/plain": [],
+            "text/html": [],
+        }
+
+        # A convenience function to simplify calls below
+        def append_field(
+            bundle: UnformattedBundle, title: str, key: str, formatter=None
+        ):
+            self._append_info_field(
+                bundle,
+                title=title,
+                key=key,
+                info=info,
+                omit_sections=omit_sections,
+                formatter=formatter,
+            )
+
+        def code_formatter(text) -> Bundle:
+            return {
+                'text/plain': self.format(text),
+                'text/html': pylight(text)
+            }
+
+        if info["isalias"]:
+            append_field(bundle, "Repr", "string_form")
+
+        elif info['ismagic']:
+            if detail_level > 0:
+                append_field(bundle, "Source", "source", code_formatter)
+            else:
+                append_field(bundle, "Docstring", "docstring", formatter)
+            append_field(bundle, "File", "file")
+
+        elif info['isclass'] or is_simple_callable(obj):
+            # Functions, methods, classes
+            append_field(bundle, "Signature", "definition", code_formatter)
+            append_field(bundle, "Init signature", "init_definition", code_formatter)
+            append_field(bundle, "Docstring", "docstring", formatter)
+            if detail_level > 0 and info["source"]:
+                append_field(bundle, "Source", "source", code_formatter)
+            else:
+                append_field(bundle, "Init docstring", "init_docstring", formatter)
+
+            append_field(bundle, "File", "file")
+            append_field(bundle, "Type", "type_name")
+            append_field(bundle, "Subclasses", "subclasses")
+
+        else:
+            # General Python objects
+            append_field(bundle, "Signature", "definition", code_formatter)
+            append_field(bundle, "Call signature", "call_def", code_formatter)
+            append_field(bundle, "Type", "type_name")
+            append_field(bundle, "String form", "string_form")
+
+            # Namespace
+            if info["namespace"] != "Interactive":
+                append_field(bundle, "Namespace", "namespace")
+
+            append_field(bundle, "Length", "length")
+            append_field(bundle, "File", "file")
+
+            # Source or docstring, depending on detail level and whether
+            # source found.
+            if detail_level > 0 and info["source"]:
+                append_field(bundle, "Source", "source", code_formatter)
+            else:
+                append_field(bundle, "Docstring", "docstring", formatter)
+
+            append_field(bundle, "Class docstring", "class_docstring", formatter)
+            append_field(bundle, "Init docstring", "init_docstring", formatter)
+            append_field(bundle, "Call docstring", "call_docstring", formatter)
+        return bundle
+
+
+    def _get_info(
+        self,
+        obj: Any,
+        oname: str = "",
+        formatter=None,
+        info: Optional[OInfo] = None,
+        detail_level: int = 0,
+        omit_sections: Union[List[str], Tuple[()]] = (),
+    ) -> Bundle:
+        """Retrieve an info dict and format it.
+
+        Parameters
+        ----------
+        obj : any
+            Object to inspect and return info from
+        oname : str (default: ''):
+            Name of the variable pointing to `obj`.
+        formatter : callable
+        info
+            already computed information
+        detail_level : integer
+            Granularity of detail level, if set to 1, give more information.
+        omit_sections : list[str]
+            Titles or keys to omit from output (can be set, tuple, etc., anything supporting `in`)
+        """
+
+        info_dict = self.info(obj, oname=oname, info=info, detail_level=detail_level)
+        omit_sections = list(omit_sections)
+
+        bundle = self._make_info_unformatted(
+            obj,
+            info_dict,
+            formatter,
+            detail_level=detail_level,
+            omit_sections=omit_sections,
+        )
+        if self.mime_hooks:
+            hook_data = InspectorHookData(
+                obj=obj,
+                info=info,
+                info_dict=info_dict,
+                detail_level=detail_level,
+                omit_sections=omit_sections,
+            )
+            for key, hook in self.mime_hooks.items():  # type:ignore
+                required_parameters = [
+                    parameter
+                    for parameter in inspect.signature(hook).parameters.values()
+                    if parameter.default != inspect.Parameter.default
+                ]
+                if len(required_parameters) == 1:
+                    res = hook(hook_data)
+                else:
+                    warnings.warn(
+                        "MIME hook format changed in IPython 8.22; hooks should now accept"
+                        " a single parameter (InspectorHookData); support for hooks requiring"
+                        " two-parameters (obj and info) will be removed in a future version",
+                        DeprecationWarning,
+                        stacklevel=2,
+                    )
+                    res = hook(obj, info)
+                if res is not None:
+                    bundle[key] = res
+        return self.format_mime(bundle)
+
+    def pinfo(
+        self,
+        obj,
+        oname="",
+        formatter=None,
+        info: Optional[OInfo] = None,
+        detail_level=0,
+        enable_html_pager=True,
+        omit_sections=(),
+    ):
+        """Show detailed information about an object.
+
+        Optional arguments:
+
+        - oname: name of the variable pointing to the object.
+
+        - formatter: callable (optional)
+              A special formatter for docstrings.
+
+              The formatter is a callable that takes a string as an input
+              and returns either a formatted string or a mime type bundle
+              in the form of a dictionary.
+
+              Although the support of custom formatter returning a string
+              instead of a mime type bundle is deprecated.
+
+        - info: a structure with some information fields which may have been
+          precomputed already.
+
+        - detail_level: if set to 1, more information is given.
+
+        - omit_sections: set of section keys and titles to omit
+        """
+        assert info is not None
+        info_b: Bundle = self._get_info(
+            obj, oname, formatter, info, detail_level, omit_sections=omit_sections
+        )
+        if not enable_html_pager:
+            del info_b["text/html"]
+        page.page(info_b)
+
+    def info(self, obj, oname="", info=None, detail_level=0) -> InfoDict:
+        """Compute a dict with detailed information about an object.
+
+        Parameters
+        ----------
+        obj : any
+            An object to find information about
+        oname : str (default: '')
+            Name of the variable pointing to `obj`.
+        info : (default: None)
+            A struct (dict like with attr access) with some information fields
+            which may have been precomputed already.
+        detail_level : int (default:0)
+            If set to 1, more information is given.
+
+        Returns
+        -------
+        An object info dict with known fields from `info_fields` (see `InfoDict`).
+        """
+
+        if info is None:
+            ismagic = False
+            isalias = False
+            ospace = ''
+        else:
+            ismagic = info.ismagic
+            isalias = info.isalias
+            ospace = info.namespace
+
+        # Get docstring, special-casing aliases:
+        att_name = oname.split(".")[-1]
+        parents_docs = None
+        prelude = ""
+        if info and info.parent is not None and hasattr(info.parent, HOOK_NAME):
+            parents_docs_dict = getattr(info.parent, HOOK_NAME)
+            parents_docs = parents_docs_dict.get(att_name, None)
+        out: InfoDict = cast(
+            InfoDict,
+            {
+                **{field: None for field in _info_fields},
+                **{
+                    "name": oname,
+                    "found": True,
+                    "isalias": isalias,
+                    "ismagic": ismagic,
+                    "subclasses": None,
+                },
+            },
+        )
+
+        if parents_docs:
+            ds = parents_docs
+        elif isalias:
+            if not callable(obj):
+                try:
+                    ds = "Alias to the system command:\n  %s" % obj[1]
+                except:
+                    ds = "Alias: " + str(obj)
+            else:
+                ds = "Alias to " + str(obj)
+                if obj.__doc__:
+                    ds += "\nDocstring:\n" + obj.__doc__
+        else:
+            ds_or_None = getdoc(obj)
+            if ds_or_None is None:
+                ds = '<no docstring>'
+            else:
+                ds = ds_or_None
+
+        ds = prelude + ds
+
+        # store output in a dict, we initialize it here and fill it as we go
+
+        string_max = 200 # max size of strings to show (snipped if longer)
+        shalf = int((string_max - 5) / 2)
+
+        if ismagic:
+            out['type_name'] = 'Magic function'
+        elif isalias:
+            out['type_name'] = 'System alias'
+        else:
+            out['type_name'] = type(obj).__name__
+
+        try:
+            bclass = obj.__class__
+            out['base_class'] = str(bclass)
+        except:
+            pass
+
+        # String form, but snip if too long in ? form (full in ??)
+        if detail_level >= self.str_detail_level:
+            try:
+                ostr = str(obj)
+                if not detail_level and len(ostr) > string_max:
+                    ostr = ostr[:shalf] + ' <...> ' + ostr[-shalf:]
+                    # TODO: `'string_form'.expandtabs()` seems wrong, but
+                    # it was (nearly) like this since the first commit ever.
+                    ostr = ("\n" + " " * len("string_form".expandtabs())).join(
+                        q.strip() for q in ostr.split("\n")
+                    )
+                out["string_form"] = ostr
+            except:
+                pass
+
+        if ospace:
+            out['namespace'] = ospace
+
+        # Length (for strings and lists)
+        try:
+            out['length'] = str(len(obj))
+        except Exception:
+            pass
+
+        # Filename where object was defined
+        binary_file = False
+        fname = find_file(obj)
+        if fname is None:
+            # if anything goes wrong, we don't want to show source, so it's as
+            # if the file was binary
+            binary_file = True
+        else:
+            if fname.endswith(('.so', '.dll', '.pyd')):
+                binary_file = True
+            elif fname.endswith('<string>'):
+                fname = 'Dynamically generated function. No source code available.'
+            out['file'] = compress_user(fname)
+
+        # Original source code for a callable, class or property.
+        if detail_level:
+            # Flush the source cache because inspect can return out-of-date
+            # source
+            linecache.checkcache()
+            try:
+                if isinstance(obj, property) or not binary_file:
+                    src = getsource(obj, oname)
+                    if src is not None:
+                        src = src.rstrip()
+                    out['source'] = src
+
+            except Exception:
+                pass
+
+        # Add docstring only if no source is to be shown (avoid repetitions).
+        if ds and not self._source_contains_docstring(out.get('source'), ds):
+            out['docstring'] = ds
+
+        # Constructor docstring for classes
+        if inspect.isclass(obj):
+            out['isclass'] = True
+
+            # get the init signature:
+            try:
+                init_def = self._getdef(obj, oname)
+            except AttributeError:
+                init_def = None
+
+            # get the __init__ docstring
+            try:
+                obj_init = obj.__init__
+            except AttributeError:
+                init_ds = None
+            else:
+                if init_def is None:
+                    # Get signature from init if top-level sig failed.
+                    # Can happen for built-in types (list, etc.).
+                    try:
+                        init_def = self._getdef(obj_init, oname)
+                    except AttributeError:
+                        pass
+                init_ds = getdoc(obj_init)
+                # Skip Python's auto-generated docstrings
+                if init_ds == _object_init_docstring:
+                    init_ds = None
+
+            if init_def:
+                out['init_definition'] = init_def
+
+            if init_ds:
+                out['init_docstring'] = init_ds
+
+            names = [sub.__name__ for sub in type.__subclasses__(obj)]
+            if len(names) < 10:
+                all_names = ', '.join(names)
+            else:
+                all_names = ', '.join(names[:10]+['...'])
+            out['subclasses'] = all_names
+        # and class docstring for instances:
+        else:
+            # reconstruct the function definition and print it:
+            defln = self._getdef(obj, oname)
+            if defln:
+                out['definition'] = defln
+
+            # First, check whether the instance docstring is identical to the
+            # class one, and print it separately if they don't coincide.  In
+            # most cases they will, but it's nice to print all the info for
+            # objects which use instance-customized docstrings.
+            if ds:
+                try:
+                    cls = getattr(obj,'__class__')
+                except:
+                    class_ds = None
+                else:
+                    class_ds = getdoc(cls)
+                # Skip Python's auto-generated docstrings
+                if class_ds in _builtin_type_docstrings:
+                    class_ds = None
+                if class_ds and ds != class_ds:
+                    out['class_docstring'] = class_ds
+
+            # Next, try to show constructor docstrings
+            try:
+                init_ds = getdoc(obj.__init__)
+                # Skip Python's auto-generated docstrings
+                if init_ds == _object_init_docstring:
+                    init_ds = None
+            except AttributeError:
+                init_ds = None
+            if init_ds:
+                out['init_docstring'] = init_ds
+
+            # Call form docstring for callable instances
+            if safe_hasattr(obj, '__call__') and not is_simple_callable(obj):
+                call_def = self._getdef(obj.__call__, oname)
+                if call_def and (call_def != out.get('definition')):
+                    # it may never be the case that call def and definition differ,
+                    # but don't include the same signature twice
+                    out['call_def'] = call_def
+                call_ds = getdoc(obj.__call__)
+                # Skip Python's auto-generated docstrings
+                if call_ds == _func_call_docstring:
+                    call_ds = None
+                if call_ds:
+                    out['call_docstring'] = call_ds
+
+        return out
+
+    @staticmethod
+    def _source_contains_docstring(src, doc):
+        """
+        Check whether the source *src* contains the docstring *doc*.
+
+        This is is helper function to skip displaying the docstring if the
+        source already contains it, avoiding repetition of information.
+        """
+        try:
+            (def_node,) = ast.parse(dedent(src)).body
+            return ast.get_docstring(def_node) == doc  # type: ignore[arg-type]
+        except Exception:
+            # The source can become invalid or even non-existent (because it
+            # is re-fetched from the source file) so the above code fail in
+            # arbitrary ways.
+            return False
+
+    def psearch(self,pattern,ns_table,ns_search=[],
+                ignore_case=False,show_all=False, *, list_types=False):
+        """Search namespaces with wildcards for objects.
+
+        Arguments:
+
+        - pattern: string containing shell-like wildcards to use in namespace
+          searches and optionally a type specification to narrow the search to
+          objects of that type.
+
+        - ns_table: dict of name->namespaces for search.
+
+        Optional arguments:
+
+          - ns_search: list of namespace names to include in search.
+
+          - ignore_case(False): make the search case-insensitive.
+
+          - show_all(False): show all names, including those starting with
+            underscores.
+
+          - list_types(False): list all available object types for object matching.
+        """
+        # print('ps pattern:<%r>' % pattern)  # dbg
+
+        # defaults
+        type_pattern = 'all'
+        filter = ''
+
+        # list all object types
+        if list_types:
+            page.page('\n'.join(sorted(typestr2type)))
+            return
+
+        cmds = pattern.split()
+        len_cmds  =  len(cmds)
+        if len_cmds == 1:
+            # Only filter pattern given
+            filter = cmds[0]
+        elif len_cmds == 2:
+            # Both filter and type specified
+            filter,type_pattern = cmds
+        else:
+            raise ValueError('invalid argument string for psearch: <%s>' %
+                             pattern)
+
+        # filter search namespaces
+        for name in ns_search:
+            if name not in ns_table:
+                raise ValueError('invalid namespace <%s>. Valid names: %s' %
+                                 (name,ns_table.keys()))
+
+        # print('type_pattern:',type_pattern)  # dbg
+        search_result, namespaces_seen = set(), set()
+        for ns_name in ns_search:
+            ns = ns_table[ns_name]
+            # Normally, locals and globals are the same, so we just check one.
+            if id(ns) in namespaces_seen:
+                continue
+            namespaces_seen.add(id(ns))
+            tmp_res = list_namespace(ns, type_pattern, filter,
+                                    ignore_case=ignore_case, show_all=show_all)
+            search_result.update(tmp_res)
+
+        page.page('\n'.join(sorted(search_result)))
+
+
+def _render_signature(obj_signature, obj_name) -> str:
+    """
+    This was mostly taken from inspect.Signature.__str__.
+    Look there for the comments.
+    The only change is to add linebreaks when this gets too long.
+    """
+    result = []
+    pos_only = False
+    kw_only = True
+    for param in obj_signature.parameters.values():
+        if param.kind == inspect.Parameter.POSITIONAL_ONLY:
+            pos_only = True
+        elif pos_only:
+            result.append('/')
+            pos_only = False
+
+        if param.kind == inspect.Parameter.VAR_POSITIONAL:
+            kw_only = False
+        elif param.kind == inspect.Parameter.KEYWORD_ONLY and kw_only:
+            result.append('*')
+            kw_only = False
+
+        result.append(str(param))
+
+    if pos_only:
+        result.append('/')
+
+    # add up name, parameters, braces (2), and commas
+    if len(obj_name) + sum(len(r) + 2 for r in result) > 75:
+        # This doesn’t fit behind “Signature: ” in an inspect window.
+        rendered = '{}(\n{})'.format(obj_name, ''.join(
+            '    {},\n'.format(r) for r in result)
+        )
+    else:
+        rendered = '{}({})'.format(obj_name, ', '.join(result))
+
+    if obj_signature.return_annotation is not inspect._empty:
+        anno = inspect.formatannotation(obj_signature.return_annotation)
+        rendered += ' -> {}'.format(anno)
+
+    return rendered

temp_venv/lib/python3.13/site-packages/IPython/core/page.py

@@ -0,0 +1,348 @@
+# encoding: utf-8
+"""
+Paging capabilities for IPython.core
+
+Notes
+-----
+
+For now this uses IPython hooks, so it can't be in IPython.utils.  If we can get
+rid of that dependency, we could move it there.
+-----
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+
+import os
+import io
+import re
+import sys
+import tempfile
+import subprocess
+
+from io import UnsupportedOperation
+from pathlib import Path
+
+from IPython import get_ipython
+from IPython.display import display
+from IPython.core.error import TryNext
+from IPython.utils.data import chop
+from IPython.utils.process import system
+from IPython.utils.terminal import get_terminal_size
+from IPython.utils import py3compat
+
+
+def display_page(strng, start=0, screen_lines=25):
+    """Just display, no paging. screen_lines is ignored."""
+    if isinstance(strng, dict):
+        data = strng
+    else:
+        if start:
+            strng = u'\n'.join(strng.splitlines()[start:])
+        data = { 'text/plain': strng }
+    display(data, raw=True)
+
+
+def as_hook(page_func):
+    """Wrap a pager func to strip the `self` arg
+
+    so it can be called as a hook.
+    """
+    return lambda self, *args, **kwargs: page_func(*args, **kwargs)
+
+
+esc_re = re.compile(r"(\x1b[^m]+m)")
+
+def page_dumb(strng, start=0, screen_lines=25):
+    """Very dumb 'pager' in Python, for when nothing else works.
+
+    Only moves forward, same interface as page(), except for pager_cmd and
+    mode.
+    """
+    if isinstance(strng, dict):
+        strng = strng.get('text/plain', '')
+    out_ln  = strng.splitlines()[start:]
+    screens = chop(out_ln,screen_lines-1)
+    if len(screens) == 1:
+        print(os.linesep.join(screens[0]))
+    else:
+        last_escape = ""
+        for scr in screens[0:-1]:
+            hunk = os.linesep.join(scr)
+            print(last_escape + hunk)
+            if not page_more():
+                return
+            esc_list = esc_re.findall(hunk)
+            if len(esc_list) > 0:
+                last_escape = esc_list[-1]
+        print(last_escape + os.linesep.join(screens[-1]))
+
+def _detect_screen_size(screen_lines_def):
+    """Attempt to work out the number of lines on the screen.
+
+    This is called by page(). It can raise an error (e.g. when run in the
+    test suite), so it's separated out so it can easily be called in a try block.
+    """
+    TERM = os.environ.get('TERM',None)
+    if not((TERM=='xterm' or TERM=='xterm-color') and sys.platform != 'sunos5'):
+        # curses causes problems on many terminals other than xterm, and
+        # some termios calls lock up on Sun OS5.
+        return screen_lines_def
+    
+    try:
+        import termios
+        import curses
+    except ImportError:
+        return screen_lines_def
+    
+    # There is a bug in curses, where *sometimes* it fails to properly
+    # initialize, and then after the endwin() call is made, the
+    # terminal is left in an unusable state.  Rather than trying to
+    # check every time for this (by requesting and comparing termios
+    # flags each time), we just save the initial terminal state and
+    # unconditionally reset it every time.  It's cheaper than making
+    # the checks.
+    try:
+        term_flags = termios.tcgetattr(sys.stdout)
+    except termios.error as err:
+        # can fail on Linux 2.6, pager_page will catch the TypeError
+        raise TypeError('termios error: {0}'.format(err)) from err
+
+    try:
+        scr = curses.initscr()
+    except AttributeError:
+        # Curses on Solaris may not be complete, so we can't use it there
+        return screen_lines_def
+    
+    screen_lines_real,screen_cols = scr.getmaxyx()
+    curses.endwin()
+
+    # Restore terminal state in case endwin() didn't.
+    termios.tcsetattr(sys.stdout,termios.TCSANOW,term_flags)
+    # Now we have what we needed: the screen size in rows/columns
+    return screen_lines_real
+    # print('***Screen size:',screen_lines_real,'lines x',
+    #       screen_cols,'columns.')  # dbg
+
+def pager_page(strng, start=0, screen_lines=0, pager_cmd=None) -> None:
+    """Display a string, piping through a pager after a certain length.
+
+    strng can be a mime-bundle dict, supplying multiple representations,
+    keyed by mime-type.
+
+    The screen_lines parameter specifies the number of *usable* lines of your
+    terminal screen (total lines minus lines you need to reserve to show other
+    information).
+
+    If you set screen_lines to a number <=0, page() will try to auto-determine
+    your screen size and will only use up to (screen_size+screen_lines) for
+    printing, paging after that. That is, if you want auto-detection but need
+    to reserve the bottom 3 lines of the screen, use screen_lines = -3, and for
+    auto-detection without any lines reserved simply use screen_lines = 0.
+
+    If a string won't fit in the allowed lines, it is sent through the
+    specified pager command. If none given, look for PAGER in the environment,
+    and ultimately default to less.
+
+    If no system pager works, the string is sent through a 'dumb pager'
+    written in python, very simplistic.
+    """
+    
+    # for compatibility with mime-bundle form:
+    if isinstance(strng, dict):
+        strng = strng['text/plain']
+
+    # Ugly kludge, but calling curses.initscr() flat out crashes in emacs
+    TERM = os.environ.get('TERM','dumb')
+    if TERM in ['dumb','emacs'] and os.name != 'nt':
+        print(strng)
+        return
+    # chop off the topmost part of the string we don't want to see
+    str_lines = strng.splitlines()[start:]
+    str_toprint = os.linesep.join(str_lines)
+    num_newlines = len(str_lines)
+    len_str = len(str_toprint)
+
+    # Dumb heuristics to guesstimate number of on-screen lines the string
+    # takes.  Very basic, but good enough for docstrings in reasonable
+    # terminals. If someone later feels like refining it, it's not hard.
+    numlines = max(num_newlines,int(len_str/80)+1)
+
+    screen_lines_def = get_terminal_size()[1]
+
+    # auto-determine screen size
+    if screen_lines <= 0:
+        try:
+            screen_lines += _detect_screen_size(screen_lines_def)
+        except (TypeError, UnsupportedOperation):
+            print(str_toprint)
+            return
+
+    # print('numlines',numlines,'screenlines',screen_lines)  # dbg
+    if numlines <= screen_lines :
+        # print('*** normal print')  # dbg
+        print(str_toprint)
+    else:
+        # Try to open pager and default to internal one if that fails.
+        # All failure modes are tagged as 'retval=1', to match the return
+        # value of a failed system command.  If any intermediate attempt
+        # sets retval to 1, at the end we resort to our own page_dumb() pager.
+        pager_cmd = get_pager_cmd(pager_cmd)
+        pager_cmd += ' ' + get_pager_start(pager_cmd,start)
+        if os.name == 'nt':
+            if pager_cmd.startswith('type'):
+                # The default WinXP 'type' command is failing on complex strings.
+                retval = 1
+            else:
+                fd, tmpname = tempfile.mkstemp('.txt')
+                tmppath = Path(tmpname)
+                try:
+                    os.close(fd)
+                    with tmppath.open("wt", encoding="utf-8") as tmpfile:
+                        tmpfile.write(strng)
+                        cmd = "%s < %s" % (pager_cmd, tmppath)
+                    # tmpfile needs to be closed for windows
+                    if os.system(cmd):
+                        retval = 1
+                    else:
+                        retval = None
+                finally:
+                    Path.unlink(tmppath)
+        else:
+            try:
+                retval = None
+                # Emulate os.popen, but redirect stderr
+                proc = subprocess.Popen(
+                    pager_cmd,
+                    shell=True,
+                    stdin=subprocess.PIPE,
+                    stderr=subprocess.DEVNULL,
+                )
+                pager = os._wrap_close(
+                    io.TextIOWrapper(proc.stdin, encoding="utf-8"), proc
+                )
+                try:
+                    pager_encoding = pager.encoding or sys.stdout.encoding
+                    pager.write(strng)
+                finally:
+                    retval = pager.close()
+            except IOError as msg:  # broken pipe when user quits
+                if msg.args == (32, 'Broken pipe'):
+                    retval = None
+                else:
+                    retval = 1
+            except OSError:
+                # Other strange problems, sometimes seen in Win2k/cygwin
+                retval = 1
+        if retval is not None:
+            page_dumb(strng,screen_lines=screen_lines)
+
+
+def page(data, start: int = 0, screen_lines: int = 0, pager_cmd=None):
+    """Display content in a pager, piping through a pager after a certain length.
+
+    data can be a mime-bundle dict, supplying multiple representations,
+    keyed by mime-type, or text.
+
+    Pager is dispatched via the `show_in_pager` IPython hook.
+    If no hook is registered, `pager_page` will be used.
+    """
+    # Some routines may auto-compute start offsets incorrectly and pass a
+    # negative value.  Offset to 0 for robustness.
+    start = max(0, start)
+
+    # first, try the hook
+    ip = get_ipython()
+    if ip:
+        try:
+            ip.hooks.show_in_pager(data, start=start, screen_lines=screen_lines)
+            return
+        except TryNext:
+            pass
+    
+    # fallback on default pager
+    return pager_page(data, start, screen_lines, pager_cmd)
+
+
+def page_file(fname, start=0, pager_cmd=None):
+    """Page a file, using an optional pager command and starting line.
+    """
+
+    pager_cmd = get_pager_cmd(pager_cmd)
+    pager_cmd += ' ' + get_pager_start(pager_cmd,start)
+
+    try:
+        if os.environ['TERM'] in ['emacs','dumb']:
+            raise EnvironmentError
+        system(pager_cmd + ' ' + fname)
+    except:
+        try:
+            if start > 0:
+                start -= 1
+            page(open(fname, encoding="utf-8").read(), start)
+        except:
+            print('Unable to show file',repr(fname))
+
+
+def get_pager_cmd(pager_cmd=None):
+    """Return a pager command.
+
+    Makes some attempts at finding an OS-correct one.
+    """
+    if os.name == 'posix':
+        default_pager_cmd = 'less -R'  # -R for color control sequences
+    elif os.name in ['nt','dos']:
+        default_pager_cmd = 'type'
+
+    if pager_cmd is None:
+        try:
+            pager_cmd = os.environ['PAGER']
+        except:
+            pager_cmd = default_pager_cmd
+    
+    if pager_cmd == 'less' and '-r' not in os.environ.get('LESS', '').lower():
+        pager_cmd += ' -R'
+    
+    return pager_cmd
+
+
+def get_pager_start(pager, start):
+    """Return the string for paging files with an offset.
+
+    This is the '+N' argument which less and more (under Unix) accept.
+    """
+
+    if pager in ['less','more']:
+        if start:
+            start_string = '+' + str(start)
+        else:
+            start_string = ''
+    else:
+        start_string = ''
+    return start_string
+
+
+# (X)emacs on win32 doesn't like to be bypassed with msvcrt.getch()
+if os.name == 'nt' and os.environ.get('TERM','dumb') != 'emacs':
+    import msvcrt
+    def page_more():
+        """ Smart pausing between pages
+
+        @return:    True if need print more lines, False if quit
+        """
+        sys.stdout.write('---Return to continue, q to quit--- ')
+        ans = msvcrt.getwch()
+        if ans in ("q", "Q"):
+            result = False
+        else:
+            result = True
+        sys.stdout.write("\b"*37 + " "*37 + "\b"*37)
+        return result
+else:
+    def page_more():
+        ans = py3compat.input('---Return to continue, q to quit--- ')
+        if ans.lower().startswith('q'):
+            return False
+        else:
+            return True

temp_venv/lib/python3.13/site-packages/IPython/core/payload.py

@@ -0,0 +1,54 @@
+# -*- coding: utf-8 -*-
+"""Payload system for IPython.
+
+Authors:
+
+* Fernando Perez
+* Brian Granger
+"""
+
+#-----------------------------------------------------------------------------
+#       Copyright (C) 2008-2011 The IPython Development Team
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+from traitlets.config.configurable import Configurable
+from traitlets import List
+
+#-----------------------------------------------------------------------------
+# Main payload class
+#-----------------------------------------------------------------------------
+
+class PayloadManager(Configurable):
+    _payload: List = List([])
+
+    def write_payload(self, data, single=True):
+        """Include or update the specified `data` payload in the PayloadManager.
+
+        If a previous payload with the same source exists and `single` is True,
+        it will be overwritten with the new one.
+        """
+
+        if not isinstance(data, dict):
+            raise TypeError('Each payload write must be a dict, got: %r' % data)
+
+        if single and 'source' in data:
+            source = data['source']
+            for i, pl in enumerate(self._payload):
+                if 'source' in pl and pl['source'] == source:
+                    self._payload[i] = data
+                    return
+
+        self._payload.append(data)
+
+    def read_payload(self):
+        return self._payload
+
+    def clear_payload(self):
+        self._payload = []

temp_venv/lib/python3.13/site-packages/IPython/core/payloadpage.py

@@ -0,0 +1,41 @@
+"""A payload based version of page."""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import warnings
+from IPython.core.getipython import get_ipython
+
+# see https://github.com/ipython/ipykernel/issues/1304
+# this should be moved to ipykernel and removed in the long run.
+
+
+def page(strng, start=0, screen_lines=0, pager_cmd=None):
+    """Print a string, piping through a pager.
+
+    This version ignores the screen_lines and pager_cmd arguments and uses
+    IPython's payload system instead.
+
+    Parameters
+    ----------
+    strng : str or mime-dict
+        Text to page, or a mime-type keyed dict of already formatted data.
+    start : int
+        Starting line at which to place the display.
+    """
+
+    # Some routines may auto-compute start offsets incorrectly and pass a
+    # negative value.  Offset to 0 for robustness.
+    start = max(0, start)
+    shell = get_ipython()
+
+    if isinstance(strng, dict):
+        data = strng
+    else:
+        data = {"text/plain": strng}
+    payload = dict(
+        source="page",
+        data=data,
+        start=start,
+    )
+    shell.payload_manager.write_payload(payload)

temp_venv/lib/python3.13/site-packages/IPython/core/profileapp.py

@@ -0,0 +1,315 @@
+# encoding: utf-8
+"""
+An application for managing IPython profiles.
+
+To be invoked as the `ipython profile` subcommand.
+
+Authors:
+
+* Min RK
+
+"""
+
+#-----------------------------------------------------------------------------
+#  Copyright (C) 2008  The IPython Development Team
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+import os
+
+from traitlets.config.application import Application
+from IPython.core.application import (
+    BaseIPythonApplication, base_flags
+)
+from IPython.core.profiledir import ProfileDir
+from IPython.utils.importstring import import_item
+from IPython.paths import get_ipython_dir, get_ipython_package_dir
+from traitlets import Unicode, Bool, Dict, observe
+
+#-----------------------------------------------------------------------------
+# Constants
+#-----------------------------------------------------------------------------
+
+create_help = """Create an IPython profile by name
+
+Create an ipython profile directory by its name or
+profile directory path. Profile directories contain
+configuration, log and security related files and are named
+using the convention 'profile_<name>'. By default they are
+located in your ipython directory. Once created, you will
+can edit the configuration files in the profile
+directory to configure IPython. Most users will create a
+profile directory by name,
+`ipython profile create myprofile`, which will put the directory
+in `<ipython_dir>/profile_myprofile`.
+"""
+list_help = """List available IPython profiles
+
+List all available profiles, by profile location, that can
+be found in the current working directly or in the ipython
+directory. Profile directories are named using the convention
+'profile_<profile>'.
+"""
+profile_help = """Manage IPython profiles
+
+Profile directories contain
+configuration, log and security related files and are named
+using the convention 'profile_<name>'. By default they are
+located in your ipython directory.  You can create profiles
+with `ipython profile create <name>`, or see the profiles you
+already have with `ipython profile list`
+
+To get started configuring IPython, simply do:
+
+$> ipython profile create
+
+and IPython will create the default profile in <ipython_dir>/profile_default,
+where you can edit ipython_config.py to start configuring IPython.
+
+"""
+
+_list_examples = "ipython profile list  # list all profiles"
+
+_create_examples = """
+ipython profile create foo         # create profile foo w/ default config files
+ipython profile create foo --reset # restage default config files over current
+ipython profile create foo --parallel # also stage parallel config files
+"""
+
+_main_examples = """
+ipython profile create -h  # show the help string for the create subcommand
+ipython profile list -h    # show the help string for the list subcommand
+
+ipython locate profile foo # print the path to the directory for profile 'foo'
+"""
+
+#-----------------------------------------------------------------------------
+# Profile Application Class (for `ipython profile` subcommand)
+#-----------------------------------------------------------------------------
+
+
+def list_profiles_in(path):
+    """list profiles in a given root directory"""
+    profiles = []
+
+    # for python 3.6+ rewrite to: with os.scandir(path) as dirlist:
+    files = os.scandir(path)
+    for f in files:
+        if f.is_dir() and f.name.startswith('profile_'):
+            profiles.append(f.name.split('_', 1)[-1])
+    return profiles
+
+
+def list_bundled_profiles():
+    """list profiles that are bundled with IPython."""
+    path = os.path.join(get_ipython_package_dir(), u'core', u'profile')
+    profiles = []
+
+    # for python 3.6+ rewrite to: with os.scandir(path) as dirlist:
+    files =  os.scandir(path)
+    for profile in files:
+        if profile.is_dir() and profile.name != "__pycache__":
+            profiles.append(profile.name)
+    return profiles
+
+
+class ProfileLocate(BaseIPythonApplication):
+    description = """print the path to an IPython profile dir"""
+    
+    def parse_command_line(self, argv=None):
+        super(ProfileLocate, self).parse_command_line(argv)
+        if self.extra_args:
+            self.profile = self.extra_args[0]
+    
+    def start(self):
+        print(self.profile_dir.location)
+
+
+class ProfileList(Application):
+    name = u'ipython-profile'
+    description = list_help
+    examples = _list_examples
+
+    aliases = Dict({
+        'ipython-dir' : 'ProfileList.ipython_dir',
+        'log-level' : 'Application.log_level',
+    })
+    flags = Dict(dict(
+        debug = ({'Application' : {'log_level' : 0}},
+            "Set Application.log_level to 0, maximizing log output."
+        )
+    ))
+
+    ipython_dir = Unicode(get_ipython_dir(),
+        help="""
+        The name of the IPython directory. This directory is used for logging
+        configuration (through profiles), history storage, etc. The default
+        is usually $HOME/.ipython. This options can also be specified through
+        the environment variable IPYTHONDIR.
+        """
+    ).tag(config=True)
+
+
+    def _print_profiles(self, profiles):
+        """print list of profiles, indented."""
+        for profile in profiles:
+            print('    %s' % profile)
+
+    def list_profile_dirs(self):
+        profiles = list_bundled_profiles()
+        if profiles:
+            print()
+            print("Available profiles in IPython:")
+            self._print_profiles(profiles)
+            print()
+            print("    The first request for a bundled profile will copy it")
+            print("    into your IPython directory (%s)," % self.ipython_dir)
+            print("    where you can customize it.")
+        
+        profiles = list_profiles_in(self.ipython_dir)
+        if profiles:
+            print()
+            print("Available profiles in %s:" % self.ipython_dir)
+            self._print_profiles(profiles)
+        
+        profiles = list_profiles_in(os.getcwd())
+        if profiles:
+            print()
+            print(
+                "Profiles from CWD have been removed for security reason, see CVE-2022-21699:"
+            )
+
+        print()
+        print("To use any of the above profiles, start IPython with:")
+        print("    ipython --profile=<name>")
+        print()
+
+    def start(self):
+        self.list_profile_dirs()
+
+
+create_flags = {}
+create_flags.update(base_flags)
+# don't include '--init' flag, which implies running profile create in other apps
+create_flags.pop('init')
+create_flags['reset'] = ({'ProfileCreate': {'overwrite' : True}},
+                        "reset config files in this profile to the defaults.")
+create_flags['parallel'] = ({'ProfileCreate': {'parallel' : True}},
+                        "Include the config files for parallel "
+                        "computing apps (ipengine, ipcontroller, etc.)")
+
+
+class ProfileCreate(BaseIPythonApplication):
+    name = u'ipython-profile'
+    description = create_help
+    examples = _create_examples
+    auto_create = Bool(True).tag(config=True)
+    def _log_format_default(self):
+        return "[%(name)s] %(message)s"
+
+    def _copy_config_files_default(self):
+        return True
+
+    parallel = Bool(False,
+        help="whether to include parallel computing config files"
+    ).tag(config=True)
+
+    @observe('parallel')
+    def _parallel_changed(self, change):
+        parallel_files = [   'ipcontroller_config.py',
+                            'ipengine_config.py',
+                            'ipcluster_config.py'
+                        ]
+        if change['new']:
+            for cf in parallel_files:
+                self.config_files.append(cf)
+        else:
+            for cf in parallel_files:
+                if cf in self.config_files:
+                    self.config_files.remove(cf)
+
+    def parse_command_line(self, argv):
+        super(ProfileCreate, self).parse_command_line(argv)
+        # accept positional arg as profile name
+        if self.extra_args:
+            self.profile = self.extra_args[0]
+
+    flags = Dict(create_flags)
+
+    classes = [ProfileDir]
+    
+    def _import_app(self, app_path):
+        """import an app class"""
+        app = None
+        name = app_path.rsplit('.', 1)[-1]
+        try:
+            app = import_item(app_path)
+        except ImportError:
+            self.log.info("Couldn't import %s, config file will be excluded", name)
+        except Exception:
+            self.log.warning('Unexpected error importing %s', name, exc_info=True)
+        return app
+
+    def init_config_files(self):
+        super(ProfileCreate, self).init_config_files()
+        # use local imports, since these classes may import from here
+        from IPython.terminal.ipapp import TerminalIPythonApp
+        apps = [TerminalIPythonApp]
+        for app_path in (
+            'ipykernel.kernelapp.IPKernelApp',
+        ):
+            app = self._import_app(app_path)
+            if app is not None:
+                apps.append(app)
+        if self.parallel:
+            from ipyparallel.apps.ipcontrollerapp import IPControllerApp
+            from ipyparallel.apps.ipengineapp import IPEngineApp
+            from ipyparallel.apps.ipclusterapp import IPClusterStart
+            apps.extend([
+                IPControllerApp,
+                IPEngineApp,
+                IPClusterStart,
+            ])
+        for App in apps:
+            app = App()
+            app.config.update(self.config)
+            app.log = self.log
+            app.overwrite = self.overwrite
+            app.copy_config_files=True
+            app.ipython_dir=self.ipython_dir
+            app.profile_dir=self.profile_dir
+            app.init_config_files()
+
+    def stage_default_config_file(self):
+        pass
+
+
+class ProfileApp(Application):
+    name = u'ipython profile'
+    description = profile_help
+    examples = _main_examples
+
+    subcommands = Dict(dict(
+        create = (ProfileCreate, ProfileCreate.description.splitlines()[0]),
+        list = (ProfileList, ProfileList.description.splitlines()[0]),
+        locate = (ProfileLocate, ProfileLocate.description.splitlines()[0]),
+    ))
+
+    def start(self):
+        if self.subapp is None:
+            print(
+                "No subcommand specified. Must specify one of: "
+                + ", ".join(map(repr, self.subcommands))
+                + ".\n"
+            )
+            self.print_description()
+            self.print_subcommands()
+            self.exit(1)
+        else:
+            return self.subapp.start()

temp_venv/lib/python3.13/site-packages/IPython/core/pylabtools.py

@@ -0,0 +1,515 @@
+# -*- coding: utf-8 -*-
+"""Pylab (matplotlib) support utilities."""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+from io import BytesIO
+from binascii import b2a_base64
+from functools import partial
+import warnings
+
+from IPython.core.display import _pngxy
+from IPython.utils.decorators import flag_calls
+
+
+# Matplotlib backend resolution functionality moved from IPython to Matplotlib
+# in IPython 8.24 and Matplotlib 3.9.0. Need to keep `backends` and `backend2gui`
+# here for earlier Matplotlib and for external backend libraries such as
+# mplcairo that might rely upon it.
+_deprecated_backends = {
+    "tk": "TkAgg",
+    "gtk": "GTKAgg",
+    "gtk3": "GTK3Agg",
+    "gtk4": "GTK4Agg",
+    "wx": "WXAgg",
+    "qt4": "Qt4Agg",
+    "qt5": "Qt5Agg",
+    "qt6": "QtAgg",
+    "qt": "QtAgg",
+    "osx": "MacOSX",
+    "nbagg": "nbAgg",
+    "webagg": "WebAgg",
+    "notebook": "nbAgg",
+    "agg": "agg",
+    "svg": "svg",
+    "pdf": "pdf",
+    "ps": "ps",
+    "inline": "module://matplotlib_inline.backend_inline",
+    "ipympl": "module://ipympl.backend_nbagg",
+    "widget": "module://ipympl.backend_nbagg",
+}
+
+# We also need a reverse backends2guis mapping that will properly choose which
+# GUI support to activate based on the desired matplotlib backend.  For the
+# most part it's just a reverse of the above dict, but we also need to add a
+# few others that map to the same GUI manually:
+_deprecated_backend2gui = dict(
+    zip(_deprecated_backends.values(), _deprecated_backends.keys())
+)
+# In the reverse mapping, there are a few extra valid matplotlib backends that
+# map to the same GUI support
+_deprecated_backend2gui["GTK"] = _deprecated_backend2gui["GTKCairo"] = "gtk"
+_deprecated_backend2gui["GTK3Cairo"] = "gtk3"
+_deprecated_backend2gui["GTK4Cairo"] = "gtk4"
+_deprecated_backend2gui["WX"] = "wx"
+_deprecated_backend2gui["CocoaAgg"] = "osx"
+# There needs to be a hysteresis here as the new QtAgg Matplotlib backend
+# supports either Qt5 or Qt6 and the IPython qt event loop support Qt4, Qt5,
+# and Qt6.
+_deprecated_backend2gui["QtAgg"] = "qt"
+_deprecated_backend2gui["Qt4Agg"] = "qt4"
+_deprecated_backend2gui["Qt5Agg"] = "qt5"
+
+# And some backends that don't need GUI integration
+del _deprecated_backend2gui["nbAgg"]
+del _deprecated_backend2gui["agg"]
+del _deprecated_backend2gui["svg"]
+del _deprecated_backend2gui["pdf"]
+del _deprecated_backend2gui["ps"]
+del _deprecated_backend2gui["module://matplotlib_inline.backend_inline"]
+del _deprecated_backend2gui["module://ipympl.backend_nbagg"]
+
+
+# Deprecated attributes backends and backend2gui mostly following PEP 562.
+def __getattr__(name):
+    if name in ("backends", "backend2gui"):
+        warnings.warn(
+            f"{name} is deprecated since IPython 8.24, backends are managed "
+            "in matplotlib and can be externally registered.",
+            DeprecationWarning,
+        )
+        return globals()[f"_deprecated_{name}"]
+    raise AttributeError(f"module {__name__!r} has no attribute {name!r}")
+
+
+#-----------------------------------------------------------------------------
+# Matplotlib utilities
+#-----------------------------------------------------------------------------
+
+
+def getfigs(*fig_nums):
+    """Get a list of matplotlib figures by figure numbers.
+
+    If no arguments are given, all available figures are returned.  If the
+    argument list contains references to invalid figures, a warning is printed
+    but the function continues pasting further figures.
+
+    Parameters
+    ----------
+    figs : tuple
+        A tuple of ints giving the figure numbers of the figures to return.
+    """
+    from matplotlib._pylab_helpers import Gcf
+    if not fig_nums:
+        fig_managers = Gcf.get_all_fig_managers()
+        return [fm.canvas.figure for fm in fig_managers]
+    else:
+        figs = []
+        for num in fig_nums:
+            f = Gcf.figs.get(num)
+            if f is None:
+                print('Warning: figure %s not available.' % num)
+            else:
+                figs.append(f.canvas.figure)
+        return figs
+
+
+def figsize(sizex, sizey):
+    """Set the default figure size to be [sizex, sizey].
+
+    This is just an easy to remember, convenience wrapper that sets::
+
+      matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
+    """
+    import matplotlib
+    matplotlib.rcParams['figure.figsize'] = [sizex, sizey]
+
+
+def print_figure(fig, fmt="png", bbox_inches="tight", base64=False, **kwargs):
+    """Print a figure to an image, and return the resulting file data
+
+    Returned data will be bytes unless ``fmt='svg'``,
+    in which case it will be unicode.
+
+    Any keyword args are passed to fig.canvas.print_figure,
+    such as ``quality`` or ``bbox_inches``.
+
+    If `base64` is True, return base64-encoded str instead of raw bytes
+    for binary-encoded image formats
+
+    .. versionadded:: 7.29
+        base64 argument
+    """
+    # When there's an empty figure, we shouldn't return anything, otherwise we
+    # get big blank areas in the qt console.
+    if not fig.axes and not fig.lines:
+        return
+
+    dpi = fig.dpi
+    if fmt == 'retina':
+        dpi = dpi * 2
+        fmt = 'png'
+
+    # build keyword args
+    kw = {
+        "format":fmt,
+        "facecolor":fig.get_facecolor(),
+        "edgecolor":fig.get_edgecolor(),
+        "dpi":dpi,
+        "bbox_inches":bbox_inches,
+    }
+    # **kwargs get higher priority
+    kw.update(kwargs)
+
+    bytes_io = BytesIO()
+    if fig.canvas is None:
+        from matplotlib.backend_bases import FigureCanvasBase
+        FigureCanvasBase(fig)
+
+    fig.canvas.print_figure(bytes_io, **kw)
+    data = bytes_io.getvalue()
+    if fmt == 'svg':
+        data = data.decode('utf-8')
+    elif base64:
+        data = b2a_base64(data, newline=False).decode("ascii")
+    return data
+
+def retina_figure(fig, base64=False, **kwargs):
+    """format a figure as a pixel-doubled (retina) PNG
+
+    If `base64` is True, return base64-encoded str instead of raw bytes
+    for binary-encoded image formats
+
+    .. versionadded:: 7.29
+        base64 argument
+    """
+    pngdata = print_figure(fig, fmt="retina", base64=False, **kwargs)
+    # Make sure that retina_figure acts just like print_figure and returns
+    # None when the figure is empty.
+    if pngdata is None:
+        return
+    w, h = _pngxy(pngdata)
+    metadata = {"width": w//2, "height":h//2}
+    if base64:
+        pngdata = b2a_base64(pngdata, newline=False).decode("ascii")
+    return pngdata, metadata
+
+
+# We need a little factory function here to create the closure where
+# safe_execfile can live.
+def mpl_runner(safe_execfile):
+    """Factory to return a matplotlib-enabled runner for %run.
+
+    Parameters
+    ----------
+    safe_execfile : function
+        This must be a function with the same interface as the
+        :meth:`safe_execfile` method of IPython.
+
+    Returns
+    -------
+    A function suitable for use as the ``runner`` argument of the %run magic
+    function.
+    """
+
+    def mpl_execfile(fname,*where,**kw):
+        """matplotlib-aware wrapper around safe_execfile.
+
+        Its interface is identical to that of the :func:`execfile` builtin.
+
+        This is ultimately a call to execfile(), but wrapped in safeties to
+        properly handle interactive rendering."""
+
+        import matplotlib
+        import matplotlib.pyplot as plt
+
+        # print('*** Matplotlib runner ***')  # dbg
+        # turn off rendering until end of script
+        with matplotlib.rc_context({"interactive": False}):
+            safe_execfile(fname, *where, **kw)
+
+        if matplotlib.is_interactive():
+            plt.show()
+
+        # make rendering call now, if the user tried to do it
+        if plt.draw_if_interactive.called:
+            plt.draw()
+            plt.draw_if_interactive.called = False
+
+        # re-draw everything that is stale
+        try:
+            da = plt.draw_all
+        except AttributeError:
+            pass
+        else:
+            da()
+
+    return mpl_execfile
+
+
+def _reshow_nbagg_figure(fig):
+    """reshow an nbagg figure"""
+    try:
+        reshow = fig.canvas.manager.reshow
+    except AttributeError as e:
+        raise NotImplementedError() from e
+    else:
+        reshow()
+
+
+def select_figure_formats(shell, formats, **kwargs):
+    """Select figure formats for the inline backend.
+
+    Parameters
+    ----------
+    shell : InteractiveShell
+        The main IPython instance.
+    formats : str or set
+        One or a set of figure formats to enable: 'png', 'retina', 'jpeg', 'svg', 'pdf'.
+    **kwargs : any
+        Extra keyword arguments to be passed to fig.canvas.print_figure.
+    """
+    import matplotlib
+    from matplotlib.figure import Figure
+
+    svg_formatter = shell.display_formatter.formatters['image/svg+xml']
+    png_formatter = shell.display_formatter.formatters['image/png']
+    jpg_formatter = shell.display_formatter.formatters['image/jpeg']
+    pdf_formatter = shell.display_formatter.formatters['application/pdf']
+
+    if isinstance(formats, str):
+        formats = {formats}
+    # cast in case of list / tuple
+    formats = set(formats)
+
+    [ f.pop(Figure, None) for f in shell.display_formatter.formatters.values() ]
+    mplbackend = matplotlib.get_backend().lower()
+    if mplbackend in ("nbagg", "ipympl", "widget", "module://ipympl.backend_nbagg"):
+        formatter = shell.display_formatter.ipython_display_formatter
+        formatter.for_type(Figure, _reshow_nbagg_figure)
+
+    supported = {'png', 'png2x', 'retina', 'jpg', 'jpeg', 'svg', 'pdf'}
+    bad = formats.difference(supported)
+    if bad:
+        bs = "%s" % ','.join([repr(f) for f in bad])
+        gs = "%s" % ','.join([repr(f) for f in supported])
+        raise ValueError("supported formats are: %s not %s" % (gs, bs))
+
+    if "png" in formats:
+        png_formatter.for_type(
+            Figure, partial(print_figure, fmt="png", base64=True, **kwargs)
+        )
+    if "retina" in formats or "png2x" in formats:
+        png_formatter.for_type(Figure, partial(retina_figure, base64=True, **kwargs))
+    if "jpg" in formats or "jpeg" in formats:
+        jpg_formatter.for_type(
+            Figure, partial(print_figure, fmt="jpg", base64=True, **kwargs)
+        )
+    if "svg" in formats:
+        svg_formatter.for_type(Figure, partial(print_figure, fmt="svg", **kwargs))
+    if "pdf" in formats:
+        pdf_formatter.for_type(
+            Figure, partial(print_figure, fmt="pdf", base64=True, **kwargs)
+        )
+
+#-----------------------------------------------------------------------------
+# Code for initializing matplotlib and importing pylab
+#-----------------------------------------------------------------------------
+
+
+def find_gui_and_backend(gui=None, gui_select=None):
+    """Given a gui string return the gui and mpl backend.
+
+    Parameters
+    ----------
+    gui : str
+        Can be one of ('tk','gtk','wx','qt','qt4','inline','agg').
+    gui_select : str
+        Can be one of ('tk','gtk','wx','qt','qt4','inline').
+        This is any gui already selected by the shell.
+
+    Returns
+    -------
+    A tuple of (gui, backend) where backend is one of ('TkAgg','GTKAgg',
+    'WXAgg','Qt4Agg','module://matplotlib_inline.backend_inline','agg').
+    """
+
+    import matplotlib
+
+    if _matplotlib_manages_backends():
+        backend_registry = matplotlib.backends.registry.backend_registry
+
+        # gui argument may be a gui event loop or may be a backend name.
+        if gui in ("auto", None):
+            backend = matplotlib.rcParamsOrig["backend"]
+            backend, gui = backend_registry.resolve_backend(backend)
+        else:
+            gui = _convert_gui_to_matplotlib(gui)
+            backend, gui = backend_registry.resolve_gui_or_backend(gui)
+
+        gui = _convert_gui_from_matplotlib(gui)
+        return gui, backend
+
+    # Fallback to previous behaviour (Matplotlib < 3.9)
+    mpl_version_info = getattr(matplotlib, "__version_info__", (0, 0))
+    has_unified_qt_backend = mpl_version_info >= (3, 5)
+
+    from IPython.core.pylabtools import backends
+
+    backends_ = dict(backends)
+    if not has_unified_qt_backend:
+        backends_["qt"] = "qt5agg"
+
+    if gui and gui != 'auto':
+        # select backend based on requested gui
+        backend = backends_[gui]
+        if gui == 'agg':
+            gui = None
+    else:
+        # We need to read the backend from the original data structure, *not*
+        # from mpl.rcParams, since a prior invocation of %matplotlib may have
+        # overwritten that.
+        # WARNING: this assumes matplotlib 1.1 or newer!!
+        backend = matplotlib.rcParamsOrig['backend']
+        # In this case, we need to find what the appropriate gui selection call
+        # should be for IPython, so we can activate inputhook accordingly
+        from IPython.core.pylabtools import backend2gui
+        gui = backend2gui.get(backend, None)
+
+        # If we have already had a gui active, we need it and inline are the
+        # ones allowed.
+        if gui_select and gui != gui_select:
+            gui = gui_select
+            backend = backends_[gui]
+
+    # Matplotlib before _matplotlib_manages_backends() can return "inline" for
+    # no gui event loop rather than the None that IPython >= 8.24.0 expects.
+    if gui == "inline":
+        gui = None
+
+    return gui, backend
+
+
+def activate_matplotlib(backend):
+    """Activate the given backend and set interactive to True."""
+
+    import matplotlib
+    matplotlib.interactive(True)
+
+    # Matplotlib had a bug where even switch_backend could not force
+    # the rcParam to update. This needs to be set *before* the module
+    # magic of switch_backend().
+    matplotlib.rcParams['backend'] = backend
+
+    # Due to circular imports, pyplot may be only partially initialised
+    # when this function runs.
+    # So avoid needing matplotlib attribute-lookup to access pyplot.
+    from matplotlib import pyplot as plt
+
+    plt.switch_backend(backend)
+
+    plt.show._needmain = False
+    # We need to detect at runtime whether show() is called by the user.
+    # For this, we wrap it into a decorator which adds a 'called' flag.
+    plt.draw_if_interactive = flag_calls(plt.draw_if_interactive)
+
+
+def import_pylab(user_ns, import_all=True):
+    """Populate the namespace with pylab-related values.
+
+    Imports matplotlib, pylab, numpy, and everything from pylab and numpy.
+
+    Also imports a few names from IPython (figsize, display, getfigs)
+
+    """
+
+    # Import numpy as np/pyplot as plt are conventions we're trying to
+    # somewhat standardize on.  Making them available to users by default
+    # will greatly help this.
+    s = ("import numpy\n"
+          "import matplotlib\n"
+          "from matplotlib import pylab, mlab, pyplot\n"
+          "np = numpy\n"
+          "plt = pyplot\n"
+          )
+    exec(s, user_ns)
+
+    if import_all:
+        s = ("from matplotlib.pylab import *\n"
+             "from numpy import *\n")
+        exec(s, user_ns)
+
+    # IPython symbols to add
+    user_ns['figsize'] = figsize
+    from IPython.display import display
+    # Add display and getfigs to the user's namespace
+    user_ns['display'] = display
+    user_ns['getfigs'] = getfigs
+
+
+# Determine if Matplotlib manages backends only if needed, and cache result.
+# Do not read this directly, instead use _matplotlib_manages_backends().
+_matplotlib_manages_backends_value: bool | None = None
+
+
+def _matplotlib_manages_backends() -> bool:
+    """Return True if Matplotlib manages backends, False otherwise.
+
+    If it returns True, the caller can be sure that
+    matplotlib.backends.registry.backend_registry is available along with
+    member functions resolve_gui_or_backend, resolve_backend, list_all, and
+    list_gui_frameworks.
+
+    This function can be removed as it will always return True when Python
+    3.12, the latest version supported by Matplotlib < 3.9, reaches
+    end-of-life in late 2028.
+    """
+    global _matplotlib_manages_backends_value
+    if _matplotlib_manages_backends_value is None:
+        try:
+            from matplotlib.backends.registry import backend_registry
+
+            _matplotlib_manages_backends_value = hasattr(
+                backend_registry, "resolve_gui_or_backend"
+            )
+        except ImportError:
+            _matplotlib_manages_backends_value = False
+
+    return _matplotlib_manages_backends_value
+
+
+def _list_matplotlib_backends_and_gui_loops() -> list[str]:
+    """Return list of all Matplotlib backends and GUI event loops.
+
+    This is the list returned by
+        %matplotlib --list
+    """
+    if _matplotlib_manages_backends():
+        from matplotlib.backends.registry import backend_registry
+
+        ret = backend_registry.list_all() + [
+            _convert_gui_from_matplotlib(gui)
+            for gui in backend_registry.list_gui_frameworks()
+        ]
+    else:
+        from IPython.core import pylabtools
+
+        ret = list(pylabtools.backends.keys())
+
+    return sorted(["auto"] + ret)
+
+
+# Matplotlib and IPython do not always use the same gui framework name.
+# Always use the appropriate one of these conversion functions when passing a
+# gui framework name to/from Matplotlib.
+def _convert_gui_to_matplotlib(gui: str | None) -> str | None:
+    if gui and gui.lower() == "osx":
+        return "macosx"
+    return gui
+
+
+def _convert_gui_from_matplotlib(gui: str | None) -> str | None:
+    if gui and gui.lower() == "macosx":
+        return "osx"
+    return gui

temp_venv/lib/python3.13/site-packages/IPython/core/shellapp.py

@@ -0,0 +1,496 @@
+# encoding: utf-8
+"""
+A mixin for :class:`~IPython.core.application.Application` classes that
+launch InteractiveShell instances, load extensions, etc.
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import glob
+from itertools import chain
+import os
+import sys
+import typing as t
+
+from traitlets.config.application import boolean_flag
+from traitlets.config.configurable import Configurable
+from traitlets.config.loader import Config
+from IPython.core.application import SYSTEM_CONFIG_DIRS, ENV_CONFIG_DIRS
+from IPython.utils.contexts import preserve_keys
+from IPython.utils.path import filefind
+from traitlets import (
+    Unicode,
+    Instance,
+    List,
+    Bool,
+    CaselessStrEnum,
+    observe,
+    DottedObjectName,
+    Undefined,
+)
+from IPython.terminal import pt_inputhooks
+
+# -----------------------------------------------------------------------------
+# Aliases and Flags
+# -----------------------------------------------------------------------------
+
+gui_keys = tuple(sorted(pt_inputhooks.backends) + sorted(pt_inputhooks.aliases))
+
+shell_flags = {}
+
+addflag = lambda *args: shell_flags.update(boolean_flag(*args))
+addflag(
+    "autoindent",
+    "InteractiveShell.autoindent",
+    "Turn on autoindenting.",
+    "Turn off autoindenting.",
+)
+addflag(
+    "automagic",
+    "InteractiveShell.automagic",
+    """Turn on the auto calling of magic commands. Type %%magic at the
+        IPython  prompt  for  more information.""",
+        'Turn off the auto calling of magic commands.'
+)
+addflag('pdb', 'InteractiveShell.pdb',
+    "Enable auto calling the pdb debugger after every exception.",
+    "Disable auto calling the pdb debugger after every exception."
+)
+addflag('pprint', 'PlainTextFormatter.pprint',
+    "Enable auto pretty printing of results.",
+    "Disable auto pretty printing of results."
+)
+addflag('color-info', 'InteractiveShell.color_info',
+    """IPython can display information about objects via a set of functions,
+    and optionally can use colors for this, syntax highlighting
+    source code and various other elements. This is on by default, but can cause
+    problems with some pagers. If you see such problems, you can disable the
+    colours.""",
+    "Disable using colors for info related things."
+)
+addflag('ignore-cwd', 'InteractiveShellApp.ignore_cwd',
+        "Exclude the current working directory from sys.path",
+        "Include the current working directory in sys.path",
+)
+nosep_config = Config()
+nosep_config.InteractiveShell.separate_in = ''
+nosep_config.InteractiveShell.separate_out = ''
+nosep_config.InteractiveShell.separate_out2 = ''
+
+shell_flags['nosep']=(nosep_config, "Eliminate all spacing between prompts.")
+shell_flags['pylab'] = (
+    {'InteractiveShellApp' : {'pylab' : 'auto'}},
+    """Pre-load matplotlib and numpy for interactive use with
+    the default matplotlib backend. The exact options available
+    depend on what Matplotlib provides at runtime.""",
+)
+shell_flags['matplotlib'] = (
+    {'InteractiveShellApp' : {'matplotlib' : 'auto'}},
+    """Configure matplotlib for interactive use with
+    the default matplotlib backend. The exact options available
+    depend on what Matplotlib provides at runtime.""",
+)
+
+# it's possible we don't want short aliases for *all* of these:
+shell_aliases = dict(
+    autocall="InteractiveShell.autocall",
+    colors="InteractiveShell.colors",
+    theme="InteractiveShell.colors",
+    logfile="InteractiveShell.logfile",
+    logappend="InteractiveShell.logappend",
+    c="InteractiveShellApp.code_to_run",
+    m="InteractiveShellApp.module_to_run",
+    ext="InteractiveShellApp.extra_extensions",
+    gui='InteractiveShellApp.gui',
+    pylab='InteractiveShellApp.pylab',
+    matplotlib='InteractiveShellApp.matplotlib',
+)
+shell_aliases['cache-size'] = 'InteractiveShell.cache_size'
+
+
+# -----------------------------------------------------------------------------
+# Traitlets
+# -----------------------------------------------------------------------------
+
+
+class MatplotlibBackendCaselessStrEnum(CaselessStrEnum):
+    """An enum of Matplotlib backend strings where the case should be ignored.
+
+    Prior to Matplotlib 3.9.0 the list of valid backends is hardcoded in
+    pylabtools.backends. After that, Matplotlib manages backends.
+
+    The list of valid backends is determined when it is first needed to avoid
+    wasting unnecessary initialisation time.
+    """
+
+    def __init__(
+        self: CaselessStrEnum[t.Any],
+        default_value: t.Any = Undefined,
+        **kwargs: t.Any,
+    ) -> None:
+        super().__init__(None, default_value=default_value, **kwargs)
+
+    def __getattribute__(self, name):
+        if name == "values" and object.__getattribute__(self, name) is None:
+            from IPython.core.pylabtools import _list_matplotlib_backends_and_gui_loops
+
+            self.values = _list_matplotlib_backends_and_gui_loops()
+        return object.__getattribute__(self, name)
+
+
+#-----------------------------------------------------------------------------
+# Main classes and functions
+#-----------------------------------------------------------------------------
+
+class InteractiveShellApp(Configurable):
+    """A Mixin for applications that start InteractiveShell instances.
+
+    Provides configurables for loading extensions and executing files
+    as part of configuring a Shell environment.
+
+    The following methods should be called by the :meth:`initialize` method
+    of the subclass:
+
+      - :meth:`init_path`
+      - :meth:`init_shell` (to be implemented by the subclass)
+      - :meth:`init_gui_pylab`
+      - :meth:`init_extensions`
+      - :meth:`init_code`
+    """
+    extensions = List(Unicode(),
+        help="A list of dotted module names of IPython extensions to load."
+    ).tag(config=True)
+
+    extra_extensions = List(
+        DottedObjectName(),
+        help="""
+        Dotted module name(s) of one or more IPython extensions to load.
+
+        For specifying extra extensions to load on the command-line.
+
+        .. versionadded:: 7.10
+        """,
+    ).tag(config=True)
+
+    reraise_ipython_extension_failures = Bool(False,
+        help="Reraise exceptions encountered loading IPython extensions?",
+    ).tag(config=True)
+
+    # Extensions that are always loaded (not configurable)
+    default_extensions = List(Unicode(), [u'storemagic']).tag(config=False)
+
+    hide_initial_ns = Bool(True,
+        help="""Should variables loaded at startup (by startup files, exec_lines, etc.)
+        be hidden from tools like %who?"""
+    ).tag(config=True)
+
+    exec_files = List(Unicode(),
+        help="""List of files to run at IPython startup."""
+    ).tag(config=True)
+    exec_PYTHONSTARTUP = Bool(True,
+        help="""Run the file referenced by the PYTHONSTARTUP environment
+        variable at IPython startup."""
+    ).tag(config=True)
+    file_to_run = Unicode('',
+        help="""A file to be run""").tag(config=True)
+
+    exec_lines = List(Unicode(),
+        help="""lines of code to run at IPython startup."""
+    ).tag(config=True)
+    code_to_run = Unicode("", help="Execute the given command string.").tag(config=True)
+    module_to_run = Unicode("", help="Run the module as a script.").tag(config=True)
+    gui = CaselessStrEnum(
+        gui_keys,
+        allow_none=True,
+        help="Enable GUI event loop integration with any of {0}.".format(gui_keys),
+    ).tag(config=True)
+    matplotlib = MatplotlibBackendCaselessStrEnum(
+        allow_none=True,
+        help="""Configure matplotlib for interactive use with
+        the default matplotlib backend. The exact options available
+        depend on what Matplotlib provides at runtime.""",
+    ).tag(config=True)
+    pylab = MatplotlibBackendCaselessStrEnum(
+        allow_none=True,
+        help="""Pre-load matplotlib and numpy for interactive use,
+        selecting a particular matplotlib backend and loop integration.
+        The exact options available depend on what Matplotlib provides at runtime.
+        """,
+    ).tag(config=True)
+    pylab_import_all = Bool(
+        True,
+        help="""If true, IPython will populate the user namespace with numpy, pylab, etc.
+        and an ``import *`` is done from numpy and pylab, when using pylab mode.
+
+        When False, pylab mode should not import any names into the user namespace.
+        """,
+    ).tag(config=True)
+    ignore_cwd = Bool(
+        False,
+        help="""If True, IPython will not add the current working directory to sys.path.
+        When False, the current working directory is added to sys.path, allowing imports
+        of modules defined in the current directory."""
+    ).tag(config=True)
+    shell = Instance('IPython.core.interactiveshell.InteractiveShellABC',
+                     allow_none=True)
+    # whether interact-loop should start
+    interact = Bool(True)
+
+    user_ns = Instance(dict, args=None, allow_none=True)
+    @observe('user_ns')
+    def _user_ns_changed(self, change):
+        if self.shell is not None:
+            self.shell.user_ns = change['new']
+            self.shell.init_user_ns()
+
+    def init_path(self):
+        """Add current working directory, '', to sys.path
+
+        Unlike Python's default, we insert before the first `site-packages`
+        or `dist-packages` directory,
+        so that it is after the standard library.
+
+        .. versionchanged:: 7.2
+            Try to insert after the standard library, instead of first.
+        .. versionchanged:: 8.0
+            Allow optionally not including the current directory in sys.path
+        """
+        if '' in sys.path or self.ignore_cwd:
+            return
+        for idx, path in enumerate(sys.path):
+            parent, last_part = os.path.split(path)
+            if last_part in {'site-packages', 'dist-packages'}:
+                break
+        else:
+            # no site-packages or dist-packages found (?!)
+            # back to original behavior of inserting at the front
+            idx = 0
+        sys.path.insert(idx, '')
+
+    def init_shell(self):
+        raise NotImplementedError("Override in subclasses")
+
+    def init_gui_pylab(self):
+        """Enable GUI event loop integration, taking pylab into account."""
+        enable = False
+        shell = self.shell
+        if self.pylab:
+            enable = lambda key: shell.enable_pylab(key, import_all=self.pylab_import_all)
+            key = self.pylab
+        elif self.matplotlib:
+            enable = shell.enable_matplotlib
+            key = self.matplotlib
+        elif self.gui:
+            enable = shell.enable_gui
+            key = self.gui
+
+        if not enable:
+            return
+
+        try:
+            r = enable(key)
+        except ImportError:
+            self.log.warning("Eventloop or matplotlib integration failed. Is matplotlib installed?")
+            self.shell.showtraceback()
+            return
+        except Exception:
+            self.log.warning("GUI event loop or pylab initialization failed")
+            self.shell.showtraceback()
+            return
+
+        if isinstance(r, tuple):
+            gui, backend = r[:2]
+            self.log.info("Enabling GUI event loop integration, "
+                      "eventloop=%s, matplotlib=%s", gui, backend)
+            if key == "auto":
+                print("Using matplotlib backend: %s" % backend)
+        else:
+            gui = r
+            self.log.info("Enabling GUI event loop integration, "
+                      "eventloop=%s", gui)
+
+    def init_extensions(self):
+        """Load all IPython extensions in IPythonApp.extensions.
+
+        This uses the :meth:`ExtensionManager.load_extensions` to load all
+        the extensions listed in ``self.extensions``.
+        """
+        try:
+            self.log.debug("Loading IPython extensions...")
+            extensions = (
+                self.default_extensions + self.extensions + self.extra_extensions
+            )
+            for ext in extensions:
+                try:
+                    self.log.info("Loading IPython extension: %s", ext)
+                    self.shell.extension_manager.load_extension(ext)
+                except:
+                    if self.reraise_ipython_extension_failures:
+                        raise
+                    msg = ("Error in loading extension: {ext}\n"
+                           "Check your config files in {location}".format(
+                               ext=ext,
+                               location=self.profile_dir.location
+                           ))
+                    self.log.warning(msg, exc_info=True)
+        except:
+            if self.reraise_ipython_extension_failures:
+                raise
+            self.log.warning("Unknown error in loading extensions:", exc_info=True)
+
+    def init_code(self):
+        """run the pre-flight code, specified via exec_lines"""
+        self._run_startup_files()
+        self._run_exec_lines()
+        self._run_exec_files()
+
+        # Hide variables defined here from %who etc.
+        if self.hide_initial_ns:
+            self.shell.user_ns_hidden.update(self.shell.user_ns)
+
+        # command-line execution (ipython -i script.py, ipython -m module)
+        # should *not* be excluded from %whos
+        self._run_cmd_line_code()
+        self._run_module()
+
+        # flush output, so itwon't be attached to the first cell
+        sys.stdout.flush()
+        sys.stderr.flush()
+        self.shell._sys_modules_keys = set(sys.modules.keys())
+
+    def _run_exec_lines(self):
+        """Run lines of code in IPythonApp.exec_lines in the user's namespace."""
+        if not self.exec_lines:
+            return
+        try:
+            self.log.debug("Running code from IPythonApp.exec_lines...")
+            for line in self.exec_lines:
+                try:
+                    self.log.info("Running code in user namespace: %s" %
+                                  line)
+                    self.shell.run_cell(line, store_history=False)
+                except:
+                    self.log.warning("Error in executing line in user "
+                                  "namespace: %s" % line)
+                    self.shell.showtraceback()
+        except:
+            self.log.warning("Unknown error in handling IPythonApp.exec_lines:")
+            self.shell.showtraceback()
+
+    def _exec_file(self, fname, shell_futures=False):
+        try:
+            full_filename = filefind(fname, [u'.', self.ipython_dir])
+        except IOError:
+            self.log.warning("File not found: %r"%fname)
+            return
+        # Make sure that the running script gets a proper sys.argv as if it
+        # were run from a system shell.
+        save_argv = sys.argv
+        sys.argv = [full_filename] + self.extra_args[1:]
+        try:
+            if os.path.isfile(full_filename):
+                self.log.info("Running file in user namespace: %s" %
+                              full_filename)
+                # Ensure that __file__ is always defined to match Python
+                # behavior.
+                with preserve_keys(self.shell.user_ns, '__file__'):
+                    self.shell.user_ns['__file__'] = fname
+                    if full_filename.endswith('.ipy') or full_filename.endswith('.ipynb'):
+                        self.shell.safe_execfile_ipy(full_filename,
+                                                     shell_futures=shell_futures)
+                    else:
+                        # default to python, even without extension
+                        self.shell.safe_execfile(full_filename,
+                                                 self.shell.user_ns,
+                                                 shell_futures=shell_futures,
+                                                 raise_exceptions=True)
+        finally:
+            sys.argv = save_argv
+
+    def _run_startup_files(self):
+        """Run files from profile startup directory"""
+        startup_dirs = [self.profile_dir.startup_dir] + [
+            os.path.join(p, 'startup') for p in chain(ENV_CONFIG_DIRS, SYSTEM_CONFIG_DIRS)
+        ]
+        startup_files = []
+
+        if self.exec_PYTHONSTARTUP and os.environ.get('PYTHONSTARTUP', False) and \
+                not (self.file_to_run or self.code_to_run or self.module_to_run):
+            python_startup = os.environ['PYTHONSTARTUP']
+            self.log.debug("Running PYTHONSTARTUP file %s...", python_startup)
+            try:
+                self._exec_file(python_startup)
+            except:
+                self.log.warning("Unknown error in handling PYTHONSTARTUP file %s:", python_startup)
+                self.shell.showtraceback()
+        for startup_dir in startup_dirs[::-1]:
+            startup_files += glob.glob(os.path.join(startup_dir, '*.py'))
+            startup_files += glob.glob(os.path.join(startup_dir, '*.ipy'))
+        if not startup_files:
+            return
+
+        self.log.debug("Running startup files from %s...", startup_dir)
+        try:
+            for fname in sorted(startup_files):
+                self._exec_file(fname)
+        except:
+            self.log.warning("Unknown error in handling startup files:")
+            self.shell.showtraceback()
+
+    def _run_exec_files(self):
+        """Run files from IPythonApp.exec_files"""
+        if not self.exec_files:
+            return
+
+        self.log.debug("Running files in IPythonApp.exec_files...")
+        try:
+            for fname in self.exec_files:
+                self._exec_file(fname)
+        except:
+            self.log.warning("Unknown error in handling IPythonApp.exec_files:")
+            self.shell.showtraceback()
+
+    def _run_cmd_line_code(self):
+        """Run code or file specified at the command-line"""
+        if self.code_to_run:
+            line = self.code_to_run
+            try:
+                self.log.info("Running code given at command line (c=): %s" %
+                              line)
+                self.shell.run_cell(line, store_history=False)
+            except:
+                self.log.warning("Error in executing line in user namespace: %s" %
+                              line)
+                self.shell.showtraceback()
+                if not self.interact:
+                    self.exit(1)
+
+        # Like Python itself, ignore the second if the first of these is present
+        elif self.file_to_run:
+            fname = self.file_to_run
+            if os.path.isdir(fname):
+                fname = os.path.join(fname, "__main__.py")
+            if not os.path.exists(fname):
+                self.log.warning("File '%s' doesn't exist", fname)
+                if not self.interact:
+                    self.exit(2)
+            try:
+                self._exec_file(fname, shell_futures=True)
+            except:
+                self.shell.showtraceback(tb_offset=4)
+                if not self.interact:
+                    self.exit(1)
+
+    def _run_module(self):
+        """Run module specified at the command-line."""
+        if self.module_to_run:
+            # Make sure that the module gets a proper sys.argv as if it were
+            # run using `python -m`.
+            save_argv = sys.argv
+            sys.argv = [sys.executable] + self.extra_args
+            try:
+                self.shell.safe_run_module(self.module_to_run,
+                                           self.shell.user_ns)
+            finally:
+                sys.argv = save_argv

temp_venv/lib/python3.13/site-packages/IPython/core/splitinput.py

@@ -0,0 +1,145 @@
+# encoding: utf-8
+"""
+Simple utility for splitting user input. This is used by both inputsplitter and
+prefilter.
+
+Authors:
+
+* Brian Granger
+* Fernando Perez
+"""
+
+#-----------------------------------------------------------------------------
+#  Copyright (C) 2008-2011  The IPython Development Team
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+import re
+import sys
+
+from IPython.utils import py3compat
+from IPython.utils.encoding import get_stream_enc
+from IPython.core.oinspect import OInfo
+
+#-----------------------------------------------------------------------------
+# Main function
+#-----------------------------------------------------------------------------
+
+# RegExp for splitting line contents into pre-char//first word-method//rest.
+# For clarity, each group in on one line.
+
+# WARNING: update the regexp if the escapes in interactiveshell are changed, as
+# they are hardwired in.
+
+# Although it's not solely driven by the regex, note that:
+# ,;/% only trigger if they are the first character on the line
+# ! and !! trigger if they are first char(s) *or* follow an indent
+# ? triggers as first or last char.
+
+line_split = re.compile(r"""
+             ^(\s*)               # any leading space
+             ([,;/%]|!!?|\?\??)?  # escape character or characters
+             \s*(%{0,2}[\w\.\*]*)     # function/method, possibly with leading %
+                                  # to correctly treat things like '?%magic'
+             (.*?$|$)             # rest of line
+             """, re.VERBOSE)
+
+
+def split_user_input(line, pattern=None):
+    """Split user input into initial whitespace, escape character, function part
+    and the rest.
+    """
+    # We need to ensure that the rest of this routine deals only with unicode
+    encoding = get_stream_enc(sys.stdin, 'utf-8')
+    line = py3compat.cast_unicode(line, encoding)
+
+    if pattern is None:
+        pattern = line_split
+    match = pattern.match(line)
+    if not match:
+        # print("match failed for line '%s'" % line)
+        try:
+            ifun, the_rest = line.split(None,1)
+        except ValueError:
+            # print("split failed for line '%s'" % line)
+            ifun, the_rest = line, u''
+        pre = re.match(r'^(\s*)(.*)',line).groups()[0]
+        esc = ""
+    else:
+        pre, esc, ifun, the_rest = match.groups()
+
+    # print('line:<%s>' % line)  # dbg
+    # print('pre <%s> ifun <%s> rest <%s>' % (pre,ifun.strip(),the_rest))  # dbg
+    return pre, esc or "", ifun.strip(), the_rest
+
+
+class LineInfo:
+    """A single line of input and associated info.
+
+    Includes the following as properties:
+
+    line
+      The original, raw line
+
+    continue_prompt
+      Is this line a continuation in a sequence of multiline input?
+
+    pre
+      Any leading whitespace.
+
+    esc
+      The escape character(s) in pre or the empty string if there isn't one.
+      Note that '!!' and '??' are possible values for esc. Otherwise it will
+      always be a single character.
+
+    ifun
+      The 'function part', which is basically the maximal initial sequence
+      of valid python identifiers and the '.' character. This is what is
+      checked for alias and magic transformations, used for auto-calling,
+      etc. In contrast to Python identifiers, it may start with "%" and contain
+      "*".
+
+    the_rest
+      Everything else on the line.
+
+    raw_the_rest
+      the_rest without whitespace stripped.
+    """
+    def __init__(self, line, continue_prompt=False):
+        self.line            = line
+        self.continue_prompt = continue_prompt
+        self.pre, self.esc, self.ifun, self.raw_the_rest = split_user_input(line)
+        self.the_rest = self.raw_the_rest.lstrip()
+
+        self.pre_char       = self.pre.strip()
+        if self.pre_char:
+            self.pre_whitespace = '' # No whitespace allowed before esc chars
+        else:
+            self.pre_whitespace = self.pre
+
+    def ofind(self, ip) -> OInfo:
+        """Do a full, attribute-walking lookup of the ifun in the various
+        namespaces for the given IPython InteractiveShell instance.
+
+        Return a dict with keys: {found, obj, ospace, ismagic}
+
+        Note: can cause state changes because of calling getattr, but should
+        only be run if autocall is on and if the line hasn't matched any
+        other, less dangerous handlers.
+
+        Does cache the results of the call, so can be called multiple times
+        without worrying about *further* damaging state.
+        """
+        return ip._ofind(self.ifun)
+
+    def __str__(self):
+        return "LineInfo [%s|%s|%s|%s]" %(self.pre, self.esc, self.ifun, self.the_rest)
+
+    def __repr__(self):
+        return "<" + str(self) + ">"

temp_venv/lib/python3.13/site-packages/IPython/core/tbtools.py

@@ -0,0 +1,554 @@
+import functools
+import inspect
+import pydoc
+import sys
+import types
+import warnings
+from types import TracebackType
+from typing import Any, Callable, Optional, Tuple
+
+import stack_data
+from pygments.token import Token
+
+from IPython import get_ipython
+from IPython.core import debugger
+from IPython.utils import path as util_path
+from IPython.utils import py3compat
+from IPython.utils.PyColorize import Theme, TokenStream, theme_table
+
+_sentinel = object()
+INDENT_SIZE = 8
+
+
+@functools.lru_cache
+def count_lines_in_py_file(filename: str) -> int:
+    """
+    Given a filename, returns the number of lines in the file
+    if it ends with the extension ".py". Otherwise, returns 0.
+    """
+    if not filename.endswith(".py"):
+        return 0
+    else:
+        try:
+            with open(filename, "r") as file:
+                s = sum(1 for line in file)
+        except UnicodeError:
+            return 0
+    return s
+
+
+def get_line_number_of_frame(frame: types.FrameType) -> int:
+    """
+    Given a frame object, returns the total number of lines in the file
+    containing the frame's code object, or the number of lines in the
+    frame's source code if the file is not available.
+
+    Parameters
+    ----------
+    frame : FrameType
+        The frame object whose line number is to be determined.
+
+    Returns
+    -------
+    int
+        The total number of lines in the file containing the frame's
+        code object, or the number of lines in the frame's source code
+        if the file is not available.
+    """
+    filename = frame.f_code.co_filename
+    if filename is None:
+        print("No file....")
+        lines, first = inspect.getsourcelines(frame)
+        return first + len(lines)
+    return count_lines_in_py_file(filename)
+
+
+def _safe_string(value: Any, what: Any, func: Any = str) -> str:
+    # Copied from cpython/Lib/traceback.py
+    try:
+        return func(value)
+    except:
+        return f"<{what} {func.__name__}() failed>"
+
+
+def _format_traceback_lines(
+    lines: list[stack_data.Line],
+    theme: Theme,
+    has_colors: bool,
+    lvals_toks: list[TokenStream],
+) -> TokenStream:
+    """
+    Format tracebacks lines with pointing arrow, leading numbers,
+    this assumes the stack have been extracted using stackdata.
+
+
+    Parameters
+    ----------
+    lines : list[Line]
+    """
+    numbers_width = INDENT_SIZE - 1
+    tokens: TokenStream = []
+
+    for stack_line in lines:
+        if stack_line is stack_data.LINE_GAP:
+            toks = [(Token.LinenoEm, "   (...)")]
+            tokens.extend(toks)
+            continue
+
+        lineno = stack_line.lineno
+        line = stack_line.render(pygmented=has_colors).rstrip("\n") + "\n"
+        if stack_line.is_current:
+            # This is the line with the error
+            pad = numbers_width - len(str(lineno))
+            toks = [
+                (Token.LinenoEm, theme.make_arrow(pad)),
+                (Token.LinenoEm, str(lineno)),
+                (Token, " "),
+                (Token, line),
+            ]
+        else:
+            num = "%*s" % (numbers_width, lineno)
+            toks = [
+                (Token.LinenoEm, str(num)),
+                (Token, " "),
+                (Token, line),
+            ]
+
+        tokens.extend(toks)
+        if lvals_toks and stack_line.is_current:
+            for lv in lvals_toks:
+                tokens.append((Token, " " * INDENT_SIZE))
+                tokens.extend(lv)
+                tokens.append((Token, "\n"))
+            # strip the last newline
+            tokens = tokens[:-1]
+
+    return tokens
+
+
+# some internal-use functions
+def text_repr(value: Any) -> str:
+    """Hopefully pretty robust repr equivalent."""
+    # this is pretty horrible but should always return *something*
+    try:
+        return pydoc.text.repr(value)  # type: ignore[call-arg]
+    except KeyboardInterrupt:
+        raise
+    except:
+        try:
+            return repr(value)
+        except KeyboardInterrupt:
+            raise
+        except:
+            try:
+                # all still in an except block so we catch
+                # getattr raising
+                name = getattr(value, "__name__", None)
+                if name:
+                    # ick, recursion
+                    return text_repr(name)
+                klass = getattr(value, "__class__", None)
+                if klass:
+                    return "%s instance" % text_repr(klass)
+                return "UNRECOVERABLE REPR FAILURE"
+            except KeyboardInterrupt:
+                raise
+            except:
+                return "UNRECOVERABLE REPR FAILURE"
+
+
+def eqrepr(value: Any, repr: Callable[[Any], str] = text_repr) -> str:
+    return "=%s" % repr(value)
+
+
+def nullrepr(value: Any, repr: Callable[[Any], str] = text_repr) -> str:
+    return ""
+
+
+def _tokens_filename(
+    em: bool,
+    file: str | None,
+    *,
+    lineno: int | None = None,
+) -> TokenStream:
+    """
+    Format filename lines with custom formatting from caching compiler or `File *.py` by default
+
+    Parameters
+    ----------
+    em: wether bold or not
+    file : str
+    """
+    Normal = Token.NormalEm if em else Token.Normal
+    Filename = Token.FilenameEm if em else Token.Filename
+    ipinst = get_ipython()
+    if (
+        ipinst is not None
+        and (data := ipinst.compile.format_code_name(file)) is not None
+    ):
+        label, name = data
+        if lineno is None:
+            return [
+                (Normal, label),
+                (Normal, " "),
+                (Filename, name),
+            ]
+        else:
+            return [
+                (Normal, label),
+                (Normal, " "),
+                (Filename, name),
+                (Filename, f", line {lineno}"),
+            ]
+    else:
+        name = util_path.compress_user(
+            py3compat.cast_unicode(file, util_path.fs_encoding)
+        )
+        if lineno is None:
+            return [
+                (Normal, "File "),
+                (Filename, name),
+            ]
+        else:
+            return [
+                (Normal, "File "),
+                (Filename, f"{name}:{lineno}"),
+            ]
+
+
+def _simple_format_traceback_lines(
+    lnum: int,
+    index: int,
+    lines: list[tuple[str, tuple[str, bool]]],
+    lvals_toks: list[TokenStream],
+    theme: Theme,
+) -> TokenStream:
+    """
+    Format tracebacks lines with pointing arrow, leading numbers
+
+    This should be equivalent to _format_traceback_lines, but does not rely on stackdata
+    to format the lines
+
+    This is due to the fact that stackdata may be slow on super long and complex files.
+
+    Parameters
+    ==========
+
+    lnum: int
+        number of the target line of code.
+    index: int
+        which line in the list should be highlighted.
+    lines: list[string]
+    lvals_toks: pairs of token type and str
+        Values of local variables, already colored, to inject just after the error line.
+    """
+    for item in lvals_toks:
+        assert isinstance(item, list)
+        for subit in item:
+            assert isinstance(subit[1], str)
+
+    numbers_width = INDENT_SIZE - 1
+    res_toks: TokenStream = []
+    for i, (line, (new_line, err)) in enumerate(lines, lnum - index):
+        if not err:
+            line = new_line
+
+        colored_line = line
+        if i == lnum:
+            # This is the line with the error
+            pad = numbers_width - len(str(i))
+            line_toks = [
+                (Token.LinenoEm, theme.make_arrow(pad)),
+                (Token.LinenoEm, str(lnum)),
+                (Token, " "),
+                (Token, colored_line),
+            ]
+        else:
+            padding_num = "%*s" % (numbers_width, i)
+
+            line_toks = [
+                (Token.LinenoEm, padding_num),
+                (Token, " "),
+                (Token, colored_line),
+            ]
+        res_toks.extend(line_toks)
+
+        if lvals_toks and i == lnum:
+            for lv in lvals_toks:
+                res_toks.extend(lv)
+            # res_toks.extend(lvals_toks)
+    return res_toks
+
+
+class FrameInfo:
+    """
+    Mirror of stack data's FrameInfo, but so that we can bypass highlighting on
+    really long frames.
+    """
+
+    description: Optional[str]
+    filename: Optional[str]
+    lineno: int
+    # number of context lines to use
+    context: Optional[int]
+    raw_lines: list[str]
+    _sd: stack_data.core.FrameInfo
+    frame: Any
+
+    @classmethod
+    def _from_stack_data_FrameInfo(
+        cls, frame_info: stack_data.core.FrameInfo | stack_data.core.RepeatedFrames
+    ) -> "FrameInfo":
+        return cls(
+            getattr(frame_info, "description", None),
+            getattr(frame_info, "filename", None),  # type: ignore[arg-type]
+            getattr(frame_info, "lineno", None),  # type: ignore[arg-type]
+            getattr(frame_info, "frame", None),
+            getattr(frame_info, "code", None),
+            sd=frame_info,
+            context=None,
+        )
+
+    def __init__(
+        self,
+        description: Optional[str],
+        filename: str,
+        lineno: int,
+        frame: Any,
+        code: Optional[types.CodeType],
+        *,
+        sd: Any = None,
+        context: int | None = None,
+    ):
+        assert isinstance(lineno, (int, type(None))), lineno
+        self.description = description
+        self.filename = filename
+        self.lineno = lineno
+        self.frame = frame
+        self.code = code
+        self._sd = sd
+        self.context = context
+
+        # self.lines = []
+        if sd is None:
+            try:
+                # return a list of source lines and a starting line number
+                self.raw_lines = inspect.getsourcelines(frame)[0]
+            except OSError:
+                self.raw_lines = [
+                    "'Could not get source, probably due dynamically evaluated source code.'"
+                ]
+
+    @property
+    def variables_in_executing_piece(self) -> list[Any]:
+        if self._sd is not None:
+            return self._sd.variables_in_executing_piece  # type:ignore[misc]
+        else:
+            return []
+
+    @property
+    def lines(self) -> list[Any]:
+        from executing.executing import NotOneValueFound
+
+        assert self._sd is not None
+        try:
+            return self._sd.lines  # type: ignore[misc]
+        except NotOneValueFound:
+
+            class Dummy:
+                lineno = 0
+                is_current = False
+
+                def render(self, *, pygmented: bool) -> str:
+                    return "<Error retrieving source code with stack_data see ipython/ipython#13598>"
+
+            return [Dummy()]
+
+    @property
+    def executing(self) -> Any:
+        if self._sd is not None:
+            return self._sd.executing
+        else:
+            return None
+
+
+class TBTools:
+    """Basic tools used by all traceback printer classes."""
+
+    # Number of frames to skip when reporting tracebacks
+    tb_offset = 0
+    _theme_name: str
+    _old_theme_name: str
+    call_pdb: bool
+    ostream: Any
+    debugger_cls: Any
+    pdb: Any
+
+    def __init__(
+        self,
+        color_scheme: Any = _sentinel,
+        call_pdb: bool = False,
+        ostream: Any = None,
+        *,
+        debugger_cls: type | None = None,
+        theme_name: str = "nocolor",
+    ):
+        if color_scheme is not _sentinel:
+            assert isinstance(color_scheme, str), color_scheme
+            warnings.warn(
+                "color_scheme is deprecated since IPython 9.0, use theme_name instead, all lowercase",
+                DeprecationWarning,
+                stacklevel=2,
+            )
+            theme_name = color_scheme
+        if theme_name in ["Linux", "LightBG", "Neutral", "NoColor"]:
+            warnings.warn(
+                f"Theme names and color schemes are lowercase in IPython 9.0 use {theme_name.lower()} instead",
+                DeprecationWarning,
+                stacklevel=2,
+            )
+            theme_name = theme_name.lower()
+        # Whether to call the interactive pdb debugger after printing
+        # tracebacks or not
+        super().__init__()
+        self.call_pdb = call_pdb
+
+        # Output stream to write to.  Note that we store the original value in
+        # a private attribute and then make the public ostream a property, so
+        # that we can delay accessing sys.stdout until runtime.  The way
+        # things are written now, the sys.stdout object is dynamically managed
+        # so a reference to it should NEVER be stored statically.  This
+        # property approach confines this detail to a single location, and all
+        # subclasses can simply access self.ostream for writing.
+        self._ostream = ostream
+
+        # Create color table
+        self.set_theme_name(theme_name)
+        self.debugger_cls = debugger_cls or debugger.Pdb
+
+        if call_pdb:
+            self.pdb = self.debugger_cls()
+        else:
+            self.pdb = None
+
+    def _get_ostream(self) -> Any:
+        """Output stream that exceptions are written to.
+
+        Valid values are:
+
+        - None: the default, which means that IPython will dynamically resolve
+          to sys.stdout.  This ensures compatibility with most tools, including
+          Windows (where plain stdout doesn't recognize ANSI escapes).
+
+        - Any object with 'write' and 'flush' attributes.
+        """
+        return sys.stdout if self._ostream is None else self._ostream
+
+    def _set_ostream(self, val) -> None:  # type:ignore[no-untyped-def]
+        assert val is None or (hasattr(val, "write") and hasattr(val, "flush"))
+        self._ostream = val
+
+    ostream = property(_get_ostream, _set_ostream)
+
+    @staticmethod
+    def _get_chained_exception(exception_value: Any) -> Any:
+        cause = getattr(exception_value, "__cause__", None)
+        if cause:
+            return cause
+        if getattr(exception_value, "__suppress_context__", False):
+            return None
+        return getattr(exception_value, "__context__", None)
+
+    def get_parts_of_chained_exception(
+        self, evalue: BaseException | None
+    ) -> Optional[Tuple[type, BaseException, TracebackType]]:
+        chained_evalue = self._get_chained_exception(evalue)
+
+        if chained_evalue:
+            return (
+                chained_evalue.__class__,
+                chained_evalue,
+                chained_evalue.__traceback__,
+            )
+        return None
+
+    def prepare_chained_exception_message(
+        self, cause: BaseException | None
+    ) -> list[list[str]]:
+        direct_cause = (
+            "\nThe above exception was the direct cause of the following exception:\n"
+        )
+        exception_during_handling = (
+            "\nDuring handling of the above exception, another exception occurred:\n"
+        )
+
+        if cause:
+            message = [[direct_cause]]
+        else:
+            message = [[exception_during_handling]]
+        return message
+
+    @property
+    def has_colors(self) -> bool:
+        assert self._theme_name == self._theme_name.lower()
+        return self._theme_name != "nocolor"
+
+    def set_theme_name(self, name: str) -> None:
+        assert name in theme_table
+        assert name.lower() == name
+        self._theme_name = name
+        # Also set colors of debugger
+        if hasattr(self, "pdb") and self.pdb is not None:
+            self.pdb.set_theme_name(name)
+
+    def set_colors(self, name: str) -> None:
+        """Shorthand access to the color table scheme selector method."""
+
+        # todo emit deprecation
+        warnings.warn(
+            "set_colors is deprecated since IPython 9.0, use set_theme_name instead",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+        self.set_theme_name(name)
+
+    def color_toggle(self) -> None:
+        """Toggle between the currently active color scheme and nocolor."""
+        if self._theme_name == "nocolor":
+            self._theme_name = self._old_theme_name
+        else:
+            self._old_theme_name = self._theme_name
+            self._theme_name = "nocolor"
+
+    def stb2text(self, stb: list[str]) -> str:
+        """Convert a structured traceback (a list) to a string."""
+        return "\n".join(stb)
+
+    def text(
+        self,
+        etype: type,
+        value: BaseException | None,
+        tb: TracebackType | None,
+        tb_offset: Optional[int] = None,
+        context: int = 5,
+    ) -> str:
+        """Return formatted traceback.
+
+        Subclasses may override this if they add extra arguments.
+        """
+        tb_list = self.structured_traceback(etype, value, tb, tb_offset, context)
+        return self.stb2text(tb_list)
+
+    def structured_traceback(
+        self,
+        etype: type,
+        evalue: BaseException | None,
+        etb: Optional[TracebackType] = None,
+        tb_offset: Optional[int] = None,
+        context: int = 5,
+    ) -> list[str]:
+        """Return a list of traceback frames.
+
+        Must be implemented by each class.
+        """
+        raise NotImplementedError()

temp_venv/lib/python3.13/site-packages/IPython/core/tips.py

@@ -0,0 +1,118 @@
+from datetime import datetime
+import os
+from random import choice
+from typing import Any
+
+_tips: Any = {
+    # (month, day)
+    "every_year": {
+        (1, 1): "Happy new year!",
+        # European time:
+        # [2/8/25, 23:28:24] Fernando Perez: Hi! Yes, this was my first public
+        # announcement:
+        # [2/8/25, 23:28:25] Fernando Perez:
+        # https://mail.python.org/pipermail/python-list/2001-December/093408.html
+        # [2/8/25, 23:28:55] Fernando Perez: All that started two months earlier
+        # - in October 2001 I read this article:
+        # [2/8/25, 23:28:55] Fernando Perez:
+        # https://web.archive.org/web/20011202000624/http://www.onlamp.com/pub/a/python/2001/10/11/pythonnews.html
+        # [2/8/25, 23:29:05] Fernando Perez: Which is also archived here:
+        # [2/8/25, 23:29:05] Fernando Perez:
+        # https://docstore.mik.ua/orelly/weblinux2/orn/interactive_python.html
+        # [2/8/25, 23:29:48] Fernando Perez: That article put me on the trail of
+        # LazyPython, and I also found out (can’t remember where) about IPP
+        # (Interactive Python Prompt), another similar projecd by Janko Hauser.
+        # [2/8/25, 23:30:20] Fernando Perez: A also read an article around that
+        # time, about new features in Python 2.0, which spoke of how
+        # sys.displayhook could be programmed to call any object you wanted.
+        # [2/8/25, 23:31:01] Fernando Perez: Those things together gave me the
+        # idea of implementing a stateful object, the “IPython Prompt”, that
+        # could store a  cache of old results, Mathematica-style, and that could
+        # have all kinds of other useful tricks up its sleeve.
+        # [2/8/25, 23:31:17] Fernando Perez: I can’t remember if I did the
+        # prompt stuff first and then read about LazyPython/IPP.
+        # [2/8/25, 23:31:41] Fernando Perez: I do know that, implementation
+        # wise, at first I just did the tiny IPython 0.0.1 that I posted much
+        # later on github as a gist:
+        # [2/8/25, 23:31:55] Fernando Perez:
+        # https://gist.github.com/fperez/1579699
+        # [2/8/25, 23:32:03] Fernando Perez: But I only shared that publicly
+        # much later.
+        # [2/8/25, 23:33:19] Fernando Perez: I did find out about IPP/LazyPython
+        # sometime in October, contacted Janko and Nathan who told me to use
+        # their code at will but said they were busy with other things, and got
+        # cranking for a few mad weeks on what became the IPython 0.2.0 that I
+        # posted about in that comp.lang.python thread of December 2001.
+        # [2/8/25, 23:33:52] Fernando Perez: That period from Oct 11 to Dec 9
+        # 2001 was maniacal coding, with very little sleep 🙂
+        (
+            10,
+            11,
+        ): "IPython's first line of code was written {} years ago by Fernando Pérez".format(
+            datetime.now().year - 2001
+        ),
+        (
+            12,
+            9,
+        ): "IPython 0.0.2 was announced {} years ago: https://mail.python.org/pipermail/python-list/2001-December/093408.html".format(
+            datetime.now().year - 2001
+        ),
+        (
+            3,
+            8,
+        ): "Today is International Women's Day: https://www.internationalwomensday.com/",
+        (
+            3,
+            31,
+        ): "Happy International Transgender Day of Visibility! You are valid. You matter. https://en.wikipedia.org/wiki/International_Transgender_Day_of_Visibility",
+    },
+    "random": [
+        "Use `F2` or %edit with no arguments to open an empty editor with a temporary file.",
+        "Run your doctests from within IPython for development and debugging. The special %doctest_mode command toggles a mode where the prompt, output and exceptions display matches as closely as possible that of the default Python interpreter.",
+        "You can use `files = !ls *.png`",
+        "Use the IPython.lib.demo.Demo class to load any Python script as an interactive demo.",
+        "Put a ';' at the end of a line to suppress the printing of output.",
+        "You can use Ctrl-O to force a new line in terminal IPython",
+        "Use `object?` to see the help on `object`, `object??` to view its source",
+        "`?` alone on a line will brings up IPython's help",
+        "You can use `%hist` to view history, see the options with `%history?`",
+        "You can change the editing mode of IPython to behave more like vi, or emacs.",
+        "IPython 9.0+ has hooks to integrate AI/LLM completions.",
+        "Use `%timeit` or `%%timeit`, and the  `-r`, `-n`, and `-o` options to easily profile your code.",
+        "Use `ipython --help-all | less` to view all the IPython configuration options.",
+        "Use `--theme`, or the `%colors` magic to change IPython's themes and colors.",
+        "The `%timeit` magic has a `-o` flag, which returns the results, making it easy to plot. See `%timeit?`.",
+    ],
+}
+
+if os.name == "nt":
+    _tips["random"].extend(
+        [
+            "We can't show you all tips on Windows as sometimes Unicode characters crash the Windows console, please help us debug it."
+        ]
+    )
+    # unicode may crash windows console, so we filter out tips with non-ASCII characters.
+    _tips["every_year"] = {
+        k: v
+        for k, v in _tips["every_year"].items()
+        if all(ord(char) < 128 for char in v)
+    }
+else:
+    _tips["random"].extend(
+        [
+            "You can use LaTeX or Unicode completion, `\\alpha<tab>` will insert the α symbol.",
+            "You can find how to type a LaTeX symbol by back-completing it, eg `\\θ<tab>` will expand to `\\theta`.",
+            "You can find how to type a Unicode symbol by back-completing it, eg `\\Ⅷ<tab>` will expand to `\\ROMAN NUMERAL EIGHT`.",
+            "IPython supports combining unicode identifiers, eg F\\vec<tab> will become F⃗, useful for physics equations. Play with \\dot \\ddot and others.",
+        ]
+    )
+
+
+def pick_tip() -> str:
+    current_date = datetime.now()
+    month, day = current_date.month, current_date.day
+
+    if (month, day) in _tips["every_year"]:
+        return _tips["every_year"][(month, day)]
+
+    return choice(_tips["random"])

temp_venv/lib/python3.13/site-packages/IPython/core/ultratb.py

@@ -0,0 +1,1252 @@
+"""
+Verbose and colourful traceback formatting.
+
+**ColorTB**
+
+I've always found it a bit hard to visually parse tracebacks in Python.  The
+ColorTB class is a solution to that problem.  It colors the different parts of a
+traceback in a manner similar to what you would expect from a syntax-highlighting
+text editor.
+
+Installation instructions for ColorTB::
+
+    import sys,ultratb
+    sys.excepthook = ultratb.ColorTB()
+
+**VerboseTB**
+
+I've also included a port of Ka-Ping Yee's "cgitb.py" that produces all kinds
+of useful info when a traceback occurs.  Ping originally had it spit out HTML
+and intended it for CGI programmers, but why should they have all the fun?  I
+altered it to spit out colored text to the terminal.  It's a bit overwhelming,
+but kind of neat, and maybe useful for long-running programs that you believe
+are bug-free.  If a crash *does* occur in that type of program you want details.
+Give it a shot--you'll love it or you'll hate it.
+
+.. note::
+
+  The Verbose mode prints the variables currently visible where the exception
+  happened (shortening their strings if too long). This can potentially be
+  very slow, if you happen to have a huge data structure whose string
+  representation is complex to compute. Your computer may appear to freeze for
+  a while with cpu usage at 100%. If this occurs, you can cancel the traceback
+  with Ctrl-C (maybe hitting it more than once).
+
+  If you encounter this kind of situation often, you may want to use the
+  Verbose_novars mode instead of the regular Verbose, which avoids formatting
+  variables (but otherwise includes the information and context given by
+  Verbose).
+
+.. note::
+
+  The verbose mode print all variables in the stack, which means it can
+  potentially leak sensitive information like access keys, or unencrypted
+  password.
+
+Installation instructions for VerboseTB::
+
+    import sys,ultratb
+    sys.excepthook = ultratb.VerboseTB()
+
+Note:  Much of the code in this module was lifted verbatim from the standard
+library module 'traceback.py' and Ka-Ping Yee's 'cgitb.py'.
+
+
+Inheritance diagram:
+
+.. inheritance-diagram:: IPython.core.ultratb
+   :parts: 3
+"""
+
+# *****************************************************************************
+# Copyright (C) 2001 Nathaniel Gray <[email protected]>
+# Copyright (C) 2001-2004 Fernando Perez <[email protected]>
+#
+# Distributed under the terms of the BSD License.  The full license is in
+# the file COPYING, distributed as part of this software.
+# *****************************************************************************
+
+import functools
+import inspect
+import linecache
+import sys
+import time
+import traceback
+import types
+import warnings
+from collections.abc import Sequence
+from types import TracebackType
+from typing import Any, Callable, List, Optional, Tuple
+
+import stack_data
+from pygments.formatters.terminal256 import Terminal256Formatter
+from pygments.token import Token
+
+from IPython import get_ipython
+from IPython.utils import path as util_path
+from IPython.utils import py3compat
+from IPython.utils.PyColorize import Parser, Theme, TokenStream, theme_table
+from IPython.utils.terminal import get_terminal_size
+
+from .display_trap import DisplayTrap
+from .doctb import DocTB
+from .tbtools import (
+    FrameInfo,
+    TBTools,
+    _format_traceback_lines,
+    _safe_string,
+    _simple_format_traceback_lines,
+    _tokens_filename,
+    eqrepr,
+    get_line_number_of_frame,
+    nullrepr,
+    text_repr,
+)
+
+# Globals
+# amount of space to put line numbers before verbose tracebacks
+INDENT_SIZE = 8
+
+# When files are too long do not use stackdata to get frames.
+# it is too long.
+FAST_THRESHOLD = 10_000
+
+# ---------------------------------------------------------------------------
+class ListTB(TBTools):
+    """Print traceback information from a traceback list, with optional color.
+
+    Calling requires 3 arguments: (etype, evalue, elist)
+    as would be obtained by::
+
+      etype, evalue, tb = sys.exc_info()
+      if tb:
+        elist = traceback.extract_tb(tb)
+      else:
+        elist = None
+
+    It can thus be used by programs which need to process the traceback before
+    printing (such as console replacements based on the code module from the
+    standard library).
+
+    Because they are meant to be called without a full traceback (only a
+    list), instances of this class can't call the interactive pdb debugger."""
+
+    def __call__(
+        self,
+        etype: type[BaseException],
+        evalue: BaseException | None,
+        etb: TracebackType | None,
+    ) -> None:
+        self.ostream.flush()
+        self.ostream.write(self.text(etype, evalue, etb))
+        self.ostream.write("\n")
+
+    def _extract_tb(self, tb: TracebackType | None) -> traceback.StackSummary | None:
+        if tb:
+            return traceback.extract_tb(tb)
+        else:
+            return None
+
+    def structured_traceback(
+        self,
+        etype: type,
+        evalue: Optional[BaseException],
+        etb: Optional[TracebackType] = None,
+        tb_offset: Optional[int] = None,
+        context: int = 5,
+    ) -> list[str]:
+        """Return a color formatted string with the traceback info.
+
+        Parameters
+        ----------
+        etype : exception type
+            Type of the exception raised.
+        evalue : object
+            Data stored in the exception
+        etb : list | TracebackType | None
+            If list: List of frames, see class docstring for details.
+            If Traceback: Traceback of the exception.
+        tb_offset : int, optional
+            Number of frames in the traceback to skip.  If not given, the
+            instance evalue is used (set in constructor).
+        context : int, optional
+            Number of lines of context information to print.
+
+        Returns
+        -------
+        String with formatted exception.
+        """
+        # This is a workaround to get chained_exc_ids in recursive calls
+        # etb should not be a tuple if structured_traceback is not recursive
+        if isinstance(etb, tuple):
+            etb, chained_exc_ids = etb
+        else:
+            chained_exc_ids = set()
+        elist: list[Any]
+        if isinstance(etb, list):
+            elist = etb
+        elif etb is not None:
+            elist = self._extract_tb(etb)  # type: ignore[assignment]
+        else:
+            elist = []
+        tb_offset = self.tb_offset if tb_offset is None else tb_offset
+        assert isinstance(tb_offset, int)
+        out_list: list[str] = []
+        if elist:
+            if tb_offset and len(elist) > tb_offset:
+                elist = elist[tb_offset:]
+
+            out_list.append(
+                theme_table[self._theme_name].format(
+                    [
+                        (Token, "Traceback"),
+                        (Token, " "),
+                        (Token.NormalEm, "(most recent call last)"),
+                        (Token, ":"),
+                        (Token, "\n"),
+                    ]
+                ),
+            )
+            out_list.extend(self._format_list(elist))
+        # The exception info should be a single entry in the list.
+        lines = "".join(self._format_exception_only(etype, evalue))
+        out_list.append(lines)
+
+        # Find chained exceptions if we have a traceback (not for exception-only mode)
+        if etb is not None:
+            exception = self.get_parts_of_chained_exception(evalue)
+
+            if exception and (id(exception[1]) not in chained_exc_ids):
+                chained_exception_message: list[str] = (
+                    self.prepare_chained_exception_message(evalue.__cause__)[0]
+                    if evalue is not None
+                    else [""]
+                )
+                etype, evalue, etb = exception
+                # Trace exception to avoid infinite 'cause' loop
+                chained_exc_ids.add(id(exception[1]))
+                chained_exceptions_tb_offset = 0
+                ol1 = self.structured_traceback(
+                    etype,
+                    evalue,
+                    (etb, chained_exc_ids),  # type: ignore[arg-type]
+                    chained_exceptions_tb_offset,
+                    context,
+                )
+                ol2 = chained_exception_message
+
+                out_list = ol1 + ol2 + out_list
+
+        return out_list
+
+    def _format_list(self, extracted_list: list[Any]) -> list[str]:
+        """Format a list of traceback entry tuples for printing.
+
+        Given a list of tuples as returned by extract_tb() or
+        extract_stack(), return a list of strings ready for printing.
+        Each string in the resulting list corresponds to the item with the
+        same index in the argument list.  Each string ends in a newline;
+        the strings may contain internal newlines as well, for those items
+        whose source text line is not None.
+
+        Lifted almost verbatim from traceback.py
+        """
+
+        output_list = []
+        for ind, (filename, lineno, name, line) in enumerate(extracted_list):
+            # Will emphasize the last entry
+            em = True if ind == len(extracted_list) - 1 else False
+
+            item = theme_table[self._theme_name].format(
+                [(Token.NormalEm if em else Token.Normal, "  ")]
+                + _tokens_filename(em, filename, lineno=lineno)
+            )
+
+            # This seem to be only in xmode plain (%run sinpleer), investigate why not share with verbose.
+            # look at _tokens_filename in forma_record.
+            if name != "<module>":
+                item += theme_table[self._theme_name].format(
+                    [
+                        (Token.NormalEm if em else Token.Normal, " in "),
+                        (Token.TB.NameEm if em else Token.TB.Name, name),
+                    ]
+                )
+            item += theme_table[self._theme_name].format(
+                [(Token.NormalEm if em else Token, "\n")]
+            )
+            if line:
+                item += theme_table[self._theme_name].format(
+                    [
+                        (Token.Line if em else Token, "    "),
+                        (Token.Line if em else Token, line.strip()),
+                        (Token, "\n"),
+                    ]
+                )
+            output_list.append(item)
+
+        return output_list
+
+    def _format_exception_only(
+        self, etype: type[BaseException], value: BaseException | None
+    ) -> list[str]:
+        """Format the exception part of a traceback.
+
+        The arguments are the exception type and value such as given by
+        sys.exc_info()[:2]. The return value is a list of strings, each ending
+        in a newline.  Normally, the list contains a single string; however,
+        for SyntaxError exceptions, it contains several lines that (when
+        printed) display detailed information about where the syntax error
+        occurred.  The message indicating which exception occurred is the
+        always last string in the list.
+
+        Also lifted nearly verbatim from traceback.py
+        """
+        have_filedata = False
+        output_list = []
+        stype_tokens = [(Token.ExcName, etype.__name__)]
+        stype: str = theme_table[self._theme_name].format(stype_tokens)
+        if value is None:
+            # Not sure if this can still happen in Python 2.6 and above
+            output_list.append(stype + "\n")
+        else:
+            if issubclass(etype, SyntaxError):
+                assert hasattr(value, "filename")
+                assert hasattr(value, "lineno")
+                assert hasattr(value, "text")
+                assert hasattr(value, "offset")
+                assert hasattr(value, "msg")
+                have_filedata = True
+                if not value.filename:
+                    value.filename = "<string>"
+                if value.lineno:
+                    lineno = value.lineno
+                    textline = linecache.getline(value.filename, value.lineno)
+                else:
+                    lineno = "unknown"
+                    textline = ""
+                output_list.append(
+                    theme_table[self._theme_name].format(
+                        [(Token, "  ")]
+                        + _tokens_filename(
+                            True,
+                            value.filename,
+                            lineno=(None if lineno == "unknown" else lineno),
+                        )
+                        + [(Token, "\n")]
+                    )
+                )
+                if textline == "":
+                    textline = py3compat.cast_unicode(value.text, "utf-8")
+
+                if textline is not None:
+                    i = 0
+                    while i < len(textline) and textline[i].isspace():
+                        i += 1
+                    output_list.append(
+                        theme_table[self._theme_name].format(
+                            [
+                                (Token.Line, "    "),
+                                (Token.Line, textline.strip()),
+                                (Token, "\n"),
+                            ]
+                        )
+                    )
+                    if value.offset is not None:
+                        s = "    "
+                        for c in textline[i : value.offset - 1]:
+                            if c.isspace():
+                                s += c
+                            else:
+                                s += " "
+                        output_list.append(
+                            theme_table[self._theme_name].format(
+                                [(Token.Caret, s + "^"), (Token, "\n")]
+                            )
+                        )
+
+            try:
+                assert hasattr(value, "msg")
+                s = value.msg
+            except Exception:
+                s = self._some_str(value)
+            if s:
+                output_list.append(
+                    theme_table[self._theme_name].format(
+                        stype_tokens
+                        + [
+                            (Token.ExcName, ":"),
+                            (Token, " "),
+                            (Token, s),
+                            (Token, "\n"),
+                        ]
+                    )
+                )
+            else:
+                output_list.append("%s\n" % stype)
+
+            # PEP-678 notes
+            output_list.extend(f"{x}\n" for x in getattr(value, "__notes__", []))
+
+        # sync with user hooks
+        if have_filedata:
+            ipinst = get_ipython()
+            if ipinst is not None:
+                assert value is not None
+                assert hasattr(value, "lineno")
+                assert hasattr(value, "filename")
+                ipinst.hooks.synchronize_with_editor(value.filename, value.lineno, 0)
+
+        return output_list
+
+    def get_exception_only(self, etype, value):
+        """Only print the exception type and message, without a traceback.
+
+        Parameters
+        ----------
+        etype : exception type
+        value : exception value
+        """
+        return ListTB.structured_traceback(self, etype, value)
+
+    def show_exception_only(
+        self, etype: BaseException | None, evalue: TracebackType | None
+    ) -> None:
+        """Only print the exception type and message, without a traceback.
+
+        Parameters
+        ----------
+        etype : exception type
+        evalue : exception value
+        """
+        # This method needs to use __call__ from *this* class, not the one from
+        # a subclass whose signature or behavior may be different
+        ostream = self.ostream
+        ostream.flush()
+        ostream.write("\n".join(self.get_exception_only(etype, evalue)))
+        ostream.flush()
+
+    def _some_str(self, value: Any) -> str:
+        # Lifted from traceback.py
+        try:
+            return py3compat.cast_unicode(str(value))
+        except:
+            return "<unprintable %s object>" % type(value).__name__
+
+
+_sentinel = object()
+_default = "default"
+
+
+# ----------------------------------------------------------------------------
+class VerboseTB(TBTools):
+    """A port of Ka-Ping Yee's cgitb.py module that outputs color text instead
+    of HTML.  Requires inspect and pydoc.  Crazy, man.
+
+    Modified version which optionally strips the topmost entries from the
+    traceback, to be used with alternate interpreters (because their own code
+    would appear in the traceback)."""
+
+    tb_highlight = "bg:ansiyellow"
+    tb_highlight_style = "default"
+
+    _mode: str
+
+    def __init__(
+        self,
+        # TODO: no default ?
+        theme_name: str = _default,
+        call_pdb: bool = False,
+        ostream: Any = None,
+        tb_offset: int = 0,
+        long_header: bool = False,
+        include_vars: bool = True,
+        check_cache: Callable[[], None] | None = None,
+        debugger_cls: type | None = None,
+        *,
+        color_scheme: Any = _sentinel,
+    ):
+        """Specify traceback offset, headers and color scheme.
+
+        Define how many frames to drop from the tracebacks. Calling it with
+        tb_offset=1 allows use of this handler in interpreters which will have
+        their own code at the top of the traceback (VerboseTB will first
+        remove that frame before printing the traceback info)."""
+        if color_scheme is not _sentinel:
+            assert isinstance(color_scheme, str)
+            theme_name = color_scheme.lower()
+
+            warnings.warn(
+                "color_scheme is deprecated as of IPython 9.0 and replaced by "
+                "theme_name (which should be lowercase). As you passed a "
+                "color_scheme value I will try to see if I have corresponding "
+                "theme.",
+                stacklevel=2,
+                category=DeprecationWarning,
+            )
+
+            if theme_name != _default:
+                warnings.warn(
+                    "You passed both `theme_name` and `color_scheme` "
+                    "(deprecated) to VerboseTB constructor. `theme_name` will "
+                    "be ignored for the time being.",
+                    stacklevel=2,
+                    category=DeprecationWarning,
+                )
+
+        if theme_name == _default:
+            theme_name = "linux"
+
+        assert isinstance(theme_name, str)
+        super().__init__(
+            theme_name=theme_name,
+            call_pdb=call_pdb,
+            ostream=ostream,
+            debugger_cls=debugger_cls,
+        )
+        self.tb_offset = tb_offset
+        self.long_header = long_header
+        self.include_vars = include_vars
+        # By default we use linecache.checkcache, but the user can provide a
+        # different check_cache implementation.  This was formerly used by the
+        # IPython kernel for interactive code, but is no longer necessary.
+        if check_cache is None:
+            check_cache = linecache.checkcache
+        self.check_cache = check_cache
+
+        self.skip_hidden = True
+
+    def format_record(self, frame_info: FrameInfo) -> str:
+        """Format a single stack frame"""
+        assert isinstance(frame_info, FrameInfo)
+
+        if isinstance(frame_info._sd, stack_data.RepeatedFrames):
+            return theme_table[self._theme_name].format(
+                [
+                    (Token, "    "),
+                    (
+                        Token.ExcName,
+                        "[... skipping similar frames: %s]" % frame_info.description,
+                    ),
+                    (Token, "\n"),
+                ]
+            )
+
+        indent: str = " " * INDENT_SIZE
+
+        assert isinstance(frame_info.lineno, int)
+        args, varargs, varkw, locals_ = inspect.getargvalues(frame_info.frame)
+        if frame_info.executing is not None:
+            func = frame_info.executing.code_qualname()
+        else:
+            func = "?"
+        if func == "<module>":
+            call = ""
+        else:
+            # Decide whether to include variable details or not
+            var_repr = eqrepr if self.include_vars else nullrepr
+            try:
+                scope = inspect.formatargvalues(
+                    args, varargs, varkw, locals_, formatvalue=var_repr
+                )
+                assert isinstance(scope, str)
+                call = theme_table[self._theme_name].format(
+                    [(Token, "in "), (Token.VName, func), (Token.ValEm, scope)]
+                )
+            except KeyError:
+                # This happens in situations like errors inside generator
+                # expressions, where local variables are listed in the
+                # line, but can't be extracted from the frame.  I'm not
+                # 100% sure this isn't actually a bug in inspect itself,
+                # but since there's no info for us to compute with, the
+                # best we can do is report the failure and move on.  Here
+                # we must *not* call any traceback construction again,
+                # because that would mess up use of %debug later on.  So we
+                # simply report the failure and move on.  The only
+                # limitation will be that this frame won't have locals
+                # listed in the call signature.  Quite subtle problem...
+                # I can't think of a good way to validate this in a unit
+                # test, but running a script consisting of:
+                #  dict( (k,v.strip()) for (k,v) in range(10) )
+                # will illustrate the error, if this exception catch is
+                # disabled.
+                call = theme_table[self._theme_name].format(
+                    [
+                        (Token, "in "),
+                        (Token.VName, func),
+                        (Token.ValEm, "(***failed resolving arguments***)"),
+                    ]
+                )
+
+        lvals_toks: list[TokenStream] = []
+        if self.include_vars:
+            try:
+                # we likely want to fix stackdata at some point, but
+                # still need a workaround.
+                fibp = frame_info.variables_in_executing_piece
+                for var in fibp:
+                    lvals_toks.append(
+                        [
+                            (Token, var.name),
+                            (Token, " "),
+                            (Token.ValEm, "= "),
+                            (Token.ValEm, repr(var.value)),
+                        ]
+                    )
+            except Exception:
+                lvals_toks.append(
+                    [
+                        (
+                            Token,
+                            "Exception trying to inspect frame. No more locals available.",
+                        ),
+                    ]
+                )
+
+        if frame_info._sd is None:
+            # fast fallback if file is too long
+            assert frame_info.filename is not None
+            level_tokens = [
+                (Token.FilenameEm, util_path.compress_user(frame_info.filename)),
+                (Token, " "),
+                (Token, call),
+                (Token, "\n"),
+            ]
+
+            _line_format = Parser(theme_name=self._theme_name).format2
+            assert isinstance(frame_info.code, types.CodeType)
+            first_line: int = frame_info.code.co_firstlineno
+            current_line: int = frame_info.lineno
+            raw_lines: list[str] = frame_info.raw_lines
+            index: int = current_line - first_line
+            assert frame_info.context is not None
+            if index >= frame_info.context:
+                start = max(index - frame_info.context, 0)
+                stop = index + frame_info.context
+                index = frame_info.context
+            else:
+                start = 0
+                stop = index + frame_info.context
+            raw_lines = raw_lines[start:stop]
+
+            # Jan 2025: may need _line_format(py3ompat.cast_unicode(s))
+            raw_color_err = [(s, _line_format(s, "str")) for s in raw_lines]
+
+            tb_tokens = _simple_format_traceback_lines(
+                current_line,
+                index,
+                raw_color_err,
+                lvals_toks,
+                theme=theme_table[self._theme_name],
+            )
+            _tb_lines: str = theme_table[self._theme_name].format(tb_tokens)
+
+            return theme_table[self._theme_name].format(level_tokens + tb_tokens)
+        else:
+            result = theme_table[self._theme_name].format(
+                _tokens_filename(True, frame_info.filename, lineno=frame_info.lineno)
+            )
+            result += ", " if call else ""
+            result += f"{call}\n"
+            result += theme_table[self._theme_name].format(
+                _format_traceback_lines(
+                    frame_info.lines,
+                    theme_table[self._theme_name],
+                    self.has_colors,
+                    lvals_toks,
+                )
+            )
+            return result
+
+    def prepare_header(self, etype: str, long_version: bool = False) -> str:
+        width = min(75, get_terminal_size()[0])
+        if long_version:
+            # Header with the exception type, python version, and date
+            pyver = "Python " + sys.version.split()[0] + ": " + sys.executable
+            date = time.ctime(time.time())
+            theme = theme_table[self._theme_name]
+            head = theme.format(
+                [
+                    (Token.Topline, theme.symbols["top_line"] * width),
+                    (Token, "\n"),
+                    (Token.ExcName, etype),
+                    (Token, " " * (width - len(etype) - len(pyver))),
+                    (Token, pyver),
+                    (Token, "\n"),
+                    (Token, date.rjust(width)),
+                ]
+            )
+            head += (
+                "\nA problem occurred executing Python code.  Here is the sequence of function"
+                "\ncalls leading up to the error, with the most recent (innermost) call last."
+            )
+        else:
+            # Simplified header
+            head = theme_table[self._theme_name].format(
+                [
+                    (Token.ExcName, etype),
+                    (
+                        Token,
+                        "Traceback (most recent call last)".rjust(width - len(etype)),
+                    ),
+                ]
+            )
+
+        return head
+
+    def format_exception(self, etype, evalue):
+        # Get (safely) a string form of the exception info
+        try:
+            etype_str, evalue_str = map(str, (etype, evalue))
+        except:
+            # User exception is improperly defined.
+            etype, evalue = str, sys.exc_info()[:2]
+            etype_str, evalue_str = map(str, (etype, evalue))
+
+        # PEP-678 notes
+        notes = getattr(evalue, "__notes__", [])
+        if not isinstance(notes, Sequence) or isinstance(notes, (str, bytes)):
+            notes = [_safe_string(notes, "__notes__", func=repr)]
+
+        # ... and format it
+        return [
+            theme_table[self._theme_name].format(
+                [(Token.ExcName, etype_str), (Token, ": "), (Token, evalue_str)]
+            ),
+            *(
+                theme_table[self._theme_name].format(
+                    [(Token, _safe_string(py3compat.cast_unicode(n), "note"))]
+                )
+                for n in notes
+            ),
+        ]
+
+    def format_exception_as_a_whole(
+        self,
+        etype: type,
+        evalue: Optional[BaseException],
+        etb: Optional[TracebackType],
+        context: int,
+        tb_offset: Optional[int],
+    ) -> list[list[str]]:
+        """Formats the header, traceback and exception message for a single exception.
+
+        This may be called multiple times by Python 3 exception chaining
+        (PEP 3134).
+        """
+        # some locals
+        orig_etype = etype
+        try:
+            etype = etype.__name__  # type: ignore[assignment]
+        except AttributeError:
+            pass
+
+        tb_offset = self.tb_offset if tb_offset is None else tb_offset
+        assert isinstance(tb_offset, int)
+        head = self.prepare_header(str(etype), self.long_header)
+        records = self.get_records(etb, context, tb_offset) if etb else []
+
+        frames = []
+        skipped = 0
+        lastrecord = len(records) - 1
+        for i, record in enumerate(records):
+            if (
+                not isinstance(record._sd, stack_data.RepeatedFrames)
+                and self.skip_hidden
+            ):
+                if (
+                    record.frame.f_locals.get("__tracebackhide__", 0)
+                    and i != lastrecord
+                ):
+                    skipped += 1
+                    continue
+            if skipped:
+                frames.append(
+                    theme_table[self._theme_name].format(
+                        [
+                            (Token, "    "),
+                            (Token.ExcName, "[... skipping hidden %s frame]" % skipped),
+                            (Token, "\n"),
+                        ]
+                    )
+                )
+                skipped = 0
+            frames.append(self.format_record(record))
+        if skipped:
+            frames.append(
+                theme_table[self._theme_name].format(
+                    [
+                        (Token, "    "),
+                        (Token.ExcName, "[... skipping hidden %s frame]" % skipped),
+                        (Token, "\n"),
+                    ]
+                )
+            )
+
+        formatted_exception = self.format_exception(etype, evalue)
+        if records:
+            frame_info = records[-1]
+            ipinst = get_ipython()
+            if ipinst is not None:
+                ipinst.hooks.synchronize_with_editor(
+                    frame_info.filename, frame_info.lineno, 0
+                )
+
+        return [[head] + frames + formatted_exception]
+
+    def get_records(self, etb: TracebackType, context: int, tb_offset: int) -> Any:
+        assert etb is not None
+        context = context - 1
+        after = context // 2
+        before = context - after
+        if self.has_colors:
+            base_style = theme_table[self._theme_name].as_pygments_style()
+            style = stack_data.style_with_executing_node(base_style, self.tb_highlight)
+            formatter = Terminal256Formatter(style=style)
+        else:
+            formatter = None
+        options = stack_data.Options(
+            before=before,
+            after=after,
+            pygments_formatter=formatter,
+        )
+
+        # Let's estimate the amount of code we will have to parse/highlight.
+        cf: Optional[TracebackType] = etb
+        max_len = 0
+        tbs = []
+        while cf is not None:
+            try:
+                mod = inspect.getmodule(cf.tb_frame)
+                if mod is not None:
+                    mod_name = mod.__name__
+                    root_name, *_ = mod_name.split(".")
+                    if root_name == "IPython":
+                        cf = cf.tb_next
+                        continue
+                max_len = get_line_number_of_frame(cf.tb_frame)
+
+            except OSError:
+                max_len = 0
+            max_len = max(max_len, max_len)
+            tbs.append(cf)
+            cf = getattr(cf, "tb_next", None)
+
+        if max_len > FAST_THRESHOLD:
+            FIs: list[FrameInfo] = []
+            for tb in tbs:
+                frame = tb.tb_frame  # type: ignore[union-attr]
+                lineno = frame.f_lineno
+                code = frame.f_code
+                filename = code.co_filename
+                # TODO: Here we need to use before/after/
+                FIs.append(
+                    FrameInfo(
+                        "Raw frame", filename, lineno, frame, code, context=context
+                    )
+                )
+            return FIs
+        res = list(stack_data.FrameInfo.stack_data(etb, options=options))[tb_offset:]
+        res2 = [FrameInfo._from_stack_data_FrameInfo(r) for r in res]
+        return res2
+
+    def structured_traceback(
+        self,
+        etype: type,
+        evalue: Optional[BaseException],
+        etb: Optional[TracebackType] = None,
+        tb_offset: Optional[int] = None,
+        context: int = 5,
+    ) -> list[str]:
+        """Return a nice text document describing the traceback."""
+        formatted_exceptions: list[list[str]] = self.format_exception_as_a_whole(
+            etype, evalue, etb, context, tb_offset
+        )
+
+        termsize = min(75, get_terminal_size()[0])
+        theme = theme_table[self._theme_name]
+        head: str = theme.format(
+            [
+                (
+                    Token.Topline,
+                    theme.symbols["top_line"] * termsize,
+                ),
+            ]
+        )
+        structured_traceback_parts: list[str] = [head]
+        chained_exceptions_tb_offset = 0
+        lines_of_context = 3
+        exception = self.get_parts_of_chained_exception(evalue)
+        if exception:
+            assert evalue is not None
+            formatted_exceptions += self.prepare_chained_exception_message(
+                evalue.__cause__
+            )
+            etype, evalue, etb = exception
+        else:
+            evalue = None
+        chained_exc_ids = set()
+        while evalue:
+            formatted_exceptions += self.format_exception_as_a_whole(
+                etype, evalue, etb, lines_of_context, chained_exceptions_tb_offset
+            )
+            exception = self.get_parts_of_chained_exception(evalue)
+
+            if exception and id(exception[1]) not in chained_exc_ids:
+                chained_exc_ids.add(
+                    id(exception[1])
+                )  # trace exception to avoid infinite 'cause' loop
+                formatted_exceptions += self.prepare_chained_exception_message(
+                    evalue.__cause__
+                )
+                etype, evalue, etb = exception
+            else:
+                evalue = None
+
+        # we want to see exceptions in a reversed order:
+        # the first exception should be on top
+        for fx in reversed(formatted_exceptions):
+            structured_traceback_parts += fx
+
+        return structured_traceback_parts
+
+    def debugger(self, force: bool = False) -> None:
+        """Call up the pdb debugger if desired, always clean up the tb
+        reference.
+
+        Keywords:
+
+          - force(False): by default, this routine checks the instance call_pdb
+            flag and does not actually invoke the debugger if the flag is false.
+            The 'force' option forces the debugger to activate even if the flag
+            is false.
+
+        If the call_pdb flag is set, the pdb interactive debugger is
+        invoked. In all cases, the self.tb reference to the current traceback
+        is deleted to prevent lingering references which hamper memory
+        management.
+
+        Note that each call to pdb() does an 'import readline', so if your app
+        requires a special setup for the readline completers, you'll have to
+        fix that by hand after invoking the exception handler."""
+
+        if force or self.call_pdb:
+            if self.pdb is None:
+                self.pdb = self.debugger_cls()
+            # the system displayhook may have changed, restore the original
+            # for pdb
+            display_trap = DisplayTrap(hook=sys.__displayhook__)
+            with display_trap:
+                self.pdb.reset()
+                # Find the right frame so we don't pop up inside ipython itself
+                if hasattr(self, "tb") and self.tb is not None:  # type: ignore[has-type]
+                    etb = self.tb  # type: ignore[has-type]
+                else:
+                    etb = self.tb = sys.last_traceback
+                while self.tb is not None and self.tb.tb_next is not None:
+                    assert self.tb.tb_next is not None
+                    self.tb = self.tb.tb_next
+                if etb and etb.tb_next:
+                    etb = etb.tb_next
+                self.pdb.botframe = etb.tb_frame
+                # last_value should be deprecated, but last-exc sometimme not set
+                # please check why later and remove the getattr.
+                exc = (
+                    sys.last_value
+                    if sys.version_info < (3, 12)
+                    else getattr(sys, "last_exc", sys.last_value)
+                )  # type: ignore[attr-defined]
+                if exc:
+                    self.pdb.interaction(None, exc)
+                else:
+                    self.pdb.interaction(None, etb)
+
+        if hasattr(self, "tb"):
+            del self.tb
+
+    def handler(self, info=None):
+        (etype, evalue, etb) = info or sys.exc_info()
+        self.tb = etb
+        ostream = self.ostream
+        ostream.flush()
+        ostream.write(self.text(etype, evalue, etb))  # type:ignore[arg-type]
+        ostream.write("\n")
+        ostream.flush()
+
+    # Changed so an instance can just be called as VerboseTB_inst() and print
+    # out the right info on its own.
+    def __call__(self, etype=None, evalue=None, etb=None):
+        """This hook can replace sys.excepthook (for Python 2.1 or higher)."""
+        if etb is None:
+            self.handler()
+        else:
+            self.handler((etype, evalue, etb))
+        try:
+            self.debugger()
+        except KeyboardInterrupt:
+            print("\nKeyboardInterrupt")
+
+
+# ----------------------------------------------------------------------------
+class FormattedTB(VerboseTB, ListTB):
+    """Subclass ListTB but allow calling with a traceback.
+
+    It can thus be used as a sys.excepthook for Python > 2.1.
+
+    Also adds 'Context' and 'Verbose' modes, not available in ListTB.
+
+    Allows a tb_offset to be specified. This is useful for situations where
+    one needs to remove a number of topmost frames from the traceback (such as
+    occurs with python programs that themselves execute other python code,
+    like Python shells)."""
+
+    mode: str
+
+    def __init__(
+        self,
+        mode="Plain",
+        # TODO: no default
+        theme_name="linux",
+        call_pdb=False,
+        ostream=None,
+        tb_offset=0,
+        long_header=False,
+        include_vars=False,
+        check_cache=None,
+        debugger_cls=None,
+    ):
+        # NEVER change the order of this list. Put new modes at the end:
+        self.valid_modes = ["Plain", "Context", "Verbose", "Minimal", "Docs"]
+        self.verbose_modes = self.valid_modes[1:3]
+
+        VerboseTB.__init__(
+            self,
+            theme_name=theme_name,
+            call_pdb=call_pdb,
+            ostream=ostream,
+            tb_offset=tb_offset,
+            long_header=long_header,
+            include_vars=include_vars,
+            check_cache=check_cache,
+            debugger_cls=debugger_cls,
+        )
+
+        # Different types of tracebacks are joined with different separators to
+        # form a single string.  They are taken from this dict
+        self._join_chars = dict(
+            Plain="", Context="\n", Verbose="\n", Minimal="", Docs=""
+        )
+        # set_mode also sets the tb_join_char attribute
+        self.set_mode(mode)
+
+    def structured_traceback(
+        self,
+        etype: type,
+        evalue: BaseException | None,
+        etb: TracebackType | None = None,
+        tb_offset: int | None = None,
+        context: int = 5,
+    ) -> list[str]:
+        tb_offset = self.tb_offset if tb_offset is None else tb_offset
+        mode = self.mode
+        if mode in self.verbose_modes:
+            # Verbose modes need a full traceback
+            return VerboseTB.structured_traceback(
+                self, etype, evalue, etb, tb_offset, context
+            )
+        elif mode == "Docs":
+            # return DocTB
+            return DocTB(
+                theme_name=self._theme_name,
+                call_pdb=self.call_pdb,
+                ostream=self.ostream,
+                tb_offset=tb_offset,
+                long_header=self.long_header,
+                include_vars=self.include_vars,
+                check_cache=self.check_cache,
+                debugger_cls=self.debugger_cls,
+            ).structured_traceback(
+                etype, evalue, etb, tb_offset, 1
+            )  # type: ignore[arg-type]
+
+        elif mode == "Minimal":
+            return ListTB.get_exception_only(self, etype, evalue)
+        else:
+            # We must check the source cache because otherwise we can print
+            # out-of-date source code.
+            self.check_cache()
+            # Now we can extract and format the exception
+            return ListTB.structured_traceback(
+                self, etype, evalue, etb, tb_offset, context
+            )
+
+    def stb2text(self, stb: list[str]) -> str:
+        """Convert a structured traceback (a list) to a string."""
+        return self.tb_join_char.join(stb)
+
+    def set_mode(self, mode: Optional[str] = None) -> None:
+        """Switch to the desired mode.
+
+        If mode is not specified, cycles through the available modes."""
+
+        if not mode:
+            new_idx = (self.valid_modes.index(self.mode) + 1) % len(self.valid_modes)
+            self.mode = self.valid_modes[new_idx]
+        elif mode not in self.valid_modes:
+            raise ValueError(
+                "Unrecognized mode in FormattedTB: <" + mode + ">\n"
+                "Valid modes: " + str(self.valid_modes)
+            )
+        else:
+            assert isinstance(mode, str)
+            self.mode = mode
+        # include variable details only in 'Verbose' mode
+        self.include_vars = self.mode == self.valid_modes[2]
+        # Set the join character for generating text tracebacks
+        self.tb_join_char = self._join_chars[self.mode]
+
+    # some convenient shortcuts
+    def plain(self) -> None:
+        self.set_mode(self.valid_modes[0])
+
+    def context(self) -> None:
+        self.set_mode(self.valid_modes[1])
+
+    def verbose(self) -> None:
+        self.set_mode(self.valid_modes[2])
+
+    def minimal(self) -> None:
+        self.set_mode(self.valid_modes[3])
+
+
+# ----------------------------------------------------------------------------
+class AutoFormattedTB(FormattedTB):
+    """A traceback printer which can be called on the fly.
+
+    It will find out about exceptions by itself.
+
+    A brief example::
+
+        AutoTB = AutoFormattedTB(mode = 'Verbose', theme_name='linux')
+        try:
+          ...
+        except:
+          AutoTB()  # or AutoTB(out=logfile) where logfile is an open file object
+    """
+
+    def __call__(
+        self,
+        etype: type | None = None,
+        evalue: BaseException | None = None,
+        etb: TracebackType | None = None,
+        out: Any = None,
+        tb_offset: int | None = None,
+    ) -> None:
+        """Print out a formatted exception traceback.
+
+        Optional arguments:
+          - out: an open file-like object to direct output to.
+
+          - tb_offset: the number of frames to skip over in the stack, on a
+          per-call basis (this overrides temporarily the instance's tb_offset
+          given at initialization time."""
+
+        if out is None:
+            out = self.ostream
+        out.flush()
+        out.write(self.text(etype, evalue, etb, tb_offset))  # type:ignore[arg-type]
+        out.write("\n")
+        out.flush()
+        # FIXME: we should remove the auto pdb behavior from here and leave
+        # that to the clients.
+        try:
+            self.debugger()
+        except KeyboardInterrupt:
+            print("\nKeyboardInterrupt")
+
+    def structured_traceback(
+        self,
+        etype: type,
+        evalue: Optional[BaseException],
+        etb: Optional[TracebackType] = None,
+        tb_offset: Optional[int] = None,
+        context: int = 5,
+    ) -> list[str]:
+        # tb: TracebackType or tupleof tb types ?
+        if etype is None:
+            etype, evalue, etb = sys.exc_info()
+        if isinstance(etb, tuple):
+            # tb is a tuple if this is a chained exception.
+            self.tb = etb[0]
+        else:
+            self.tb = etb
+        return FormattedTB.structured_traceback(
+            self, etype, evalue, etb, tb_offset, context
+        )
+
+
+# ---------------------------------------------------------------------------
+
+
+# A simple class to preserve Nathan's original functionality.
+class ColorTB(FormattedTB):
+    """Deprecated since IPython 9.0."""
+
+    def __init__(self, *args, **kwargs):
+        warnings.warn(
+            "Deprecated since IPython 9.0 use FormattedTB directly ColorTB is just an alias",
+            DeprecationWarning,
+            stacklevel=2,
+        )
+
+        super().__init__(*args, **kwargs)
+
+
+class SyntaxTB(ListTB):
+    """Extension which holds some state: the last exception value"""
+
+    last_syntax_error: BaseException | None
+
+    def __init__(self, *, theme_name):
+        super().__init__(theme_name=theme_name)
+        self.last_syntax_error = None
+
+    def __call__(self, etype, value, elist):
+        self.last_syntax_error = value
+
+        super().__call__(etype, value, elist)
+
+    def structured_traceback(
+        self,
+        etype: type,
+        evalue: BaseException | None,
+        etb: TracebackType | None = None,
+        tb_offset: int | None = None,
+        context: int = 5,
+    ) -> list[str]:
+        value = evalue
+        # If the source file has been edited, the line in the syntax error can
+        # be wrong (retrieved from an outdated cache). This replaces it with
+        # the current value.
+        if (
+            isinstance(value, SyntaxError)
+            and isinstance(value.filename, str)
+            and isinstance(value.lineno, int)
+        ):
+            linecache.checkcache(value.filename)
+            newtext = linecache.getline(value.filename, value.lineno)
+            if newtext:
+                value.text = newtext
+        self.last_syntax_error = value
+        return super(SyntaxTB, self).structured_traceback(
+            etype, value, etb, tb_offset=tb_offset, context=context
+        )
+
+    def clear_err_state(self) -> Any | None:
+        """Return the current error state and clear it"""
+        e = self.last_syntax_error
+        self.last_syntax_error = None
+        return e
+
+    def stb2text(self, stb: list[str]) -> str:
+        """Convert a structured traceback (a list) to a string."""
+        return "".join(stb)

temp_venv/lib/python3.13/site-packages/IPython/core/usage.py

@@ -0,0 +1,341 @@
+# -*- coding: utf-8 -*-
+"""Usage information for the main IPython applications.
+"""
+#-----------------------------------------------------------------------------
+#  Copyright (C) 2008-2011  The IPython Development Team
+#  Copyright (C) 2001-2007 Fernando Perez. <[email protected]>
+#
+#  Distributed under the terms of the BSD License.  The full license is in
+#  the file COPYING, distributed as part of this software.
+#-----------------------------------------------------------------------------
+
+import sys
+from IPython.core import release
+
+cl_usage = """\
+=========
+ IPython
+=========
+
+Tools for Interactive Computing in Python
+=========================================
+
+    A Python shell with automatic history (input and output), dynamic object
+    introspection, easier configuration, command completion, access to the
+    system shell and more.  IPython can also be embedded in running programs.
+
+
+Usage
+
+    ipython [subcommand] [options] [-c cmd | -m mod | file] [--] [arg] ...
+
+    If invoked with no options, it executes the file and exits, passing the
+    remaining arguments to the script, just as if you had specified the same
+    command with python. You may need to specify `--` before args to be passed
+    to the script, to prevent IPython from attempting to parse them. If you
+    specify the option `-i` before the filename, it will enter an interactive
+    IPython session after running the script, rather than exiting. Files ending
+    in .py will be treated as normal Python, but files ending in .ipy can
+    contain special IPython syntax (magic commands, shell expansions, etc.).
+
+    Almost all configuration in IPython is available via the command-line. Do
+    `ipython --help-all` to see all available options.  For persistent
+    configuration, look into your `ipython_config.py` configuration file for
+    details.
+
+    This file is typically installed in the `IPYTHONDIR` directory, and there
+    is a separate configuration directory for each profile. The default profile
+    directory will be located in $IPYTHONDIR/profile_default. IPYTHONDIR
+    defaults to to `$HOME/.ipython`.  For Windows users, $HOME resolves to
+    C:\\Users\\YourUserName in most instances.
+
+    To initialize a profile with the default configuration file, do::
+
+      $> ipython profile create
+
+    and start editing `IPYTHONDIR/profile_default/ipython_config.py`
+
+    In IPython's documentation, we will refer to this directory as
+    `IPYTHONDIR`, you can change its default location by creating an
+    environment variable with this name and setting it to the desired path.
+
+    For more information, see the manual available in HTML and PDF in your
+    installation, or online at https://ipython.org/documentation.html.
+"""
+
+interactive_usage = """
+IPython -- An enhanced Interactive Python
+=========================================
+
+IPython offers a fully compatible replacement for the standard Python
+interpreter, with convenient shell features, special commands, command
+history mechanism and output results caching.
+
+At your system command line, type 'ipython -h' to see the command line
+options available. This document only describes interactive features.
+
+GETTING HELP
+------------
+
+Within IPython you have various way to access help:
+
+  ?         -> Introduction and overview of IPython's features (this screen).
+  object?   -> Details about 'object'.
+  object??  -> More detailed, verbose information about 'object'.
+  %quickref -> Quick reference of all IPython specific syntax and magics.
+  help      -> Access Python's own help system.
+
+If you are in terminal IPython you can quit this screen by pressing `q`.
+
+
+MAIN FEATURES
+-------------
+
+* Access to the standard Python help with object docstrings and the Python
+  manuals. Simply type 'help' (no quotes) to invoke it.
+
+* Magic commands: type %magic for information on the magic subsystem.
+
+* System command aliases, via the %alias command or the configuration file(s).
+
+* Dynamic object information:
+
+  Typing ?word or word? prints detailed information about an object. Certain
+  long strings (code, etc.) get snipped in the center for brevity.
+
+  Typing ??word or word?? gives access to the full information without
+  snipping long strings. Strings that are longer than the screen are printed
+  through the less pager.
+
+  The ?/?? system gives access to the full source code for any object (if
+  available), shows function prototypes and other useful information.
+
+  If you just want to see an object's docstring, type '%pdoc object' (without
+  quotes, and without % if you have automagic on).
+
+* Tab completion in the local namespace:
+
+  At any time, hitting tab will complete any available python commands or
+  variable names, and show you a list of the possible completions if there's
+  no unambiguous one. It will also complete filenames in the current directory.
+
+* Search previous command history in multiple ways:
+
+  - Start typing, and then use arrow keys up/down or (Ctrl-p/Ctrl-n) to search
+    through the history items that match what you've typed so far.
+
+  - Hit Ctrl-r: opens a search prompt. Begin typing and the system searches
+    your history for lines that match what you've typed so far, completing as
+    much as it can.
+
+  - %hist: search history by index.
+
+* Persistent command history across sessions.
+
+* Logging of input with the ability to save and restore a working session.
+
+* System shell with !. Typing !ls will run 'ls' in the current directory.
+
+* The reload command does a 'deep' reload of a module: changes made to the
+  module since you imported will actually be available without having to exit.
+
+* Verbose and colored exception traceback printouts. See the magic xmode and
+  xcolor functions for details (just type %magic).
+
+* Input caching system:
+
+  IPython offers numbered prompts (In/Out) with input and output caching. All
+  input is saved and can be retrieved as variables (besides the usual arrow
+  key recall).
+
+  The following GLOBAL variables always exist (so don't overwrite them!):
+  _i: stores previous input.
+  _ii: next previous.
+  _iii: next-next previous.
+  _ih : a list of all input _ih[n] is the input from line n.
+
+  Additionally, global variables named _i<n> are dynamically created (<n>
+  being the prompt counter), such that _i<n> == _ih[<n>]
+
+  For example, what you typed at prompt 14 is available as _i14 and _ih[14].
+
+  You can create macros which contain multiple input lines from this history,
+  for later re-execution, with the %macro function.
+
+  The history function %hist allows you to see any part of your input history
+  by printing a range of the _i variables. Note that inputs which contain
+  magic functions (%) appear in the history with a prepended comment. This is
+  because they aren't really valid Python code, so you can't exec them.
+
+* Output caching system:
+
+  For output that is returned from actions, a system similar to the input
+  cache exists but using _ instead of _i. Only actions that produce a result
+  (NOT assignments, for example) are cached. If you are familiar with
+  Mathematica, IPython's _ variables behave exactly like Mathematica's %
+  variables.
+
+  The following GLOBAL variables always exist (so don't overwrite them!):
+  _ (one underscore): previous output.
+  __ (two underscores): next previous.
+  ___ (three underscores): next-next previous.
+
+  Global variables named _<n> are dynamically created (<n> being the prompt
+  counter), such that the result of output <n> is always available as _<n>.
+
+  Finally, a global dictionary named _oh exists with entries for all lines
+  which generated output.
+
+* Directory history:
+
+  Your history of visited directories is kept in the global list _dh, and the
+  magic %cd command can be used to go to any entry in that list.
+
+* Auto-parentheses and auto-quotes (adapted from Nathan Gray's LazyPython)
+
+  1. Auto-parentheses
+        
+     Callable objects (i.e. functions, methods, etc) can be invoked like
+     this (notice the commas between the arguments)::
+       
+         In [1]: callable_ob arg1, arg2, arg3
+       
+     and the input will be translated to this::
+       
+         callable_ob(arg1, arg2, arg3)
+       
+     This feature is off by default (in rare cases it can produce
+     undesirable side-effects), but you can activate it at the command-line
+     by starting IPython with `--autocall 1`, set it permanently in your
+     configuration file, or turn on at runtime with `%autocall 1`.
+
+     You can force auto-parentheses by using '/' as the first character
+     of a line.  For example::
+       
+          In [1]: /globals             # becomes 'globals()'
+       
+     Note that the '/' MUST be the first character on the line!  This
+     won't work::
+       
+          In [2]: print /globals    # syntax error
+
+     In most cases the automatic algorithm should work, so you should
+     rarely need to explicitly invoke /. One notable exception is if you
+     are trying to call a function with a list of tuples as arguments (the
+     parenthesis will confuse IPython)::
+       
+          In [1]: zip (1,2,3),(4,5,6)  # won't work
+       
+     but this will work::
+       
+          In [2]: /zip (1,2,3),(4,5,6)
+          ------> zip ((1,2,3),(4,5,6))
+          Out[2]= [(1, 4), (2, 5), (3, 6)]
+
+     IPython tells you that it has altered your command line by
+     displaying the new command line preceded by -->.  e.g.::
+       
+          In [18]: callable list
+          -------> callable (list)
+
+  2. Auto-Quoting
+    
+     You can force auto-quoting of a function's arguments by using ',' as
+     the first character of a line.  For example::
+       
+          In [1]: ,my_function /home/me   # becomes my_function("/home/me")
+
+     If you use ';' instead, the whole argument is quoted as a single
+     string (while ',' splits on whitespace)::
+       
+          In [2]: ,my_function a b c   # becomes my_function("a","b","c")
+          In [3]: ;my_function a b c   # becomes my_function("a b c")
+
+     Note that the ',' MUST be the first character on the line!  This
+     won't work::
+       
+          In [4]: x = ,my_function /home/me    # syntax error
+"""
+
+interactive_usage_min =  """\
+An enhanced console for Python.
+Some of its features are:
+- Tab completion in the local namespace.
+- Logging of input, see command-line options.
+- System shell escape via ! , eg !ls.
+- Magic commands, starting with a % (like %ls, %pwd, %cd, etc.)
+- Keeps track of locally defined variables via %who, %whos.
+- Show object information with a ? eg ?x or x? (use ?? for more info).
+"""
+
+quick_reference = r"""
+IPython -- An enhanced Interactive Python - Quick Reference Card
+================================================================
+
+obj?, obj??      : Get help, or more help for object (also works as
+                   ?obj, ??obj).
+?foo.*abc*       : List names in 'foo' containing 'abc' in them.
+%magic           : Information about IPython's 'magic' % functions.
+
+Magic functions are prefixed by % or %%, and typically take their arguments
+without parentheses, quotes or even commas for convenience.  Line magics take a
+single % and cell magics are prefixed with two %%.
+
+Example magic function calls:
+
+%alias d ls -F   : 'd' is now an alias for 'ls -F'
+alias d ls -F    : Works if 'alias' not a python name
+alist = %alias   : Get list of aliases to 'alist'
+cd /usr/share    : Obvious. cd -<tab> to choose from visited dirs.
+%cd??            : See help AND source for magic %cd
+%timeit x=10     : time the 'x=10' statement with high precision.
+%%timeit x=2**100
+x**100           : time 'x**100' with a setup of 'x=2**100'; setup code is not
+                   counted.  This is an example of a cell magic.
+
+System commands:
+
+!cp a.txt b/     : System command escape, calls os.system()
+cp a.txt b/      : after %rehashx, most system commands work without !
+cp ${f}.txt $bar : Variable expansion in magics and system commands
+files = !ls /usr : Capture system command output
+files.s, files.l, files.n: "a b c", ['a','b','c'], 'a\nb\nc'
+
+History:
+
+_i, _ii, _iii    : Previous, next previous, next next previous input
+_i4, _ih[2:5]    : Input history line 4, lines 2-4
+exec(_i81)       : Execute input history line #81 again
+%rep 81          : Edit input history line #81
+_, __, ___       : previous, next previous, next next previous output
+_dh              : Directory history
+_oh              : Output history
+%hist            : Command history of current session.
+%hist -g foo     : Search command history of (almost) all sessions for 'foo'.
+%hist -g         : Command history of (almost) all sessions.
+%hist 1/2-8      : Command history containing lines 2-8 of session 1.
+%hist 1/ ~2/     : Command history of session 1 and 2 sessions before current.
+%hist ~8/1-~6/5  : Command history from line 1 of 8 sessions ago to
+                   line 5 of 6 sessions ago.
+%edit 0/         : Open editor to execute code with history of current session.
+
+Autocall:
+
+f 1,2            : f(1,2)  # Off by default, enable with %autocall magic.
+/f 1,2           : f(1,2) (forced autoparen)
+,f 1 2           : f("1","2")
+;f 1 2           : f("1 2")
+
+Remember: TAB completion works in many contexts, not just file names
+or python names.
+
+The following magic functions are currently available:
+
+"""
+
+default_banner_parts = ["Python %s\n"%sys.version.split("\n")[0],
+    "Type 'copyright', 'credits' or 'license' for more information\n" ,
+    "IPython {version} -- An enhanced Interactive Python. Type '?' for help.\n".format(version=release.version),
+]
+
+default_banner = ''.join(default_banner_parts)

temp_venv/lib/python3.13/site-packages/IPython/sphinxext/custom_doctests.py

@@ -0,0 +1,155 @@
+"""
+Handlers for IPythonDirective's @doctest pseudo-decorator.
+
+The Sphinx extension that provides support for embedded IPython code provides
+a pseudo-decorator @doctest, which treats the input/output block as a
+doctest, raising a RuntimeError during doc generation if the actual output
+(after running the input) does not match the expected output.
+
+An example usage is:
+
+.. code-block:: rst
+
+   .. ipython::
+
+        In [1]: x = 1
+
+        @doctest
+        In [2]: x + 2
+        Out[3]: 3
+
+One can also provide arguments to the decorator. The first argument should be
+the name of a custom handler. The specification of any other arguments is
+determined by the handler. For example,
+
+.. code-block:: rst
+
+      .. ipython::
+
+         @doctest float
+         In [154]: 0.1 + 0.2
+         Out[154]: 0.3
+
+allows the actual output ``0.30000000000000004`` to match the expected output
+due to a comparison with `np.allclose`.
+
+This module contains handlers for the @doctest pseudo-decorator. Handlers
+should have the following function signature::
+
+    handler(sphinx_shell, args, input_lines, found, submitted)
+
+where `sphinx_shell` is the embedded Sphinx shell, `args` contains the list
+of arguments that follow: '@doctest handler_name', `input_lines` contains
+a list of the lines relevant to the current doctest, `found` is a string
+containing the output from the IPython shell, and `submitted` is a string
+containing the expected output from the IPython shell.
+
+Handlers must be registered in the `doctests` dict at the end of this module.
+
+"""
+
+def str_to_array(s):
+    """
+    Simplistic converter of strings from repr to float NumPy arrays.
+
+    If the repr representation has ellipsis in it, then this will fail.
+
+    Parameters
+    ----------
+    s : str
+        The repr version of a NumPy array.
+
+    Examples
+    --------
+    >>> s = "array([ 0.3,  inf,  nan])"
+    >>> a = str_to_array(s)
+
+    """
+    import numpy as np
+
+    # Need to make sure eval() knows about inf and nan.
+    # This also assumes default printoptions for NumPy.
+    from numpy import inf, nan
+
+    if s.startswith(u'array'):
+        # Remove array( and )
+        s = s[6:-1]
+
+    if s.startswith(u'['):
+        a = np.array(eval(s), dtype=float)
+    else:
+        # Assume its a regular float. Force 1D so we can index into it.
+        a = np.atleast_1d(float(s))
+    return a
+
+def float_doctest(sphinx_shell, args, input_lines, found, submitted):
+    """
+    Doctest which allow the submitted output to vary slightly from the input.
+
+    Here is how it might appear in an rst file:
+
+    .. code-block:: rst
+
+       .. ipython::
+
+          @doctest float
+          In [1]: 0.1 + 0.2
+          Out[1]: 0.3
+
+    """
+    import numpy as np
+
+    if len(args) == 2:
+        rtol = 1e-05
+        atol = 1e-08
+    else:
+        # Both must be specified if any are specified.
+        try:
+            rtol = float(args[2])
+            atol = float(args[3])
+        except IndexError:
+            e = ("Both `rtol` and `atol` must be specified "
+                 "if either are specified: {0}".format(args))
+            raise IndexError(e) from e
+
+    try:
+        submitted = str_to_array(submitted)
+        found = str_to_array(found)
+    except:
+        # For example, if the array is huge and there are ellipsis in it.
+        error = True
+    else:
+        found_isnan = np.isnan(found)
+        submitted_isnan = np.isnan(submitted)
+        error = not np.allclose(found_isnan, submitted_isnan)
+        error |= not np.allclose(found[~found_isnan],
+                                 submitted[~submitted_isnan],
+                                 rtol=rtol, atol=atol)
+
+    TAB = ' ' * 4
+    directive = sphinx_shell.directive
+    if directive is None:
+        source = 'Unavailable'
+        content = 'Unavailable'
+    else:
+        source = directive.state.document.current_source
+        # Add tabs and make into a single string.
+        content = '\n'.join([TAB + line for line in directive.content])
+
+    if error:
+
+        e = ('doctest float comparison failure\n\n'
+             'Document source: {0}\n\n'
+             'Raw content: \n{1}\n\n'
+             'On input line(s):\n{TAB}{2}\n\n'
+             'we found output:\n{TAB}{3}\n\n'
+             'instead of the expected:\n{TAB}{4}\n\n')
+        e = e.format(source, content, '\n'.join(input_lines), repr(found),
+                     repr(submitted), TAB=TAB)
+        raise RuntimeError(e)
+
+# dict of allowable doctest handlers. The key represents the first argument
+# that must be given to @doctest in order to activate the handler.
+doctests = {
+    'float': float_doctest,
+}

temp_venv/lib/python3.13/site-packages/IPython/sphinxext/ipython_console_highlighting.py

@@ -0,0 +1,28 @@
+"""
+reST directive for syntax-highlighting ipython interactive sessions.
+
+"""
+
+from sphinx import highlighting
+from ipython_pygments_lexers import IPyLexer
+
+
+def setup(app):
+    """Setup as a sphinx extension."""
+
+    # This is only a lexer, so adding it below to pygments appears sufficient.
+    # But if somebody knows what the right API usage should be to do that via
+    # sphinx, by all means fix it here.  At least having this setup.py
+    # suppresses the sphinx warning we'd get without it.
+    metadata = {"parallel_read_safe": True, "parallel_write_safe": True}
+    return metadata
+
+
+# Register the extension as a valid pygments lexer.
+# Alternatively, we could register the lexer with pygments instead. This would
+# require using setuptools entrypoints: http://pygments.org/docs/plugins
+
+ipy3 = IPyLexer()
+
+highlighting.lexers["ipython"] = ipy3
+highlighting.lexers["ipython3"] = ipy3

temp_venv/lib/python3.13/site-packages/IPython/sphinxext/ipython_directive.py

@@ -0,0 +1,1278 @@
+# -*- coding: utf-8 -*-
+"""
+Sphinx directive to support embedded IPython code.
+
+IPython provides an extension for `Sphinx <http://www.sphinx-doc.org/>`_ to
+highlight and run code.
+
+This directive allows pasting of entire interactive IPython sessions, prompts
+and all, and their code will actually get re-executed at doc build time, with
+all prompts renumbered sequentially. It also allows you to input code as a pure
+python input by giving the argument python to the directive. The output looks
+like an interactive ipython section.
+
+Here is an example of how the IPython directive can
+**run** python code, at build time.
+
+.. ipython::
+
+   In [1]: 1+1
+
+   In [1]: import datetime
+      ...: datetime.date.fromisoformat('2022-02-22')
+
+It supports IPython construct that plain
+Python does not understand (like magics):
+
+.. ipython::
+
+   In [0]: import time
+
+   In [0]: %pdoc time.sleep
+
+This will also support top-level async when using IPython 7.0+
+
+.. ipython::
+
+   In [2]: import asyncio
+      ...: print('before')
+      ...: await asyncio.sleep(1)
+      ...: print('after')
+
+
+The namespace will persist across multiple code chucks, Let's define a variable:
+
+.. ipython::
+
+   In [0]: who = "World"
+
+And now say hello:
+
+.. ipython::
+
+   In [0]: print('Hello,', who)
+
+If the current section raises an exception, you can add the ``:okexcept:`` flag
+to the current block, otherwise the build will fail.
+
+.. ipython::
+   :okexcept:
+
+   In [1]: 1/0
+
+IPython Sphinx directive module
+===============================
+
+To enable this directive, simply list it in your Sphinx ``conf.py`` file
+(making sure the directory where you placed it is visible to sphinx, as is
+needed for all Sphinx directives). For example, to enable syntax highlighting
+and the IPython directive::
+
+    extensions = ['IPython.sphinxext.ipython_console_highlighting',
+                  'IPython.sphinxext.ipython_directive']
+
+The IPython directive outputs code-blocks with the language 'ipython'. So
+if you do not have the syntax highlighting extension enabled as well, then
+all rendered code-blocks will be uncolored. By default this directive assumes
+that your prompts are unchanged IPython ones, but this can be customized.
+The configurable options that can be placed in conf.py are:
+
+ipython_savefig_dir:
+    The directory in which to save the figures. This is relative to the
+    Sphinx source directory. The default is `html_static_path`.
+ipython_rgxin:
+    The compiled regular expression to denote the start of IPython input
+    lines. The default is ``re.compile('In \\[(\\d+)\\]:\\s?(.*)\\s*')``. You
+    shouldn't need to change this.
+ipython_warning_is_error: [default to True]
+    Fail the build if something unexpected happen, for example if a block raise
+    an exception but does not have the `:okexcept:` flag. The exact behavior of
+    what is considered strict, may change between the sphinx directive version.
+ipython_rgxout:
+    The compiled regular expression to denote the start of IPython output
+    lines. The default is ``re.compile('Out\\[(\\d+)\\]:\\s?(.*)\\s*')``. You
+    shouldn't need to change this.
+ipython_promptin:
+    The string to represent the IPython input prompt in the generated ReST.
+    The default is ``'In [%d]:'``. This expects that the line numbers are used
+    in the prompt.
+ipython_promptout:
+    The string to represent the IPython prompt in the generated ReST. The
+    default is ``'Out [%d]:'``. This expects that the line numbers are used
+    in the prompt.
+ipython_mplbackend:
+    The string which specifies if the embedded Sphinx shell should import
+    Matplotlib and set the backend. The value specifies a backend that is
+    passed to `matplotlib.use()` before any lines in `ipython_execlines` are
+    executed. If not specified in conf.py, then the default value of 'agg' is
+    used. To use the IPython directive without matplotlib as a dependency, set
+    the value to `None`. It may end up that matplotlib is still imported
+    if the user specifies so in `ipython_execlines` or makes use of the
+    @savefig pseudo decorator.
+ipython_execlines:
+    A list of strings to be exec'd in the embedded Sphinx shell. Typical
+    usage is to make certain packages always available. Set this to an empty
+    list if you wish to have no imports always available. If specified in
+    ``conf.py`` as `None`, then it has the effect of making no imports available.
+    If omitted from conf.py altogether, then the default value of
+    ['import numpy as np', 'import matplotlib.pyplot as plt'] is used.
+ipython_holdcount
+    When the @suppress pseudo-decorator is used, the execution count can be
+    incremented or not. The default behavior is to hold the execution count,
+    corresponding to a value of `True`. Set this to `False` to increment
+    the execution count after each suppressed command.
+
+As an example, to use the IPython directive when `matplotlib` is not available,
+one sets the backend to `None`::
+
+    ipython_mplbackend = None
+
+An example usage of the directive is:
+
+.. code-block:: rst
+
+    .. ipython::
+
+        In [1]: x = 1
+
+        In [2]: y = x**2
+
+        In [3]: print(y)
+
+See http://matplotlib.org/sampledoc/ipython_directive.html for additional
+documentation.
+
+Pseudo-Decorators
+=================
+
+Note: Only one decorator is supported per input. If more than one decorator
+is specified, then only the last one is used.
+
+In addition to the Pseudo-Decorators/options described at the above link,
+several enhancements have been made. The directive will emit a message to the
+console at build-time if code-execution resulted in an exception or warning.
+You can suppress these on a per-block basis by specifying the :okexcept:
+or :okwarning: options:
+
+.. code-block:: rst
+
+    .. ipython::
+        :okexcept:
+        :okwarning:
+
+        In [1]: 1/0
+        In [2]: # raise warning.
+
+To Do
+=====
+
+- Turn the ad-hoc test() function into a real test suite.
+- Break up ipython-specific functionality from matplotlib stuff into better
+  separated code.
+
+"""
+
+# Authors
+# =======
+#
+# - John D Hunter: original author.
+# - Fernando Perez: refactoring, documentation, cleanups, port to 0.11.
+# - VáclavŠmilauer <eudoxos-AT-arcig.cz>: Prompt generalizations.
+# - Skipper Seabold, refactoring, cleanups, pure python addition
+
+#-----------------------------------------------------------------------------
+# Imports
+#-----------------------------------------------------------------------------
+
+# Stdlib
+import atexit
+import errno
+import os
+import pathlib
+import re
+import sys
+import tempfile
+import ast
+import warnings
+import shutil
+from io import StringIO
+from typing import Any, Dict, Set
+
+# Third-party
+from docutils.parsers.rst import directives
+from docutils.parsers.rst import Directive
+from sphinx.util import logging
+
+# Our own
+from traitlets.config import Config
+from IPython import InteractiveShell
+from IPython.core.profiledir import ProfileDir
+
+use_matplotlib = False
+try:
+    import matplotlib
+    use_matplotlib = True
+except Exception:
+    pass
+
+#-----------------------------------------------------------------------------
+# Globals
+#-----------------------------------------------------------------------------
+# for tokenizing blocks
+COMMENT, INPUT, OUTPUT =  range(3)
+
+PSEUDO_DECORATORS = ["suppress", "verbatim", "savefig", "doctest"]
+
+#-----------------------------------------------------------------------------
+# Functions and class declarations
+#-----------------------------------------------------------------------------
+
+def block_parser(part, rgxin, rgxout, fmtin, fmtout):
+    """
+    part is a string of ipython text, comprised of at most one
+    input, one output, comments, and blank lines.  The block parser
+    parses the text into a list of::
+
+      blocks = [ (TOKEN0, data0), (TOKEN1, data1), ...]
+
+    where TOKEN is one of [COMMENT | INPUT | OUTPUT ] and
+    data is, depending on the type of token::
+
+      COMMENT : the comment string
+
+      INPUT: the (DECORATOR, INPUT_LINE, REST) where
+         DECORATOR: the input decorator (or None)
+         INPUT_LINE: the input as string (possibly multi-line)
+         REST : any stdout generated by the input line (not OUTPUT)
+
+      OUTPUT: the output string, possibly multi-line
+
+    """
+    block = []
+    lines = part.split('\n')
+    N = len(lines)
+    i = 0
+    decorator = None
+    while 1:
+
+        if i==N:
+            # nothing left to parse -- the last line
+            break
+
+        line = lines[i]
+        i += 1
+        line_stripped = line.strip()
+        if line_stripped.startswith('#'):
+            block.append((COMMENT, line))
+            continue
+
+        if any(
+            line_stripped.startswith("@" + pseudo_decorator)
+            for pseudo_decorator in PSEUDO_DECORATORS
+        ):
+            if decorator:
+                raise RuntimeError(
+                    "Applying multiple pseudo-decorators on one line is not supported"
+                )
+            else:
+                decorator = line_stripped
+                continue
+
+        # does this look like an input line?
+        matchin = rgxin.match(line)
+        if matchin:
+            lineno, inputline = int(matchin.group(1)), matchin.group(2)
+
+            # the ....: continuation string
+            continuation = '   %s:'%''.join(['.']*(len(str(lineno))+2))
+            Nc = len(continuation)
+            # input lines can continue on for more than one line, if
+            # we have a '\' line continuation char or a function call
+            # echo line 'print'.  The input line can only be
+            # terminated by the end of the block or an output line, so
+            # we parse out the rest of the input line if it is
+            # multiline as well as any echo text
+
+            rest = []
+            while i<N:
+
+                # look ahead; if the next line is blank, or a comment, or
+                # an output line, we're done
+
+                nextline = lines[i]
+                matchout = rgxout.match(nextline)
+                # print("nextline=%s, continuation=%s, starts=%s"%(nextline, continuation, nextline.startswith(continuation)))
+                if matchout or nextline.startswith('#'):
+                    break
+                elif nextline.startswith(continuation):
+                    # The default ipython_rgx* treat the space following the colon as optional.
+                    # However, If the space is there we must consume it or code
+                    # employing the cython_magic extension will fail to execute.
+                    #
+                    # This works with the default ipython_rgx* patterns,
+                    # If you modify them, YMMV.
+                    nextline = nextline[Nc:]
+                    if nextline and nextline[0] == ' ':
+                        nextline = nextline[1:]
+
+                    inputline += '\n' +  nextline
+                else:
+                    rest.append(nextline)
+                i+= 1
+
+            block.append((INPUT, (decorator, inputline, '\n'.join(rest))))
+            continue
+
+        # if it looks like an output line grab all the text to the end
+        # of the block
+        matchout = rgxout.match(line)
+        if matchout:
+            lineno, output = int(matchout.group(1)), matchout.group(2)
+            if i<N-1:
+                output = '\n'.join([output] + lines[i:])
+
+            block.append((OUTPUT, output))
+            break
+
+    return block
+
+
+class EmbeddedSphinxShell:
+    """An embedded IPython instance to run inside Sphinx"""
+
+    def __init__(self, exec_lines=None):
+
+        self.cout = StringIO()
+
+        if exec_lines is None:
+            exec_lines = []
+
+        # Create config object for IPython
+        config = Config()
+        config.HistoryManager.hist_file = ':memory:'
+        config.InteractiveShell.autocall = False
+        config.InteractiveShell.autoindent = False
+        config.InteractiveShell.colors = "nocolor"
+
+        # create a profile so instance history isn't saved
+        tmp_profile_dir = tempfile.mkdtemp(prefix='profile_')
+        profname = 'auto_profile_sphinx_build'
+        pdir = os.path.join(tmp_profile_dir,profname)
+        profile = ProfileDir.create_profile_dir(pdir)
+
+        # Create and initialize global ipython, but don't start its mainloop.
+        # This will persist across different EmbeddedSphinxShell instances.
+        IP = InteractiveShell.instance(config=config, profile_dir=profile)
+        atexit.register(self.cleanup)
+
+        # Store a few parts of IPython we'll need.
+        self.IP = IP
+        self.user_ns = self.IP.user_ns
+        self.user_global_ns = self.IP.user_global_ns
+
+        self.input = ''
+        self.output = ''
+        self.tmp_profile_dir = tmp_profile_dir
+
+        self.is_verbatim = False
+        self.is_doctest = False
+        self.is_suppress = False
+
+        # Optionally, provide more detailed information to shell.
+        # this is assigned by the SetUp method of IPythonDirective
+        # to point at itself.
+        #
+        # So, you can access handy things at self.directive.state
+        self.directive = None
+
+        # on the first call to the savefig decorator, we'll import
+        # pyplot as plt so we can make a call to the plt.gcf().savefig
+        self._pyplot_imported = False
+
+        # Prepopulate the namespace.
+        for line in exec_lines:
+            self.process_input_line(line, store_history=False)
+
+    def cleanup(self):
+        shutil.rmtree(self.tmp_profile_dir, ignore_errors=True)
+
+    def clear_cout(self):
+        self.cout.seek(0)
+        self.cout.truncate(0)
+
+    def process_input_line(self, line, store_history):
+        return self.process_input_lines([line], store_history=store_history)
+
+    def process_input_lines(self, lines, store_history=True):
+        """process the input, capturing stdout"""
+        stdout = sys.stdout
+        source_raw = '\n'.join(lines)
+        try:
+            sys.stdout = self.cout
+            self.IP.run_cell(source_raw, store_history=store_history)
+        finally:
+            sys.stdout = stdout
+
+    def process_image(self, decorator):
+        """
+        # build out an image directive like
+        # .. image:: somefile.png
+        #    :width 4in
+        #
+        # from an input like
+        # savefig somefile.png width=4in
+        """
+        savefig_dir = self.savefig_dir
+        source_dir = self.source_dir
+        saveargs = decorator.split(' ')
+        filename = saveargs[1]
+        # insert relative path to image file in source
+        # as absolute path for Sphinx
+        # sphinx expects a posix path, even on Windows
+        path = pathlib.Path(savefig_dir, filename)
+        outfile = '/' + path.relative_to(source_dir).as_posix()
+
+        imagerows = ['.. image:: %s' % outfile]
+
+        for kwarg in saveargs[2:]:
+            arg, val = kwarg.split('=')
+            arg = arg.strip()
+            val = val.strip()
+            imagerows.append('   :%s: %s'%(arg, val))
+
+        image_file = os.path.basename(outfile) # only return file name
+        image_directive = '\n'.join(imagerows)
+        return image_file, image_directive
+
+    # Callbacks for each type of token
+    def process_input(self, data, input_prompt, lineno):
+        """
+        Process data block for INPUT token.
+
+        """
+        decorator, input, rest = data
+        image_file = None
+        image_directive = None
+
+        is_verbatim = decorator=='@verbatim' or self.is_verbatim
+        is_doctest = (decorator is not None and \
+                     decorator.startswith('@doctest')) or self.is_doctest
+        is_suppress = decorator=='@suppress' or self.is_suppress
+        is_okexcept = decorator=='@okexcept' or self.is_okexcept
+        is_okwarning = decorator=='@okwarning' or self.is_okwarning
+        is_savefig = decorator is not None and \
+                     decorator.startswith('@savefig')
+
+        input_lines = input.split('\n')
+        if len(input_lines) > 1:
+            if input_lines[-1] != "":
+                input_lines.append('') # make sure there's a blank line
+                                       # so splitter buffer gets reset
+
+        continuation = '   %s:'%''.join(['.']*(len(str(lineno))+2))
+
+        if is_savefig:
+            image_file, image_directive = self.process_image(decorator)
+
+        ret = []
+        is_semicolon = False
+
+        # Hold the execution count, if requested to do so.
+        if is_suppress and self.hold_count:
+            store_history = False
+        else:
+            store_history = True
+
+        # Note: catch_warnings is not thread safe
+        with warnings.catch_warnings(record=True) as ws:
+            if input_lines[0].endswith(';'):
+                is_semicolon = True
+            #for i, line in enumerate(input_lines):
+
+            # process the first input line
+            if is_verbatim:
+                self.process_input_lines([''])
+                self.IP.execution_count += 1 # increment it anyway
+            else:
+                # only submit the line in non-verbatim mode
+                self.process_input_lines(input_lines, store_history=store_history)
+
+        if not is_suppress:
+            for i, line in enumerate(input_lines):
+                if i == 0:
+                    formatted_line = '%s %s'%(input_prompt, line)
+                else:
+                    formatted_line = '%s %s'%(continuation, line)
+                ret.append(formatted_line)
+
+        if not is_suppress and len(rest.strip()) and is_verbatim:
+            # The "rest" is the standard output of the input. This needs to be
+            # added when in verbatim mode. If there is no "rest", then we don't
+            # add it, as the new line will be added by the processed output.
+            ret.append(rest)
+
+        # Fetch the processed output. (This is not the submitted output.)
+        self.cout.seek(0)
+        processed_output = self.cout.read()
+        if not is_suppress and not is_semicolon:
+            #
+            # In IPythonDirective.run, the elements of `ret` are eventually
+            # combined such that '' entries correspond to newlines. So if
+            # `processed_output` is equal to '', then the adding it to `ret`
+            # ensures that there is a blank line between consecutive inputs
+            # that have no outputs, as in:
+            #
+            #    In [1]: x = 4
+            #
+            #    In [2]: x = 5
+            #
+            # When there is processed output, it has a '\n' at the tail end. So
+            # adding the output to `ret` will provide the necessary spacing
+            # between consecutive input/output blocks, as in:
+            #
+            #   In [1]: x
+            #   Out[1]: 5
+            #
+            #   In [2]: x
+            #   Out[2]: 5
+            #
+            # When there is stdout from the input, it also has a '\n' at the
+            # tail end, and so this ensures proper spacing as well. E.g.:
+            #
+            #   In [1]: print(x)
+            #   5
+            #
+            #   In [2]: x = 5
+            #
+            # When in verbatim mode, `processed_output` is empty (because
+            # nothing was passed to IP. Sometimes the submitted code block has
+            # an Out[] portion and sometimes it does not. When it does not, we
+            # need to ensure proper spacing, so we have to add '' to `ret`.
+            # However, if there is an Out[] in the submitted code, then we do
+            # not want to add a newline as `process_output` has stuff to add.
+            # The difficulty is that `process_input` doesn't know if
+            # `process_output` will be called---so it doesn't know if there is
+            # Out[] in the code block. The requires that we include a hack in
+            # `process_block`. See the comments there.
+            #
+            ret.append(processed_output)
+        elif is_semicolon:
+            # Make sure there is a newline after the semicolon.
+            ret.append('')
+
+        # context information
+        filename = "Unknown"
+        lineno = 0
+        if self.directive.state:
+            filename = self.directive.state.document.current_source
+            lineno = self.directive.state.document.current_line
+
+        # Use sphinx logger for warnings
+        logger = logging.getLogger(__name__)
+
+        # output any exceptions raised during execution to stdout
+        # unless :okexcept: has been specified.
+        if not is_okexcept and (
+            ("Traceback" in processed_output) or ("SyntaxError" in processed_output)
+        ):
+            s = "\n>>>" + ("-" * 73) + "\n"
+            s += "Exception in %s at block ending on line %s\n" % (filename, lineno)
+            s += "Specify :okexcept: as an option in the ipython:: block to suppress this message\n"
+            s += processed_output + "\n"
+            s += "<<<" + ("-" * 73)
+            logger.warning(s)
+            if self.warning_is_error:
+                raise RuntimeError(
+                    "Unexpected exception in `{}` line {}".format(filename, lineno)
+                )
+
+        # output any warning raised during execution to stdout
+        # unless :okwarning: has been specified.
+        if not is_okwarning:
+            for w in ws:
+                s = "\n>>>" + ("-" * 73) + "\n"
+                s += "Warning in %s at block ending on line %s\n" % (filename, lineno)
+                s += "Specify :okwarning: as an option in the ipython:: block to suppress this message\n"
+                s += ("-" * 76) + "\n"
+                s += warnings.formatwarning(
+                    w.message, w.category, w.filename, w.lineno, w.line
+                )
+                s += "<<<" + ("-" * 73)
+                logger.warning(s)
+                if self.warning_is_error:
+                    raise RuntimeError(
+                        "Unexpected warning in `{}` line {}".format(filename, lineno)
+                    )
+
+        self.clear_cout()
+        return (ret, input_lines, processed_output,
+                is_doctest, decorator, image_file, image_directive)
+
+
+    def process_output(self, data, output_prompt, input_lines, output,
+                       is_doctest, decorator, image_file):
+        """
+        Process data block for OUTPUT token.
+
+        """
+        # Recall: `data` is the submitted output, and `output` is the processed
+        # output from `input_lines`.
+
+        TAB = ' ' * 4
+
+        if is_doctest and output is not None:
+
+            found = output # This is the processed output
+            found = found.strip()
+            submitted = data.strip()
+
+            if self.directive is None:
+                source = 'Unavailable'
+                content = 'Unavailable'
+            else:
+                source = self.directive.state.document.current_source
+                content = self.directive.content
+                # Add tabs and join into a single string.
+                content = '\n'.join([TAB + line for line in content])
+
+            # Make sure the output contains the output prompt.
+            ind = found.find(output_prompt)
+            if ind < 0:
+                e = ('output does not contain output prompt\n\n'
+                     'Document source: {0}\n\n'
+                     'Raw content: \n{1}\n\n'
+                     'Input line(s):\n{TAB}{2}\n\n'
+                     'Output line(s):\n{TAB}{3}\n\n')
+                e = e.format(source, content, '\n'.join(input_lines),
+                             repr(found), TAB=TAB)
+                raise RuntimeError(e)
+            found = found[len(output_prompt):].strip()
+
+            # Handle the actual doctest comparison.
+            if decorator.strip() == '@doctest':
+                # Standard doctest
+                if found != submitted:
+                    e = ('doctest failure\n\n'
+                         'Document source: {0}\n\n'
+                         'Raw content: \n{1}\n\n'
+                         'On input line(s):\n{TAB}{2}\n\n'
+                         'we found output:\n{TAB}{3}\n\n'
+                         'instead of the expected:\n{TAB}{4}\n\n')
+                    e = e.format(source, content, '\n'.join(input_lines),
+                                 repr(found), repr(submitted), TAB=TAB)
+                    raise RuntimeError(e)
+            else:
+                self.custom_doctest(decorator, input_lines, found, submitted)
+
+        # When in verbatim mode, this holds additional submitted output
+        # to be written in the final Sphinx output.
+        # https://github.com/ipython/ipython/issues/5776
+        out_data = []
+
+        is_verbatim = decorator=='@verbatim' or self.is_verbatim
+        if is_verbatim and data.strip():
+            # Note that `ret` in `process_block` has '' as its last element if
+            # the code block was in verbatim mode. So if there is no submitted
+            # output, then we will have proper spacing only if we do not add
+            # an additional '' to `out_data`. This is why we condition on
+            # `and data.strip()`.
+
+            # The submitted output has no output prompt. If we want the
+            # prompt and the code to appear, we need to join them now
+            # instead of adding them separately---as this would create an
+            # undesired newline. How we do this ultimately depends on the
+            # format of the output regex. I'll do what works for the default
+            # prompt for now, and we might have to adjust if it doesn't work
+            # in other cases. Finally, the submitted output does not have
+            # a trailing newline, so we must add it manually.
+            out_data.append("{0} {1}\n".format(output_prompt, data))
+
+        return out_data
+
+    def process_comment(self, data):
+        """Process data fPblock for COMMENT token."""
+        if not self.is_suppress:
+            return [data]
+
+    def save_image(self, image_file):
+        """
+        Saves the image file to disk.
+        """
+        self.ensure_pyplot()
+        command = 'plt.gcf().savefig("%s")'%image_file
+        # print('SAVEFIG', command)  # dbg
+        self.process_input_line('bookmark ipy_thisdir', store_history=False)
+        self.process_input_line('cd -b ipy_savedir', store_history=False)
+        self.process_input_line(command, store_history=False)
+        self.process_input_line('cd -b ipy_thisdir', store_history=False)
+        self.process_input_line('bookmark -d ipy_thisdir', store_history=False)
+        self.clear_cout()
+
+    def process_block(self, block):
+        """
+        process block from the block_parser and return a list of processed lines
+        """
+        ret = []
+        output = None
+        input_lines = None
+        lineno = self.IP.execution_count
+
+        input_prompt = self.promptin % lineno
+        output_prompt = self.promptout % lineno
+        image_file = None
+        image_directive = None
+
+        found_input = False
+        for token, data in block:
+            if token == COMMENT:
+                out_data = self.process_comment(data)
+            elif token == INPUT:
+                found_input = True
+                (out_data, input_lines, output, is_doctest,
+                 decorator, image_file, image_directive) = \
+                          self.process_input(data, input_prompt, lineno)
+            elif token == OUTPUT:
+                if not found_input:
+
+                    TAB = ' ' * 4
+                    linenumber = 0
+                    source = 'Unavailable'
+                    content = 'Unavailable'
+                    if self.directive:
+                        linenumber = self.directive.state.document.current_line
+                        source = self.directive.state.document.current_source
+                        content = self.directive.content
+                        # Add tabs and join into a single string.
+                        content = '\n'.join([TAB + line for line in content])
+
+                    e = ('\n\nInvalid block: Block contains an output prompt '
+                         'without an input prompt.\n\n'
+                         'Document source: {0}\n\n'
+                         'Content begins at line {1}: \n\n{2}\n\n'
+                         'Problematic block within content: \n\n{TAB}{3}\n\n')
+                    e = e.format(source, linenumber, content, block, TAB=TAB)
+
+                    # Write, rather than include in exception, since Sphinx
+                    # will truncate tracebacks.
+                    sys.stdout.write(e)
+                    raise RuntimeError('An invalid block was detected.')
+                out_data = \
+                    self.process_output(data, output_prompt, input_lines,
+                                        output, is_doctest, decorator,
+                                        image_file)
+                if out_data:
+                    # Then there was user submitted output in verbatim mode.
+                    # We need to remove the last element of `ret` that was
+                    # added in `process_input`, as it is '' and would introduce
+                    # an undesirable newline.
+                    assert(ret[-1] == '')
+                    del ret[-1]
+
+            if out_data:
+                ret.extend(out_data)
+
+        # save the image files
+        if image_file is not None:
+            self.save_image(image_file)
+
+        return ret, image_directive
+
+    def ensure_pyplot(self):
+        """
+        Ensures that pyplot has been imported into the embedded IPython shell.
+
+        Also, makes sure to set the backend appropriately if not set already.
+
+        """
+        # We are here if the @figure pseudo decorator was used. Thus, it's
+        # possible that we could be here even if python_mplbackend were set to
+        # `None`. That's also strange and perhaps worthy of raising an
+        # exception, but for now, we just set the backend to 'agg'.
+
+        if not self._pyplot_imported:
+            if 'matplotlib.backends' not in sys.modules:
+                # Then ipython_matplotlib was set to None but there was a
+                # call to the @figure decorator (and ipython_execlines did
+                # not set a backend).
+                #raise Exception("No backend was set, but @figure was used!")
+                import matplotlib
+                matplotlib.use('agg')
+
+            # Always import pyplot into embedded shell.
+            self.process_input_line('import matplotlib.pyplot as plt',
+                                    store_history=False)
+            self._pyplot_imported = True
+
+    def process_pure_python(self, content):
+        """
+        content is a list of strings. it is unedited directive content
+
+        This runs it line by line in the InteractiveShell, prepends
+        prompts as needed capturing stderr and stdout, then returns
+        the content as a list as if it were ipython code
+        """
+        output = []
+        savefig = False # keep up with this to clear figure
+        multiline = False # to handle line continuation
+        multiline_start = None
+        fmtin = self.promptin
+
+        ct = 0
+
+        for lineno, line in enumerate(content):
+
+            line_stripped = line.strip()
+            if not len(line):
+                output.append(line)
+                continue
+
+            # handle pseudo-decorators, whilst ensuring real python decorators are treated as input
+            if any(
+                line_stripped.startswith("@" + pseudo_decorator)
+                for pseudo_decorator in PSEUDO_DECORATORS
+            ):
+                output.extend([line])
+                if 'savefig' in line:
+                    savefig = True # and need to clear figure
+                continue
+
+            # handle comments
+            if line_stripped.startswith('#'):
+                output.extend([line])
+                continue
+
+            # deal with lines checking for multiline
+            continuation  = u'   %s:'% ''.join(['.']*(len(str(ct))+2))
+            if not multiline:
+                modified = u"%s %s" % (fmtin % ct, line_stripped)
+                output.append(modified)
+                ct += 1
+                try:
+                    ast.parse(line_stripped)
+                    output.append(u'')
+                except Exception: # on a multiline
+                    multiline = True
+                    multiline_start = lineno
+            else: # still on a multiline
+                modified = u'%s %s' % (continuation, line)
+                output.append(modified)
+
+                # if the next line is indented, it should be part of multiline
+                if len(content) > lineno + 1:
+                    nextline = content[lineno + 1]
+                    if len(nextline) - len(nextline.lstrip()) > 3:
+                        continue
+                try:
+                    mod = ast.parse(
+                            '\n'.join(content[multiline_start:lineno+1]))
+                    if isinstance(mod.body[0], ast.FunctionDef):
+                        # check to see if we have the whole function
+                        for element in mod.body[0].body:
+                            if isinstance(element, ast.Return):
+                                multiline = False
+                    else:
+                        output.append(u'')
+                        multiline = False
+                except Exception:
+                    pass
+
+            if savefig: # clear figure if plotted
+                self.ensure_pyplot()
+                self.process_input_line('plt.clf()', store_history=False)
+                self.clear_cout()
+                savefig = False
+
+        return output
+
+    def custom_doctest(self, decorator, input_lines, found, submitted):
+        """
+        Perform a specialized doctest.
+
+        """
+        from .custom_doctests import doctests
+
+        args = decorator.split()
+        doctest_type = args[1]
+        if doctest_type in doctests:
+            doctests[doctest_type](self, args, input_lines, found, submitted)
+        else:
+            e = "Invalid option to @doctest: {0}".format(doctest_type)
+            raise Exception(e)
+
+
+class IPythonDirective(Directive):
+
+    has_content: bool = True
+    required_arguments: int = 0
+    optional_arguments: int = 4  # python, suppress, verbatim, doctest
+    final_argumuent_whitespace: bool = True
+    option_spec: Dict[str, Any] = {
+        "python": directives.unchanged,
+        "suppress": directives.flag,
+        "verbatim": directives.flag,
+        "doctest": directives.flag,
+        "okexcept": directives.flag,
+        "okwarning": directives.flag,
+    }
+
+    shell = None
+
+    seen_docs: Set = set()
+
+    def get_config_options(self):
+        # contains sphinx configuration variables
+        config = self.state.document.settings.env.config
+
+        # get config variables to set figure output directory
+        savefig_dir = config.ipython_savefig_dir
+        source_dir = self.state.document.settings.env.srcdir
+        savefig_dir = os.path.join(source_dir, savefig_dir)
+
+        # get regex and prompt stuff
+        rgxin      = config.ipython_rgxin
+        rgxout     = config.ipython_rgxout
+        warning_is_error= config.ipython_warning_is_error
+        promptin   = config.ipython_promptin
+        promptout  = config.ipython_promptout
+        mplbackend = config.ipython_mplbackend
+        exec_lines = config.ipython_execlines
+        hold_count = config.ipython_holdcount
+
+        return (savefig_dir, source_dir, rgxin, rgxout,
+                promptin, promptout, mplbackend, exec_lines, hold_count, warning_is_error)
+
+    def setup(self):
+        # Get configuration values.
+        (savefig_dir, source_dir, rgxin, rgxout, promptin, promptout,
+         mplbackend, exec_lines, hold_count, warning_is_error) = self.get_config_options()
+
+        try:
+            os.makedirs(savefig_dir)
+        except OSError as e:
+            if e.errno != errno.EEXIST:
+                raise
+
+        if self.shell is None:
+            # We will be here many times.  However, when the
+            # EmbeddedSphinxShell is created, its interactive shell member
+            # is the same for each instance.
+
+            if mplbackend and 'matplotlib.backends' not in sys.modules and use_matplotlib:
+                import matplotlib
+                matplotlib.use(mplbackend)
+
+            # Must be called after (potentially) importing matplotlib and
+            # setting its backend since exec_lines might import pylab.
+            self.shell = EmbeddedSphinxShell(exec_lines)
+
+            # Store IPython directive to enable better error messages
+            self.shell.directive = self
+
+        # reset the execution count if we haven't processed this doc
+        #NOTE: this may be borked if there are multiple seen_doc tmp files
+        #check time stamp?
+        if self.state.document.current_source not in self.seen_docs:
+            self.shell.IP.history_manager.reset()
+            self.shell.IP.execution_count = 1
+            self.seen_docs.add(self.state.document.current_source)
+
+        # and attach to shell so we don't have to pass them around
+        self.shell.rgxin = rgxin
+        self.shell.rgxout = rgxout
+        self.shell.promptin = promptin
+        self.shell.promptout = promptout
+        self.shell.savefig_dir = savefig_dir
+        self.shell.source_dir = source_dir
+        self.shell.hold_count = hold_count
+        self.shell.warning_is_error = warning_is_error
+
+        # setup bookmark for saving figures directory
+        self.shell.process_input_line(
+            'bookmark ipy_savedir "%s"' % savefig_dir, store_history=False
+        )
+        self.shell.clear_cout()
+
+        return rgxin, rgxout, promptin, promptout
+
+    def teardown(self):
+        # delete last bookmark
+        self.shell.process_input_line('bookmark -d ipy_savedir',
+                                      store_history=False)
+        self.shell.clear_cout()
+
+    def run(self):
+        debug = False
+
+        #TODO, any reason block_parser can't be a method of embeddable shell
+        # then we wouldn't have to carry these around
+        rgxin, rgxout, promptin, promptout = self.setup()
+
+        options = self.options
+        self.shell.is_suppress = 'suppress' in options
+        self.shell.is_doctest = 'doctest' in options
+        self.shell.is_verbatim = 'verbatim' in options
+        self.shell.is_okexcept = 'okexcept' in options
+        self.shell.is_okwarning = 'okwarning' in options
+
+        # handle pure python code
+        if 'python' in self.arguments:
+            content = self.content
+            self.content = self.shell.process_pure_python(content)
+
+        # parts consists of all text within the ipython-block.
+        # Each part is an input/output block.
+        parts = '\n'.join(self.content).split('\n\n')
+
+        lines = ['.. code-block:: ipython', '']
+        figures = []
+
+        # Use sphinx logger for warnings
+        logger = logging.getLogger(__name__)
+
+        for part in parts:
+            block = block_parser(part, rgxin, rgxout, promptin, promptout)
+            if len(block):
+                rows, figure = self.shell.process_block(block)
+                for row in rows:
+                    lines.extend(['   {0}'.format(line)
+                                  for line in row.split('\n')])
+
+                if figure is not None:
+                    figures.append(figure)
+            else:
+                message = 'Code input with no code at {}, line {}'\
+                            .format(
+                                self.state.document.current_source,
+                                self.state.document.current_line)
+                if self.shell.warning_is_error:
+                    raise RuntimeError(message)
+                else:
+                    logger.warning(message)
+
+        for figure in figures:
+            lines.append('')
+            lines.extend(figure.split('\n'))
+            lines.append('')
+
+        if len(lines) > 2:
+            if debug:
+                print('\n'.join(lines))
+            else:
+                # This has to do with input, not output. But if we comment
+                # these lines out, then no IPython code will appear in the
+                # final output.
+                self.state_machine.insert_input(
+                    lines, self.state_machine.input_lines.source(0))
+
+        # cleanup
+        self.teardown()
+
+        return []
+
+# Enable as a proper Sphinx directive
+def setup(app):
+    setup.app = app
+
+    app.add_directive('ipython', IPythonDirective)
+    app.add_config_value('ipython_savefig_dir', 'savefig', 'env')
+    app.add_config_value('ipython_warning_is_error', True, 'env')
+    app.add_config_value('ipython_rgxin',
+                         re.compile(r'In \[(\d+)\]:\s?(.*)\s*'), 'env')
+    app.add_config_value('ipython_rgxout',
+                         re.compile(r'Out\[(\d+)\]:\s?(.*)\s*'), 'env')
+    app.add_config_value('ipython_promptin', 'In [%d]:', 'env')
+    app.add_config_value('ipython_promptout', 'Out[%d]:', 'env')
+
+    # We could just let matplotlib pick whatever is specified as the default
+    # backend in the matplotlibrc file, but this would cause issues if the
+    # backend didn't work in headless environments. For this reason, 'agg'
+    # is a good default backend choice.
+    app.add_config_value('ipython_mplbackend', 'agg', 'env')
+
+    # If the user sets this config value to `None`, then EmbeddedSphinxShell's
+    # __init__ method will treat it as [].
+    execlines = ['import numpy as np']
+    if use_matplotlib:
+        execlines.append('import matplotlib.pyplot as plt')
+    app.add_config_value('ipython_execlines', execlines, 'env')
+
+    app.add_config_value('ipython_holdcount', True, 'env')
+
+    metadata = {'parallel_read_safe': True, 'parallel_write_safe': True}
+    return metadata
+
+# Simple smoke test, needs to be converted to a proper automatic test.
+def test():
+
+    examples = [
+        r"""
+In [9]: pwd
+Out[9]: '/home/jdhunter/py4science/book'
+
+In [10]: cd bookdata/
+/home/jdhunter/py4science/book/bookdata
+
+In [2]: from pylab import *
+
+In [2]: ion()
+
+In [3]: im = imread('stinkbug.png')
+
+@savefig mystinkbug.png width=4in
+In [4]: imshow(im)
+Out[4]: <matplotlib.image.AxesImage object at 0x39ea850>
+
+""",
+        r"""
+
+In [1]: x = 'hello world'
+
+# string methods can be
+# used to alter the string
+@doctest
+In [2]: x.upper()
+Out[2]: 'HELLO WORLD'
+
+@verbatim
+In [3]: x.st<TAB>
+x.startswith  x.strip
+""",
+    r"""
+
+In [130]: url = 'http://ichart.finance.yahoo.com/table.csv?s=CROX\
+   .....: &d=9&e=22&f=2009&g=d&a=1&br=8&c=2006&ignore=.csv'
+
+In [131]: print url.split('&')
+['http://ichart.finance.yahoo.com/table.csv?s=CROX', 'd=9', 'e=22', 'f=2009', 'g=d', 'a=1', 'b=8', 'c=2006', 'ignore=.csv']
+
+In [60]: import urllib
+
+""",
+    r"""\
+
+In [133]: import numpy.random
+
+@suppress
+In [134]: numpy.random.seed(2358)
+
+@doctest
+In [135]: numpy.random.rand(10,2)
+Out[135]:
+array([[ 0.64524308,  0.59943846],
+       [ 0.47102322,  0.8715456 ],
+       [ 0.29370834,  0.74776844],
+       [ 0.99539577,  0.1313423 ],
+       [ 0.16250302,  0.21103583],
+       [ 0.81626524,  0.1312433 ],
+       [ 0.67338089,  0.72302393],
+       [ 0.7566368 ,  0.07033696],
+       [ 0.22591016,  0.77731835],
+       [ 0.0072729 ,  0.34273127]])
+
+""",
+
+    r"""
+In [106]: print x
+jdh
+
+In [109]: for i in range(10):
+   .....:     print i
+   .....:
+   .....:
+0
+1
+2
+3
+4
+5
+6
+7
+8
+9
+""",
+
+        r"""
+
+In [144]: from pylab import *
+
+In [145]: ion()
+
+# use a semicolon to suppress the output
+@savefig test_hist.png width=4in
+In [151]: hist(np.random.randn(10000), 100);
+
+
+@savefig test_plot.png width=4in
+In [151]: plot(np.random.randn(10000), 'o');
+   """,
+
+        r"""
+# use a semicolon to suppress the output
+In [151]: plt.clf()
+
+@savefig plot_simple.png width=4in
+In [151]: plot([1,2,3])
+
+@savefig hist_simple.png width=4in
+In [151]: hist(np.random.randn(10000), 100);
+
+""",
+     r"""
+# update the current fig
+In [151]: ylabel('number')
+
+In [152]: title('normal distribution')
+
+
+@savefig hist_with_text.png
+In [153]: grid(True)
+
+@doctest float
+In [154]: 0.1 + 0.2
+Out[154]: 0.3
+
+@doctest float
+In [155]: np.arange(16).reshape(4,4)
+Out[155]:
+array([[ 0,  1,  2,  3],
+       [ 4,  5,  6,  7],
+       [ 8,  9, 10, 11],
+       [12, 13, 14, 15]])
+
+In [1]: x = np.arange(16, dtype=float).reshape(4,4)
+
+In [2]: x[0,0] = np.inf
+
+In [3]: x[0,1] = np.nan
+
+@doctest float
+In [4]: x
+Out[4]:
+array([[ inf,  nan,   2.,   3.],
+       [  4.,   5.,   6.,   7.],
+       [  8.,   9.,  10.,  11.],
+       [ 12.,  13.,  14.,  15.]])
+
+
+        """,
+        ]
+    # skip local-file depending first example:
+    examples = examples[1:]
+
+    #ipython_directive.DEBUG = True  # dbg
+    #options = dict(suppress=True)  # dbg
+    options = {}
+    for example in examples:
+        content = example.split('\n')
+        IPythonDirective('debug', arguments=None, options=options,
+                          content=content, lineno=0,
+                          content_offset=None, block_text=None,
+                          state=None, state_machine=None,
+                          )
+
+# Run test suite as a script
+if __name__=='__main__':
+    if not os.path.isdir('_static'):
+        os.mkdir('_static')
+    test()
+    print('All OK? Check figures in _static/')

temp_venv/lib/python3.13/site-packages/IPython/terminal/debugger.py

@@ -0,0 +1,181 @@
+import asyncio
+import os
+import sys
+
+from IPython.core.debugger import Pdb
+from IPython.core.completer import IPCompleter
+from .ptutils import IPythonPTCompleter
+from .shortcuts import create_ipython_shortcuts
+from . import embed
+
+from pathlib import Path
+from pygments.token import Token
+from prompt_toolkit.application import create_app_session
+from prompt_toolkit.shortcuts.prompt import PromptSession
+from prompt_toolkit.enums import EditingMode
+from prompt_toolkit.formatted_text import PygmentsTokens
+from prompt_toolkit.history import InMemoryHistory, FileHistory
+from concurrent.futures import ThreadPoolExecutor
+
+# we want to avoid ptk as much as possible when using subprocesses
+# as it uses cursor positioning requests, deletes color ....
+_use_simple_prompt = "IPY_TEST_SIMPLE_PROMPT" in os.environ
+
+
+class TerminalPdb(Pdb):
+    """Standalone IPython debugger."""
+
+    def __init__(self, *args, pt_session_options=None, **kwargs):
+        Pdb.__init__(self, *args, **kwargs)
+        self._ptcomp = None
+        self.pt_init(pt_session_options)
+        self.thread_executor = ThreadPoolExecutor(1)
+
+    def pt_init(self, pt_session_options=None):
+        """Initialize the prompt session and the prompt loop
+        and store them in self.pt_app and self.pt_loop.
+
+        Additional keyword arguments for the PromptSession class
+        can be specified in pt_session_options.
+        """
+        if pt_session_options is None:
+            pt_session_options = {}
+
+        def get_prompt_tokens():
+            return [(Token.Prompt, self.prompt)]
+
+        if self._ptcomp is None:
+            compl = IPCompleter(
+                shell=self.shell, namespace={}, global_namespace={}, parent=self.shell
+            )
+            # add a completer for all the do_ methods
+            methods_names = [m[3:] for m in dir(self) if m.startswith("do_")]
+
+            def gen_comp(self, text):
+                return [m for m in methods_names if m.startswith(text)]
+            import types
+            newcomp = types.MethodType(gen_comp, compl)
+            compl.custom_matchers.insert(0, newcomp)
+            # end add completer.
+
+            self._ptcomp = IPythonPTCompleter(compl)
+
+        # setup history only when we start pdb
+        if self.shell.debugger_history is None:
+            if self.shell.debugger_history_file is not None:
+                p = Path(self.shell.debugger_history_file).expanduser()
+                if not p.exists():
+                    p.touch()
+                self.debugger_history = FileHistory(os.path.expanduser(str(p)))
+            else:
+                self.debugger_history = InMemoryHistory()
+        else:
+            self.debugger_history = self.shell.debugger_history
+
+        options = dict(
+            message=(lambda: PygmentsTokens(get_prompt_tokens())),
+            editing_mode=getattr(EditingMode, self.shell.editing_mode.upper()),
+            key_bindings=create_ipython_shortcuts(self.shell),
+            history=self.debugger_history,
+            completer=self._ptcomp,
+            enable_history_search=True,
+            mouse_support=self.shell.mouse_support,
+            complete_style=self.shell.pt_complete_style,
+            style=getattr(self.shell, "style", None),
+            color_depth=self.shell.color_depth,
+        )
+
+        options.update(pt_session_options)
+        if not _use_simple_prompt:
+            self.pt_loop = asyncio.new_event_loop()
+            self.pt_app = PromptSession(**options)
+
+    def _prompt(self):
+        """
+        In case other prompt_toolkit apps have to run in parallel to this one (e.g. in madbg),
+        create_app_session must be used to prevent mixing up between them. According to the prompt_toolkit docs:
+
+        > If you need multiple applications running at the same time, you have to create a separate
+        > `AppSession` using a `with create_app_session():` block.
+        """
+        with create_app_session():
+            return self.pt_app.prompt()
+
+    def cmdloop(self, intro=None):
+        """Repeatedly issue a prompt, accept input, parse an initial prefix
+        off the received input, and dispatch to action methods, passing them
+        the remainder of the line as argument.
+
+        override the same methods from cmd.Cmd to provide prompt toolkit replacement.
+        """
+        if not self.use_rawinput:
+            raise ValueError('Sorry ipdb does not support use_rawinput=False')
+
+        # In order to make sure that prompt, which uses asyncio doesn't
+        # interfere with applications in which it's used, we always run the
+        # prompt itself in a different thread (we can't start an event loop
+        # within an event loop). This new thread won't have any event loop
+        # running, and here we run our prompt-loop.
+        self.preloop()
+
+        try:
+            if intro is not None:
+                self.intro = intro
+            if self.intro:
+                print(self.intro, file=self.stdout)
+            stop = None
+            while not stop:
+                if self.cmdqueue:
+                    line = self.cmdqueue.pop(0)
+                else:
+                    self._ptcomp.ipy_completer.namespace = self.curframe_locals
+                    self._ptcomp.ipy_completer.global_namespace = self.curframe.f_globals
+
+                    # Run the prompt in a different thread.
+                    if not _use_simple_prompt:
+                        try:
+                            line = self.thread_executor.submit(self._prompt).result()
+                        except EOFError:
+                            line = "EOF"
+                    else:
+                        line = input("ipdb> ")
+
+                line = self.precmd(line)
+                stop = self.onecmd(line)
+                stop = self.postcmd(stop, line)
+            self.postloop()
+        except Exception:
+            raise
+
+    def do_interact(self, arg):
+        ipshell = embed.InteractiveShellEmbed(
+            config=self.shell.config,
+            banner1="*interactive*",
+            exit_msg="*exiting interactive console...*",
+        )
+        global_ns = self.curframe.f_globals
+        ipshell(
+            module=sys.modules.get(global_ns["__name__"], None),
+            local_ns=self.curframe_locals,
+        )
+
+
+def set_trace(frame=None):
+    """
+    Start debugging from `frame`.
+
+    If frame is not specified, debugging starts from caller's frame.
+    """
+    TerminalPdb().set_trace(frame or sys._getframe().f_back)
+
+
+if __name__ == '__main__':
+    import pdb
+    # IPython.core.debugger.Pdb.trace_dispatch shall not catch
+    # bdb.BdbQuit. When started through __main__ and an exception
+    # happened after hitting "c", this is needed in order to
+    # be able to quit the debugging session (see #9950).
+    old_trace_dispatch = pdb.Pdb.trace_dispatch
+    pdb.Pdb = TerminalPdb  # type: ignore
+    pdb.Pdb.trace_dispatch = old_trace_dispatch  # type: ignore
+    pdb.main()

temp_venv/lib/python3.13/site-packages/IPython/terminal/embed.py

@@ -0,0 +1,436 @@
+# encoding: utf-8
+"""
+An embedded IPython shell.
+"""
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+
+import sys
+import warnings
+
+from IPython.core import ultratb, compilerop
+from IPython.core import magic_arguments
+from IPython.core.magic import Magics, magics_class, line_magic
+from IPython.core.interactiveshell import InteractiveShell, make_main_module_type
+from IPython.terminal.interactiveshell import TerminalInteractiveShell
+from IPython.terminal.ipapp import load_default_config
+
+from traitlets import Bool, CBool, Unicode
+from IPython.utils.io import ask_yes_no
+
+from typing import Set
+
+class KillEmbedded(Exception):pass
+
+# kept for backward compatibility as IPython 6 was released with
+# the typo. See https://github.com/ipython/ipython/pull/10706
+KillEmbeded = KillEmbedded
+
+# This is an additional magic that is exposed in embedded shells.
+@magics_class
+class EmbeddedMagics(Magics):
+
+    @line_magic
+    @magic_arguments.magic_arguments()
+    @magic_arguments.argument('-i', '--instance', action='store_true',
+                              help='Kill instance instead of call location')
+    @magic_arguments.argument('-x', '--exit', action='store_true',
+                              help='Also exit the current session')
+    @magic_arguments.argument('-y', '--yes', action='store_true',
+                              help='Do not ask confirmation')
+    def kill_embedded(self, parameter_s=''):
+        """%kill_embedded : deactivate for good the current embedded IPython
+
+        This function (after asking for confirmation) sets an internal flag so
+        that an embedded IPython will never activate again for the given call
+        location. This is useful to permanently disable a shell that is being
+        called inside a loop: once you've figured out what you needed from it,
+        you may then kill it and the program will then continue to run without
+        the interactive shell interfering again.
+
+        Kill Instance Option:
+
+            If for some reasons you need to kill the location where the instance
+            is created and not called, for example if you create a single
+            instance in one place and debug in many locations, you can use the
+            ``--instance`` option to kill this specific instance. Like for the
+            ``call location`` killing an "instance" should work even if it is
+            recreated within a loop.
+
+        .. note::
+
+            This was the default behavior before IPython 5.2
+
+        """
+
+        args = magic_arguments.parse_argstring(self.kill_embedded, parameter_s)
+        print(args)
+        if args.instance:
+            # let no ask
+            if not args.yes:
+                kill = ask_yes_no(
+                    "Are you sure you want to kill this embedded instance? [y/N] ", 'n')
+            else:
+                kill = True
+            if kill:
+                self.shell._disable_init_location()
+                print("This embedded IPython instance will not reactivate anymore "
+                      "once you exit.")
+        else:
+            if not args.yes:
+                kill = ask_yes_no(
+                    "Are you sure you want to kill this embedded call_location? [y/N] ", 'n')
+            else:
+                kill = True
+            if kill:
+                self.shell.embedded_active = False
+                print("This embedded IPython  call location will not reactivate anymore "
+                      "once you exit.")
+
+        if args.exit:
+            # Ask-exit does not really ask, it just set internals flags to exit
+            # on next loop.
+            self.shell.ask_exit()
+
+
+    @line_magic
+    def exit_raise(self, parameter_s=''):
+        """%exit_raise Make the current embedded kernel exit and raise and exception.
+
+        This function sets an internal flag so that an embedded IPython will
+        raise a `IPython.terminal.embed.KillEmbedded` Exception on exit, and then exit the current I. This is
+        useful to permanently exit a loop that create IPython embed instance.
+        """
+
+        self.shell.should_raise = True
+        self.shell.ask_exit()
+
+
+class _Sentinel:
+    def __init__(self, repr):
+        assert isinstance(repr, str)
+        self.repr = repr
+
+    def __repr__(self):
+        return repr
+
+
+class InteractiveShellEmbed(TerminalInteractiveShell):
+
+    dummy_mode = Bool(False)
+    exit_msg = Unicode('')
+    embedded = CBool(True)
+    should_raise = CBool(False)
+    # Like the base class display_banner is not configurable, but here it
+    # is True by default.
+    display_banner = CBool(True)
+    exit_msg = Unicode()
+
+    # When embedding, by default we don't change the terminal title
+    term_title = Bool(False,
+        help="Automatically set the terminal title"
+    ).tag(config=True)
+
+    _inactive_locations: Set[str] = set()
+
+    def _disable_init_location(self):
+        """Disable the current Instance creation location"""
+        InteractiveShellEmbed._inactive_locations.add(self._init_location_id)
+
+    @property
+    def embedded_active(self):
+        return (self._call_location_id not in InteractiveShellEmbed._inactive_locations)\
+            and (self._init_location_id not in InteractiveShellEmbed._inactive_locations)
+
+    @embedded_active.setter
+    def embedded_active(self, value):
+        if value:
+            InteractiveShellEmbed._inactive_locations.discard(
+                self._call_location_id)
+            InteractiveShellEmbed._inactive_locations.discard(
+                self._init_location_id)
+        else:
+            InteractiveShellEmbed._inactive_locations.add(
+                self._call_location_id)
+
+    def __init__(self, **kw):
+        assert (
+            "user_global_ns" not in kw
+        ), "Key word argument `user_global_ns` has been replaced by `user_module` since IPython 4.0."
+        # temporary fix for https://github.com/ipython/ipython/issues/14164
+        cls = type(self)
+        if cls._instance is None:
+            for subclass in cls._walk_mro():
+                subclass._instance = self
+            cls._instance = self
+
+        clid = kw.pop('_init_location_id', None)
+        if not clid:
+            frame = sys._getframe(1)
+            clid = '%s:%s' % (frame.f_code.co_filename, frame.f_lineno)
+        self._init_location_id = clid
+
+        super(InteractiveShellEmbed,self).__init__(**kw)
+
+        # don't use the ipython crash handler so that user exceptions aren't
+        # trapped
+        sys.excepthook = ultratb.FormattedTB(
+            theme_name=self.colors,
+            mode=self.xmode,
+            call_pdb=self.pdb,
+        )
+
+    def init_sys_modules(self):
+        """
+        Explicitly overwrite :mod:`IPython.core.interactiveshell` to do nothing.
+        """
+        pass
+
+    def init_magics(self):
+        super(InteractiveShellEmbed, self).init_magics()
+        self.register_magics(EmbeddedMagics)
+
+    def __call__(
+        self,
+        header="",
+        local_ns=None,
+        module=None,
+        dummy=None,
+        stack_depth=1,
+        compile_flags=None,
+        **kw,
+    ):
+        """Activate the interactive interpreter.
+
+        __call__(self,header='',local_ns=None,module=None,dummy=None) -> Start
+        the interpreter shell with the given local and global namespaces, and
+        optionally print a header string at startup.
+
+        The shell can be globally activated/deactivated using the
+        dummy_mode attribute. This allows you to turn off a shell used
+        for debugging globally.
+
+        However, *each* time you call the shell you can override the current
+        state of dummy_mode with the optional keyword parameter 'dummy'. For
+        example, if you set dummy mode on with IPShell.dummy_mode = True, you
+        can still have a specific call work by making it as IPShell(dummy=False).
+        """
+
+        # we are called, set the underlying interactiveshell not to exit.
+        self.keep_running = True
+
+        # If the user has turned it off, go away
+        clid = kw.pop('_call_location_id', None)
+        if not clid:
+            frame = sys._getframe(1)
+            clid = '%s:%s' % (frame.f_code.co_filename, frame.f_lineno)
+        self._call_location_id = clid
+
+        if not self.embedded_active:
+            return
+
+        # Normal exits from interactive mode set this flag, so the shell can't
+        # re-enter (it checks this variable at the start of interactive mode).
+        self.exit_now = False
+
+        # Allow the dummy parameter to override the global __dummy_mode
+        if dummy or (dummy != 0 and self.dummy_mode):
+            return
+
+        # self.banner is auto computed
+        if header:
+            self.old_banner2 = self.banner2
+            self.banner2 = self.banner2 + '\n' + header + '\n'
+        else:
+            self.old_banner2 = ''
+
+        if self.display_banner:
+            self.show_banner()
+
+        # Call the embedding code with a stack depth of 1 so it can skip over
+        # our call and get the original caller's namespaces.
+        self.mainloop(
+            local_ns, module, stack_depth=stack_depth, compile_flags=compile_flags
+        )
+
+        self.banner2 = self.old_banner2
+
+        if self.exit_msg is not None:
+            print(self.exit_msg)
+
+        if self.should_raise:
+            raise KillEmbedded('Embedded IPython raising error, as user requested.')
+
+    def mainloop(
+        self,
+        local_ns=None,
+        module=None,
+        stack_depth=0,
+        compile_flags=None,
+    ):
+        """Embeds IPython into a running python program.
+
+        Parameters
+        ----------
+        local_ns, module
+            Working local namespace (a dict) and module (a module or similar
+            object). If given as None, they are automatically taken from the scope
+            where the shell was called, so that program variables become visible.
+        stack_depth : int
+            How many levels in the stack to go to looking for namespaces (when
+            local_ns or module is None). This allows an intermediate caller to
+            make sure that this function gets the namespace from the intended
+            level in the stack. By default (0) it will get its locals and globals
+            from the immediate caller.
+        compile_flags
+            A bit field identifying the __future__ features
+            that are enabled, as passed to the builtin :func:`compile` function.
+            If given as None, they are automatically taken from the scope where
+            the shell was called.
+
+        """
+        
+        # Get locals and globals from caller
+        if ((local_ns is None or module is None or compile_flags is None)
+            and self.default_user_namespaces):
+            call_frame = sys._getframe(stack_depth).f_back
+
+            if local_ns is None:
+                local_ns = call_frame.f_locals
+            if module is None:
+                global_ns = call_frame.f_globals
+                try:
+                    module = sys.modules[global_ns['__name__']]
+                except KeyError:
+                    warnings.warn("Failed to get module %s" % \
+                        global_ns.get('__name__', 'unknown module')
+                    )
+                    module = make_main_module_type(global_ns)()
+            if compile_flags is None:
+                compile_flags = (call_frame.f_code.co_flags &
+                                 compilerop.PyCF_MASK)
+        
+        # Save original namespace and module so we can restore them after 
+        # embedding; otherwise the shell doesn't shut down correctly.
+        orig_user_module = self.user_module
+        orig_user_ns = self.user_ns
+        orig_compile_flags = self.compile.flags
+        
+        # Update namespaces and fire up interpreter
+        
+        # The global one is easy, we can just throw it in
+        if module is not None:
+            self.user_module = module
+
+        # But the user/local one is tricky: ipython needs it to store internal
+        # data, but we also need the locals. We'll throw our hidden variables
+        # like _ih and get_ipython() into the local namespace, but delete them
+        # later.
+        if local_ns is not None:
+            reentrant_local_ns = {k: v for (k, v) in local_ns.items() if k not in self.user_ns_hidden.keys()}
+            self.user_ns = reentrant_local_ns
+            self.init_user_ns()
+
+        # Compiler flags
+        if compile_flags is not None:
+            self.compile.flags = compile_flags
+
+        # make sure the tab-completer has the correct frame information, so it
+        # actually completes using the frame's locals/globals
+        self.set_completer_frame()
+
+        with self.builtin_trap, self.display_trap:
+            self.interact()
+        
+        # now, purge out the local namespace of IPython's hidden variables.
+        if local_ns is not None:
+            local_ns.update({k: v for (k, v) in self.user_ns.items() if k not in self.user_ns_hidden.keys()})
+
+        
+        # Restore original namespace so shell can shut down when we exit.
+        self.user_module = orig_user_module
+        self.user_ns = orig_user_ns
+        self.compile.flags = orig_compile_flags
+
+
+def embed(*, header="", compile_flags=None, **kwargs):
+    """Call this to embed IPython at the current point in your program.
+
+    The first invocation of this will create a :class:`terminal.embed.InteractiveShellEmbed`
+    instance and then call it.  Consecutive calls just call the already
+    created instance.
+
+    If you don't want the kernel to initialize the namespace
+    from the scope of the surrounding function,
+    and/or you want to load full IPython configuration,
+    you probably want `IPython.start_ipython()` instead.
+
+    Here is a simple example::
+
+        from IPython import embed
+        a = 10
+        b = 20
+        embed(header='First time')
+        c = 30
+        d = 40
+        embed()
+
+    Parameters
+    ----------
+
+    header : str
+        Optional header string to print at startup.
+    compile_flags
+        Passed to the `compile_flags` parameter of :py:meth:`terminal.embed.InteractiveShellEmbed.mainloop()`,
+        which is called when the :class:`terminal.embed.InteractiveShellEmbed` instance is called.
+    **kwargs : various, optional
+        Any other kwargs will be passed to the :class:`terminal.embed.InteractiveShellEmbed` constructor.
+        Full customization can be done by passing a traitlets :class:`Config` in as the
+        `config` argument (see :ref:`configure_start_ipython` and :ref:`terminal_options`).
+    """
+    config = kwargs.get('config')
+    if config is None:
+        config = load_default_config()
+        config.InteractiveShellEmbed = config.TerminalInteractiveShell
+        kwargs["config"] = config
+    using = kwargs.get("using", "sync")
+    colors = kwargs.pop("colors", "nocolor")
+    if using:
+        kwargs["config"].update(
+            {
+                "TerminalInteractiveShell": {
+                    "loop_runner": using,
+                    "colors": colors,
+                    "autoawait": using != "sync",
+                }
+            }
+        )
+    # save ps1/ps2 if defined
+    ps1 = None
+    ps2 = None
+    try:
+        ps1 = sys.ps1
+        ps2 = sys.ps2
+    except AttributeError:
+        pass
+    #save previous instance
+    saved_shell_instance = InteractiveShell._instance
+    if saved_shell_instance is not None:
+        cls = type(saved_shell_instance)
+        cls.clear_instance()
+    frame = sys._getframe(1)
+    shell = InteractiveShellEmbed.instance(_init_location_id='%s:%s' % (
+        frame.f_code.co_filename, frame.f_lineno), **kwargs)
+    shell(header=header, stack_depth=2, compile_flags=compile_flags,
+        _call_location_id='%s:%s' % (frame.f_code.co_filename, frame.f_lineno))
+    InteractiveShellEmbed.clear_instance()
+    #restore previous instance
+    if saved_shell_instance is not None:
+        cls = type(saved_shell_instance)
+        cls.clear_instance()
+        for subclass in cls._walk_mro():
+            subclass._instance = saved_shell_instance
+    if ps1 is not None:
+        sys.ps1 = ps1
+        sys.ps2 = ps2

temp_venv/lib/python3.13/site-packages/IPython/terminal/interactiveshell.py

@@ -0,0 +1,1119 @@
+"""IPython terminal interface using prompt_toolkit"""
+
+import os
+import sys
+import inspect
+from warnings import warn
+from typing import Union as UnionType, Optional
+
+from IPython.core.async_helpers import get_asyncio_loop
+from IPython.core.interactiveshell import InteractiveShell, InteractiveShellABC
+from IPython.utils.py3compat import input
+from IPython.utils.PyColorize import theme_table
+from IPython.utils.terminal import toggle_set_term_title, set_term_title, restore_term_title
+from IPython.utils.process import abbrev_cwd
+from traitlets import (
+    Any,
+    Bool,
+    Dict,
+    Enum,
+    Float,
+    Instance,
+    Integer,
+    List,
+    Type,
+    Unicode,
+    Union,
+    default,
+    observe,
+    validate,
+    DottedObjectName,
+)
+from traitlets.utils.importstring import import_item
+
+
+from prompt_toolkit.auto_suggest import AutoSuggestFromHistory
+from prompt_toolkit.enums import DEFAULT_BUFFER, EditingMode
+from prompt_toolkit.filters import HasFocus, Condition, IsDone
+from prompt_toolkit.formatted_text import PygmentsTokens
+from prompt_toolkit.history import History
+from prompt_toolkit.layout.processors import ConditionalProcessor, HighlightMatchingBracketProcessor
+from prompt_toolkit.output import ColorDepth
+from prompt_toolkit.patch_stdout import patch_stdout
+from prompt_toolkit.shortcuts import PromptSession, CompleteStyle, print_formatted_text
+from prompt_toolkit.styles import DynamicStyle, merge_styles
+from prompt_toolkit.styles.pygments import style_from_pygments_cls, style_from_pygments_dict
+from pygments.styles import get_style_by_name
+from pygments.style import Style
+
+from .debugger import TerminalPdb, Pdb
+from .magics import TerminalMagics
+from .pt_inputhooks import get_inputhook_name_and_func
+from .prompts import Prompts, ClassicPrompts, RichPromptDisplayHook
+from .ptutils import IPythonPTCompleter, IPythonPTLexer
+from .shortcuts import (
+    KEY_BINDINGS,
+    UNASSIGNED_ALLOWED_COMMANDS,
+    create_ipython_shortcuts,
+    create_identifier,
+    RuntimeBinding,
+    add_binding,
+)
+from .shortcuts.filters import KEYBINDING_FILTERS, filter_from_string
+from .shortcuts.auto_suggest import (
+    NavigableAutoSuggestFromHistory,
+    AppendAutoSuggestionInAnyLine,
+)
+
+
+class _NoStyle(Style):
+    pass
+
+
+
+def _backward_compat_continuation_prompt_tokens(
+    method, width: int, *, lineno: int, wrap_count: int
+):
+    """
+    Sagemath use custom prompt and we broke them in 8.19.
+
+    make sure to pass only width if method only support width
+    """
+    sig = inspect.signature(method)
+    extra = {}
+    params = inspect.signature(method).parameters
+    if "lineno" in inspect.signature(method).parameters or any(
+        [p.kind == p.VAR_KEYWORD for p in sig.parameters.values()]
+    ):
+        extra["lineno"] = lineno
+    if "line_number" in inspect.signature(method).parameters or any(
+        [p.kind == p.VAR_KEYWORD for p in sig.parameters.values()]
+    ):
+        extra["line_number"] = lineno
+
+    if "wrap_count" in inspect.signature(method).parameters or any(
+        [p.kind == p.VAR_KEYWORD for p in sig.parameters.values()]
+    ):
+        extra["wrap_count"] = wrap_count
+    return method(width, **extra)
+
+
+def get_default_editor():
+    try:
+        return os.environ['EDITOR']
+    except KeyError:
+        pass
+    except UnicodeError:
+        warn("$EDITOR environment variable is not pure ASCII. Using platform "
+             "default editor.")
+
+    if os.name == 'posix':
+        return 'vi'  # the only one guaranteed to be there!
+    else:
+        return "notepad"  # same in Windows!
+
+
+# conservatively check for tty
+# overridden streams can result in things like:
+# - sys.stdin = None
+# - no isatty method
+for _name in ('stdin', 'stdout', 'stderr'):
+    _stream = getattr(sys, _name)
+    try:
+        if not _stream or not hasattr(_stream, "isatty") or not _stream.isatty():
+            _is_tty = False
+            break
+    except ValueError:
+        # stream is closed
+        _is_tty = False
+        break
+else:
+    _is_tty = True
+
+
+_use_simple_prompt = ('IPY_TEST_SIMPLE_PROMPT' in os.environ) or (not _is_tty)
+
+def black_reformat_handler(text_before_cursor):
+    """
+    We do not need to protect against error,
+    this is taken care at a higher level where any reformat error is ignored.
+    Indeed we may call reformatting on incomplete code.
+    """
+    import black
+
+    formatted_text = black.format_str(text_before_cursor, mode=black.FileMode())
+    if not text_before_cursor.endswith("\n") and formatted_text.endswith("\n"):
+        formatted_text = formatted_text[:-1]
+    return formatted_text
+
+
+def yapf_reformat_handler(text_before_cursor):
+    from yapf.yapflib import file_resources
+    from yapf.yapflib import yapf_api
+
+    style_config = file_resources.GetDefaultStyleForDir(os.getcwd())
+    formatted_text, was_formatted = yapf_api.FormatCode(
+        text_before_cursor, style_config=style_config
+    )
+    if was_formatted:
+        if not text_before_cursor.endswith("\n") and formatted_text.endswith("\n"):
+            formatted_text = formatted_text[:-1]
+        return formatted_text
+    else:
+        return text_before_cursor
+
+
+class PtkHistoryAdapter(History):
+    """
+    Prompt toolkit has it's own way of handling history, Where it assumes it can
+    Push/pull from history.
+
+    """
+
+    def __init__(self, shell):
+        super().__init__()
+        self.shell = shell
+        self._refresh()
+
+    def append_string(self, string):
+        # we rely on sql for that.
+        self._loaded = False
+        self._refresh()
+
+    def _refresh(self):
+        if not self._loaded:
+            self._loaded_strings = list(self.load_history_strings())
+
+    def load_history_strings(self):
+        last_cell = ""
+        res = []
+        for __, ___, cell in self.shell.history_manager.get_tail(
+            self.shell.history_load_length, include_latest=True
+        ):
+            # Ignore blank lines and consecutive duplicates
+            cell = cell.rstrip()
+            if cell and (cell != last_cell):
+                res.append(cell)
+                last_cell = cell
+        yield from res[::-1]
+
+    def store_string(self, string: str) -> None:
+        pass
+
+class TerminalInteractiveShell(InteractiveShell):
+    mime_renderers = Dict().tag(config=True)
+
+    min_elide = Integer(
+        30, help="minimum characters for filling with ellipsis in file completions"
+    ).tag(config=True)
+    space_for_menu = Integer(
+        6,
+        help="Number of line at the bottom of the screen "
+        "to reserve for the tab completion menu, "
+        "search history, ...etc, the height of "
+        "these menus will at most this value. "
+        "Increase it is you prefer long and skinny "
+        "menus, decrease for short and wide.",
+    ).tag(config=True)
+
+    pt_app: UnionType[PromptSession, None] = None
+    auto_suggest: UnionType[
+        AutoSuggestFromHistory,
+        NavigableAutoSuggestFromHistory,
+        None,
+    ] = None
+    debugger_history = None
+
+    debugger_history_file = Unicode(
+        "~/.pdbhistory", help="File in which to store and read history"
+    ).tag(config=True)
+
+    simple_prompt = Bool(_use_simple_prompt,
+        help="""Use `raw_input` for the REPL, without completion and prompt colors.
+
+            Useful when controlling IPython as a subprocess, and piping
+            STDIN/OUT/ERR. Known usage are: IPython's own testing machinery,
+            and emacs' inferior-python subprocess (assuming you have set
+            `python-shell-interpreter` to "ipython") available through the
+            built-in `M-x run-python` and third party packages such as elpy.
+
+            This mode default to `True` if the `IPY_TEST_SIMPLE_PROMPT`
+            environment variable is set, or the current terminal is not a tty.
+            Thus the Default value reported in --help-all, or config will often
+            be incorrectly reported.
+            """,
+    ).tag(config=True)
+
+    @property
+    def debugger_cls(self):
+        return Pdb if self.simple_prompt else TerminalPdb
+
+    confirm_exit = Bool(True,
+        help="""
+        Set to confirm when you try to exit IPython with an EOF (Control-D
+        in Unix, Control-Z/Enter in Windows). By typing 'exit' or 'quit',
+        you can force a direct exit without any confirmation.""",
+    ).tag(config=True)
+
+    editing_mode = Unicode('emacs',
+        help="Shortcut style to use at the prompt. 'vi' or 'emacs'.",
+    ).tag(config=True)
+
+    emacs_bindings_in_vi_insert_mode = Bool(
+        True,
+        help="Add shortcuts from 'emacs' insert mode to 'vi' insert mode.",
+    ).tag(config=True)
+
+    modal_cursor = Bool(
+        True,
+        help="""
+       Cursor shape changes depending on vi mode: beam in vi insert mode,
+       block in nav mode, underscore in replace mode.""",
+    ).tag(config=True)
+
+    ttimeoutlen = Float(
+        0.01,
+        help="""The time in milliseconds that is waited for a key code
+       to complete.""",
+    ).tag(config=True)
+
+    timeoutlen = Float(
+        0.5,
+        help="""The time in milliseconds that is waited for a mapped key
+       sequence to complete.""",
+    ).tag(config=True)
+
+    autoformatter = Unicode(
+        None,
+        help="Autoformatter to reformat Terminal code. Can be `'black'`, `'yapf'` or `None`",
+        allow_none=True
+    ).tag(config=True)
+
+    auto_match = Bool(
+        False,
+        help="""
+        Automatically add/delete closing bracket or quote when opening bracket or quote is entered/deleted.
+        Brackets: (), [], {}
+        Quotes: '', \"\"
+        """,
+    ).tag(config=True)
+
+    mouse_support = Bool(False,
+        help="Enable mouse support in the prompt\n(Note: prevents selecting text with the mouse)"
+    ).tag(config=True)
+
+    # We don't load the list of styles for the help string, because loading
+    # Pygments plugins takes time and can cause unexpected errors.
+    highlighting_style = Union(
+        [Unicode("legacy"), Type(klass=Style)],
+        help="""Deprecated, and has not effect, use IPython themes
+
+        The name or class of a Pygments style to use for syntax
+        highlighting. To see available styles, run `pygmentize -L styles`.""",
+    ).tag(config=True)
+
+    @validate('editing_mode')
+    def _validate_editing_mode(self, proposal):
+        if proposal['value'].lower() == 'vim':
+            proposal['value']= 'vi'
+        elif proposal['value'].lower() == 'default':
+            proposal['value']= 'emacs'
+
+        if hasattr(EditingMode, proposal['value'].upper()):
+            return proposal['value'].lower()
+
+        return self.editing_mode
+
+    @observe('editing_mode')
+    def _editing_mode(self, change):
+        if self.pt_app:
+            self.pt_app.editing_mode = getattr(EditingMode, change.new.upper())
+
+    def _set_formatter(self, formatter):
+        if formatter is None:
+            self.reformat_handler = lambda x:x
+        elif formatter == 'black':
+            self.reformat_handler = black_reformat_handler
+        elif formatter == "yapf":
+            self.reformat_handler = yapf_reformat_handler
+        else:
+            raise ValueError
+
+    @observe("autoformatter")
+    def _autoformatter_changed(self, change):
+        formatter = change.new
+        self._set_formatter(formatter)
+
+    @observe('highlighting_style')
+    @observe('colors')
+    def _highlighting_style_changed(self, change):
+        assert change.new == change.new.lower()
+        if change.new != "legacy":
+            warn(
+                "highlighting_style is deprecated since 9.0 and have no effect, use themeing."
+            )
+            return
+
+    def refresh_style(self):
+        self._style = self._make_style_from_name_or_cls("legacy")
+
+    # TODO: deprecate this
+    highlighting_style_overrides = Dict(
+        help="Override highlighting format for specific tokens"
+    ).tag(config=True)
+
+    true_color = Bool(False,
+        help="""Use 24bit colors instead of 256 colors in prompt highlighting.
+        If your terminal supports true color, the following command should
+        print ``TRUECOLOR`` in orange::
+
+            printf \"\\x1b[38;2;255;100;0mTRUECOLOR\\x1b[0m\\n\"
+        """,
+    ).tag(config=True)
+
+    editor = Unicode(get_default_editor(),
+        help="Set the editor used by IPython (default to $EDITOR/vi/notepad)."
+    ).tag(config=True)
+
+    prompts_class = Type(Prompts, help='Class used to generate Prompt token for prompt_toolkit').tag(config=True)
+
+    prompts = Instance(Prompts)
+
+    @default('prompts')
+    def _prompts_default(self):
+        return self.prompts_class(self)
+
+#    @observe('prompts')
+#    def _(self, change):
+#        self._update_layout()
+
+    @default('displayhook_class')
+    def _displayhook_class_default(self):
+        return RichPromptDisplayHook
+
+    term_title = Bool(True,
+        help="Automatically set the terminal title"
+    ).tag(config=True)
+
+    term_title_format = Unicode("IPython: {cwd}",
+        help="Customize the terminal title format.  This is a python format string. " +
+             "Available substitutions are: {cwd}."
+    ).tag(config=True)
+
+    display_completions = Enum(('column', 'multicolumn','readlinelike'),
+        help= ( "Options for displaying tab completions, 'column', 'multicolumn', and "
+                "'readlinelike'. These options are for `prompt_toolkit`, see "
+                "`prompt_toolkit` documentation for more information."
+                ),
+        default_value='multicolumn').tag(config=True)
+
+    highlight_matching_brackets = Bool(True,
+        help="Highlight matching brackets.",
+    ).tag(config=True)
+
+    extra_open_editor_shortcuts = Bool(False,
+        help="Enable vi (v) or Emacs (C-X C-E) shortcuts to open an external editor. "
+             "This is in addition to the F2 binding, which is always enabled."
+    ).tag(config=True)
+
+    handle_return = Any(None,
+        help="Provide an alternative handler to be called when the user presses "
+             "Return. This is an advanced option intended for debugging, which "
+             "may be changed or removed in later releases."
+    ).tag(config=True)
+
+    enable_history_search = Bool(True,
+        help="Allows to enable/disable the prompt toolkit history search"
+    ).tag(config=True)
+
+    autosuggestions_provider = Unicode(
+        "NavigableAutoSuggestFromHistory",
+        help="Specifies from which source automatic suggestions are provided. "
+        "Can be set to ``'NavigableAutoSuggestFromHistory'`` (:kbd:`up` and "
+        ":kbd:`down` swap suggestions), ``'AutoSuggestFromHistory'``, "
+        " or ``None`` to disable automatic suggestions. "
+        "Default is `'NavigableAutoSuggestFromHistory`'.",
+        allow_none=True,
+    ).tag(config=True)
+    _autosuggestions_provider: Any
+
+    llm_constructor_kwargs = Dict(
+        {},
+        help="""
+        Extra arguments to pass to `llm_provider_class` constructor.
+
+        This is used to – for example – set the `model_id`""",
+    ).tag(config=True)
+
+    llm_prefix_from_history = DottedObjectName(
+        "input_history",
+        help="""\
+    Fully Qualifed name of a function that takes an IPython history manager and
+    return a prefix to pass the llm provider in addition to the current buffer
+    text.
+
+    You can use:
+
+     - no_prefix
+     - input_history
+
+    As default value. `input_history` (default),  will use all the input history
+    of current IPython session
+
+    """,
+    ).tag(config=True)
+    _llm_prefix_from_history: Any
+
+    @observe("llm_prefix_from_history")
+    def _llm_prefix_from_history_changed(self, change):
+        name = change.new
+        self._llm_prefix_from_history = name
+        self._set_autosuggestions()
+
+    llm_provider_class = DottedObjectName(
+        None,
+        allow_none=True,
+        help="""\
+        Provisional:
+            This is a provisinal API in IPython 8.32, before stabilisation
+            in 9.0, it may change without warnings.
+
+        class to use for the `NavigableAutoSuggestFromHistory` to request
+        completions from a LLM, this should inherit from
+        `jupyter_ai_magics:BaseProvider` and implement
+        `stream_inline_completions`
+    """,
+    ).tag(config=True)
+    _llm_provider_class: Any = None
+
+    @observe("llm_provider_class")
+    def _llm_provider_class_changed(self, change):
+        provider_class = change.new
+        self._llm_provider_class = provider_class
+        self._set_autosuggestions()
+
+    def _set_autosuggestions(self, provider=None):
+        if provider is None:
+            provider = self.autosuggestions_provider
+        # disconnect old handler
+        if self.auto_suggest and isinstance(
+            self.auto_suggest, NavigableAutoSuggestFromHistory
+        ):
+            self.auto_suggest.disconnect()
+        if provider is None:
+            self.auto_suggest = None
+        elif provider == "AutoSuggestFromHistory":
+            self.auto_suggest = AutoSuggestFromHistory()
+        elif provider == "NavigableAutoSuggestFromHistory":
+            # LLM stuff are all Provisional in 8.32
+            if self._llm_provider_class:
+                llm_provider_constructor = import_item(self._llm_provider_class)
+                llm_provider = llm_provider_constructor(**self.llm_constructor_kwargs)
+            else:
+                llm_provider = None
+            self.auto_suggest = NavigableAutoSuggestFromHistory()
+            # Provisinal in 8.32
+            self.auto_suggest._llm_provider = llm_provider
+
+            name = self.llm_prefix_from_history
+
+            if name == "no_prefix":
+
+                def no_prefix(history_manager):
+                    return ""
+
+                fun = no_prefix
+
+            elif name == "input_history":
+
+                def input_history(history_manager):
+                    return "\n".join([s[2] for s in history_manager.get_range()]) + "\n"
+
+                fun = input_history
+
+            else:
+                fun = import_item(name)
+            self.auto_suggest._llm_prefixer = fun
+        else:
+            raise ValueError("No valid provider.")
+        if self.pt_app:
+            self.pt_app.auto_suggest = self.auto_suggest
+
+    @observe("autosuggestions_provider")
+    def _autosuggestions_provider_changed(self, change):
+        provider = change.new
+        self._set_autosuggestions(provider)
+
+    shortcuts = List(
+        trait=Dict(
+            key_trait=Enum(
+                [
+                    "command",
+                    "match_keys",
+                    "match_filter",
+                    "new_keys",
+                    "new_filter",
+                    "create",
+                ]
+            ),
+            per_key_traits={
+                "command": Unicode(),
+                "match_keys": List(Unicode()),
+                "match_filter": Unicode(),
+                "new_keys": List(Unicode()),
+                "new_filter": Unicode(),
+                "create": Bool(False),
+            },
+        ),
+        help="""
+        Add, disable or modifying shortcuts.
+
+        Each entry on the list should be a dictionary with ``command`` key
+        identifying the target function executed by the shortcut and at least
+        one of the following:
+
+          - ``match_keys``: list of keys used to match an existing shortcut,
+          - ``match_filter``: shortcut filter used to match an existing shortcut,
+          - ``new_keys``: list of keys to set,
+          - ``new_filter``: a new shortcut filter to set
+
+        The filters have to be composed of pre-defined verbs and joined by one
+        of the following conjunctions: ``&`` (and), ``|`` (or), ``~`` (not).
+        The pre-defined verbs are:
+
+        {filters}
+
+        To disable a shortcut set ``new_keys`` to an empty list.
+        To add a shortcut add key ``create`` with value ``True``.
+
+        When modifying/disabling shortcuts, ``match_keys``/``match_filter`` can
+        be omitted if the provided specification uniquely identifies a shortcut
+        to be modified/disabled. When modifying a shortcut ``new_filter`` or
+        ``new_keys`` can be omitted which will result in reuse of the existing
+        filter/keys.
+
+        Only shortcuts defined in IPython (and not default prompt-toolkit
+        shortcuts) can be modified or disabled. The full list of shortcuts,
+        command identifiers and filters is available under
+        :ref:`terminal-shortcuts-list`.
+
+        Here is an example:
+
+        .. code::
+
+            c.TerminalInteractiveShell.shortcuts = [
+               {{
+                   "new_keys": ["c-q"],
+                   "command": "prompt_toolkit:named_commands.capitalize_word",
+                   "create": True,
+               }},
+               {{
+                   "new_keys": ["c-j"],
+                   "command": "prompt_toolkit:named_commands.beginning_of_line",
+                   "create": True,
+               }},
+            ]
+
+
+        """.format(
+            filters="\n        ".join([f"  - ``{k}``" for k in KEYBINDING_FILTERS])
+        ),
+    ).tag(config=True)
+
+    @observe("shortcuts")
+    def _shortcuts_changed(self, change):
+        if self.pt_app:
+            self.pt_app.key_bindings = self._merge_shortcuts(user_shortcuts=change.new)
+
+    def _merge_shortcuts(self, user_shortcuts):
+        # rebuild the bindings list from scratch
+        key_bindings = create_ipython_shortcuts(self)
+
+        # for now we only allow adding shortcuts for a specific set of
+        # commands; this is a security precution.
+        allowed_commands = {
+            create_identifier(binding.command): binding.command
+            for binding in KEY_BINDINGS
+        }
+        allowed_commands.update(
+            {
+                create_identifier(command): command
+                for command in UNASSIGNED_ALLOWED_COMMANDS
+            }
+        )
+        shortcuts_to_skip = []
+        shortcuts_to_add = []
+
+        for shortcut in user_shortcuts:
+            command_id = shortcut["command"]
+            if command_id not in allowed_commands:
+                allowed_commands = "\n - ".join(allowed_commands)
+                raise ValueError(
+                    f"{command_id} is not a known shortcut command."
+                    f" Allowed commands are: \n - {allowed_commands}"
+                )
+            old_keys = shortcut.get("match_keys", None)
+            old_filter = (
+                filter_from_string(shortcut["match_filter"])
+                if "match_filter" in shortcut
+                else None
+            )
+            matching = [
+                binding
+                for binding in KEY_BINDINGS
+                if (
+                    (old_filter is None or binding.filter == old_filter)
+                    and (old_keys is None or [k for k in binding.keys] == old_keys)
+                    and create_identifier(binding.command) == command_id
+                )
+            ]
+
+            new_keys = shortcut.get("new_keys", None)
+            new_filter = shortcut.get("new_filter", None)
+
+            command = allowed_commands[command_id]
+
+            creating_new = shortcut.get("create", False)
+            modifying_existing = not creating_new and (
+                new_keys is not None or new_filter
+            )
+
+            if creating_new and new_keys == []:
+                raise ValueError("Cannot add a shortcut without keys")
+
+            if modifying_existing:
+                specification = {
+                    key: shortcut[key]
+                    for key in ["command", "filter"]
+                    if key in shortcut
+                }
+                if len(matching) == 0:
+                    raise ValueError(
+                        f"No shortcuts matching {specification} found in {KEY_BINDINGS}"
+                    )
+                elif len(matching) > 1:
+                    raise ValueError(
+                        f"Multiple shortcuts matching {specification} found,"
+                        f" please add keys/filter to select one of: {matching}"
+                    )
+
+                matched = matching[0]
+                old_filter = matched.filter
+                old_keys = list(matched.keys)
+                shortcuts_to_skip.append(
+                    RuntimeBinding(
+                        command,
+                        keys=old_keys,
+                        filter=old_filter,
+                    )
+                )
+
+            if new_keys != []:
+                shortcuts_to_add.append(
+                    RuntimeBinding(
+                        command,
+                        keys=new_keys or old_keys,
+                        filter=(
+                            filter_from_string(new_filter)
+                            if new_filter is not None
+                            else (
+                                old_filter
+                                if old_filter is not None
+                                else filter_from_string("always")
+                            )
+                        ),
+                    )
+                )
+
+        # rebuild the bindings list from scratch
+        key_bindings = create_ipython_shortcuts(self, skip=shortcuts_to_skip)
+        for binding in shortcuts_to_add:
+            add_binding(key_bindings, binding)
+
+        return key_bindings
+
+    prompt_includes_vi_mode = Bool(True,
+        help="Display the current vi mode (when using vi editing mode)."
+    ).tag(config=True)
+
+    prompt_line_number_format = Unicode(
+        "",
+        help="The format for line numbering, will be passed `line` (int, 1 based)"
+        " the current line number and `rel_line` the relative line number."
+        " for example to display both you can use the following template string :"
+        " c.TerminalInteractiveShell.prompt_line_number_format='{line: 4d}/{rel_line:+03d} | '"
+        " This will display the current line number, with leading space and a width of at least 4"
+        " character, as well as the relative line number 0 padded and always with a + or - sign."
+        " Note that when using Emacs mode the prompt of the first line may not update.",
+    ).tag(config=True)
+
+    @observe('term_title')
+    def init_term_title(self, change=None):
+        # Enable or disable the terminal title.
+        if self.term_title and _is_tty:
+            toggle_set_term_title(True)
+            set_term_title(self.term_title_format.format(cwd=abbrev_cwd()))
+        else:
+            toggle_set_term_title(False)
+
+    def restore_term_title(self):
+        if self.term_title and _is_tty:
+            restore_term_title()
+
+    def init_display_formatter(self):
+        super(TerminalInteractiveShell, self).init_display_formatter()
+        # terminal only supports plain text
+        self.display_formatter.active_types = ["text/plain"]
+
+    def init_prompt_toolkit_cli(self):
+        if self.simple_prompt:
+            # Fall back to plain non-interactive output for tests.
+            # This is very limited.
+            def prompt():
+                prompt_text = "".join(x[1] for x in self.prompts.in_prompt_tokens())
+                lines = [input(prompt_text)]
+                prompt_continuation = "".join(
+                    x[1] for x in self.prompts.continuation_prompt_tokens()
+                )
+                while self.check_complete("\n".join(lines))[0] == "incomplete":
+                    lines.append(input(prompt_continuation))
+                return "\n".join(lines)
+
+            self.prompt_for_code = prompt
+            return
+
+        # Set up keyboard shortcuts
+        key_bindings = self._merge_shortcuts(user_shortcuts=self.shortcuts)
+
+        # Pre-populate history from IPython's history database
+        history = PtkHistoryAdapter(self)
+
+        self.refresh_style()
+        ptk_s = DynamicStyle(lambda: self._style)
+
+        editing_mode = getattr(EditingMode, self.editing_mode.upper())
+
+        self._use_asyncio_inputhook = False
+        self.pt_app = PromptSession(
+            auto_suggest=self.auto_suggest,
+            editing_mode=editing_mode,
+            key_bindings=key_bindings,
+            history=history,
+            completer=IPythonPTCompleter(shell=self),
+            enable_history_search=self.enable_history_search,
+            style=ptk_s,
+            include_default_pygments_style=False,
+            mouse_support=self.mouse_support,
+            enable_open_in_editor=self.extra_open_editor_shortcuts,
+            color_depth=self.color_depth,
+            tempfile_suffix=".py",
+            **self._extra_prompt_options(),
+        )
+        if isinstance(self.auto_suggest, NavigableAutoSuggestFromHistory):
+            self.auto_suggest.connect(self.pt_app)
+
+    def _make_style_from_name_or_cls(self, name_or_cls):
+        """
+        Small wrapper that make an IPython compatible style from a style name
+
+        We need that to add style for prompt ... etc.
+        """
+        assert name_or_cls == "legacy"
+        legacy = self.colors.lower()
+
+        theme = theme_table.get(legacy, None)
+        assert theme is not None, legacy
+
+        if legacy == "nocolor":
+            style_overrides = {}
+            style_cls = _NoStyle
+        else:
+            style_overrides = {**theme.extra_style, **self.highlighting_style_overrides}
+            if theme.base is not None:
+                style_cls = get_style_by_name(theme.base)
+            else:
+                style_cls = _NoStyle
+
+        style = merge_styles(
+            [
+                style_from_pygments_cls(style_cls),
+                style_from_pygments_dict(style_overrides),
+            ]
+        )
+
+        return style
+
+    @property
+    def pt_complete_style(self):
+        return {
+            'multicolumn': CompleteStyle.MULTI_COLUMN,
+            'column': CompleteStyle.COLUMN,
+            'readlinelike': CompleteStyle.READLINE_LIKE,
+        }[self.display_completions]
+
+    @property
+    def color_depth(self):
+        return (ColorDepth.TRUE_COLOR if self.true_color else None)
+
+    def _ptk_prompt_cont(self, width: int, line_number: int, wrap_count: int):
+        return PygmentsTokens(
+            _backward_compat_continuation_prompt_tokens(
+                self.prompts.continuation_prompt_tokens,
+                width,
+                lineno=line_number,
+                wrap_count=wrap_count,
+            )
+        )
+
+    def _extra_prompt_options(self):
+        """
+        Return the current layout option for the current Terminal InteractiveShell
+        """
+        def get_message():
+            return PygmentsTokens(self.prompts.in_prompt_tokens())
+
+        if self.editing_mode == "emacs" and self.prompt_line_number_format == "":
+            # with emacs mode the prompt is (usually) static, so we call only
+            # the function once. With VI mode it can toggle between [ins] and
+            # [nor] so we can't precompute.
+            # here I'm going to favor the default keybinding which almost
+            # everybody uses to decrease CPU usage.
+            # if we have issues with users with custom Prompts we can see how to
+            # work around this.
+            get_message = get_message()
+
+        options = {
+            "complete_in_thread": False,
+            "lexer": IPythonPTLexer(),
+            "reserve_space_for_menu": self.space_for_menu,
+            "message": get_message,
+            "prompt_continuation": self._ptk_prompt_cont,
+            "multiline": True,
+            "complete_style": self.pt_complete_style,
+            "input_processors": [
+                # Highlight matching brackets, but only when this setting is
+                # enabled, and only when the DEFAULT_BUFFER has the focus.
+                ConditionalProcessor(
+                    processor=HighlightMatchingBracketProcessor(chars="[](){}"),
+                    filter=HasFocus(DEFAULT_BUFFER)
+                    & ~IsDone()
+                    & Condition(lambda: self.highlight_matching_brackets),
+                ),
+                # Show auto-suggestion in lines other than the last line.
+                ConditionalProcessor(
+                    processor=AppendAutoSuggestionInAnyLine(),
+                    filter=HasFocus(DEFAULT_BUFFER)
+                    & ~IsDone()
+                    & Condition(
+                        lambda: isinstance(
+                            self.auto_suggest,
+                            NavigableAutoSuggestFromHistory,
+                        )
+                    ),
+                ),
+            ],
+        }
+
+        return options
+
+    def prompt_for_code(self):
+        if self.rl_next_input:
+            default = self.rl_next_input
+            self.rl_next_input = None
+        else:
+            default = ''
+
+        # In order to make sure that asyncio code written in the
+        # interactive shell doesn't interfere with the prompt, we run the
+        # prompt in a different event loop.
+        # If we don't do this, people could spawn coroutine with a
+        # while/true inside which will freeze the prompt.
+
+        with patch_stdout(raw=True):
+            if self._use_asyncio_inputhook:
+                # When we integrate the asyncio event loop, run the UI in the
+                # same event loop as the rest of the code. don't use an actual
+                # input hook. (Asyncio is not made for nesting event loops.)
+                asyncio_loop = get_asyncio_loop()
+                text = asyncio_loop.run_until_complete(
+                    self.pt_app.prompt_async(
+                        default=default, **self._extra_prompt_options()
+                    )
+                )
+            else:
+                text = self.pt_app.prompt(
+                    default=default,
+                    inputhook=self._inputhook,
+                    **self._extra_prompt_options(),
+                )
+
+        return text
+
+    def init_io(self):
+        if sys.platform not in {'win32', 'cli'}:
+            return
+
+        import colorama
+        colorama.init()
+
+    def init_magics(self):
+        super(TerminalInteractiveShell, self).init_magics()
+        self.register_magics(TerminalMagics)
+
+    def init_alias(self):
+        # The parent class defines aliases that can be safely used with any
+        # frontend.
+        super(TerminalInteractiveShell, self).init_alias()
+
+        # Now define aliases that only make sense on the terminal, because they
+        # need direct access to the console in a way that we can't emulate in
+        # GUI or web frontend
+        if os.name == 'posix':
+            for cmd in ('clear', 'more', 'less', 'man'):
+                self.alias_manager.soft_define_alias(cmd, cmd)
+
+    def __init__(self, *args, **kwargs) -> None:
+        super().__init__(*args, **kwargs)
+        self._set_autosuggestions(self.autosuggestions_provider)
+        self.init_prompt_toolkit_cli()
+        self.init_term_title()
+        self.keep_running = True
+        self._set_formatter(self.autoformatter)
+
+    def ask_exit(self):
+        self.keep_running = False
+
+    rl_next_input = None
+
+    def interact(self):
+        self.keep_running = True
+        while self.keep_running:
+            print(self.separate_in, end='')
+
+            try:
+                code = self.prompt_for_code()
+            except EOFError:
+                if (not self.confirm_exit) \
+                        or self.ask_yes_no('Do you really want to exit ([y]/n)?','y','n'):
+                    self.ask_exit()
+
+            else:
+                if code:
+                    self.run_cell(code, store_history=True)
+
+    def mainloop(self):
+        # An extra layer of protection in case someone mashing Ctrl-C breaks
+        # out of our internal code.
+        while True:
+            try:
+                self.interact()
+                break
+            except KeyboardInterrupt as e:
+                print("\n%s escaped interact()\n" % type(e).__name__)
+            finally:
+                # An interrupt during the eventloop will mess up the
+                # internal state of the prompt_toolkit library.
+                # Stopping the eventloop fixes this, see
+                # https://github.com/ipython/ipython/pull/9867
+                if hasattr(self, '_eventloop'):
+                    self._eventloop.stop()
+
+                self.restore_term_title()
+
+        # try to call some at-exit operation optimistically as some things can't
+        # be done during interpreter shutdown. this is technically inaccurate as
+        # this make mainlool not re-callable, but that should be a rare if not
+        # in existent use case.
+
+        self._atexit_once()
+
+    _inputhook = None
+    def inputhook(self, context):
+        warn(
+            "inputkook seem unused, and marked for deprecation/Removal as of IPython 9.0. "
+            "Please open an issue if you are using it.",
+            category=PendingDeprecationWarning,
+            stacklevel=2,
+        )
+        if self._inputhook is not None:
+            self._inputhook(context)
+
+    active_eventloop: Optional[str] = None
+
+    def enable_gui(self, gui: Optional[str] = None) -> None:
+        if gui:
+            from ..core.pylabtools import _convert_gui_from_matplotlib
+
+            gui = _convert_gui_from_matplotlib(gui)
+
+        if self.simple_prompt is True and gui is not None:
+            print(
+                f'Cannot install event loop hook for "{gui}" when running with `--simple-prompt`.'
+            )
+            print(
+                "NOTE: Tk is supported natively; use Tk apps and Tk backends with `--simple-prompt`."
+            )
+            return
+
+        if self._inputhook is None and gui is None:
+            print("No event loop hook running.")
+            return
+
+        if self._inputhook is not None and gui is not None:
+            newev, newinhook = get_inputhook_name_and_func(gui)
+            if self._inputhook == newinhook:
+                # same inputhook, do nothing
+                self.log.info(
+                    f"Shell is already running the {self.active_eventloop} eventloop. Doing nothing"
+                )
+                return
+            self.log.warning(
+                f"Shell is already running a different gui event loop for {self.active_eventloop}. "
+                "Call with no arguments to disable the current loop."
+            )
+            return
+        if self._inputhook is not None and gui is None:
+            self.active_eventloop = self._inputhook = None
+
+        if gui and (gui not in {None, "webagg"}):
+            # This hook runs with each cycle of the `prompt_toolkit`'s event loop.
+            self.active_eventloop, self._inputhook = get_inputhook_name_and_func(gui)
+        else:
+            self.active_eventloop = self._inputhook = None
+
+        self._use_asyncio_inputhook = gui == "asyncio"
+
+    # Run !system commands directly, not through pipes, so terminal programs
+    # work correctly.
+    system = InteractiveShell.system_raw
+
+    def auto_rewrite_input(self, cmd):
+        """Overridden from the parent class to use fancy rewriting prompt"""
+        if not self.show_rewritten_input:
+            return
+
+        tokens = self.prompts.rewrite_prompt_tokens()
+        if self.pt_app:
+            print_formatted_text(PygmentsTokens(tokens), end='',
+                                 style=self.pt_app.app.style)
+            print(cmd)
+        else:
+            prompt = ''.join(s for t, s in tokens)
+            print(prompt, cmd, sep='')
+
+    _prompts_before = None
+    def switch_doctest_mode(self, mode):
+        """Switch prompts to classic for %doctest_mode"""
+        if mode:
+            self._prompts_before = self.prompts
+            self.prompts = ClassicPrompts(self)
+        elif self._prompts_before:
+            self.prompts = self._prompts_before
+            self._prompts_before = None
+#        self._update_layout()
+
+
+InteractiveShellABC.register(TerminalInteractiveShell)
+
+if __name__ == '__main__':
+    TerminalInteractiveShell.instance().interact()

temp_venv/lib/python3.13/site-packages/IPython/terminal/ipapp.py

@@ -0,0 +1,346 @@
+# encoding: utf-8
+"""
+The :class:`~traitlets.config.application.Application` object for the command
+line :command:`ipython` program.
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+
+import logging
+import os
+import sys
+import warnings
+
+from traitlets.config.loader import Config
+from traitlets.config.application import boolean_flag, catch_config_error
+from IPython.core import release
+from IPython.core import usage
+from IPython.core.completer import IPCompleter
+from IPython.core.crashhandler import CrashHandler
+from IPython.core.formatters import PlainTextFormatter
+from IPython.core.history import HistoryManager
+from IPython.core.application import (
+    ProfileDir, BaseIPythonApplication, base_flags, base_aliases
+)
+from IPython.core.magic import MagicsManager
+from IPython.core.magics import (
+    ScriptMagics, LoggingMagics
+)
+from IPython.core.shellapp import (
+    InteractiveShellApp, shell_flags, shell_aliases
+)
+from IPython.extensions.storemagic import StoreMagics
+from .interactiveshell import TerminalInteractiveShell
+from IPython.paths import get_ipython_dir
+from traitlets import (
+    Bool, List, default, observe, Type
+)
+
+#-----------------------------------------------------------------------------
+# Globals, utilities and helpers
+#-----------------------------------------------------------------------------
+
+_examples = """
+ipython --matplotlib       # enable matplotlib integration
+ipython --matplotlib=qt    # enable matplotlib integration with qt4 backend
+
+ipython --log-level=DEBUG  # set logging to DEBUG
+ipython --profile=foo      # start with profile foo
+
+ipython profile create foo # create profile foo w/ default config files
+ipython help profile       # show the help for the profile subcmd
+
+ipython locate             # print the path to the IPython directory
+ipython locate profile foo # print the path to the directory for profile `foo`
+"""
+
+#-----------------------------------------------------------------------------
+# Crash handler for this application
+#-----------------------------------------------------------------------------
+
+class IPAppCrashHandler(CrashHandler):
+    """sys.excepthook for IPython itself, leaves a detailed report on disk."""
+
+    def __init__(self, app):
+        contact_name = release.author
+        contact_email = release.author_email
+        bug_tracker = 'https://github.com/ipython/ipython/issues'
+        super(IPAppCrashHandler,self).__init__(
+            app, contact_name, contact_email, bug_tracker
+        )
+
+    def make_report(self,traceback):
+        """Return a string containing a crash report."""
+
+        sec_sep = self.section_sep
+        # Start with parent report
+        report = [super(IPAppCrashHandler, self).make_report(traceback)]
+        # Add interactive-specific info we may have
+        rpt_add = report.append
+        try:
+            rpt_add(sec_sep+"History of session input:")
+            for line in self.app.shell.user_ns['_ih']:
+                rpt_add(line)
+            rpt_add('\n*** Last line of input (may not be in above history):\n')
+            rpt_add(self.app.shell._last_input_line+'\n')
+        except:
+            pass
+
+        return ''.join(report)
+
+#-----------------------------------------------------------------------------
+# Aliases and Flags
+#-----------------------------------------------------------------------------
+flags = dict(base_flags)
+flags.update(shell_flags)
+frontend_flags = {}
+addflag = lambda *args: frontend_flags.update(boolean_flag(*args))
+addflag('autoedit-syntax', 'TerminalInteractiveShell.autoedit_syntax',
+        'Turn on auto editing of files with syntax errors.',
+        'Turn off auto editing of files with syntax errors.'
+)
+addflag('simple-prompt', 'TerminalInteractiveShell.simple_prompt',
+        "Force simple minimal prompt using `raw_input`",
+        "Use a rich interactive prompt with prompt_toolkit",
+)
+
+addflag('banner', 'TerminalIPythonApp.display_banner',
+        "Display a banner upon starting IPython.",
+        "Don't display a banner upon starting IPython."
+)
+addflag('confirm-exit', 'TerminalInteractiveShell.confirm_exit',
+    """Set to confirm when you try to exit IPython with an EOF (Control-D
+    in Unix, Control-Z/Enter in Windows). By typing 'exit' or 'quit',
+    you can force a direct exit without any confirmation.""",
+    "Don't prompt the user when exiting."
+)
+addflag(
+    "tip",
+    "TerminalInteractiveShell.enable_tip",
+    """Shows a tip when IPython starts.""",
+    "Don't show tip when IPython starts.",
+)
+addflag('term-title', 'TerminalInteractiveShell.term_title',
+    "Enable auto setting the terminal title.",
+    "Disable auto setting the terminal title."
+)
+classic_config = Config()
+classic_config.InteractiveShell.cache_size = 0
+classic_config.PlainTextFormatter.pprint = False
+classic_config.TerminalInteractiveShell.prompts_class = (
+    "IPython.terminal.prompts.ClassicPrompts"
+)
+classic_config.InteractiveShell.separate_in = ""
+classic_config.InteractiveShell.separate_out = ""
+classic_config.InteractiveShell.separate_out2 = ""
+classic_config.InteractiveShell.colors = "nocolor"
+classic_config.InteractiveShell.xmode = "Plain"
+
+frontend_flags['classic']=(
+    classic_config,
+    "Gives IPython a similar feel to the classic Python prompt."
+)
+# # log doesn't make so much sense this way anymore
+# paa('--log','-l',
+#     action='store_true', dest='InteractiveShell.logstart',
+#     help="Start logging to the default log file (./ipython_log.py).")
+#
+# # quick is harder to implement
+frontend_flags['quick']=(
+    {'TerminalIPythonApp' : {'quick' : True}},
+    "Enable quick startup with no config files."
+)
+
+frontend_flags['i'] = (
+    {'TerminalIPythonApp' : {'force_interact' : True}},
+    """If running code from the command line, become interactive afterwards.
+    It is often useful to follow this with `--` to treat remaining flags as
+    script arguments.
+    """
+)
+flags.update(frontend_flags)
+
+aliases = dict(base_aliases)
+aliases.update(shell_aliases)  # type: ignore[arg-type]
+
+#-----------------------------------------------------------------------------
+# Main classes and functions
+#-----------------------------------------------------------------------------
+
+
+class LocateIPythonApp(BaseIPythonApplication):
+    description = """print the path to the IPython dir"""
+    subcommands = dict(
+        profile=('IPython.core.profileapp.ProfileLocate',
+            "print the path to an IPython profile directory",
+        ),
+    )
+    def start(self):
+        if self.subapp is not None:
+            return self.subapp.start()
+        else:
+            print(self.ipython_dir)
+
+
+class TerminalIPythonApp(BaseIPythonApplication, InteractiveShellApp):
+    name = "ipython"
+    description = usage.cl_usage
+    crash_handler_class = IPAppCrashHandler  # typing: ignore[assignment]
+    examples = _examples
+
+    flags = flags
+    aliases = aliases
+    classes = List()
+
+    interactive_shell_class = Type(
+        klass=object,   # use default_value otherwise which only allow subclasses.
+        default_value=TerminalInteractiveShell,
+        help="Class to use to instantiate the TerminalInteractiveShell object. Useful for custom Frontends"
+    ).tag(config=True)
+
+    @default('classes')
+    def _classes_default(self):
+        """This has to be in a method, for TerminalIPythonApp to be available."""
+        return [
+            InteractiveShellApp,  # ShellApp comes before TerminalApp, because
+            self.__class__,      # it will also affect subclasses (e.g. QtConsole)
+            TerminalInteractiveShell,
+            HistoryManager,
+            MagicsManager,
+            ProfileDir,
+            PlainTextFormatter,
+            IPCompleter,
+            ScriptMagics,
+            LoggingMagics,
+            StoreMagics,
+        ]
+
+    subcommands = dict(
+        profile = ("IPython.core.profileapp.ProfileApp",
+            "Create and manage IPython profiles."
+        ),
+        kernel = ("ipykernel.kernelapp.IPKernelApp",
+            "Start a kernel without an attached frontend."
+        ),
+        locate=('IPython.terminal.ipapp.LocateIPythonApp',
+            LocateIPythonApp.description
+        ),
+        history=('IPython.core.historyapp.HistoryApp',
+            "Manage the IPython history database."
+        ),
+    )
+
+    # *do* autocreate requested profile, but don't create the config file.
+    auto_create = Bool(True).tag(config=True)
+
+    # configurables
+    quick = Bool(False,
+        help="""Start IPython quickly by skipping the loading of config files."""
+    ).tag(config=True)
+    @observe('quick')
+    def _quick_changed(self, change):
+        if change['new']:
+            self.load_config_file = lambda *a, **kw: None
+
+    display_banner = Bool(True,
+        help="Whether to display a banner upon starting IPython."
+    ).tag(config=True)
+
+    # if there is code of files to run from the cmd line, don't interact
+    # unless the --i flag (App.force_interact) is true.
+    force_interact = Bool(False,
+        help="""If a command or file is given via the command-line,
+        e.g. 'ipython foo.py', start an interactive shell after executing the
+        file or command."""
+    ).tag(config=True)
+    @observe('force_interact')
+    def _force_interact_changed(self, change):
+        if change['new']:
+            self.interact = True
+
+    @observe('file_to_run', 'code_to_run', 'module_to_run')
+    def _file_to_run_changed(self, change):
+        new = change['new']
+        if new:
+            self.something_to_run = True
+        if new and not self.force_interact:
+                self.interact = False
+
+    # internal, not-configurable
+    something_to_run=Bool(False)
+
+    @catch_config_error
+    def initialize(self, argv=None):
+        """Do actions after construct, but before starting the app."""
+        super(TerminalIPythonApp, self).initialize(argv)
+        if self.subapp is not None:
+            # don't bother initializing further, starting subapp
+            return
+        # print(self.extra_args)
+        if self.extra_args and not self.something_to_run:
+            self.file_to_run = self.extra_args[0]
+        self.init_path()
+        # create the shell
+        self.init_shell()
+        # and draw the banner
+        self.init_banner()
+        # Now a variety of things that happen after the banner is printed.
+        self.init_gui_pylab()
+        self.init_extensions()
+        self.init_code()
+
+    def init_shell(self):
+        """initialize the InteractiveShell instance"""
+        # Create an InteractiveShell instance.
+        # shell.display_banner should always be False for the terminal
+        # based app, because we call shell.show_banner() by hand below
+        # so the banner shows *before* all extension loading stuff.
+        self.shell = self.interactive_shell_class.instance(parent=self,
+                        profile_dir=self.profile_dir,
+                        ipython_dir=self.ipython_dir, user_ns=self.user_ns)
+        self.shell.configurables.append(self)
+
+    def init_banner(self):
+        """optionally display the banner"""
+        if self.display_banner and self.interact:
+            self.shell.show_banner()
+        # Make sure there is a space below the banner.
+        if self.log_level <= logging.INFO: print()
+
+    def _pylab_changed(self, name, old, new):
+        """Replace --pylab='inline' with --pylab='auto'"""
+        if new == 'inline':
+            warnings.warn("'inline' not available as pylab backend, "
+                      "using 'auto' instead.")
+            self.pylab = 'auto'
+
+    def start(self):
+        if self.subapp is not None:
+            return self.subapp.start()
+        # perform any prexec steps:
+        if self.interact:
+            self.log.debug("Starting IPython's mainloop...")
+            self.shell.mainloop()
+        else:
+            self.log.debug("IPython not interactive...")
+            self.shell.restore_term_title()
+            if not self.shell.last_execution_succeeded:
+                sys.exit(1)
+
+def load_default_config(ipython_dir=None):
+    """Load the default config file from the default ipython_dir.
+
+    This is useful for embedded shells.
+    """
+    if ipython_dir is None:
+        ipython_dir = get_ipython_dir()
+
+    profile_dir = os.path.join(ipython_dir, 'profile_default')
+    app = TerminalIPythonApp()
+    app.config_file_paths.append(profile_dir)
+    app.load_config_file()
+    return app.config
+
+launch_new_instance = TerminalIPythonApp.launch_instance

temp_venv/lib/python3.13/site-packages/IPython/terminal/magics.py

@@ -0,0 +1,214 @@
+"""Extra magics for terminal use."""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+
+from logging import error
+import os
+import sys
+
+from IPython.core.error import TryNext, UsageError
+from IPython.core.magic import Magics, magics_class, line_magic
+from IPython.lib.clipboard import ClipboardEmpty
+from IPython.testing.skipdoctest import skip_doctest
+from IPython.utils.text import SList, strip_email_quotes
+from IPython.utils import py3compat
+
+def get_pasted_lines(sentinel, l_input=py3compat.input, quiet=False):
+    """ Yield pasted lines until the user enters the given sentinel value.
+    """
+    if not quiet:
+        print("Pasting code; enter '%s' alone on the line to stop or use Ctrl-D." \
+              % sentinel)
+        prompt = ":"
+    else:
+        prompt = ""
+    while True:
+        try:
+            l = l_input(prompt)
+            if l == sentinel:
+                return
+            else:
+                yield l
+        except EOFError:
+            print('<EOF>')
+            return
+
+
+@magics_class
+class TerminalMagics(Magics):
+    def __init__(self, shell):
+        super(TerminalMagics, self).__init__(shell)
+
+    def store_or_execute(self, block, name, store_history=False):
+        """ Execute a block, or store it in a variable, per the user's request.
+        """
+        if name:
+            # If storing it for further editing
+            self.shell.user_ns[name] = SList(block.splitlines())
+            print("Block assigned to '%s'" % name)
+        else:
+            b = self.preclean_input(block)
+            self.shell.user_ns['pasted_block'] = b
+            self.shell.using_paste_magics = True
+            try:
+                self.shell.run_cell(b, store_history)
+            finally:
+                self.shell.using_paste_magics = False
+
+    def preclean_input(self, block):
+        lines = block.splitlines()
+        while lines and not lines[0].strip():
+            lines = lines[1:]
+        return strip_email_quotes('\n'.join(lines))
+
+    def rerun_pasted(self, name='pasted_block'):
+        """ Rerun a previously pasted command.
+        """
+        b = self.shell.user_ns.get(name)
+
+        # Sanity checks
+        if b is None:
+            raise UsageError('No previous pasted block available')
+        if not isinstance(b, str):
+            raise UsageError(
+                "Variable 'pasted_block' is not a string, can't execute")
+
+        print("Re-executing '%s...' (%d chars)"% (b.split('\n',1)[0], len(b)))
+        self.shell.run_cell(b)
+
+    @line_magic
+    def autoindent(self, parameter_s = ''):
+        """Toggle autoindent on/off (deprecated)"""
+        self.shell.set_autoindent()
+        print("Automatic indentation is:",['OFF','ON'][self.shell.autoindent])
+
+    @skip_doctest
+    @line_magic
+    def cpaste(self, parameter_s=''):
+        """Paste & execute a pre-formatted code block from clipboard.
+
+        You must terminate the block with '--' (two minus-signs) or Ctrl-D
+        alone on the line. You can also provide your own sentinel with '%paste
+        -s %%' ('%%' is the new sentinel for this operation).
+
+        The block is dedented prior to execution to enable execution of method
+        definitions. '>' and '+' characters at the beginning of a line are
+        ignored, to allow pasting directly from e-mails, diff files and
+        doctests (the '...' continuation prompt is also stripped).  The
+        executed block is also assigned to variable named 'pasted_block' for
+        later editing with '%edit pasted_block'.
+
+        You can also pass a variable name as an argument, e.g. '%cpaste foo'.
+        This assigns the pasted block to variable 'foo' as string, without
+        dedenting or executing it (preceding >>> and + is still stripped)
+
+        '%cpaste -r' re-executes the block previously entered by cpaste.
+        '%cpaste -q' suppresses any additional output messages.
+
+        Do not be alarmed by garbled output on Windows (it's a readline bug).
+        Just press enter and type -- (and press enter again) and the block
+        will be what was just pasted.
+
+        Shell escapes are not supported (yet).
+
+        See Also
+        --------
+        paste : automatically pull code from clipboard.
+
+        Examples
+        --------
+        ::
+
+          In [8]: %cpaste
+          Pasting code; enter '--' alone on the line to stop.
+          :>>> a = ["world!", "Hello"]
+          :>>> print(" ".join(sorted(a)))
+          :--
+          Hello world!
+
+        ::
+          In [8]: %cpaste
+          Pasting code; enter '--' alone on the line to stop.
+          :>>> %alias_magic t timeit
+          :>>> %t -n1 pass
+          :--
+          Created `%t` as an alias for `%timeit`.
+          Created `%%t` as an alias for `%%timeit`.
+          354 ns ± 224 ns per loop (mean ± std. dev. of 7 runs, 1 loop each)
+        """
+        opts, name = self.parse_options(parameter_s, 'rqs:', mode='string')
+        if 'r' in opts:
+            self.rerun_pasted()
+            return
+
+        quiet = ('q' in opts)
+
+        sentinel = opts.get('s', u'--')
+        block = '\n'.join(get_pasted_lines(sentinel, quiet=quiet))
+        self.store_or_execute(block, name, store_history=True)
+
+    @line_magic
+    def paste(self, parameter_s=''):
+        """Paste & execute a pre-formatted code block from clipboard.
+
+        The text is pulled directly from the clipboard without user
+        intervention and printed back on the screen before execution (unless
+        the -q flag is given to force quiet mode).
+
+        The block is dedented prior to execution to enable execution of method
+        definitions. '>' and '+' characters at the beginning of a line are
+        ignored, to allow pasting directly from e-mails, diff files and
+        doctests (the '...' continuation prompt is also stripped).  The
+        executed block is also assigned to variable named 'pasted_block' for
+        later editing with '%edit pasted_block'.
+
+        You can also pass a variable name as an argument, e.g. '%paste foo'.
+        This assigns the pasted block to variable 'foo' as string, without
+        executing it (preceding >>> and + is still stripped).
+
+        Options:
+
+          -r: re-executes the block previously entered by cpaste.
+
+          -q: quiet mode: do not echo the pasted text back to the terminal.
+
+        IPython statements (magics, shell escapes) are not supported (yet).
+
+        See Also
+        --------
+        cpaste : manually paste code into terminal until you mark its end.
+        """
+        opts, name = self.parse_options(parameter_s, 'rq', mode='string')
+        if 'r' in opts:
+            self.rerun_pasted()
+            return
+        try:
+            block = self.shell.hooks.clipboard_get()
+        except TryNext as clipboard_exc:
+            message = getattr(clipboard_exc, 'args')
+            if message:
+                error(message[0])
+            else:
+                error('Could not get text from the clipboard.')
+            return
+        except ClipboardEmpty as e:
+            raise UsageError("The clipboard appears to be empty") from e
+
+        # By default, echo back to terminal unless quiet mode is requested
+        if 'q' not in opts:
+            sys.stdout.write(self.shell.pycolorize(block))
+            if not block.endswith("\n"):
+                sys.stdout.write("\n")
+            sys.stdout.write("## -- End pasted text --\n")
+
+        self.store_or_execute(block, name, store_history=True)
+
+    # Class-level: add a '%cls' magic only on Windows
+    if sys.platform == 'win32':
+        @line_magic
+        def cls(self, s):
+            """Clear screen.
+            """
+            os.system("cls")

temp_venv/lib/python3.13/site-packages/IPython/terminal/prompts.py

@@ -0,0 +1,141 @@
+"""Terminal input and output prompts."""
+
+from pygments.token import Token
+import sys
+
+from IPython.core.displayhook import DisplayHook
+
+from prompt_toolkit.formatted_text import fragment_list_width, PygmentsTokens
+from prompt_toolkit.shortcuts import print_formatted_text
+from prompt_toolkit.enums import EditingMode
+
+
+class Prompts:
+    def __init__(self, shell):
+        self.shell = shell
+
+    def vi_mode(self):
+        if (getattr(self.shell.pt_app, 'editing_mode', None) == EditingMode.VI
+                and self.shell.prompt_includes_vi_mode):
+            mode = str(self.shell.pt_app.app.vi_state.input_mode)
+            if mode.startswith('InputMode.'):
+                mode = mode[10:13].lower()
+            elif mode.startswith('vi-'):
+                mode = mode[3:6]
+            return '['+mode+'] '
+        return ''
+
+    def current_line(self) -> int:
+        if self.shell.pt_app is not None:
+            return self.shell.pt_app.default_buffer.document.cursor_position_row or 0
+        return 0
+
+    def in_prompt_tokens(self):
+        return [
+            (Token.Prompt.Mode, self.vi_mode()),
+            (
+                Token.Prompt.LineNumber,
+                self.shell.prompt_line_number_format.format(
+                    line=1, rel_line=-self.current_line()
+                ),
+            ),
+            (Token.Prompt, "In ["),
+            (Token.PromptNum, str(self.shell.execution_count)),
+            (Token.Prompt, ']: '),
+        ]
+
+    def _width(self):
+        return fragment_list_width(self.in_prompt_tokens())
+
+    def continuation_prompt_tokens(
+        self,
+        width: int | None = None,
+        *,
+        lineno: int | None = None,
+        wrap_count: int | None = None,
+    ):
+        if width is None:
+            width = self._width()
+        line = lineno + 1 if lineno is not None else 0
+        if wrap_count:
+            return [
+                (
+                    Token.Prompt.Wrap,
+                    # (" " * (width - 2)) + "\N{HORIZONTAL ELLIPSIS} ",
+                    (" " * (width - 2)) + "\N{VERTICAL ELLIPSIS} ",
+                ),
+            ]
+        prefix = " " * len(
+            self.vi_mode()
+        ) + self.shell.prompt_line_number_format.format(
+            line=line, rel_line=line - self.current_line() - 1
+        )
+        return [
+            (
+                getattr(Token.Prompt.Continuation, f"L{lineno}"),
+                prefix + (" " * (width - len(prefix) - 5)) + "...:",
+            ),
+            (Token.Prompt.Padding, " "),
+        ]
+
+    def rewrite_prompt_tokens(self):
+        width = self._width()
+        return [
+            (Token.Prompt, ('-' * (width - 2)) + '> '),
+        ]
+
+    def out_prompt_tokens(self):
+        return [
+            (Token.OutPrompt, 'Out['),
+            (Token.OutPromptNum, str(self.shell.execution_count)),
+            (Token.OutPrompt, ']: '),
+        ]
+
+class ClassicPrompts(Prompts):
+    def in_prompt_tokens(self):
+        return [
+            (Token.Prompt, '>>> '),
+        ]
+
+    def continuation_prompt_tokens(self, width=None):
+        return [(Token.Prompt.Continuation, "... ")]
+
+    def rewrite_prompt_tokens(self):
+        return []
+
+    def out_prompt_tokens(self):
+        return []
+
+class RichPromptDisplayHook(DisplayHook):
+    """Subclass of base display hook using coloured prompt"""
+    def write_output_prompt(self):
+        sys.stdout.write(self.shell.separate_out)
+        # If we're not displaying a prompt, it effectively ends with a newline,
+        # because the output will be left-aligned.
+        self.prompt_end_newline = True
+
+        if self.do_full_cache:
+            tokens = self.shell.prompts.out_prompt_tokens()
+            prompt_txt = "".join(s for _, s in tokens)
+            if prompt_txt and not prompt_txt.endswith("\n"):
+                # Ask for a newline before multiline output
+                self.prompt_end_newline = False
+
+            if self.shell.pt_app:
+                print_formatted_text(PygmentsTokens(tokens),
+                    style=self.shell.pt_app.app.style, end='',
+                )
+            else:
+                sys.stdout.write(prompt_txt)
+
+    def write_format_data(self, format_dict, md_dict=None) -> None:
+        assert self.shell is not None
+        if self.shell.mime_renderers:
+
+            for mime, handler in self.shell.mime_renderers.items():
+                if mime in format_dict:
+                    handler(format_dict[mime], None)
+                    return
+                
+        super().write_format_data(format_dict, md_dict)
+

temp_venv/lib/python3.13/site-packages/IPython/terminal/ptutils.py

@@ -0,0 +1,230 @@
+"""prompt-toolkit utilities
+
+Everything in this module is a private API,
+not to be used outside IPython.
+"""
+
+# Copyright (c) IPython Development Team.
+# Distributed under the terms of the Modified BSD License.
+
+import unicodedata
+from wcwidth import wcwidth
+
+from IPython.core.completer import (
+    provisionalcompleter, cursor_to_position,
+    _deduplicate_completions)
+from prompt_toolkit.completion import Completer, Completion
+from prompt_toolkit.lexers import Lexer
+from prompt_toolkit.lexers import PygmentsLexer
+from prompt_toolkit.patch_stdout import patch_stdout
+from IPython.core.getipython import get_ipython
+
+
+import pygments.lexers as pygments_lexers
+import os
+import sys
+import traceback
+
+_completion_sentinel = object()
+
+
+def _elide_point(string: str, *, min_elide) -> str:
+    """
+    If a string is long enough, and has at least 3 dots,
+    replace the middle part with ellipses.
+
+    If a string naming a file is long enough, and has at least 3 slashes,
+    replace the middle part with ellipses.
+
+    If three consecutive dots, or two consecutive dots are encountered these are
+    replaced by the equivalents HORIZONTAL ELLIPSIS or TWO DOT LEADER unicode
+    equivalents
+    """
+    string = string.replace('...','\N{HORIZONTAL ELLIPSIS}')
+    string = string.replace('..','\N{TWO DOT LEADER}')
+    if len(string) < min_elide:
+        return string
+
+    object_parts = string.split('.')
+    file_parts = string.split(os.sep)
+    if file_parts[-1] == '':
+        file_parts.pop()
+
+    if len(object_parts) > 3:
+        return "{}.{}\N{HORIZONTAL ELLIPSIS}{}.{}".format(
+            object_parts[0],
+            object_parts[1][:1],
+            object_parts[-2][-1:],
+            object_parts[-1],
+        )
+
+    elif len(file_parts) > 3:
+        return ("{}" + os.sep + "{}\N{HORIZONTAL ELLIPSIS}{}" + os.sep + "{}").format(
+            file_parts[0], file_parts[1][:1], file_parts[-2][-1:], file_parts[-1]
+        )
+
+    return string
+
+
+def _elide_typed(string: str, typed: str, *, min_elide: int) -> str:
+    """
+    Elide the middle of a long string if the beginning has already been typed.
+    """
+
+    if len(string) < min_elide:
+        return string
+    cut_how_much = len(typed)-3
+    if cut_how_much < 7:
+        return string
+    if string.startswith(typed) and len(string)> len(typed):
+        return f"{string[:3]}\N{HORIZONTAL ELLIPSIS}{string[cut_how_much:]}"
+    return string
+
+
+def _elide(string: str, typed: str, min_elide) -> str:
+    return _elide_typed(
+        _elide_point(string, min_elide=min_elide),
+        typed, min_elide=min_elide)
+
+
+
+def _adjust_completion_text_based_on_context(text, body, offset):
+    if text.endswith('=') and len(body) > offset and body[offset] == '=':
+        return text[:-1]
+    else:
+        return text
+
+
+class IPythonPTCompleter(Completer):
+    """Adaptor to provide IPython completions to prompt_toolkit"""
+    def __init__(self, ipy_completer=None, shell=None):
+        if shell is None and ipy_completer is None:
+            raise TypeError("Please pass shell=an InteractiveShell instance.")
+        self._ipy_completer = ipy_completer
+        self.shell = shell
+
+    @property
+    def ipy_completer(self):
+        if self._ipy_completer:
+            return self._ipy_completer
+        else:
+            return self.shell.Completer
+
+    def get_completions(self, document, complete_event):
+        if not document.current_line.strip():
+            return
+        # Some bits of our completion system may print stuff (e.g. if a module
+        # is imported). This context manager ensures that doesn't interfere with
+        # the prompt.
+
+        with patch_stdout(), provisionalcompleter():
+            body = document.text
+            cursor_row = document.cursor_position_row
+            cursor_col = document.cursor_position_col
+            cursor_position = document.cursor_position
+            offset = cursor_to_position(body, cursor_row, cursor_col)
+            try:
+                yield from self._get_completions(body, offset, cursor_position, self.ipy_completer)
+            except Exception as e:
+                try:
+                    exc_type, exc_value, exc_tb = sys.exc_info()
+                    traceback.print_exception(exc_type, exc_value, exc_tb)
+                except AttributeError:
+                    print('Unrecoverable Error in completions')
+
+    def _get_completions(self, body, offset, cursor_position, ipyc):
+        """
+        Private equivalent of get_completions() use only for unit_testing.
+        """
+        debug = getattr(ipyc, 'debug', False)
+        completions = _deduplicate_completions(
+            body, ipyc.completions(body, offset))
+        for c in completions:
+            if not c.text:
+                # Guard against completion machinery giving us an empty string.
+                continue
+            text = unicodedata.normalize('NFC', c.text)
+            # When the first character of the completion has a zero length,
+            # then it's probably a decomposed unicode character. E.g. caused by
+            # the "\dot" completion. Try to compose again with the previous
+            # character.
+            if wcwidth(text[0]) == 0:
+                if cursor_position + c.start > 0:
+                    char_before = body[c.start - 1]
+                    fixed_text = unicodedata.normalize(
+                        'NFC', char_before + text)
+
+                    # Yield the modified completion instead, if this worked.
+                    if wcwidth(text[0:1]) == 1:
+                        yield Completion(fixed_text, start_position=c.start - offset - 1)
+                        continue
+
+            # TODO: Use Jedi to determine meta_text
+            # (Jedi currently has a bug that results in incorrect information.)
+            # meta_text = ''
+            # yield Completion(m, start_position=start_pos,
+            #                  display_meta=meta_text)
+            display_text = c.text
+
+            adjusted_text = _adjust_completion_text_based_on_context(
+                c.text, body, offset
+            )
+            min_elide = 30 if self.shell is None else self.shell.min_elide
+            if c.type == "function":
+                yield Completion(
+                    adjusted_text,
+                    start_position=c.start - offset,
+                    display=_elide(
+                        display_text + "()",
+                        body[c.start : c.end],
+                        min_elide=min_elide,
+                    ),
+                    display_meta=c.type + c.signature,
+                )
+            else:
+                yield Completion(
+                    adjusted_text,
+                    start_position=c.start - offset,
+                    display=_elide(
+                        display_text,
+                        body[c.start : c.end],
+                        min_elide=min_elide,
+                    ),
+                    display_meta=c.type,
+                )
+
+
+class IPythonPTLexer(Lexer):
+    """
+    Wrapper around PythonLexer and BashLexer.
+    """
+    def __init__(self):
+        l = pygments_lexers
+        self.python_lexer = PygmentsLexer(l.Python3Lexer)
+        self.shell_lexer = PygmentsLexer(l.BashLexer)
+
+        self.magic_lexers = {
+            'HTML': PygmentsLexer(l.HtmlLexer),
+            'html': PygmentsLexer(l.HtmlLexer),
+            'javascript': PygmentsLexer(l.JavascriptLexer),
+            'js': PygmentsLexer(l.JavascriptLexer),
+            'perl': PygmentsLexer(l.PerlLexer),
+            'ruby': PygmentsLexer(l.RubyLexer),
+            'latex': PygmentsLexer(l.TexLexer),
+        }
+
+    def lex_document(self, document):
+        text = document.text.lstrip()
+
+        lexer = self.python_lexer
+
+        if text.startswith('!') or text.startswith('%%bash'):
+            lexer = self.shell_lexer
+
+        elif text.startswith('%%'):
+            for magic, l in self.magic_lexers.items():
+                if text.startswith('%%' + magic):
+                    lexer = l
+                    break
+
+        return lexer.lex_document(document)